Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:47:07 UTC

Update Date

2022-03-07 02:53:12 UTC

HMDB ID

HMDB0031999

Secondary Accession Numbers

HMDB31999

Metabolite Identification

Common Name

Casuarine 6-alpha-D-glucoside

Description

Casuarine 6-alpha-D-glucoside belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. Based on a literature review very few articles have been published on Casuarine 6-alpha-D-glucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

HMDB0031999
     RDKit          3D
Casuarine 6-alpha-D-glucoside
 50 52  0  0  0  0  0  0  0  0999 V2000
    1.8797    2.0792    0.9677 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8465    1.4219    0.2160 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4967    0.4046    1.0867 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6041   -0.5269    1.5590 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9246   -1.2309    0.5901 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9318   -0.4571    0.0946 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3505   -0.7502    0.3430 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0297    0.4409    0.9938 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4419    0.1933    0.7422 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1571    1.4289    0.5905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4032    1.3412    1.4752 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1019    2.5270    1.3381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6033    1.5497   -0.8274 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7686    2.4545   -1.5109 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4151    0.1945   -1.4275 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6750   -0.4131   -1.5640 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5371   -0.5446   -0.4764 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1284   -0.7460   -0.9782 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9581   -1.8894   -1.6996 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8322   -1.9342   -0.2990 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8689   -1.5138   -1.6206 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2585   -1.8010    0.1980 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4640   -2.4645    1.3924 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -0.3488    0.4154 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8321   -0.2118    1.0786 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7172    2.9657    0.5609 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4859    1.0485   -0.7439 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6313    2.2039   -0.0202 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8743    0.9459    1.9964 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3595   -2.0374    1.1816 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5813   -1.6137    0.9556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8707    0.4561    2.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7193    1.4071    0.4954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5365    2.2992    0.9053 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9885    0.4576    1.1481 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0340    1.2519    2.5089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0595    2.4459    1.5584 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6484    1.9078   -0.9196 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2100    2.6578   -2.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0011    0.2675   -2.4540 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5805   -1.2725   -2.0152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9801   -1.5685   -0.3393 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8220    0.1526   -1.5223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5827   -2.6240   -1.4703 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6155   -3.0407   -0.3049 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9640   -1.1629   -1.8361 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9770   -2.2071   -0.5450 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8495   -3.2315    1.4132 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7418    0.0962   -0.5952 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3959   -1.0087    0.8370 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
  5 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24  3  1  0
 18  7  1  0
 17  9  1  0
  1 26  1  0
  2 27  1  0
  2 28  1  0
  3 29  1  0
  5 30  1  0
  7 31  1  0
  8 32  1  0
  8 33  1  0
 10 34  1  0
 11 35  1  0
 11 36  1  0
 12 37  1  0
 13 38  1  0
 14 39  1  0
 15 40  1  0
 16 41  1  0
 17 42  1  0
 18 43  1  0
 19 44  1  0
 20 45  1  0
 21 46  1  0
 22 47  1  0
 23 48  1  0
 24 49  1  0
 25 50  1  0
M  END

  Mrv0541 05061306172D          

 25 27  0  0  0  0            999 V2000
    1.5692    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2549    0.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792    4.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0542    1.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2917    3.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7846    1.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4849    1.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5692    2.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167    3.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5292    2.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167    2.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2917    2.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7846    1.0799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0619   -0.1311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2917    5.0648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3099    1.4924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8242    2.9445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5292    4.3503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2549    2.9445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3542    2.9214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5292    1.4924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792    1.4924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792    2.9214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  1  1  0  0  0  0
  6  3  1  0  0  0  0
  8  4  1  0  0  0  0
  9  5  1  0  0  0  0
  9  7  1  0  0  0  0
 10  6  1  0  0  0  0
 11  7  1  0  0  0  0
 11  8  1  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15  1  1  0  0  0  0
 15  4  1  0  0  0  0
 15  7  1  0  0  0  0
 16  2  1  0  0  0  0
 17  3  1  0  0  0  0
 18  8  1  0  0  0  0
 19  9  1  0  0  0  0
 20 10  1  0  0  0  0
 21 11  1  0  0  0  0
 22 12  1  0  0  0  0
 23 13  1  0  0  0  0
 24  5  1  0  0  0  0
 24 14  1  0  0  0  0
 25  6  1  0  0  0  0
 25 14  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0031999

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1C(O)C(O)C2C(O)C(CN12)OC1OC(CO)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C14H25NO10/c16-2-4-8(18)11(21)7-9(19)5(1-15(4)7)24-14-13(23)12(22)10(20)6(3-17)25-14/h4-14,16-23H,1-3H2

> <INCHI_KEY>
KQYACACELNVFOY-UHFFFAOYSA-N

> <FORMULA>
C14H25NO10

> <MOLECULAR_WEIGHT>
367.349

> <EXACT_MASS>
367.147846025

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_AVERAGE_POLARIZABILITY>
35.31378946023078

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
3-(hydroxymethyl)-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-hexahydro-1H-pyrrolizine-1,2,7-triol

> <ALOGPS_LOGP>
-3.16

> <JCHEM_LOGP>
-5.015623706666666

> <ALOGPS_LOGS>
0.19

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
1

> <JCHEM_PKA>
12.842968392864428

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.144859013699852

> <JCHEM_PKA_STRONGEST_BASIC>
7.63398123849549

> <JCHEM_POLAR_SURFACE_AREA>
183.54

> <JCHEM_REFRACTIVITY>
77.9461

> <JCHEM_ROTATABLE_BOND_COUNT>
4

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
5.69e+02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
3-(hydroxymethyl)-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-hexahydro-1H-pyrrolizine-1,2,7-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0031999
     RDKit          3D
Casuarine 6-alpha-D-glucoside
 50 52  0  0  0  0  0  0  0  0999 V2000
    1.8797    2.0792    0.9677 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8465    1.4219    0.2160 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4967    0.4046    1.0867 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6041   -0.5269    1.5590 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9246   -1.2309    0.5901 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9318   -0.4571    0.0946 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3505   -0.7502    0.3430 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0297    0.4409    0.9938 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4419    0.1933    0.7422 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1571    1.4289    0.5905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4032    1.3412    1.4752 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1019    2.5270    1.3381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6033    1.5497   -0.8274 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7686    2.4545   -1.5109 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4151    0.1945   -1.4275 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6750   -0.4131   -1.5640 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5371   -0.5446   -0.4764 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1284   -0.7460   -0.9782 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9581   -1.8894   -1.6996 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8322   -1.9342   -0.2990 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8689   -1.5138   -1.6206 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2585   -1.8010    0.1980 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4640   -2.4645    1.3924 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -0.3488    0.4154 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8321   -0.2118    1.0786 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7172    2.9657    0.5609 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4859    1.0485   -0.7439 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6313    2.2039   -0.0202 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8743    0.9459    1.9964 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3595   -2.0374    1.1816 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5813   -1.6137    0.9556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8707    0.4561    2.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7193    1.4071    0.4954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5365    2.2992    0.9053 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9885    0.4576    1.1481 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0340    1.2519    2.5089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0595    2.4459    1.5584 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6484    1.9078   -0.9196 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2100    2.6578   -2.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0011    0.2675   -2.4540 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5805   -1.2725   -2.0152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9801   -1.5685   -0.3393 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8220    0.1526   -1.5223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5827   -2.6240   -1.4703 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6155   -3.0407   -0.3049 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9640   -1.1629   -1.8361 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9770   -2.2071   -0.5450 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8495   -3.2315    1.4132 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7418    0.0962   -0.5952 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3959   -1.0087    0.8370 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
  5 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24  3  1  0
 18  7  1  0
 17  9  1  0
  1 26  1  0
  2 27  1  0
  2 28  1  0
  3 29  1  0
  5 30  1  0
  7 31  1  0
  8 32  1  0
  8 33  1  0
 10 34  1  0
 11 35  1  0
 11 36  1  0
 12 37  1  0
 13 38  1  0
 14 39  1  0
 15 40  1  0
 16 41  1  0
 17 42  1  0
 18 43  1  0
 19 44  1  0
 20 45  1  0
 21 46  1  0
 22 47  1  0
 23 48  1  0
 24 49  1  0
 25 50  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       2.929   1.540   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -0.476   0.075   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       5.375   8.121   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       3.835   2.786   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       6.145   6.787   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       1.465   3.556   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -0.905   2.786   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       2.929   4.032   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       7.685   6.787   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000   4.032   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       8.455   5.453   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       7.685   4.120   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       6.145   4.120   0.000  0.00  0.00           C+0
HETATM   15  N   UNK     0       1.465   2.016   0.000  0.00  0.00           N+0
HETATM   16  O   UNK     0      -1.982  -0.245   0.000  0.00  0.00           O+0
HETATM   17  O   UNK     0       6.145   9.454   0.000  0.00  0.00           O+0
HETATM   18  O   UNK     0      -2.445   2.786   0.000  0.00  0.00           O+0
HETATM   19  O   UNK     0       3.405   5.496   0.000  0.00  0.00           O+0
HETATM   20  O   UNK     0       8.455   8.121   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0      -0.476   5.496   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0       9.995   5.453   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       8.455   2.786   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       5.375   2.786   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       5.375   5.453   0.000  0.00  0.00           O+0
CONECT    1    5   15                                                       
CONECT    2    4   16                                                       
CONECT    3    6   17                                                       
CONECT    4    2    8   15                                                  
CONECT    5    1    9   24                                                  
CONECT    6    3   10   25                                                  
CONECT    7    9   11   15                                                  
CONECT    8    4   11   18                                                  
CONECT    9    5    7   19                                                  
CONECT   10    6   12   20                                                  
CONECT   11    7    8   21                                                  
CONECT   12   10   13   22                                                  
CONECT   13   12   14   23                                                  
CONECT   14   13   24   25                                                  
CONECT   15    1    4    7                                                  
CONECT   16    2                                                            
CONECT   17    3                                                            
CONECT   18    8                                                            
CONECT   19    9                                                            
CONECT   20   10                                                            
CONECT   21   11                                                            
CONECT   22   12                                                            
CONECT   23   13                                                            
CONECT   24    5   14                                                       
CONECT   25    6   14                                                       
MASTER        0    0    0    0    0    0    0    0   25    0   54    0
END

COMPND    HMDB0031999
HETATM    1  O1  UNL     1       1.880   2.079   0.968  1.00  0.00           O  
HETATM    2  C1  UNL     1       2.846   1.422   0.216  1.00  0.00           C  
HETATM    3  C2  UNL     1       3.497   0.405   1.087  1.00  0.00           C  
HETATM    4  O2  UNL     1       2.604  -0.527   1.559  1.00  0.00           O  
HETATM    5  C3  UNL     1       1.925  -1.231   0.590  1.00  0.00           C  
HETATM    6  O3  UNL     1       0.932  -0.457   0.095  1.00  0.00           O  
HETATM    7  C4  UNL     1      -0.351  -0.750   0.343  1.00  0.00           C  
HETATM    8  C5  UNL     1      -1.030   0.441   0.994  1.00  0.00           C  
HETATM    9  N1  UNL     1      -2.442   0.193   0.742  1.00  0.00           N  
HETATM   10  C6  UNL     1      -3.157   1.429   0.591  1.00  0.00           C  
HETATM   11  C7  UNL     1      -4.403   1.341   1.475  1.00  0.00           C  
HETATM   12  O4  UNL     1      -5.102   2.527   1.338  1.00  0.00           O  
HETATM   13  C8  UNL     1      -3.603   1.550  -0.827  1.00  0.00           C  
HETATM   14  O5  UNL     1      -2.769   2.454  -1.511  1.00  0.00           O  
HETATM   15  C9  UNL     1      -3.415   0.195  -1.427  1.00  0.00           C  
HETATM   16  O6  UNL     1      -4.675  -0.413  -1.564  1.00  0.00           O  
HETATM   17  C10 UNL     1      -2.537  -0.545  -0.476  1.00  0.00           C  
HETATM   18  C11 UNL     1      -1.128  -0.746  -0.978  1.00  0.00           C  
HETATM   19  O7  UNL     1      -0.958  -1.889  -1.700  1.00  0.00           O  
HETATM   20  C12 UNL     1       2.832  -1.934  -0.299  1.00  0.00           C  
HETATM   21  O8  UNL     1       2.869  -1.514  -1.621  1.00  0.00           O  
HETATM   22  C13 UNL     1       4.259  -1.801   0.198  1.00  0.00           C  
HETATM   23  O9  UNL     1       4.464  -2.464   1.392  1.00  0.00           O  
HETATM   24  C14 UNL     1       4.634  -0.349   0.415  1.00  0.00           C  
HETATM   25  O10 UNL     1       5.832  -0.212   1.079  1.00  0.00           O  
HETATM   26  H1  UNL     1       1.717   2.966   0.561  1.00  0.00           H  
HETATM   27  H2  UNL     1       2.486   1.049  -0.744  1.00  0.00           H  
HETATM   28  H3  UNL     1       3.631   2.204  -0.020  1.00  0.00           H  
HETATM   29  H4  UNL     1       3.874   0.946   1.996  1.00  0.00           H  
HETATM   30  H5  UNL     1       1.360  -2.037   1.182  1.00  0.00           H  
HETATM   31  H6  UNL     1      -0.581  -1.614   0.956  1.00  0.00           H  
HETATM   32  H7  UNL     1      -0.871   0.456   2.079  1.00  0.00           H  
HETATM   33  H8  UNL     1      -0.719   1.407   0.495  1.00  0.00           H  
HETATM   34  H9  UNL     1      -2.537   2.299   0.905  1.00  0.00           H  
HETATM   35  H10 UNL     1      -4.988   0.458   1.148  1.00  0.00           H  
HETATM   36  H11 UNL     1      -4.034   1.252   2.509  1.00  0.00           H  
HETATM   37  H12 UNL     1      -6.059   2.446   1.558  1.00  0.00           H  
HETATM   38  H13 UNL     1      -4.648   1.908  -0.920  1.00  0.00           H  
HETATM   39  H14 UNL     1      -3.210   2.658  -2.369  1.00  0.00           H  
HETATM   40  H15 UNL     1      -3.001   0.268  -2.454  1.00  0.00           H  
HETATM   41  H16 UNL     1      -4.581  -1.273  -2.015  1.00  0.00           H  
HETATM   42  H17 UNL     1      -2.980  -1.568  -0.339  1.00  0.00           H  
HETATM   43  H18 UNL     1      -0.822   0.153  -1.522  1.00  0.00           H  
HETATM   44  H19 UNL     1      -1.583  -2.624  -1.470  1.00  0.00           H  
HETATM   45  H20 UNL     1       2.615  -3.041  -0.305  1.00  0.00           H  
HETATM   46  H21 UNL     1       1.964  -1.163  -1.836  1.00  0.00           H  
HETATM   47  H22 UNL     1       4.977  -2.207  -0.545  1.00  0.00           H  
HETATM   48  H23 UNL     1       3.850  -3.232   1.413  1.00  0.00           H  
HETATM   49  H24 UNL     1       4.742   0.096  -0.595  1.00  0.00           H  
HETATM   50  H25 UNL     1       6.396  -1.009   0.837  1.00  0.00           H  
CONECT    1    2   26
CONECT    2    3   27   28
CONECT    3    4   24   29
CONECT    4    5
CONECT    5    6   20   30
CONECT    6    7
CONECT    7    8   18   31
CONECT    8    9   32   33
CONECT    9   10   17
CONECT   10   11   13   34
CONECT   11   12   35   36
CONECT   12   37
CONECT   13   14   15   38
CONECT   14   39
CONECT   15   16   17   40
CONECT   16   41
CONECT   17   18   42
CONECT   18   19   43
CONECT   19   44
CONECT   20   21   22   45
CONECT   21   46
CONECT   22   23   24   47
CONECT   23   48
CONECT   24   25   49
CONECT   25   50
END

HMDB0031999
     RDKit          3D
Casuarine 6-alpha-D-glucoside
 50 52  0  0  0  0  0  0  0  0999 V2000
    1.8797    2.0792    0.9677 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8465    1.4219    0.2160 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4967    0.4046    1.0867 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6041   -0.5269    1.5590 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9246   -1.2309    0.5901 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9318   -0.4571    0.0946 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3505   -0.7502    0.3430 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0297    0.4409    0.9938 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4419    0.1933    0.7422 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1571    1.4289    0.5905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4032    1.3412    1.4752 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1019    2.5270    1.3381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6033    1.5497   -0.8274 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7686    2.4545   -1.5109 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4151    0.1945   -1.4275 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6750   -0.4131   -1.5640 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5371   -0.5446   -0.4764 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1284   -0.7460   -0.9782 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9581   -1.8894   -1.6996 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8322   -1.9342   -0.2990 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8689   -1.5138   -1.6206 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2585   -1.8010    0.1980 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4640   -2.4645    1.3924 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -0.3488    0.4154 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8321   -0.2118    1.0786 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7172    2.9657    0.5609 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4859    1.0485   -0.7439 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6313    2.2039   -0.0202 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8743    0.9459    1.9964 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3595   -2.0374    1.1816 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5813   -1.6137    0.9556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8707    0.4561    2.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7193    1.4071    0.4954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5365    2.2992    0.9053 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9885    0.4576    1.1481 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0340    1.2519    2.5089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0595    2.4459    1.5584 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6484    1.9078   -0.9196 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2100    2.6578   -2.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0011    0.2675   -2.4540 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5805   -1.2725   -2.0152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9801   -1.5685   -0.3393 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8220    0.1526   -1.5223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5827   -2.6240   -1.4703 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6155   -3.0407   -0.3049 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9640   -1.1629   -1.8361 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9770   -2.2071   -0.5450 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8495   -3.2315    1.4132 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7418    0.0962   -0.5952 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3959   -1.0087    0.8370 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
  5 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24  3  1  0
 18  7  1  0
 17  9  1  0
  1 26  1  0
  2 27  1  0
  2 28  1  0
  3 29  1  0
  5 30  1  0
  7 31  1  0
  8 32  1  0
  8 33  1  0
 10 34  1  0
 11 35  1  0
 11 36  1  0
 12 37  1  0
 13 38  1  0
 14 39  1  0
 15 40  1  0
 16 41  1  0
 17 42  1  0
 18 43  1  0
 19 44  1  0
 20 45  1  0
 21 46  1  0
 22 47  1  0
 23 48  1  0
 24 49  1  0
 25 50  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Casuarine 6-a-D-glucoside	Generator
Casuarine 6-α-D-glucoside	Generator

Chemical Formula

C₁₄H₂₅NO₁₀

Average Molecular Weight

367.349

Monoisotopic Molecular Weight

367.147846025

IUPAC Name

3-(hydroxymethyl)-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-hexahydro-1H-pyrrolizine-1,2,7-triol

Traditional Name

3-(hydroxymethyl)-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-hexahydro-1H-pyrrolizine-1,2,7-triol

CAS Registry Number

186795-20-0

SMILES

OCC1C(O)C(O)C2C(O)C(CN12)OC1OC(CO)C(O)C(O)C1O

InChI Identifier

InChI=1S/C14H25NO10/c16-2-4-8(18)11(21)7-9(19)5(1-15(4)7)24-14-13(23)12(22)10(20)6(3-17)25-14/h4-14,16-23H,1-3H2

InChI Key

KQYACACELNVFOY-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.

Kingdom

Organic compounds

Super Class

Organic oxygen compounds

Class

Organooxygen compounds

Sub Class

Carbohydrates and carbohydrate conjugates

Direct Parent

O-glycosyl compounds

Alternative Parents

Substituents

Hexose monosaccharide
O-glycosyl compound
Pyrrolizidine
Monosaccharide
Oxane
N-alkylpyrrolidine
Pyrrolidine
Tertiary aliphatic amine
Tertiary amine
Secondary alcohol
1,2-aminoalcohol
Azacycle
Organoheterocyclic compound
Polyol
Oxacycle
Acetal
Primary alcohol
Hydrocarbon derivative
Organopnictogen compound
Organic nitrogen compound
Amine
Alcohol
Organonitrogen compound
Aliphatic heteropolycyclic compound

Molecular Framework

Aliphatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0031999)
Cytoplasm (HMDB: HMDB0031999)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0031999)

Source

Endogenous

Endogenous (HMDB: HMDB0031999)

Plant

Plant (HMDB: HMDB0031999)

Exogenous

Food

Food (HMDB: HMDB0031999)

Fruit

Fruits (FooDB: FOOD00871)

Exogenous (HMDB: HMDB0031999)

Process

Not Available

Role

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	569 g/L	ALOGPS
logP	-3.2	ALOGPS
logP	-5	ChemAxon
logS	0.19	ALOGPS
pKa (Strongest Acidic)	12.14	ChemAxon
pKa (Strongest Basic)	7.63	ChemAxon
Physiological Charge	1	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	183.54 Å²	ChemAxon
Rotatable Bond Count	4	ChemAxon
Refractivity	77.95 m³·mol⁻¹	ChemAxon
Polarizability	35.31 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	182.324	31661259
DarkChem	[M-H]-	178.584	31661259
DeepCCS	[M-2H]-	213.124	30932474
DeepCCS	[M+Na]+	188.351	30932474
AllCCS	[M+H]+	185.9	32859911
AllCCS	[M+H-H2O]+	183.2	32859911
AllCCS	[M+NH4]+	188.4	32859911
AllCCS	[M+Na]+	189.1	32859911
AllCCS	[M-H]-	183.6	32859911
AllCCS	[M+Na-2H]-	183.2	32859911
AllCCS	[M+HCOO]-	182.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Casuarine 6-alpha-D-glucoside	OCC1C(O)C(O)C2C(O)C(CN12)OC1OC(CO)C(O)C(O)C1O	4228.4	Standard polar	33892256
Casuarine 6-alpha-D-glucoside	OCC1C(O)C(O)C2C(O)C(CN12)OC1OC(CO)C(O)C(O)C1O	2728.8	Standard non polar	33892256
Casuarine 6-alpha-D-glucoside	OCC1C(O)C(O)C2C(O)C(CN12)OC1OC(CO)C(O)C(O)C1O	3321.0	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Casuarine 6-alpha-D-glucoside,1TMS,isomer #1	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3309.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #2	C[Si](C)(C)OC1C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3323.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #3	C[Si](C)(C)OC1C(O)C(CO)N2CC(OC3OC(CO)C(O)C(O)C3O)C(O)C12	3311.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #4	C[Si](C)(C)OC1C(OC2OC(CO)C(O)C(O)C2O)CN2C(CO)C(O)C(O)C12	3308.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O)C1O	3257.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #6	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C1O	3265.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #7	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C1O	3226.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TMS,isomer #8	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O)OC(CO)C(O)C1O	3257.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #1	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3270.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O)C1O	3255.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #11	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C1O	3267.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #12	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C1O	3240.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #13	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)OC(CO)C(O)C1O	3260.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O	3248.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #15	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C1O	3260.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #16	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C1O	3238.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #17	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)OC(CO)C(O)C1O	3257.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #18	C[Si](C)(C)OC1C(OC2OC(CO)C(O)C(O)C2O)CN2C(CO)C(O)C(O[Si](C)(C)C)C12	3239.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3243.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #2	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3278.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #20	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C1O	3247.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #21	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C1O	3215.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #22	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O	3238.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3219.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3191.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3221.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #26	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C1O	3197.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #27	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C1O[Si](C)(C)C	3207.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #28	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C	3207.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #3	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3275.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O)C(O)C1O	3250.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #5	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3250.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #6	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3220.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #7	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3243.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #8	C[Si](C)(C)OC1C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3257.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TMS,isomer #9	C[Si](C)(C)OC1C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3278.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #1	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3194.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #10	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3160.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #11	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3181.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3159.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #13	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3187.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #14	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3151.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #15	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3173.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3143.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3109.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3148.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #19	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	3143.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #2	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3207.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #20	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	3143.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #21	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	3138.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #22	C[Si](C)(C)OC1C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3186.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O	3162.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #24	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C1O	3191.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #25	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C1O	3164.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #26	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)OC(CO)C(O)C1O	3179.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3185.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #28	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C1O	3211.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #29	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C1O	3183.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O)C1O	3158.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #30	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O	3197.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3174.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3146.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3177.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #34	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C1O	3171.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #35	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C1O[Si](C)(C)C	3178.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #36	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C	3171.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3158.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3161.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3136.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #4	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3187.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3165.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #41	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C1O	3181.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #42	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C1O	3166.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C1O[Si](C)(C)C	3171.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #44	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C1O	3155.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #45	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C	3165.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #46	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O	3166.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3144.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3118.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3157.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #5	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3153.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #50	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3142.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #51	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3148.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #52	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	3137.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3103.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3115.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3115.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #56	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3134.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #6	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3177.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #7	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3186.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O	3158.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TMS,isomer #9	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3187.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #1	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3055.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3035.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3019.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3050.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #13	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	3059.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #14	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	3065.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #15	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	3048.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3024.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #17	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3076.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #18	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3052.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #19	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3054.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O	3026.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3035.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3018.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3052.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #23	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	3061.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #24	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	3069.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #25	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	3050.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3031.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3005.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3046.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #29	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	3054.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #3	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3084.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #30	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	3050.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #31	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	3043.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3005.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3024.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3019.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #35	C[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	3040.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3045.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #37	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C1O	3095.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #38	C[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C1O	3058.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #39	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O	3068.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #4	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3048.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O	3044.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O	3025.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C	3062.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C1O	3074.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #44	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C1O[Si](C)(C)C	3070.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #45	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C	3058.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3062.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3053.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3084.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #49	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3088.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #5	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3063.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #50	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3089.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #51	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	3075.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3040.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3058.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3058.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #55	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3075.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3039.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3031.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3060.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3036.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O	3042.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3055.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3054.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #62	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3066.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #63	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3068.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #64	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3070.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #65	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	3054.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3028.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3045.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3050.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #69	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3067.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #7	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	3097.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3053.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #8	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	3069.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TMS,isomer #9	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	3073.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O	2934.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #10	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2908.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2943.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2913.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2964.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #14	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	2930.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #15	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	2951.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #16	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2922.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2912.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2936.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2917.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #2	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CN12	2965.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #20	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2924.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2929.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2905.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2948.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #24	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	2920.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #25	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	2941.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #26	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2911.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2916.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2944.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2923.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #3	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CN12	2908.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #30	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2930.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2909.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2933.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2917.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #34	C[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2915.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2943.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2949.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2905.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2963.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #39	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2946.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #4	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CN12	2953.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #40	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2934.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #41	C[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	2923.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2916.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2942.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2926.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2941.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2938.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2966.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2955.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #49	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2963.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O	2932.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2973.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2921.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2947.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2934.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2967.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #55	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2941.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2978.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O	2890.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C	2949.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #8	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	2913.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,5TMS,isomer #9	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	2937.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2861.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #10	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2822.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2847.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2866.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2845.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #14	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2835.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2862.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2839.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2860.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2839.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #19	C[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2832.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2843.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2868.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2863.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2846.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2867.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2841.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #25	C[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2840.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2866.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2890.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2867.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2882.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #4	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CN12	2833.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #5	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CN12	2850.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #6	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2822.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2830.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2848.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,6TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2829.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2835.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2852.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2836.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #4	C[Si](C)(C)OCC1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2C(O[Si](C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CN12	2813.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2817.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2836.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2833.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,7TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2827.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3545.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3564.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)N2CC(OC3OC(CO)C(O)C(O)C3O)C(O)C12	3551.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(OC2OC(CO)C(O)C(O)C2O)CN2C(CO)C(O)C(O)C12	3542.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O)C1O	3502.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C1O	3522.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C1O	3502.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O)OC(CO)C(O)C1O	3513.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3736.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O)C1O	3709.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C1O	3725.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C1O	3700.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)OC(CO)C(O)C1O	3707.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O	3699.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C1O	3718.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C1O	3698.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)OC(CO)C(O)C1O	3700.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1C(OC2OC(CO)C(O)C(O)C2O)CN2C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C12	3707.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3694.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3736.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O	3703.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C1O	3683.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	3681.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3674.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3675.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3687.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O	3672.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C1O[Si](C)(C)C(C)(C)C	3672.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3674.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3733.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O)C(O)C1O	3712.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3716.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3694.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3699.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3715.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3734.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O)CN12	3833.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3823.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3806.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3814.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3806.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3787.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3780.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3794.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3792.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3807.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3774.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3843.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3777.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)CN12	3779.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(O[Si](C)(C)C(C)(C)C)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN2C1CO	3828.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O	3793.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C1O	3812.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C1O	3793.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)OC(CO)C(O)C1O	3774.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3818.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O	3832.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C1O	3814.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O)C1O	3815.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	3792.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3785.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3789.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3801.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O	3778.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C1O[Si](C)(C)C(C)(C)C	3783.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3783.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3792.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3773.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3781.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3827.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3790.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O	3808.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O	3770.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C1O[Si](C)(C)C(C)(C)C	3772.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C1O	3790.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3773.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	3767.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3783.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3783.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3797.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3821.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3763.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3765.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3767.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3780.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3781.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3786.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3765.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3805.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3828.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O	3817.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3828.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O)CN12	3904.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3911.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3927.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3929.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3904.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3915.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)CN12	3909.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3903.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3918.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3918.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3897.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O	3897.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3910.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3927.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3926.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3899.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3911.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1C(O)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)CN12	3903.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3880.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3903.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3903.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3876.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3915.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3876.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)CN12	3877.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3894.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3896.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3899.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OCC1C(O)C(O)C2C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)CN12	3862.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3898.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O	3906.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C1O	3909.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	3887.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3914.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3877.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3893.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3891.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O	3886.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C1O[Si](C)(C)C(C)(C)C	3876.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3882.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3900.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3910.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3915.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3900.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3892.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3893.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3895.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3890.9	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3897.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3893.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3870.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3887.0	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3906.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3900.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3884.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3914.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3892.7	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3889.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3894.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #63	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3890.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #64	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3868.8	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #65	CC(C)(C)[Si](C)(C)OC1C(OC2CN3C(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	3894.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #66	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3890.3	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #67	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3891.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #68	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3890.6	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #69	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2CN3C(CO)C(O)C(O)C3C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3855.4	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CN12	3927.5	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #70	CC(C)(C)[Si](C)(C)OCC1OC(OC2CN3C(CO)C(O)C(O)C3C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3896.2	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CN12	3926.1	Semi standard non polar	33892256
Casuarine 6-alpha-D-glucoside,4TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C(O)C2C(O[Si](C)(C)C(C)(C)C)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CN12	3908.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Casuarine 6-alpha-D-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0f79-1529000000-a5293c7b1397c89c278f	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Casuarine 6-alpha-D-glucoside GC-MS (4 TMS) - 70eV, Positive	splash10-0006-6501249000-60aa95d7c697f3da565a	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Casuarine 6-alpha-D-glucoside GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 10V, Positive-QTOF	splash10-0ktr-0849000000-18ebc31f257b57b6fe23	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 20V, Positive-QTOF	splash10-000i-0911000000-77e6827be7351081fbce	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 40V, Positive-QTOF	splash10-000i-1910000000-73ba5f1491db9a36d5a5	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 10V, Negative-QTOF	splash10-014r-1539000000-9738b20b824144f1b997	2016-08-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 20V, Negative-QTOF	splash10-0fe0-1924000000-a5e6e1301614e68c1125	2016-08-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 40V, Negative-QTOF	splash10-0006-9500000000-9be7ea2576dcc49f3928	2016-08-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 10V, Positive-QTOF	splash10-014i-0019000000-3f8745a3693eca13c09d	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 20V, Positive-QTOF	splash10-052r-0965000000-ec4dd40d54d0465be1bf	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 40V, Positive-QTOF	splash10-054o-6290000000-7e9aac8fc292ca2b0c47	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 10V, Negative-QTOF	splash10-014i-0119000000-322441aa44860c22716c	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 20V, Negative-QTOF	splash10-02t9-4269000000-c1f67535914ef4fbf22b	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Casuarine 6-alpha-D-glucoside 40V, Negative-QTOF	splash10-00dl-9331000000-42b785601cb8a2190471	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-30	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB008694

KNApSAcK ID

C00036887

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

67340977

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Casuarine 6-alpha-D-glucoside (HMDB0031999)

MOL for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

3D MOL for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

3D SDF for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

3D-SDF for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

PDB for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

3D PDB for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

SMILES for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

INCHI for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

Structure for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

3D Structure for HMDB0031999 (Casuarine 6-alpha-D-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra