Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2009-07-25 00:12:13 UTC |
---|
Update Date | 2022-03-07 02:51:28 UTC |
---|
HMDB ID | HMDB0013045 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Prostaglandin PGE2 glyceryl ester |
---|
Description | GE2 glycerol ester is a COX-2 oxidative metabolite of 2-arachidonoyl glycerol, modulates inhibitory synaptic transmission in mouse hippocampal neurons. 2-Arachidonoyl glycerol (2-AG) has been isolated from porcine brain,1 and has been characterized as the natural endocannabinoid ligand for the CB1 receptor.2 Incubation of 2-AG with COX-2 and specific prostaglandin H2 (PGH2) isomerases in cell cultures and isolated enzyme preparations results in prostaglandin glycerol ester formation.3 The biosynthesis of PGH, PGD, PGE, PGF, and TXA-2-glyceryl ester compounds have all been documented. The 2-glyceryl ester moiety equilibrates rapidly (within minutes) with the more stable 1-glyceryl ester, producing a 10:90 2:1-glyceryl ester mixture in typical aqueous media. While the stability and metabolism of these prostaglandin products has been investigated,4 little is known about their intrinsic biological activity. Prostaglandins are eicosanoids. The eicosanoids consist of the prostaglandins (PGs), thromboxanes (TXs), leukotrienes (LTs), and lipoxins (LXs). The PGs and TXs are collectively identified as prostanoids. Prostaglandins were originally shown to be synthesized in the prostate gland, thromboxanes from platelets (thrombocytes), and leukotrienes from leukocytes, hence the derivation of their names. All mammalian cells except erythrocytes synthesize eicosanoids. These molecules are extremely potent, able to cause profound physiological effects at very dilute concentrations. All eicosanoids function locally at the site of synthesis, through receptor-mediated G-protein linked signalling pathways. |
---|
Structure | CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](O)CC(=O)[C@H]1C\C=C/CCCC(=O)OC(CO)CO InChI=1S/C23H38O7/c1-2-3-6-9-17(26)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-18(15-24)16-25/h4,7,12-13,17-20,22,24-26,28H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,19-,20-,22-/m0/s1 |
---|
Synonyms | Value | Source |
---|
1,3-Dihydroxypropan-2-yl (5Z)-7-[(1S,2S,3S)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]hept-5-enoic acid | Generator |
|
---|
Chemical Formula | C23H38O7 |
---|
Average Molecular Weight | 426.5436 |
---|
Monoisotopic Molecular Weight | 426.26175357 |
---|
IUPAC Name | 1,3-dihydroxypropan-2-yl (5Z)-7-[(1S,2S,3S)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]hept-5-enoate |
---|
Traditional Name | 1,3-dihydroxypropan-2-yl (5Z)-7-[(1S,2S,3S)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]hept-5-enoate |
---|
CAS Registry Number | Not Available |
---|
SMILES | CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](O)CC(=O)[C@H]1C\C=C/CCCC(=O)OC(CO)CO |
---|
InChI Identifier | InChI=1S/C23H38O7/c1-2-3-6-9-17(26)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-18(15-24)16-25/h4,7,12-13,17-20,22,24-26,28H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,19-,20-,22-/m0/s1 |
---|
InChI Key | HJWDPZIOTMUWRW-KSGZNQJUSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as prostaglandins and related compounds. These are unsaturated carboxylic acids consisting of a 20 carbon skeleton that also contains a five member ring, and are based upon the fatty acid arachidonic acid. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Fatty Acyls |
---|
Sub Class | Eicosanoids |
---|
Direct Parent | Prostaglandins and related compounds |
---|
Alternative Parents | |
---|
Substituents | - Prostaglandin skeleton
- Fatty alcohol
- 2-acyl-sn-glycerol
- Monoradylglycerol
- Monoacylglycerol
- Glycerolipid
- Fatty acid ester
- Cyclopentanol
- Cyclic alcohol
- Carboxylic acid ester
- Cyclic ketone
- Secondary alcohol
- Ketone
- Carboxylic acid derivative
- Monocarboxylic acid or derivatives
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Primary alcohol
- Organooxygen compound
- Aliphatic homomonocyclic compound
|
---|
Molecular Framework | Aliphatic homomonocyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Prostaglandin PGE2 glyceryl ester,1TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO)O[Si](C)(C)C | 3249.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TMS,isomer #2 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO | 3206.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TMS,isomer #3 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C | 3265.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TMS,isomer #4 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C)C[C@@H]1O | 3230.6 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C)=C[C@@H]1O | 3163.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO)O[Si](C)(C)C | 3151.0 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #10 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O | 3181.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)O[Si](C)(C)C | 3232.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C)C[C@@H]1O)O[Si](C)(C)C | 3236.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C)=C[C@@H]1O)O[Si](C)(C)C | 3151.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C | 3187.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 3216.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C | 3191.1 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #8 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C | 3253.0 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TMS,isomer #9 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O | 3241.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)O[Si](C)(C)C | 3137.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #10 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O | 3243.6 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #11 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O | 3196.1 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3166.7 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3143.5 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #4 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)O[Si](C)(C)C | 3213.1 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #5 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O)O[Si](C)(C)C | 3227.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #6 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O)O[Si](C)(C)C | 3156.7 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C | 3166.4 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #8 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 3192.1 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TMS,isomer #9 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C | 3169.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)O[Si](C)(C)C | 3145.4 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3184.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3155.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O)O[Si](C)(C)C | 3224.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #5 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O)O[Si](C)(C)C | 3176.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 3193.6 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C | 3177.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,5TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3212.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,5TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3174.5 | Standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,5TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)=C(O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3335.0 | Standard polar | 33892256 | Prostaglandin PGE2 glyceryl ester,5TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3188.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,5TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2957.0 | Standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,5TMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C)C(O[Si](C)(C)C)=C[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3403.2 | Standard polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO)O[Si](C)(C)C(C)(C)C | 3490.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TBDMS,isomer #2 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO | 3413.6 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TBDMS,isomer #3 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C | 3503.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TBDMS,isomer #4 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3485.3 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,1TBDMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O | 3394.4 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO)O[Si](C)(C)C(C)(C)C | 3619.1 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #10 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O | 3624.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3725.0 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3709.6 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3622.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C | 3627.0 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3646.5 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C | 3632.0 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #8 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C | 3728.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,2TBDMS,isomer #9 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3698.4 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3853.0 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #10 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3929.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #11 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O | 3873.7 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3845.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3839.7 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #4 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3960.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #5 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3926.4 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #6 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3863.2 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C | 3859.5 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #8 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3855.5 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,3TBDMS,isomer #9 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C | 3852.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4063.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #2 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4053.9 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4045.8 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #4 | CCCCC[C@@H](/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4129.6 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #5 | CCCCC[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4066.4 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/[C@H]1C(C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 4065.1 | Semi standard non polar | 33892256 | Prostaglandin PGE2 glyceryl ester,4TBDMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)OC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C[C@@H]1O[Si](C)(C)C(C)(C)C | 4065.1 | Semi standard non polar | 33892256 |
|
---|