Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 17:30:37 UTC |
---|
Update Date | 2022-03-07 02:52:10 UTC |
---|
HMDB ID | HMDB0029475 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | [10]-Gingerdione |
---|
Description | [10]-Gingerdione belongs to the class of organic compounds known as gingerdiones. Gingerdiones are compounds containing a gingerdione moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-dione. Based on a literature review a significant number of articles have been published on [10]-Gingerdione. |
---|
Structure | CCCCCCCCCC(=O)CC(=O)CCC1=CC(OC)=C(O)C=C1 InChI=1S/C21H32O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,24H,3-11,13,16H2,1-2H3 |
---|
Synonyms | Value | Source |
---|
1-(4-Hydroxy-3-methoxyphenyl)-3,5-tetradecanedione | HMDB |
|
---|
Chemical Formula | C21H32O4 |
---|
Average Molecular Weight | 348.4764 |
---|
Monoisotopic Molecular Weight | 348.230059512 |
---|
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)tetradecane-3,5-dione |
---|
Traditional Name | 1-(4-hydroxy-3-methoxyphenyl)tetradecane-3,5-dione |
---|
CAS Registry Number | Not Available |
---|
SMILES | CCCCCCCCCC(=O)CC(=O)CCC1=CC(OC)=C(O)C=C1 |
---|
InChI Identifier | InChI=1S/C21H32O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,24H,3-11,13,16H2,1-2H3 |
---|
InChI Key | QPSYZJDGMPQMSV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as gingerdiones. Gingerdiones are compounds containing a gingerdione moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-dione. |
---|
Kingdom | Organic compounds |
---|
Super Class | Benzenoids |
---|
Class | Phenols |
---|
Sub Class | Methoxyphenols |
---|
Direct Parent | Gingerdiones |
---|
Alternative Parents | |
---|
Substituents | - Gingerdione
- Phenoxy compound
- Anisole
- Methoxybenzene
- Phenol ether
- 1-hydroxy-2-unsubstituted benzenoid
- Alkyl aryl ether
- 1,3-diketone
- Monocyclic benzene moiety
- 1,3-dicarbonyl compound
- Ketone
- Ether
- Organic oxygen compound
- Organooxygen compound
- Carbonyl group
- Hydrocarbon derivative
- Organic oxide
- Aromatic homomonocyclic compound
|
---|
Molecular Framework | Aromatic homomonocyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Not Available |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | | Show more...
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
[10]-Gingerdione,1TMS,isomer #1 | CCCCCCCCCC(=O)CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1 | 2784.3 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TMS,isomer #2 | CCCCCCCCCC(=CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 2888.4 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TMS,isomer #3 | CCCCCCCCC=C(CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 2864.1 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TMS,isomer #4 | CCCCCCCCCC(=O)CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 2875.4 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TMS,isomer #5 | CCCCCCCCCC(=O)C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 2878.8 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #1 | CCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2901.3 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #1 | CCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2780.3 | Standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #2 | CCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2901.1 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #2 | CCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2776.7 | Standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #3 | CCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2929.3 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #3 | CCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2812.4 | Standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #4 | CCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2886.4 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #4 | CCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2771.3 | Standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #5 | CCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3016.6 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #5 | CCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2918.0 | Standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #6 | CCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2951.8 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #6 | CCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2947.7 | Standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #7 | CCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2991.3 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TMS,isomer #7 | CCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2879.8 | Standard non polar | 33892256 | [10]-Gingerdione,3TMS,isomer #1 | CCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3031.6 | Semi standard non polar | 33892256 | [10]-Gingerdione,3TMS,isomer #1 | CCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2842.8 | Standard non polar | 33892256 | [10]-Gingerdione,3TMS,isomer #2 | CCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2975.4 | Semi standard non polar | 33892256 | [10]-Gingerdione,3TMS,isomer #2 | CCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2870.1 | Standard non polar | 33892256 | [10]-Gingerdione,3TMS,isomer #3 | CCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2997.2 | Semi standard non polar | 33892256 | [10]-Gingerdione,3TMS,isomer #3 | CCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2810.9 | Standard non polar | 33892256 | [10]-Gingerdione,1TBDMS,isomer #1 | CCCCCCCCCC(=O)CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1 | 3040.7 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TBDMS,isomer #2 | CCCCCCCCCC(=CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3139.4 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TBDMS,isomer #3 | CCCCCCCCC=C(CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3104.2 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TBDMS,isomer #4 | CCCCCCCCCC(=O)CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3118.7 | Semi standard non polar | 33892256 | [10]-Gingerdione,1TBDMS,isomer #5 | CCCCCCCCCC(=O)C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3127.5 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #1 | CCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3390.1 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #1 | CCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3146.6 | Standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #2 | CCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3355.3 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #2 | CCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3139.6 | Standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #3 | CCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3395.6 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #3 | CCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3190.0 | Standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #4 | CCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3388.0 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #4 | CCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3135.9 | Standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #5 | CCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3512.3 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #5 | CCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3299.9 | Standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #6 | CCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3431.2 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #6 | CCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3325.4 | Standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #7 | CCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3497.2 | Semi standard non polar | 33892256 | [10]-Gingerdione,2TBDMS,isomer #7 | CCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3239.8 | Standard non polar | 33892256 | [10]-Gingerdione,3TBDMS,isomer #1 | CCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3727.6 | Semi standard non polar | 33892256 | [10]-Gingerdione,3TBDMS,isomer #1 | CCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3345.0 | Standard non polar | 33892256 | [10]-Gingerdione,3TBDMS,isomer #2 | CCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3649.7 | Semi standard non polar | 33892256 | [10]-Gingerdione,3TBDMS,isomer #2 | CCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3364.5 | Standard non polar | 33892256 | [10]-Gingerdione,3TBDMS,isomer #3 | CCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3707.8 | Semi standard non polar | 33892256 | [10]-Gingerdione,3TBDMS,isomer #3 | CCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3298.6 | Standard non polar | 33892256 |
| Show more...
---|