Showing metabocard for Dehydrotomatine (HMDB0032002)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 17:47:08 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:53:12 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0032002 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Dehydrotomatine | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Dehydrotomatine belongs to the class of organic compounds known as steroidal saponins. These are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. Dehydrotomatine is a very strong basic compound (based on its pKa). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0032002 (Dehydrotomatine)Mrv0541 05061306172D 72 81 0 0 0 0 999 V2000 2.5224 -0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4270 0.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2004 -0.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6545 -0.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4876 -2.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6640 -2.4830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6277 -1.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8476 -0.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3768 -0.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0240 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5532 -0.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4417 -1.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7645 -1.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8834 -2.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8594 -0.3805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9275 5.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2425 -0.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2075 1.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4261 1.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3365 -1.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5514 -0.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9409 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2179 -1.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2937 -1.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7470 -1.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4701 -1.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8794 2.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1505 -1.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2978 5.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8723 0.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5778 0.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2843 -1.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.5091 3.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1214 4.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3256 1.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4916 4.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7717 0.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.6855 3.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0383 3.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3184 -0.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4014 0.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9553 2.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.1317 2.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2322 2.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4948 -0.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2147 3.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6784 1.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5707 -1.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0998 -0.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9646 -1.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6734 -0.5142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.1039 5.7885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.0661 -0.1094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3839 1.6528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 19.7030 2.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.9625 4.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.5747 5.6447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.1492 1.3172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.3153 4.1702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5953 0.0345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.8193 4.2471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.7712 3.1501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6887 -1.3441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.6025 2.0065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0415 -1.2482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8444 4.3140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0486 0.7238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1245 0.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8548 1.5089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.4086 2.7916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.7614 2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3349 -2.0234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6 5 1 0 0 0 0 10 8 1 0 0 0 0 11 9 1 0 0 0 0 12 7 1 0 0 0 0 20 1 1 0 0 0 0 20 7 1 0 0 0 0 20 15 1 0 0 0 0 21 2 1 0 0 0 0 22 5 2 0 0 0 0 22 13 1 0 0 0 0 23 8 1 0 0 0 0 23 13 1 0 0 0 0 24 6 1 0 0 0 0 25 9 1 0 0 0 0 25 24 1 0 0 0 0 26 14 1 0 0 0 0 26 24 1 0 0 0 0 27 19 1 0 0 0 0 28 14 1 0 0 0 0 29 16 1 0 0 0 0 30 17 1 0 0 0 0 31 18 1 0 0 0 0 32 21 1 0 0 0 0 32 28 1 0 0 0 0 33 27 1 0 0 0 0 34 29 1 0 0 0 0 35 30 1 0 0 0 0 36 34 1 0 0 0 0 38 33 1 0 0 0 0 39 36 1 0 0 0 0 40 37 1 0 0 0 0 41 31 1 0 0 0 0 41 37 1 0 0 0 0 42 35 1 0 0 0 0 43 42 1 0 0 0 0 44 38 1 0 0 0 0 45 40 1 0 0 0 0 46 39 1 0 0 0 0 47 43 1 0 0 0 0 48 3 1 0 0 0 0 48 10 1 0 0 0 0 48 22 1 0 0 0 0 48 25 1 0 0 0 0 49 4 1 0 0 0 0 49 11 1 0 0 0 0 49 26 1 0 0 0 0 49 32 1 0 0 0 0 50 12 1 0 0 0 0 50 21 1 0 0 0 0 51 15 1 0 0 0 0 51 50 1 0 0 0 0 52 16 1 0 0 0 0 53 17 1 0 0 0 0 54 18 1 0 0 0 0 55 27 1 0 0 0 0 56 33 1 0 0 0 0 57 34 1 0 0 0 0 58 35 1 0 0 0 0 59 36 1 0 0 0 0 60 37 1 0 0 0 0 61 38 1 0 0 0 0 62 39 1 0 0 0 0 63 40 1 0 0 0 0 64 19 1 0 0 0 0 64 44 1 0 0 0 0 65 23 1 0 0 0 0 65 45 1 0 0 0 0 66 29 1 0 0 0 0 66 46 1 0 0 0 0 67 30 1 0 0 0 0 67 47 1 0 0 0 0 68 31 1 0 0 0 0 68 45 1 0 0 0 0 69 41 1 0 0 0 0 69 47 1 0 0 0 0 70 42 1 0 0 0 0 70 44 1 0 0 0 0 71 43 1 0 0 0 0 71 46 1 0 0 0 0 72 28 1 0 0 0 0 72 50 1 0 0 0 0 M END 3D MOL for HMDB0032002 (Dehydrotomatine)HMDB0032002 RDKit 3D Dehydrotomatine 153162 0 0 0 0 0 0 0 0999 V2000 13.2200 -1.0363 2.0776 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8461 -0.2502 0.8150 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1037 0.9608 1.2464 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2633 1.5915 0.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4539 0.4846 -0.4554 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3819 -0.4364 -1.0958 N 0 0 0 0 0 0 0 0 0 0 0 0 12.0298 -1.1854 -0.0428 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7344 -0.1136 0.5681 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5261 -0.5444 0.0845 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3488 0.1531 0.6887 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4673 0.6388 -0.4573 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0487 0.2758 -0.1016 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0437 1.2396 -0.6316 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7320 0.6431 -0.9203 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3860 -0.5623 -0.6020 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0320 -1.1521 -0.9106 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6578 -1.9446 0.3308 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7160 -2.1862 0.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3423 -1.3614 1.3052 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2102 -0.5567 0.5490 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9206 0.3163 1.3085 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0789 1.4367 1.8900 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8730 2.2881 2.6779 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7614 -0.3356 2.4137 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8354 -1.0624 1.9018 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9927 -0.4222 2.1973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7650 -1.0288 3.2142 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8870 -0.2346 3.4639 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1676 -0.9910 3.2869 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2749 -0.1827 3.5373 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8532 1.1244 2.8647 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1279 1.7314 3.0814 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6726 1.1085 1.3802 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8794 2.1594 0.8942 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5002 2.8722 -0.1030 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7812 2.8212 -1.3046 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3060 3.6302 -2.2785 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5569 4.3606 -1.9223 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8104 5.2785 -2.9469 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3567 5.1532 -0.6555 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6011 5.4546 -0.0630 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5496 4.3254 0.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2651 4.8484 0.4858 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8984 -0.1355 1.0111 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1416 0.0069 -0.1394 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4696 -0.9055 -1.1044 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4005 -1.8359 -1.2017 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9027 -3.0035 -1.8242 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9032 -4.1066 -1.6366 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6825 -3.7839 -2.2167 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1644 -2.6616 -3.2622 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7082 -3.7651 -3.9149 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1536 -1.5373 -3.3476 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4732 -1.9346 -3.1975 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7928 -0.3638 -2.4547 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6877 0.2560 -3.0553 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8941 -1.2355 3.2052 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0536 -0.6008 4.0935 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1097 -2.2015 2.2882 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0945 -2.9708 1.6514 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5249 -3.1386 0.4864 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8837 -2.8870 -0.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3487 -1.4951 0.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2965 -1.1728 1.5755 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7390 -1.1812 -0.3496 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9770 -1.4019 -1.8152 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4812 -1.3599 -1.9761 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0156 0.0595 -1.7047 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8049 0.8290 -2.9615 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4567 -0.1453 -1.3737 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4035 0.9553 -1.4695 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0161 2.3244 -1.1193 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4185 -2.1048 1.8521 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0746 -0.5782 2.6115 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3559 -1.0301 2.7978 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8415 -0.0187 0.3415 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3780 0.6654 2.0546 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7778 1.7476 1.6133 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6602 2.3674 0.6486 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9694 2.0553 -0.6001 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8949 -1.1470 -1.7024 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3159 -1.7496 0.5734 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7620 -1.9143 -0.4971 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5038 -1.6520 0.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8129 -0.6177 1.3181 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6212 0.9534 1.3910 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5078 1.7466 -0.4957 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9961 0.3980 1.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3608 1.7609 -1.5542 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8581 2.0747 0.1064 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9962 1.2725 -1.4456 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3217 -0.3326 -1.0941 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1232 -1.7540 -1.8164 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8409 -1.2199 1.1610 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6326 -0.6735 1.8009 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6655 0.8238 0.6402 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2895 1.0516 2.5627 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6617 2.0888 1.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1835 3.0883 2.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1331 0.5181 3.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7429 0.5737 2.6608 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8171 -0.0557 4.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1998 -1.7754 4.1047 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2900 -1.5380 2.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2392 0.1349 4.4843 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1589 1.8242 3.3814 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4631 2.1786 2.2892 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6487 1.1161 0.8362 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5099 2.5414 -0.3437 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4908 4.2877 -2.6603 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5624 2.9555 -3.1507 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3791 3.6234 -1.8210 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2632 6.0612 -2.5453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8295 6.0918 -0.8140 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4914 5.4473 0.9092 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0327 4.3788 1.2988 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3471 5.6365 1.0752 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5819 -0.9961 0.8138 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3232 -1.5298 -0.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8625 -3.2964 -1.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2792 -5.0680 -2.0525 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7328 -4.3241 -0.5436 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0825 -3.4601 -1.5045 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2493 -2.3425 -3.7991 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9439 -4.4910 -3.2866 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0580 -1.1301 -4.3978 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7205 -2.4647 -3.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6329 0.3205 -2.4039 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8893 1.1950 -3.3346 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5461 -1.9341 3.8128 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6108 -1.2941 4.6409 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4936 -2.8790 2.8678 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3474 -2.6420 0.7696 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0541 -4.0543 -0.0193 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6287 -3.4807 1.5423 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5720 -3.6392 0.3491 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9014 -3.1813 -1.2079 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8769 -0.2051 1.8345 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3311 -1.1870 2.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7688 -1.9701 2.1839 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4499 -1.7795 0.2463 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5544 -0.5184 -2.3617 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6161 -2.3591 -2.1940 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7180 -1.6413 -3.0164 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9031 -2.0562 -1.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8048 0.8517 -3.4878 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1508 0.2829 -3.7053 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3563 1.8126 -2.8748 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8728 -1.0236 -1.9364 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9210 0.9813 -2.4610 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2451 2.7912 -1.7631 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9280 2.9790 -1.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7329 2.5145 -0.0767 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 33 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 24 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 17 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 71 72 1 0 7 2 1 0 70 9 1 0 71 5 1 0 68 11 1 0 65 12 1 0 63 15 1 0 59 19 1 0 44 26 1 0 55 46 1 0 42 35 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 6 81 1 0 7 82 1 0 7 83 1 0 9 84 1 0 10 85 1 0 10 86 1 0 11 87 1 0 12 88 1 0 13 89 1 0 13 90 1 0 14 91 1 0 16 92 1 0 16 93 1 0 17 94 1 0 19 95 1 0 21 96 1 0 22 97 1 0 22 98 1 0 23 99 1 0 24100 1 0 26101 1 0 28102 1 0 29103 1 0 29104 1 0 30105 1 0 31106 1 0 32107 1 0 33108 1 0 35109 1 0 37110 1 0 37111 1 0 38112 1 0 39113 1 0 40114 1 0 41115 1 0 42116 1 0 43117 1 0 44118 1 0 46119 1 0 48120 1 0 49121 1 0 49122 1 0 50123 1 0 51124 1 0 52125 1 0 53126 1 0 54127 1 0 55128 1 0 56129 1 0 57130 1 0 58131 1 0 59132 1 0 60133 1 0 61134 1 0 61135 1 0 62136 1 0 62137 1 0 64138 1 0 64139 1 0 64140 1 0 65141 1 0 66142 1 0 66143 1 0 67144 1 0 67145 1 0 69146 1 0 69147 1 0 69148 1 0 70149 1 0 71150 1 0 72151 1 0 72152 1 0 72153 1 0 M END 3D SDF for HMDB0032002 (Dehydrotomatine)Mrv0541 05061306172D 72 81 0 0 0 0 999 V2000 2.5224 -0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4270 0.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2004 -0.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6545 -0.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4876 -2.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6640 -2.4830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6277 -1.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8476 -0.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3768 -0.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0240 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5532 -0.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4417 -1.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7645 -1.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8834 -2.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8594 -0.3805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9275 5.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2425 -0.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2075 1.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4261 1.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3365 -1.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5514 -0.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9409 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2179 -1.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2937 -1.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7470 -1.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4701 -1.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8794 2.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1505 -1.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2978 5.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8723 0.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5778 0.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2843 -1.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.5091 3.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1214 4.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3256 1.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4916 4.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7717 0.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.6855 3.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0383 3.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3184 -0.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4014 0.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9553 2.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.1317 2.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2322 2.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4948 -0.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2147 3.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6784 1.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5707 -1.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0998 -0.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9646 -1.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6734 -0.5142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.1039 5.7885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.0661 -0.1094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3839 1.6528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 19.7030 2.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.9625 4.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.5747 5.6447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.1492 1.3172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.3153 4.1702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5953 0.0345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.8193 4.2471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.7712 3.1501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6887 -1.3441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.6025 2.0065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0415 -1.2482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8444 4.3140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0486 0.7238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1245 0.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8548 1.5089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.4086 2.7916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.7614 2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3349 -2.0234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6 5 1 0 0 0 0 10 8 1 0 0 0 0 11 9 1 0 0 0 0 12 7 1 0 0 0 0 20 1 1 0 0 0 0 20 7 1 0 0 0 0 20 15 1 0 0 0 0 21 2 1 0 0 0 0 22 5 2 0 0 0 0 22 13 1 0 0 0 0 23 8 1 0 0 0 0 23 13 1 0 0 0 0 24 6 1 0 0 0 0 25 9 1 0 0 0 0 25 24 1 0 0 0 0 26 14 1 0 0 0 0 26 24 1 0 0 0 0 27 19 1 0 0 0 0 28 14 1 0 0 0 0 29 16 1 0 0 0 0 30 17 1 0 0 0 0 31 18 1 0 0 0 0 32 21 1 0 0 0 0 32 28 1 0 0 0 0 33 27 1 0 0 0 0 34 29 1 0 0 0 0 35 30 1 0 0 0 0 36 34 1 0 0 0 0 38 33 1 0 0 0 0 39 36 1 0 0 0 0 40 37 1 0 0 0 0 41 31 1 0 0 0 0 41 37 1 0 0 0 0 42 35 1 0 0 0 0 43 42 1 0 0 0 0 44 38 1 0 0 0 0 45 40 1 0 0 0 0 46 39 1 0 0 0 0 47 43 1 0 0 0 0 48 3 1 0 0 0 0 48 10 1 0 0 0 0 48 22 1 0 0 0 0 48 25 1 0 0 0 0 49 4 1 0 0 0 0 49 11 1 0 0 0 0 49 26 1 0 0 0 0 49 32 1 0 0 0 0 50 12 1 0 0 0 0 50 21 1 0 0 0 0 51 15 1 0 0 0 0 51 50 1 0 0 0 0 52 16 1 0 0 0 0 53 17 1 0 0 0 0 54 18 1 0 0 0 0 55 27 1 0 0 0 0 56 33 1 0 0 0 0 57 34 1 0 0 0 0 58 35 1 0 0 0 0 59 36 1 0 0 0 0 60 37 1 0 0 0 0 61 38 1 0 0 0 0 62 39 1 0 0 0 0 63 40 1 0 0 0 0 64 19 1 0 0 0 0 64 44 1 0 0 0 0 65 23 1 0 0 0 0 65 45 1 0 0 0 0 66 29 1 0 0 0 0 66 46 1 0 0 0 0 67 30 1 0 0 0 0 67 47 1 0 0 0 0 68 31 1 0 0 0 0 68 45 1 0 0 0 0 69 41 1 0 0 0 0 69 47 1 0 0 0 0 70 42 1 0 0 0 0 70 44 1 0 0 0 0 71 43 1 0 0 0 0 71 46 1 0 0 0 0 72 28 1 0 0 0 0 72 50 1 0 0 0 0 M END > <DATABASE_ID> HMDB0032002 > <DATABASE_NAME> hmdb > <SMILES> CC1C2C(CC3C4CC=C5CC(CCC5(C)C4CCC23C)OC2OC(CO)C(OC3OC(CO)C(O)C(OC4OCC(O)C(O)C4O)C3OC3OC(CO)C(O)C(O)C3O)C(O)C2O)OC11CCC(C)CN1 > <INCHI_IDENTIFIER> InChI=1S/C50H81NO21/c1-20-7-12-50(51-15-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(63)37(60)41(31(18-54)68-45)69-47-43(71-46-39(62)36(59)34(57)29(16-52)66-46)42(35(58)30(17-53)67-47)70-44-38(61)33(56)27(55)19-64-44/h5,20-21,23-47,51-63H,6-19H2,1-4H3 > <INCHI_KEY> BYMOGFTUZUEFHY-UHFFFAOYSA-N > <FORMULA> C50H81NO21 > <MOLECULAR_WEIGHT> 1032.1722 > <EXACT_MASS> 1031.530108659 > <JCHEM_ACCEPTOR_COUNT> 22 > <JCHEM_AVERAGE_POLARIZABILITY> 109.93411280168706 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-[(2-{[4,5-dihydroxy-2-(hydroxymethyl)-6-{5',7,9,13-tetramethyl-5-oxaspiro[pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosane-6,2'-piperidin]-18-eneoxy}oxan-3-yl]oxy}-5-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol > <ALOGPS_LOGP> -0.09 > <JCHEM_LOGP> -1.8431300933333326 > <ALOGPS_LOGS> -2.75 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 10 > <JCHEM_PHYSIOLOGICAL_CHARGE> 1 > <JCHEM_PKA> 12.226076895259729 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.779276536240427 > <JCHEM_PKA_STRONGEST_BASIC> 9.539133023598703 > <JCHEM_POLAR_SURFACE_AREA> 337.86000000000007 > <JCHEM_REFRACTIVITY> 245.6375000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 11 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.82e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-[(2-{[4,5-dihydroxy-2-(hydroxymethyl)-6-{5',7,9,13-tetramethyl-5-oxaspiro[pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosane-6,2'-piperidin]-18-eneoxy}oxan-3-yl]oxy}-5-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0032002 (Dehydrotomatine)HMDB0032002 RDKit 3D Dehydrotomatine 153162 0 0 0 0 0 0 0 0999 V2000 13.2200 -1.0363 2.0776 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8461 -0.2502 0.8150 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1037 0.9608 1.2464 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2633 1.5915 0.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4539 0.4846 -0.4554 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3819 -0.4364 -1.0958 N 0 0 0 0 0 0 0 0 0 0 0 0 12.0298 -1.1854 -0.0428 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7344 -0.1136 0.5681 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5261 -0.5444 0.0845 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3488 0.1531 0.6887 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4673 0.6388 -0.4573 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0487 0.2758 -0.1016 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0437 1.2396 -0.6316 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7320 0.6431 -0.9203 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3860 -0.5623 -0.6020 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0320 -1.1521 -0.9106 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6578 -1.9446 0.3308 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7160 -2.1862 0.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3423 -1.3614 1.3052 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2102 -0.5567 0.5490 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9206 0.3163 1.3085 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0789 1.4367 1.8900 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8730 2.2881 2.6779 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7614 -0.3356 2.4137 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8354 -1.0624 1.9018 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9927 -0.4222 2.1973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7650 -1.0288 3.2142 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8870 -0.2346 3.4639 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1676 -0.9910 3.2869 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2749 -0.1827 3.5373 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8532 1.1244 2.8647 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1279 1.7314 3.0814 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6726 1.1085 1.3802 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8794 2.1594 0.8942 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5002 2.8722 -0.1030 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7812 2.8212 -1.3046 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3060 3.6302 -2.2785 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5569 4.3606 -1.9223 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8104 5.2785 -2.9469 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3567 5.1532 -0.6555 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6011 5.4546 -0.0630 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5496 4.3254 0.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2651 4.8484 0.4858 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8984 -0.1355 1.0111 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1416 0.0069 -0.1394 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4696 -0.9055 -1.1044 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4005 -1.8359 -1.2017 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9027 -3.0035 -1.8242 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9032 -4.1066 -1.6366 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6825 -3.7839 -2.2167 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1644 -2.6616 -3.2622 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7082 -3.7651 -3.9149 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1536 -1.5373 -3.3476 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4732 -1.9346 -3.1975 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7928 -0.3638 -2.4547 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6877 0.2560 -3.0553 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8941 -1.2355 3.2052 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0536 -0.6008 4.0935 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1097 -2.2015 2.2882 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0945 -2.9708 1.6514 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5249 -3.1386 0.4864 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8837 -2.8870 -0.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3487 -1.4951 0.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2965 -1.1728 1.5755 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7390 -1.1812 -0.3496 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9770 -1.4019 -1.8152 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4812 -1.3599 -1.9761 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0156 0.0595 -1.7047 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8049 0.8290 -2.9615 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4567 -0.1453 -1.3737 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4035 0.9553 -1.4695 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0161 2.3244 -1.1193 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4185 -2.1048 1.8521 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0746 -0.5782 2.6115 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3559 -1.0301 2.7978 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8415 -0.0187 0.3415 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3780 0.6654 2.0546 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7778 1.7476 1.6133 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6602 2.3674 0.6486 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9694 2.0553 -0.6001 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8949 -1.1470 -1.7024 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3159 -1.7496 0.5734 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7620 -1.9143 -0.4971 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5038 -1.6520 0.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8129 -0.6177 1.3181 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6212 0.9534 1.3910 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5078 1.7466 -0.4957 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9961 0.3980 1.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3608 1.7609 -1.5542 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8581 2.0747 0.1064 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9962 1.2725 -1.4456 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3217 -0.3326 -1.0941 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1232 -1.7540 -1.8164 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8409 -1.2199 1.1610 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6326 -0.6735 1.8009 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6655 0.8238 0.6402 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2895 1.0516 2.5627 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6617 2.0888 1.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1835 3.0883 2.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1331 0.5181 3.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7429 0.5737 2.6608 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8171 -0.0557 4.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1998 -1.7754 4.1047 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2900 -1.5380 2.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2392 0.1349 4.4843 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1589 1.8242 3.3814 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4631 2.1786 2.2892 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6487 1.1161 0.8362 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5099 2.5414 -0.3437 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4908 4.2877 -2.6603 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5624 2.9555 -3.1507 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3791 3.6234 -1.8210 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2632 6.0612 -2.5453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8295 6.0918 -0.8140 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4914 5.4473 0.9092 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0327 4.3788 1.2988 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3471 5.6365 1.0752 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5819 -0.9961 0.8138 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3232 -1.5298 -0.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8625 -3.2964 -1.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2792 -5.0680 -2.0525 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7328 -4.3241 -0.5436 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0825 -3.4601 -1.5045 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2493 -2.3425 -3.7991 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9439 -4.4910 -3.2866 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0580 -1.1301 -4.3978 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7205 -2.4647 -3.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6329 0.3205 -2.4039 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8893 1.1950 -3.3346 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5461 -1.9341 3.8128 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6108 -1.2941 4.6409 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4936 -2.8790 2.8678 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3474 -2.6420 0.7696 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0541 -4.0543 -0.0193 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6287 -3.4807 1.5423 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5720 -3.6392 0.3491 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9014 -3.1813 -1.2079 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8769 -0.2051 1.8345 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3311 -1.1870 2.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7688 -1.9701 2.1839 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4499 -1.7795 0.2463 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5544 -0.5184 -2.3617 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6161 -2.3591 -2.1940 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7180 -1.6413 -3.0164 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9031 -2.0562 -1.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8048 0.8517 -3.4878 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1508 0.2829 -3.7053 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3563 1.8126 -2.8748 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8728 -1.0236 -1.9364 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9210 0.9813 -2.4610 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2451 2.7912 -1.7631 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9280 2.9790 -1.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7329 2.5145 -0.0767 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 33 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 24 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 17 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 71 72 1 0 7 2 1 0 70 9 1 0 71 5 1 0 68 11 1 0 65 12 1 0 63 15 1 0 59 19 1 0 44 26 1 0 55 46 1 0 42 35 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 6 81 1 0 7 82 1 0 7 83 1 0 9 84 1 0 10 85 1 0 10 86 1 0 11 87 1 0 12 88 1 0 13 89 1 0 13 90 1 0 14 91 1 0 16 92 1 0 16 93 1 0 17 94 1 0 19 95 1 0 21 96 1 0 22 97 1 0 22 98 1 0 23 99 1 0 24100 1 0 26101 1 0 28102 1 0 29103 1 0 29104 1 0 30105 1 0 31106 1 0 32107 1 0 33108 1 0 35109 1 0 37110 1 0 37111 1 0 38112 1 0 39113 1 0 40114 1 0 41115 1 0 42116 1 0 43117 1 0 44118 1 0 46119 1 0 48120 1 0 49121 1 0 49122 1 0 50123 1 0 51124 1 0 52125 1 0 53126 1 0 54127 1 0 55128 1 0 56129 1 0 57130 1 0 58131 1 0 59132 1 0 60133 1 0 61134 1 0 61135 1 0 62136 1 0 62137 1 0 64138 1 0 64139 1 0 64140 1 0 65141 1 0 66142 1 0 66143 1 0 67144 1 0 67145 1 0 69146 1 0 69147 1 0 69148 1 0 70149 1 0 71150 1 0 72151 1 0 72152 1 0 72153 1 0 M END PDB for HMDB0032002 (Dehydrotomatine)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 4.708 -1.652 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 10.130 0.204 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 17.174 -0.685 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 12.422 -0.497 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 17.710 -4.724 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 16.173 -4.635 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 6.772 -3.342 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 20.249 -0.864 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 15.637 -0.596 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 18.711 -0.775 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 14.099 -0.506 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 8.291 -3.592 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 20.094 -3.527 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 12.849 -4.252 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 7.204 -0.710 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 27.865 10.716 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 30.319 -0.115 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 22.787 2.996 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 34.395 3.656 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 6.228 -1.901 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 10.363 -1.318 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 18.556 -3.438 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 20.940 -2.241 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 15.482 -3.259 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 16.328 -1.972 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 13.944 -3.169 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 35.242 4.943 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 11.481 -3.545 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 28.556 9.339 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 29.628 1.261 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 23.479 1.620 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 11.731 -2.025 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 34.550 6.319 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 30.093 9.250 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 30.474 2.548 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 30.784 7.874 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 25.707 0.154 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 33.013 6.408 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 29.938 6.587 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 24.861 -1.133 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 25.016 1.530 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 29.783 3.924 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 28.246 4.014 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 32.167 5.122 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 23.324 -1.043 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 28.401 6.677 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 27.400 2.727 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 17.865 -2.062 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 13.253 -1.793 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 9.267 -2.401 0.000 0.00 0.00 C+0 HETATM 51 N UNK 0 8.724 -0.960 0.000 0.00 0.00 N+0 HETATM 52 O UNK 0 26.327 10.805 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 31.857 -0.204 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 21.250 3.085 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 36.779 4.853 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 35.397 7.605 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 30.939 10.537 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 32.012 2.459 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 32.322 7.784 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 27.245 0.064 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 33.263 7.928 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 31.306 5.880 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 25.552 -2.509 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 32.858 3.745 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 22.477 -2.330 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 27.710 8.053 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 28.091 1.351 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 22.632 0.333 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 25.862 2.817 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 30.629 5.211 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 27.555 5.390 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 9.958 -3.777 0.000 0.00 0.00 O+0 CONECT 1 20 CONECT 2 21 CONECT 3 48 CONECT 4 49 CONECT 5 6 22 CONECT 6 5 24 CONECT 7 12 20 CONECT 8 10 23 CONECT 9 11 25 CONECT 10 8 48 CONECT 11 9 49 CONECT 12 7 50 CONECT 13 22 23 CONECT 14 26 28 CONECT 15 20 51 CONECT 16 29 52 CONECT 17 30 53 CONECT 18 31 54 CONECT 19 27 64 CONECT 20 1 7 15 CONECT 21 2 32 50 CONECT 22 5 13 48 CONECT 23 8 13 65 CONECT 24 6 25 26 CONECT 25 9 24 48 CONECT 26 14 24 49 CONECT 27 19 33 55 CONECT 28 14 32 72 CONECT 29 16 34 66 CONECT 30 17 35 67 CONECT 31 18 41 68 CONECT 32 21 28 49 CONECT 33 27 38 56 CONECT 34 29 36 57 CONECT 35 30 42 58 CONECT 36 34 39 59 CONECT 37 40 41 60 CONECT 38 33 44 61 CONECT 39 36 46 62 CONECT 40 37 45 63 CONECT 41 31 37 69 CONECT 42 35 43 70 CONECT 43 42 47 71 CONECT 44 38 64 70 CONECT 45 40 65 68 CONECT 46 39 66 71 CONECT 47 43 67 69 CONECT 48 3 10 22 25 CONECT 49 4 11 26 32 CONECT 50 12 21 51 72 CONECT 51 15 50 CONECT 52 16 CONECT 53 17 CONECT 54 18 CONECT 55 27 CONECT 56 33 CONECT 57 34 CONECT 58 35 CONECT 59 36 CONECT 60 37 CONECT 61 38 CONECT 62 39 CONECT 63 40 CONECT 64 19 44 CONECT 65 23 45 CONECT 66 29 46 CONECT 67 30 47 CONECT 68 31 45 CONECT 69 41 47 CONECT 70 42 44 CONECT 71 43 46 CONECT 72 28 50 MASTER 0 0 0 0 0 0 0 0 72 0 162 0 END 3D PDB for HMDB0032002 (Dehydrotomatine)COMPND HMDB0032002 HETATM 1 C1 UNL 1 13.220 -1.036 2.078 1.00 0.00 C HETATM 2 C2 UNL 1 12.846 -0.250 0.815 1.00 0.00 C HETATM 3 C3 UNL 1 12.104 0.961 1.246 1.00 0.00 C HETATM 4 C4 UNL 1 11.263 1.592 0.128 1.00 0.00 C HETATM 5 C5 UNL 1 10.454 0.485 -0.455 1.00 0.00 C HETATM 6 N1 UNL 1 11.382 -0.436 -1.096 1.00 0.00 N HETATM 7 C6 UNL 1 12.030 -1.185 -0.043 1.00 0.00 C HETATM 8 O1 UNL 1 9.734 -0.114 0.568 1.00 0.00 O HETATM 9 C7 UNL 1 8.526 -0.544 0.085 1.00 0.00 C HETATM 10 C8 UNL 1 7.349 0.153 0.689 1.00 0.00 C HETATM 11 C9 UNL 1 6.467 0.639 -0.457 1.00 0.00 C HETATM 12 C10 UNL 1 5.049 0.276 -0.102 1.00 0.00 C HETATM 13 C11 UNL 1 4.044 1.240 -0.632 1.00 0.00 C HETATM 14 C12 UNL 1 2.732 0.643 -0.920 1.00 0.00 C HETATM 15 C13 UNL 1 2.386 -0.562 -0.602 1.00 0.00 C HETATM 16 C14 UNL 1 1.032 -1.152 -0.911 1.00 0.00 C HETATM 17 C15 UNL 1 0.658 -1.945 0.331 1.00 0.00 C HETATM 18 O2 UNL 1 -0.716 -2.186 0.383 1.00 0.00 O HETATM 19 C16 UNL 1 -1.342 -1.361 1.305 1.00 0.00 C HETATM 20 O3 UNL 1 -2.210 -0.557 0.549 1.00 0.00 O HETATM 21 C17 UNL 1 -2.921 0.316 1.309 1.00 0.00 C HETATM 22 C18 UNL 1 -2.079 1.437 1.890 1.00 0.00 C HETATM 23 O4 UNL 1 -2.873 2.288 2.678 1.00 0.00 O HETATM 24 C19 UNL 1 -3.761 -0.336 2.414 1.00 0.00 C HETATM 25 O5 UNL 1 -4.835 -1.062 1.902 1.00 0.00 O HETATM 26 C20 UNL 1 -5.993 -0.422 2.197 1.00 0.00 C HETATM 27 O6 UNL 1 -6.765 -1.029 3.214 1.00 0.00 O HETATM 28 C21 UNL 1 -7.887 -0.235 3.464 1.00 0.00 C HETATM 29 C22 UNL 1 -9.168 -0.991 3.287 1.00 0.00 C HETATM 30 O7 UNL 1 -10.275 -0.183 3.537 1.00 0.00 O HETATM 31 C23 UNL 1 -7.853 1.124 2.865 1.00 0.00 C HETATM 32 O8 UNL 1 -9.128 1.731 3.081 1.00 0.00 O HETATM 33 C24 UNL 1 -7.673 1.108 1.380 1.00 0.00 C HETATM 34 O9 UNL 1 -6.879 2.159 0.894 1.00 0.00 O HETATM 35 C25 UNL 1 -7.500 2.872 -0.103 1.00 0.00 C HETATM 36 O10 UNL 1 -6.781 2.821 -1.305 1.00 0.00 O HETATM 37 C26 UNL 1 -7.306 3.630 -2.279 1.00 0.00 C HETATM 38 C27 UNL 1 -8.557 4.361 -1.922 1.00 0.00 C HETATM 39 O11 UNL 1 -8.810 5.278 -2.947 1.00 0.00 O HETATM 40 C28 UNL 1 -8.357 5.153 -0.656 1.00 0.00 C HETATM 41 O12 UNL 1 -9.601 5.455 -0.063 1.00 0.00 O HETATM 42 C29 UNL 1 -7.550 4.325 0.305 1.00 0.00 C HETATM 43 O13 UNL 1 -6.265 4.848 0.486 1.00 0.00 O HETATM 44 C30 UNL 1 -6.898 -0.135 1.011 1.00 0.00 C HETATM 45 O14 UNL 1 -6.142 0.007 -0.139 1.00 0.00 O HETATM 46 C31 UNL 1 -6.470 -0.906 -1.104 1.00 0.00 C HETATM 47 O15 UNL 1 -5.400 -1.836 -1.202 1.00 0.00 O HETATM 48 C32 UNL 1 -5.903 -3.004 -1.824 1.00 0.00 C HETATM 49 C33 UNL 1 -4.903 -4.107 -1.637 1.00 0.00 C HETATM 50 O16 UNL 1 -3.683 -3.784 -2.217 1.00 0.00 O HETATM 51 C34 UNL 1 -6.164 -2.662 -3.262 1.00 0.00 C HETATM 52 O17 UNL 1 -6.708 -3.765 -3.915 1.00 0.00 O HETATM 53 C35 UNL 1 -7.154 -1.537 -3.348 1.00 0.00 C HETATM 54 O18 UNL 1 -8.473 -1.935 -3.197 1.00 0.00 O HETATM 55 C36 UNL 1 -6.793 -0.364 -2.455 1.00 0.00 C HETATM 56 O19 UNL 1 -5.688 0.256 -3.055 1.00 0.00 O HETATM 57 C37 UNL 1 -2.894 -1.236 3.205 1.00 0.00 C HETATM 58 O20 UNL 1 -2.054 -0.601 4.093 1.00 0.00 O HETATM 59 C38 UNL 1 -2.110 -2.202 2.288 1.00 0.00 C HETATM 60 O21 UNL 1 -3.094 -2.971 1.651 1.00 0.00 O HETATM 61 C39 UNL 1 1.525 -3.139 0.486 1.00 0.00 C HETATM 62 C40 UNL 1 2.884 -2.887 -0.128 1.00 0.00 C HETATM 63 C41 UNL 1 3.349 -1.495 0.106 1.00 0.00 C HETATM 64 C42 UNL 1 3.297 -1.173 1.575 1.00 0.00 C HETATM 65 C43 UNL 1 4.739 -1.181 -0.350 1.00 0.00 C HETATM 66 C44 UNL 1 4.977 -1.402 -1.815 1.00 0.00 C HETATM 67 C45 UNL 1 6.481 -1.360 -1.976 1.00 0.00 C HETATM 68 C46 UNL 1 7.016 0.060 -1.705 1.00 0.00 C HETATM 69 C47 UNL 1 6.805 0.829 -2.962 1.00 0.00 C HETATM 70 C48 UNL 1 8.457 -0.145 -1.374 1.00 0.00 C HETATM 71 C49 UNL 1 9.403 0.955 -1.469 1.00 0.00 C HETATM 72 C50 UNL 1 9.016 2.324 -1.119 1.00 0.00 C HETATM 73 H1 UNL 1 13.419 -2.105 1.852 1.00 0.00 H HETATM 74 H2 UNL 1 14.075 -0.578 2.612 1.00 0.00 H HETATM 75 H3 UNL 1 12.356 -1.030 2.798 1.00 0.00 H HETATM 76 H4 UNL 1 13.842 -0.019 0.341 1.00 0.00 H HETATM 77 H5 UNL 1 11.378 0.665 2.055 1.00 0.00 H HETATM 78 H6 UNL 1 12.778 1.748 1.613 1.00 0.00 H HETATM 79 H7 UNL 1 10.660 2.367 0.649 1.00 0.00 H HETATM 80 H8 UNL 1 11.969 2.055 -0.600 1.00 0.00 H HETATM 81 H9 UNL 1 10.895 -1.147 -1.702 1.00 0.00 H HETATM 82 H10 UNL 1 11.316 -1.750 0.573 1.00 0.00 H HETATM 83 H11 UNL 1 12.762 -1.914 -0.497 1.00 0.00 H HETATM 84 H12 UNL 1 8.504 -1.652 0.193 1.00 0.00 H HETATM 85 H13 UNL 1 6.813 -0.618 1.318 1.00 0.00 H HETATM 86 H14 UNL 1 7.621 0.953 1.391 1.00 0.00 H HETATM 87 H15 UNL 1 6.508 1.747 -0.496 1.00 0.00 H HETATM 88 H16 UNL 1 4.996 0.398 1.027 1.00 0.00 H HETATM 89 H17 UNL 1 4.361 1.761 -1.554 1.00 0.00 H HETATM 90 H18 UNL 1 3.858 2.075 0.106 1.00 0.00 H HETATM 91 H19 UNL 1 1.996 1.272 -1.446 1.00 0.00 H HETATM 92 H20 UNL 1 0.322 -0.333 -1.094 1.00 0.00 H HETATM 93 H21 UNL 1 1.123 -1.754 -1.816 1.00 0.00 H HETATM 94 H22 UNL 1 0.841 -1.220 1.161 1.00 0.00 H HETATM 95 H23 UNL 1 -0.633 -0.673 1.801 1.00 0.00 H HETATM 96 H24 UNL 1 -3.665 0.824 0.640 1.00 0.00 H HETATM 97 H25 UNL 1 -1.289 1.052 2.563 1.00 0.00 H HETATM 98 H26 UNL 1 -1.662 2.089 1.102 1.00 0.00 H HETATM 99 H27 UNL 1 -3.184 3.088 2.192 1.00 0.00 H HETATM 100 H28 UNL 1 -4.133 0.518 3.046 1.00 0.00 H HETATM 101 H29 UNL 1 -5.743 0.574 2.661 1.00 0.00 H HETATM 102 H30 UNL 1 -7.817 -0.056 4.593 1.00 0.00 H HETATM 103 H31 UNL 1 -9.200 -1.775 4.105 1.00 0.00 H HETATM 104 H32 UNL 1 -9.290 -1.538 2.359 1.00 0.00 H HETATM 105 H33 UNL 1 -10.239 0.135 4.484 1.00 0.00 H HETATM 106 H34 UNL 1 -7.159 1.824 3.381 1.00 0.00 H HETATM 107 H35 UNL 1 -9.463 2.179 2.289 1.00 0.00 H HETATM 108 H36 UNL 1 -8.649 1.116 0.836 1.00 0.00 H HETATM 109 H37 UNL 1 -8.510 2.541 -0.344 1.00 0.00 H HETATM 110 H38 UNL 1 -6.491 4.288 -2.660 1.00 0.00 H HETATM 111 H39 UNL 1 -7.562 2.956 -3.151 1.00 0.00 H HETATM 112 H40 UNL 1 -9.379 3.623 -1.821 1.00 0.00 H HETATM 113 H41 UNL 1 -9.263 6.061 -2.545 1.00 0.00 H HETATM 114 H42 UNL 1 -7.830 6.092 -0.814 1.00 0.00 H HETATM 115 H43 UNL 1 -9.491 5.447 0.909 1.00 0.00 H HETATM 116 H44 UNL 1 -8.033 4.379 1.299 1.00 0.00 H HETATM 117 H45 UNL 1 -6.347 5.637 1.075 1.00 0.00 H HETATM 118 H46 UNL 1 -7.582 -0.996 0.814 1.00 0.00 H HETATM 119 H47 UNL 1 -7.323 -1.530 -0.750 1.00 0.00 H HETATM 120 H48 UNL 1 -6.863 -3.296 -1.348 1.00 0.00 H HETATM 121 H49 UNL 1 -5.279 -5.068 -2.053 1.00 0.00 H HETATM 122 H50 UNL 1 -4.733 -4.324 -0.544 1.00 0.00 H HETATM 123 H51 UNL 1 -3.082 -3.460 -1.504 1.00 0.00 H HETATM 124 H52 UNL 1 -5.249 -2.343 -3.799 1.00 0.00 H HETATM 125 H53 UNL 1 -6.944 -4.491 -3.287 1.00 0.00 H HETATM 126 H54 UNL 1 -7.058 -1.130 -4.398 1.00 0.00 H HETATM 127 H55 UNL 1 -8.720 -2.465 -3.974 1.00 0.00 H HETATM 128 H56 UNL 1 -7.633 0.320 -2.404 1.00 0.00 H HETATM 129 H57 UNL 1 -5.889 1.195 -3.335 1.00 0.00 H HETATM 130 H58 UNL 1 -3.546 -1.934 3.813 1.00 0.00 H HETATM 131 H59 UNL 1 -1.611 -1.294 4.641 1.00 0.00 H HETATM 132 H60 UNL 1 -1.494 -2.879 2.868 1.00 0.00 H HETATM 133 H61 UNL 1 -3.347 -2.642 0.770 1.00 0.00 H HETATM 134 H62 UNL 1 1.054 -4.054 -0.019 1.00 0.00 H HETATM 135 H63 UNL 1 1.629 -3.481 1.542 1.00 0.00 H HETATM 136 H64 UNL 1 3.572 -3.639 0.349 1.00 0.00 H HETATM 137 H65 UNL 1 2.901 -3.181 -1.208 1.00 0.00 H HETATM 138 H66 UNL 1 2.877 -0.205 1.834 1.00 0.00 H HETATM 139 H67 UNL 1 4.331 -1.187 2.031 1.00 0.00 H HETATM 140 H68 UNL 1 2.769 -1.970 2.184 1.00 0.00 H HETATM 141 H69 UNL 1 5.450 -1.779 0.246 1.00 0.00 H HETATM 142 H70 UNL 1 4.554 -0.518 -2.362 1.00 0.00 H HETATM 143 H71 UNL 1 4.616 -2.359 -2.194 1.00 0.00 H HETATM 144 H72 UNL 1 6.718 -1.641 -3.016 1.00 0.00 H HETATM 145 H73 UNL 1 6.903 -2.056 -1.236 1.00 0.00 H HETATM 146 H74 UNL 1 7.805 0.852 -3.488 1.00 0.00 H HETATM 147 H75 UNL 1 6.151 0.283 -3.705 1.00 0.00 H HETATM 148 H76 UNL 1 6.356 1.813 -2.875 1.00 0.00 H HETATM 149 H77 UNL 1 8.873 -1.024 -1.936 1.00 0.00 H HETATM 150 H78 UNL 1 9.921 0.981 -2.461 1.00 0.00 H HETATM 151 H79 UNL 1 8.245 2.791 -1.763 1.00 0.00 H HETATM 152 H80 UNL 1 9.928 2.979 -1.285 1.00 0.00 H HETATM 153 H81 UNL 1 8.733 2.515 -0.077 1.00 0.00 H CONECT 1 2 73 74 75 CONECT 2 3 7 76 CONECT 3 4 77 78 CONECT 4 5 79 80 CONECT 5 6 8 71 CONECT 6 7 81 CONECT 7 82 83 CONECT 8 9 CONECT 9 10 70 84 CONECT 10 11 85 86 CONECT 11 12 68 87 CONECT 12 13 65 88 CONECT 13 14 89 90 CONECT 14 15 15 91 CONECT 15 16 63 CONECT 16 17 92 93 CONECT 17 18 61 94 CONECT 18 19 CONECT 19 20 59 95 CONECT 20 21 CONECT 21 22 24 96 CONECT 22 23 97 98 CONECT 23 99 CONECT 24 25 57 100 CONECT 25 26 CONECT 26 27 44 101 CONECT 27 28 CONECT 28 29 31 102 CONECT 29 30 103 104 CONECT 30 105 CONECT 31 32 33 106 CONECT 32 107 CONECT 33 34 44 108 CONECT 34 35 CONECT 35 36 42 109 CONECT 36 37 CONECT 37 38 110 111 CONECT 38 39 40 112 CONECT 39 113 CONECT 40 41 42 114 CONECT 41 115 CONECT 42 43 116 CONECT 43 117 CONECT 44 45 118 CONECT 45 46 CONECT 46 47 55 119 CONECT 47 48 CONECT 48 49 51 120 CONECT 49 50 121 122 CONECT 50 123 CONECT 51 52 53 124 CONECT 52 125 CONECT 53 54 55 126 CONECT 54 127 CONECT 55 56 128 CONECT 56 129 CONECT 57 58 59 130 CONECT 58 131 CONECT 59 60 132 CONECT 60 133 CONECT 61 62 134 135 CONECT 62 63 136 137 CONECT 63 64 65 CONECT 64 138 139 140 CONECT 65 66 141 CONECT 66 67 142 143 CONECT 67 68 144 145 CONECT 68 69 70 CONECT 69 146 147 148 CONECT 70 71 149 CONECT 71 72 150 CONECT 72 151 152 153 END SMILES for HMDB0032002 (Dehydrotomatine)CC1C2C(CC3C4CC=C5CC(CCC5(C)C4CCC23C)OC2OC(CO)C(OC3OC(CO)C(O)C(OC4OCC(O)C(O)C4O)C3OC3OC(CO)C(O)C(O)C3O)C(O)C2O)OC11CCC(C)CN1 INCHI for HMDB0032002 (Dehydrotomatine)InChI=1S/C50H81NO21/c1-20-7-12-50(51-15-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(63)37(60)41(31(18-54)68-45)69-47-43(71-46-39(62)36(59)34(57)29(16-52)66-46)42(35(58)30(17-53)67-47)70-44-38(61)33(56)27(55)19-64-44/h5,20-21,23-47,51-63H,6-19H2,1-4H3 3D Structure for HMDB0032002 (Dehydrotomatine) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C50H81NO21 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1032.1722 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1031.530108659 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-[(2-{[4,5-dihydroxy-2-(hydroxymethyl)-6-{5',7,9,13-tetramethyl-5-oxaspiro[pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosane-6,2'-piperidin]-18-eneoxy}oxan-3-yl]oxy}-5-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-[(2-{[4,5-dihydroxy-2-(hydroxymethyl)-6-{5',7,9,13-tetramethyl-5-oxaspiro[pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosane-6,2'-piperidin]-18-eneoxy}oxan-3-yl]oxy}-5-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 157604-98-3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1C2C(CC3C4CC=C5CC(CCC5(C)C4CCC23C)OC2OC(CO)C(OC3OC(CO)C(O)C(OC4OCC(O)C(O)C4O)C3OC3OC(CO)C(O)C(O)C3O)C(O)C2O)OC11CCC(C)CN1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C50H81NO21/c1-20-7-12-50(51-15-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(63)37(60)41(31(18-54)68-45)69-47-43(71-46-39(62)36(59)34(57)29(16-52)66-46)42(35(58)30(17-53)67-47)70-44-38(61)33(56)27(55)19-64-44/h5,20-21,23-47,51-63H,6-19H2,1-4H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | BYMOGFTUZUEFHY-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as steroidal saponins. These are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Steroids and steroid derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Steroidal glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Steroidal saponins | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB008697 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131751243 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | 143063 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|