Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:32:25 UTC

Update Date

2022-03-07 02:52:16 UTC

HMDB ID

HMDB0029754

Secondary Accession Numbers

HMDB29754

Metabolite Identification

Common Name

Procyanidin B1

Description

Procyanidin B1, also known as ec-(4b,8)-C or endotelon, belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. Thus, procyanidin B1 is considered to be a flavonoid. Procyanidin B1 is found, on average, in the highest concentration within a few different foods, such as cocoa powder, peach (var.), and nectarines (Prunus persica var. nucipersica) and in a lower concentration in green tea, apples (Malus pumila), and rubus (blackberry, raspberry). Procyanidin B1 has also been detected, but not quantified in, several different foods, such as chickpeas (Cicer arietinum), red bell peppers (Capsicum annuum), garden tomato (var.), redcurrants (Ribes rubrum), and kiwis (Actinidia chinensis). This could make procyanidin B1 a potential biomarker for the consumption of these foods. Procyanidin B1 is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. Based on a literature review a significant number of articles have been published on Procyanidin B1.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

Procyanidin dimer B1
  Mrv1572001071617282D          

 42 47  0  0  1  0            999 V2000
    1.1608   -2.4631    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.8752   -2.8756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4463   -2.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682   -2.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826   -2.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826   -3.7006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6971   -2.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6971   -1.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116   -1.2256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826   -1.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682   -1.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4463   -1.2256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608   -1.6381    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.8752   -1.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8752   -0.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897    0.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -0.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0187    0.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -1.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0187   -1.6381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897   -1.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826    0.0635    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.6971    0.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116    0.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1261    0.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1261    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8405    1.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116    1.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6971    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826    1.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682    1.3010    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4463    1.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4463    2.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608    2.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8752    2.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897    2.9510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8752    1.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897    1.3010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682    0.4760    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4463    0.0635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116   -0.7615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1  0  0  0
  1  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  5  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  8 10  1  0  0  0  0
 10 11  2  0  0  0  0
  4 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
  1 13  1  0  0  0  0
 13 14  1  6  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
 16 17  2  0  0  0  0
 17 18  1  0  0  0  0
 17 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 21  2  0  0  0  0
 14 21  1  0  0  0  0
 22 10  1  1  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  1  0  0  0  0
 26 28  1  0  0  0  0
 28 29  2  0  0  0  0
 23 29  1  0  0  0  0
 29 30  1  0  0  0  0
 31 30  1  0  0  0  0
 31 32  1  6  0  0  0
 32 33  2  0  0  0  0
 33 34  1  0  0  0  0
 34 35  2  0  0  0  0
 35 36  1  0  0  0  0
 35 37  1  0  0  0  0
 37 38  1  0  0  0  0
 37 39  2  0  0  0  0
 32 39  1  0  0  0  0
 40 31  1  0  0  0  0
 40 22  1  0  0  0  0
 40 41  1  6  0  0  0
 24 42  1  0  0  0  0
M  END

HMDB0029754
     RDKit          3D
Procyanidin B1
 68 73  0  0  0  0  0  0  0  0999 V2000
   -5.4896   -2.8254   -1.9876 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3592   -2.4250   -1.2895 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0819   -2.5957   -1.7758 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9887   -2.1801   -1.0427 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6996   -2.3706   -1.5710 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1399   -1.5796    0.2025 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4126   -1.4019    0.7027 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5117   -1.8319   -0.0592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6148   -0.8080    1.9404 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5595   -0.1269    2.5563 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.5531    1.3221    2.2600 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7688    1.8333    0.9987 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7595    3.1953    0.7228 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5293    4.0810    1.7265 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5049    5.4684    1.5238 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3091    3.5925    3.0058 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0678    4.4643    4.0718 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3211    2.2343    3.2672 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2193   -0.7774    2.3758 C   0  0  2  0  0  0  0  0  0  0  0  0
   -0.2621    0.1672    2.8196 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9146   -1.1424    0.9612 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.1921   -2.1090    0.8349 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1046   -3.3561    1.3808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0496   -3.7107    2.0554 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1116   -4.2977    1.2992 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2737   -3.9229    0.6123 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2543   -4.8987    0.5577 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3908   -2.6671    0.0490 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -1.7512    0.1626 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4641   -0.4856   -0.4080 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7893   -0.0775   -0.7154 C   0  0  2  0  0  0  0  0  0  0  0  0
    2.8466    1.2413   -1.3500 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7893    2.1658   -0.9246 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8858    3.4217   -1.4889 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0481    3.8099   -2.5002 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500    5.0889   -3.0714 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0993    2.9084   -2.9435 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2449    3.2813   -3.9629 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0180    1.6605   -2.3687 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -1.1715   -1.5930 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.5021   -0.7609   -2.2656 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6547   -2.3556   -0.6630 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4732   -3.2625   -2.8840 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9663   -3.0680   -2.7547 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5898   -2.8061   -2.4740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4803   -1.6629    0.3910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7732   -0.2089    3.6697 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9578    1.1893    0.1593 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9362    3.5641   -0.2988 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6541    5.8876    0.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0587    5.4573    3.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1395    1.9141    4.3025 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1243   -1.6244    3.0939 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1207    0.7761    2.0475 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6102   -0.1962    0.4216 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2273   -4.5871    2.4925 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0169   -5.2855    1.7433 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1228   -4.7069    0.0850 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3809   -0.0671    0.2208 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4838    1.9278   -0.1302 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6380    4.1486   -1.1439 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8639    5.7006   -2.7030 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2973    4.1927   -4.3895 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2745    0.9308   -2.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5547   -1.5013   -2.2666 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6529    0.2111   -2.2261 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -3.2130   -1.2601 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3834   -2.0172    0.1102 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  2  0
 31 40  1  0
 40 41  1  0
 40 42  1  0
  8  2  1  0
 18 11  1  0
 29 22  1  0
 39 32  1  0
 21  6  1  0
 42 28  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  1
 12 48  1  0
 13 49  1  0
 15 50  1  0
 17 51  1  0
 18 52  1  0
 19 53  1  1
 20 54  1  0
 21 55  1  6
 24 56  1  0
 25 57  1  0
 27 58  1  0
 31 59  1  1
 33 60  1  0
 34 61  1  0
 36 62  1  0
 38 63  1  0
 39 64  1  0
 40 65  1  6
 41 66  1  0
 42 67  1  0
 42 68  1  0
M  END

Procyanidin dimer B1
  Mrv1572001071617282D          

 42 47  0  0  1  0            999 V2000
    1.1608   -2.4631    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.8752   -2.8756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4463   -2.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682   -2.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826   -2.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826   -3.7006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6971   -2.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6971   -1.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116   -1.2256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826   -1.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682   -1.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4463   -1.2256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608   -1.6381    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.8752   -1.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8752   -0.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897    0.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -0.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0187    0.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -1.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0187   -1.6381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897   -1.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826    0.0635    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -1.6971    0.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116    0.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1261    0.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1261    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8405    1.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116    1.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6971    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9826    1.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682    1.3010    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4463    1.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4463    2.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608    2.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8752    2.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897    2.9510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8752    1.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897    1.3010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1608    1.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2682    0.4760    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.4463    0.0635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4116   -0.7615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1  0  0  0
  1  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  5  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  8 10  1  0  0  0  0
 10 11  2  0  0  0  0
  4 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
  1 13  1  0  0  0  0
 13 14  1  6  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
 16 17  2  0  0  0  0
 17 18  1  0  0  0  0
 17 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 21  2  0  0  0  0
 14 21  1  0  0  0  0
 22 10  1  1  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  1  0  0  0  0
 26 28  1  0  0  0  0
 28 29  2  0  0  0  0
 23 29  1  0  0  0  0
 29 30  1  0  0  0  0
 31 30  1  0  0  0  0
 31 32  1  6  0  0  0
 32 33  2  0  0  0  0
 33 34  1  0  0  0  0
 34 35  2  0  0  0  0
 35 36  1  0  0  0  0
 35 37  1  0  0  0  0
 37 38  1  0  0  0  0
 37 39  2  0  0  0  0
 32 39  1  0  0  0  0
 40 31  1  0  0  0  0
 40 22  1  0  0  0  0
 40 41  1  6  0  0  0
 24 42  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0029754

> <DATABASE_NAME>
hmdb

> <SMILES>
O[C@H]1CC2=C(O)C=C(O)C([C@@H]3[C@@H](O)[C@H](OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2O[C@@H]1C1=CC=C(O)C(O)=C1

> <INCHI_IDENTIFIER>
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m0/s1

> <INCHI_KEY>
XFZJEEAOWLFHDH-UKWJTHFESA-N

> <FORMULA>
C30H26O12

> <MOLECULAR_WEIGHT>
578.526

> <EXACT_MASS>
578.142426277

> <JCHEM_ACCEPTOR_COUNT>
12

> <JCHEM_ATOM_COUNT>
68

> <JCHEM_AVERAGE_POLARIZABILITY>
57.121978140681996

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <ALOGPS_LOGP>
2.29

> <JCHEM_LOGP>
3.1157450136666665

> <ALOGPS_LOGS>
-3.62

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
6

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.12686840566425

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.693248815093794

> <JCHEM_PKA_STRONGEST_BASIC>
-5.176560370760915

> <JCHEM_POLAR_SURFACE_AREA>
220.75999999999996

> <JCHEM_REFRACTIVITY>
146.50799999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
3

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.38e-01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
procyanidin B1

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0029754
     RDKit          3D
Procyanidin B1
 68 73  0  0  0  0  0  0  0  0999 V2000
   -5.4896   -2.8254   -1.9876 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3592   -2.4250   -1.2895 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0819   -2.5957   -1.7758 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9887   -2.1801   -1.0427 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6996   -2.3706   -1.5710 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1399   -1.5796    0.2025 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4126   -1.4019    0.7027 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5117   -1.8319   -0.0592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6148   -0.8080    1.9404 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5595   -0.1269    2.5563 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.5531    1.3221    2.2600 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7688    1.8333    0.9987 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7595    3.1953    0.7228 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5293    4.0810    1.7265 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5049    5.4684    1.5238 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3091    3.5925    3.0058 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0678    4.4643    4.0718 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3211    2.2343    3.2672 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2193   -0.7774    2.3758 C   0  0  2  0  0  0  0  0  0  0  0  0
   -0.2621    0.1672    2.8196 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9146   -1.1424    0.9612 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.1921   -2.1090    0.8349 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1046   -3.3561    1.3808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0496   -3.7107    2.0554 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1116   -4.2977    1.2992 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2737   -3.9229    0.6123 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2543   -4.8987    0.5577 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3908   -2.6671    0.0490 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -1.7512    0.1626 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4641   -0.4856   -0.4080 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7893   -0.0775   -0.7154 C   0  0  2  0  0  0  0  0  0  0  0  0
    2.8466    1.2413   -1.3500 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7893    2.1658   -0.9246 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8858    3.4217   -1.4889 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0481    3.8099   -2.5002 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500    5.0889   -3.0714 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0993    2.9084   -2.9435 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2449    3.2813   -3.9629 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0180    1.6605   -2.3687 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -1.1715   -1.5930 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.5021   -0.7609   -2.2656 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6547   -2.3556   -0.6630 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4732   -3.2625   -2.8840 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9663   -3.0680   -2.7547 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5898   -2.8061   -2.4740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4803   -1.6629    0.3910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7732   -0.2089    3.6697 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9578    1.1893    0.1593 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9362    3.5641   -0.2988 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6541    5.8876    0.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0587    5.4573    3.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1395    1.9141    4.3025 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1243   -1.6244    3.0939 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1207    0.7761    2.0475 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6102   -0.1962    0.4216 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2273   -4.5871    2.4925 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0169   -5.2855    1.7433 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1228   -4.7069    0.0850 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3809   -0.0671    0.2208 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4838    1.9278   -0.1302 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6380    4.1486   -1.1439 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8639    5.7006   -2.7030 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2973    4.1927   -4.3895 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2745    0.9308   -2.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5547   -1.5013   -2.2666 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6529    0.2111   -2.2261 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -3.2130   -1.2601 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3834   -2.0172    0.1102 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  2  0
 31 40  1  0
 40 41  1  0
 40 42  1  0
  8  2  1  0
 18 11  1  0
 29 22  1  0
 39 32  1  0
 21  6  1  0
 42 28  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  1
 12 48  1  0
 13 49  1  0
 15 50  1  0
 17 51  1  0
 18 52  1  0
 19 53  1  1
 20 54  1  0
 21 55  1  6
 24 56  1  0
 25 57  1  0
 27 58  1  0
 31 59  1  1
 33 60  1  0
 34 61  1  0
 36 62  1  0
 38 63  1  0
 39 64  1  0
 40 65  1  6
 41 66  1  0
 42 67  1  0
 42 68  1  0
M  END

HEADER    PROTEIN                                 07-JAN-16   NONE
TITLE     NULL                                                        
COMPND    MOLECULE: Procyanidin dimer B1                              
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   07-JAN-16         0                                  
HETATM    1  C   UNK     0       2.167  -4.598   0.000  0.00  0.00           C+0
HETATM    2  O   UNK     0       3.500  -5.368   0.000  0.00  0.00           O+0
HETATM    3  C   UNK     0       0.833  -5.368   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -0.501  -4.598   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.834  -5.368   0.000  0.00  0.00           C+0
HETATM    6  O   UNK     0      -1.834  -6.908   0.000  0.00  0.00           O+0
HETATM    7  C   UNK     0      -3.168  -4.598   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -3.168  -3.058   0.000  0.00  0.00           C+0
HETATM    9  O   UNK     0      -4.502  -2.288   0.000  0.00  0.00           O+0
HETATM   10  C   UNK     0      -1.834  -2.288   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -0.501  -3.058   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0       0.833  -2.288   0.000  0.00  0.00           O+0
HETATM   13  C   UNK     0       2.167  -3.058   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       3.500  -2.288   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       3.500  -0.748   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.834   0.022   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       6.168  -0.748   0.000  0.00  0.00           C+0
HETATM   18  O   UNK     0       7.502   0.022   0.000  0.00  0.00           O+0
HETATM   19  C   UNK     0       6.168  -2.288   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0       7.502  -3.058   0.000  0.00  0.00           O+0
HETATM   21  C   UNK     0       4.834  -3.058   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      -1.834   0.119   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -3.168   0.889   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      -4.502   0.119   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      -5.835   0.889   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -5.835   2.429   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0      -7.169   3.199   0.000  0.00  0.00           O+0
HETATM   28  C   UNK     0      -4.502   3.199   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      -3.168   2.429   0.000  0.00  0.00           C+0
HETATM   30  O   UNK     0      -1.834   3.199   0.000  0.00  0.00           O+0
HETATM   31  C   UNK     0      -0.501   2.429   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0       0.833   3.199   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0       0.833   4.739   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0       2.167   5.509   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0       3.500   4.739   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0       4.834   5.509   0.000  0.00  0.00           O+0
HETATM   37  C   UNK     0       3.500   3.199   0.000  0.00  0.00           C+0
HETATM   38  O   UNK     0       4.834   2.429   0.000  0.00  0.00           O+0
HETATM   39  C   UNK     0       2.167   2.429   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0      -0.501   0.889   0.000  0.00  0.00           C+0
HETATM   41  O   UNK     0       0.833   0.119   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0      -4.502  -1.421   0.000  0.00  0.00           O+0
CONECT    1    2    3   13                                                  
CONECT    2    1                                                            
CONECT    3    1    4                                                       
CONECT    4    3    5   11                                                  
CONECT    5    4    6    7                                                  
CONECT    6    5                                                            
CONECT    7    5    8                                                       
CONECT    8    7    9   10                                                  
CONECT    9    8                                                            
CONECT   10    8   11   22                                                  
CONECT   11   10    4   12                                                  
CONECT   12   11   13                                                       
CONECT   13   12    1   14                                                  
CONECT   14   13   15   21                                                  
CONECT   15   14   16                                                       
CONECT   16   15   17                                                       
CONECT   17   16   18   19                                                  
CONECT   18   17                                                            
CONECT   19   17   20   21                                                  
CONECT   20   19                                                            
CONECT   21   19   14                                                       
CONECT   22   10   23   40                                                  
CONECT   23   22   24   29                                                  
CONECT   24   23   25   42                                                  
CONECT   25   24   26                                                       
CONECT   26   25   27   28                                                  
CONECT   27   26                                                            
CONECT   28   26   29                                                       
CONECT   29   28   23   30                                                  
CONECT   30   29   31                                                       
CONECT   31   30   32   40                                                  
CONECT   32   31   33   39                                                  
CONECT   33   32   34                                                       
CONECT   34   33   35                                                       
CONECT   35   34   36   37                                                  
CONECT   36   35                                                            
CONECT   37   35   38   39                                                  
CONECT   38   37                                                            
CONECT   39   37   32                                                       
CONECT   40   31   22   41                                                  
CONECT   41   40                                                            
CONECT   42   24                                                            
MASTER        0    0    0    0    0    0    0    0   42    0   94    0
END

COMPND    HMDB0029754
HETATM    1  O1  UNL     1      -5.490  -2.825  -1.988  1.00  0.00           O  
HETATM    2  C1  UNL     1      -4.359  -2.425  -1.290  1.00  0.00           C  
HETATM    3  C2  UNL     1      -3.082  -2.596  -1.776  1.00  0.00           C  
HETATM    4  C3  UNL     1      -1.989  -2.180  -1.043  1.00  0.00           C  
HETATM    5  O2  UNL     1      -0.700  -2.371  -1.571  1.00  0.00           O  
HETATM    6  C4  UNL     1      -2.140  -1.580   0.202  1.00  0.00           C  
HETATM    7  C5  UNL     1      -3.413  -1.402   0.703  1.00  0.00           C  
HETATM    8  C6  UNL     1      -4.512  -1.832  -0.059  1.00  0.00           C  
HETATM    9  O3  UNL     1      -3.615  -0.808   1.940  1.00  0.00           O  
HETATM   10  C7  UNL     1      -2.560  -0.127   2.556  1.00  0.00           C  
HETATM   11  C8  UNL     1      -2.553   1.322   2.260  1.00  0.00           C  
HETATM   12  C9  UNL     1      -2.769   1.833   0.999  1.00  0.00           C  
HETATM   13  C10 UNL     1      -2.759   3.195   0.723  1.00  0.00           C  
HETATM   14  C11 UNL     1      -2.529   4.081   1.727  1.00  0.00           C  
HETATM   15  O4  UNL     1      -2.505   5.468   1.524  1.00  0.00           O  
HETATM   16  C12 UNL     1      -2.309   3.593   3.006  1.00  0.00           C  
HETATM   17  O5  UNL     1      -2.068   4.464   4.072  1.00  0.00           O  
HETATM   18  C13 UNL     1      -2.321   2.234   3.267  1.00  0.00           C  
HETATM   19  C14 UNL     1      -1.219  -0.777   2.376  1.00  0.00           C  
HETATM   20  O6  UNL     1      -0.262   0.167   2.820  1.00  0.00           O  
HETATM   21  C15 UNL     1      -0.915  -1.142   0.961  1.00  0.00           C  
HETATM   22  C16 UNL     1       0.192  -2.109   0.835  1.00  0.00           C  
HETATM   23  C17 UNL     1       0.105  -3.356   1.381  1.00  0.00           C  
HETATM   24  O7  UNL     1      -1.050  -3.711   2.055  1.00  0.00           O  
HETATM   25  C18 UNL     1       1.112  -4.298   1.299  1.00  0.00           C  
HETATM   26  C19 UNL     1       2.274  -3.923   0.612  1.00  0.00           C  
HETATM   27  O8  UNL     1       3.254  -4.899   0.558  1.00  0.00           O  
HETATM   28  C20 UNL     1       2.391  -2.667   0.049  1.00  0.00           C  
HETATM   29  C21 UNL     1       1.338  -1.751   0.163  1.00  0.00           C  
HETATM   30  O9  UNL     1       1.464  -0.486  -0.408  1.00  0.00           O  
HETATM   31  C22 UNL     1       2.789  -0.077  -0.715  1.00  0.00           C  
HETATM   32  C23 UNL     1       2.847   1.241  -1.350  1.00  0.00           C  
HETATM   33  C24 UNL     1       3.789   2.166  -0.925  1.00  0.00           C  
HETATM   34  C25 UNL     1       3.886   3.422  -1.489  1.00  0.00           C  
HETATM   35  C26 UNL     1       3.048   3.810  -2.500  1.00  0.00           C  
HETATM   36  O10 UNL     1       3.150   5.089  -3.071  1.00  0.00           O  
HETATM   37  C27 UNL     1       2.099   2.908  -2.943  1.00  0.00           C  
HETATM   38  O11 UNL     1       1.245   3.281  -3.963  1.00  0.00           O  
HETATM   39  C28 UNL     1       2.018   1.661  -2.369  1.00  0.00           C  
HETATM   40  C29 UNL     1       3.361  -1.171  -1.593  1.00  0.00           C  
HETATM   41  O12 UNL     1       4.502  -0.761  -2.266  1.00  0.00           O  
HETATM   42  C30 UNL     1       3.655  -2.356  -0.663  1.00  0.00           C  
HETATM   43  H1  UNL     1      -5.473  -3.263  -2.884  1.00  0.00           H  
HETATM   44  H2  UNL     1      -2.966  -3.068  -2.755  1.00  0.00           H  
HETATM   45  H3  UNL     1      -0.590  -2.806  -2.474  1.00  0.00           H  
HETATM   46  H4  UNL     1      -5.480  -1.663   0.391  1.00  0.00           H  
HETATM   47  H5  UNL     1      -2.773  -0.209   3.670  1.00  0.00           H  
HETATM   48  H6  UNL     1      -2.958   1.189   0.159  1.00  0.00           H  
HETATM   49  H7  UNL     1      -2.936   3.564  -0.299  1.00  0.00           H  
HETATM   50  H8  UNL     1      -2.654   5.888   0.636  1.00  0.00           H  
HETATM   51  H9  UNL     1      -2.059   5.457   3.883  1.00  0.00           H  
HETATM   52  H10 UNL     1      -2.140   1.914   4.302  1.00  0.00           H  
HETATM   53  H11 UNL     1      -1.124  -1.624   3.094  1.00  0.00           H  
HETATM   54  H12 UNL     1      -0.121   0.776   2.048  1.00  0.00           H  
HETATM   55  H13 UNL     1      -0.610  -0.196   0.422  1.00  0.00           H  
HETATM   56  H14 UNL     1      -1.227  -4.587   2.493  1.00  0.00           H  
HETATM   57  H15 UNL     1       1.017  -5.285   1.743  1.00  0.00           H  
HETATM   58  H16 UNL     1       4.123  -4.707   0.085  1.00  0.00           H  
HETATM   59  H17 UNL     1       3.381  -0.067   0.221  1.00  0.00           H  
HETATM   60  H18 UNL     1       4.484   1.928  -0.130  1.00  0.00           H  
HETATM   61  H19 UNL     1       4.638   4.149  -1.144  1.00  0.00           H  
HETATM   62  H20 UNL     1       3.864   5.701  -2.703  1.00  0.00           H  
HETATM   63  H21 UNL     1       1.297   4.193  -4.389  1.00  0.00           H  
HETATM   64  H22 UNL     1       1.275   0.931  -2.704  1.00  0.00           H  
HETATM   65  H23 UNL     1       2.555  -1.501  -2.267  1.00  0.00           H  
HETATM   66  H24 UNL     1       4.653   0.211  -2.226  1.00  0.00           H  
HETATM   67  H25 UNL     1       4.042  -3.213  -1.260  1.00  0.00           H  
HETATM   68  H26 UNL     1       4.383  -2.017   0.110  1.00  0.00           H  
CONECT    1    2   43
CONECT    2    3    3    8
CONECT    3    4   44
CONECT    4    5    6    6
CONECT    5   45
CONECT    6    7   21
CONECT    7    8    8    9
CONECT    8   46
CONECT    9   10
CONECT   10   11   19   47
CONECT   11   12   12   18
CONECT   12   13   48
CONECT   13   14   14   49
CONECT   14   15   16
CONECT   15   50
CONECT   16   17   18   18
CONECT   17   51
CONECT   18   52
CONECT   19   20   21   53
CONECT   20   54
CONECT   21   22   55
CONECT   22   23   23   29
CONECT   23   24   25
CONECT   24   56
CONECT   25   26   26   57
CONECT   26   27   28
CONECT   27   58
CONECT   28   29   29   42
CONECT   29   30
CONECT   30   31
CONECT   31   32   40   59
CONECT   32   33   33   39
CONECT   33   34   60
CONECT   34   35   35   61
CONECT   35   36   37
CONECT   36   62
CONECT   37   38   39   39
CONECT   38   63
CONECT   39   64
CONECT   40   41   42   65
CONECT   41   66
CONECT   42   67   68
END

HMDB0029754
     RDKit          3D
Procyanidin B1
 68 73  0  0  0  0  0  0  0  0999 V2000
   -5.4896   -2.8254   -1.9876 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3592   -2.4250   -1.2895 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0819   -2.5957   -1.7758 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9887   -2.1801   -1.0427 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6996   -2.3706   -1.5710 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1399   -1.5796    0.2025 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4126   -1.4019    0.7027 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5117   -1.8319   -0.0592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6148   -0.8080    1.9404 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5595   -0.1269    2.5563 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.5531    1.3221    2.2600 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7688    1.8333    0.9987 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7595    3.1953    0.7228 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5293    4.0810    1.7265 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5049    5.4684    1.5238 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3091    3.5925    3.0058 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0678    4.4643    4.0718 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3211    2.2343    3.2672 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2193   -0.7774    2.3758 C   0  0  2  0  0  0  0  0  0  0  0  0
   -0.2621    0.1672    2.8196 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9146   -1.1424    0.9612 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.1921   -2.1090    0.8349 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1046   -3.3561    1.3808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0496   -3.7107    2.0554 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1116   -4.2977    1.2992 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2737   -3.9229    0.6123 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2543   -4.8987    0.5577 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3908   -2.6671    0.0490 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -1.7512    0.1626 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4641   -0.4856   -0.4080 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7893   -0.0775   -0.7154 C   0  0  2  0  0  0  0  0  0  0  0  0
    2.8466    1.2413   -1.3500 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7893    2.1658   -0.9246 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8858    3.4217   -1.4889 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0481    3.8099   -2.5002 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500    5.0889   -3.0714 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0993    2.9084   -2.9435 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2449    3.2813   -3.9629 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0180    1.6605   -2.3687 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -1.1715   -1.5930 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.5021   -0.7609   -2.2656 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6547   -2.3556   -0.6630 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4732   -3.2625   -2.8840 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9663   -3.0680   -2.7547 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5898   -2.8061   -2.4740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4803   -1.6629    0.3910 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7732   -0.2089    3.6697 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9578    1.1893    0.1593 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9362    3.5641   -0.2988 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6541    5.8876    0.6356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0587    5.4573    3.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1395    1.9141    4.3025 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1243   -1.6244    3.0939 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1207    0.7761    2.0475 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6102   -0.1962    0.4216 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2273   -4.5871    2.4925 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0169   -5.2855    1.7433 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1228   -4.7069    0.0850 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3809   -0.0671    0.2208 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4838    1.9278   -0.1302 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6380    4.1486   -1.1439 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8639    5.7006   -2.7030 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2973    4.1927   -4.3895 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2745    0.9308   -2.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5547   -1.5013   -2.2666 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6529    0.2111   -2.2261 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -3.2130   -1.2601 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3834   -2.0172    0.1102 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  2  0
 31 40  1  0
 40 41  1  0
 40 42  1  0
  8  2  1  0
 18 11  1  0
 29 22  1  0
 39 32  1  0
 21  6  1  0
 42 28  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  1
 12 48  1  0
 13 49  1  0
 15 50  1  0
 17 51  1  0
 18 52  1  0
 19 53  1  1
 20 54  1  0
 21 55  1  6
 24 56  1  0
 25 57  1  0
 27 58  1  0
 31 59  1  1
 33 60  1  0
 34 61  1  0
 36 62  1  0
 38 63  1  0
 39 64  1  0
 40 65  1  6
 41 66  1  0
 42 67  1  0
 42 68  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
EC-(4b,8)-C	ChEBI
Endotelon	ChEBI
Epicatechin(4beta->8)catechin	ChEBI
Epicatechin-(4beta->8)-ent-epicatechin	ChEBI
Proanthocyanidin b1	ChEBI
Procyanidin dimer b1	ChEBI
Epicatechin(4b->8)catechin	Generator
Epicatechin(4β->8)catechin	Generator
Epicatechin-(4b->8)-ent-epicatechin	Generator
Epicatechin-(4β->8)-ent-epicatechin	Generator
Procyanidin b	HMDB
Procyanidin D	HMDB
Procyanidol D	HMDB
Procyanidol oligomer	HMDB

Chemical Formula

C₃₀H₂₆O₁₂

Average Molecular Weight

578.526

Monoisotopic Molecular Weight

578.142426277

IUPAC Name

(2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

Traditional Name

procyanidin B1

CAS Registry Number

20315-25-7

SMILES

O[C@H]1CC2=C(O)C=C(O)C([C@@H]3[C@@H](O)[C@H](OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2O[C@@H]1C1=CC=C(O)C(O)=C1

InChI Identifier

InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m0/s1

InChI Key

XFZJEEAOWLFHDH-UKWJTHFESA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Biflavonoids and polyflavonoids

Direct Parent

Biflavonoids and polyflavonoids

Alternative Parents

Substituents

B-type proanthocyanidin
Bi- and polyflavonoid skeleton
Proanthocyanidin
Catechin
Flavan-3-ol
Hydroxyflavonoid
3'-hydroxyflavonoid
7-hydroxyflavonoid
5-hydroxyflavonoid
4'-hydroxyflavonoid
3-hydroxyflavonoid
Flavan
Chromane
1-benzopyran
Benzopyran
Catechol
Phenol
1-hydroxy-2-unsubstituted benzenoid
Alkyl aryl ether
1-hydroxy-4-unsubstituted benzenoid
Benzenoid
Monocyclic benzene moiety
Secondary alcohol
Polyol
Organoheterocyclic compound
Oxacycle
Ether
Hydrocarbon derivative
Alcohol
Organic oxygen compound
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

polyphenol (CHEBI:75633 )
proanthocyanidin (CHEBI:75633 )
biflavonoid (CHEBI:75633 )
hydroxyflavan (CHEBI:75633 )
Proanthocyanidins (LMPK12030001 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0029754)
Cytoplasm (HMDB: HMDB0029754)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0029754)

Source

Endogenous

Endogenous (HMDB: HMDB0029754)

Plant

Exogenous

Food

Food (HMDB: HMDB0029754)

Bilberry (FooDB: FOOD00193)
Rubus (Blackberry, Raspberry) (FooDB: FOOD00160)
Redcurrant (FooDB: FOOD00156)
Lingonberry (FooDB: FOOD00194)
Strawberry (FooDB: FOOD00083)
Common grape (FooDB: FOOD00204)
Fox grape (FooDB: FOOD00228)

Other fruit

Fig (FooDB: FOOD00081)

Vegetable

Fruit vegetable

Eggplant (FooDB: FOOD00174)
Avocado (FooDB: FOOD00130)
Pepper (FooDB: FOOD00040)
Green bell pepper (FooDB: FOOD00877)
Red bell pepper (FooDB: FOOD00880)
Italian sweet red pepper (FooDB: FOOD00881)
Garden tomato (var.) (FooDB: FOOD00173)

Leaf vegetable

Lettuce (FooDB: FOOD00095)

Root vegetable

Carrot (FooDB: FOOD00245)

Pulse

Bean

Lentil

Lentils (FooDB: FOOD00098)

Pea

Chickpea (FooDB: FOOD00047)
Common pea (FooDB: FOOD00141)

Nut

Chestnut (FooDB: FOOD00045)
Common hazelnut (FooDB: FOOD00062)

Herb and spice

Spice

Cocoa and cocoa product

Cocoa product

Cocoa powder (FooDB: FOOD00685)
Other cocoa product (FooDB: FOOD00683)

Cocoa

Cocoa bean (FooDB: FOOD00182)

Beverage

Other beverage

Fruit juice (FooDB: FOOD00763)

Fortified wines

Sherry (FooDB: FOOD00632)

Fermented beverage

Grape wine (FooDB: FOOD00612)
Apple cider (FooDB: FOOD00615)

Alcoholic beverage

Alcoholic beverages (FooDB: FOOD00854)

Gourd

Tea

Tea (FooDB: FOOD00038)
Black tea (FooDB: FOOD00907)
Green tea (FooDB: FOOD00908)

Cereal and cereal product

Cereal

Common wheat (FooDB: FOOD00187)

Not Available

EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (HMDB: HMDB0029754)
angiotensin converting enzyme inhibitor (HMDB: HMDB0029754)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	231 - 232 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.14 g/L	ALOGPS
logP	2.29	ALOGPS
logP	3.12	ChemAxon
logS	-3.6	ALOGPS
pKa (Strongest Acidic)	8.69	ChemAxon
pKa (Strongest Basic)	-5.2	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	12	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	220.76 Å²	ChemAxon
Rotatable Bond Count	3	ChemAxon
Refractivity	146.51 m³·mol⁻¹	ChemAxon
Polarizability	57.12 Å³	ChemAxon
Number of Rings	6	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M-2H]-	269.693	30932474
DeepCCS	[M+Na]+	243.559	30932474
AllCCS	[M+H]+	236.8	32859911
AllCCS	[M+H-H2O]+	235.2	32859911
AllCCS	[M+NH4]+	238.3	32859911
AllCCS	[M+Na]+	238.7	32859911
AllCCS	[M-H]-	231.3	32859911
AllCCS	[M+Na-2H]-	232.9	32859911
AllCCS	[M+HCOO]-	234.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Procyanidin B1	O[C@H]1CC2=C(O)C=C(O)C([C@@H]3[C@@H](O)[C@H](OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	7510.3	Standard polar	33892256
Procyanidin B1	O[C@H]1CC2=C(O)C=C(O)C([C@@H]3[C@@H](O)[C@H](OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	5312.8	Standard non polar	33892256
Procyanidin B1	O[C@H]1CC2=C(O)C=C(O)C([C@@H]3[C@@H](O)[C@H](OC4=CC(O)=CC(O)=C34)C3=CC=C(O)C(O)=C3)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	5869.1	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Procyanidin B1,1TMS,isomer #1	C[Si](C)(C)O[C@H]1CC2=C(O)C=C(O)C([C@H]3C4=C(O)C=C(O)C=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@@H]3O)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	5654.7	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #10	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5645.8	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5601.9	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O	5611.2	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #4	C[Si](C)(C)O[C@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2[C@@H]1C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5631.5	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5680.4	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5643.8	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #7	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5670.1	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #8	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5656.8	Semi standard non polar	33892256
Procyanidin B1,1TMS,isomer #9	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5671.5	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #1	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5482.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #10	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5422.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5468.4	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #12	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5457.4	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5456.2	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #14	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5432.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5430.6	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #16	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5458.8	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #17	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5427.1	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5493.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #19	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5494.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O	5501.7	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5481.0	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #21	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5465.6	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O[Si](C)(C)C	5468.0	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #23	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5483.2	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #24	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5458.6	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #25	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5475.5	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #26	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5463.1	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #27	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5497.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #28	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5502.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #29	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5472.0	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5530.1	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #30	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5452.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5486.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5483.5	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5472.0	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #34	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5483.0	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #35	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5460.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5503.8	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #37	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5476.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #38	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5499.8	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #39	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5481.8	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #4	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5521.7	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #40	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5489.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #41	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5461.5	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #42	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5447.8	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #43	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5473.1	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #44	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5441.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #45	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5443.5	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #5	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5505.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #6	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5494.6	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #7	C[Si](C)(C)O[C@H]1CC2=C(O)C=C(O)C([C@H]3C4=C(O)C=C(O)C=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@@H]3O[Si](C)(C)C)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	5516.9	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #8	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5514.3	Semi standard non polar	33892256
Procyanidin B1,2TMS,isomer #9	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5498.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #1	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5318.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #10	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5356.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #100	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5270.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #101	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5295.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #102	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5284.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #103	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5293.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #104	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5294.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #105	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5295.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #106	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5211.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #107	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5205.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #108	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5216.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #109	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5203.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #11	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5329.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #110	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5287.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #111	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5275.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #112	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5273.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #113	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5341.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #114	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5256.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #115	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5255.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #116	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5341.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #117	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5256.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #118	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5239.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #119	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5244.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #12	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5316.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #120	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5238.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #13	C[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O[Si](C)(C)C	5358.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #14	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5337.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #15	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5326.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5349.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #17	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5347.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #18	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5335.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #19	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5376.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5340.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5337.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #21	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5325.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5289.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #23	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5288.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #24	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5345.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #25	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5291.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #26	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5288.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #27	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5248.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #28	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5242.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #29	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)C=C1O	5300.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5309.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #30	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O[Si](C)(C)C	5300.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #31	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5248.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #32	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5244.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #33	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5302.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #34	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5304.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #35	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5297.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #36	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5309.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #37	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5345.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5301.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #39	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5265.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #4	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5274.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #40	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5256.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #41	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5283.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #42	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5271.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #43	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5252.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5312.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #45	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5292.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #46	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5287.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #47	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5309.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #48	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5300.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #49	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5284.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #5	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5269.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #50	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5228.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5230.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #52	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5267.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #53	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5228.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #54	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5219.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #55	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5188.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5174.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #57	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5228.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #58	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5266.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #59	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5192.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5307.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #60	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5176.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #61	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5228.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #62	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5232.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #63	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5218.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #64	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5264.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #65	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5362.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #66	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5350.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #67	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5325.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5357.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #69	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5341.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #7	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5284.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #70	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5327.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #71	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5294.3	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #72	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5284.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #73	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5331.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #74	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5295.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #75	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5274.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5260.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #77	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5237.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5301.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #79	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5322.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #8	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5277.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #80	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5252.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #81	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5231.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #82	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5293.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #83	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5305.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #84	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5281.7	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #85	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5323.0	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #86	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5249.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #87	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5311.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #88	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5203.4	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #89	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5191.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #9	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5372.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #90	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5281.5	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #91	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5249.8	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #92	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5307.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #93	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5205.9	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #94	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5188.2	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #95	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5327.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #96	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5253.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #97	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5240.6	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #98	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5318.1	Semi standard non polar	33892256
Procyanidin B1,3TMS,isomer #99	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5295.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #1	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5243.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #10	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5173.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #100	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5015.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #101	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5000.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #102	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5113.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #103	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5119.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #104	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5106.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5163.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #106	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5113.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #107	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5105.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #108	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5186.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #109	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5113.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5229.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #110	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5115.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #111	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5051.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #112	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5032.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #113	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5145.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #114	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5196.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #115	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5044.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #116	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5030.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #117	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5143.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #118	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5149.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #119	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5138.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #12	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5186.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #120	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5194.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #121	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5132.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #122	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5068.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #123	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5003.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #124	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	4991.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #125	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5069.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #126	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	4994.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #127	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	4980.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #128	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5068.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #129	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5059.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #13	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5184.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #130	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5119.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #131	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5054.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #132	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	4962.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #133	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5039.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #134	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	4952.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #135	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5041.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #136	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5128.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #137	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	4968.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #138	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5032.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #139	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	4952.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #14	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5109.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #140	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5122.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #141	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5181.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #142	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5172.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #143	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5234.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #144	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5184.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #145	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5180.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #146	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5130.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #147	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5122.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #148	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5205.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #149	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5236.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5108.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #150	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5110.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #151	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5106.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #152	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5190.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #153	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5198.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #154	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5196.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #155	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5239.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #156	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5193.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #157	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5145.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #158	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5044.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #159	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5032.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5190.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #160	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5145.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #161	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5036.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #162	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5021.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #163	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5149.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #164	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5137.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #165	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5184.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #166	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5122.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #167	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5040.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #168	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5106.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #169	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5031.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5107.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #170	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5109.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #171	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5182.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #172	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5044.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #173	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5099.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #174	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5027.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #175	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5177.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #176	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5149.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #177	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5157.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #178	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	4990.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #179	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	4985.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5109.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #180	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5074.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #181	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5066.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #182	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5212.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #183	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5064.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #184	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5052.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #185	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5057.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #186	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5150.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #187	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	4997.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #188	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	4984.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #189	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5082.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #19	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5022.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #190	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5065.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #191	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5056.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #192	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5154.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #193	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5145.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #194	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5151.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #195	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5206.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #196	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5194.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #197	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5051.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #198	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5051.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #199	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5044.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5208.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5021.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #200	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5040.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #201	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5201.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #202	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5079.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #203	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5070.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #204	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5070.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #205	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5068.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #206	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5156.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #207	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5139.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #208	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5134.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #209	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5143.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #21	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)C=C1O	5122.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #210	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5128.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #22	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O[Si](C)(C)C	5160.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #23	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5019.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #24	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5016.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #25	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5132.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #26	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5127.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #27	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5131.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #28	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5172.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #29	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5258.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #3	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5155.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #30	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5234.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #31	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5229.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O[Si](C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5271.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #33	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5230.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #34	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5218.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #35	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5177.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #36	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5169.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5236.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5175.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5171.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #4	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5148.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #40	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5092.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #41	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5086.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #42	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)C=C1O	5175.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #43	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O[Si](C)(C)C	5213.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #44	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5086.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #45	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5079.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #46	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5180.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #47	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5182.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #48	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5180.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #49	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5224.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #5	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5211.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5176.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5174.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5235.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5177.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5176.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #55	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5117.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #56	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5114.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #57	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5200.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #58	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C	5249.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #59	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5112.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #6	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5158.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #60	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5107.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #61	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5201.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #62	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)C=C1O	5194.0	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #63	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)=CC=C1O	5200.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #64	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O[Si](C)(C)C	5236.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #65	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5185.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #66	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5136.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #67	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5035.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5040.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5145.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #7	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5154.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5034.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #71	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5032.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #72	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O[Si](C)(C)C)C2	5140.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #73	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5144.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #74	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)[C@@H](O[Si](C)(C)C)C2	5186.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #75	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)C=C1O	5106.4	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #76	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5032.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #77	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5103.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #78	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)C=C1O	5036.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #79	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H]2O)=CC=C1O	5106.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5214.8	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #80	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5178.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #81	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)C=C1O	5038.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #82	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)=CC=C1O	5101.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #83	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H]2O[Si](C)(C)C)=CC=C1O	5039.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #84	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5181.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #85	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@H](C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5208.7	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #86	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5174.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #87	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5170.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #88	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C([C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5208.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #89	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5179.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #9	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C)C4)[C@H]2O)C=C1O	5181.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #90	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O[Si](C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5169.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #91	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5098.6	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #92	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5101.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #93	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5177.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #94	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C)C(O)=C1)[C@@H](O)C2	5096.3	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #95	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C)=C1)[C@@H](O)C2	5090.5	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #96	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5019.9	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #97	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5004.2	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #98	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C)C=C1O	5113.1	Semi standard non polar	33892256
Procyanidin B1,4TMS,isomer #99	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C	5163.3	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)O[C@H]1CC2=C(O)C=C(O)C([C@H]3C4=C(O)C=C(O)C=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@@H]3O)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	5862.2	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5889.0	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5839.5	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O	5856.3	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2[C@@H]1C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5860.0	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5871.2	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5885.9	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5904.3	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5894.5	Semi standard non polar	33892256
Procyanidin B1,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5910.1	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5965.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5925.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5970.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O[Si](C)(C)C(C)(C)C)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5921.6	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5926.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5909.2	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(O)=C([C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C(C)(C)C)C2=C1C[C@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5915.7	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5931.8	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O[Si](C)(C)C(C)(C)C)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5909.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O[Si](C)(C)C(C)(C)C)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	6006.8	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O[Si](C)(C)C(C)(C)C)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5972.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O	5988.5	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5976.7	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5962.1	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C[C@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1[C@H]1C2=C(O)C=C(O)C=C2O[C@H](C2=CC=C(O)C(O)=C2)[C@@H]1O[Si](C)(C)C(C)(C)C	5956.9	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	5983.7	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O[Si](C)(C)C(C)(C)C)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5961.5	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O	5954.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O	5942.5	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5968.9	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O2	5995.9	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C(C)(C)C)C=C1O	5951.9	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C(C)(C)C)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	6015.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O	5934.2	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1)[C@H](C1=C(O)C=C(O)C3=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C3)[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O2	5983.5	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5963.2	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O)C2	5950.2	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)[C@@H](O)C2	5963.2	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)[C@@H](O)C2	5943.9	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	6013.0	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5990.5	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	6004.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)=CC=C1O	5992.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@H](C1=CC=C(O)C(O)=C1)[C@H](O)[C@H]2C1=C(O)C=C(O)C2=C1O[C@H](C1=CC=C(O)C(O)=C1)[C@@H](O[Si](C)(C)C(C)(C)C)C2	5987.7	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)[C@@H]2O)C=C1O	5978.5	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)[C@@H](O)C4)[C@H]2O)C=C1O	5945.3	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O)C4)[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C	5970.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)[C@@H]2O)C=C1O	5960.8	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)[C@@H]2O)=CC=C1O	5930.3	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O[Si](C)(C)C(C)(C)C	5969.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C(C)(C)C)C4)[C@H]2O)C=C1O	5992.6	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O)=C3[C@H](C3=C(O)C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H](O[Si](C)(C)C(C)(C)C)C4)[C@H]2O)=CC=C1O	5983.9	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)O[C@H]1CC2=C(O)C=C(O)C([C@H]3C4=C(O)C=C(O)C=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@@H]3O[Si](C)(C)C(C)(C)C)=C2O[C@@H]1C1=CC=C(O)C(O)=C1	5970.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)C=C1O	6000.4	Semi standard non polar	33892256
Procyanidin B1,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@@H]2O[Si](C)(C)C(C)(C)C)C(O)=CC(O)=C3[C@H]2C3=C(O)C=C(O)C=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@@H]2O)=CC=C1O	5987.4	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (Non-derivatized) - 70eV, Positive	splash10-03mj-0510690000-115aeaaab9de9537434c	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (1 TMS) - 70eV, Positive	splash10-00dr-2301229000-34e0d16a3e8eb63a692a	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS ("Procyanidin B1,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Procyanidin B1 GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 40V, Negative-QTOF	splash10-052r-0390200000-9f1e13b0bba9785308a3	2017-08-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF , Negative-QTOF	splash10-004i-0100090000-6fdf4ab81dd423c4334d	2017-08-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 10V, Negative-QTOF	splash10-004i-0000190000-136d2e8bbb6419a5dcb7	2017-08-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 30V, Negative-QTOF	splash10-052r-0191600000-fe7651fd7e7097baa30a	2017-08-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 20V, Negative-QTOF	splash10-004i-0050960000-456238d05a29305098bb	2017-08-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 50V, Negative-QTOF	splash10-0551-0690000000-0de917967e41c73de31b	2017-08-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 40V, Negative-QTOF	splash10-052r-0390200000-9f1e13b0bba9785308a3	2017-09-12	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF , Negative-QTOF	splash10-004i-0100090000-6fdf4ab81dd423c4334d	2017-09-12	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 10V, Negative-QTOF	splash10-004i-0000190000-136d2e8bbb6419a5dcb7	2017-09-12	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 30V, Negative-QTOF	splash10-052r-0191600000-fe7651fd7e7097baa30a	2017-09-12	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 20V, Negative-QTOF	splash10-004i-0050960000-456238d05a29305098bb	2017-09-12	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 ESI-TOF 50V, Negative-QTOF	splash10-0551-0690000000-0de917967e41c73de31b	2017-09-12	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 LC-ESI-QTOF , negative-QTOF	splash10-004r-0960640000-4a8afc17f0a82219e1c6	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 LC-ESI-QTOF , positive-QTOF	splash10-004i-0910120000-904b693b4080a3b311f0	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 6V, Positive-QTOF	splash10-004i-0020690000-f8b67d5f019fb672880b	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 6V, Positive-QTOF	splash10-0570-0891300000-4b7ae7a8937f478478a9	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 6V, Positive-QTOF	splash10-004i-0940000000-d82f8b13868ad872d04b	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 6V, Positive-QTOF	splash10-01t9-0930000000-e22414604be4795a3b5b	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Procyanidin B1 6V, Positive-QTOF	splash10-0570-0591730000-e2fd4fa16cc5af16e65a	2021-09-20	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Procyanidin B1 10V, Positive-QTOF	splash10-004i-0110980000-5100aeb456b72604bfbe	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Procyanidin B1 20V, Positive-QTOF	splash10-0a4i-0334920000-f9222e1bae7f0bca6417	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Procyanidin B1 40V, Positive-QTOF	splash10-0076-0491110000-c8af712677eef1677727	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Procyanidin B1 10V, Negative-QTOF	splash10-004i-0000290000-ae7911e8a6b7e2e8867e	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Procyanidin B1 20V, Negative-QTOF	splash10-0kbr-0920440000-53d4ef58d673c17bbbb2	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Procyanidin B1 40V, Negative-QTOF	splash10-004i-0910000000-851c43689a6c620aa704	2016-08-03	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

FooDB ID

KNApSAcK ID

Chemspider ID

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Procyanidin_B1

METLIN ID

Not Available

PubChem Compound

11250133

PDB ID

Not Available

ChEBI ID

75633

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Procyanidin B1 (HMDB0029754)

MOL for HMDB0029754 (Procyanidin B1)

3D MOL for HMDB0029754 (Procyanidin B1)

3D SDF for HMDB0029754 (Procyanidin B1)

3D-SDF for HMDB0029754 (Procyanidin B1)

PDB for HMDB0029754 (Procyanidin B1)

3D PDB for HMDB0029754 (Procyanidin B1)

SMILES for HMDB0029754 (Procyanidin B1)

INCHI for HMDB0029754 (Procyanidin B1)

Structure for HMDB0029754 (Procyanidin B1)

3D Structure for HMDB0029754 (Procyanidin B1)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra