Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 17:30:52 UTC |
---|
Update Date | 2022-03-07 02:52:11 UTC |
---|
HMDB ID | HMDB0029511 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Garcinone C |
---|
Description | Garcinone C belongs to the class of organic compounds known as 8-prenylated xanthones. These are organic compounds containing a C5-isoprenoid group linked to a xanthone moiety at the 8-position. Xanthone is a tricyclic compound made up of two benzene rings linearly fused to each other through a pyran ring that carries a ketone group. Garcinone C has been detected, but not quantified in, fruits and purple mangosteens (Garcinia mangostana). This could make garcinone C a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Garcinone C. |
---|
Structure | CC(C)=CCC1=C(O)C2=C(OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C2=O)C=C1O InChI=1S/C23H26O7/c1-11(2)5-6-12-14(24)9-17-19(21(12)27)22(28)18-13(7-8-23(3,4)29)20(26)15(25)10-16(18)30-17/h5,9-10,24-27,29H,6-8H2,1-4H3 |
---|
Synonyms | Value | Source |
---|
Garcinone C | MeSH |
|
---|
Chemical Formula | C23H26O7 |
---|
Average Molecular Weight | 414.4483 |
---|
Monoisotopic Molecular Weight | 414.167853186 |
---|
IUPAC Name | 1,3,6,7-tetrahydroxy-8-(3-hydroxy-3-methylbutyl)-2-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
---|
Traditional Name | 1,3,6,7-tetrahydroxy-8-(3-hydroxy-3-methylbutyl)-2-(3-methylbut-2-en-1-yl)xanthen-9-one |
---|
CAS Registry Number | 76996-27-5 |
---|
SMILES | CC(C)=CCC1=C(O)C2=C(OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C2=O)C=C1O |
---|
InChI Identifier | InChI=1S/C23H26O7/c1-11(2)5-6-12-14(24)9-17-19(21(12)27)22(28)18-13(7-8-23(3,4)29)20(26)15(25)10-16(18)30-17/h5,9-10,24-27,29H,6-8H2,1-4H3 |
---|
InChI Key | HLOCLVMUASBDDP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as 8-prenylated xanthones. These are organic compounds containing a C5-isoprenoid group linked to a xanthone moiety at the 8-position. Xanthone is a tricyclic compound made up of two benzene rings linearly fused to each other through a pyran ring that carries a ketone group. |
---|
Kingdom | Organic compounds |
---|
Super Class | Organoheterocyclic compounds |
---|
Class | Benzopyrans |
---|
Sub Class | 1-benzopyrans |
---|
Direct Parent | 8-prenylated xanthones |
---|
Alternative Parents | |
---|
Substituents | - 2-prenylated xanthone
- 8-prenylated xanthone
- Chromone
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Pyranone
- Pyran
- Benzenoid
- Tertiary alcohol
- Heteroaromatic compound
- Vinylogous acid
- Polyol
- Oxacycle
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Organooxygen compound
- Organic oxygen compound
- Aromatic heteropolycyclic compound
|
---|
Molecular Framework | Aromatic heteropolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | 216 - 218 °C | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | 0.018 mg/L @ 25 °C (est) | The Good Scents Company Information System | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | | Show more...
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Garcinone C,1TMS,isomer #1 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3434.7 | Semi standard non polar | 33892256 | Garcinone C,1TMS,isomer #2 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3503.2 | Semi standard non polar | 33892256 | Garcinone C,1TMS,isomer #3 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3449.7 | Semi standard non polar | 33892256 | Garcinone C,1TMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3653.7 | Semi standard non polar | 33892256 | Garcinone C,1TMS,isomer #5 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3485.8 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3358.0 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #10 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3517.6 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #2 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3349.2 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #3 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3315.2 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3471.1 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #5 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3401.5 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #6 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3397.1 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #7 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3537.3 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #8 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3359.9 | Semi standard non polar | 33892256 | Garcinone C,2TMS,isomer #9 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3492.0 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3341.5 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #10 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3434.2 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #2 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3291.7 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #3 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3398.2 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3287.4 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #5 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3411.8 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #6 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3378.8 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #7 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3326.7 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #8 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3471.4 | Semi standard non polar | 33892256 | Garcinone C,3TMS,isomer #9 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3471.6 | Semi standard non polar | 33892256 | Garcinone C,4TMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C | 3316.0 | Semi standard non polar | 33892256 | Garcinone C,4TMS,isomer #2 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3476.1 | Semi standard non polar | 33892256 | Garcinone C,4TMS,isomer #3 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3444.6 | Semi standard non polar | 33892256 | Garcinone C,4TMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3391.5 | Semi standard non polar | 33892256 | Garcinone C,4TMS,isomer #5 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O | 3425.2 | Semi standard non polar | 33892256 | Garcinone C,5TMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C)C=C2OC3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(CCC(C)(C)O[Si](C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C | 3466.9 | Semi standard non polar | 33892256 | Garcinone C,1TBDMS,isomer #1 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3692.0 | Semi standard non polar | 33892256 | Garcinone C,1TBDMS,isomer #2 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3741.4 | Semi standard non polar | 33892256 | Garcinone C,1TBDMS,isomer #3 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3695.2 | Semi standard non polar | 33892256 | Garcinone C,1TBDMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 3904.7 | Semi standard non polar | 33892256 | Garcinone C,1TBDMS,isomer #5 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3718.7 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3838.8 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #10 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 3990.1 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #2 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3838.3 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #3 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3806.3 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3963.5 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #5 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3885.0 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #6 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3899.0 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #7 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 4019.9 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #8 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 3856.5 | Semi standard non polar | 33892256 | Garcinone C,2TBDMS,isomer #9 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 3990.9 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4010.8 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #10 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 4127.5 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #2 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3952.9 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #3 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4092.4 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 3934.5 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #5 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4094.7 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #6 | CC(C)=CCC1=C(O)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4055.9 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #7 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O | 4015.0 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #8 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 4160.1 | Semi standard non polar | 33892256 | Garcinone C,3TBDMS,isomer #9 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 4169.4 | Semi standard non polar | 33892256 | Garcinone C,4TBDMS,isomer #1 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4098.2 | Semi standard non polar | 33892256 | Garcinone C,4TBDMS,isomer #2 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4320.8 | Semi standard non polar | 33892256 | Garcinone C,4TBDMS,isomer #3 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4256.4 | Semi standard non polar | 33892256 | Garcinone C,4TBDMS,isomer #4 | CC(C)=CCC1=C(O)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O[Si](C)(C)C(C)(C)C | 4194.7 | Semi standard non polar | 33892256 | Garcinone C,4TBDMS,isomer #5 | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)C=C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)=C3C(=O)C2=C1O | 4285.4 | Semi standard non polar | 33892256 |
| Show more...
---|