Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:30:40 UTC

Update Date

2022-03-07 02:52:10 UTC

HMDB ID

HMDB0029484

Secondary Accession Numbers

HMDB29484

Metabolite Identification

Common Name

Isovitexin 2''-O-glucoside

Description

Isovitexin 2''-O-glucoside belongs to the class of organic compounds known as coumarins and derivatives. These are polycyclic aromatic compounds containing a 1-benzopyran moiety with a ketone group at the C2 carbon atom (1-benzopyran-2-one). Isovitexin 2''-O-glucoside has been detected, but not quantified in, several different foods, such as red tea, cucumbers (Cucumis sativus), muskmelons (Cucumis melo), teas (Camellia sinensis), and black tea. This could make isovitexin 2''-O-glucoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Isovitexin 2''-O-glucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 02241217332D          

 42 46  0  0  0  0            999 V2000
   -2.5005   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2141   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6441   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9305   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9305   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6441   -3.7126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7868   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7868   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2141    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581    2.8876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    3.7126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2155    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 16  1  0  0  0  0
  2  3  1  0  0  0  0
  2 32  1  0  0  0  0
  3  4  1  0  0  0  0
  5  6  2  0  0  0  0
  5 10  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  7 25  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 12 27  2  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 14 22  1  0  0  0  0
 15 16  1  0  0  0  0
 15 29  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 17 33  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 39  1  0  0  0  0
 20 21  1  0  0  0  0
 20 36  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 23 28  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  2  0  0  0  0
 29 30  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 37 40  1  0  0  0  0
 38 39  1  0  0  0  0
 38 41  1  0  0  0  0
 41 42  1  0  0  0  0
M  END

HMDB0029484
     RDKit          3D
Isovitexin 2''-O-glucoside
 72 76  0  0  0  0  0  0  0  0999 V2000
    1.0929    2.0242   -2.0790 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0165    1.5033   -1.4298 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2844    2.0990   -1.3806 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3029    1.5200   -0.6617 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6240    2.1346   -0.6074 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9612    3.3073   -1.2421 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2569    3.8284   -1.1407 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2454    3.2049   -0.4124 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5154    3.7607   -0.3418 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9118    2.0296    0.2253 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6385    1.5121    0.1291 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0888    0.4127   -0.0233 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9306   -0.1693   -0.0442 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8300   -1.3473    0.6774 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6374   -2.0092    0.6961 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4953   -3.1880    1.4041 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4910   -1.5471    0.0095 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7217   -2.3446    0.0871 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8384   -2.8224    1.4155 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6892   -3.8645    1.5689 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0337   -5.2187    1.3995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4617   -5.4508    0.1852 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9843   -3.7379    0.8736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4331   -5.0379    0.5380 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0528   -2.9098   -0.3482 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7588   -3.6286   -1.4920 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0076   -1.7340   -0.2602 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4624   -0.8585    0.6930 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0117    0.3141    0.2957 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3723    1.4592    0.7837 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8810    2.5358    0.0591 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1312    3.8132    0.2816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7904    3.7325   -0.0777 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3364    2.7657    0.3071 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7973    3.6974   -0.6222 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1276    1.4862    0.0499 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0213    1.1953   -1.2970 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4323    0.3839    0.8192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458    0.8335    2.1524 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6232   -0.3683   -0.7038 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4261    0.1251   -1.3890 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8370    0.3354   -0.7408 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030    3.0175   -1.9302 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2156    3.8368   -1.8290 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4985    4.7686   -1.6594 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1729    3.4646   -1.0639 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6881    1.5362    0.7996 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3953    0.5995    0.6295 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6821   -1.7572    1.2304 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2166   -3.6290    1.9322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6181   -3.2918   -0.5464 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9508   -3.8594    2.6935 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2077   -5.2561    2.1675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7266   -6.0356    1.7108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8851   -6.2355   -0.2523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7791   -3.3769    1.5986 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7682   -5.4878    1.3756 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0568   -2.4787   -0.4549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4533   -3.0748   -2.2341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0668   -1.3120   -1.2523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0673    0.4606   -0.8040 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7694    2.2809   -1.0191 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2581    4.2257    1.3147 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5994    4.5734   -0.3985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7424    3.8633   -1.0620 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5460    3.1841    1.3181 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7157    3.4754   -0.9089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1754    1.6296    0.3816 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4232    0.3250   -1.5403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9542   -0.5877    0.7541 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5443    0.4806    2.5977 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6305    0.8834   -1.9061 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 17 40  1  0
 40 41  1  0
 40 42  2  0
 42  2  1  0
 11  5  1  0
 42 13  1  0
 27 18  1  0
 38 29  1  0
  3 43  1  0
  6 44  1  0
  7 45  1  0
  9 46  1  0
 10 47  1  0
 11 48  1  0
 14 49  1  0
 16 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 41 72  1  0
M  END

  Mrv0541 02241217332D          

 42 46  0  0  0  0            999 V2000
   -2.5005   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2141   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6441   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9305   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9305   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6441   -3.7126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7868   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7868   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2141    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581    2.8876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    3.7126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5005    2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2155    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 16  1  0  0  0  0
  2  3  1  0  0  0  0
  2 32  1  0  0  0  0
  3  4  1  0  0  0  0
  5  6  2  0  0  0  0
  5 10  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  7 25  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 12 27  2  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 14 22  1  0  0  0  0
 15 16  1  0  0  0  0
 15 29  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 17 33  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 39  1  0  0  0  0
 20 21  1  0  0  0  0
 20 36  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 23 28  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  2  0  0  0  0
 29 30  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 37 40  1  0  0  0  0
 38 39  1  0  0  0  0
 38 41  1  0  0  0  0
 41 42  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0029484

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2C(O)C(O)C(CO)OC2C2=C(O)C=C3OC(=CC(=O)C3=C2O)C2=CC=C(O)C=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O15/c28-7-15-20(34)23(37)26(42-27-24(38)22(36)19(33)16(8-29)41-27)25(40-15)18-12(32)6-14-17(21(18)35)11(31)5-13(39-14)9-1-3-10(30)4-2-9/h1-6,15-16,19-20,22-30,32-38H,7-8H2

> <INCHI_KEY>
RQTTXGQDIROLTQ-UHFFFAOYSA-N

> <FORMULA>
C27H30O15

> <MOLECULAR_WEIGHT>
594.5181

> <EXACT_MASS>
594.15847029

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
57.69775702898954

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
6-[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.67

> <JCHEM_LOGP>
-1.821467417

> <ALOGPS_LOGS>
-1.98

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.50206612280177

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.196596382383968

> <JCHEM_PKA_STRONGEST_BASIC>
-3.645025606539847

> <JCHEM_POLAR_SURFACE_AREA>
256.28999999999996

> <JCHEM_REFRACTIVITY>
138.44549999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
6.26e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
6-[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0029484
     RDKit          3D
Isovitexin 2''-O-glucoside
 72 76  0  0  0  0  0  0  0  0999 V2000
    1.0929    2.0242   -2.0790 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0165    1.5033   -1.4298 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2844    2.0990   -1.3806 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3029    1.5200   -0.6617 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6240    2.1346   -0.6074 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9612    3.3073   -1.2421 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2569    3.8284   -1.1407 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2454    3.2049   -0.4124 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5154    3.7607   -0.3418 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9118    2.0296    0.2253 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6385    1.5121    0.1291 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0888    0.4127   -0.0233 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9306   -0.1693   -0.0442 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8300   -1.3473    0.6774 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6374   -2.0092    0.6961 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4953   -3.1880    1.4041 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4910   -1.5471    0.0095 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7217   -2.3446    0.0871 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8384   -2.8224    1.4155 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6892   -3.8645    1.5689 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0337   -5.2187    1.3995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4617   -5.4508    0.1852 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9843   -3.7379    0.8736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4331   -5.0379    0.5380 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0528   -2.9098   -0.3482 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7588   -3.6286   -1.4920 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0076   -1.7340   -0.2602 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4624   -0.8585    0.6930 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0117    0.3141    0.2957 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3723    1.4592    0.7837 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8810    2.5358    0.0591 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1312    3.8132    0.2816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7904    3.7325   -0.0777 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3364    2.7657    0.3071 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7973    3.6974   -0.6222 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1276    1.4862    0.0499 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0213    1.1953   -1.2970 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4323    0.3839    0.8192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458    0.8335    2.1524 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6232   -0.3683   -0.7038 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4261    0.1251   -1.3890 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8370    0.3354   -0.7408 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030    3.0175   -1.9302 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2156    3.8368   -1.8290 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4985    4.7686   -1.6594 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1729    3.4646   -1.0639 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6881    1.5362    0.7996 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3953    0.5995    0.6295 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6821   -1.7572    1.2304 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2166   -3.6290    1.9322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6181   -3.2918   -0.5464 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9508   -3.8594    2.6935 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2077   -5.2561    2.1675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7266   -6.0356    1.7108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8851   -6.2355   -0.2523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7791   -3.3769    1.5986 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7682   -5.4878    1.3756 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0568   -2.4787   -0.4549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4533   -3.0748   -2.2341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0668   -1.3120   -1.2523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0673    0.4606   -0.8040 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7694    2.2809   -1.0191 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2581    4.2257    1.3147 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5994    4.5734   -0.3985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7424    3.8633   -1.0620 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5460    3.1841    1.3181 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7157    3.4754   -0.9089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1754    1.6296    0.3816 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4232    0.3250   -1.5403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9542   -0.5877    0.7541 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5443    0.4806    2.5977 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6305    0.8834   -1.9061 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 17 40  1  0
 40 41  1  0
 40 42  2  0
 42  2  1  0
 11  5  1  0
 42 13  1  0
 27 18  1  0
 38 29  1  0
  3 43  1  0
  6 44  1  0
  7 45  1  0
  9 46  1  0
 10 47  1  0
 11 48  1  0
 14 49  1  0
 16 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 41 72  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  O   UNK     0      -4.668  -2.310   0.000  0.00  0.00           O+0
HETATM    2  C   UNK     0      -6.000  -1.540   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -7.334  -2.310   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0      -8.669  -1.540   0.000  0.00  0.00           O+0
HETATM    5  C   UNK     0       6.002  -6.930   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       4.670  -6.160   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       4.670  -4.620   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       6.002  -3.850   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       7.337  -4.620   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       7.337  -6.160   0.000  0.00  0.00           C+0
HETATM   11  O   UNK     0       8.669  -6.930   0.000  0.00  0.00           O+0
HETATM   12  O   UNK     0       2.001   0.000   0.000  0.00  0.00           O+0
HETATM   13  O   UNK     0      -3.333  -4.620   0.000  0.00  0.00           O+0
HETATM   14  C   UNK     0      -1.998  -3.850   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -1.998  -2.310   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -3.333  -1.540   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -3.333   0.000   0.000  0.00  0.00           C+0
HETATM   18  O   UNK     0      -1.998   0.770   0.000  0.00  0.00           O+0
HETATM   19  C   UNK     0      -1.998   2.310   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -0.666   3.080   0.000  0.00  0.00           C+0
HETATM   21  O   UNK     0       0.668   2.310   0.000  0.00  0.00           O+0
HETATM   22  C   UNK     0      -0.666  -4.620   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       0.668  -3.850   0.000  0.00  0.00           C+0
HETATM   24  O   UNK     0       2.001  -4.620   0.000  0.00  0.00           O+0
HETATM   25  C   UNK     0       3.335  -3.850   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       3.335  -2.310   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       2.001  -1.540   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       0.668  -2.310   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      -0.666  -1.540   0.000  0.00  0.00           C+0
HETATM   30  O   UNK     0      -0.666   0.000   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -7.334   0.770   0.000  0.00  0.00           O+0
HETATM   32  C   UNK     0      -6.000   0.000   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      -4.668   0.770   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0      -4.668   2.310   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       0.668   5.390   0.000  0.00  0.00           O+0
HETATM   36  C   UNK     0      -0.666   4.620   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0      -1.998   5.390   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      -3.333   4.620   0.000  0.00  0.00           C+0
HETATM   39  O   UNK     0      -3.333   3.080   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0      -1.998   6.930   0.000  0.00  0.00           O+0
HETATM   41  C   UNK     0      -4.668   5.390   0.000  0.00  0.00           C+0
HETATM   42  O   UNK     0      -6.002   4.620   0.000  0.00  0.00           O+0
CONECT    1    2   16                                                       
CONECT    2    1    3   32                                                  
CONECT    3    2    4                                                       
CONECT    4    3                                                            
CONECT    5    6   10                                                       
CONECT    6    5    7                                                       
CONECT    7    6    8   25                                                  
CONECT    8    7    9                                                       
CONECT    9    8   10                                                       
CONECT   10    5    9   11                                                  
CONECT   11   10                                                            
CONECT   12   27                                                            
CONECT   13   14                                                            
CONECT   14   13   15   22                                                  
CONECT   15   14   16   29                                                  
CONECT   16    1   15   17                                                  
CONECT   17   16   18   33                                                  
CONECT   18   17   19                                                       
CONECT   19   18   20   39                                                  
CONECT   20   19   21   36                                                  
CONECT   21   20                                                            
CONECT   22   14   23                                                       
CONECT   23   22   24   28                                                  
CONECT   24   23   25                                                       
CONECT   25    7   24   26                                                  
CONECT   26   25   27                                                       
CONECT   27   12   26   28                                                  
CONECT   28   23   27   29                                                  
CONECT   29   15   28   30                                                  
CONECT   30   29                                                            
CONECT   31   32                                                            
CONECT   32    2   31   33                                                  
CONECT   33   17   32   34                                                  
CONECT   34   33                                                            
CONECT   35   36                                                            
CONECT   36   20   35   37                                                  
CONECT   37   36   38   40                                                  
CONECT   38   37   39   41                                                  
CONECT   39   19   38                                                       
CONECT   40   37                                                            
CONECT   41   38   42                                                       
CONECT   42   41                                                            
MASTER        0    0    0    0    0    0    0    0   42    0   92    0
END

COMPND    HMDB0029484
HETATM    1  O1  UNL     1       1.093   2.024  -2.079  1.00  0.00           O  
HETATM    2  C1  UNL     1       2.016   1.503  -1.430  1.00  0.00           C  
HETATM    3  C2  UNL     1       3.284   2.099  -1.381  1.00  0.00           C  
HETATM    4  C3  UNL     1       4.303   1.520  -0.662  1.00  0.00           C  
HETATM    5  C4  UNL     1       5.624   2.135  -0.607  1.00  0.00           C  
HETATM    6  C5  UNL     1       5.961   3.307  -1.242  1.00  0.00           C  
HETATM    7  C6  UNL     1       7.257   3.828  -1.141  1.00  0.00           C  
HETATM    8  C7  UNL     1       8.245   3.205  -0.412  1.00  0.00           C  
HETATM    9  O2  UNL     1       9.515   3.761  -0.342  1.00  0.00           O  
HETATM   10  C8  UNL     1       7.912   2.030   0.225  1.00  0.00           C  
HETATM   11  C9  UNL     1       6.639   1.512   0.129  1.00  0.00           C  
HETATM   12  O3  UNL     1       4.089   0.413  -0.023  1.00  0.00           O  
HETATM   13  C10 UNL     1       2.931  -0.169  -0.044  1.00  0.00           C  
HETATM   14  C11 UNL     1       2.830  -1.347   0.677  1.00  0.00           C  
HETATM   15  C12 UNL     1       1.637  -2.009   0.696  1.00  0.00           C  
HETATM   16  O4  UNL     1       1.495  -3.188   1.404  1.00  0.00           O  
HETATM   17  C13 UNL     1       0.491  -1.547   0.010  1.00  0.00           C  
HETATM   18  C14 UNL     1      -0.722  -2.345   0.087  1.00  0.00           C  
HETATM   19  O5  UNL     1      -0.838  -2.822   1.416  1.00  0.00           O  
HETATM   20  C15 UNL     1      -1.689  -3.865   1.569  1.00  0.00           C  
HETATM   21  C16 UNL     1      -1.034  -5.219   1.400  1.00  0.00           C  
HETATM   22  O6  UNL     1      -0.462  -5.451   0.185  1.00  0.00           O  
HETATM   23  C17 UNL     1      -2.984  -3.738   0.874  1.00  0.00           C  
HETATM   24  O7  UNL     1      -3.433  -5.038   0.538  1.00  0.00           O  
HETATM   25  C18 UNL     1      -3.053  -2.910  -0.348  1.00  0.00           C  
HETATM   26  O8  UNL     1      -2.759  -3.629  -1.492  1.00  0.00           O  
HETATM   27  C19 UNL     1      -2.008  -1.734  -0.260  1.00  0.00           C  
HETATM   28  O9  UNL     1      -2.462  -0.859   0.693  1.00  0.00           O  
HETATM   29  C20 UNL     1      -3.012   0.314   0.296  1.00  0.00           C  
HETATM   30  O10 UNL     1      -2.372   1.459   0.784  1.00  0.00           O  
HETATM   31  C21 UNL     1      -2.881   2.536   0.059  1.00  0.00           C  
HETATM   32  C22 UNL     1      -2.131   3.813   0.282  1.00  0.00           C  
HETATM   33  O11 UNL     1      -0.790   3.732  -0.078  1.00  0.00           O  
HETATM   34  C23 UNL     1      -4.336   2.766   0.307  1.00  0.00           C  
HETATM   35  O12 UNL     1      -4.797   3.697  -0.622  1.00  0.00           O  
HETATM   36  C24 UNL     1      -5.128   1.486   0.050  1.00  0.00           C  
HETATM   37  O13 UNL     1      -5.021   1.195  -1.297  1.00  0.00           O  
HETATM   38  C25 UNL     1      -4.432   0.384   0.819  1.00  0.00           C  
HETATM   39  O14 UNL     1      -4.346   0.833   2.152  1.00  0.00           O  
HETATM   40  C26 UNL     1       0.623  -0.368  -0.704  1.00  0.00           C  
HETATM   41  O15 UNL     1      -0.426   0.125  -1.389  1.00  0.00           O  
HETATM   42  C27 UNL     1       1.837   0.335  -0.741  1.00  0.00           C  
HETATM   43  H1  UNL     1       3.403   3.018  -1.930  1.00  0.00           H  
HETATM   44  H2  UNL     1       5.216   3.837  -1.829  1.00  0.00           H  
HETATM   45  H3  UNL     1       7.499   4.769  -1.659  1.00  0.00           H  
HETATM   46  H4  UNL     1      10.173   3.465  -1.064  1.00  0.00           H  
HETATM   47  H5  UNL     1       8.688   1.536   0.800  1.00  0.00           H  
HETATM   48  H6  UNL     1       6.395   0.600   0.629  1.00  0.00           H  
HETATM   49  H7  UNL     1       3.682  -1.757   1.230  1.00  0.00           H  
HETATM   50  H8  UNL     1       2.217  -3.629   1.932  1.00  0.00           H  
HETATM   51  H9  UNL     1      -0.618  -3.292  -0.546  1.00  0.00           H  
HETATM   52  H10 UNL     1      -1.951  -3.859   2.694  1.00  0.00           H  
HETATM   53  H11 UNL     1      -0.208  -5.256   2.168  1.00  0.00           H  
HETATM   54  H12 UNL     1      -1.727  -6.036   1.711  1.00  0.00           H  
HETATM   55  H13 UNL     1      -0.885  -6.235  -0.252  1.00  0.00           H  
HETATM   56  H14 UNL     1      -3.779  -3.377   1.599  1.00  0.00           H  
HETATM   57  H15 UNL     1      -3.768  -5.488   1.376  1.00  0.00           H  
HETATM   58  H16 UNL     1      -4.057  -2.479  -0.455  1.00  0.00           H  
HETATM   59  H17 UNL     1      -2.453  -3.075  -2.234  1.00  0.00           H  
HETATM   60  H18 UNL     1      -2.067  -1.312  -1.252  1.00  0.00           H  
HETATM   61  H19 UNL     1      -3.067   0.461  -0.804  1.00  0.00           H  
HETATM   62  H20 UNL     1      -2.769   2.281  -1.019  1.00  0.00           H  
HETATM   63  H21 UNL     1      -2.258   4.226   1.315  1.00  0.00           H  
HETATM   64  H22 UNL     1      -2.599   4.573  -0.398  1.00  0.00           H  
HETATM   65  H23 UNL     1      -0.742   3.863  -1.062  1.00  0.00           H  
HETATM   66  H24 UNL     1      -4.546   3.184   1.318  1.00  0.00           H  
HETATM   67  H25 UNL     1      -5.716   3.475  -0.909  1.00  0.00           H  
HETATM   68  H26 UNL     1      -6.175   1.630   0.382  1.00  0.00           H  
HETATM   69  H27 UNL     1      -5.423   0.325  -1.540  1.00  0.00           H  
HETATM   70  H28 UNL     1      -4.954  -0.588   0.754  1.00  0.00           H  
HETATM   71  H29 UNL     1      -3.544   0.481   2.598  1.00  0.00           H  
HETATM   72  H30 UNL     1      -0.630   0.883  -1.906  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   42
CONECT    3    4    4   43
CONECT    4    5   12
CONECT    5    6    6   11
CONECT    6    7   44
CONECT    7    8    8   45
CONECT    8    9   10
CONECT    9   46
CONECT   10   11   11   47
CONECT   11   48
CONECT   12   13
CONECT   13   14   14   42
CONECT   14   15   49
CONECT   15   16   17   17
CONECT   16   50
CONECT   17   18   40
CONECT   18   19   27   51
CONECT   19   20
CONECT   20   21   23   52
CONECT   21   22   53   54
CONECT   22   55
CONECT   23   24   25   56
CONECT   24   57
CONECT   25   26   27   58
CONECT   26   59
CONECT   27   28   60
CONECT   28   29
CONECT   29   30   38   61
CONECT   30   31
CONECT   31   32   34   62
CONECT   32   33   63   64
CONECT   33   65
CONECT   34   35   36   66
CONECT   35   67
CONECT   36   37   38   68
CONECT   37   69
CONECT   38   39   70
CONECT   39   71
CONECT   40   41   42   42
CONECT   41   72
END

