Showing metabocard for Quinquenoside I (HMDB0032814)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 17:51:59 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:53:28 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0032814 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Quinquenoside I | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Quinquenoside I belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Quinquenoside I is an extremely weak basic (essentially neutral) compound (based on its pKa). | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0032814 (Quinquenoside I)Mrv0541 05061306432D 71 77 0 0 0 0 999 V2000 6.1282 2.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3435 2.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7307 1.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9459 2.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1612 2.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2885 -0.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9073 0.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6920 0.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1766 0.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6914 1.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9069 1.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1922 1.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4779 1.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4783 0.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1930 -0.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6864 -0.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0739 2.3696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1934 -0.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4791 -1.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7644 -0.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7640 -0.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7636 0.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2005 2.9572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5691 3.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7411 2.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5258 2.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0494 0.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6649 -0.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6645 -0.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3788 -1.3446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0934 -0.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0938 -0.1075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8085 0.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8089 1.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0946 1.5425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8065 -3.8203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5212 -3.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2355 -3.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2351 -4.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3795 -2.5846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6652 -2.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9505 -2.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2363 -2.1710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5216 -2.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8073 -2.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8077 -1.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5224 -0.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5228 -0.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2375 0.3040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9501 -3.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6644 -3.8217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2367 -1.3460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4378 -2.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0502 -1.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3368 -2.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0941 -2.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0945 -1.3474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8084 -2.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5231 -2.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2374 -2.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6482 3.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9027 4.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3504 4.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5435 4.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2889 4.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8413 3.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4099 2.7313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4820 3.8391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9912 5.4085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6049 5.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0526 6.3652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 25 2 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 10 1 0 0 0 0 4 23 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 7 11 1 0 0 0 0 7 15 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 14 21 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 54 1 0 0 0 0 21 22 1 0 0 0 0 21 27 1 0 0 0 0 23 61 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 54 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 46 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 33 48 1 0 0 0 0 34 35 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 44 1 0 0 0 0 38 39 1 0 0 0 0 38 50 1 0 0 0 0 40 41 1 0 0 0 0 40 56 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 42 50 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 47 52 1 0 0 0 0 48 49 1 0 0 0 0 50 51 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 56 57 2 0 0 0 0 56 58 1 0 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 61 62 1 0 0 0 0 61 66 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 63 70 1 0 0 0 0 64 65 1 0 0 0 0 64 69 1 0 0 0 0 65 66 1 0 0 0 0 65 68 1 0 0 0 0 66 67 1 0 0 0 0 70 71 1 0 0 0 0 M END 3D MOL for HMDB0032814 (Quinquenoside I)HMDB0032814 RDKit 3D Quinquenoside I 157163 0 0 0 0 0 0 0 0999 V2000 15.0718 1.2752 -1.7976 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6600 1.6517 -1.5351 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6260 0.8420 -1.7341 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2525 1.3095 -1.4439 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3222 0.5082 -1.6556 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9533 2.5508 -0.9626 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6980 3.0814 -0.6624 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9159 2.4073 0.3927 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6356 1.0844 0.1705 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5254 0.7369 0.9969 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1332 -0.4872 0.6214 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9911 -0.7599 -0.0103 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9334 -1.4542 0.8643 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8878 -1.8344 0.0753 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6953 -1.2163 0.2832 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6796 -2.1815 0.9539 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5247 -1.3314 1.3797 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0823 -0.5123 0.2219 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2526 0.9160 0.4995 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5634 -1.0286 -0.9967 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0543 -0.5048 -2.2469 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4881 -0.9450 -2.3855 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2798 -0.8621 -1.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0395 -2.2373 -1.1054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5771 -0.7814 0.1626 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2639 -0.0512 1.2972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3888 0.8620 0.9293 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1894 1.0166 2.0933 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2603 0.4499 -0.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2745 1.2553 -0.7832 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4714 1.8574 -0.0994 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9859 2.9379 0.9134 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2644 2.5893 -1.1379 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4659 3.3496 -0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5835 2.6433 -0.1309 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0695 3.0263 1.0186 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1990 2.2694 1.6233 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5435 4.2095 1.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0711 0.9711 0.6876 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5503 -0.2157 0.5735 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9837 -0.2982 0.7967 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4537 -1.5148 0.3905 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6881 -1.8566 1.2081 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6998 -0.9398 1.0645 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5082 -2.6575 0.3942 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0923 -3.0076 -0.9122 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3315 -2.5348 1.3205 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4871 -3.2858 2.4778 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0786 -1.1050 1.7380 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8549 -0.7982 2.8896 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5667 0.5730 -2.0857 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4343 -0.4295 -2.2796 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3580 0.1406 -1.3678 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9422 1.4305 -1.9390 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0483 -0.9373 -1.0722 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4761 -2.1209 -1.9719 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6585 0.2692 -1.6576 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5151 -2.6004 1.3525 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7795 -3.5413 0.3746 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8090 -4.5066 0.9856 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1276 -5.4779 0.0554 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2109 -3.0730 -0.9484 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5876 -3.8040 -1.9782 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1450 -1.5955 -1.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3227 -1.1428 -1.8752 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1182 0.7583 2.4062 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1586 -0.1575 2.4635 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6052 2.1010 2.8072 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6214 2.9857 3.1737 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5386 2.6558 1.7488 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7969 2.1241 1.8915 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1619 0.2493 -2.1934 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7397 1.3802 -0.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4874 1.9635 -2.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4390 2.6268 -1.1563 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7862 -0.1315 -2.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9166 4.1307 -0.2710 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0842 3.2843 -1.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8916 2.9096 0.4721 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8390 1.5844 0.7997 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4876 0.1902 -0.2648 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6318 -0.7663 1.6623 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7057 -0.3719 0.9691 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4704 -3.0537 0.3591 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1631 -2.5325 1.8996 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8686 -0.6820 2.2049 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2309 -2.0077 1.8169 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4205 1.0411 1.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0529 1.3536 -0.1211 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6210 1.6100 0.2881 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3287 -2.1517 -0.9785 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0349 0.5920 -2.2069 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5652 -0.8439 -3.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4042 -2.0048 -2.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9411 -0.4285 -3.2469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8859 -2.2432 -0.4426 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1419 -2.6392 -2.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3188 -2.9687 -0.6010 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5491 -1.8644 0.5808 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7226 -0.7851 2.0277 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5173 0.4603 1.9373 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9654 1.8622 0.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7687 1.7063 2.6879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8085 -0.5358 0.1029 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7535 2.3019 -1.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2159 2.6765 1.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9393 3.1798 0.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6434 3.8419 0.7447 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5261 1.9365 -2.0072 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5532 3.3437 -1.6044 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2586 4.3441 -0.2986 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9656 3.7217 -1.7588 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9984 1.7893 -0.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7769 1.7906 0.7856 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8766 1.5441 2.3878 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9515 2.9770 2.0809 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2358 4.5275 2.5643 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5013 5.1039 1.0718 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5479 4.0721 2.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4479 -0.8290 -0.3367 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8004 -1.3961 -0.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3396 -1.9692 2.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0365 -2.8674 0.8808 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1327 -0.8112 1.9460 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0656 -3.5752 0.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7009 -3.8976 -0.8751 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4300 -2.8866 0.7754 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7442 -3.9412 2.5687 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0570 -0.8798 2.0207 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9771 0.1923 2.9778 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5881 1.2997 -2.9404 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4978 0.0157 -2.1698 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7477 -1.4411 -2.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1365 -0.3630 -3.3537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0411 1.4502 -2.5872 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7733 2.2658 -1.2230 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7094 1.8451 -2.6671 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1224 -1.8010 -2.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0582 -2.8733 -1.4035 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6252 -2.6418 -2.4149 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9665 0.8356 -2.3127 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2158 0.9258 -0.9580 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4705 -0.0580 -2.3831 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8516 -4.1418 0.2668 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6632 -3.8655 1.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3536 -4.9915 1.8978 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0816 -5.7781 0.1429 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3022 -3.3545 -1.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8894 -4.3999 -1.6676 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3479 -1.4670 -1.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2399 -0.1695 -1.9999 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3731 0.4336 3.1590 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5681 -0.3599 1.5964 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2695 1.9360 3.7161 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5618 3.0083 4.1591 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5918 3.7524 1.8940 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9587 1.6635 2.7540 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 2 3 36 37 1 0 36 38 1 0 31 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 30 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 20 55 1 0 55 56 1 0 55 57 1 0 13 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 10 66 1 0 66 67 1 0 66 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 70 8 1 0 64 12 1 0 55 15 1 0 25 18 1 0 53 29 1 0 53 23 1 0 49 40 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 0 3 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 10 80 1 0 12 81 1 0 13 82 1 0 15 83 1 0 16 84 1 0 16 85 1 0 17 86 1 0 17 87 1 0 19 88 1 0 19 89 1 0 19 90 1 0 20 91 1 0 21 92 1 0 21 93 1 0 22 94 1 0 22 95 1 0 24 96 1 0 24 97 1 0 24 98 1 0 25 99 1 0 26100 1 0 26101 1 0 27102 1 0 28103 1 0 29104 1 0 30105 1 0 32106 1 0 32107 1 0 32108 1 0 33109 1 0 33110 1 0 34111 1 0 34112 1 0 35113 1 0 37114 1 0 37115 1 0 37116 1 0 38117 1 0 38118 1 0 38119 1 0 40120 1 0 42121 1 0 43122 1 0 43123 1 0 44124 1 0 45125 1 0 46126 1 0 47127 1 0 48128 1 0 49129 1 0 50130 1 0 51131 1 0 51132 1 0 52133 1 0 52134 1 0 54135 1 0 54136 1 0 54137 1 0 56138 1 0 56139 1 0 56140 1 0 57141 1 0 57142 1 0 57143 1 0 59144 1 0 60145 1 0 60146 1 0 61147 1 0 62148 1 0 63149 1 0 64150 1 0 65151 1 0 66152 1 0 67153 1 0 68154 1 0 69155 1 0 70156 1 0 71157 1 0 M END 3D SDF for HMDB0032814 (Quinquenoside I)Mrv0541 05061306432D 71 77 0 0 0 0 999 V2000 6.1282 2.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3435 2.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7307 1.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9459 2.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1612 2.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2885 -0.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9073 0.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6920 0.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1766 0.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6914 1.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9069 1.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1922 1.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4779 1.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4783 0.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1930 -0.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6864 -0.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0739 2.3696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1934 -0.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4791 -1.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7644 -0.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7640 -0.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7636 0.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2005 2.9572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5691 3.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7411 2.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5258 2.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0494 0.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6649 -0.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6645 -0.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3788 -1.3446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0934 -0.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0938 -0.1075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8085 0.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8089 1.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0946 1.5425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8065 -3.8203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5212 -3.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2355 -3.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2351 -4.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3795 -2.5846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6652 -2.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9505 -2.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2363 -2.1710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5216 -2.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8073 -2.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8077 -1.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5224 -0.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5228 -0.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2375 0.3040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9501 -3.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6644 -3.8217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2367 -1.3460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4378 -2.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0502 -1.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3368 -2.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0941 -2.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0945 -1.3474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8084 -2.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5231 -2.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2374 -2.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6482 3.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9027 4.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3504 4.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5435 4.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2889 4.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8413 3.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4099 2.7313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4820 3.8391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9912 5.4085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6049 5.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0526 6.3652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 25 2 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 10 1 0 0 0 0 4 23 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 7 11 1 0 0 0 0 7 15 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 14 21 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 54 1 0 0 0 0 21 22 1 0 0 0 0 21 27 1 0 0 0 0 23 61 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 54 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 46 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 33 48 1 0 0 0 0 34 35 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 44 1 0 0 0 0 38 39 1 0 0 0 0 38 50 1 0 0 0 0 40 41 1 0 0 0 0 40 56 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 42 50 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 47 52 1 0 0 0 0 48 49 1 0 0 0 0 50 51 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 56 57 2 0 0 0 0 56 58 1 0 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 61 62 1 0 0 0 0 61 66 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 63 70 1 0 0 0 0 64 65 1 0 0 0 0 64 69 1 0 0 0 0 65 66 1 0 0 0 0 65 68 1 0 0 0 0 66 67 1 0 0 0 0 70 71 1 0 0 0 0 M END > <DATABASE_ID> HMDB0032814 > <DATABASE_NAME> hmdb > <SMILES> C\C=C\C(=O)OCC1OC(OC2C(O)C(O)C(CO)OC2OC2CCC3(C)C(CCC4(C)C3CC(O)C3C(CCC43C)C(C)(CCC=C(C)C)OC3OC(CO)C(O)C(O)C3O)C2(C)C)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C52H86O19/c1-10-12-34(56)65-24-30-38(59)40(61)42(63)45(68-30)70-44-41(62)37(58)29(23-54)67-47(44)69-33-16-18-49(6)31(48(33,4)5)15-20-50(7)32(49)21-27(55)35-26(14-19-51(35,50)8)52(9,17-11-13-25(2)3)71-46-43(64)39(60)36(57)28(22-53)66-46/h10,12-13,26-33,35-47,53-55,57-64H,11,14-24H2,1-9H3/b12-10+ > <INCHI_KEY> BTRPYCUFCMLYGV-ZRDIBKRKSA-N > <FORMULA> C52H86O19 > <MOLECULAR_WEIGHT> 1015.2278 > <EXACT_MASS> 1014.57633057 > <JCHEM_ACCEPTOR_COUNT> 18 > <JCHEM_AVERAGE_POLARIZABILITY> 111.09032107809062 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 11 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> {6-[(4,5-dihydroxy-2-{[16-hydroxy-2,6,6,10,11-pentamethyl-14-(6-methyl-2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hept-5-en-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl]oxy}-6-(hydroxymethyl)oxan-3-yl)oxy]-3,4,5-trihydroxyoxan-2-yl}methyl (2E)-but-2-enoate > <ALOGPS_LOGP> 2.02 > <JCHEM_LOGP> 2.0368176133333367 > <ALOGPS_LOGS> -3.89 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 7 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.313121987439079 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.847105655774998 > <JCHEM_PKA_STRONGEST_BASIC> -3.648377769780388 > <JCHEM_POLAR_SURFACE_AREA> 304.21 > <JCHEM_REFRACTIVITY> 253.94850000000014 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.32e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> {6-[(4,5-dihydroxy-2-{[16-hydroxy-2,6,6,10,11-pentamethyl-14-(6-methyl-2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hept-5-en-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl]oxy}-6-(hydroxymethyl)oxan-3-yl)oxy]-3,4,5-trihydroxyoxan-2-yl}methyl (2E)-but-2-enoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0032814 (Quinquenoside I)HMDB0032814 RDKit 3D Quinquenoside I 157163 0 0 0 0 0 0 0 0999 V2000 15.0718 1.2752 -1.7976 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6600 1.6517 -1.5351 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6260 0.8420 -1.7341 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2525 1.3095 -1.4439 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3222 0.5082 -1.6556 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9533 2.5508 -0.9626 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6980 3.0814 -0.6624 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9159 2.4073 0.3927 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6356 1.0844 0.1705 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5254 0.7369 0.9969 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1332 -0.4872 0.6214 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9911 -0.7599 -0.0103 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9334 -1.4542 0.8643 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8878 -1.8344 0.0753 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6953 -1.2163 0.2832 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6796 -2.1815 0.9539 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5247 -1.3314 1.3797 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0823 -0.5123 0.2219 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2526 0.9160 0.4995 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5634 -1.0286 -0.9967 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0543 -0.5048 -2.2469 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4881 -0.9450 -2.3855 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2798 -0.8621 -1.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0395 -2.2373 -1.1054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5771 -0.7814 0.1626 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2639 -0.0512 1.2972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3888 0.8620 0.9293 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1894 1.0166 2.0933 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2603 0.4499 -0.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2745 1.2553 -0.7832 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4714 1.8574 -0.0994 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9859 2.9379 0.9134 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2644 2.5893 -1.1379 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4659 3.3496 -0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5835 2.6433 -0.1309 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0695 3.0263 1.0186 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1990 2.2694 1.6233 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5435 4.2095 1.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0711 0.9711 0.6876 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5503 -0.2157 0.5735 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9837 -0.2982 0.7967 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4537 -1.5148 0.3905 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6881 -1.8566 1.2081 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6998 -0.9398 1.0645 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5082 -2.6575 0.3942 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0923 -3.0076 -0.9122 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3315 -2.5348 1.3205 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4871 -3.2858 2.4778 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0786 -1.1050 1.7380 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8549 -0.7982 2.8896 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5667 0.5730 -2.0857 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4343 -0.4295 -2.2796 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3580 0.1406 -1.3678 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9422 1.4305 -1.9390 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0483 -0.9373 -1.0722 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4761 -2.1209 -1.9719 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6585 0.2692 -1.6576 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5151 -2.6004 1.3525 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7795 -3.5413 0.3746 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8090 -4.5066 0.9856 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1276 -5.4779 0.0554 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2109 -3.0730 -0.9484 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5876 -3.8040 -1.9782 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1450 -1.5955 -1.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3227 -1.1428 -1.8752 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1182 0.7583 2.4062 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1586 -0.1575 2.4635 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6052 2.1010 2.8072 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6214 2.9857 3.1737 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5386 2.6558 1.7488 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7969 2.1241 1.8915 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1619 0.2493 -2.1934 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7397 1.3802 -0.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4874 1.9635 -2.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4390 2.6268 -1.1563 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7862 -0.1315 -2.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9166 4.1307 -0.2710 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0842 3.2843 -1.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8916 2.9096 0.4721 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8390 1.5844 0.7997 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4876 0.1902 -0.2648 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6318 -0.7663 1.6623 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7057 -0.3719 0.9691 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4704 -3.0537 0.3591 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1631 -2.5325 1.8996 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8686 -0.6820 2.2049 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2309 -2.0077 1.8169 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4205 1.0411 1.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0529 1.3536 -0.1211 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6210 1.6100 0.2881 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3287 -2.1517 -0.9785 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0349 0.5920 -2.2069 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5652 -0.8439 -3.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4042 -2.0048 -2.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9411 -0.4285 -3.2469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8859 -2.2432 -0.4426 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1419 -2.6392 -2.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3188 -2.9687 -0.6010 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5491 -1.8644 0.5808 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7226 -0.7851 2.0277 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5173 0.4603 1.9373 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9654 1.8622 0.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7687 1.7063 2.6879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8085 -0.5358 0.1029 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7535 2.3019 -1.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2159 2.6765 1.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9393 3.1798 0.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6434 3.8419 0.7447 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5261 1.9365 -2.0072 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5532 3.3437 -1.6044 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2586 4.3441 -0.2986 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9656 3.7217 -1.7588 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9984 1.7893 -0.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7769 1.7906 0.7856 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8766 1.5441 2.3878 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9515 2.9770 2.0809 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2358 4.5275 2.5643 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5013 5.1039 1.0718 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5479 4.0721 2.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4479 -0.8290 -0.3367 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8004 -1.3961 -0.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3396 -1.9692 2.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0365 -2.8674 0.8808 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1327 -0.8112 1.9460 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0656 -3.5752 0.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7009 -3.8976 -0.8751 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4300 -2.8866 0.7754 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7442 -3.9412 2.5687 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0570 -0.8798 2.0207 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9771 0.1923 2.9778 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5881 1.2997 -2.9404 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4978 0.0157 -2.1698 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7477 -1.4411 -2.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1365 -0.3630 -3.3537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0411 1.4502 -2.5872 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7733 2.2658 -1.2230 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7094 1.8451 -2.6671 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1224 -1.8010 -2.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0582 -2.8733 -1.4035 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6252 -2.6418 -2.4149 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9665 0.8356 -2.3127 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2158 0.9258 -0.9580 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4705 -0.0580 -2.3831 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8516 -4.1418 0.2668 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6632 -3.8655 1.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3536 -4.9915 1.8978 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0816 -5.7781 0.1429 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3022 -3.3545 -1.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8894 -4.3999 -1.6676 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3479 -1.4670 -1.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2399 -0.1695 -1.9999 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3731 0.4336 3.1590 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5681 -0.3599 1.5964 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2695 1.9360 3.7161 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5618 3.0083 4.1591 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5918 3.7524 1.8940 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9587 1.6635 2.7540 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 1 0 35 36 2 3 36 37 1 0 36 38 1 0 31 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 30 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 20 55 1 0 55 56 1 0 55 57 1 0 13 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 10 66 1 0 66 67 1 0 66 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 70 8 1 0 64 12 1 0 55 15 1 0 25 18 1 0 53 29 1 0 53 23 1 0 49 40 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 0 3 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 10 80 1 0 12 81 1 0 13 82 1 0 15 83 1 0 16 84 1 0 16 85 1 0 17 86 1 0 17 87 1 0 19 88 1 0 19 89 1 0 19 90 1 0 20 91 1 0 21 92 1 0 21 93 1 0 22 94 1 0 22 95 1 0 24 96 1 0 24 97 1 0 24 98 1 0 25 99 1 0 26100 1 0 26101 1 0 27102 1 0 28103 1 0 29104 1 0 30105 1 0 32106 1 0 32107 1 0 32108 1 0 33109 1 0 33110 1 0 34111 1 0 34112 1 0 35113 1 0 37114 1 0 37115 1 0 37116 1 0 38117 1 0 38118 1 0 38119 1 0 40120 1 0 42121 1 0 43122 1 0 43123 1 0 44124 1 0 45125 1 0 46126 1 0 47127 1 0 48128 1 0 49129 1 0 50130 1 0 51131 1 0 51132 1 0 52133 1 0 52134 1 0 54135 1 0 54136 1 0 54137 1 0 56138 1 0 56139 1 0 56140 1 0 57141 1 0 57142 1 0 57143 1 0 59144 1 0 60145 1 0 60146 1 0 61147 1 0 62148 1 0 63149 1 0 64150 1 0 65151 1 0 66152 1 0 67153 1 0 68154 1 0 69155 1 0 70156 1 0 71157 1 0 M END PDB for HMDB0032814 (Quinquenoside I)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 11.439 4.136 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 9.975 4.611 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 8.831 3.580 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 7.366 4.055 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 5.901 4.530 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 6.139 -0.793 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 5.427 0.574 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 6.892 0.099 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 7.796 1.345 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 6.891 2.590 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 5.426 2.114 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 4.092 2.883 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 2.759 2.113 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 2.759 0.573 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 4.094 -0.197 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 5.015 -1.506 0.000 0.00 0.00 C+0 HETATM 17 O UNK 0 3.871 4.423 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 4.094 -1.737 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 2.761 -2.507 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.427 -1.738 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 1.426 -0.198 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 1.425 1.342 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 7.841 5.520 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 12.262 6.673 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 12.583 5.167 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 14.048 4.692 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 0.092 0.571 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -1.241 -0.199 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -1.240 -1.739 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 -2.574 -2.510 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 -3.908 -1.741 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 -3.908 -0.201 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 -5.243 0.569 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -5.243 2.109 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 -3.910 2.879 0.000 0.00 0.00 O+0 HETATM 36 O UNK 0 -5.239 -7.131 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 -6.573 -6.362 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -7.906 -7.133 0.000 0.00 0.00 C+0 HETATM 39 O UNK 0 -7.906 -8.673 0.000 0.00 0.00 O+0 HETATM 40 O UNK 0 -11.908 -4.825 0.000 0.00 0.00 O+0 HETATM 41 C UNK 0 -10.575 -4.054 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -9.241 -4.823 0.000 0.00 0.00 C+0 HETATM 43 O UNK 0 -7.908 -4.053 0.000 0.00 0.00 O+0 HETATM 44 C UNK 0 -6.574 -4.822 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 -5.240 -4.051 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -5.241 -2.511 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -6.575 -1.742 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -6.576 -0.202 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 -7.910 0.567 0.000 0.00 0.00 O+0 HETATM 50 C UNK 0 -9.240 -6.363 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 -10.574 -7.134 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 -7.909 -2.513 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 0.817 -3.868 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 0.094 -2.509 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -0.629 -3.869 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 -13.242 -4.055 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 -13.243 -2.515 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 -14.576 -4.826 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -15.910 -4.056 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -17.243 -4.827 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 6.810 6.664 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 7.285 8.129 0.000 0.00 0.00 O+0 HETATM 63 C UNK 0 6.254 9.273 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 4.748 8.952 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 4.273 7.487 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 5.304 6.343 0.000 0.00 0.00 C+0 HETATM 67 O UNK 0 4.498 5.098 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 2.766 7.166 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 3.717 10.096 0.000 0.00 0.00 O+0 HETATM 70 C UNK 0 6.729 10.738 0.000 0.00 0.00 C+0 HETATM 71 O UNK 0 5.698 11.882 0.000 0.00 0.00 O+0 CONECT 1 2 25 CONECT 2 1 3 CONECT 3 2 4 CONECT 4 3 5 10 23 CONECT 5 4 CONECT 6 7 CONECT 7 6 8 11 15 CONECT 8 7 9 CONECT 9 8 10 CONECT 10 4 9 11 CONECT 11 7 10 12 CONECT 12 11 13 17 CONECT 13 12 14 CONECT 14 13 15 21 CONECT 15 7 14 16 18 CONECT 16 15 CONECT 17 12 CONECT 18 15 19 CONECT 19 18 20 CONECT 20 19 21 54 CONECT 21 14 20 22 27 CONECT 22 21 CONECT 23 4 61 CONECT 24 25 CONECT 25 1 24 26 CONECT 26 25 CONECT 27 21 28 CONECT 28 27 29 CONECT 29 28 30 54 CONECT 30 29 31 CONECT 31 30 32 46 CONECT 32 31 33 CONECT 33 32 34 48 CONECT 34 33 35 CONECT 35 34 CONECT 36 37 CONECT 37 36 38 44 CONECT 38 37 39 50 CONECT 39 38 CONECT 40 41 56 CONECT 41 40 42 CONECT 42 41 43 50 CONECT 43 42 44 CONECT 44 37 43 45 CONECT 45 44 46 CONECT 46 31 45 47 CONECT 47 46 48 52 CONECT 48 33 47 49 CONECT 49 48 CONECT 50 38 42 51 CONECT 51 50 CONECT 52 47 CONECT 53 54 CONECT 54 20 29 53 55 CONECT 55 54 CONECT 56 40 57 58 CONECT 57 56 CONECT 58 56 59 CONECT 59 58 60 CONECT 60 59 CONECT 61 23 62 66 CONECT 62 61 63 CONECT 63 62 64 70 CONECT 64 63 65 69 CONECT 65 64 66 68 CONECT 66 61 65 67 CONECT 67 66 CONECT 68 65 CONECT 69 64 CONECT 70 63 71 CONECT 71 70 MASTER 0 0 0 0 0 0 0 0 71 0 154 0 END 3D PDB for HMDB0032814 (Quinquenoside I)COMPND HMDB0032814 HETATM 1 C1 UNL 1 15.072 1.275 -1.798 1.00 0.00 C HETATM 2 C2 UNL 1 13.660 1.652 -1.535 1.00 0.00 C HETATM 3 C3 UNL 1 12.626 0.842 -1.734 1.00 0.00 C HETATM 4 C4 UNL 1 11.252 1.309 -1.444 1.00 0.00 C HETATM 5 O1 UNL 1 10.322 0.508 -1.656 1.00 0.00 O HETATM 6 O2 UNL 1 10.953 2.551 -0.963 1.00 0.00 O HETATM 7 C5 UNL 1 9.698 3.081 -0.662 1.00 0.00 C HETATM 8 C6 UNL 1 8.916 2.407 0.393 1.00 0.00 C HETATM 9 O3 UNL 1 8.636 1.084 0.170 1.00 0.00 O HETATM 10 C7 UNL 1 7.525 0.737 0.997 1.00 0.00 C HETATM 11 O4 UNL 1 7.133 -0.487 0.621 1.00 0.00 O HETATM 12 C8 UNL 1 5.991 -0.760 -0.010 1.00 0.00 C HETATM 13 C9 UNL 1 4.933 -1.454 0.864 1.00 0.00 C HETATM 14 O5 UNL 1 3.888 -1.834 0.075 1.00 0.00 O HETATM 15 C10 UNL 1 2.695 -1.216 0.283 1.00 0.00 C HETATM 16 C11 UNL 1 1.680 -2.182 0.954 1.00 0.00 C HETATM 17 C12 UNL 1 0.525 -1.331 1.380 1.00 0.00 C HETATM 18 C13 UNL 1 -0.082 -0.512 0.222 1.00 0.00 C HETATM 19 C14 UNL 1 0.253 0.916 0.499 1.00 0.00 C HETATM 20 C15 UNL 1 0.563 -1.029 -0.997 1.00 0.00 C HETATM 21 C16 UNL 1 -0.054 -0.505 -2.247 1.00 0.00 C HETATM 22 C17 UNL 1 -1.488 -0.945 -2.385 1.00 0.00 C HETATM 23 C18 UNL 1 -2.280 -0.862 -1.101 1.00 0.00 C HETATM 24 C19 UNL 1 -3.040 -2.237 -1.105 1.00 0.00 C HETATM 25 C20 UNL 1 -1.577 -0.781 0.163 1.00 0.00 C HETATM 26 C21 UNL 1 -2.264 -0.051 1.297 1.00 0.00 C HETATM 27 C22 UNL 1 -3.389 0.862 0.929 1.00 0.00 C HETATM 28 O6 UNL 1 -4.189 1.017 2.093 1.00 0.00 O HETATM 29 C23 UNL 1 -4.260 0.450 -0.147 1.00 0.00 C HETATM 30 C24 UNL 1 -5.275 1.255 -0.783 1.00 0.00 C HETATM 31 C25 UNL 1 -6.471 1.857 -0.099 1.00 0.00 C HETATM 32 C26 UNL 1 -5.986 2.938 0.913 1.00 0.00 C HETATM 33 C27 UNL 1 -7.264 2.589 -1.138 1.00 0.00 C HETATM 34 C28 UNL 1 -8.466 3.350 -0.783 1.00 0.00 C HETATM 35 C29 UNL 1 -9.583 2.643 -0.131 1.00 0.00 C HETATM 36 C30 UNL 1 -10.069 3.026 1.019 1.00 0.00 C HETATM 37 C31 UNL 1 -11.199 2.269 1.623 1.00 0.00 C HETATM 38 C32 UNL 1 -9.543 4.210 1.730 1.00 0.00 C HETATM 39 O7 UNL 1 -7.071 0.971 0.688 1.00 0.00 O HETATM 40 C33 UNL 1 -7.550 -0.216 0.573 1.00 0.00 C HETATM 41 O8 UNL 1 -8.984 -0.298 0.797 1.00 0.00 O HETATM 42 C34 UNL 1 -9.454 -1.515 0.391 1.00 0.00 C HETATM 43 C35 UNL 1 -10.688 -1.857 1.208 1.00 0.00 C HETATM 44 O9 UNL 1 -11.700 -0.940 1.065 1.00 0.00 O HETATM 45 C36 UNL 1 -8.508 -2.658 0.394 1.00 0.00 C HETATM 46 O10 UNL 1 -8.092 -3.008 -0.912 1.00 0.00 O HETATM 47 C37 UNL 1 -7.332 -2.535 1.320 1.00 0.00 C HETATM 48 O11 UNL 1 -7.487 -3.286 2.478 1.00 0.00 O HETATM 49 C38 UNL 1 -7.079 -1.105 1.738 1.00 0.00 C HETATM 50 O12 UNL 1 -7.855 -0.798 2.890 1.00 0.00 O HETATM 51 C39 UNL 1 -5.567 0.573 -2.086 1.00 0.00 C HETATM 52 C40 UNL 1 -4.434 -0.430 -2.280 1.00 0.00 C HETATM 53 C41 UNL 1 -3.358 0.141 -1.368 1.00 0.00 C HETATM 54 C42 UNL 1 -2.942 1.431 -1.939 1.00 0.00 C HETATM 55 C43 UNL 1 2.048 -0.937 -1.072 1.00 0.00 C HETATM 56 C44 UNL 1 2.476 -2.121 -1.972 1.00 0.00 C HETATM 57 C45 UNL 1 2.658 0.269 -1.658 1.00 0.00 C HETATM 58 O13 UNL 1 5.515 -2.600 1.353 1.00 0.00 O HETATM 59 C46 UNL 1 5.779 -3.541 0.375 1.00 0.00 C HETATM 60 C47 UNL 1 6.809 -4.507 0.986 1.00 0.00 C HETATM 61 O14 UNL 1 7.128 -5.478 0.055 1.00 0.00 O HETATM 62 C48 UNL 1 6.211 -3.073 -0.948 1.00 0.00 C HETATM 63 O15 UNL 1 5.588 -3.804 -1.978 1.00 0.00 O HETATM 64 C49 UNL 1 6.145 -1.596 -1.227 1.00 0.00 C HETATM 65 O16 UNL 1 7.323 -1.143 -1.875 1.00 0.00 O HETATM 66 C50 UNL 1 8.118 0.758 2.406 1.00 0.00 C HETATM 67 O17 UNL 1 9.159 -0.157 2.464 1.00 0.00 O HETATM 68 C51 UNL 1 8.605 2.101 2.807 1.00 0.00 C HETATM 69 O18 UNL 1 7.621 2.986 3.174 1.00 0.00 O HETATM 70 C52 UNL 1 9.539 2.656 1.749 1.00 0.00 C HETATM 71 O19 UNL 1 10.797 2.124 1.892 1.00 0.00 O HETATM 72 H1 UNL 1 15.162 0.249 -2.193 1.00 0.00 H HETATM 73 H2 UNL 1 15.740 1.380 -0.930 1.00 0.00 H HETATM 74 H3 UNL 1 15.487 1.964 -2.578 1.00 0.00 H HETATM 75 H4 UNL 1 13.439 2.627 -1.156 1.00 0.00 H HETATM 76 H5 UNL 1 12.786 -0.132 -2.097 1.00 0.00 H HETATM 77 H6 UNL 1 9.917 4.131 -0.271 1.00 0.00 H HETATM 78 H7 UNL 1 9.084 3.284 -1.578 1.00 0.00 H HETATM 79 H8 UNL 1 7.892 2.910 0.472 1.00 0.00 H HETATM 80 H9 UNL 1 6.839 1.584 0.800 1.00 0.00 H HETATM 81 H10 UNL 1 5.488 0.190 -0.265 1.00 0.00 H HETATM 82 H11 UNL 1 4.632 -0.766 1.662 1.00 0.00 H HETATM 83 H12 UNL 1 2.706 -0.372 0.969 1.00 0.00 H HETATM 84 H13 UNL 1 1.470 -3.054 0.359 1.00 0.00 H HETATM 85 H14 UNL 1 2.163 -2.533 1.900 1.00 0.00 H HETATM 86 H15 UNL 1 0.869 -0.682 2.205 1.00 0.00 H HETATM 87 H16 UNL 1 -0.231 -2.008 1.817 1.00 0.00 H HETATM 88 H17 UNL 1 0.420 1.041 1.586 1.00 0.00 H HETATM 89 H18 UNL 1 1.053 1.354 -0.121 1.00 0.00 H HETATM 90 H19 UNL 1 -0.621 1.610 0.288 1.00 0.00 H HETATM 91 H20 UNL 1 0.329 -2.152 -0.979 1.00 0.00 H HETATM 92 H21 UNL 1 0.035 0.592 -2.207 1.00 0.00 H HETATM 93 H22 UNL 1 0.565 -0.844 -3.099 1.00 0.00 H HETATM 94 H23 UNL 1 -1.404 -2.005 -2.746 1.00 0.00 H HETATM 95 H24 UNL 1 -1.941 -0.428 -3.247 1.00 0.00 H HETATM 96 H25 UNL 1 -3.886 -2.243 -0.443 1.00 0.00 H HETATM 97 H26 UNL 1 -3.142 -2.639 -2.114 1.00 0.00 H HETATM 98 H27 UNL 1 -2.319 -2.969 -0.601 1.00 0.00 H HETATM 99 H28 UNL 1 -1.549 -1.864 0.581 1.00 0.00 H HETATM 100 H29 UNL 1 -2.723 -0.785 2.028 1.00 0.00 H HETATM 101 H30 UNL 1 -1.517 0.460 1.937 1.00 0.00 H HETATM 102 H31 UNL 1 -2.965 1.862 0.739 1.00 0.00 H HETATM 103 H32 UNL 1 -3.769 1.706 2.688 1.00 0.00 H HETATM 104 H33 UNL 1 -4.808 -0.536 0.103 1.00 0.00 H HETATM 105 H34 UNL 1 -4.753 2.302 -1.099 1.00 0.00 H HETATM 106 H35 UNL 1 -6.216 2.676 1.952 1.00 0.00 H HETATM 107 H36 UNL 1 -4.939 3.180 0.796 1.00 0.00 H HETATM 108 H37 UNL 1 -6.643 3.842 0.745 1.00 0.00 H HETATM 109 H38 UNL 1 -7.526 1.936 -2.007 1.00 0.00 H HETATM 110 H39 UNL 1 -6.553 3.344 -1.604 1.00 0.00 H HETATM 111 H40 UNL 1 -8.259 4.344 -0.299 1.00 0.00 H HETATM 112 H41 UNL 1 -8.966 3.722 -1.759 1.00 0.00 H HETATM 113 H42 UNL 1 -9.998 1.789 -0.636 1.00 0.00 H HETATM 114 H43 UNL 1 -11.777 1.791 0.786 1.00 0.00 H HETATM 115 H44 UNL 1 -10.877 1.544 2.388 1.00 0.00 H HETATM 116 H45 UNL 1 -11.951 2.977 2.081 1.00 0.00 H HETATM 117 H46 UNL 1 -10.236 4.527 2.564 1.00 0.00 H HETATM 118 H47 UNL 1 -9.501 5.104 1.072 1.00 0.00 H HETATM 119 H48 UNL 1 -8.548 4.072 2.175 1.00 0.00 H HETATM 120 H49 UNL 1 -7.448 -0.829 -0.337 1.00 0.00 H HETATM 121 H50 UNL 1 -9.800 -1.396 -0.675 1.00 0.00 H HETATM 122 H51 UNL 1 -10.340 -1.969 2.262 1.00 0.00 H HETATM 123 H52 UNL 1 -11.036 -2.867 0.881 1.00 0.00 H HETATM 124 H53 UNL 1 -12.133 -0.811 1.946 1.00 0.00 H HETATM 125 H54 UNL 1 -9.066 -3.575 0.732 1.00 0.00 H HETATM 126 H55 UNL 1 -7.701 -3.898 -0.875 1.00 0.00 H HETATM 127 H56 UNL 1 -6.430 -2.887 0.775 1.00 0.00 H HETATM 128 H57 UNL 1 -6.744 -3.941 2.569 1.00 0.00 H HETATM 129 H58 UNL 1 -6.057 -0.880 2.021 1.00 0.00 H HETATM 130 H59 UNL 1 -7.977 0.192 2.978 1.00 0.00 H HETATM 131 H60 UNL 1 -5.588 1.300 -2.940 1.00 0.00 H HETATM 132 H61 UNL 1 -6.498 0.016 -2.170 1.00 0.00 H HETATM 133 H62 UNL 1 -4.748 -1.441 -2.052 1.00 0.00 H HETATM 134 H63 UNL 1 -4.137 -0.363 -3.354 1.00 0.00 H HETATM 135 H64 UNL 1 -2.041 1.450 -2.587 1.00 0.00 H HETATM 136 H65 UNL 1 -2.773 2.266 -1.223 1.00 0.00 H HETATM 137 H66 UNL 1 -3.709 1.845 -2.667 1.00 0.00 H HETATM 138 H67 UNL 1 3.122 -1.801 -2.804 1.00 0.00 H HETATM 139 H68 UNL 1 3.058 -2.873 -1.403 1.00 0.00 H HETATM 140 H69 UNL 1 1.625 -2.642 -2.415 1.00 0.00 H HETATM 141 H70 UNL 1 1.967 0.836 -2.313 1.00 0.00 H HETATM 142 H71 UNL 1 3.216 0.926 -0.958 1.00 0.00 H HETATM 143 H72 UNL 1 3.470 -0.058 -2.383 1.00 0.00 H HETATM 144 H73 UNL 1 4.852 -4.142 0.267 1.00 0.00 H HETATM 145 H74 UNL 1 7.663 -3.865 1.285 1.00 0.00 H HETATM 146 H75 UNL 1 6.354 -4.991 1.898 1.00 0.00 H HETATM 147 H76 UNL 1 8.082 -5.778 0.143 1.00 0.00 H HETATM 148 H77 UNL 1 7.302 -3.355 -1.077 1.00 0.00 H HETATM 149 H78 UNL 1 4.889 -4.400 -1.668 1.00 0.00 H HETATM 150 H79 UNL 1 5.348 -1.467 -1.992 1.00 0.00 H HETATM 151 H80 UNL 1 7.240 -0.170 -2.000 1.00 0.00 H HETATM 152 H81 UNL 1 7.373 0.434 3.159 1.00 0.00 H HETATM 153 H82 UNL 1 9.568 -0.360 1.596 1.00 0.00 H HETATM 154 H83 UNL 1 9.269 1.936 3.716 1.00 0.00 H HETATM 155 H84 UNL 1 7.562 3.008 4.159 1.00 0.00 H HETATM 156 H85 UNL 1 9.592 3.752 1.894 1.00 0.00 H HETATM 157 H86 UNL 1 10.959 1.664 2.754 1.00 0.00 H CONECT 1 2 72 73 74 CONECT 2 3 3 75 CONECT 3 4 76 CONECT 4 5 5 6 CONECT 6 7 CONECT 7 8 77 78 CONECT 8 9 70 79 CONECT 9 10 CONECT 10 11 66 80 CONECT 11 12 CONECT 12 13 64 81 CONECT 13 14 58 82 CONECT 14 15 CONECT 15 16 55 83 CONECT 16 17 84 85 CONECT 17 18 86 87 CONECT 18 19 20 25 CONECT 19 88 89 90 CONECT 20 21 55 91 CONECT 21 22 92 93 CONECT 22 23 94 95 CONECT 23 24 25 53 CONECT 24 96 97 98 CONECT 25 26 99 CONECT 26 27 100 101 CONECT 27 28 29 102 CONECT 28 103 CONECT 29 30 53 104 CONECT 30 31 51 105 CONECT 31 32 33 39 CONECT 32 106 107 108 CONECT 33 34 109 110 CONECT 34 35 111 112 CONECT 35 36 36 113 CONECT 36 37 38 CONECT 37 114 115 116 CONECT 38 117 118 119 CONECT 39 40 CONECT 40 41 49 120 CONECT 41 42 CONECT 42 43 45 121 CONECT 43 44 122 123 CONECT 44 124 CONECT 45 46 47 125 CONECT 46 126 CONECT 47 48 49 127 CONECT 48 128 CONECT 49 50 129 CONECT 50 130 CONECT 51 52 131 132 CONECT 52 53 133 134 CONECT 53 54 CONECT 54 135 136 137 CONECT 55 56 57 CONECT 56 138 139 140 CONECT 57 141 142 143 CONECT 58 59 CONECT 59 60 62 144 CONECT 60 61 145 146 CONECT 61 147 CONECT 62 63 64 148 CONECT 63 149 CONECT 64 65 150 CONECT 65 151 CONECT 66 67 68 152 CONECT 67 153 CONECT 68 69 70 154 CONECT 69 155 CONECT 70 71 156 CONECT 71 157 END SMILES for HMDB0032814 (Quinquenoside I)C\C=C\C(=O)OCC1OC(OC2C(O)C(O)C(CO)OC2OC2CCC3(C)C(CCC4(C)C3CC(O)C3C(CCC43C)C(C)(CCC=C(C)C)OC3OC(CO)C(O)C(O)C3O)C2(C)C)C(O)C(O)C1O INCHI for HMDB0032814 (Quinquenoside I)InChI=1S/C52H86O19/c1-10-12-34(56)65-24-30-38(59)40(61)42(63)45(68-30)70-44-41(62)37(58)29(23-54)67-47(44)69-33-16-18-49(6)31(48(33,4)5)15-20-50(7)32(49)21-27(55)35-26(14-19-51(35,50)8)52(9,17-11-13-25(2)3)71-46-43(64)39(60)36(57)28(22-53)66-46/h10,12-13,26-33,35-47,53-55,57-64H,11,14-24H2,1-9H3/b12-10+ 3D Structure for HMDB0032814 (Quinquenoside I) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C52H86O19 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1015.2278 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1014.57633057 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | {6-[(4,5-dihydroxy-2-{[16-hydroxy-2,6,6,10,11-pentamethyl-14-(6-methyl-2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hept-5-en-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl]oxy}-6-(hydroxymethyl)oxan-3-yl)oxy]-3,4,5-trihydroxyoxan-2-yl}methyl (2E)-but-2-enoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | {6-[(4,5-dihydroxy-2-{[16-hydroxy-2,6,6,10,11-pentamethyl-14-(6-methyl-2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hept-5-en-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl]oxy}-6-(hydroxymethyl)oxan-3-yl)oxy]-3,4,5-trihydroxyoxan-2-yl}methyl (2E)-but-2-enoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 208764-50-5 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | C\C=C\C(=O)OCC1OC(OC2C(O)C(O)C(CO)OC2OC2CCC3(C)C(CCC4(C)C3CC(O)C3C(CCC43C)C(C)(CCC=C(C)C)OC3OC(CO)C(O)C(O)C3O)C2(C)C)C(O)C(O)C1O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C52H86O19/c1-10-12-34(56)65-24-30-38(59)40(61)42(63)45(68-30)70-44-41(62)37(58)29(23-54)67-47(44)69-33-16-18-49(6)31(48(33,4)5)15-20-50(7)32(49)21-27(55)35-26(14-19-51(35,50)8)52(9,17-11-13-25(2)3)71-46-43(64)39(60)36(57)28(22-53)66-46/h10,12-13,26-33,35-47,53-55,57-64H,11,14-24H2,1-9H3/b12-10+ | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | BTRPYCUFCMLYGV-ZRDIBKRKSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB010788 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131751320 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|