Showing metabocard for Asparagoside G (HMDB0030117)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 17:34:53 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:52:26 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0030117 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Asparagoside G | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Asparagoside G belongs to the class of organic compounds known as steroidal saponins. These are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. Asparagoside G is an extremely weak basic (essentially neutral) compound (based on its pKa). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0030117 (Asparagoside G)Mrv0541 02241216262D 75 83 0 0 0 0 999 V2000 1.7238 1.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9822 0.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4969 -0.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9836 -1.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4996 -1.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7144 -1.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0006 -1.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -1.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7129 -0.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0020 -0.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7130 -0.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7982 0.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0007 -2.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7115 -3.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4266 -2.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1417 -3.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8540 -2.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8540 -1.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1445 -1.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4308 -1.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4308 -1.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7660 -0.7961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7674 0.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5870 -0.0564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0710 0.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8920 0.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2275 -0.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9353 0.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3773 1.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1970 1.1098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6797 1.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5007 1.6927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9833 2.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8042 2.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2883 2.9468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5217 2.6169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3441 2.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8268 3.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6477 3.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1304 3.7843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4899 3.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5704 -3.1215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2855 -2.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2841 -1.8879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 -1.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 -0.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2884 -0.2392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -3.9506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7143 -2.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7157 -1.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6453 -1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2020 2.3830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2020 1.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4415 1.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4429 0.3492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6439 -0.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9894 0.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2756 0.0055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7745 2.4381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7731 1.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0375 1.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3224 1.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4307 -3.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1431 -2.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1431 -1.8922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8595 -1.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8595 -0.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5759 -0.2406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8582 -3.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8582 -3.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5704 -2.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5745 -1.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2883 -1.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2869 -3.1298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 23 1 0 0 0 0 3 4 1 0 0 0 0 3 11 1 0 0 0 0 4 5 1 0 0 0 0 4 22 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 6 11 1 0 0 0 0 7 8 1 0 0 0 0 7 13 1 0 0 0 0 8 9 1 0 0 0 0 8 20 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 15 20 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 42 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 23 28 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 26 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 37 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 33 39 1 0 0 0 0 34 35 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 38 41 1 0 0 0 0 39 40 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 43 49 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 45 51 1 0 0 0 0 46 47 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 50 64 1 0 0 0 0 51 52 1 0 0 0 0 52 57 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 55 61 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 62 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 64 65 1 0 0 0 0 65 66 1 0 0 0 0 65 71 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 67 73 1 0 0 0 0 68 69 1 0 0 0 0 70 71 1 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 73 74 1 0 0 0 0 M END 3D MOL for HMDB0030117 (Asparagoside G)HMDB0030117 RDKit 3D Asparagoside G 161169 0 0 0 0 0 0 0 0999 V2000 9.8765 1.9078 1.4507 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7866 0.3939 1.1706 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5905 0.1683 -0.2662 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3760 0.7207 -0.9390 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0728 0.2455 -0.5031 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9598 -1.1411 -0.5938 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1211 0.6500 -1.5905 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8976 0.2719 -1.1131 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8226 1.3061 -1.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0151 1.3949 -0.0179 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6075 0.9754 -0.3502 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9063 2.1924 -0.9077 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2521 2.6829 -0.1175 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2197 1.5169 0.0709 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5826 0.8790 -1.2230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5732 -0.2170 -0.9945 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6119 0.2802 -0.1952 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8625 0.0210 -0.8414 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7253 1.0354 -0.7944 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3516 1.0702 0.4869 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7849 2.4560 0.7442 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6605 3.0069 -0.1795 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4558 0.0181 0.5213 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6414 0.5295 0.0919 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7499 0.4156 0.8884 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8938 1.7449 1.4530 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7052 1.6871 2.5698 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9889 1.2685 3.8330 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8621 1.2638 4.9296 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8187 0.6411 2.3626 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9013 1.0590 3.1079 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1991 0.6487 0.9222 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2288 -0.2988 0.7336 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0133 0.2638 0.0728 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9390 1.1227 -1.0592 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9615 -1.2029 -0.2328 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6024 -1.2892 -1.4367 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1964 -2.5313 -1.6453 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5877 -2.5151 -1.5044 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1832 -3.6494 -2.0730 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5353 -3.9221 -1.4830 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3474 -4.1833 -0.1105 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1041 -3.5998 -3.5643 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2650 -3.0963 -4.1104 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9375 -2.6951 -3.9728 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5963 -2.9205 -5.2799 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8204 -3.0518 -2.9793 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6645 -2.3711 -3.4069 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4545 -1.2441 -0.2884 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0312 -1.4986 1.0209 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7983 -1.2638 -0.1808 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3894 -0.6811 1.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5244 0.5672 0.9952 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6124 1.2116 2.3798 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8605 0.1964 0.6315 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6408 -0.0807 1.9350 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9688 -0.6181 1.4123 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7672 0.6336 0.9935 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0353 1.3653 2.2830 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9920 0.1564 0.3658 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3008 0.8810 0.5952 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2304 2.3572 0.3178 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9407 -0.2827 1.8007 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1604 0.0792 1.4324 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7205 -0.2390 0.2446 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0821 0.9075 -0.4178 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8214 0.7924 -1.5488 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1920 0.0642 -2.6977 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9037 -1.2582 -2.4050 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1640 0.1773 -1.1826 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1927 1.0875 -1.3889 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1807 -0.2194 0.2648 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3140 -0.9961 0.5250 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9843 -1.0723 0.5928 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0348 -1.3282 1.9675 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6957 2.0195 2.5381 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1269 2.4661 0.8881 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9141 2.2566 1.2007 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8356 0.1121 1.7512 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7260 -0.9266 -0.5194 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4632 0.6488 -0.8039 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4963 1.8448 -0.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4838 0.5498 -2.0692 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6793 -1.6010 -0.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6481 -0.7128 -1.6043 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1579 2.2646 -1.6932 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1698 0.8841 -2.1452 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9483 2.4917 0.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7346 0.3132 -1.2758 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6034 2.0527 -1.9580 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6309 3.0655 -0.9577 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7821 3.4302 -0.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0072 3.0773 0.8683 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1543 1.8704 0.5615 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6871 0.5167 -1.7867 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0566 1.6183 -1.9187 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8615 -0.6556 -1.9410 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5688 -0.2479 -1.8689 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5356 0.8125 1.1956 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8921 3.1373 0.8015 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2654 2.5603 1.7623 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4583 3.9632 -0.3586 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5659 -0.3148 1.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6869 -0.2231 1.7562 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2203 2.6422 2.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1750 1.9567 4.0537 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6377 0.2005 3.7560 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5358 2.0028 4.8897 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4690 -0.3320 2.7335 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0758 2.0099 3.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6445 1.6146 0.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7255 -0.0639 -0.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1954 -0.7268 -0.3368 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4357 0.6939 -1.8036 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2993 -2.1324 0.3470 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8848 -3.2606 -0.8468 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5382 -4.5210 -1.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2344 -3.0650 -1.6215 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9550 -4.8370 -1.9217 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6839 -4.9190 -0.0599 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8808 -4.6063 -3.9485 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0558 -3.4603 -3.5894 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2361 -1.6708 -3.7207 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4583 -2.8750 -5.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6367 -4.1478 -3.0135 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8427 -1.3980 -3.2934 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1561 -2.1434 -0.8995 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6706 -2.4229 1.1261 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9033 -1.5186 -0.7709 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3603 -2.1794 -0.0013 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2679 -0.4932 1.7961 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7461 -1.4202 1.6537 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6486 1.6364 2.5310 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5212 0.4448 3.1909 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0869 2.0097 2.5637 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7724 -0.8717 0.2254 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7362 0.8649 2.4501 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1907 -0.8705 2.5353 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5178 -1.1582 2.1789 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7882 -1.2320 0.5009 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7683 0.7592 3.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4611 2.3031 2.3888 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1359 1.5394 2.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2050 -0.9092 0.6024 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7304 0.6435 1.5680 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2340 2.7971 0.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8308 2.8748 1.1205 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6733 2.6693 -0.6442 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7863 -0.1376 2.9380 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7490 -1.4086 1.6401 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0453 -0.8904 -0.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0199 1.8381 -1.9215 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2481 0.5979 -3.0239 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8465 0.0817 -3.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7287 -1.8040 -2.5394 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3003 -0.7417 -1.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6263 0.8795 -2.2360 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1368 0.6821 0.8999 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7322 -1.1939 -0.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9634 -2.0014 0.0227 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1035 -0.4506 2.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 27 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 23 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 36 49 1 0 49 50 1 0 16 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 61 62 1 0 2 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 72 74 1 0 74 75 1 0 61 5 1 0 74 65 1 0 60 8 1 0 58 10 1 0 55 11 1 0 53 14 1 0 49 18 1 0 34 25 1 0 47 38 1 0 1 76 1 0 1 77 1 0 1 78 1 0 2 79 1 0 3 80 1 0 3 81 1 0 4 82 1 0 4 83 1 0 6 84 1 0 8 85 1 0 9 86 1 0 9 87 1 0 10 88 1 0 11 89 1 0 12 90 1 0 12 91 1 0 13 92 1 0 13 93 1 0 14 94 1 0 15 95 1 0 15 96 1 0 16 97 1 0 18 98 1 0 20 99 1 0 21100 1 0 21101 1 0 22102 1 0 23103 1 0 25104 1 0 27105 1 0 28106 1 0 28107 1 0 29108 1 0 30109 1 0 31110 1 0 32111 1 0 33112 1 0 34113 1 0 35114 1 0 36115 1 0 38116 1 0 40117 1 0 41118 1 0 41119 1 0 42120 1 0 43121 1 0 44122 1 0 45123 1 0 46124 1 0 47125 1 0 48126 1 0 49127 1 0 50128 1 0 51129 1 0 51130 1 0 52131 1 0 52132 1 0 54133 1 0 54134 1 0 54135 1 0 55136 1 0 56137 1 0 56138 1 0 57139 1 0 57140 1 0 59141 1 0 59142 1 0 59143 1 0 60144 1 0 61145 1 0 62146 1 0 62147 1 0 62148 1 0 63149 1 0 63150 1 0 65151 1 0 67152 1 0 68153 1 0 68154 1 0 69155 1 0 70156 1 0 71157 1 0 72158 1 0 73159 1 0 74160 1 0 75161 1 0 M END 3D SDF for HMDB0030117 (Asparagoside G)Mrv0541 02241216262D 75 83 0 0 0 0 999 V2000 1.7238 1.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9822 0.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4969 -0.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9836 -1.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4996 -1.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7144 -1.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0006 -1.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -1.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7129 -0.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0020 -0.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7130 -0.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7982 0.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0007 -2.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7115 -3.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4266 -2.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1417 -3.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8540 -2.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8540 -1.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1445 -1.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4308 -1.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4308 -1.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7660 -0.7961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7674 0.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5870 -0.0564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0710 0.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8920 0.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2275 -0.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9353 0.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3773 1.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1970 1.1098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6797 1.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5007 1.6927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9833 2.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8042 2.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2883 2.9468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5217 2.6169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3441 2.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8268 3.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6477 3.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1304 3.7843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4899 3.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5704 -3.1215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2855 -2.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2841 -1.8879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 -1.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 -0.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2884 -0.2392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -3.9506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7143 -2.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7157 -1.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6453 -1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2020 2.3830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2020 1.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4415 1.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4429 0.3492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6439 -0.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9894 0.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2756 0.0055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7745 2.4381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7731 1.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0375 1.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3224 1.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4307 -3.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1431 -2.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1431 -1.8922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8595 -1.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8595 -0.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5759 -0.2406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8582 -3.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8582 -3.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5704 -2.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5745 -1.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2883 -1.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2869 -3.1298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 23 1 0 0 0 0 3 4 1 0 0 0 0 3 11 1 0 0 0 0 4 5 1 0 0 0 0 4 22 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 6 11 1 0 0 0 0 7 8 1 0 0 0 0 7 13 1 0 0 0 0 8 9 1 0 0 0 0 8 20 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 15 20 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 42 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 23 28 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 26 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 37 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 33 39 1 0 0 0 0 34 35 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 38 41 1 0 0 0 0 39 40 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 43 49 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 45 51 1 0 0 0 0 46 47 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 50 64 1 0 0 0 0 51 52 1 0 0 0 0 52 57 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 55 61 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 62 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 64 65 1 0 0 0 0 65 66 1 0 0 0 0 65 71 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 67 73 1 0 0 0 0 68 69 1 0 0 0 0 70 71 1 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 73 74 1 0 0 0 0 M END > <DATABASE_ID> HMDB0030117 > <DATABASE_NAME> hmdb > <SMILES> CC(CCC1(O)OC2CC3C4CCC5CC(CCC5(C)C4CCC3(C)C2C1C)OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O)COC1OC(CO)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C51H86O24/c1-20(19-67-45-39(62)36(59)33(56)28(15-52)69-45)7-12-51(66)21(2)32-27(75-51)14-26-24-6-5-22-13-23(8-10-49(22,3)25(24)9-11-50(26,32)4)68-48-42(65)44(74-47-41(64)38(61)35(58)30(17-54)71-47)43(31(18-55)72-48)73-46-40(63)37(60)34(57)29(16-53)70-46/h20-48,52-66H,5-19H2,1-4H3 > <INCHI_KEY> RZZKWHQUBSTBSP-UHFFFAOYSA-N > <FORMULA> C51H86O24 > <MOLECULAR_WEIGHT> 1083.2141 > <EXACT_MASS> 1082.55090368 > <JCHEM_ACCEPTOR_COUNT> 24 > <JCHEM_AVERAGE_POLARIZABILITY> 114.89064932618523 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 15 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-[(5-hydroxy-6-{[6-hydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-2-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol > <ALOGPS_LOGP> -0.92 > <JCHEM_LOGP> -2.9121612196666637 > <ALOGPS_LOGS> -2.88 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 9 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 11.890978063594442 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.461725793375619 > <JCHEM_PKA_STRONGEST_BASIC> -3.6786119366911016 > <JCHEM_POLAR_SURFACE_AREA> 386.52000000000004 > <JCHEM_REFRACTIVITY> 252.57920000000007 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.41e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-[(5-hydroxy-6-{[6-hydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-2-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0030117 (Asparagoside G)HMDB0030117 RDKit 3D Asparagoside G 161169 0 0 0 0 0 0 0 0999 V2000 9.8765 1.9078 1.4507 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7866 0.3939 1.1706 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5905 0.1683 -0.2662 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3760 0.7207 -0.9390 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0728 0.2455 -0.5031 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9598 -1.1411 -0.5938 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1211 0.6500 -1.5905 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8976 0.2719 -1.1131 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8226 1.3061 -1.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0151 1.3949 -0.0179 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6075 0.9754 -0.3502 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9063 2.1924 -0.9077 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2521 2.6829 -0.1175 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2197 1.5169 0.0709 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5826 0.8790 -1.2230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5732 -0.2170 -0.9945 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6119 0.2802 -0.1952 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8625 0.0210 -0.8414 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7253 1.0354 -0.7944 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3516 1.0702 0.4869 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7849 2.4560 0.7442 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6605 3.0069 -0.1795 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4558 0.0181 0.5213 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6414 0.5295 0.0919 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7499 0.4156 0.8884 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8938 1.7449 1.4530 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7052 1.6871 2.5698 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9889 1.2685 3.8330 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8621 1.2638 4.9296 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8187 0.6411 2.3626 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9013 1.0590 3.1079 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1991 0.6487 0.9222 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2288 -0.2988 0.7336 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0133 0.2638 0.0728 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9390 1.1227 -1.0592 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9615 -1.2029 -0.2328 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6024 -1.2892 -1.4367 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1964 -2.5313 -1.6453 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5877 -2.5151 -1.5044 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1832 -3.6494 -2.0730 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5353 -3.9221 -1.4830 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3474 -4.1833 -0.1105 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1041 -3.5998 -3.5643 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2650 -3.0963 -4.1104 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9375 -2.6951 -3.9728 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5963 -2.9205 -5.2799 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8204 -3.0518 -2.9793 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6645 -2.3711 -3.4069 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4545 -1.2441 -0.2884 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0312 -1.4986 1.0209 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7983 -1.2638 -0.1808 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3894 -0.6811 1.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5244 0.5672 0.9952 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6124 1.2116 2.3798 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8605 0.1964 0.6315 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6408 -0.0807 1.9350 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9688 -0.6181 1.4123 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7672 0.6336 0.9935 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0353 1.3653 2.2830 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9920 0.1564 0.3658 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3008 0.8810 0.5952 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2304 2.3572 0.3178 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9407 -0.2827 1.8007 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1604 0.0792 1.4324 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7205 -0.2390 0.2446 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0821 0.9075 -0.4178 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8214 0.7924 -1.5488 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1920 0.0642 -2.6977 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9037 -1.2582 -2.4050 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1640 0.1773 -1.1826 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1927 1.0875 -1.3889 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1807 -0.2194 0.2648 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3140 -0.9961 0.5250 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9843 -1.0723 0.5928 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0348 -1.3282 1.9675 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6957 2.0195 2.5381 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1269 2.4661 0.8881 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9141 2.2566 1.2007 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8356 0.1121 1.7512 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7260 -0.9266 -0.5194 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4632 0.6488 -0.8039 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4963 1.8448 -0.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4838 0.5498 -2.0692 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6793 -1.6010 -0.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6481 -0.7128 -1.6043 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1579 2.2646 -1.6932 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1698 0.8841 -2.1452 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9483 2.4917 0.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7346 0.3132 -1.2758 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6034 2.0527 -1.9580 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6309 3.0655 -0.9577 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7821 3.4302 -0.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0072 3.0773 0.8683 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1543 1.8704 0.5615 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6871 0.5167 -1.7867 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0566 1.6183 -1.9187 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8615 -0.6556 -1.9410 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5688 -0.2479 -1.8689 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5356 0.8125 1.1956 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8921 3.1373 0.8015 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2654 2.5603 1.7623 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4583 3.9632 -0.3586 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5659 -0.3148 1.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6869 -0.2231 1.7562 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2203 2.6422 2.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1750 1.9567 4.0537 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6377 0.2005 3.7560 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5358 2.0028 4.8897 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4690 -0.3320 2.7335 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0758 2.0099 3.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6445 1.6146 0.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7255 -0.0639 -0.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1954 -0.7268 -0.3368 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4357 0.6939 -1.8036 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2993 -2.1324 0.3470 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8848 -3.2606 -0.8468 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5382 -4.5210 -1.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2344 -3.0650 -1.6215 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9550 -4.8370 -1.9217 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6839 -4.9190 -0.0599 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8808 -4.6063 -3.9485 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0558 -3.4603 -3.5894 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2361 -1.6708 -3.7207 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4583 -2.8750 -5.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6367 -4.1478 -3.0135 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8427 -1.3980 -3.2934 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1561 -2.1434 -0.8995 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6706 -2.4229 1.1261 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9033 -1.5186 -0.7709 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3603 -2.1794 -0.0013 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2679 -0.4932 1.7961 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7461 -1.4202 1.6537 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6486 1.6364 2.5310 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5212 0.4448 3.1909 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0869 2.0097 2.5637 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7724 -0.8717 0.2254 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7362 0.8649 2.4501 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1907 -0.8705 2.5353 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5178 -1.1582 2.1789 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7882 -1.2320 0.5009 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7683 0.7592 3.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4611 2.3031 2.3888 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1359 1.5394 2.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2050 -0.9092 0.6024 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7304 0.6435 1.5680 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2340 2.7971 0.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8308 2.8748 1.1205 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6733 2.6693 -0.6442 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7863 -0.1376 2.9380 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7490 -1.4086 1.6401 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0453 -0.8904 -0.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0199 1.8381 -1.9215 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2481 0.5979 -3.0239 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8465 0.0817 -3.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7287 -1.8040 -2.5394 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3003 -0.7417 -1.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6263 0.8795 -2.2360 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1368 0.6821 0.8999 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7322 -1.1939 -0.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9634 -2.0014 0.0227 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1035 -0.4506 2.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 27 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 23 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 36 49 1 0 49 50 1 0 16 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 61 62 1 0 2 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 72 74 1 0 74 75 1 0 61 5 1 0 74 65 1 0 60 8 1 0 58 10 1 0 55 11 1 0 53 14 1 0 49 18 1 0 34 25 1 0 47 38 1 0 1 76 1 0 1 77 1 0 1 78 1 0 2 79 1 0 3 80 1 0 3 81 1 0 4 82 1 0 4 83 1 0 6 84 1 0 8 85 1 0 9 86 1 0 9 87 1 0 10 88 1 0 11 89 1 0 12 90 1 0 12 91 1 0 13 92 1 0 13 93 1 0 14 94 1 0 15 95 1 0 15 96 1 0 16 97 1 0 18 98 1 0 20 99 1 0 21100 1 0 21101 1 0 22102 1 0 23103 1 0 25104 1 0 27105 1 0 28106 1 0 28107 1 0 29108 1 0 30109 1 0 31110 1 0 32111 1 0 33112 1 0 34113 1 0 35114 1 0 36115 1 0 38116 1 0 40117 1 0 41118 1 0 41119 1 0 42120 1 0 43121 1 0 44122 1 0 45123 1 0 46124 1 0 47125 1 0 48126 1 0 49127 1 0 50128 1 0 51129 1 0 51130 1 0 52131 1 0 52132 1 0 54133 1 0 54134 1 0 54135 1 0 55136 1 0 56137 1 0 56138 1 0 57139 1 0 57140 1 0 59141 1 0 59142 1 0 59143 1 0 60144 1 0 61145 1 0 62146 1 0 62147 1 0 62148 1 0 63149 1 0 63150 1 0 65151 1 0 67152 1 0 68153 1 0 68154 1 0 69155 1 0 70156 1 0 71157 1 0 72158 1 0 73159 1 0 74160 1 0 75161 1 0 M END PDB for HMDB0030117 (Asparagoside G)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 3.218 1.992 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 3.700 0.529 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 2.794 -0.724 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 3.703 -1.964 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 2.799 -3.211 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 1.334 -2.739 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -0.001 -3.509 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -1.333 -2.741 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -1.331 -1.201 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -0.004 -0.434 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 1.331 -1.194 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 1.490 0.334 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 0.001 -5.052 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -1.328 -5.817 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 -2.663 -5.052 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 -3.998 -5.822 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -5.327 -5.054 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -5.327 -3.514 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -4.003 -2.749 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -2.671 -3.509 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -2.671 -1.976 0.000 0.00 0.00 C+0 HETATM 22 O UNK 0 5.163 -1.486 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 5.166 0.057 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 6.696 -0.105 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 7.599 1.142 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 9.132 0.983 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 9.758 -0.423 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 5.479 1.560 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 10.038 2.230 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 11.568 2.072 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 12.469 3.319 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 14.001 3.160 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 14.902 4.410 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 16.435 4.251 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 17.338 5.501 0.000 0.00 0.00 O+0 HETATM 36 O UNK 0 10.307 4.885 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 11.842 4.728 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 12.743 5.976 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 14.276 5.817 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 15.177 7.064 0.000 0.00 0.00 O+0 HETATM 41 O UNK 0 12.114 7.380 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 -6.665 -5.827 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 -8.000 -5.057 0.000 0.00 0.00 C+0 HETATM 44 O UNK 0 -7.997 -3.524 0.000 0.00 0.00 O+0 HETATM 45 C UNK 0 -9.337 -2.749 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 -9.337 -1.217 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 -8.005 -0.447 0.000 0.00 0.00 O+0 HETATM 48 O UNK 0 -9.334 -7.375 0.000 0.00 0.00 O+0 HETATM 49 C UNK 0 -9.337 -5.829 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -10.667 -5.062 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -10.669 -3.522 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 -12.405 -2.523 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 -15.310 4.448 0.000 0.00 0.00 O+0 HETATM 54 C UNK 0 -15.310 2.908 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -13.891 2.192 0.000 0.00 0.00 C+0 HETATM 56 O UNK 0 -13.893 0.652 0.000 0.00 0.00 O+0 HETATM 57 C UNK 0 -12.402 -0.064 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -11.180 0.778 0.000 0.00 0.00 C+0 HETATM 59 O UNK 0 -9.848 0.010 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 -12.646 4.551 0.000 0.00 0.00 O+0 HETATM 61 C UNK 0 -12.643 3.013 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -11.270 2.320 0.000 0.00 0.00 C+0 HETATM 63 O UNK 0 -9.935 3.088 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 -12.004 -5.837 0.000 0.00 0.00 O+0 HETATM 65 C UNK 0 -13.334 -5.067 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 -13.334 -3.532 0.000 0.00 0.00 O+0 HETATM 67 C UNK 0 -14.671 -2.759 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 -14.671 -1.222 0.000 0.00 0.00 C+0 HETATM 69 O UNK 0 -16.008 -0.449 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 -14.669 -7.380 0.000 0.00 0.00 O+0 HETATM 71 C UNK 0 -14.669 -5.840 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 -15.998 -5.075 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -16.006 -3.530 0.000 0.00 0.00 C+0 HETATM 74 O UNK 0 -17.338 -2.762 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 -17.336 -5.842 0.000 0.00 0.00 O+0 CONECT 1 2 CONECT 2 1 3 23 CONECT 3 2 4 11 CONECT 4 3 5 22 CONECT 5 4 6 CONECT 6 5 7 11 CONECT 7 6 8 13 CONECT 8 7 9 20 CONECT 9 8 10 CONECT 10 9 11 CONECT 11 3 6 10 12 CONECT 12 11 CONECT 13 7 14 CONECT 14 13 15 CONECT 15 14 16 20 CONECT 16 15 17 CONECT 17 16 18 42 CONECT 18 17 19 CONECT 19 18 20 CONECT 20 8 15 19 21 CONECT 21 20 CONECT 22 4 23 CONECT 23 2 22 24 28 CONECT 24 23 25 CONECT 25 24 26 CONECT 26 25 27 29 CONECT 27 26 CONECT 28 23 CONECT 29 26 30 CONECT 30 29 31 CONECT 31 30 32 37 CONECT 32 31 33 CONECT 33 32 34 39 CONECT 34 33 35 CONECT 35 34 CONECT 36 37 CONECT 37 31 36 38 CONECT 38 37 39 41 CONECT 39 33 38 40 CONECT 40 39 CONECT 41 38 CONECT 42 17 43 CONECT 43 42 44 49 CONECT 44 43 45 CONECT 45 44 46 51 CONECT 46 45 47 CONECT 47 46 CONECT 48 49 CONECT 49 43 48 50 CONECT 50 49 51 64 CONECT 51 45 50 52 CONECT 52 51 57 CONECT 53 54 CONECT 54 53 55 CONECT 55 54 56 61 CONECT 56 55 57 CONECT 57 52 56 58 CONECT 58 57 59 62 CONECT 59 58 CONECT 60 61 CONECT 61 55 60 62 CONECT 62 58 61 63 CONECT 63 62 CONECT 64 50 65 CONECT 65 64 66 71 CONECT 66 65 67 CONECT 67 66 68 73 CONECT 68 67 69 CONECT 69 68 CONECT 70 71 CONECT 71 65 70 72 CONECT 72 71 73 75 CONECT 73 67 72 74 CONECT 74 73 CONECT 75 72 MASTER 0 0 0 0 0 0 0 0 75 0 166 0 END 3D PDB for HMDB0030117 (Asparagoside G)COMPND HMDB0030117 HETATM 1 C1 UNL 1 9.877 1.908 1.451 1.00 0.00 C HETATM 2 C2 UNL 1 9.787 0.394 1.171 1.00 0.00 C HETATM 3 C3 UNL 1 9.590 0.168 -0.266 1.00 0.00 C HETATM 4 C4 UNL 1 8.376 0.721 -0.939 1.00 0.00 C HETATM 5 C5 UNL 1 7.073 0.245 -0.503 1.00 0.00 C HETATM 6 O1 UNL 1 6.960 -1.141 -0.594 1.00 0.00 O HETATM 7 O2 UNL 1 6.121 0.650 -1.590 1.00 0.00 O HETATM 8 C6 UNL 1 4.898 0.272 -1.113 1.00 0.00 C HETATM 9 C7 UNL 1 3.823 1.306 -1.320 1.00 0.00 C HETATM 10 C8 UNL 1 3.015 1.395 -0.018 1.00 0.00 C HETATM 11 C9 UNL 1 1.607 0.975 -0.350 1.00 0.00 C HETATM 12 C10 UNL 1 0.906 2.192 -0.908 1.00 0.00 C HETATM 13 C11 UNL 1 -0.252 2.683 -0.117 1.00 0.00 C HETATM 14 C12 UNL 1 -1.220 1.517 0.071 1.00 0.00 C HETATM 15 C13 UNL 1 -1.583 0.879 -1.223 1.00 0.00 C HETATM 16 C14 UNL 1 -2.573 -0.217 -0.994 1.00 0.00 C HETATM 17 O3 UNL 1 -3.612 0.280 -0.195 1.00 0.00 O HETATM 18 C15 UNL 1 -4.863 0.021 -0.841 1.00 0.00 C HETATM 19 O4 UNL 1 -5.725 1.035 -0.794 1.00 0.00 O HETATM 20 C16 UNL 1 -6.352 1.070 0.487 1.00 0.00 C HETATM 21 C17 UNL 1 -6.785 2.456 0.744 1.00 0.00 C HETATM 22 O5 UNL 1 -7.660 3.007 -0.180 1.00 0.00 O HETATM 23 C18 UNL 1 -7.456 0.018 0.521 1.00 0.00 C HETATM 24 O6 UNL 1 -8.641 0.530 0.092 1.00 0.00 O HETATM 25 C19 UNL 1 -9.750 0.416 0.888 1.00 0.00 C HETATM 26 O7 UNL 1 -9.894 1.745 1.453 1.00 0.00 O HETATM 27 C20 UNL 1 -10.705 1.687 2.570 1.00 0.00 C HETATM 28 C21 UNL 1 -9.989 1.269 3.833 1.00 0.00 C HETATM 29 O8 UNL 1 -10.862 1.264 4.930 1.00 0.00 O HETATM 30 C22 UNL 1 -11.819 0.641 2.363 1.00 0.00 C HETATM 31 O9 UNL 1 -12.901 1.059 3.108 1.00 0.00 O HETATM 32 C23 UNL 1 -12.199 0.649 0.922 1.00 0.00 C HETATM 33 O10 UNL 1 -13.229 -0.299 0.734 1.00 0.00 O HETATM 34 C24 UNL 1 -11.013 0.264 0.073 1.00 0.00 C HETATM 35 O11 UNL 1 -10.939 1.123 -1.059 1.00 0.00 O HETATM 36 C25 UNL 1 -6.962 -1.203 -0.233 1.00 0.00 C HETATM 37 O12 UNL 1 -7.602 -1.289 -1.437 1.00 0.00 O HETATM 38 C26 UNL 1 -8.196 -2.531 -1.645 1.00 0.00 C HETATM 39 O13 UNL 1 -9.588 -2.515 -1.504 1.00 0.00 O HETATM 40 C27 UNL 1 -10.183 -3.649 -2.073 1.00 0.00 C HETATM 41 C28 UNL 1 -11.535 -3.922 -1.483 1.00 0.00 C HETATM 42 O14 UNL 1 -11.347 -4.183 -0.111 1.00 0.00 O HETATM 43 C29 UNL 1 -10.104 -3.600 -3.564 1.00 0.00 C HETATM 44 O15 UNL 1 -11.265 -3.096 -4.110 1.00 0.00 O HETATM 45 C30 UNL 1 -8.938 -2.695 -3.973 1.00 0.00 C HETATM 46 O16 UNL 1 -8.596 -2.920 -5.280 1.00 0.00 O HETATM 47 C31 UNL 1 -7.820 -3.052 -2.979 1.00 0.00 C HETATM 48 O17 UNL 1 -6.664 -2.371 -3.407 1.00 0.00 O HETATM 49 C32 UNL 1 -5.455 -1.244 -0.288 1.00 0.00 C HETATM 50 O18 UNL 1 -5.031 -1.499 1.021 1.00 0.00 O HETATM 51 C33 UNL 1 -1.798 -1.264 -0.181 1.00 0.00 C HETATM 52 C34 UNL 1 -1.389 -0.681 1.145 1.00 0.00 C HETATM 53 C35 UNL 1 -0.524 0.567 0.995 1.00 0.00 C HETATM 54 C36 UNL 1 -0.612 1.212 2.380 1.00 0.00 C HETATM 55 C37 UNL 1 0.860 0.196 0.631 1.00 0.00 C HETATM 56 C38 UNL 1 1.641 -0.081 1.935 1.00 0.00 C HETATM 57 C39 UNL 1 2.969 -0.618 1.412 1.00 0.00 C HETATM 58 C40 UNL 1 3.767 0.634 0.993 1.00 0.00 C HETATM 59 C41 UNL 1 4.035 1.365 2.283 1.00 0.00 C HETATM 60 C42 UNL 1 4.992 0.156 0.366 1.00 0.00 C HETATM 61 C43 UNL 1 6.301 0.881 0.595 1.00 0.00 C HETATM 62 C44 UNL 1 6.230 2.357 0.318 1.00 0.00 C HETATM 63 C45 UNL 1 10.941 -0.283 1.801 1.00 0.00 C HETATM 64 O19 UNL 1 12.160 0.079 1.432 1.00 0.00 O HETATM 65 C46 UNL 1 12.721 -0.239 0.245 1.00 0.00 C HETATM 66 O20 UNL 1 13.082 0.907 -0.418 1.00 0.00 O HETATM 67 C47 UNL 1 13.821 0.792 -1.549 1.00 0.00 C HETATM 68 C48 UNL 1 13.192 0.064 -2.698 1.00 0.00 C HETATM 69 O21 UNL 1 12.904 -1.258 -2.405 1.00 0.00 O HETATM 70 C49 UNL 1 15.164 0.177 -1.183 1.00 0.00 C HETATM 71 O22 UNL 1 16.193 1.087 -1.389 1.00 0.00 O HETATM 72 C50 UNL 1 15.181 -0.219 0.265 1.00 0.00 C HETATM 73 O23 UNL 1 16.314 -0.996 0.525 1.00 0.00 O HETATM 74 C51 UNL 1 13.984 -1.072 0.593 1.00 0.00 C HETATM 75 O24 UNL 1 14.035 -1.328 1.967 1.00 0.00 O HETATM 76 H1 UNL 1 9.696 2.019 2.538 1.00 0.00 H HETATM 77 H2 UNL 1 9.127 2.466 0.888 1.00 0.00 H HETATM 78 H3 UNL 1 10.914 2.257 1.201 1.00 0.00 H HETATM 79 H4 UNL 1 8.836 0.112 1.751 1.00 0.00 H HETATM 80 H5 UNL 1 9.726 -0.927 -0.519 1.00 0.00 H HETATM 81 H6 UNL 1 10.463 0.649 -0.804 1.00 0.00 H HETATM 82 H7 UNL 1 8.496 1.845 -0.884 1.00 0.00 H HETATM 83 H8 UNL 1 8.484 0.550 -2.069 1.00 0.00 H HETATM 84 H9 UNL 1 7.679 -1.601 -0.090 1.00 0.00 H HETATM 85 H10 UNL 1 4.648 -0.713 -1.604 1.00 0.00 H HETATM 86 H11 UNL 1 4.158 2.265 -1.693 1.00 0.00 H HETATM 87 H12 UNL 1 3.170 0.884 -2.145 1.00 0.00 H HETATM 88 H13 UNL 1 2.948 2.492 0.193 1.00 0.00 H HETATM 89 H14 UNL 1 1.735 0.313 -1.276 1.00 0.00 H HETATM 90 H15 UNL 1 0.603 2.053 -1.958 1.00 0.00 H HETATM 91 H16 UNL 1 1.631 3.065 -0.958 1.00 0.00 H HETATM 92 H17 UNL 1 -0.782 3.430 -0.754 1.00 0.00 H HETATM 93 H18 UNL 1 -0.007 3.077 0.868 1.00 0.00 H HETATM 94 H19 UNL 1 -2.154 1.870 0.562 1.00 0.00 H HETATM 95 H20 UNL 1 -0.687 0.517 -1.787 1.00 0.00 H HETATM 96 H21 UNL 1 -2.057 1.618 -1.919 1.00 0.00 H HETATM 97 H22 UNL 1 -2.862 -0.656 -1.941 1.00 0.00 H HETATM 98 H23 UNL 1 -4.569 -0.248 -1.869 1.00 0.00 H HETATM 99 H24 UNL 1 -5.536 0.812 1.196 1.00 0.00 H HETATM 100 H25 UNL 1 -5.892 3.137 0.802 1.00 0.00 H HETATM 101 H26 UNL 1 -7.265 2.560 1.762 1.00 0.00 H HETATM 102 H27 UNL 1 -7.458 3.963 -0.359 1.00 0.00 H HETATM 103 H28 UNL 1 -7.566 -0.315 1.567 1.00 0.00 H HETATM 104 H29 UNL 1 -9.687 -0.223 1.756 1.00 0.00 H HETATM 105 H30 UNL 1 -11.220 2.642 2.774 1.00 0.00 H HETATM 106 H31 UNL 1 -9.175 1.957 4.054 1.00 0.00 H HETATM 107 H32 UNL 1 -9.638 0.200 3.756 1.00 0.00 H HETATM 108 H33 UNL 1 -11.536 2.003 4.890 1.00 0.00 H HETATM 109 H34 UNL 1 -11.469 -0.332 2.734 1.00 0.00 H HETATM 110 H35 UNL 1 -13.076 2.010 3.059 1.00 0.00 H HETATM 111 H36 UNL 1 -12.645 1.615 0.606 1.00 0.00 H HETATM 112 H37 UNL 1 -13.726 -0.064 -0.114 1.00 0.00 H HETATM 113 H38 UNL 1 -11.195 -0.727 -0.337 1.00 0.00 H HETATM 114 H39 UNL 1 -10.436 0.694 -1.804 1.00 0.00 H HETATM 115 H40 UNL 1 -7.299 -2.132 0.347 1.00 0.00 H HETATM 116 H41 UNL 1 -7.885 -3.261 -0.847 1.00 0.00 H HETATM 117 H42 UNL 1 -9.538 -4.521 -1.738 1.00 0.00 H HETATM 118 H43 UNL 1 -12.234 -3.065 -1.621 1.00 0.00 H HETATM 119 H44 UNL 1 -11.955 -4.837 -1.922 1.00 0.00 H HETATM 120 H45 UNL 1 -10.684 -4.919 -0.060 1.00 0.00 H HETATM 121 H46 UNL 1 -9.881 -4.606 -3.948 1.00 0.00 H HETATM 122 H47 UNL 1 -12.056 -3.460 -3.589 1.00 0.00 H HETATM 123 H48 UNL 1 -9.236 -1.671 -3.721 1.00 0.00 H HETATM 124 H49 UNL 1 -9.458 -2.875 -5.803 1.00 0.00 H HETATM 125 H50 UNL 1 -7.637 -4.148 -3.014 1.00 0.00 H HETATM 126 H51 UNL 1 -6.843 -1.398 -3.293 1.00 0.00 H HETATM 127 H52 UNL 1 -5.156 -2.143 -0.899 1.00 0.00 H HETATM 128 H53 UNL 1 -4.671 -2.423 1.126 1.00 0.00 H HETATM 129 H54 UNL 1 -0.903 -1.519 -0.771 1.00 0.00 H HETATM 130 H55 UNL 1 -2.360 -2.179 -0.001 1.00 0.00 H HETATM 131 H56 UNL 1 -2.268 -0.493 1.796 1.00 0.00 H HETATM 132 H57 UNL 1 -0.746 -1.420 1.654 1.00 0.00 H HETATM 133 H58 UNL 1 -1.649 1.636 2.531 1.00 0.00 H HETATM 134 H59 UNL 1 -0.521 0.445 3.191 1.00 0.00 H HETATM 135 H60 UNL 1 0.087 2.010 2.564 1.00 0.00 H HETATM 136 H61 UNL 1 0.772 -0.872 0.225 1.00 0.00 H HETATM 137 H62 UNL 1 1.736 0.865 2.450 1.00 0.00 H HETATM 138 H63 UNL 1 1.191 -0.870 2.535 1.00 0.00 H HETATM 139 H64 UNL 1 3.518 -1.158 2.179 1.00 0.00 H HETATM 140 H65 UNL 1 2.788 -1.232 0.501 1.00 0.00 H HETATM 141 H66 UNL 1 3.768 0.759 3.198 1.00 0.00 H HETATM 142 H67 UNL 1 3.461 2.303 2.389 1.00 0.00 H HETATM 143 H68 UNL 1 5.136 1.539 2.425 1.00 0.00 H HETATM 144 H69 UNL 1 5.205 -0.909 0.602 1.00 0.00 H HETATM 145 H70 UNL 1 6.730 0.644 1.568 1.00 0.00 H HETATM 146 H71 UNL 1 5.234 2.797 0.369 1.00 0.00 H HETATM 147 H72 UNL 1 6.831 2.875 1.120 1.00 0.00 H HETATM 148 H73 UNL 1 6.673 2.669 -0.644 1.00 0.00 H HETATM 149 H74 UNL 1 10.786 -0.138 2.938 1.00 0.00 H HETATM 150 H75 UNL 1 10.749 -1.409 1.640 1.00 0.00 H HETATM 151 H76 UNL 1 12.045 -0.890 -0.339 1.00 0.00 H HETATM 152 H77 UNL 1 14.020 1.838 -1.922 1.00 0.00 H HETATM 153 H78 UNL 1 12.248 0.598 -3.024 1.00 0.00 H HETATM 154 H79 UNL 1 13.846 0.082 -3.606 1.00 0.00 H HETATM 155 H80 UNL 1 13.729 -1.804 -2.539 1.00 0.00 H HETATM 156 H81 UNL 1 15.300 -0.742 -1.830 1.00 0.00 H HETATM 157 H82 UNL 1 16.626 0.879 -2.236 1.00 0.00 H HETATM 158 H83 UNL 1 15.137 0.682 0.900 1.00 0.00 H HETATM 159 H84 UNL 1 16.732 -1.194 -0.368 1.00 0.00 H HETATM 160 H85 UNL 1 13.963 -2.001 0.023 1.00 0.00 H HETATM 161 H86 UNL 1 14.104 -0.451 2.440 1.00 0.00 H CONECT 1 2 76 77 78 CONECT 2 3 63 79 CONECT 3 4 80 81 CONECT 4 5 82 83 CONECT 5 6 7 61 CONECT 6 84 CONECT 7 8 CONECT 8 9 60 85 CONECT 9 10 86 87 CONECT 10 11 58 88 CONECT 11 12 55 89 CONECT 12 13 90 91 CONECT 13 14 92 93 CONECT 14 15 53 94 CONECT 15 16 95 96 CONECT 16 17 51 97 CONECT 17 18 CONECT 18 19 49 98 CONECT 19 20 CONECT 20 21 23 99 CONECT 21 22 100 101 CONECT 22 102 CONECT 23 24 36 103 CONECT 24 25 CONECT 25 26 34 104 CONECT 26 27 CONECT 27 28 30 105 CONECT 28 29 106 107 CONECT 29 108 CONECT 30 31 32 109 CONECT 31 110 CONECT 32 33 34 111 CONECT 33 112 CONECT 34 35 113 CONECT 35 114 CONECT 36 37 49 115 CONECT 37 38 CONECT 38 39 47 116 CONECT 39 40 CONECT 40 41 43 117 CONECT 41 42 118 119 CONECT 42 120 CONECT 43 44 45 121 CONECT 44 122 CONECT 45 46 47 123 CONECT 46 124 CONECT 47 48 125 CONECT 48 126 CONECT 49 50 127 CONECT 50 128 CONECT 51 52 129 130 CONECT 52 53 131 132 CONECT 53 54 55 CONECT 54 133 134 135 CONECT 55 56 136 CONECT 56 57 137 138 CONECT 57 58 139 140 CONECT 58 59 60 CONECT 59 141 142 143 CONECT 60 61 144 CONECT 61 62 145 CONECT 62 146 147 148 CONECT 63 64 149 150 CONECT 64 65 CONECT 65 66 74 151 CONECT 66 67 CONECT 67 68 70 152 CONECT 68 69 153 154 CONECT 69 155 CONECT 70 71 72 156 CONECT 71 157 CONECT 72 73 74 158 CONECT 73 159 CONECT 74 75 160 CONECT 75 161 END SMILES for HMDB0030117 (Asparagoside G)CC(CCC1(O)OC2CC3C4CCC5CC(CCC5(C)C4CCC3(C)C2C1C)OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O)COC1OC(CO)C(O)C(O)C1O INCHI for HMDB0030117 (Asparagoside G)InChI=1S/C51H86O24/c1-20(19-67-45-39(62)36(59)33(56)28(15-52)69-45)7-12-51(66)21(2)32-27(75-51)14-26-24-6-5-22-13-23(8-10-49(22,3)25(24)9-11-50(26,32)4)68-48-42(65)44(74-47-41(64)38(61)35(58)30(17-54)71-47)43(31(18-55)72-48)73-46-40(63)37(60)34(57)29(16-53)70-46/h20-48,52-66H,5-19H2,1-4H3 3D Structure for HMDB0030117 (Asparagoside G) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C51H86O24 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1083.2141 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1082.55090368 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-[(5-hydroxy-6-{[6-hydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-2-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-[(5-hydroxy-6-{[6-hydroxy-7,9,13-trimethyl-6-(3-methyl-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}butyl)-5-oxapentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan-16-yl]oxy}-2-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 60267-27-8 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(CCC1(O)OC2CC3C4CCC5CC(CCC5(C)C4CCC3(C)C2C1C)OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O)COC1OC(CO)C(O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C51H86O24/c1-20(19-67-45-39(62)36(59)33(56)28(15-52)69-45)7-12-51(66)21(2)32-27(75-51)14-26-24-6-5-22-13-23(8-10-49(22,3)25(24)9-11-50(26,32)4)68-48-42(65)44(74-47-41(64)38(61)35(58)30(17-54)71-47)43(31(18-55)72-48)73-46-40(63)37(60)34(57)29(16-53)70-46/h20-48,52-66H,5-19H2,1-4H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | RZZKWHQUBSTBSP-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as steroidal saponins. These are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Steroids and steroid derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Steroidal glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Steroidal saponins | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB001918 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 2305845 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 3042722 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|