HMDB0029484
     RDKit          3D
Isovitexin 2''-O-glucoside
 72 76  0  0  0  0  0  0  0  0999 V2000
    1.0929    2.0242   -2.0790 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0165    1.5033   -1.4298 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2844    2.0990   -1.3806 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3029    1.5200   -0.6617 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6240    2.1346   -0.6074 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9612    3.3073   -1.2421 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2569    3.8284   -1.1407 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2454    3.2049   -0.4124 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5154    3.7607   -0.3418 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9118    2.0296    0.2253 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6385    1.5121    0.1291 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0888    0.4127   -0.0233 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9306   -0.1693   -0.0442 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8300   -1.3473    0.6774 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6374   -2.0092    0.6961 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4953   -3.1880    1.4041 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4910   -1.5471    0.0095 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7217   -2.3446    0.0871 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8384   -2.8224    1.4155 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6892   -3.8645    1.5689 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0337   -5.2187    1.3995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4617   -5.4508    0.1852 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9843   -3.7379    0.8736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4331   -5.0379    0.5380 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0528   -2.9098   -0.3482 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7588   -3.6286   -1.4920 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0076   -1.7340   -0.2602 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4624   -0.8585    0.6930 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0117    0.3141    0.2957 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3723    1.4592    0.7837 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8810    2.5358    0.0591 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1312    3.8132    0.2816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7904    3.7325   -0.0777 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3364    2.7657    0.3071 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7973    3.6974   -0.6222 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1276    1.4862    0.0499 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0213    1.1953   -1.2970 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4323    0.3839    0.8192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3458    0.8335    2.1524 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6232   -0.3683   -0.7038 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4261    0.1251   -1.3890 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8370    0.3354   -0.7408 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030    3.0175   -1.9302 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2156    3.8368   -1.8290 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4985    4.7686   -1.6594 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1729    3.4646   -1.0639 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6881    1.5362    0.7996 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3953    0.5995    0.6295 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6821   -1.7572    1.2304 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2166   -3.6290    1.9322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6181   -3.2918   -0.5464 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9508   -3.8594    2.6935 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2077   -5.2561    2.1675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7266   -6.0356    1.7108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8851   -6.2355   -0.2523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7791   -3.3769    1.5986 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7682   -5.4878    1.3756 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0568   -2.4787   -0.4549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4533   -3.0748   -2.2341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0668   -1.3120   -1.2523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0673    0.4606   -0.8040 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7694    2.2809   -1.0191 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2581    4.2257    1.3147 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5994    4.5734   -0.3985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7424    3.8633   -1.0620 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5460    3.1841    1.3181 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7157    3.4754   -0.9089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1754    1.6296    0.3816 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4232    0.3250   -1.5403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9542   -0.5877    0.7541 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5443    0.4806    2.5977 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6305    0.8834   -1.9061 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 17 40  1  0
 40 41  1  0
 40 42  2  0
 42  2  1  0
 11  5  1  0
 42 13  1  0
 27 18  1  0
 38 29  1  0
  3 43  1  0
  6 44  1  0
  7 45  1  0
  9 46  1  0
 10 47  1  0
 11 48  1  0
 14 49  1  0
 16 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 41 72  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Meloside a	HMDB
Isovitexin 2''-O-beta-glucoside	MeSH
Isovitexin 2''-O-glucoside	MeSH

Chemical Formula

C₂₇H₃₀O₁₅

Average Molecular Weight

594.5181

Monoisotopic Molecular Weight

594.15847029

IUPAC Name

6-[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

Traditional Name

6-[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

CAS Registry Number

60767-80-8

SMILES

OCC1OC(OC2C(O)C(O)C(CO)OC2C2=C(O)C=C3OC(=CC(=O)C3=C2O)C2=CC=C(O)C=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O15/c28-7-15-20(34)23(37)26(42-27-24(38)22(36)19(33)16(8-29)41-27)25(40-15)18-12(32)6-14-17(21(18)35)11(31)5-13(39-14)9-1-3-10(30)4-2-9/h1-6,15-16,19-20,22-30,32-38H,7-8H2

InChI Key

RQTTXGQDIROLTQ-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as coumarins and derivatives. These are polycyclic aromatic compounds containing a 1-benzopyran moiety with a ketone group at the C2 carbon atom (1-benzopyran-2-one).

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Coumarins and derivatives

Sub Class

Not Available

Direct Parent

Coumarins and derivatives

Alternative Parents

Substituents

Coumarin
Benzopyran
1-benzopyran
Alkyl aryl ether
Pyranone
Pyran
Benzenoid
Cyclic alcohol
Heteroaromatic compound
Lactone
Secondary alcohol
Oxacycle
Ether
Organoheterocyclic compound
Organic oxygen compound
Organooxygen compound
Alcohol
Hydrocarbon derivative
Organic oxide
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0029484)
Cytoplasm (HMDB: HMDB0029484)

Source

Exogenous

Exogenous (HMDB: HMDB0029484)

Food

Cereal and cereal product

Cereal product

Breakfast cereal (FooDB: FOOD00270)

Cereal

Rye (FooDB: FOOD00169)

Cereals and cereal products (FooDB: FOOD00858)

Process

Not Available

Role

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	6.26 g/L	ALOGPS
logP	-0.67	ALOGPS
logP	-1.8	ChemAxon
logS	-2	ALOGPS
pKa (Strongest Acidic)	6.2	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	256.29 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	138.45 m³·mol⁻¹	ChemAxon
Polarizability	57.7 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	227.341	30932474
DeepCCS	[M-H]-	224.977	30932474
DeepCCS	[M-2H]-	258.217	30932474
DeepCCS	[M+Na]+	233.254	30932474
AllCCS	[M+H]+	233.7	32859911
AllCCS	[M+H-H2O]+	232.2	32859911
AllCCS	[M+NH4]+	235.0	32859911
AllCCS	[M+Na]+	235.3	32859911
AllCCS	[M-H]-	231.8	32859911
AllCCS	[M+Na-2H]-	234.3	32859911
AllCCS	[M+HCOO]-	237.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Isovitexin 2''-O-glucoside	OCC1OC(OC2C(O)C(O)C(CO)OC2C2=C(O)C=C3OC(=CC(=O)C3=C2O)C2=CC=C(O)C=C2)C(O)C(O)C1O	5799.1	Standard polar	33892256
Isovitexin 2''-O-glucoside	OCC1OC(OC2C(O)C(O)C(CO)OC2C2=C(O)C=C3OC(=CC(=O)C3=C2O)C2=CC=C(O)C=C2)C(O)C(O)C1O	5232.2	Standard non polar	33892256
Isovitexin 2''-O-glucoside	OCC1OC(OC2C(O)C(O)C(CO)OC2C2=C(O)C=C3OC(=CC(=O)C3=C2O)C2=CC=C(O)C=C2)C(O)C(O)C1O	5822.9	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Isovitexin 2''-O-glucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5561.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O	5610.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #2	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1OC1OC(CO)C(O)C(O)C1O	5620.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #3	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O	5603.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5569.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #5	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5598.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #6	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5529.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #7	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5633.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #8	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O	5604.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TMS,isomer #9	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C1O	5604.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5490.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C	5556.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5502.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5526.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5542.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #14	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5489.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #15	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O	5538.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #16	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C1O	5528.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #17	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5537.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5500.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #19	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5515.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5515.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #20	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5529.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #21	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5476.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #22	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O	5521.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #23	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O	5512.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #24	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O	5519.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5495.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5513.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5461.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5494.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5491.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O	5459.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5489.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5526.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5517.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5522.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5504.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #35	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5519.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #36	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5486.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #37	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5468.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #38	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5482.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #39	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5503.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5471.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5540.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5519.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5532.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O	5513.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #44	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C	5535.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C	5534.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5493.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5509.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5490.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5497.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5500.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5404.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5406.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #100	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5401.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5416.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #102	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5413.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5380.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5409.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #105	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5382.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #106	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5344.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #107	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5376.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #108	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5418.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #109	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5414.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5408.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #110	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5422.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #111	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5359.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #112	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5351.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5387.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #114	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5356.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #115	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5351.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5380.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #117	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5435.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5431.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5440.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5418.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #120	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5451.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5422.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5402.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5431.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5318.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5328.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5331.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5343.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O	5354.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5324.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5353.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5372.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5366.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5367.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5366.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5381.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5424.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5389.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5388.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5372.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5401.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5403.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5397.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5411.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5401.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5400.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5411.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5427.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5440.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5463.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5387.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #40	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5378.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #41	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5454.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #42	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5444.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #43	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5453.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5387.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5411.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5319.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5390.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5381.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5386.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5390.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5400.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5366.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5409.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5384.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5411.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #55	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5369.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5427.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5402.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5430.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #59	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5362.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5399.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #60	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5328.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #61	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5358.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #62	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5424.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #63	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5440.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #64	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	5443.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #65	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5402.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #66	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5420.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #67	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5336.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5397.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5388.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5384.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5389.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5399.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #72	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5365.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #73	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5408.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5383.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5407.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5369.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5418.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5395.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5419.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5408.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #80	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5360.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #81	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5327.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #82	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5350.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #83	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5411.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #84	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O	5428.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #85	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5429.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #86	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5403.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #87	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5353.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #88	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5394.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #89	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5370.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O	5364.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #90	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5390.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #91	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5358.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #92	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5412.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #93	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5391.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #94	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5413.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #95	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5338.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #96	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5307.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #97	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5328.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #98	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5399.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,3TMS,isomer #99	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5384.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O	5247.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5177.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #100	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5216.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #101	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5166.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #102	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5204.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #103	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5284.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #104	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5284.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #105	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C	5293.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #106	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5249.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #107	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5188.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #108	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5224.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #109	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5184.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5203.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #110	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5211.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #111	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5202.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #112	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5262.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #113	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5226.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #114	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5261.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #115	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5180.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #116	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5132.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #117	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5160.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #118	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5227.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #119	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5235.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5174.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #120	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5233.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5230.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5277.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5236.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5268.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5203.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #126	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5149.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #127	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5190.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #128	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5235.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #129	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5232.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5228.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #130	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5244.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #131	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5217.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #132	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5167.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #133	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5209.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #134	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5279.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #135	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5280.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #136	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5288.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #137	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5169.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #138	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5176.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #139	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5172.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5216.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #140	C[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5293.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #141	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5265.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #142	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5203.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #143	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5239.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #144	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5197.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #145	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5221.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #146	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5216.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #147	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5275.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #148	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5237.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #149	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5269.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5202.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #150	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5193.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #151	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5145.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #152	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5167.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #153	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5233.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #154	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5231.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #155	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5231.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #156	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5232.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #157	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5278.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #158	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5234.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #159	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5266.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5212.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #160	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5204.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #161	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5147.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #162	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5183.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #163	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5231.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #164	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5231.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #165	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5233.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #166	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5220.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #167	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5166.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #168	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5206.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #169	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5272.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5188.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #170	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5274.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #171	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5275.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #172	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5168.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #173	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5168.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #174	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5164.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #175	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5272.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #176	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5246.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #177	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5275.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #178	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5232.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #179	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5265.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5238.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #180	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5215.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #181	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5155.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #182	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5193.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #183	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5224.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #184	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5218.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #185	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5221.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #186	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5229.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #187	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5174.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #188	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5215.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #189	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5266.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5242.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #190	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5263.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #191	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5266.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #192	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5169.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #193	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5166.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #194	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5158.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #195	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5251.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #196	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5265.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #197	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5207.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #198	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5251.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #199	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5282.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5252.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5211.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #200	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5287.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5283.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #202	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5204.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #203	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5208.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #204	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5196.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #205	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5277.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #206	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5202.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #207	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5220.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #208	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5229.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #209	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5217.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5183.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #210	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5316.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5235.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5221.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5190.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5238.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5231.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5242.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5241.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5211.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5247.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5200.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5201.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5227.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5189.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5243.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5256.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5244.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5256.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5226.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5276.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5247.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5292.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5259.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5230.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5275.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5273.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5237.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5282.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5266.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5279.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5274.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5272.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5171.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5159.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5160.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5141.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5191.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5188.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5158.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5134.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5189.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5167.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5242.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5136.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5190.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5176.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5200.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5195.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5257.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5215.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5198.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5239.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5219.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5286.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5192.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #71	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5235.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #72	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5218.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #73	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5230.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #74	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5231.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5270.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5239.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5283.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5228.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5240.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5194.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5241.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5243.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5256.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5249.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5281.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #85	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5269.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #86	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5306.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #87	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5221.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #88	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5281.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #89	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5248.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5173.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #90	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5270.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #91	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5296.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5220.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5276.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5239.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5272.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5237.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5316.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #98	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5281.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5320.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5754.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O	5846.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1OC1OC(CO)C(O)C(O)C1O	5841.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O	5830.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5756.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5781.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5757.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5810.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O	5835.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C1O	5834.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O[Si](C)(C)C(C)(C)C)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5877.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C	5958.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5894.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5902.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5939.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5882.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5942.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5921.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	5916.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5896.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5899.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C(C)(C)C)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O	5913.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5929.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5878.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5932.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O	5909.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5906.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5873.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5905.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5856.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5893.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5873.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O	5860.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5869.3	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5930.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5913.5	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5912.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5889.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5883.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5889.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5869.9	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5861.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5906.8	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5871.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5946.6	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5921.2	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5916.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5910.1	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5924.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5930.4	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5891.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5900.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5877.7	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5893.0	Semi standard non polar	33892256
Isovitexin 2''-O-glucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5898.4	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0gz9-2222290000-c8628161d4a353e32399	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (1 TMS) - 70eV, Positive	splash10-05aj-7363029000-9ebb805d79934f59f56f	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS ("Isovitexin 2''-O-glucoside,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-glucoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 10V, Positive-QTOF	splash10-00o1-0100980000-b6771bc1dfe1dda9123c	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 20V, Positive-QTOF	splash10-0159-0100910000-ccf230927fb687910496	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 40V, Positive-QTOF	splash10-00kb-2497500000-c1d327fffcdaeadb9ffc	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 10V, Positive-QTOF	splash10-00o1-0100980000-b6771bc1dfe1dda9123c	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 20V, Positive-QTOF	splash10-0159-0100910000-ccf230927fb687910496	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 40V, Positive-QTOF	splash10-00kb-2497500000-c1d327fffcdaeadb9ffc	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 10V, Negative-QTOF	splash10-002f-1210590000-edc3e04ca7b495450e91	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 20V, Negative-QTOF	splash10-03gl-2514930000-31e4e0ba5a50bc5a7203	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 40V, Negative-QTOF	splash10-03gl-6926300000-69f49a65bfccb6e5fad7	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 10V, Negative-QTOF	splash10-002f-1210590000-edc3e04ca7b495450e91	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 20V, Negative-QTOF	splash10-03gl-2514930000-31e4e0ba5a50bc5a7203	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 40V, Negative-QTOF	splash10-03gl-6926300000-69f49a65bfccb6e5fad7	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 10V, Negative-QTOF	splash10-0006-0000090000-c2b3948e01c1f6089ea8	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 20V, Negative-QTOF	splash10-0006-0000090000-888637a47809c9cf248e	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 40V, Negative-QTOF	splash10-0a6r-0900530000-39fd5e23f8dd6ec78743	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 10V, Positive-QTOF	splash10-0002-0000090000-54e89fd530db4e77b6eb	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 20V, Positive-QTOF	splash10-0002-0000090000-54e89fd530db4e77b6eb	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-glucoside 40V, Positive-QTOF	splash10-004j-0400980000-c6c96f609f5462c4a2b2	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB000615

KNApSAcK ID

C00006219

Chemspider ID

286921

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

323971

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Isovitexin 2''-O-glucoside (HMDB0029484)

MOL for HMDB0029484 (Isovitexin 2''-O-glucoside)

3D MOL for HMDB0029484 (Isovitexin 2''-O-glucoside)

3D SDF for HMDB0029484 (Isovitexin 2''-O-glucoside)

3D-SDF for HMDB0029484 (Isovitexin 2''-O-glucoside)

PDB for HMDB0029484 (Isovitexin 2''-O-glucoside)

3D PDB for HMDB0029484 (Isovitexin 2''-O-glucoside)

SMILES for HMDB0029484 (Isovitexin 2''-O-glucoside)

INCHI for HMDB0029484 (Isovitexin 2''-O-glucoside)

Structure for HMDB0029484 (Isovitexin 2''-O-glucoside)

3D Structure for HMDB0029484 (Isovitexin 2''-O-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra