Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2009-07-25 00:20:02 UTC

Update Date

2021-09-14 15:46:02 UTC

HMDB ID

HMDB0013112

Secondary Accession Numbers

HMDB13112

Metabolite Identification

Common Name

UDP-N-acetyl-D-mannosamine

Description

UDP-N-acetyl-D-mannosamine is involved in teichoic acid (poly-glycerol) biosynthesis pathway and enterobacterial common antigen biosynthesis pathway. It serves as both enzymatic reactants and products in those two pathways. In teichoic acid (poly-glycerol) biosynthesis pathway, UDP-N-acetyl-mannosamine is synthesized from UDP-N-acetyl-glocasamine by UDP-N-acetylglucosamine 2-epimerase, encoded by the mnaA gene.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652303102016492D          

 39 41  0  0  1  0            999 V2000
   13.2353   -8.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208   -9.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8064   -8.6185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208   -9.8560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2353  -10.2685    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   13.9498   -9.8560    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   13.9498   -9.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6642  -10.2685    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   15.3787   -9.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6642  -11.0935    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   15.3787  -11.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3787  -12.3310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9498  -11.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2353  -11.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208  -11.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208  -12.3310    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.6958  -12.3310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3458  -12.3310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208  -13.1560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8064  -13.5685    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.3938  -12.8540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2189  -14.2830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0919  -13.9810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0919  -14.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3774  -15.2185    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.2911  -16.0390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4842  -16.2105    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    9.0717  -15.4961    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    8.2512  -15.4098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6237  -14.8829    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    9.4522  -14.0760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1486  -16.9642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6335  -17.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2980  -18.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4775  -18.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1419  -19.2252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9926  -17.8041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3281  -17.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8432  -16.3830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  2  4  1  0  0  0  0
  5  4  1  6  0  0  0
  5  6  1  0  0  0  0
  5 14  1  0  0  0  0
  6  7  1  6  0  0  0
  6  8  1  0  0  0  0
  8  9  1  1  0  0  0
  8 10  1  0  0  0  0
 10 11  1  6  0  0  0
 10 13  1  0  0  0  0
 11 12  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 16 18  2  0  0  0  0
 16 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 20 22  2  0  0  0  0
 20 23  1  0  0  0  0
 23 24  1  0  0  0  0
 25 24  1  6  0  0  0
 25 26  1  0  0  0  0
 25 30  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 32  1  6  0  0  0
 28 29  1  1  0  0  0
 28 30  1  0  0  0  0
 30 31  1  1  0  0  0
 32 33  1  0  0  0  0
 32 38  1  0  0  0  0
 33 34  2  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 35 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  2  0  0  0  0
M  END

HMDB0013112
     RDKit          3D
UDP-N-acetyl-D-mannosamine
 66 68  0  0  0  0  0  0  0  0999 V2000
    6.8851    3.1584   -1.4123 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3661    1.9109   -0.8061 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0132    0.8328   -0.9519 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1724    1.9026   -0.0900 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5442    0.7760    0.4943 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.8270    0.1302   -0.7337 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2271    1.1903   -1.3518 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5937    1.3505   -0.9426 P   0  0  0  0  0  5  0  0  0  0  0  0
    0.7949    1.6357   -2.1898 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3659    2.5634    0.2089 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0636   -0.1102   -0.2955 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4202    0.0168    0.3492 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.5004    1.2012    1.3105 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8672   -1.4156    1.1933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6064    0.1523   -0.8567 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2173    1.4634   -0.7097 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5384    1.1210   -0.1371 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.3158    0.1698   -0.8081 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2205   -0.0114    0.2813 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.1496   -1.0574    0.1539 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3738   -0.8872   -0.3955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2132   -1.9693   -0.4452 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8227   -3.2129    0.0579 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5931   -4.1969    0.0117 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6122   -3.3518    0.5950 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8129   -2.2631    0.6228 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6560   -2.4304    1.1358 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7854    1.4016    0.2552 C   0  0  1  0  0  0  0  0  0  0  0  0
   -6.5795    1.6637    1.3412 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4528    2.1905    0.3007 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.3102    2.4474    1.6916 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9856   -0.8685   -0.2979 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7278   -1.9785    0.1174 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.6793   -2.9476   -1.0591 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2500   -2.4003   -2.1951 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1568   -1.6619    0.4288 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.6092   -2.6596    1.3086 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2462   -0.3120    1.1691 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.5600   -0.0787    1.5514 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1762    3.4579   -2.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8646    2.9996   -1.8918 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9101    4.0428   -0.7323 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6796    2.8412   -0.0120 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7138    1.1762    1.1674 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6165   -0.2805   -1.4005 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7886    3.4228   -0.0033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1965   -1.2417    2.0887 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3030    1.8361   -1.7453 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6116    2.1151   -0.1147 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3076    0.5312    0.8606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5748   -0.0947    1.1843 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5995    0.0955   -0.7595 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2052   -1.8686   -0.8838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3410   -4.2919    0.9721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2202    1.6379   -0.7354 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8627    2.6086    1.2962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4982    3.0998   -0.2850 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6268    3.1060    1.9010 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2433   -2.4311    0.9754 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0871   -3.9484   -0.7972 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5959   -3.1085   -1.2882 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2252   -2.6076   -2.2449 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8150   -1.6092   -0.4527 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9833   -3.4309    1.3396 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6867   -0.5658    2.1536 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9406   -0.9570    1.8805 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 19 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
  6 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38  5  1  0
 30 17  1  0
 26 20  1  0
  1 40  1  0
  1 41  1  0
  1 42  1  0
  4 43  1  0
  5 44  1  1
  6 45  1  0
 10 46  1  0
 14 47  1  0
 16 48  1  0
 16 49  1  0
 17 50  1  1
 19 51  1  1
 21 52  1  0
 22 53  1  0
 25 54  1  0
 28 55  1  6
 29 56  1  0
 30 57  1  6
 31 58  1  0
 33 59  1  1
 34 60  1  0
 34 61  1  0
 35 62  1  0
 36 63  1  6
 37 64  1  0
 38 65  1  1
 39 66  1  0
M  END


  Mrv1652303102016492D          

 39 41  0  0  1  0            999 V2000
   13.2353   -8.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208   -9.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8064   -8.6185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208   -9.8560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2353  -10.2685    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   13.9498   -9.8560    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   13.9498   -9.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6642  -10.2685    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   15.3787   -9.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6642  -11.0935    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   15.3787  -11.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3787  -12.3310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9498  -11.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2353  -11.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208  -11.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208  -12.3310    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.6958  -12.3310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3458  -12.3310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5208  -13.1560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8064  -13.5685    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.3938  -12.8540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2189  -14.2830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0919  -13.9810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0919  -14.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3774  -15.2185    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.2911  -16.0390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4842  -16.2105    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    9.0717  -15.4961    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    8.2512  -15.4098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6237  -14.8829    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    9.4522  -14.0760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1486  -16.9642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6335  -17.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2980  -18.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4775  -18.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1419  -19.2252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9926  -17.8041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3281  -17.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8432  -16.3830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  2  4  1  0  0  0  0
  5  4  1  6  0  0  0
  5  6  1  0  0  0  0
  5 14  1  0  0  0  0
  6  7  1  6  0  0  0
  6  8  1  0  0  0  0
  8  9  1  1  0  0  0
  8 10  1  0  0  0  0
 10 11  1  6  0  0  0
 10 13  1  0  0  0  0
 11 12  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 16 18  2  0  0  0  0
 16 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 20 22  2  0  0  0  0
 20 23  1  0  0  0  0
 23 24  1  0  0  0  0
 25 24  1  6  0  0  0
 25 26  1  0  0  0  0
 25 30  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 32  1  6  0  0  0
 28 29  1  1  0  0  0
 28 30  1  0  0  0  0
 30 31  1  1  0  0  0
 32 33  1  0  0  0  0
 32 38  1  0  0  0  0
 33 34  2  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 35 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  2  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0013112

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(=O)N[C@@H]1[C@H](O)[C@@H](O)[C@H](CO)OC1OP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O

> <INCHI_IDENTIFIER>
InChI=1S/C17H27N3O17P2/c1-6(22)18-10-13(26)11(24)7(4-21)35-16(10)36-39(31,32)37-38(29,30)33-5-8-12(25)14(27)15(34-8)20-3-2-9(23)19-17(20)28/h2-3,7-8,10-16,21,24-27H,4-5H2,1H3,(H,18,22)(H,29,30)(H,31,32)(H,19,23,28)/t7-,8-,10+,11-,12-,13-,14-,15-,16?/m0/s1

> <INCHI_KEY>
LFTYTUAZOPRMMI-IUPDHGCPSA-N

> <FORMULA>
C17H27N3O17P2

> <MOLECULAR_WEIGHT>
607.3537

> <EXACT_MASS>
607.081569477

> <JCHEM_ACCEPTOR_COUNT>
14

> <JCHEM_ATOM_COUNT>
66

> <JCHEM_AVERAGE_POLARIZABILITY>
51.14680972561175

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
[({[(2S,3R,4S,5S)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid

> <ALOGPS_LOGP>
-1.41

> <JCHEM_LOGP>
-5.284643272333334

> <ALOGPS_LOGS>
-1.72

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-2

> <JCHEM_PKA>
3.1791675779187587

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.737213537795745

> <JCHEM_PKA_STRONGEST_BASIC>
-3.5185279253200745

> <JCHEM_POLAR_SURFACE_AREA>
300.4099999999999

> <JCHEM_REFRACTIVITY>
117.55709999999999

> <JCHEM_ROTATABLE_BOND_COUNT>
10

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.14e+01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
{[(2S,3R,4S,5S)-5-(2,4-dioxo-3H-pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy([(3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy)phosphinic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0013112
     RDKit          3D
UDP-N-acetyl-D-mannosamine
 66 68  0  0  0  0  0  0  0  0999 V2000
    6.8851    3.1584   -1.4123 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3661    1.9109   -0.8061 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0132    0.8328   -0.9519 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1724    1.9026   -0.0900 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5442    0.7760    0.4943 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.8270    0.1302   -0.7337 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2271    1.1903   -1.3518 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5937    1.3505   -0.9426 P   0  0  0  0  0  5  0  0  0  0  0  0
    0.7949    1.6357   -2.1898 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3659    2.5634    0.2089 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0636   -0.1102   -0.2955 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4202    0.0168    0.3492 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.5004    1.2012    1.3105 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8672   -1.4156    1.1933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6064    0.1523   -0.8567 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2173    1.4634   -0.7097 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5384    1.1210   -0.1371 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.3158    0.1698   -0.8081 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2205   -0.0114    0.2813 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.1496   -1.0574    0.1539 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3738   -0.8872   -0.3955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2132   -1.9693   -0.4452 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8227   -3.2129    0.0579 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5931   -4.1969    0.0117 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6122   -3.3518    0.5950 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8129   -2.2631    0.6228 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6560   -2.4304    1.1358 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7854    1.4016    0.2552 C   0  0  1  0  0  0  0  0  0  0  0  0
   -6.5795    1.6637    1.3412 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4528    2.1905    0.3007 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.3102    2.4474    1.6916 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9856   -0.8685   -0.2979 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7278   -1.9785    0.1174 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.6793   -2.9476   -1.0591 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2500   -2.4003   -2.1951 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1568   -1.6619    0.4288 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.6092   -2.6596    1.3086 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2462   -0.3120    1.1691 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.5600   -0.0787    1.5514 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1762    3.4579   -2.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8646    2.9996   -1.8918 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9101    4.0428   -0.7323 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6796    2.8412   -0.0120 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7138    1.1762    1.1674 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6165   -0.2805   -1.4005 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7886    3.4228   -0.0033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1965   -1.2417    2.0887 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3030    1.8361   -1.7453 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6116    2.1151   -0.1147 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3076    0.5312    0.8606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5748   -0.0947    1.1843 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5995    0.0955   -0.7595 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2052   -1.8686   -0.8838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3410   -4.2919    0.9721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2202    1.6379   -0.7354 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8627    2.6086    1.2962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4982    3.0998   -0.2850 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6268    3.1060    1.9010 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2433   -2.4311    0.9754 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0871   -3.9484   -0.7972 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5959   -3.1085   -1.2882 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2252   -2.6076   -2.2449 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8150   -1.6092   -0.4527 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9833   -3.4309    1.3396 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6867   -0.5658    2.1536 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9406   -0.9570    1.8805 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 19 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
  6 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38  5  1  0
 30 17  1  0
 26 20  1  0
  1 40  1  0
  1 41  1  0
  1 42  1  0
  4 43  1  0
  5 44  1  1
  6 45  1  0
 10 46  1  0
 14 47  1  0
 16 48  1  0
 16 49  1  0
 17 50  1  1
 19 51  1  1
 21 52  1  0
 22 53  1  0
 25 54  1  0
 28 55  1  6
 29 56  1  0
 30 57  1  6
 31 58  1  0
 33 59  1  1
 34 60  1  0
 34 61  1  0
 35 62  1  0
 36 63  1  6
 37 64  1  0
 38 65  1  1
 39 66  1  0
M  END

HEADER    PROTEIN                                 10-MAR-20   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   10-MAR-20         0                                  
HETATM    1  C   UNK     0      24.706 -16.088   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      23.372 -16.858   0.000  0.00  0.00           C+0
HETATM    3  O   UNK     0      22.039 -16.088   0.000  0.00  0.00           O+0
HETATM    4  N   UNK     0      23.372 -18.398   0.000  0.00  0.00           N+0
HETATM    5  C   UNK     0      24.706 -19.168   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      26.040 -18.398   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0      26.040 -16.858   0.000  0.00  0.00           O+0
HETATM    8  C   UNK     0      27.373 -19.168   0.000  0.00  0.00           C+0
HETATM    9  O   UNK     0      28.707 -18.398   0.000  0.00  0.00           O+0
HETATM   10  C   UNK     0      27.373 -20.708   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      28.707 -21.478   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0      28.707 -23.018   0.000  0.00  0.00           O+0
HETATM   13  O   UNK     0      26.040 -21.478   0.000  0.00  0.00           O+0
HETATM   14  C   UNK     0      24.706 -20.708   0.000  0.00  0.00           C+0
HETATM   15  O   UNK     0      23.372 -21.478   0.000  0.00  0.00           O+0
HETATM   16  P   UNK     0      23.372 -23.018   0.000  0.00  0.00           P+0
HETATM   17  O   UNK     0      21.832 -23.018   0.000  0.00  0.00           O+0
HETATM   18  O   UNK     0      24.912 -23.018   0.000  0.00  0.00           O+0
HETATM   19  O   UNK     0      23.372 -24.558   0.000  0.00  0.00           O+0
HETATM   20  P   UNK     0      22.039 -25.328   0.000  0.00  0.00           P+0
HETATM   21  O   UNK     0      21.268 -23.994   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0      22.809 -26.662   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      20.705 -26.098   0.000  0.00  0.00           O+0
HETATM   24  C   UNK     0      20.705 -27.638   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      19.371 -28.408   0.000  0.00  0.00           C+0
HETATM   26  O   UNK     0      19.210 -29.939   0.000  0.00  0.00           O+0
HETATM   27  C   UNK     0      17.704 -30.260   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      16.934 -28.926   0.000  0.00  0.00           C+0
HETATM   29  O   UNK     0      15.402 -28.765   0.000  0.00  0.00           O+0
HETATM   30  C   UNK     0      17.964 -27.781   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0      17.644 -26.275   0.000  0.00  0.00           O+0
HETATM   32  N   UNK     0      17.077 -31.667   0.000  0.00  0.00           N+0
HETATM   33  C   UNK     0      17.983 -32.912   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0      17.356 -34.319   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      15.825 -34.480   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0      15.198 -35.887   0.000  0.00  0.00           O+0
HETATM   37  N   UNK     0      14.920 -33.234   0.000  0.00  0.00           N+0
HETATM   38  C   UNK     0      15.546 -31.827   0.000  0.00  0.00           C+0
HETATM   39  O   UNK     0      14.641 -30.582   0.000  0.00  0.00           O+0
CONECT    1    2                                                            
CONECT    2    1    3    4                                                  
CONECT    3    2                                                            
CONECT    4    2    5                                                       
CONECT    5    4    6   14                                                  
CONECT    6    5    7    8                                                  
CONECT    7    6                                                            
CONECT    8    6    9   10                                                  
CONECT    9    8                                                            
CONECT   10    8   11   13                                                  
CONECT   11   10   12                                                       
CONECT   12   11                                                            
CONECT   13   10   14                                                       
CONECT   14    5   13   15                                                  
CONECT   15   14   16                                                       
CONECT   16   15   17   18   19                                             
CONECT   17   16                                                            
CONECT   18   16                                                            
CONECT   19   16   20                                                       
CONECT   20   19   21   22   23                                             
CONECT   21   20                                                            
CONECT   22   20                                                            
CONECT   23   20   24                                                       
CONECT   24   23   25                                                       
CONECT   25   24   26   30                                                  
CONECT   26   25   27                                                       
CONECT   27   26   28   32                                                  
CONECT   28   27   29   30                                                  
CONECT   29   28                                                            
CONECT   30   25   28   31                                                  
CONECT   31   30                                                            
CONECT   32   27   33   38                                                  
CONECT   33   32   34                                                       
CONECT   34   33   35                                                       
CONECT   35   34   36   37                                                  
CONECT   36   35                                                            
CONECT   37   35   38                                                       
CONECT   38   32   37   39                                                  
CONECT   39   38                                                            
MASTER        0    0    0    0    0    0    0    0   39    0   82    0
END

COMPND    HMDB0013112
HETATM    1  C1  UNL     1       6.885   3.158  -1.412  1.00  0.00           C  
HETATM    2  C2  UNL     1       6.366   1.911  -0.806  1.00  0.00           C  
HETATM    3  O1  UNL     1       7.013   0.833  -0.952  1.00  0.00           O  
HETATM    4  N1  UNL     1       5.172   1.903  -0.090  1.00  0.00           N  
HETATM    5  C3  UNL     1       4.544   0.776   0.494  1.00  0.00           C  
HETATM    6  C4  UNL     1       3.827   0.130  -0.734  1.00  0.00           C  
HETATM    7  O2  UNL     1       3.227   1.190  -1.352  1.00  0.00           O  
HETATM    8  P1  UNL     1       1.594   1.350  -0.943  1.00  0.00           P  
HETATM    9  O3  UNL     1       0.795   1.636  -2.190  1.00  0.00           O  
HETATM   10  O4  UNL     1       1.366   2.563   0.209  1.00  0.00           O  
HETATM   11  O5  UNL     1       1.064  -0.110  -0.296  1.00  0.00           O  
HETATM   12  P2  UNL     1      -0.420   0.017   0.349  1.00  0.00           P  
HETATM   13  O6  UNL     1      -0.500   1.201   1.310  1.00  0.00           O  
HETATM   14  O7  UNL     1      -0.867  -1.416   1.193  1.00  0.00           O  
HETATM   15  O8  UNL     1      -1.606   0.152  -0.857  1.00  0.00           O  
HETATM   16  C5  UNL     1      -2.217   1.463  -0.710  1.00  0.00           C  
HETATM   17  C6  UNL     1      -3.538   1.121  -0.137  1.00  0.00           C  
HETATM   18  O9  UNL     1      -4.316   0.170  -0.808  1.00  0.00           O  
HETATM   19  C7  UNL     1      -5.221  -0.011   0.281  1.00  0.00           C  
HETATM   20  N2  UNL     1      -6.150  -1.057   0.154  1.00  0.00           N  
HETATM   21  C8  UNL     1      -7.374  -0.887  -0.396  1.00  0.00           C  
HETATM   22  C9  UNL     1      -8.213  -1.969  -0.445  1.00  0.00           C  
HETATM   23  C10 UNL     1      -7.823  -3.213   0.058  1.00  0.00           C  
HETATM   24  O10 UNL     1      -8.593  -4.197   0.012  1.00  0.00           O  
HETATM   25  N3  UNL     1      -6.612  -3.352   0.595  1.00  0.00           N  
HETATM   26  C11 UNL     1      -5.813  -2.263   0.623  1.00  0.00           C  
HETATM   27  O11 UNL     1      -4.656  -2.430   1.136  1.00  0.00           O  
HETATM   28  C12 UNL     1      -5.785   1.402   0.255  1.00  0.00           C  
HETATM   29  O12 UNL     1      -6.579   1.664   1.341  1.00  0.00           O  
HETATM   30  C13 UNL     1      -4.453   2.191   0.301  1.00  0.00           C  
HETATM   31  O13 UNL     1      -4.310   2.447   1.692  1.00  0.00           O  
HETATM   32  O14 UNL     1       2.986  -0.869  -0.298  1.00  0.00           O  
HETATM   33  C14 UNL     1       3.728  -1.979   0.117  1.00  0.00           C  
HETATM   34  C15 UNL     1       3.679  -2.948  -1.059  1.00  0.00           C  
HETATM   35  O15 UNL     1       4.250  -2.400  -2.195  1.00  0.00           O  
HETATM   36  C16 UNL     1       5.157  -1.662   0.429  1.00  0.00           C  
HETATM   37  O16 UNL     1       5.609  -2.660   1.309  1.00  0.00           O  
HETATM   38  C17 UNL     1       5.246  -0.312   1.169  1.00  0.00           C  
HETATM   39  O17 UNL     1       6.560  -0.079   1.551  1.00  0.00           O  
HETATM   40  H1  UNL     1       6.176   3.458  -2.283  1.00  0.00           H  
HETATM   41  H2  UNL     1       7.865   3.000  -1.892  1.00  0.00           H  
HETATM   42  H3  UNL     1       6.910   4.043  -0.732  1.00  0.00           H  
HETATM   43  H4  UNL     1       4.680   2.841  -0.012  1.00  0.00           H  
HETATM   44  H5  UNL     1       3.714   1.176   1.167  1.00  0.00           H  
HETATM   45  H6  UNL     1       4.617  -0.280  -1.400  1.00  0.00           H  
HETATM   46  H7  UNL     1       1.789   3.423  -0.003  1.00  0.00           H  
HETATM   47  H8  UNL     1      -1.196  -1.242   2.089  1.00  0.00           H  
HETATM   48  H9  UNL     1      -2.303   1.836  -1.745  1.00  0.00           H  
HETATM   49  H10 UNL     1      -1.612   2.115  -0.115  1.00  0.00           H  
HETATM   50  H11 UNL     1      -3.308   0.531   0.861  1.00  0.00           H  
HETATM   51  H12 UNL     1      -4.575  -0.095   1.184  1.00  0.00           H  
HETATM   52  H13 UNL     1      -7.600   0.096  -0.759  1.00  0.00           H  
HETATM   53  H14 UNL     1      -9.205  -1.869  -0.884  1.00  0.00           H  
HETATM   54  H15 UNL     1      -6.341  -4.292   0.972  1.00  0.00           H  
HETATM   55  H16 UNL     1      -6.220   1.638  -0.735  1.00  0.00           H  
HETATM   56  H17 UNL     1      -6.863   2.609   1.296  1.00  0.00           H  
HETATM   57  H18 UNL     1      -4.498   3.100  -0.285  1.00  0.00           H  
HETATM   58  H19 UNL     1      -3.627   3.106   1.901  1.00  0.00           H  
HETATM   59  H20 UNL     1       3.243  -2.431   0.975  1.00  0.00           H  
HETATM   60  H21 UNL     1       4.087  -3.948  -0.797  1.00  0.00           H  
HETATM   61  H22 UNL     1       2.596  -3.108  -1.288  1.00  0.00           H  
HETATM   62  H23 UNL     1       5.225  -2.608  -2.245  1.00  0.00           H  
HETATM   63  H24 UNL     1       5.815  -1.609  -0.453  1.00  0.00           H  
HETATM   64  H25 UNL     1       4.983  -3.431   1.340  1.00  0.00           H  
HETATM   65  H26 UNL     1       4.687  -0.566   2.154  1.00  0.00           H  
HETATM   66  H27 UNL     1       6.941  -0.957   1.880  1.00  0.00           H  
CONECT    1    2   40   41   42
CONECT    2    3    3    4
CONECT    4    5   43
CONECT    5    6   38   44
CONECT    6    7   32   45
CONECT    7    8
CONECT    8    9    9   10   11
CONECT   10   46
CONECT   11   12
CONECT   12   13   13   14   15
CONECT   14   47
CONECT   15   16
CONECT   16   17   48   49
CONECT   17   18   30   50
CONECT   18   19
CONECT   19   20   28   51
CONECT   20   21   26
CONECT   21   22   22   52
CONECT   22   23   53
CONECT   23   24   24   25
CONECT   25   26   54
CONECT   26   27   27
CONECT   28   29   30   55
CONECT   29   56
CONECT   30   31   57
CONECT   31   58
CONECT   32   33
CONECT   33   34   36   59
CONECT   34   35   60   61
CONECT   35   62
CONECT   36   37   38   63
CONECT   37   64
CONECT   38   39   65
CONECT   39   66
END

HMDB0013112
     RDKit          3D
UDP-N-acetyl-D-mannosamine
 66 68  0  0  0  0  0  0  0  0999 V2000
    6.8851    3.1584   -1.4123 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3661    1.9109   -0.8061 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0132    0.8328   -0.9519 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1724    1.9026   -0.0900 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5442    0.7760    0.4943 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.8270    0.1302   -0.7337 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2271    1.1903   -1.3518 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5937    1.3505   -0.9426 P   0  0  0  0  0  5  0  0  0  0  0  0
    0.7949    1.6357   -2.1898 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3659    2.5634    0.2089 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0636   -0.1102   -0.2955 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4202    0.0168    0.3492 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.5004    1.2012    1.3105 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8672   -1.4156    1.1933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6064    0.1523   -0.8567 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2173    1.4634   -0.7097 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5384    1.1210   -0.1371 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.3158    0.1698   -0.8081 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2205   -0.0114    0.2813 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.1496   -1.0574    0.1539 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3738   -0.8872   -0.3955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2132   -1.9693   -0.4452 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8227   -3.2129    0.0579 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5931   -4.1969    0.0117 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6122   -3.3518    0.5950 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8129   -2.2631    0.6228 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6560   -2.4304    1.1358 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7854    1.4016    0.2552 C   0  0  1  0  0  0  0  0  0  0  0  0
   -6.5795    1.6637    1.3412 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4528    2.1905    0.3007 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.3102    2.4474    1.6916 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9856   -0.8685   -0.2979 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7278   -1.9785    0.1174 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.6793   -2.9476   -1.0591 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2500   -2.4003   -2.1951 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1568   -1.6619    0.4288 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.6092   -2.6596    1.3086 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2462   -0.3120    1.1691 C   0  0  1  0  0  0  0  0  0  0  0  0
    6.5600   -0.0787    1.5514 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1762    3.4579   -2.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8646    2.9996   -1.8918 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9101    4.0428   -0.7323 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6796    2.8412   -0.0120 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7138    1.1762    1.1674 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6165   -0.2805   -1.4005 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7886    3.4228   -0.0033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1965   -1.2417    2.0887 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3030    1.8361   -1.7453 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6116    2.1151   -0.1147 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3076    0.5312    0.8606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5748   -0.0947    1.1843 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5995    0.0955   -0.7595 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2052   -1.8686   -0.8838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3410   -4.2919    0.9721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2202    1.6379   -0.7354 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8627    2.6086    1.2962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4982    3.0998   -0.2850 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6268    3.1060    1.9010 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2433   -2.4311    0.9754 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0871   -3.9484   -0.7972 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5959   -3.1085   -1.2882 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2252   -2.6076   -2.2449 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8150   -1.6092   -0.4527 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9833   -3.4309    1.3396 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6867   -0.5658    2.1536 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9406   -0.9570    1.8805 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 19 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
  6 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38  5  1  0
 30 17  1  0
 26 20  1  0
  1 40  1  0
  1 41  1  0
  1 42  1  0
  4 43  1  0
  5 44  1  1
  6 45  1  0
 10 46  1  0
 14 47  1  0
 16 48  1  0
 16 49  1  0
 17 50  1  1
 19 51  1  1
 21 52  1  0
 22 53  1  0
 25 54  1  0
 28 55  1  6
 29 56  1  0
 30 57  1  6
 31 58  1  0
 33 59  1  1
 34 60  1  0
 34 61  1  0
 35 62  1  0
 36 63  1  6
 37 64  1  0
 38 65  1  1
 39 66  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Uridine diphosphate N-acetylgalactosamine	HMDB
Uridine-diphosphate-N-acetylgalactosamine	HMDB
Uridine-diphosphate-N-acetylglucosamine	HMDB
Diphosphate N-acetylgalactosamine, uridine	MeSH, HMDB
UDP Acetylgalactosamine	MeSH, HMDB
Acetylgalactosamine, UDP	MeSH, HMDB
Uridine diphosphate N acetylgalactosamine	MeSH, HMDB
N-Acetylgalactosamine, uridine diphosphate	MeSH, HMDB

Chemical Formula

C₁₇H₂₇N₃O₁₇P₂

Average Molecular Weight

607.3537

Monoisotopic Molecular Weight

607.081569477

IUPAC Name

[({[(2S,3R,4S,5S)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid

Traditional Name

{[(2S,3R,4S,5S)-5-(2,4-dioxo-3H-pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy([(3R,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy)phosphinic acid

CAS Registry Number

Not Available

SMILES

CC(=O)N[C@@H]1[C@H](O)[C@@H](O)[C@H](CO)OC1OP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O

InChI Identifier

InChI=1S/C17H27N3O17P2/c1-6(22)18-10-13(26)11(24)7(4-21)35-16(10)36-39(31,32)37-38(29,30)33-5-8-12(25)14(27)15(34-8)20-3-2-9(23)19-17(20)28/h2-3,7-8,10-16,21,24-27H,4-5H2,1H3,(H,18,22)(H,29,30)(H,31,32)(H,19,23,28)/t7-,8-,10+,11-,12-,13-,14-,15-,16?/m0/s1

InChI Key

LFTYTUAZOPRMMI-IUPDHGCPSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as pyrimidine nucleotide sugars. These are pyrimidine nucleotides bound to a saccharide derivative through the terminal phosphate group.

Kingdom

Organic compounds

Super Class

Nucleosides, nucleotides, and analogues

Class

Pyrimidine nucleotides

Sub Class

Pyrimidine nucleotide sugars

Direct Parent

Pyrimidine nucleotide sugars

Alternative Parents

Substituents

Pyrimidine nucleotide sugar
Pyrimidine ribonucleoside diphosphate
Pentose phosphate
Pentose-5-phosphate
N-acyl-alpha-hexosamine
Glycosyl compound
N-glycosyl compound
Monosaccharide phosphate
Organic pyrophosphate
Pyrimidone
Monoalkyl phosphate
Hydropyrimidine
Monosaccharide
Organic phosphoric acid derivative
Oxane
Phosphoric acid ester
Pyrimidine
Alkyl phosphate
Vinylogous amide
Acetamide
Tetrahydrofuran
Heteroaromatic compound
Urea
Secondary carboxylic acid amide
Secondary alcohol
Carboxamide group
Lactam
Azacycle
Carboxylic acid derivative
Oxacycle
Organoheterocyclic compound
Organopnictogen compound
Organooxygen compound
Alcohol
Primary alcohol
Organic nitrogen compound
Organic oxygen compound
Organic oxide
Carbonyl group
Hydrocarbon derivative
Organonitrogen compound
Aromatic heteromonocyclic compound

Molecular Framework

Aromatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Not Available

Endogenous (HMDB: HMDB0013112)

Process

Naturally occurring process

Biological process

Biochemical pathway

Metabolic pathway

Amino Sugar and Nucleotide Sugar Metabolism I (PathBank: SMP0000905)

Role

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	11.4 g/L	ALOGPS
logP	-1.4	ALOGPS
logP	-5.3	ChemAxon
logS	-1.7	ALOGPS
pKa (Strongest Acidic)	1.74	ChemAxon
pKa (Strongest Basic)	-3.5	ChemAxon
Physiological Charge	-2	ChemAxon
Hydrogen Acceptor Count	14	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	300.41 Å²	ChemAxon
Rotatable Bond Count	10	ChemAxon
Refractivity	117.56 m³·mol⁻¹	ChemAxon
Polarizability	51.15 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	191.864	30932474
DeepCCS	[M-H]-	190.211	30932474
DeepCCS	[M-2H]-	224.245	30932474
DeepCCS	[M+Na]+	198.762	30932474
AllCCS	[M+H]+	220.8	32859911
AllCCS	[M+H-H2O]+	219.6	32859911
AllCCS	[M+NH4]+	221.8	32859911
AllCCS	[M+Na]+	222.1	32859911
AllCCS	[M-H]-	217.4	32859911
AllCCS	[M+Na-2H]-	218.8	32859911
AllCCS	[M+HCOO]-	220.6	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
UDP-N-acetyl-D-mannosamine	CC(=O)N[C@@H]1[C@H](O)[C@@H](O)[C@H](CO)OC1OP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O	5079.8	Standard polar	33892256
UDP-N-acetyl-D-mannosamine	CC(=O)N[C@@H]1[C@H](O)[C@@H](O)[C@H](CO)OC1OP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O	3390.6	Standard non polar	33892256
UDP-N-acetyl-D-mannosamine	CC(=O)N[C@@H]1[C@H](O)[C@@H](O)[C@H](CO)OC1OP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O	5122.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
UDP-N-acetyl-D-mannosamine,1TMS,isomer #1	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4430.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #2	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4449.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #3	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4405.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #4	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4430.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #5	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4440.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #6	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4519.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #7	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4507.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #8	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4487.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TMS,isomer #9	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4540.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #1	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4245.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #10	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4279.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #11	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4290.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #12	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4356.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #13	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4346.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #14	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4320.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #15	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4435.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #16	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4242.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #17	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4255.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #18	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4327.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #19	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4315.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #2	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4258.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #20	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4320.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #21	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4409.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #22	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4283.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #23	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4327.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #24	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4319.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #25	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4307.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #26	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4415.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #27	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4340.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #28	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4333.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #29	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4311.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #3	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4261.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #30	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4423.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #31	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4404.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #32	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4385.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #33	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4482.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #34	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4380.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #35	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4469.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #36	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4468.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #4	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4283.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #5	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4338.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #6	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4330.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #7	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4309.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #8	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4422.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TMS,isomer #9	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4265.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #1	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4169.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #10	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4214.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #11	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4209.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #12	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4168.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #13	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4285.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #14	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4184.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #15	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4206.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #16	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4199.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #17	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4183.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #18	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4291.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #19	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4223.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #2	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4148.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #20	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4216.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #21	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4203.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #22	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4311.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #23	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4261.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #24	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4219.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #25	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4344.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #26	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4221.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #27	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4342.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #28	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4331.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #29	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4174.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #3	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4166.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #30	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4154.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #31	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4210.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #32	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4204.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #33	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4165.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #34	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4290.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #35	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4162.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #36	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4218.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #37	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4212.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #38	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4169.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #39	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4301.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #4	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4205.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #40	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4216.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #41	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4210.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #42	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4200.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #43	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4310.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #44	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4261.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #45	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4222.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #46	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4353.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #47	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4224.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #48	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4351.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #49	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4340.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #5	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4200.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #50	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4141.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #51	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4176.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #52	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4169.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #53	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4165.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #54	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4266.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #55	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4184.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #56	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4176.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #57	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4172.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #58	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4275.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #59	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4228.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #6	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4161.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #60	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4221.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #61	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4334.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #62	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4221.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #63	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4328.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #64	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4337.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #65	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4209.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #66	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4201.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #67	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4189.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #68	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4301.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #69	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4243.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #7	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4276.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #70	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4205.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #71	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4328.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #72	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4208.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #73	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4328.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #74	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4316.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #75	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4251.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #76	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4211.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #77	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4336.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #78	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4215.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #79	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4337.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #8	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4157.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #80	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4321.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #81	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4258.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #82	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4390.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #83	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4377.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #84	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4378.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,3TMS,isomer #9	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4175.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #1	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4116.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #10	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4106.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #100	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4220.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #101	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4222.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #102	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4152.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #103	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4136.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #104	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4231.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #105	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4135.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #106	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4230.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #107	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4233.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #108	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4154.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #109	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4265.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #11	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4218.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #110	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4265.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #111	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4267.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #112	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4168.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #113	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4146.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #114	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4254.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #115	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4144.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #116	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4251.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #117	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4242.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #118	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4155.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #119	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4271.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #12	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4163.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #120	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4252.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #121	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4253.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #122	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4171.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #123	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4280.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #124	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4261.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #125	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4264.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #126	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C	4293.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #13	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4153.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #14	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4126.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #15	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4235.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #16	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4200.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #17	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4149.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #18	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4261.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #19	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4143.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #2	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4123.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #20	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4260.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #21	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4229.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #22	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4128.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #23	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4164.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #24	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4155.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #25	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4115.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #26	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4229.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #27	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4170.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #28	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4160.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #29	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4133.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #3	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4169.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #30	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4246.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #31	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4209.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #32	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4161.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #33	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4272.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #34	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4157.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #35	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4272.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #36	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4241.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #37	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4163.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #38	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4152.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #39	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4148.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #4	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4160.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #40	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4251.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #41	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4176.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #42	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4151.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #43	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4259.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #44	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4145.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #45	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4258.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #46	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4247.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #47	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4185.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #48	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4175.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #49	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4275.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #5	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4121.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #50	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4166.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #51	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4274.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #52	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4268.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #53	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4192.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #54	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4300.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #55	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4280.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #56	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C)[Si](C)(C)C	4280.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #57	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4108.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #58	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4156.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #59	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4148.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #6	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C	4244.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #60	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4120.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #61	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4242.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #62	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4150.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #63	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4137.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #64	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4112.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #65	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4216.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #66	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4187.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #67	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4144.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #68	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4256.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #69	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4142.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #7	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C	4124.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #70	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4257.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #71	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4230.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #72	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4156.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #73	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4147.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #74	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4122.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #75	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4227.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #76	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4198.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #77	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4157.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #78	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4268.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #79	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4155.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #8	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4158.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #80	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4269.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #81	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4240.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #82	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4175.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #83	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4156.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #84	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4262.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #85	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4153.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #86	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O	4261.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #87	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4258.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #88	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4179.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #89	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O	4296.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #9	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4147.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #90	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4278.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #91	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O)[Si](C)(C)C	4281.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #92	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4118.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #93	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4112.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #94	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4110.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #95	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4209.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #96	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4143.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #97	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4121.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #98	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C)C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O	4221.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,4TMS,isomer #99	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C	4121.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #1	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4618.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #2	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4629.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #3	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4599.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #4	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4622.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #5	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4630.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #6	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4710.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #7	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4694.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #8	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4676.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,1TBDMS,isomer #9	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4738.3	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #1	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4648.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #10	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4651.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #11	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4648.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #12	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4718.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #13	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4704.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #14	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)[Si](C)(C)C(C)(C)C	4675.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #15	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4776.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #16	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4636.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #17	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4640.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #18	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4704.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #19	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4691.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #2	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4649.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #20	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4671.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #21	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4756.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #22	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4667.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #23	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4720.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #24	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4706.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #25	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4679.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #26	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4769.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #27	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4723.2	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #28	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4710.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #29	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4677.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #3	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4644.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #30	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4770.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #31	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4782.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #32	CC(=O)N([C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4726.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #33	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O	4835.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #34	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4718.7	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #35	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O	4821.5	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #36	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C	4800.4	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #4	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C	4639.8	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #5	CC(=O)N[C@H]1C(OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4721.0	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #6	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4704.9	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #7	CC(=O)N([C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4681.1	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #8	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H](O)[C@H]2O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4774.6	Semi standard non polar	33892256
UDP-N-acetyl-D-mannosamine,2TBDMS,isomer #9	CC(=O)N[C@H]1C(OP(=O)(O)OP(=O)(O)OC[C@@H]2O[C@H](N3C=CC(=O)[NH]C3=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4649.9	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (Non-derivatized) - 70eV, Positive	splash10-0f96-5924660000-c11cc7fa21a050c0f373	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (1 TMS) - 70eV, Positive	splash10-0h03-7952838000-56b15bfcc0138d466a26	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - UDP-N-acetyl-D-mannosamine GC-MS (TMS_2_15) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 10V, Positive-QTOF	splash10-03di-0910020000-4282200321d0bfe45943	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 20V, Positive-QTOF	splash10-03di-3921000000-6076288d599ab3313479	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 40V, Positive-QTOF	splash10-03di-5910000000-14d31d6720f9ec539675	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 10V, Negative-QTOF	splash10-06ri-9502331000-138ea2dd91899208164e	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 20V, Negative-QTOF	splash10-03dl-9504010000-0424c67ad101c9f6be36	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 40V, Negative-QTOF	splash10-06r6-5901000000-dce542e7a9e33e0e747c	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 10V, Negative-QTOF	splash10-0a4i-0000029000-6a481f04b19fa3177889	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 20V, Negative-QTOF	splash10-0a6s-5100192000-07c7ec84c4bab85e334a	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 40V, Negative-QTOF	splash10-053u-4719110000-3a1b07828c441361af2f	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 10V, Positive-QTOF	splash10-00mk-0000982000-8e4f05f581cea906b6bb	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 20V, Positive-QTOF	splash10-0hi2-0213591000-da4a947496986866c59e	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - UDP-N-acetyl-D-mannosamine 40V, Positive-QTOF	splash10-0a4j-6980020000-82befaa44d12d4c3c15d	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-16	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

KNApSAcK ID

Chemspider ID

KEGG Compound ID

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

53481607

PDB ID

Not Available

ChEBI ID

16287

Food Biomarker Ontology

Not Available

VMH ID

UACMAM

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Not Available

Showing metabocard for UDP-N-acetyl-D-mannosamine (HMDB0013112)

MOL for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

3D MOL for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

3D SDF for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

3D-SDF for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

PDB for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

3D PDB for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

SMILES for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

INCHI for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

Structure for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

3D Structure for HMDB0013112 (UDP-N-acetyl-D-mannosamine)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra