Showing metabocard for Protoisoeruboside B (HMDB0029785)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 17:32:37 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:52:17 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0029785 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Protoisoeruboside B | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Protoisoeruboside B belongs to the class of organic compounds known as steroidal saponins. These are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. Based on a literature review a significant number of articles have been published on Protoisoeruboside B. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0029785 (Protoisoeruboside B)Mrv0541 02241211542D 87 96 0 0 0 0 999 V2000 1.7747 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7747 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7747 -0.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4892 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5766 0.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4892 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2745 -1.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7581 -1.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2745 -0.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7581 0.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5040 0.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0832 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3688 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3456 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3456 -1.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0054 -0.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6688 0.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8487 0.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3652 -0.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5436 -0.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7152 0.7673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1556 1.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9741 1.0346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5436 -0.8662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7977 -3.1846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0832 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3688 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3456 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -4.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4591 1.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2809 1.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7644 2.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4293 3.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6094 3.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1242 2.4569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2743 3.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7578 4.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9146 3.7044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5861 2.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6159 0.8630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5121 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5121 -1.9471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9411 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9411 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9411 -0.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6556 -1.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6556 -3.1846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -4.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4262 -1.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3702 -2.7721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0846 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7991 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7991 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0846 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0846 -4.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7991 -4.4222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8982 -0.4768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5136 -1.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5136 -3.1846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7216 0.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5764 1.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2083 1.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9838 1.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1274 0.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4954 -0.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4425 -2.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -1.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8715 -2.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8715 -2.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -3.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4425 -2.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9030 0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5333 0.7096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6157 1.8035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0664 2.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8024 1.3068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -4.1334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8715 -4.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5861 -3.3084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5861 -1.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -0.8332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 31 1 0 0 0 0 2 3 1 0 0 0 0 2 8 1 0 0 0 0 3 4 1 0 0 0 0 3 16 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 6 8 1 0 0 0 0 6 11 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 26 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 22 1 0 0 0 0 14 15 1 0 0 0 0 14 28 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 16 30 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 19 24 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 22 26 1 0 0 0 0 24 25 1 0 0 0 0 25 33 1 0 0 0 0 27 28 1 0 0 0 0 27 44 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 33 34 1 0 0 0 0 33 38 1 0 0 0 0 34 35 1 0 0 0 0 34 43 1 0 0 0 0 35 36 1 0 0 0 0 35 42 1 0 0 0 0 36 37 1 0 0 0 0 36 41 1 0 0 0 0 37 38 1 0 0 0 0 37 39 1 0 0 0 0 39 40 1 0 0 0 0 44 45 1 0 0 0 0 44 49 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 46 50 1 0 0 0 0 47 48 1 0 0 0 0 47 52 1 0 0 0 0 48 49 1 0 0 0 0 48 53 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 52 55 1 0 0 0 0 55 56 1 0 0 0 0 55 60 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 57 61 1 0 0 0 0 58 59 1 0 0 0 0 58 65 1 0 0 0 0 59 60 1 0 0 0 0 59 64 1 0 0 0 0 60 63 1 0 0 0 0 61 62 1 0 0 0 0 63 66 1 0 0 0 0 64 72 1 0 0 0 0 66 67 1 0 0 0 0 66 71 1 0 0 0 0 67 68 1 0 0 0 0 67 82 1 0 0 0 0 68 69 1 0 0 0 0 68 81 1 0 0 0 0 69 70 1 0 0 0 0 69 80 1 0 0 0 0 70 71 1 0 0 0 0 70 78 1 0 0 0 0 72 73 1 0 0 0 0 72 77 1 0 0 0 0 73 74 1 0 0 0 0 73 87 1 0 0 0 0 74 75 1 0 0 0 0 74 86 1 0 0 0 0 75 76 1 0 0 0 0 75 85 1 0 0 0 0 76 77 1 0 0 0 0 76 83 1 0 0 0 0 78 79 1 0 0 0 0 83 84 1 0 0 0 0 M END 3D MOL for HMDB0029785 (Protoisoeruboside B)HMDB0029785 RDKit 3D Protoisoeruboside B 183192 0 0 0 0 0 0 0 0999 V2000 12.5651 -3.8375 0.3537 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6540 -2.3126 0.1177 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4122 -1.6757 0.7339 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1669 -2.2600 0.0769 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9664 -1.6632 0.7706 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0075 -1.9538 2.1543 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7878 -0.3261 0.6142 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8998 -0.0193 -0.3543 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6375 0.7053 0.1516 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5086 -0.1735 -0.2250 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2816 0.5770 -0.7376 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7571 1.3557 0.4552 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4296 1.9559 0.0762 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8910 2.7624 1.0298 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4800 0.7656 -0.1352 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0933 1.1528 -0.0216 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9333 0.4627 -0.8906 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7944 -0.3606 -0.1330 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0115 0.2637 0.0541 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9678 -0.4181 -0.7346 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2336 0.1954 -0.6219 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1663 1.6845 -0.8415 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6578 1.9763 -2.0829 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8223 -0.1704 0.6699 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9183 -1.0165 0.6570 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8763 -0.6542 1.5698 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0730 -1.7629 2.3863 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4355 -2.8666 1.7052 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1963 -3.8007 2.6553 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4040 -4.2062 3.7291 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3099 -2.6246 0.5401 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4560 -2.7731 -0.5997 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9860 -1.3049 0.3468 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9562 -0.9583 -0.9757 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8413 -0.6083 -1.7985 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0357 -0.9466 -0.7154 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.1708 -0.7390 -1.3994 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.3821 0.7593 -1.6561 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.6161 0.9392 -2.3402 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3804 -1.4345 -2.6927 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.2808 -2.5098 -2.4456 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1845 -1.9043 -3.4484 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8362 -1.0097 -4.4745 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0158 -2.1528 -2.5891 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2956 -3.0146 -1.6140 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2310 -0.2405 1.0838 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9809 0.2698 2.1219 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1924 1.6273 2.0896 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1394 2.2477 2.8743 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0494 3.5824 2.5352 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3454 3.8303 1.2431 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2654 5.1964 0.9433 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3649 4.3055 2.6393 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8828 4.7527 1.4454 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3617 3.4218 3.3254 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.6338 4.0319 3.2934 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5037 2.1562 2.4536 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2870 2.5146 1.3594 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7140 -0.6585 1.6136 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1886 -0.5682 2.9494 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4701 0.1478 1.4710 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4604 -0.4320 2.2560 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3713 -0.2798 -2.0458 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9187 -1.0288 -1.6722 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9310 0.0334 -1.3914 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0095 0.9258 -2.5886 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3008 -0.5364 -1.0942 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7630 -1.4515 -2.1538 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1394 -2.0420 -1.8704 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0457 -0.9837 -1.3595 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2999 -0.0500 -2.5360 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3807 -1.3694 -0.8778 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6678 -2.2623 0.1898 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7781 -2.4368 1.3640 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9165 -1.8037 0.7504 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0742 -0.4536 0.5575 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2448 0.0006 1.1898 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1223 0.4216 0.1987 O 0 0 0 0 0 0 0 0 0 0 0 0 15.4919 1.2498 -0.6811 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5492 1.8001 -1.6239 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9708 2.6420 -2.5435 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6986 2.3317 -0.0380 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3348 2.2533 -0.3343 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8941 2.4511 1.4386 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9247 3.3256 1.7423 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0007 1.1379 2.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1338 1.2002 2.9822 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3479 -4.0706 1.3915 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6042 -4.2082 0.1269 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8907 -4.3222 -0.3661 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6528 -2.1352 -0.9487 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3991 -1.8214 1.8240 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4560 -0.5946 0.5298 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1449 -3.3512 0.0562 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1623 -1.9175 -0.9726 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6450 -2.6797 2.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3420 0.5614 -1.2039 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7164 0.7954 1.2453 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5703 1.7328 -0.2630 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0817 -0.7677 0.6131 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4837 1.2832 -1.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6581 0.6572 1.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4992 2.1289 0.7405 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5806 2.4799 -0.9012 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3657 3.5268 0.7188 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7354 0.0621 0.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2512 0.9201 1.0460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0728 2.2845 -0.0341 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5640 1.3205 -1.2674 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9276 1.3042 -0.3289 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7951 -0.2045 -1.4985 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2544 2.0211 -0.8321 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7009 2.2289 -0.0251 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1397 1.1704 -2.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1735 0.7490 1.2373 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4163 0.1486 2.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5239 -3.4929 1.4137 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5201 -4.7139 2.0769 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1054 -3.3177 3.0309 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4931 -4.4962 3.3899 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0662 -3.4702 0.4541 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0997 -3.6903 -0.6487 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0484 -1.3357 0.7484 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6210 -0.3443 -2.3848 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0404 -0.9897 -0.6947 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6034 1.2171 -2.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4496 1.3401 -0.7346 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2577 1.4556 -1.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9754 -0.7778 -3.3808 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1813 -2.1786 -2.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4977 -2.8890 -3.9238 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6858 -1.5859 -5.2891 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0651 -2.1800 -3.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9995 -3.9344 -1.6965 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0310 0.5937 0.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8854 1.9613 1.0937 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4091 4.0346 3.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8161 3.3665 0.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2850 3.4588 1.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1596 5.3348 -0.0358 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2482 5.2408 3.2780 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7265 4.1157 0.7280 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0789 3.1294 4.3406 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4517 4.9417 3.6994 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1236 1.4772 3.0942 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1991 2.1657 1.4879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5303 -1.7041 1.4008 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2164 0.4014 3.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6600 1.1707 1.8994 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8899 -0.9673 2.9687 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1058 -1.0933 -2.3165 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2076 0.3155 -2.9442 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1157 -1.6849 -2.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7127 -1.5521 -0.7125 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9860 1.3393 -2.8223 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7156 0.3305 -3.5066 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3111 1.7774 -2.5498 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1797 -1.1196 -0.1566 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0761 -2.3248 -2.1689 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7128 -1.0458 -3.1932 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0689 -2.9396 -1.2678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5274 -2.3544 -2.8624 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3191 -0.2110 -2.9056 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6078 -0.2243 -3.3899 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2935 1.0204 -2.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0217 -1.6179 -1.7602 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9391 -3.2838 -0.2118 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3418 -3.1701 2.0368 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7790 -1.5221 2.0291 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8229 -2.9150 1.2266 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9624 -2.0646 1.8397 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7612 -2.3246 0.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7314 -0.8537 1.7317 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7900 0.6685 -1.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2510 2.3784 -0.9811 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1159 0.9756 -2.1411 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6594 2.8597 -3.2376 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0400 3.2978 -0.4998 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1986 1.7118 -1.1596 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9579 2.9428 1.8545 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7268 3.1488 1.2314 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1591 0.9198 2.8424 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8827 0.6187 2.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 33 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 24 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 17 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 73 74 1 0 2 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 79 82 1 0 82 83 1 0 82 84 1 0 84 85 1 0 84 86 1 0 86 87 1 0 73 5 1 0 86 77 1 0 72 8 1 0 70 10 1 0 67 11 1 0 65 15 1 0 61 19 1 0 46 26 1 0 57 48 1 0 44 35 1 0 1 88 1 0 1 89 1 0 1 90 1 0 2 91 1 0 3 92 1 0 3 93 1 0 4 94 1 0 4 95 1 0 6 96 1 0 8 97 1 0 9 98 1 0 9 99 1 0 10100 1 0 11101 1 0 12102 1 0 12103 1 0 13104 1 0 14105 1 0 15106 1 0 16107 1 0 16108 1 0 17109 1 0 19110 1 0 21111 1 0 22112 1 0 22113 1 0 23114 1 0 24115 1 0 26116 1 0 28117 1 0 29118 1 0 29119 1 0 30120 1 0 31121 1 0 32122 1 0 33123 1 0 35124 1 0 37125 1 0 38126 1 0 38127 1 0 39128 1 0 40129 1 0 41130 1 0 42131 1 0 43132 1 0 44133 1 0 45134 1 0 46135 1 0 48136 1 0 50137 1 0 51138 1 0 51139 1 0 52140 1 0 53141 1 0 54142 1 0 55143 1 0 56144 1 0 57145 1 0 58146 1 0 59147 1 0 60148 1 0 61149 1 0 62150 1 0 63151 1 0 63152 1 0 64153 1 0 64154 1 0 66155 1 0 66156 1 0 66157 1 0 67158 1 0 68159 1 0 68160 1 0 69161 1 0 69162 1 0 71163 1 0 71164 1 0 71165 1 0 72166 1 0 73167 1 0 74168 1 0 74169 1 0 74170 1 0 75171 1 0 75172 1 0 77173 1 0 79174 1 0 80175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 86182 1 0 87183 1 0 M END 3D SDF for HMDB0029785 (Protoisoeruboside B)Mrv0541 02241211542D 87 96 0 0 0 0 999 V2000 1.7747 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7747 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7747 -0.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4892 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5766 0.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4892 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2745 -1.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7581 -1.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2745 -0.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7581 0.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5040 0.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0832 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3688 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3456 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3456 -1.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0054 -0.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6688 0.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8487 0.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3652 -0.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5436 -0.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7152 0.7673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1556 1.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9741 1.0346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5436 -0.8662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7977 -3.1846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0832 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3688 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3456 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0602 -4.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4591 1.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2809 1.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7644 2.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4293 3.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6094 3.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1242 2.4569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2743 3.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7578 4.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9146 3.7044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5861 2.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6159 0.8630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5121 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5121 -1.9471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9411 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9411 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9411 -0.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6556 -1.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6556 -3.1846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -4.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4262 -1.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3702 -2.7721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0846 -3.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7991 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7991 -1.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0846 -1.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0846 -4.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7991 -4.4222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8982 -0.4768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5136 -1.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5136 -3.1846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7216 0.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5764 1.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2083 1.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9838 1.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1274 0.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4954 -0.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4425 -2.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -1.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8715 -2.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8715 -2.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -3.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4425 -2.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9030 0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5333 0.7096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6157 1.8035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0664 2.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8024 1.3068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -4.1334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8715 -4.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5861 -3.3084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5861 -1.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1571 -0.8332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 31 1 0 0 0 0 2 3 1 0 0 0 0 2 8 1 0 0 0 0 3 4 1 0 0 0 0 3 16 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 6 8 1 0 0 0 0 6 11 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 26 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 22 1 0 0 0 0 14 15 1 0 0 0 0 14 28 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 16 30 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 19 24 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 22 26 1 0 0 0 0 24 25 1 0 0 0 0 25 33 1 0 0 0 0 27 28 1 0 0 0 0 27 44 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 33 34 1 0 0 0 0 33 38 1 0 0 0 0 34 35 1 0 0 0 0 34 43 1 0 0 0 0 35 36 1 0 0 0 0 35 42 1 0 0 0 0 36 37 1 0 0 0 0 36 41 1 0 0 0 0 37 38 1 0 0 0 0 37 39 1 0 0 0 0 39 40 1 0 0 0 0 44 45 1 0 0 0 0 44 49 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 46 50 1 0 0 0 0 47 48 1 0 0 0 0 47 52 1 0 0 0 0 48 49 1 0 0 0 0 48 53 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 52 55 1 0 0 0 0 55 56 1 0 0 0 0 55 60 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 57 61 1 0 0 0 0 58 59 1 0 0 0 0 58 65 1 0 0 0 0 59 60 1 0 0 0 0 59 64 1 0 0 0 0 60 63 1 0 0 0 0 61 62 1 0 0 0 0 63 66 1 0 0 0 0 64 72 1 0 0 0 0 66 67 1 0 0 0 0 66 71 1 0 0 0 0 67 68 1 0 0 0 0 67 82 1 0 0 0 0 68 69 1 0 0 0 0 68 81 1 0 0 0 0 69 70 1 0 0 0 0 69 80 1 0 0 0 0 70 71 1 0 0 0 0 70 78 1 0 0 0 0 72 73 1 0 0 0 0 72 77 1 0 0 0 0 73 74 1 0 0 0 0 73 87 1 0 0 0 0 74 75 1 0 0 0 0 74 86 1 0 0 0 0 75 76 1 0 0 0 0 75 85 1 0 0 0 0 76 77 1 0 0 0 0 76 83 1 0 0 0 0 78 79 1 0 0 0 0 83 84 1 0 0 0 0 M END > <DATABASE_ID> HMDB0029785 > <DATABASE_NAME> hmdb > <SMILES> CC(CCC1(O)OC2CC3C4CC(O)C5CC(CCC5(C)C4CCC3(C)C2C1C)OC1OC(CO)C(OC2OC(CO)C(O)C(OC3OC(CO)C(O)C(O)C3O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O)COC1OC(CO)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C57H96O30/c1-20(19-77-50-43(72)39(68)35(64)29(14-58)79-50)5-10-57(76)21(2)34-28(87-57)13-25-23-12-27(63)26-11-22(6-8-55(26,3)24(23)7-9-56(25,34)4)78-51-46(75)42(71)47(33(18-62)83-51)84-54-49(86-53-45(74)41(70)37(66)31(16-60)81-53)48(38(67)32(17-61)82-54)85-52-44(73)40(69)36(65)30(15-59)80-52/h20-54,58-76H,5-19H2,1-4H3 > <INCHI_KEY> WYWLHHWQKOHXHW-UHFFFAOYSA-N > <FORMULA> C57H96O30 > <MOLECULAR_WEIGHT> 1261.3541 > <EXACT_MASS> 1260.598641732 > <JCHEM_ACCEPTOR_COUNT> 30 > <JCHEM_AVERAGE_POLARIZABILITY> 130.89167691593937 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 19 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-({2-[(6-{[6,19-dihydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl)oxy]-5-hydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-4-yl}oxy)-6-(hydroxymethyl)oxane-3,4,5-triol > <ALOGPS_LOGP> -1.68 > <JCHEM_LOGP> -5.991761662333332 > <ALOGPS_LOGS> -2.27 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 10 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 11.892971892907308 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.463190839316672 > <JCHEM_PKA_STRONGEST_BASIC> -3.6786216354192804 > <JCHEM_POLAR_SURFACE_AREA> 485.9000000000002 > <JCHEM_REFRACTIVITY> 286.58499999999987 > <JCHEM_ROTATABLE_BOND_COUNT> 19 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 6.82e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-({2-[(6-{[6,19-dihydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl)oxy]-5-hydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-4-yl}oxy)-6-(hydroxymethyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0029785 (Protoisoeruboside B)HMDB0029785 RDKit 3D Protoisoeruboside B 183192 0 0 0 0 0 0 0 0999 V2000 12.5651 -3.8375 0.3537 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6540 -2.3126 0.1177 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4122 -1.6757 0.7339 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1669 -2.2600 0.0769 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9664 -1.6632 0.7706 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0075 -1.9538 2.1543 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7878 -0.3261 0.6142 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8998 -0.0193 -0.3543 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6375 0.7053 0.1516 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5086 -0.1735 -0.2250 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2816 0.5770 -0.7376 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7571 1.3557 0.4552 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4296 1.9559 0.0762 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8910 2.7624 1.0298 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4800 0.7656 -0.1352 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0933 1.1528 -0.0216 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9333 0.4627 -0.8906 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7944 -0.3606 -0.1330 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0115 0.2637 0.0541 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9678 -0.4181 -0.7346 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2336 0.1954 -0.6219 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1663 1.6845 -0.8415 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6578 1.9763 -2.0829 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8223 -0.1704 0.6699 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9183 -1.0165 0.6570 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8763 -0.6542 1.5698 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0730 -1.7629 2.3863 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4355 -2.8666 1.7052 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1963 -3.8007 2.6553 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4040 -4.2062 3.7291 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3099 -2.6246 0.5401 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4560 -2.7731 -0.5997 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9860 -1.3049 0.3468 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9562 -0.9583 -0.9757 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8413 -0.6083 -1.7985 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0357 -0.9466 -0.7154 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.1708 -0.7390 -1.3994 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.3821 0.7593 -1.6561 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.6161 0.9392 -2.3402 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3804 -1.4345 -2.6927 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.2808 -2.5098 -2.4456 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1845 -1.9043 -3.4484 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8362 -1.0097 -4.4745 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0158 -2.1528 -2.5891 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2956 -3.0146 -1.6140 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2310 -0.2405 1.0838 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9809 0.2698 2.1219 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1924 1.6273 2.0896 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1394 2.2477 2.8743 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0494 3.5824 2.5352 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3454 3.8303 1.2431 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2654 5.1964 0.9433 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3649 4.3055 2.6393 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8828 4.7527 1.4454 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3617 3.4218 3.3254 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.6338 4.0319 3.2934 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5037 2.1562 2.4536 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2870 2.5146 1.3594 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7140 -0.6585 1.6136 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1886 -0.5682 2.9494 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4701 0.1478 1.4710 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4604 -0.4320 2.2560 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3713 -0.2798 -2.0458 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9187 -1.0288 -1.6722 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9310 0.0334 -1.3914 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0095 0.9258 -2.5886 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3008 -0.5364 -1.0942 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7630 -1.4515 -2.1538 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1394 -2.0420 -1.8704 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0457 -0.9837 -1.3595 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2999 -0.0500 -2.5360 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3807 -1.3694 -0.8778 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6678 -2.2623 0.1898 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7781 -2.4368 1.3640 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9165 -1.8037 0.7504 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0742 -0.4536 0.5575 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2448 0.0006 1.1898 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1223 0.4216 0.1987 O 0 0 0 0 0 0 0 0 0 0 0 0 15.4919 1.2498 -0.6811 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5492 1.8001 -1.6239 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9708 2.6420 -2.5435 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6986 2.3317 -0.0380 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3348 2.2533 -0.3343 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8941 2.4511 1.4386 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9247 3.3256 1.7423 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0007 1.1379 2.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1338 1.2002 2.9822 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3479 -4.0706 1.3915 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6042 -4.2082 0.1269 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8907 -4.3222 -0.3661 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6528 -2.1352 -0.9487 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3991 -1.8214 1.8240 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4560 -0.5946 0.5298 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1449 -3.3512 0.0562 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1623 -1.9175 -0.9726 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6450 -2.6797 2.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3420 0.5614 -1.2039 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7164 0.7954 1.2453 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5703 1.7328 -0.2630 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0817 -0.7677 0.6131 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4837 1.2832 -1.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6581 0.6572 1.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4992 2.1289 0.7405 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5806 2.4799 -0.9012 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3657 3.5268 0.7188 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7354 0.0621 0.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2512 0.9201 1.0460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0728 2.2845 -0.0341 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5640 1.3205 -1.2674 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9276 1.3042 -0.3289 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7951 -0.2045 -1.4985 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2544 2.0211 -0.8321 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7009 2.2289 -0.0251 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1397 1.1704 -2.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1735 0.7490 1.2373 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4163 0.1486 2.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5239 -3.4929 1.4137 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5201 -4.7139 2.0769 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1054 -3.3177 3.0309 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4931 -4.4962 3.3899 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0662 -3.4702 0.4541 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0997 -3.6903 -0.6487 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0484 -1.3357 0.7484 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6210 -0.3443 -2.3848 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0404 -0.9897 -0.6947 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6034 1.2171 -2.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4496 1.3401 -0.7346 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2577 1.4556 -1.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9754 -0.7778 -3.3808 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1813 -2.1786 -2.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4977 -2.8890 -3.9238 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6858 -1.5859 -5.2891 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0651 -2.1800 -3.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9995 -3.9344 -1.6965 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0310 0.5937 0.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8854 1.9613 1.0937 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4091 4.0346 3.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8161 3.3665 0.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2850 3.4588 1.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1596 5.3348 -0.0358 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2482 5.2408 3.2780 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7265 4.1157 0.7280 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0789 3.1294 4.3406 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4517 4.9417 3.6994 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1236 1.4772 3.0942 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1991 2.1657 1.4879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5303 -1.7041 1.4008 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2164 0.4014 3.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6600 1.1707 1.8994 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8899 -0.9673 2.9687 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1058 -1.0933 -2.3165 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2076 0.3155 -2.9442 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1157 -1.6849 -2.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7127 -1.5521 -0.7125 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9860 1.3393 -2.8223 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7156 0.3305 -3.5066 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3111 1.7774 -2.5498 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1797 -1.1196 -0.1566 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0761 -2.3248 -2.1689 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7128 -1.0458 -3.1932 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0689 -2.9396 -1.2678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5274 -2.3544 -2.8624 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3191 -0.2110 -2.9056 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6078 -0.2243 -3.3899 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2935 1.0204 -2.2271 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0217 -1.6179 -1.7602 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9391 -3.2838 -0.2118 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3418 -3.1701 2.0368 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7790 -1.5221 2.0291 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8229 -2.9150 1.2266 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9624 -2.0646 1.8397 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7612 -2.3246 0.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7314 -0.8537 1.7317 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7900 0.6685 -1.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2510 2.3784 -0.9811 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1159 0.9756 -2.1411 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6594 2.8597 -3.2376 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0400 3.2978 -0.4998 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1986 1.7118 -1.1596 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9579 2.9428 1.8545 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7268 3.1488 1.2314 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1591 0.9198 2.8424 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8827 0.6187 2.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 33 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 24 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 17 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 73 74 1 0 2 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 79 82 1 0 82 83 1 0 82 84 1 0 84 85 1 0 84 86 1 0 86 87 1 0 73 5 1 0 86 77 1 0 72 8 1 0 70 10 1 0 67 11 1 0 65 15 1 0 61 19 1 0 46 26 1 0 57 48 1 0 44 35 1 0 1 88 1 0 1 89 1 0 1 90 1 0 2 91 1 0 3 92 1 0 3 93 1 0 4 94 1 0 4 95 1 0 6 96 1 0 8 97 1 0 9 98 1 0 9 99 1 0 10100 1 0 11101 1 0 12102 1 0 12103 1 0 13104 1 0 14105 1 0 15106 1 0 16107 1 0 16108 1 0 17109 1 0 19110 1 0 21111 1 0 22112 1 0 22113 1 0 23114 1 0 24115 1 0 26116 1 0 28117 1 0 29118 1 0 29119 1 0 30120 1 0 31121 1 0 32122 1 0 33123 1 0 35124 1 0 37125 1 0 38126 1 0 38127 1 0 39128 1 0 40129 1 0 41130 1 0 42131 1 0 43132 1 0 44133 1 0 45134 1 0 46135 1 0 48136 1 0 50137 1 0 51138 1 0 51139 1 0 52140 1 0 53141 1 0 54142 1 0 55143 1 0 56144 1 0 57145 1 0 58146 1 0 59147 1 0 60148 1 0 61149 1 0 62150 1 0 63151 1 0 63152 1 0 64153 1 0 64154 1 0 66155 1 0 66156 1 0 66157 1 0 67158 1 0 68159 1 0 68160 1 0 69161 1 0 69162 1 0 71163 1 0 71164 1 0 71165 1 0 72166 1 0 73167 1 0 74168 1 0 74169 1 0 74170 1 0 75171 1 0 75172 1 0 77173 1 0 79174 1 0 80175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 86182 1 0 87183 1 0 M END PDB for HMDB0029785 (Protoisoeruboside B)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 3.313 -5.175 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 3.313 -3.635 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 1.979 -2.864 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 1.979 -1.324 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 3.313 -0.554 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 4.647 -1.324 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 4.810 0.209 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 4.647 -2.864 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 6.112 -3.339 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 7.015 -2.094 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 6.112 -0.847 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 7.015 0.401 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 6.541 1.864 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -2.022 -3.635 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 -0.688 -2.864 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 0.645 -3.635 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 0.645 -2.094 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 13.077 -0.558 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 12.448 0.847 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 10.918 1.007 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 10.015 -0.237 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 8.481 -0.077 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 8.802 1.432 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 13.357 2.095 0.000 0.00 0.00 C+0 HETATM 25 O UNK 0 14.885 1.931 0.000 0.00 0.00 O+0 HETATM 26 O UNK 0 8.481 -1.617 0.000 0.00 0.00 O+0 HETATM 27 O UNK 0 -3.356 -5.945 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 -2.022 -5.175 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -0.688 -5.945 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 0.645 -5.175 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 1.979 -5.945 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 1.979 -7.485 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 15.790 3.179 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 17.324 3.019 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 18.227 4.266 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 17.601 5.671 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 16.071 5.831 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 15.165 4.586 0.000 0.00 0.00 O+0 HETATM 39 C UNK 0 15.445 7.238 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 16.348 8.486 0.000 0.00 0.00 O+0 HETATM 41 O UNK 0 18.507 6.915 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 19.761 4.103 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 17.950 1.611 0.000 0.00 0.00 O+0 HETATM 44 C UNK 0 -4.689 -5.175 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 -4.689 -3.635 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -6.023 -2.864 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -7.357 -3.635 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -7.357 -5.175 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -6.023 -5.945 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -6.023 -1.324 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 -7.357 -0.554 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 -8.690 -2.864 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 -8.690 -5.945 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 -6.023 -7.485 0.000 0.00 0.00 O+0 HETATM 55 C UNK 0 -10.129 -3.693 0.000 0.00 0.00 C+0 HETATM 56 O UNK 0 -10.024 -5.175 0.000 0.00 0.00 O+0 HETATM 57 C UNK 0 -11.358 -5.945 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -12.692 -5.175 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -12.692 -3.635 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -11.358 -2.864 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -11.358 -7.485 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 -12.692 -8.255 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 -11.010 -0.890 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 -14.025 -2.864 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 -14.025 -5.945 0.000 0.00 0.00 O+0 HETATM 66 C UNK 0 -12.547 0.397 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 -12.276 1.913 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 -13.455 2.902 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 -14.903 2.375 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 -15.171 0.859 0.000 0.00 0.00 C+0 HETATM 71 O UNK 0 -13.991 -0.129 0.000 0.00 0.00 O+0 HETATM 72 C UNK 0 -15.759 -3.865 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -17.093 -3.095 0.000 0.00 0.00 C+0 HETATM 74 C UNK 0 -18.427 -3.865 0.000 0.00 0.00 C+0 HETATM 75 C UNK 0 -18.427 -5.405 0.000 0.00 0.00 C+0 HETATM 76 C UNK 0 -17.093 -6.176 0.000 0.00 0.00 C+0 HETATM 77 O UNK 0 -15.759 -5.405 0.000 0.00 0.00 O+0 HETATM 78 C UNK 0 -16.619 0.333 0.000 0.00 0.00 C+0 HETATM 79 O UNK 0 -17.795 1.325 0.000 0.00 0.00 O+0 HETATM 80 O UNK 0 -16.083 3.367 0.000 0.00 0.00 O+0 HETATM 81 O UNK 0 -13.191 4.420 0.000 0.00 0.00 O+0 HETATM 82 O UNK 0 -10.831 2.439 0.000 0.00 0.00 O+0 HETATM 83 C UNK 0 -17.093 -7.716 0.000 0.00 0.00 C+0 HETATM 84 O UNK 0 -18.427 -8.486 0.000 0.00 0.00 O+0 HETATM 85 O UNK 0 -19.761 -6.176 0.000 0.00 0.00 O+0 HETATM 86 O UNK 0 -19.761 -3.095 0.000 0.00 0.00 O+0 HETATM 87 O UNK 0 -17.093 -1.555 0.000 0.00 0.00 O+0 CONECT 1 2 31 CONECT 2 1 3 8 CONECT 3 2 4 16 CONECT 4 3 5 CONECT 5 4 6 CONECT 6 5 7 8 11 CONECT 7 6 CONECT 8 2 6 9 CONECT 9 8 10 CONECT 10 9 11 26 CONECT 11 6 10 12 CONECT 12 11 13 22 CONECT 13 12 CONECT 14 15 28 CONECT 15 14 16 CONECT 16 3 15 17 30 CONECT 17 16 CONECT 18 19 CONECT 19 18 20 24 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 12 21 23 26 CONECT 23 22 CONECT 24 19 25 CONECT 25 24 33 CONECT 26 10 22 CONECT 27 28 44 CONECT 28 14 27 29 CONECT 29 28 30 CONECT 30 16 29 31 CONECT 31 1 30 32 CONECT 32 31 CONECT 33 25 34 38 CONECT 34 33 35 43 CONECT 35 34 36 42 CONECT 36 35 37 41 CONECT 37 36 38 39 CONECT 38 33 37 CONECT 39 37 40 CONECT 40 39 CONECT 41 36 CONECT 42 35 CONECT 43 34 CONECT 44 27 45 49 CONECT 45 44 46 CONECT 46 45 47 50 CONECT 47 46 48 52 CONECT 48 47 49 53 CONECT 49 44 48 54 CONECT 50 46 51 CONECT 51 50 CONECT 52 47 55 CONECT 53 48 CONECT 54 49 CONECT 55 52 56 60 CONECT 56 55 57 CONECT 57 56 58 61 CONECT 58 57 59 65 CONECT 59 58 60 64 CONECT 60 55 59 63 CONECT 61 57 62 CONECT 62 61 CONECT 63 60 66 CONECT 64 59 72 CONECT 65 58 CONECT 66 63 67 71 CONECT 67 66 68 82 CONECT 68 67 69 81 CONECT 69 68 70 80 CONECT 70 69 71 78 CONECT 71 66 70 CONECT 72 64 73 77 CONECT 73 72 74 87 CONECT 74 73 75 86 CONECT 75 74 76 85 CONECT 76 75 77 83 CONECT 77 72 76 CONECT 78 70 79 CONECT 79 78 CONECT 80 69 CONECT 81 68 CONECT 82 67 CONECT 83 76 84 CONECT 84 83 CONECT 85 75 CONECT 86 74 CONECT 87 73 MASTER 0 0 0 0 0 0 0 0 87 0 192 0 END 3D PDB for HMDB0029785 (Protoisoeruboside B)COMPND HMDB0029785 HETATM 1 C1 UNL 1 12.565 -3.837 0.354 1.00 0.00 C HETATM 2 C2 UNL 1 12.654 -2.313 0.118 1.00 0.00 C HETATM 3 C3 UNL 1 11.412 -1.676 0.734 1.00 0.00 C HETATM 4 C4 UNL 1 10.167 -2.260 0.077 1.00 0.00 C HETATM 5 C5 UNL 1 8.966 -1.663 0.771 1.00 0.00 C HETATM 6 O1 UNL 1 9.008 -1.954 2.154 1.00 0.00 O HETATM 7 O2 UNL 1 8.788 -0.326 0.614 1.00 0.00 O HETATM 8 C6 UNL 1 7.900 -0.019 -0.354 1.00 0.00 C HETATM 9 C7 UNL 1 6.637 0.705 0.152 1.00 0.00 C HETATM 10 C8 UNL 1 5.509 -0.174 -0.225 1.00 0.00 C HETATM 11 C9 UNL 1 4.282 0.577 -0.738 1.00 0.00 C HETATM 12 C10 UNL 1 3.757 1.356 0.455 1.00 0.00 C HETATM 13 C11 UNL 1 2.430 1.956 0.076 1.00 0.00 C HETATM 14 O3 UNL 1 1.891 2.762 1.030 1.00 0.00 O HETATM 15 C12 UNL 1 1.480 0.766 -0.135 1.00 0.00 C HETATM 16 C13 UNL 1 0.093 1.153 -0.022 1.00 0.00 C HETATM 17 C14 UNL 1 -0.933 0.463 -0.891 1.00 0.00 C HETATM 18 O4 UNL 1 -1.794 -0.361 -0.133 1.00 0.00 O HETATM 19 C15 UNL 1 -3.012 0.264 0.054 1.00 0.00 C HETATM 20 O5 UNL 1 -3.968 -0.418 -0.735 1.00 0.00 O HETATM 21 C16 UNL 1 -5.234 0.195 -0.622 1.00 0.00 C HETATM 22 C17 UNL 1 -5.166 1.685 -0.841 1.00 0.00 C HETATM 23 O6 UNL 1 -4.658 1.976 -2.083 1.00 0.00 O HETATM 24 C18 UNL 1 -5.822 -0.170 0.670 1.00 0.00 C HETATM 25 O7 UNL 1 -6.918 -1.017 0.657 1.00 0.00 O HETATM 26 C19 UNL 1 -7.876 -0.654 1.570 1.00 0.00 C HETATM 27 O8 UNL 1 -8.073 -1.763 2.386 1.00 0.00 O HETATM 28 C20 UNL 1 -8.436 -2.867 1.705 1.00 0.00 C HETATM 29 C21 UNL 1 -9.196 -3.801 2.655 1.00 0.00 C HETATM 30 O9 UNL 1 -8.404 -4.206 3.729 1.00 0.00 O HETATM 31 C22 UNL 1 -9.310 -2.625 0.540 1.00 0.00 C HETATM 32 O10 UNL 1 -8.456 -2.773 -0.600 1.00 0.00 O HETATM 33 C23 UNL 1 -9.986 -1.305 0.347 1.00 0.00 C HETATM 34 O11 UNL 1 -9.956 -0.958 -0.976 1.00 0.00 O HETATM 35 C24 UNL 1 -10.841 -0.608 -1.798 1.00 0.00 C HETATM 36 O12 UNL 1 -12.036 -0.947 -0.715 1.00 0.00 O HETATM 37 C25 UNL 1 -13.171 -0.739 -1.399 1.00 0.00 C HETATM 38 C26 UNL 1 -13.382 0.759 -1.656 1.00 0.00 C HETATM 39 O13 UNL 1 -14.616 0.939 -2.340 1.00 0.00 O HETATM 40 C27 UNL 1 -13.380 -1.434 -2.693 1.00 0.00 C HETATM 41 O14 UNL 1 -14.281 -2.510 -2.446 1.00 0.00 O HETATM 42 C28 UNL 1 -12.184 -1.904 -3.448 1.00 0.00 C HETATM 43 O15 UNL 1 -11.836 -1.010 -4.475 1.00 0.00 O HETATM 44 C29 UNL 1 -11.016 -2.153 -2.589 1.00 0.00 C HETATM 45 O16 UNL 1 -11.296 -3.015 -1.614 1.00 0.00 O HETATM 46 C30 UNL 1 -9.231 -0.241 1.084 1.00 0.00 C HETATM 47 O17 UNL 1 -9.981 0.270 2.122 1.00 0.00 O HETATM 48 C31 UNL 1 -10.192 1.627 2.090 1.00 0.00 C HETATM 49 O18 UNL 1 -9.139 2.248 2.874 1.00 0.00 O HETATM 50 C32 UNL 1 -9.049 3.582 2.535 1.00 0.00 C HETATM 51 C33 UNL 1 -8.345 3.830 1.243 1.00 0.00 C HETATM 52 O19 UNL 1 -8.265 5.196 0.943 1.00 0.00 O HETATM 53 C34 UNL 1 -10.365 4.306 2.639 1.00 0.00 C HETATM 54 O20 UNL 1 -10.883 4.753 1.445 1.00 0.00 O HETATM 55 C35 UNL 1 -11.362 3.422 3.325 1.00 0.00 C HETATM 56 O21 UNL 1 -12.634 4.032 3.293 1.00 0.00 O HETATM 57 C36 UNL 1 -11.504 2.156 2.454 1.00 0.00 C HETATM 58 O22 UNL 1 -12.287 2.515 1.359 1.00 0.00 O HETATM 59 C37 UNL 1 -4.714 -0.658 1.614 1.00 0.00 C HETATM 60 O23 UNL 1 -5.189 -0.568 2.949 1.00 0.00 O HETATM 61 C38 UNL 1 -3.470 0.148 1.471 1.00 0.00 C HETATM 62 O24 UNL 1 -2.460 -0.432 2.256 1.00 0.00 O HETATM 63 C39 UNL 1 -0.371 -0.280 -2.046 1.00 0.00 C HETATM 64 C40 UNL 1 0.919 -1.029 -1.672 1.00 0.00 C HETATM 65 C41 UNL 1 1.931 0.033 -1.391 1.00 0.00 C HETATM 66 C42 UNL 1 2.009 0.926 -2.589 1.00 0.00 C HETATM 67 C43 UNL 1 3.301 -0.536 -1.094 1.00 0.00 C HETATM 68 C44 UNL 1 3.763 -1.451 -2.154 1.00 0.00 C HETATM 69 C45 UNL 1 5.139 -2.042 -1.870 1.00 0.00 C HETATM 70 C46 UNL 1 6.046 -0.984 -1.359 1.00 0.00 C HETATM 71 C47 UNL 1 6.300 -0.050 -2.536 1.00 0.00 C HETATM 72 C48 UNL 1 7.381 -1.369 -0.878 1.00 0.00 C HETATM 73 C49 UNL 1 7.668 -2.262 0.190 1.00 0.00 C HETATM 74 C50 UNL 1 6.778 -2.437 1.364 1.00 0.00 C HETATM 75 C51 UNL 1 13.916 -1.804 0.750 1.00 0.00 C HETATM 76 O25 UNL 1 14.074 -0.454 0.557 1.00 0.00 O HETATM 77 C52 UNL 1 15.245 0.001 1.190 1.00 0.00 C HETATM 78 O26 UNL 1 16.122 0.422 0.199 1.00 0.00 O HETATM 79 C53 UNL 1 15.492 1.250 -0.681 1.00 0.00 C HETATM 80 C54 UNL 1 16.549 1.800 -1.624 1.00 0.00 C HETATM 81 O27 UNL 1 15.971 2.642 -2.544 1.00 0.00 O HETATM 82 C55 UNL 1 14.699 2.332 -0.038 1.00 0.00 C HETATM 83 O28 UNL 1 13.335 2.253 -0.334 1.00 0.00 O HETATM 84 C56 UNL 1 14.894 2.451 1.439 1.00 0.00 C HETATM 85 O29 UNL 1 15.925 3.326 1.742 1.00 0.00 O HETATM 86 C57 UNL 1 15.001 1.138 2.138 1.00 0.00 C HETATM 87 O30 UNL 1 16.134 1.200 2.982 1.00 0.00 O HETATM 88 H1 UNL 1 12.348 -4.071 1.391 1.00 0.00 H HETATM 89 H2 UNL 1 13.604 -4.208 0.127 1.00 0.00 H HETATM 90 H3 UNL 1 11.891 -4.322 -0.366 1.00 0.00 H HETATM 91 H4 UNL 1 12.653 -2.135 -0.949 1.00 0.00 H HETATM 92 H5 UNL 1 11.399 -1.821 1.824 1.00 0.00 H HETATM 93 H6 UNL 1 11.456 -0.595 0.530 1.00 0.00 H HETATM 94 H7 UNL 1 10.145 -3.351 0.056 1.00 0.00 H HETATM 95 H8 UNL 1 10.162 -1.918 -0.973 1.00 0.00 H HETATM 96 H9 UNL 1 9.645 -2.680 2.369 1.00 0.00 H HETATM 97 H10 UNL 1 8.342 0.561 -1.204 1.00 0.00 H HETATM 98 H11 UNL 1 6.716 0.795 1.245 1.00 0.00 H HETATM 99 H12 UNL 1 6.570 1.733 -0.263 1.00 0.00 H HETATM 100 H13 UNL 1 5.082 -0.768 0.613 1.00 0.00 H HETATM 101 H14 UNL 1 4.484 1.283 -1.535 1.00 0.00 H HETATM 102 H15 UNL 1 3.658 0.657 1.304 1.00 0.00 H HETATM 103 H16 UNL 1 4.499 2.129 0.741 1.00 0.00 H HETATM 104 H17 UNL 1 2.581 2.480 -0.901 1.00 0.00 H HETATM 105 H18 UNL 1 1.366 3.527 0.719 1.00 0.00 H HETATM 106 H19 UNL 1 1.735 0.062 0.711 1.00 0.00 H HETATM 107 H20 UNL 1 -0.251 0.920 1.046 1.00 0.00 H HETATM 108 H21 UNL 1 -0.073 2.284 -0.034 1.00 0.00 H HETATM 109 H22 UNL 1 -1.564 1.321 -1.267 1.00 0.00 H HETATM 110 H23 UNL 1 -2.928 1.304 -0.329 1.00 0.00 H HETATM 111 H24 UNL 1 -5.795 -0.205 -1.498 1.00 0.00 H HETATM 112 H25 UNL 1 -6.254 2.021 -0.832 1.00 0.00 H HETATM 113 H26 UNL 1 -4.701 2.229 -0.025 1.00 0.00 H HETATM 114 H27 UNL 1 -4.140 1.170 -2.398 1.00 0.00 H HETATM 115 H28 UNL 1 -6.173 0.749 1.237 1.00 0.00 H HETATM 116 H29 UNL 1 -7.416 0.149 2.187 1.00 0.00 H HETATM 117 H30 UNL 1 -7.524 -3.493 1.414 1.00 0.00 H HETATM 118 H31 UNL 1 -9.520 -4.714 2.077 1.00 0.00 H HETATM 119 H32 UNL 1 -10.105 -3.318 3.031 1.00 0.00 H HETATM 120 H33 UNL 1 -7.493 -4.496 3.390 1.00 0.00 H HETATM 121 H34 UNL 1 -10.066 -3.470 0.454 1.00 0.00 H HETATM 122 H35 UNL 1 -8.100 -3.690 -0.649 1.00 0.00 H HETATM 123 H36 UNL 1 -11.048 -1.336 0.748 1.00 0.00 H HETATM 124 H37 UNL 1 -11.621 -0.344 -2.385 1.00 0.00 H HETATM 125 H38 UNL 1 -14.040 -0.990 -0.695 1.00 0.00 H HETATM 126 H39 UNL 1 -12.603 1.217 -2.275 1.00 0.00 H HETATM 127 H40 UNL 1 -13.450 1.340 -0.735 1.00 0.00 H HETATM 128 H41 UNL 1 -15.258 1.456 -1.749 1.00 0.00 H HETATM 129 H42 UNL 1 -13.975 -0.778 -3.381 1.00 0.00 H HETATM 130 H43 UNL 1 -15.181 -2.179 -2.290 1.00 0.00 H HETATM 131 H44 UNL 1 -12.498 -2.889 -3.924 1.00 0.00 H HETATM 132 H45 UNL 1 -11.686 -1.586 -5.289 1.00 0.00 H HETATM 133 H46 UNL 1 -10.065 -2.180 -3.031 1.00 0.00 H HETATM 134 H47 UNL 1 -11.000 -3.934 -1.696 1.00 0.00 H HETATM 135 H48 UNL 1 -9.031 0.594 0.397 1.00 0.00 H HETATM 136 H49 UNL 1 -9.885 1.961 1.094 1.00 0.00 H HETATM 137 H50 UNL 1 -8.409 4.035 3.369 1.00 0.00 H HETATM 138 H51 UNL 1 -8.816 3.366 0.368 1.00 0.00 H HETATM 139 H52 UNL 1 -7.285 3.459 1.311 1.00 0.00 H HETATM 140 H53 UNL 1 -8.160 5.335 -0.036 1.00 0.00 H HETATM 141 H54 UNL 1 -10.248 5.241 3.278 1.00 0.00 H HETATM 142 H55 UNL 1 -10.726 4.116 0.728 1.00 0.00 H HETATM 143 H56 UNL 1 -11.079 3.129 4.341 1.00 0.00 H HETATM 144 H57 UNL 1 -12.452 4.942 3.699 1.00 0.00 H HETATM 145 H58 UNL 1 -12.124 1.477 3.094 1.00 0.00 H HETATM 146 H59 UNL 1 -13.199 2.166 1.488 1.00 0.00 H HETATM 147 H60 UNL 1 -4.530 -1.704 1.401 1.00 0.00 H HETATM 148 H61 UNL 1 -5.216 0.401 3.189 1.00 0.00 H HETATM 149 H62 UNL 1 -3.660 1.171 1.899 1.00 0.00 H HETATM 150 H63 UNL 1 -2.890 -0.967 2.969 1.00 0.00 H HETATM 151 H64 UNL 1 -1.106 -1.093 -2.316 1.00 0.00 H HETATM 152 H65 UNL 1 -0.208 0.316 -2.944 1.00 0.00 H HETATM 153 H66 UNL 1 1.116 -1.685 -2.510 1.00 0.00 H HETATM 154 H67 UNL 1 0.713 -1.552 -0.712 1.00 0.00 H HETATM 155 H68 UNL 1 2.986 1.339 -2.822 1.00 0.00 H HETATM 156 H69 UNL 1 1.716 0.331 -3.507 1.00 0.00 H HETATM 157 H70 UNL 1 1.311 1.777 -2.550 1.00 0.00 H HETATM 158 H71 UNL 1 3.180 -1.120 -0.157 1.00 0.00 H HETATM 159 H72 UNL 1 3.076 -2.325 -2.169 1.00 0.00 H HETATM 160 H73 UNL 1 3.713 -1.046 -3.193 1.00 0.00 H HETATM 161 H74 UNL 1 5.069 -2.940 -1.268 1.00 0.00 H HETATM 162 H75 UNL 1 5.527 -2.354 -2.862 1.00 0.00 H HETATM 163 H76 UNL 1 7.319 -0.211 -2.906 1.00 0.00 H HETATM 164 H77 UNL 1 5.608 -0.224 -3.390 1.00 0.00 H HETATM 165 H78 UNL 1 6.294 1.020 -2.227 1.00 0.00 H HETATM 166 H79 UNL 1 8.022 -1.618 -1.760 1.00 0.00 H HETATM 167 H80 UNL 1 7.939 -3.284 -0.212 1.00 0.00 H HETATM 168 H81 UNL 1 7.342 -3.170 2.037 1.00 0.00 H HETATM 169 H82 UNL 1 6.779 -1.522 2.029 1.00 0.00 H HETATM 170 H83 UNL 1 5.823 -2.915 1.227 1.00 0.00 H HETATM 171 H84 UNL 1 13.962 -2.065 1.840 1.00 0.00 H HETATM 172 H85 UNL 1 14.761 -2.325 0.237 1.00 0.00 H HETATM 173 H86 UNL 1 15.731 -0.854 1.732 1.00 0.00 H HETATM 174 H87 UNL 1 14.790 0.669 -1.326 1.00 0.00 H HETATM 175 H88 UNL 1 17.251 2.378 -0.981 1.00 0.00 H HETATM 176 H89 UNL 1 17.116 0.976 -2.141 1.00 0.00 H HETATM 177 H90 UNL 1 16.659 2.860 -3.238 1.00 0.00 H HETATM 178 H91 UNL 1 15.040 3.298 -0.500 1.00 0.00 H HETATM 179 H92 UNL 1 13.199 1.712 -1.160 1.00 0.00 H HETATM 180 H93 UNL 1 13.958 2.943 1.855 1.00 0.00 H HETATM 181 H94 UNL 1 16.727 3.149 1.231 1.00 0.00 H HETATM 182 H95 UNL 1 14.159 0.920 2.842 1.00 0.00 H HETATM 183 H96 UNL 1 16.883 0.619 2.627 1.00 0.00 H CONECT 1 2 88 89 90 CONECT 2 3 75 91 CONECT 3 4 92 93 CONECT 4 5 94 95 CONECT 5 6 7 73 CONECT 6 96 CONECT 7 8 CONECT 8 9 72 97 CONECT 9 10 98 99 CONECT 10 11 70 100 CONECT 11 12 67 101 CONECT 12 13 102 103 CONECT 13 14 15 104 CONECT 14 105 CONECT 15 16 65 106 CONECT 16 17 107 108 CONECT 17 18 63 109 CONECT 18 19 CONECT 19 20 61 110 CONECT 20 21 CONECT 21 22 24 111 CONECT 22 23 112 113 CONECT 23 114 CONECT 24 25 59 115 CONECT 25 26 CONECT 26 27 46 116 CONECT 27 28 CONECT 28 29 31 117 CONECT 29 30 118 119 CONECT 30 120 CONECT 31 32 33 121 CONECT 32 122 CONECT 33 34 46 123 CONECT 34 35 CONECT 35 36 44 124 CONECT 36 37 CONECT 37 38 40 125 CONECT 38 39 126 127 CONECT 39 128 CONECT 40 41 42 129 CONECT 41 130 CONECT 42 43 44 131 CONECT 43 132 CONECT 44 45 133 CONECT 45 134 CONECT 46 47 135 CONECT 47 48 CONECT 48 49 57 136 CONECT 49 50 CONECT 50 51 53 137 CONECT 51 52 138 139 CONECT 52 140 CONECT 53 54 55 141 CONECT 54 142 CONECT 55 56 57 143 CONECT 56 144 CONECT 57 58 145 CONECT 58 146 CONECT 59 60 61 147 CONECT 60 148 CONECT 61 62 149 CONECT 62 150 CONECT 63 64 151 152 CONECT 64 65 153 154 CONECT 65 66 67 CONECT 66 155 156 157 CONECT 67 68 158 CONECT 68 69 159 160 CONECT 69 70 161 162 CONECT 70 71 72 CONECT 71 163 164 165 CONECT 72 73 166 CONECT 73 74 167 CONECT 74 168 169 170 CONECT 75 76 171 172 CONECT 76 77 CONECT 77 78 86 173 CONECT 78 79 CONECT 79 80 82 174 CONECT 80 81 175 176 CONECT 81 177 CONECT 82 83 84 178 CONECT 83 179 CONECT 84 85 86 180 CONECT 85 181 CONECT 86 87 182 CONECT 87 183 END SMILES for HMDB0029785 (Protoisoeruboside B)CC(CCC1(O)OC2CC3C4CC(O)C5CC(CCC5(C)C4CCC3(C)C2C1C)OC1OC(CO)C(OC2OC(CO)C(O)C(OC3OC(CO)C(O)C(O)C3O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O)COC1OC(CO)C(O)C(O)C1O INCHI for HMDB0029785 (Protoisoeruboside B)InChI=1S/C57H96O30/c1-20(19-77-50-43(72)39(68)35(64)29(14-58)79-50)5-10-57(76)21(2)34-28(87-57)13-25-23-12-27(63)26-11-22(6-8-55(26,3)24(23)7-9-56(25,34)4)78-51-46(75)42(71)47(33(18-62)83-51)84-54-49(86-53-45(74)41(70)37(66)31(16-60)81-53)48(38(67)32(17-61)82-54)85-52-44(73)40(69)36(65)30(15-59)80-52/h20-54,58-76H,5-19H2,1-4H3 3D Structure for HMDB0029785 (Protoisoeruboside B) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C57H96O30 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1261.3541 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1260.598641732 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-({2-[(6-{[6,19-dihydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl)oxy]-5-hydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-4-yl}oxy)-6-(hydroxymethyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-({2-[(6-{[6,19-dihydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl)oxy]-5-hydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-4-yl}oxy)-6-(hydroxymethyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 186545-34-6 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(CCC1(O)OC2CC3C4CC(O)C5CC(CCC5(C)C4CCC3(C)C2C1C)OC1OC(CO)C(OC2OC(CO)C(O)C(OC3OC(CO)C(O)C(O)C3O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O)COC1OC(CO)C(O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C57H96O30/c1-20(19-77-50-43(72)39(68)35(64)29(14-58)79-50)5-10-57(76)21(2)34-28(87-57)13-25-23-12-27(63)26-11-22(6-8-55(26,3)24(23)7-9-56(25,34)4)78-51-46(75)42(71)47(33(18-62)83-51)84-54-49(86-53-45(74)41(70)37(66)31(16-60)81-53)48(38(67)32(17-61)82-54)85-52-44(73)40(69)36(65)30(15-59)80-52/h20-54,58-76H,5-19H2,1-4H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | WYWLHHWQKOHXHW-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as steroidal saponins. These are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Steroids and steroid derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Steroidal glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Steroidal saponins | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB000992 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | C00057176 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 8058274 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 9882599 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|