Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2009-07-25 00:04:23 UTC

Update Date

2022-03-07 02:51:27 UTC

HMDB ID

HMDB0012634

Secondary Accession Numbers

HMDB12634

Metabolite Identification

Common Name

20-COOH-leukotriene E4

Description

20-COOH-leukotriene E4 is a metabolite through lipid oxidation of Leukotriene E4 (LTE4).Leukotriene E4 (LTE4) is a cysteinyl leukotriene. Cysteinyl leukotrienes (CysLTs) are a family of potent inflammatory mediators that appear to contribute to the pathophysiologic features of allergic rhinitis. Nasal blockage induced by CysLTs is mainly due to dilatation of nasal blood vessels, which can be induced by the nitric oxide produced through CysLT1 receptor activation. LTE4, activate contractile and inflammatory processes via specific interaction with putative seven transmembrane-spanning receptors that couple to G proteins and subsequent intracellular signaling pathways. LTE4 is metabolized from leukotriene C4 in a reaction catalyzed by gamma-glutamyl transpeptidase and a particulate dipeptidase from kidney. (PMID: 12607939 , 12432945 , 6311078 ). Leukotrienes are eicosanoids. The eicosanoids consist of the prostaglandins (PGs), thromboxanes (TXs), leukotrienes (LTs), and lipoxins (LXs). The PGs and TXs are collectively identified as prostanoids. Prostaglandins were originally shown to be synthesized in the prostate gland, thromboxanes from platelets (thrombocytes), and leukotrienes from leukocytes, hence the derivation of their names. All mammalian cells except erythrocytes synthesize eicosanoids. These molecules are extremely potent, able to cause profound physiological effects at very dilute concentrations. All eicosanoids function locally at the site of synthesis, through receptor-mediated G-protein linked signalling pathways.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02251208092D          

 32 31  0  0  1  0            999 V2000
   11.3958  -12.5639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5708  -12.5639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.1583  -11.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3333  -11.8494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.9208  -11.1349    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    9.3333  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1583  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5708   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3958   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8083   -8.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6333   -8.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0458   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709  -11.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -11.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709  -12.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -13.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709  -13.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0458  -13.9929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -14.7073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0958  -11.1349    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.6833  -11.8494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6833  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0958   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6833   -8.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0958   -8.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9208   -8.2771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6833   -7.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1583  -13.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3333  -13.2784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5708  -13.9929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2 30  1  1  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 22  1  1  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 21  2  0  0  0  0
 22 23  1  1  0  0  0
 22 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 29  2  0  0  0  0
 30 31  1  0  0  0  0
 30 32  2  0  0  0  0
M  END

HMDB0012634
     RDKit          3D
20-COOH-leukotriene E4
 67 66  0  0  0  0  0  0  0  0999 V2000
   -3.9273   -4.4969   -0.1509 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3135   -3.4069   -1.0247 C   0  0  2  0  0  0  0  0  0  0  0  0
   -5.1481   -2.4021   -0.2517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2531   -1.7055    1.1395 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8663   -0.7056    0.5963 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.1155   -0.1223    1.7267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8447    0.1800    1.5671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1231    0.7619    2.7178 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1786    1.0812    2.5830 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9218    1.6469    3.6663 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1546    1.9884    3.6184 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0680    1.9051    2.5219 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7600    1.4748    1.2043 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2525    0.4285    0.6040 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2109   -0.4751    1.2086 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5284   -0.5516    0.4582 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3562   -1.0274   -0.9607 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7476   -1.0518   -1.5806 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6938   -1.5101   -2.9926 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5715   -1.8126   -3.4943 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8543   -1.5958   -3.7206 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2521    0.3877   -0.3596 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.8254   -0.1765   -1.4833 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1536    1.4126    0.2624 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4669    2.4486   -0.7937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3796    3.5321   -0.2488 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6708    4.5330   -1.3048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4126    5.5224   -1.0693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1113    4.3625   -2.5616 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1331   -3.9758   -2.1244 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6094   -3.2428   -3.0461 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4289   -5.3302   -2.2160 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7995   -4.9657    0.1750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2810   -4.2178    0.5958 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4248   -2.9141   -1.4792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0372   -2.9680    0.1292 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5650   -1.6186   -0.9126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1610   -1.3902    0.0556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5908    0.0658    2.6974 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3644    0.0075    0.6395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5691    0.9525    3.6713 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6023    0.8624    1.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3498    1.7948    4.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5754    2.4193    4.5932 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0172    1.3855    2.9259 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5342    2.9972    2.4716 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0671    2.1001    0.5880 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9334    0.1970   -0.4300 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7670   -1.5249    1.0876 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4481   -0.3369    2.2617 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0389    0.4100    0.4730 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1478   -1.3046    0.9883 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8846   -2.0058   -1.0413 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7909   -0.2368   -1.5227 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1819   -0.0283   -1.5959 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4479   -1.6705   -0.9830 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6907   -1.1568   -3.4032 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2995    0.9181   -0.6270 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4077    0.2193   -2.2846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6029    1.9313    1.0722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0766    0.9680    0.6680 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9538    2.0053   -1.6861 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5442    2.9493   -1.1484 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2966    3.1198    0.2035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572    4.1028    0.5707 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6482    4.5930   -3.3910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2606   -5.7370   -1.7973 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
  5 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
  2 30  1  0
 30 31  2  0
 30 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  6
  3 36  1  0
  3 37  1  0
  5 38  1  6
  6 39  1  0
  7 40  1  0
  8 41  1  0
  9 42  1  0
 10 43  1  0
 11 44  1  0
 12 45  1  0
 12 46  1  0
 13 47  1  0
 14 48  1  0
 15 49  1  0
 15 50  1  0
 16 51  1  0
 16 52  1  0
 17 53  1  0
 17 54  1  0
 18 55  1  0
 18 56  1  0
 21 57  1  0
 22 58  1  6
 23 59  1  0
 24 60  1  0
 24 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 26 65  1  0
 29 66  1  0
 32 67  1  0
M  END


  Mrv0541 02251208092D          

 32 31  0  0  1  0            999 V2000
   11.3958  -12.5639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5708  -12.5639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.1583  -11.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3333  -11.8494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.9208  -11.1349    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    9.3333  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1583  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5708   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3958   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8083   -8.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6333   -8.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0458   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709  -11.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -11.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709  -12.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -13.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8709  -13.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0458  -13.9929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2834  -14.7073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0958  -11.1349    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.6833  -11.8494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6833  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0958   -9.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6833   -8.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0958   -8.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9208   -8.2771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6833   -7.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1583  -13.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3333  -13.2784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5708  -13.9929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2 30  1  1  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 22  1  1  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 21  2  0  0  0  0
 22 23  1  1  0  0  0
 22 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 29  2  0  0  0  0
 30 31  1  0  0  0  0
 30 32  2  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0012634

> <DATABASE_NAME>
hmdb

> <SMILES>
N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C23H35NO7S/c24-18(23(30)31)17-32-20(19(25)13-12-16-22(28)29)14-10-8-6-4-2-1-3-5-7-9-11-15-21(26)27/h2-6,8,10,14,18-20,25H,1,7,9,11-13,15-17,24H2,(H,26,27)(H,28,29)(H,30,31)/b4-2-,5-3-,8-6+,14-10+/t18-,19+,20-/m1/s1

> <INCHI_KEY>
HVLRBLGTGJGVCX-RHSCJZQUSA-N

> <FORMULA>
C23H35NO7S

> <MOLECULAR_WEIGHT>
469.592

> <EXACT_MASS>
469.213423169

> <JCHEM_ACCEPTOR_COUNT>
8

> <JCHEM_AVERAGE_POLARIZABILITY>
51.753598294928054

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
5

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
1

> <JCHEM_IUPAC>
(6Z,9Z,11E,13E,15R,16S)-15-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid

> <ALOGPS_LOGP>
0.18

> <JCHEM_LOGP>
0.6968836436525127

> <ALOGPS_LOGS>
-4.84

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-2

> <JCHEM_PKA>
4.32966346245196

> <JCHEM_PKA_STRONGEST_ACIDIC>
2.383871530699766

> <JCHEM_PKA_STRONGEST_BASIC>
9.13006986317043

> <JCHEM_POLAR_SURFACE_AREA>
158.14999999999998

> <JCHEM_REFRACTIVITY>
129.28509999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
19

> <JCHEM_RULE_OF_FIVE>
1

> <ALOGPS_SOLUBILITY>
6.75e-03 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(6Z,9Z,11E,13E,15R,16S)-15-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0012634
     RDKit          3D
20-COOH-leukotriene E4
 67 66  0  0  0  0  0  0  0  0999 V2000
   -3.9273   -4.4969   -0.1509 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3135   -3.4069   -1.0247 C   0  0  2  0  0  0  0  0  0  0  0  0
   -5.1481   -2.4021   -0.2517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2531   -1.7055    1.1395 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8663   -0.7056    0.5963 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.1155   -0.1223    1.7267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8447    0.1800    1.5671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1231    0.7619    2.7178 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1786    1.0812    2.5830 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9218    1.6469    3.6663 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1546    1.9884    3.6184 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0680    1.9051    2.5219 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7600    1.4748    1.2043 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2525    0.4285    0.6040 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2109   -0.4751    1.2086 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5284   -0.5516    0.4582 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3562   -1.0274   -0.9607 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7476   -1.0518   -1.5806 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6938   -1.5101   -2.9926 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5715   -1.8126   -3.4943 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8543   -1.5958   -3.7206 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2521    0.3877   -0.3596 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.8254   -0.1765   -1.4833 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1536    1.4126    0.2624 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4669    2.4486   -0.7937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3796    3.5321   -0.2488 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6708    4.5330   -1.3048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4126    5.5224   -1.0693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1113    4.3625   -2.5616 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1331   -3.9758   -2.1244 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6094   -3.2428   -3.0461 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4289   -5.3302   -2.2160 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7995   -4.9657    0.1750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2810   -4.2178    0.5958 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4248   -2.9141   -1.4792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0372   -2.9680    0.1292 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5650   -1.6186   -0.9126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1610   -1.3902    0.0556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5908    0.0658    2.6974 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3644    0.0075    0.6395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5691    0.9525    3.6713 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6023    0.8624    1.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3498    1.7948    4.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5754    2.4193    4.5932 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0172    1.3855    2.9259 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5342    2.9972    2.4716 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0671    2.1001    0.5880 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9334    0.1970   -0.4300 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7670   -1.5249    1.0876 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4481   -0.3369    2.2617 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0389    0.4100    0.4730 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1478   -1.3046    0.9883 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8846   -2.0058   -1.0413 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7909   -0.2368   -1.5227 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1819   -0.0283   -1.5959 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4479   -1.6705   -0.9830 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6907   -1.1568   -3.4032 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2995    0.9181   -0.6270 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4077    0.2193   -2.2846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6029    1.9313    1.0722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0766    0.9680    0.6680 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9538    2.0053   -1.6861 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5442    2.9493   -1.1484 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2966    3.1198    0.2035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572    4.1028    0.5707 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6482    4.5930   -3.3910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2606   -5.7370   -1.7973 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
  5 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
  2 30  1  0
 30 31  2  0
 30 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  6
  3 36  1  0
  3 37  1  0
  5 38  1  6
  6 39  1  0
  7 40  1  0
  8 41  1  0
  9 42  1  0
 10 43  1  0
 11 44  1  0
 12 45  1  0
 12 46  1  0
 13 47  1  0
 14 48  1  0
 15 49  1  0
 15 50  1  0
 16 51  1  0
 16 52  1  0
 17 53  1  0
 17 54  1  0
 18 55  1  0
 18 56  1  0
 21 57  1  0
 22 58  1  6
 23 59  1  0
 24 60  1  0
 24 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 26 65  1  0
 29 66  1  0
 32 67  1  0
M  END

HEADER    PROTEIN                                 25-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   25-FEB-12         0                                  
HETATM    1  N   UNK     0      21.272 -23.453   0.000  0.00  0.00           N+0
HETATM    2  C   UNK     0      19.732 -23.453   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      18.962 -22.119   0.000  0.00  0.00           C+0
HETATM    4  S   UNK     0      17.422 -22.119   0.000  0.00  0.00           S+0
HETATM    5  C   UNK     0      16.652 -20.785   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      17.422 -19.452   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      18.962 -19.452   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      19.732 -18.118   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      21.272 -18.118   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      22.042 -16.784   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      23.582 -16.784   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      24.352 -18.118   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      25.892 -18.118   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      26.662 -19.452   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      25.892 -20.785   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      26.662 -22.119   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      25.892 -23.453   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      26.662 -24.786   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      25.892 -26.120   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0      24.352 -26.120   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0      26.662 -27.454   0.000  0.00  0.00           O+0
HETATM   22  C   UNK     0      15.112 -20.785   0.000  0.00  0.00           C+0
HETATM   23  O   UNK     0      14.342 -22.119   0.000  0.00  0.00           O+0
HETATM   24  C   UNK     0      14.342 -19.452   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      15.112 -18.118   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      14.342 -16.784   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      15.112 -15.451   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      16.652 -15.451   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      14.342 -14.117   0.000  0.00  0.00           O+0
HETATM   30  C   UNK     0      18.962 -24.786   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0      17.422 -24.786   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      19.732 -26.120   0.000  0.00  0.00           O+0
CONECT    1    2                                                            
CONECT    2    1    3   30                                                  
CONECT    3    2    4                                                       
CONECT    4    3    5                                                       
CONECT    5    4    6   22                                                  
CONECT    6    5    7                                                       
CONECT    7    6    8                                                       
CONECT    8    7    9                                                       
CONECT    9    8   10                                                       
CONECT   10    9   11                                                       
CONECT   11   10   12                                                       
CONECT   12   11   13                                                       
CONECT   13   12   14                                                       
CONECT   14   13   15                                                       
CONECT   15   14   16                                                       
CONECT   16   15   17                                                       
CONECT   17   16   18                                                       
CONECT   18   17   19                                                       
CONECT   19   18   20   21                                                  
CONECT   20   19                                                            
CONECT   21   19                                                            
CONECT   22    5   23   24                                                  
CONECT   23   22                                                            
CONECT   24   22   25                                                       
CONECT   25   24   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   28   29                                                  
CONECT   28   27                                                            
CONECT   29   27                                                            
CONECT   30    2   31   32                                                  
CONECT   31   30                                                            
CONECT   32   30                                                            
MASTER        0    0    0    0    0    0    0    0   32    0   62    0
END

COMPND    HMDB0012634
HETATM    1  N1  UNL     1      -3.927  -4.497  -0.151  1.00  0.00           N  
HETATM    2  C1  UNL     1      -4.314  -3.407  -1.025  1.00  0.00           C  
HETATM    3  C2  UNL     1      -5.148  -2.402  -0.252  1.00  0.00           C  
HETATM    4  S1  UNL     1      -4.253  -1.706   1.139  1.00  0.00           S  
HETATM    5  C3  UNL     1      -2.866  -0.706   0.596  1.00  0.00           C  
HETATM    6  C4  UNL     1      -2.115  -0.122   1.727  1.00  0.00           C  
HETATM    7  C5  UNL     1      -0.845   0.180   1.567  1.00  0.00           C  
HETATM    8  C6  UNL     1      -0.123   0.762   2.718  1.00  0.00           C  
HETATM    9  C7  UNL     1       1.179   1.081   2.583  1.00  0.00           C  
HETATM   10  C8  UNL     1       1.922   1.647   3.666  1.00  0.00           C  
HETATM   11  C9  UNL     1       3.155   1.988   3.618  1.00  0.00           C  
HETATM   12  C10 UNL     1       4.068   1.905   2.522  1.00  0.00           C  
HETATM   13  C11 UNL     1       3.760   1.475   1.204  1.00  0.00           C  
HETATM   14  C12 UNL     1       4.252   0.429   0.604  1.00  0.00           C  
HETATM   15  C13 UNL     1       5.211  -0.475   1.209  1.00  0.00           C  
HETATM   16  C14 UNL     1       6.528  -0.552   0.458  1.00  0.00           C  
HETATM   17  C15 UNL     1       6.356  -1.027  -0.961  1.00  0.00           C  
HETATM   18  C16 UNL     1       7.748  -1.052  -1.581  1.00  0.00           C  
HETATM   19  C17 UNL     1       7.694  -1.510  -2.993  1.00  0.00           C  
HETATM   20  O1  UNL     1       6.572  -1.813  -3.494  1.00  0.00           O  
HETATM   21  O2  UNL     1       8.854  -1.596  -3.721  1.00  0.00           O  
HETATM   22  C18 UNL     1      -3.252   0.388  -0.360  1.00  0.00           C  
HETATM   23  O3  UNL     1      -3.825  -0.177  -1.483  1.00  0.00           O  
HETATM   24  C19 UNL     1      -4.154   1.413   0.262  1.00  0.00           C  
HETATM   25  C20 UNL     1      -4.467   2.449  -0.794  1.00  0.00           C  
HETATM   26  C21 UNL     1      -5.380   3.532  -0.249  1.00  0.00           C  
HETATM   27  C22 UNL     1      -5.671   4.533  -1.305  1.00  0.00           C  
HETATM   28  O4  UNL     1      -6.413   5.522  -1.069  1.00  0.00           O  
HETATM   29  O5  UNL     1      -5.111   4.363  -2.562  1.00  0.00           O  
HETATM   30  C23 UNL     1      -5.133  -3.976  -2.124  1.00  0.00           C  
HETATM   31  O6  UNL     1      -5.609  -3.243  -3.046  1.00  0.00           O  
HETATM   32  O7  UNL     1      -5.429  -5.330  -2.216  1.00  0.00           O  
HETATM   33  H1  UNL     1      -4.799  -4.966   0.175  1.00  0.00           H  
HETATM   34  H2  UNL     1      -3.281  -4.218   0.596  1.00  0.00           H  
HETATM   35  H3  UNL     1      -3.425  -2.914  -1.479  1.00  0.00           H  
HETATM   36  H4  UNL     1      -6.037  -2.968   0.129  1.00  0.00           H  
HETATM   37  H5  UNL     1      -5.565  -1.619  -0.913  1.00  0.00           H  
HETATM   38  H6  UNL     1      -2.161  -1.390   0.056  1.00  0.00           H  
HETATM   39  H7  UNL     1      -2.591   0.066   2.697  1.00  0.00           H  
HETATM   40  H8  UNL     1      -0.364   0.008   0.639  1.00  0.00           H  
HETATM   41  H9  UNL     1      -0.569   0.953   3.671  1.00  0.00           H  
HETATM   42  H10 UNL     1       1.602   0.862   1.636  1.00  0.00           H  
HETATM   43  H11 UNL     1       1.350   1.795   4.636  1.00  0.00           H  
HETATM   44  H12 UNL     1       3.575   2.419   4.593  1.00  0.00           H  
HETATM   45  H13 UNL     1       5.017   1.386   2.926  1.00  0.00           H  
HETATM   46  H14 UNL     1       4.534   2.997   2.472  1.00  0.00           H  
HETATM   47  H15 UNL     1       3.067   2.100   0.588  1.00  0.00           H  
HETATM   48  H16 UNL     1       3.933   0.197  -0.430  1.00  0.00           H  
HETATM   49  H17 UNL     1       4.767  -1.525   1.088  1.00  0.00           H  
HETATM   50  H18 UNL     1       5.448  -0.337   2.262  1.00  0.00           H  
HETATM   51  H19 UNL     1       7.039   0.410   0.473  1.00  0.00           H  
HETATM   52  H20 UNL     1       7.148  -1.305   0.988  1.00  0.00           H  
HETATM   53  H21 UNL     1       5.885  -2.006  -1.041  1.00  0.00           H  
HETATM   54  H22 UNL     1       5.791  -0.237  -1.523  1.00  0.00           H  
HETATM   55  H23 UNL     1       8.182  -0.028  -1.596  1.00  0.00           H  
HETATM   56  H24 UNL     1       8.448  -1.670  -0.983  1.00  0.00           H  
HETATM   57  H25 UNL     1       9.691  -1.157  -3.403  1.00  0.00           H  
HETATM   58  H26 UNL     1      -2.300   0.918  -0.627  1.00  0.00           H  
HETATM   59  H27 UNL     1      -3.408   0.219  -2.285  1.00  0.00           H  
HETATM   60  H28 UNL     1      -3.603   1.931   1.072  1.00  0.00           H  
HETATM   61  H29 UNL     1      -5.077   0.968   0.668  1.00  0.00           H  
HETATM   62  H30 UNL     1      -4.954   2.005  -1.686  1.00  0.00           H  
HETATM   63  H31 UNL     1      -3.544   2.949  -1.148  1.00  0.00           H  
HETATM   64  H32 UNL     1      -6.297   3.120   0.204  1.00  0.00           H  
HETATM   65  H33 UNL     1      -4.857   4.103   0.571  1.00  0.00           H  
HETATM   66  H34 UNL     1      -5.648   4.593  -3.391  1.00  0.00           H  
HETATM   67  H35 UNL     1      -6.261  -5.737  -1.797  1.00  0.00           H  
CONECT    1    2   33   34
CONECT    2    3   30   35
CONECT    3    4   36   37
CONECT    4    5
CONECT    5    6   22   38
CONECT    6    7    7   39
CONECT    7    8   40
CONECT    8    9    9   41
CONECT    9   10   42
CONECT   10   11   11   43
CONECT   11   12   44
CONECT   12   13   45   46
CONECT   13   14   14   47
CONECT   14   15   48
CONECT   15   16   49   50
CONECT   16   17   51   52
CONECT   17   18   53   54
CONECT   18   19   55   56
CONECT   19   20   20   21
CONECT   21   57
CONECT   22   23   24   58
CONECT   23   59
CONECT   24   25   60   61
CONECT   25   26   62   63
CONECT   26   27   64   65
CONECT   27   28   28   29
CONECT   29   66
CONECT   30   31   31   32
CONECT   32   67
END

HMDB0012634
     RDKit          3D
20-COOH-leukotriene E4
 67 66  0  0  0  0  0  0  0  0999 V2000
   -3.9273   -4.4969   -0.1509 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3135   -3.4069   -1.0247 C   0  0  2  0  0  0  0  0  0  0  0  0
   -5.1481   -2.4021   -0.2517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2531   -1.7055    1.1395 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8663   -0.7056    0.5963 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.1155   -0.1223    1.7267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8447    0.1800    1.5671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1231    0.7619    2.7178 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1786    1.0812    2.5830 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9218    1.6469    3.6663 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1546    1.9884    3.6184 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0680    1.9051    2.5219 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7600    1.4748    1.2043 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2525    0.4285    0.6040 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2109   -0.4751    1.2086 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5284   -0.5516    0.4582 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3562   -1.0274   -0.9607 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7476   -1.0518   -1.5806 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6938   -1.5101   -2.9926 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5715   -1.8126   -3.4943 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8543   -1.5958   -3.7206 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2521    0.3877   -0.3596 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.8254   -0.1765   -1.4833 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1536    1.4126    0.2624 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4669    2.4486   -0.7937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3796    3.5321   -0.2488 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6708    4.5330   -1.3048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4126    5.5224   -1.0693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1113    4.3625   -2.5616 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1331   -3.9758   -2.1244 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6094   -3.2428   -3.0461 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4289   -5.3302   -2.2160 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7995   -4.9657    0.1750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2810   -4.2178    0.5958 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4248   -2.9141   -1.4792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0372   -2.9680    0.1292 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5650   -1.6186   -0.9126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1610   -1.3902    0.0556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5908    0.0658    2.6974 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3644    0.0075    0.6395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5691    0.9525    3.6713 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6023    0.8624    1.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3498    1.7948    4.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5754    2.4193    4.5932 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0172    1.3855    2.9259 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5342    2.9972    2.4716 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0671    2.1001    0.5880 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9334    0.1970   -0.4300 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7670   -1.5249    1.0876 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4481   -0.3369    2.2617 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0389    0.4100    0.4730 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1478   -1.3046    0.9883 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8846   -2.0058   -1.0413 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7909   -0.2368   -1.5227 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1819   -0.0283   -1.5959 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4479   -1.6705   -0.9830 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6907   -1.1568   -3.4032 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2995    0.9181   -0.6270 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4077    0.2193   -2.2846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6029    1.9313    1.0722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0766    0.9680    0.6680 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9538    2.0053   -1.6861 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5442    2.9493   -1.1484 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2966    3.1198    0.2035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8572    4.1028    0.5707 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6482    4.5930   -3.3910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2606   -5.7370   -1.7973 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
  5 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
  2 30  1  0
 30 31  2  0
 30 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  6
  3 36  1  0
  3 37  1  0
  5 38  1  6
  6 39  1  0
  7 40  1  0
  8 41  1  0
  9 42  1  0
 10 43  1  0
 11 44  1  0
 12 45  1  0
 12 46  1  0
 13 47  1  0
 14 48  1  0
 15 49  1  0
 15 50  1  0
 16 51  1  0
 16 52  1  0
 17 53  1  0
 17 54  1  0
 18 55  1  0
 18 56  1  0
 21 57  1  0
 22 58  1  6
 23 59  1  0
 24 60  1  0
 24 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 26 65  1  0
 29 66  1  0
 32 67  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
20-COOH-LTE4	HMDB
6-(S-Cysteinyl)-(5S)-hydroxy-(7E,9E,11Z,14Z)-eicosatetraenedioate	HMDB
6-(S-Cysteinyl)-(5S)-hydroxy-(7E,9E,11Z,14Z)-eicosatetraenedioic acid	HMDB

Chemical Formula

C₂₃H₃₅NO₇S

Average Molecular Weight

469.592

Monoisotopic Molecular Weight

469.213423169

IUPAC Name

(6Z,9Z,11E,13E,15R,16S)-15-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid

Traditional Name

(6Z,9Z,11E,13E,15R,16S)-15-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid

CAS Registry Number

Not Available

SMILES

N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O

InChI Identifier

InChI=1S/C23H35NO7S/c24-18(23(30)31)17-32-20(19(25)13-12-16-22(28)29)14-10-8-6-4-2-1-3-5-7-9-11-15-21(26)27/h2-6,8,10,14,18-20,25H,1,7,9,11-13,15-17,24H2,(H,26,27)(H,28,29)(H,30,31)/b4-2-,5-3-,8-6+,14-10+/t18-,19+,20-/m1/s1

InChI Key

HVLRBLGTGJGVCX-RHSCJZQUSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as cysteine and derivatives. Cysteine and derivatives are compounds containing cysteine or a derivative thereof resulting from reaction of cysteine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom.

Kingdom

Organic compounds

Super Class

Organic acids and derivatives

Class

Carboxylic acids and derivatives

Sub Class

Amino acids, peptides, and analogues

Direct Parent

Cysteine and derivatives

Alternative Parents

Substituents

Cysteine or derivatives
S-alkyl-l-cysteine
Alpha-amino acid
D-alpha-amino acid
Tricarboxylic acid or derivatives
Hydroxy fatty acid
Thia fatty acid
Fatty acyl
Secondary alcohol
Amino acid
Carboxylic acid
Dialkylthioether
Sulfenyl compound
Thioether
Alcohol
Hydrocarbon derivative
Organic oxide
Primary amine
Organosulfur compound
Organooxygen compound
Organonitrogen compound
Primary aliphatic amine
Organopnictogen compound
Organic oxygen compound
Carbonyl group
Amine
Organic nitrogen compound
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cell membrane (HMDB: HMDB0012634)

Cellular substructure

Extracellular (HMDB: HMDB0012634)
Membrane (HMDB: HMDB0012634)

Source

Endogenous

Endogenous (HMDB: HMDB0012634)

Exogenous

Food

Food (HMDB: HMDB0012634)

Process

Naturally occurring process

Biological process

Cellular process

Cell signaling (HMDB: HMDB0012634)

Role

Biological role

Energy source (HMDB: HMDB0012634)

Industrial application

Manufacturing industry

Material processing agent

Fluid processing agent

Surfactant

Surfactant (HMDB: HMDB0012634)

Emulsifier (HMDB: HMDB0012634)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.0068 g/L	ALOGPS
logP	0.18	ALOGPS
logP	0.7	ChemAxon
logS	-4.8	ALOGPS
pKa (Strongest Acidic)	2.38	ChemAxon
pKa (Strongest Basic)	9.13	ChemAxon
Physiological Charge	-2	ChemAxon
Hydrogen Acceptor Count	8	ChemAxon
Hydrogen Donor Count	5	ChemAxon
Polar Surface Area	158.15 Å²	ChemAxon
Rotatable Bond Count	19	ChemAxon
Refractivity	129.29 m³·mol⁻¹	ChemAxon
Polarizability	51.75 Å³	ChemAxon
Number of Rings	0	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	Yes	ChemAxon
Ghose Filter	Yes	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	214.838	31661259
DarkChem	[M-H]-	212.58	31661259
DeepCCS	[M+H]+	209.196	30932474
DeepCCS	[M-H]-	206.838	30932474
DeepCCS	[M-2H]-	239.723	30932474
DeepCCS	[M+Na]+	215.435	30932474
AllCCS	[M+H]+	218.4	32859911
AllCCS	[M+H-H2O]+	216.5	32859911
AllCCS	[M+NH4]+	220.1	32859911
AllCCS	[M+Na]+	220.6	32859911
AllCCS	[M-H]-	215.0	32859911
AllCCS	[M+Na-2H]-	217.8	32859911
AllCCS	[M+HCOO]-	221.0	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
20-COOH-leukotriene E4	N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O	6493.9	Standard polar	33892256
20-COOH-leukotriene E4	N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O	3389.8	Standard non polar	33892256
20-COOH-leukotriene E4	N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O	4093.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
20-COOH-leukotriene E4,1TMS,isomer #1	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O	4133.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TMS,isomer #2	C[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O	4158.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TMS,isomer #3	C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O	4131.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TMS,isomer #4	C[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O	4070.1	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TMS,isomer #5	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O	4213.7	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #1	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O	4048.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #10	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C	4150.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #11	C[Si](C)(C)N([C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O)[Si](C)(C)C	4334.7	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #2	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C	4121.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #3	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C	4092.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #4	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O	4190.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #5	C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O	4121.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #6	C[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C	4077.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #7	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O	4215.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #8	C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C	4049.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TMS,isomer #9	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O	4191.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #1	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C	4048.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #10	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4147.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #11	C[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	4329.7	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #12	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4101.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #13	C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	4287.6	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #14	C[Si](C)(C)OC(=O)[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C	4275.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #2	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C	4020.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #3	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C	4099.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #4	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4093.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #5	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O	4189.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #6	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O	4141.7	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #7	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O	4286.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #8	C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C	4046.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TMS,isomer #9	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	4189.6	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #1	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	3997.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #10	C[Si](C)(C)OC(=O)[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C	4255.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #11	C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C	4201.1	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #2	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4083.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #3	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4031.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #4	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O	4199.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #5	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O	4124.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #6	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C	4262.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #7	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C	4202.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #8	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4085.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,4TMS,isomer #9	C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C	4264.6	Semi standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #1	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4005.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #1	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	3672.2	Standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #1	C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C	4381.1	Standard polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #2	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C	4163.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #2	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C	3769.0	Standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #2	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C	4519.5	Standard polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #3	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C	4107.6	Semi standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #3	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C	3807.2	Standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #3	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C	4575.8	Standard polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #4	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4164.1	Semi standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #4	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	3786.3	Standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #4	C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C	4534.7	Standard polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #5	C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C	4165.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #5	C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C	3771.0	Standard non polar	33892256
20-COOH-leukotriene E4,5TMS,isomer #5	C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C	4512.6	Standard polar	33892256
20-COOH-leukotriene E4,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O	4395.6	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O	4410.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O	4392.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O	4333.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O	4434.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O	4566.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C	4614.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)N([C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C	4769.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C	4644.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C	4612.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O	4651.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O	4645.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C	4598.8	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O	4673.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C	4566.9	Semi standard non polar	33892256
20-COOH-leukotriene E4,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O	4651.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C	4831.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C	4858.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4996.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C	4810.1	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4963.4	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4946.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C	4786.2	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C	4808.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4860.3	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O	4884.6	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O	4837.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O	4967.5	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C	4830.0	Semi standard non polar	33892256
20-COOH-leukotriene E4,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(=O)O	4884.1	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - 20-COOH-leukotriene E4 GC-MS (Non-derivatized) - 70eV, Positive	splash10-0ukc-3219600000-afc81424c577c7c73830	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 20-COOH-leukotriene E4 GC-MS (3 TMS) - 70eV, Positive	splash10-00dl-8400918000-987eca40d2a4c9ab31e8	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 20-COOH-leukotriene E4 GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 10V, Positive-QTOF	splash10-0ue9-0001900000-a9aa6251a352d0e8e2a6	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 20V, Positive-QTOF	splash10-0lk9-1249700000-127f1da4ed2b24fdf00f	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 40V, Positive-QTOF	splash10-0cmv-4019200000-c4f5f9fd8da1131bd7f4	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 10V, Negative-QTOF	splash10-0gir-0103900000-46c830f394a499c0440d	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 20V, Negative-QTOF	splash10-03l9-1219200000-0336064a6d9bcaf9f0c9	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 40V, Negative-QTOF	splash10-000i-9302000000-10f31ff39e1d782b7a27	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 10V, Positive-QTOF	splash10-0ul0-0029500000-a97dae5c18a6435b7889	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 20V, Positive-QTOF	splash10-0kur-0039500000-4b7053be1be20c285946	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 40V, Positive-QTOF	splash10-01e9-4910000000-2ad4c146132a94fd0587	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 10V, Negative-QTOF	splash10-01x0-2309400000-bcb027d5a55752e9a430	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 20V, Negative-QTOF	splash10-03di-1219000000-43c90b9b27b55393b866	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 20-COOH-leukotriene E4 40V, Negative-QTOF	splash10-03xr-5559000000-5e7c46a6b1b8554d75a6	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular
Membrane

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB029159

KNApSAcK ID

Not Available

Chemspider ID

30776643

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

53481508

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Mizutani N: [Studies on the experimental allergic rhinitis induced by Japanese cedar pollen--role of cysteinyl leukotrienes in nasal allergic symptoms]. Yakugaku Zasshi. 2003 Jan;123(1):1-8. [PubMed:12607939 ]
Evans JF: Cysteinyl leukotriene receptors. Prostaglandins Other Lipid Mediat. 2002 Aug;68-69:587-97. [PubMed:12432945 ]
Hammarstrom S: Leukotrienes. Annu Rev Biochem. 1983;52:355-77. [PubMed:6311078 ]
Brunk E, Sahoo S, Zielinski DC, Altunkaya A, Drager A, Mih N, Gatto F, Nilsson A, Preciat Gonzalez GA, Aurich MK, Prlic A, Sastry A, Danielsdottir AD, Heinken A, Noronha A, Rose PW, Burley SK, Fleming RMT, Nielsen J, Thiele I, Palsson BO: Recon3D enables a three-dimensional view of gene variation in human metabolism. Nat Biotechnol. 2018 Mar;36(3):272-281. doi: 10.1038/nbt.4072. Epub 2018 Feb 19. [PubMed:29457794 ]

Showing metabocard for 20-COOH-leukotriene E4 (HMDB0012634)

MOL for HMDB0012634 (20-COOH-leukotriene E4)

3D MOL for HMDB0012634 (20-COOH-leukotriene E4)

3D SDF for HMDB0012634 (20-COOH-leukotriene E4)

3D-SDF for HMDB0012634 (20-COOH-leukotriene E4)

PDB for HMDB0012634 (20-COOH-leukotriene E4)

3D PDB for HMDB0012634 (20-COOH-leukotriene E4)

SMILES for HMDB0012634 (20-COOH-leukotriene E4)

INCHI for HMDB0012634 (20-COOH-leukotriene E4)

Structure for HMDB0012634 (20-COOH-leukotriene E4)

3D Structure for HMDB0012634 (20-COOH-leukotriene E4)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra