Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:52:26 UTC

Update Date

2022-03-07 02:53:30 UTC

HMDB ID

HMDB0032880

Secondary Accession Numbers

HMDB32880

Metabolite Identification

Common Name

trans-Zeatin-O-glucoside riboside

Description

Cytokinin, widely distributed in plants.Zeatin is a plant hormone derived from the purine adenine. It is a member of the plant growth hormone family known as cytokinins. Zeatin was first discovered in immature corn kernels from the genus Zea. Zeatin and derivatives were discovered to be the primary active ingredient in coconut milk, which has long been known to actively induce plant growth. ; As in the case of kinetin, zeatin has also been reported to have several in vitro anti-aging effects on human skin fibroblasts.(Wikipedia).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061306462D          

 36 39  0  0  0  0            999 V2000
    4.7812    4.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    4.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5683   -1.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2102    8.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    5.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    1.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6538    1.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    4.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0992   -1.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4957    8.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9233    1.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    8.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8838   -1.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    8.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3687   -0.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    7.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378    2.3479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9233    1.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8838    0.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    6.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378    3.1729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    1.9354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378    0.6979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1387    2.1904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1387    0.8555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4820   -2.3145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2102    9.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    9.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1387   -2.0486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    8.5354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1937   -0.5966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    6.8854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    6.0604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0992   -0.1841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4957    7.2979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0  0  0  0
  9  1  1  0  0  0  0
  9  2  2  0  0  0  0
  9  6  1  0  0  0  0
 10  4  1  0  0  0  0
 11  5  1  0  0  0  0
 13 11  1  0  0  0  0
 14 10  1  0  0  0  0
 15 13  1  0  0  0  0
 16 14  1  0  0  0  0
 17 15  1  0  0  0  0
 18 12  2  0  0  0  0
 19 12  1  0  0  0  0
 20 16  1  0  0  0  0
 21 17  1  0  0  0  0
 22  3  1  0  0  0  0
 22 18  1  0  0  0  0
 23  7  2  0  0  0  0
 23 18  1  0  0  0  0
 24  7  1  0  0  0  0
 24 19  2  0  0  0  0
 25  8  2  0  0  0  0
 25 12  1  0  0  0  0
 26  8  1  0  0  0  0
 26 19  1  0  0  0  0
 26 20  1  0  0  0  0
 27  4  1  0  0  0  0
 28  5  1  0  0  0  0
 29 13  1  0  0  0  0
 30 14  1  0  0  0  0
 31 15  1  0  0  0  0
 32 16  1  0  0  0  0
 33 17  1  0  0  0  0
 34  6  1  0  0  0  0
 34 21  1  0  0  0  0
 35 10  1  0  0  0  0
 35 20  1  0  0  0  0
 36 11  1  0  0  0  0
 36 21  1  0  0  0  0
M  END

HMDB0032880
     RDKit          3D
trans-Zeatin-O-glucoside riboside
 67 70  0  0  0  0  0  0  0  0999 V2000
   -3.1082   -1.6204   -0.2170 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2810   -0.4798    0.1816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1345   -0.6603    0.8183 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5991   -1.9795    1.1792 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6816   -2.1914    0.5152 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7641   -1.3428    0.8215 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6651   -0.3402    1.7229 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7229    0.4154    1.9674 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8863    0.2075    1.3416 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668   -0.7670    0.4333 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9774   -1.5673    0.1624 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3934   -2.4519   -0.7591 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6851   -2.1970   -1.0356 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1236   -1.1514   -0.3036 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4509   -0.5903   -0.3299 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0257   -0.5973   -1.5852 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9980    0.3719   -1.5634 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3427   -0.1489   -1.1360 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3605   -0.6958    0.1227 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4902    1.5015   -0.7303 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4721    1.9870    0.1306 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3954    0.8676    0.0999 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6082    0.9680    1.4537 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6192    0.9449   -0.1159 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7576    1.3988    0.4404 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9104    0.8653    0.0645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7856    1.8695   -0.4328 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7325    1.2640   -1.2472 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9679    2.1574   -1.2646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6520    3.4117   -1.7615 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0466   -0.1386   -0.8772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4015   -0.3756   -1.1963 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8554   -0.4830    0.5568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0363   -0.4144    1.2965 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7320    0.2774    1.2293 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3378    1.3324    1.9468 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5712   -2.5962   -0.3009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3728   -1.4313   -1.3183 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9911   -1.8260    0.3919 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5269    0.2390    1.1079 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4124   -1.9929    2.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3077   -2.7690    0.9979 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7805   -2.9584   -0.1699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6016    1.2191    2.7060 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3018   -2.7392   -1.7395 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0868   -1.1796    0.3561 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1238    0.7308   -2.6229 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6330   -0.9429   -1.8538 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0968    0.6438   -1.2019 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1607   -0.4379    0.6655 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906    2.3562   -1.3414 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4783    2.9771    0.1255 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3929    1.2708   -0.1620 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5624    0.8310    1.6789 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6469    0.9739   -1.2517 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7499    1.6323    0.1016 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8676    0.0886   -0.6879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3256    1.2804   -2.2804 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3241    2.2175   -0.2262 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7463    1.6964   -1.9321 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6224    4.1203   -1.0881 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4777   -0.8484   -1.5468 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4458   -0.4262   -2.1848 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5465   -1.5697    0.5973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4516   -1.3004    1.4384 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1174   -0.3344    1.8942 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9579    1.4279    2.8467 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
  2 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 11  6  1  0
 22 15  1  0
 35 26  1  0
 14 10  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  3 40  1  0
  4 41  1  0
  4 42  1  0
  5 43  1  0
  8 44  1  0
 13 45  1  0
 15 46  1  0
 17 47  1  0
 18 48  1  0
 18 49  1  0
 19 50  1  0
 20 51  1  0
 21 52  1  0
 22 53  1  0
 23 54  1  0
 24 55  1  0
 24 56  1  0
 26 57  1  0
 28 58  1  0
 29 59  1  0
 29 60  1  0
 30 61  1  0
 31 62  1  0
 32 63  1  0
 33 64  1  0
 34 65  1  0
 35 66  1  0
 36 67  1  0
M  END

  Mrv0541 05061306462D          

 36 39  0  0  0  0            999 V2000
    4.7812    4.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    4.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5683   -1.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2102    8.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    5.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    1.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6538    1.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    4.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0992   -1.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4957    8.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9233    1.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    8.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8838   -1.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    8.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3687   -0.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668    7.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378    2.3479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9233    1.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8838    0.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    6.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378    3.1729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    1.9354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378    0.6979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1387    2.1904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1387    0.8555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4820   -2.3145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2102    9.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    9.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1387   -2.0486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    8.5354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1937   -0.5966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3523    6.8854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7812    6.0604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0992   -0.1841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4957    7.2979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0  0  0  0
  9  1  1  0  0  0  0
  9  2  2  0  0  0  0
  9  6  1  0  0  0  0
 10  4  1  0  0  0  0
 11  5  1  0  0  0  0
 13 11  1  0  0  0  0
 14 10  1  0  0  0  0
 15 13  1  0  0  0  0
 16 14  1  0  0  0  0
 17 15  1  0  0  0  0
 18 12  2  0  0  0  0
 19 12  1  0  0  0  0
 20 16  1  0  0  0  0
 21 17  1  0  0  0  0
 22  3  1  0  0  0  0
 22 18  1  0  0  0  0
 23  7  2  0  0  0  0
 23 18  1  0  0  0  0
 24  7  1  0  0  0  0
 24 19  2  0  0  0  0
 25  8  2  0  0  0  0
 25 12  1  0  0  0  0
 26  8  1  0  0  0  0
 26 19  1  0  0  0  0
 26 20  1  0  0  0  0
 27  4  1  0  0  0  0
 28  5  1  0  0  0  0
 29 13  1  0  0  0  0
 30 14  1  0  0  0  0
 31 15  1  0  0  0  0
 32 16  1  0  0  0  0
 33 17  1  0  0  0  0
 34  6  1  0  0  0  0
 34 21  1  0  0  0  0
 35 10  1  0  0  0  0
 35 20  1  0  0  0  0
 36 11  1  0  0  0  0
 36 21  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0032880

> <DATABASE_NAME>
hmdb

> <SMILES>
C\C(COC1OC(CO)C(O)C(O)C1O)=C/CNC1=C2N=CN(C3OC(CO)C(O)C3O)C2=NC=N1

> <INCHI_IDENTIFIER>
InChI=1S/C21H31N5O10/c1-9(6-34-21-17(33)15(31)13(29)11(5-28)36-21)2-3-22-18-12-19(24-7-23-18)26(8-25-12)20-16(32)14(30)10(4-27)35-20/h2,7-8,10-11,13-17,20-21,27-33H,3-6H2,1H3,(H,22,23,24)/b9-2+

> <INCHI_KEY>
MVMBTNNVZQRZQT-XNWCZRBMSA-N

> <FORMULA>
C21H31N5O10

> <MOLECULAR_WEIGHT>
513.4983

> <EXACT_MASS>
513.207092237

> <JCHEM_ACCEPTOR_COUNT>
14

> <JCHEM_AVERAGE_POLARIZABILITY>
51.833150501653805

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-{[(2E)-4-({9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-9H-purin-6-yl}amino)-2-methylbut-2-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

> <ALOGPS_LOGP>
-1.33

> <JCHEM_LOGP>
-3.4796205029999996

> <ALOGPS_LOGS>
-1.91

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
12.576777817657046

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.01672852296644

> <JCHEM_PKA_STRONGEST_BASIC>
4.845278623794467

> <JCHEM_POLAR_SURFACE_AREA>
224.92999999999995

> <JCHEM_REFRACTIVITY>
121.99519999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
9

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
6.29e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-{[(2E)-4-({9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl}amino)-2-methylbut-2-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0032880
     RDKit          3D
trans-Zeatin-O-glucoside riboside
 67 70  0  0  0  0  0  0  0  0999 V2000
   -3.1082   -1.6204   -0.2170 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2810   -0.4798    0.1816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1345   -0.6603    0.8183 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5991   -1.9795    1.1792 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6816   -2.1914    0.5152 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7641   -1.3428    0.8215 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6651   -0.3402    1.7229 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7229    0.4154    1.9674 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8863    0.2075    1.3416 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668   -0.7670    0.4333 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9774   -1.5673    0.1624 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3934   -2.4519   -0.7591 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6851   -2.1970   -1.0356 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1236   -1.1514   -0.3036 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4509   -0.5903   -0.3299 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0257   -0.5973   -1.5852 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9980    0.3719   -1.5634 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3427   -0.1489   -1.1360 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3605   -0.6958    0.1227 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4902    1.5015   -0.7303 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4721    1.9870    0.1306 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3954    0.8676    0.0999 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6082    0.9680    1.4537 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6192    0.9449   -0.1159 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7576    1.3988    0.4404 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9104    0.8653    0.0645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7856    1.8695   -0.4328 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7325    1.2640   -1.2472 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9679    2.1574   -1.2646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6520    3.4117   -1.7615 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0466   -0.1386   -0.8772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4015   -0.3756   -1.1963 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8554   -0.4830    0.5568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0363   -0.4144    1.2965 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7320    0.2774    1.2293 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3378    1.3324    1.9468 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5712   -2.5962   -0.3009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3728   -1.4313   -1.3183 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9911   -1.8260    0.3919 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5269    0.2390    1.1079 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4124   -1.9929    2.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3077   -2.7690    0.9979 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7805   -2.9584   -0.1699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6016    1.2191    2.7060 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3018   -2.7392   -1.7395 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0868   -1.1796    0.3561 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1238    0.7308   -2.6229 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6330   -0.9429   -1.8538 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0968    0.6438   -1.2019 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1607   -0.4379    0.6655 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906    2.3562   -1.3414 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4783    2.9771    0.1255 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3929    1.2708   -0.1620 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5624    0.8310    1.6789 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6469    0.9739   -1.2517 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7499    1.6323    0.1016 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8676    0.0886   -0.6879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3256    1.2804   -2.2804 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3241    2.2175   -0.2262 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7463    1.6964   -1.9321 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6224    4.1203   -1.0881 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4777   -0.8484   -1.5468 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4458   -0.4262   -2.1848 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5465   -1.5697    0.5973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4516   -1.3004    1.4384 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1174   -0.3344    1.8942 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9579    1.4279    2.8467 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
  2 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 11  6  1  0
 22 15  1  0
 35 26  1  0
 14 10  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  3 40  1  0
  4 41  1  0
  4 42  1  0
  5 43  1  0
  8 44  1  0
 13 45  1  0
 15 46  1  0
 17 47  1  0
 18 48  1  0
 18 49  1  0
 19 50  1  0
 20 51  1  0
 21 52  1  0
 22 53  1  0
 23 54  1  0
 24 55  1  0
 24 56  1  0
 26 57  1  0
 28 58  1  0
 29 59  1  0
 29 60  1  0
 30 61  1  0
 31 62  1  0
 32 63  1  0
 33 64  1  0
 34 65  1  0
 35 66  1  0
 36 67  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       8.925   8.233   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       6.258   8.233   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       6.258   6.693   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -1.061  -2.789   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      11.592  15.933   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       7.591  10.543   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       6.258   2.073   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       1.220   2.843   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       7.591   9.003   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       0.185  -1.884   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      10.259  15.163   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       3.590   3.613   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       8.925  15.933   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       1.650  -2.359   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       7.591  15.163   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.555  -1.114   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       7.591  13.623   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       4.924   4.383   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       3.590   2.073   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       1.650   0.132   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       8.925  12.853   0.000  0.00  0.00           C+0
HETATM   22  N   UNK     0       4.924   5.923   0.000  0.00  0.00           N+0
HETATM   23  N   UNK     0       6.258   3.613   0.000  0.00  0.00           N+0
HETATM   24  N   UNK     0       4.924   1.303   0.000  0.00  0.00           N+0
HETATM   25  N   UNK     0       2.126   4.089   0.000  0.00  0.00           N+0
HETATM   26  N   UNK     0       2.126   1.597   0.000  0.00  0.00           N+0
HETATM   27  O   UNK     0      -0.900  -4.320   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      11.592  17.473   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       8.925  17.473   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       2.126  -3.824   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       6.258  15.933   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       4.095  -1.114   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       6.258  12.853   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       8.925  11.313   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       0.185  -0.344   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      10.259  13.623   0.000  0.00  0.00           O+0
CONECT    1    9                                                            
CONECT    2    3    9                                                       
CONECT    3    2   22                                                       
CONECT    4   10   27                                                       
CONECT    5   11   28                                                       
CONECT    6    9   34                                                       
CONECT    7   23   24                                                       
CONECT    8   25   26                                                       
CONECT    9    1    2    6                                                  
CONECT   10    4   14   35                                                  
CONECT   11    5   13   36                                                  
CONECT   12   18   19   25                                                  
CONECT   13   11   15   29                                                  
CONECT   14   10   16   30                                                  
CONECT   15   13   17   31                                                  
CONECT   16   14   20   32                                                  
CONECT   17   15   21   33                                                  
CONECT   18   12   22   23                                                  
CONECT   19   12   24   26                                                  
CONECT   20   16   26   35                                                  
CONECT   21   17   34   36                                                  
CONECT   22    3   18                                                       
CONECT   23    7   18                                                       
CONECT   24    7   19                                                       
CONECT   25    8   12                                                       
CONECT   26    8   19   20                                                  
CONECT   27    4                                                            
CONECT   28    5                                                            
CONECT   29   13                                                            
CONECT   30   14                                                            
CONECT   31   15                                                            
CONECT   32   16                                                            
CONECT   33   17                                                            
CONECT   34    6   21                                                       
CONECT   35   10   20                                                       
CONECT   36   11   21                                                       
MASTER        0    0    0    0    0    0    0    0   36    0   78    0
END

COMPND    HMDB0032880
HETATM    1  C1  UNL     1      -3.108  -1.620  -0.217  1.00  0.00           C  
HETATM    2  C2  UNL     1      -2.281  -0.480   0.182  1.00  0.00           C  
HETATM    3  C3  UNL     1      -1.135  -0.660   0.818  1.00  0.00           C  
HETATM    4  C4  UNL     1      -0.599  -1.979   1.179  1.00  0.00           C  
HETATM    5  N1  UNL     1       0.682  -2.191   0.515  1.00  0.00           N  
HETATM    6  C5  UNL     1       1.764  -1.343   0.822  1.00  0.00           C  
HETATM    7  N2  UNL     1       1.665  -0.340   1.723  1.00  0.00           N  
HETATM    8  C6  UNL     1       2.723   0.415   1.967  1.00  0.00           C  
HETATM    9  N3  UNL     1       3.886   0.207   1.342  1.00  0.00           N  
HETATM   10  C7  UNL     1       4.067  -0.767   0.433  1.00  0.00           C  
HETATM   11  C8  UNL     1       2.977  -1.567   0.162  1.00  0.00           C  
HETATM   12  N4  UNL     1       3.393  -2.452  -0.759  1.00  0.00           N  
HETATM   13  C9  UNL     1       4.685  -2.197  -1.036  1.00  0.00           C  
HETATM   14  N5  UNL     1       5.124  -1.151  -0.304  1.00  0.00           N  
HETATM   15  C10 UNL     1       6.451  -0.590  -0.330  1.00  0.00           C  
HETATM   16  O1  UNL     1       7.026  -0.597  -1.585  1.00  0.00           O  
HETATM   17  C11 UNL     1       7.998   0.372  -1.563  1.00  0.00           C  
HETATM   18  C12 UNL     1       9.343  -0.149  -1.136  1.00  0.00           C  
HETATM   19  O2  UNL     1       9.360  -0.696   0.123  1.00  0.00           O  
HETATM   20  C13 UNL     1       7.490   1.502  -0.730  1.00  0.00           C  
HETATM   21  O3  UNL     1       8.472   1.987   0.131  1.00  0.00           O  
HETATM   22  C14 UNL     1       6.395   0.868   0.100  1.00  0.00           C  
HETATM   23  O4  UNL     1       6.608   0.968   1.454  1.00  0.00           O  
HETATM   24  C15 UNL     1      -2.619   0.945  -0.116  1.00  0.00           C  
HETATM   25  O5  UNL     1      -3.758   1.399   0.440  1.00  0.00           O  
HETATM   26  C16 UNL     1      -4.910   0.865   0.065  1.00  0.00           C  
HETATM   27  O6  UNL     1      -5.786   1.870  -0.433  1.00  0.00           O  
HETATM   28  C17 UNL     1      -6.733   1.264  -1.247  1.00  0.00           C  
HETATM   29  C18 UNL     1      -7.968   2.157  -1.265  1.00  0.00           C  
HETATM   30  O7  UNL     1      -7.652   3.412  -1.762  1.00  0.00           O  
HETATM   31  C19 UNL     1      -7.047  -0.139  -0.877  1.00  0.00           C  
HETATM   32  O8  UNL     1      -8.401  -0.376  -1.196  1.00  0.00           O  
HETATM   33  C20 UNL     1      -6.855  -0.483   0.557  1.00  0.00           C  
HETATM   34  O9  UNL     1      -8.036  -0.414   1.297  1.00  0.00           O  
HETATM   35  C21 UNL     1      -5.732   0.277   1.229  1.00  0.00           C  
HETATM   36  O10 UNL     1      -6.338   1.332   1.947  1.00  0.00           O  
HETATM   37  H1  UNL     1      -2.571  -2.596  -0.301  1.00  0.00           H  
HETATM   38  H2  UNL     1      -3.373  -1.431  -1.318  1.00  0.00           H  
HETATM   39  H3  UNL     1      -3.991  -1.826   0.392  1.00  0.00           H  
HETATM   40  H4  UNL     1      -0.527   0.239   1.108  1.00  0.00           H  
HETATM   41  H5  UNL     1      -0.412  -1.993   2.309  1.00  0.00           H  
HETATM   42  H6  UNL     1      -1.308  -2.769   0.998  1.00  0.00           H  
HETATM   43  H7  UNL     1       0.781  -2.958  -0.170  1.00  0.00           H  
HETATM   44  H8  UNL     1       2.602   1.219   2.706  1.00  0.00           H  
HETATM   45  H9  UNL     1       5.302  -2.739  -1.739  1.00  0.00           H  
HETATM   46  H10 UNL     1       7.087  -1.180   0.356  1.00  0.00           H  
HETATM   47  H11 UNL     1       8.124   0.731  -2.623  1.00  0.00           H  
HETATM   48  H12 UNL     1       9.633  -0.943  -1.854  1.00  0.00           H  
HETATM   49  H13 UNL     1      10.097   0.644  -1.202  1.00  0.00           H  
HETATM   50  H14 UNL     1      10.161  -0.438   0.666  1.00  0.00           H  
HETATM   51  H15 UNL     1       7.091   2.356  -1.341  1.00  0.00           H  
HETATM   52  H16 UNL     1       8.478   2.977   0.126  1.00  0.00           H  
HETATM   53  H17 UNL     1       5.393   1.271  -0.162  1.00  0.00           H  
HETATM   54  H18 UNL     1       7.562   0.831   1.679  1.00  0.00           H  
HETATM   55  H19 UNL     1      -2.647   0.974  -1.252  1.00  0.00           H  
HETATM   56  H20 UNL     1      -1.750   1.632   0.102  1.00  0.00           H  
HETATM   57  H21 UNL     1      -4.868   0.089  -0.688  1.00  0.00           H  
HETATM   58  H22 UNL     1      -6.326   1.280  -2.280  1.00  0.00           H  
HETATM   59  H23 UNL     1      -8.324   2.217  -0.226  1.00  0.00           H  
HETATM   60  H24 UNL     1      -8.746   1.696  -1.932  1.00  0.00           H  
HETATM   61  H25 UNL     1      -7.622   4.120  -1.088  1.00  0.00           H  
HETATM   62  H26 UNL     1      -6.478  -0.848  -1.547  1.00  0.00           H  
HETATM   63  H27 UNL     1      -8.446  -0.426  -2.185  1.00  0.00           H  
HETATM   64  H28 UNL     1      -6.547  -1.570   0.597  1.00  0.00           H  
HETATM   65  H29 UNL     1      -8.452  -1.300   1.438  1.00  0.00           H  
HETATM   66  H30 UNL     1      -5.117  -0.334   1.894  1.00  0.00           H  
HETATM   67  H31 UNL     1      -5.958   1.428   2.847  1.00  0.00           H  
CONECT    1    2   37   38   39
CONECT    2    3    3   24
CONECT    3    4   40
CONECT    4    5   41   42
CONECT    5    6   43
CONECT    6    7    7   11
CONECT    7    8
CONECT    8    9    9   44
CONECT    9   10
CONECT   10   11   11   14
CONECT   11   12
CONECT   12   13   13
CONECT   13   14   45
CONECT   14   15
CONECT   15   16   22   46
CONECT   16   17
CONECT   17   18   20   47
CONECT   18   19   48   49
CONECT   19   50
CONECT   20   21   22   51
CONECT   21   52
CONECT   22   23   53
CONECT   23   54
CONECT   24   25   55   56
CONECT   25   26
CONECT   26   27   35   57
CONECT   27   28
CONECT   28   29   31   58
CONECT   29   30   59   60
CONECT   30   61
CONECT   31   32   33   62
CONECT   32   63
CONECT   33   34   35   64
CONECT   34   65
CONECT   35   36   66
CONECT   36   67
END

HMDB0032880
     RDKit          3D
trans-Zeatin-O-glucoside riboside
 67 70  0  0  0  0  0  0  0  0999 V2000
   -3.1082   -1.6204   -0.2170 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2810   -0.4798    0.1816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1345   -0.6603    0.8183 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5991   -1.9795    1.1792 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6816   -2.1914    0.5152 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7641   -1.3428    0.8215 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6651   -0.3402    1.7229 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7229    0.4154    1.9674 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8863    0.2075    1.3416 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668   -0.7670    0.4333 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9774   -1.5673    0.1624 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3934   -2.4519   -0.7591 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6851   -2.1970   -1.0356 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1236   -1.1514   -0.3036 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4509   -0.5903   -0.3299 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0257   -0.5973   -1.5852 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9980    0.3719   -1.5634 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3427   -0.1489   -1.1360 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3605   -0.6958    0.1227 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4902    1.5015   -0.7303 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4721    1.9870    0.1306 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3954    0.8676    0.0999 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6082    0.9680    1.4537 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6192    0.9449   -0.1159 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7576    1.3988    0.4404 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9104    0.8653    0.0645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7856    1.8695   -0.4328 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7325    1.2640   -1.2472 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9679    2.1574   -1.2646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6520    3.4117   -1.7615 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0466   -0.1386   -0.8772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4015   -0.3756   -1.1963 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8554   -0.4830    0.5568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0363   -0.4144    1.2965 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7320    0.2774    1.2293 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3378    1.3324    1.9468 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5712   -2.5962   -0.3009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3728   -1.4313   -1.3183 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9911   -1.8260    0.3919 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5269    0.2390    1.1079 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4124   -1.9929    2.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3077   -2.7690    0.9979 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7805   -2.9584   -0.1699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6016    1.2191    2.7060 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3018   -2.7392   -1.7395 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0868   -1.1796    0.3561 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1238    0.7308   -2.6229 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6330   -0.9429   -1.8538 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0968    0.6438   -1.2019 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1607   -0.4379    0.6655 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0906    2.3562   -1.3414 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4783    2.9771    0.1255 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3929    1.2708   -0.1620 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5624    0.8310    1.6789 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6469    0.9739   -1.2517 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7499    1.6323    0.1016 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8676    0.0886   -0.6879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3256    1.2804   -2.2804 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3241    2.2175   -0.2262 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7463    1.6964   -1.9321 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6224    4.1203   -1.0881 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4777   -0.8484   -1.5468 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4458   -0.4262   -2.1848 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5465   -1.5697    0.5973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4516   -1.3004    1.4384 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1174   -0.3344    1.8942 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9579    1.4279    2.8467 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
  2 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 11  6  1  0
 22 15  1  0
 35 26  1  0
 14 10  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  3 40  1  0
  4 41  1  0
  4 42  1  0
  5 43  1  0
  8 44  1  0
 13 45  1  0
 15 46  1  0
 17 47  1  0
 18 48  1  0
 18 49  1  0
 19 50  1  0
 20 51  1  0
 21 52  1  0
 22 53  1  0
 23 54  1  0
 24 55  1  0
 24 56  1  0
 26 57  1  0
 28 58  1  0
 29 59  1  0
 29 60  1  0
 30 61  1  0
 31 62  1  0
 32 63  1  0
 33 64  1  0
 34 65  1  0
 35 66  1  0
 36 67  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
trans-Zeatin riboside-O-glucoside	HMDB

Chemical Formula

C₂₁H₃₁N₅O₁₀

Average Molecular Weight

513.4983

Monoisotopic Molecular Weight

513.207092237

IUPAC Name

2-{[(2E)-4-({9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-9H-purin-6-yl}amino)-2-methylbut-2-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

Traditional Name

2-{[(2E)-4-({9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl}amino)-2-methylbut-2-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

CAS Registry Number

62512-97-4

SMILES

C\C(COC1OC(CO)C(O)C(O)C1O)=C/CNC1=C2N=CN(C3OC(CO)C(O)C3O)C2=NC=N1

InChI Identifier

InChI=1S/C21H31N5O10/c1-9(6-34-21-17(33)15(31)13(29)11(5-28)36-21)2-3-22-18-12-19(24-7-23-18)26(8-25-12)20-16(32)14(30)10(4-27)35-20/h2,7-8,10-11,13-17,20-21,27-33H,3-6H2,1H3,(H,22,23,24)/b9-2+

InChI Key

MVMBTNNVZQRZQT-XNWCZRBMSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as 2-naphthalene sulfonates. These are organic aromatic compounds that contain a naphthalene moiety that carries a sulfonic acid group at the 2-position. Naphthalene is a bicyclic compound that is made up of two fused benzene ring.

Kingdom

Organic compounds

Super Class

Benzenoids

Class

Naphthalenes

Sub Class

Naphthalene sulfonic acids and derivatives

Direct Parent

2-naphthalene sulfonates

Alternative Parents

Substituents

2-naphthalene sulfonic acid or derivatives
2-naphthalene sulfonate
2-naphthol
Benzenesulfonate
Arylsulfonic acid or derivatives
Benzenesulfonyl group
1-sulfo,2-unsubstituted aromatic compound
Methoxyaniline
Anisole
Phenoxy compound
Phenol ether
Methoxybenzene
Alkyl aryl ether
1-hydroxy-2-unsubstituted benzenoid
Toluene
Monocyclic benzene moiety
Organic sulfonic acid or derivatives
Sulfonyl
Organosulfonic acid
Organosulfonic acid or derivatives
Azo compound
Ether
Propargyl-type 1,3-dipolar organic compound
Organic 1,3-dipolar compound
Organopnictogen compound
Organosulfur compound
Organooxygen compound
Organonitrogen compound
Organic oxygen compound
Organic oxide
Organic nitrogen compound
Hydrocarbon derivative
Aromatic homopolycyclic compound

Molecular Framework

Aromatic homopolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0032880)
Cytoplasm (HMDB: HMDB0032880)

Source

Exogenous

Exogenous (HMDB: HMDB0032880)

Food

Food (HMDB: HMDB0032880)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0032880)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	6.29 g/L	ALOGPS
logP	-1.3	ALOGPS
logP	-3.5	ChemAxon
logS	-1.9	ALOGPS
pKa (Strongest Acidic)	12.02	ChemAxon
pKa (Strongest Basic)	4.85	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	14	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	224.93 Å²	ChemAxon
Rotatable Bond Count	9	ChemAxon
Refractivity	122 m³·mol⁻¹	ChemAxon
Polarizability	51.83 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	222.331	30932474
DeepCCS	[M-H]-	219.936	30932474
DeepCCS	[M-2H]-	252.819	30932474
DeepCCS	[M+Na]+	228.244	30932474
AllCCS	[M+H]+	217.9	32859911
AllCCS	[M+H-H2O]+	216.3	32859911
AllCCS	[M+NH4]+	219.4	32859911
AllCCS	[M+Na]+	219.8	32859911
AllCCS	[M-H]-	210.3	32859911
AllCCS	[M+Na-2H]-	211.4	32859911
AllCCS	[M+HCOO]-	212.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
trans-Zeatin-O-glucoside riboside	C\C(COC1OC(CO)C(O)C(O)C1O)=C/CNC1=C2N=CN(C3OC(CO)C(O)C3O)C2=NC=N1	4578.3	Standard polar	33892256
trans-Zeatin-O-glucoside riboside	C\C(COC1OC(CO)C(O)C(O)C1O)=C/CNC1=C2N=CN(C3OC(CO)C(O)C3O)C2=NC=N1	4032.4	Standard non polar	33892256
trans-Zeatin-O-glucoside riboside	C\C(COC1OC(CO)C(O)C(O)C1O)=C/CNC1=C2N=CN(C3OC(CO)C(O)C3O)C2=NC=N1	4575.1	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
trans-Zeatin-O-glucoside riboside,1TMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4566.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4544.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4501.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4539.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O)C1O	4575.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #6	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O	4575.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #7	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4566.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TMS,isomer #8	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4525.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4442.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #10	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4429.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #11	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4387.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #12	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4408.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #13	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4416.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #14	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4383.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #15	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4385.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #16	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4375.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #17	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4403.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #18	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4364.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #19	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4429.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4446.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #20	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4435.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #21	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4422.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #22	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4403.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #23	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O	4456.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #24	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4443.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #25	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4429.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #26	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4468.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #27	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4430.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #28	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4417.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4437.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4441.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4388.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #6	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4439.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #7	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4415.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #8	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4436.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TMS,isomer #9	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4439.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4310.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #10	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4315.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #11	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4314.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #12	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4304.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #13	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4250.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #14	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4304.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #15	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4306.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #16	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4289.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #17	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4306.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #18	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4319.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #19	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4296.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4299.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #20	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4275.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #21	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4319.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #22	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4305.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #23	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4292.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #24	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4260.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #25	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4280.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #26	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4315.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #27	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4322.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #28	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4265.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #29	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4291.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4314.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #30	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4317.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #31	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4254.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #32	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4280.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #33	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4308.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #34	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4309.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #35	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4280.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #36	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4294.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #37	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4248.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #38	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4238.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #39	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4276.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4260.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #40	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4262.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #41	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4261.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #42	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4284.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #43	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4263.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #44	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4273.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #45	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4254.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #46	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4292.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #47	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4296.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #48	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4284.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #49	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4303.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4313.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #50	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4314.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #51	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4305.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #52	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4295.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #53	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4325.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #54	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4321.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #55	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4307.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #56	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4334.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #6	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4315.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #7	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4322.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #8	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4315.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TMS,isomer #9	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4259.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4195.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #10	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4170.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #11	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4187.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #12	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4195.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #13	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4179.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #14	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4140.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #15	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4190.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #16	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4207.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #17	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4155.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #18	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4205.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #19	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4207.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4192.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #20	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4175.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #21	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4193.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #22	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4195.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #23	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4183.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #24	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4149.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #25	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4192.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #26	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4166.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #27	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4184.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #28	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4188.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #29	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4176.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4144.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #30	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4139.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #31	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4184.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #32	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4236.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #33	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4180.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #34	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4200.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #35	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4188.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #36	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4184.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #37	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4135.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #38	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4150.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #39	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4179.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4187.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #40	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4127.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #41	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4144.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #42	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4168.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #43	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4169.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #44	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4144.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #45	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4157.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #46	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4155.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #47	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4175.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #48	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4203.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #49	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4185.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #5	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4190.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #50	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4156.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #51	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4166.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #52	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4175.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #53	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4144.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #54	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4156.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #55	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4205.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #56	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4133.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #57	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4146.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #58	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4128.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #59	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4139.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #6	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4182.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #60	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4118.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #61	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4153.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #62	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4172.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #63	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4150.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #64	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4164.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #65	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4153.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #66	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4176.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #67	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4165.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #68	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4153.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #69	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4193.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #7	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4135.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #70	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O	4210.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #8	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4179.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,4TMS,isomer #9	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4179.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4115.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #10	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4093.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #11	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4066.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #12	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4090.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #13	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4088.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #14	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4074.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #15	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4043.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #16	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4083.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #17	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4112.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #18	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4075.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #19	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4102.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4060.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #20	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4081.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #21	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4084.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #22	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4110.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #23	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4119.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #24	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4096.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #25	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4064.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #26	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4114.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #27	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4115.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #28	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4083.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #29	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4111.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4114.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #30	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4090.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #31	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4105.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #32	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4069.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #33	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4101.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #34	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4077.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #35	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4150.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #36	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4043.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #37	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4065.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #38	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4094.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #39	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4056.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #4	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4099.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #40	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4049.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #41	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4061.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #42	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4044.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #43	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4036.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #44	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4050.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #45	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4082.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #46	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4081.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #47	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4068.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #48	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4079.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #49	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4092.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4075.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #50	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4077.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #51	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4054.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #52	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4044.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #53	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4055.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #54	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4043.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #55	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4077.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #56	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4089.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #6	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4100.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #7	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4098.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #8	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4084.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,5TMS,isomer #9	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C)COC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4053.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4749.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4752.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4704.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4750.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O)C1O	4759.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #6	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O	4780.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #7	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4771.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,1TBDMS,isomer #8	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4715.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4816.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #10	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4834.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #11	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4792.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #12	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4812.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #13	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4795.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #14	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4776.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #15	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4784.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #16	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4777.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #17	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4812.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #18	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4745.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #19	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4824.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4827.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #20	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4834.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #21	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4828.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #22	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4785.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #23	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O	4838.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #24	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4828.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #25	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4802.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #26	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4862.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #27	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4810.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #28	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4797.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4820.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4831.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4780.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #6	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4830.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #7	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4788.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #8	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4830.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,2TBDMS,isomer #9	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4841.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #1	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4834.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #10	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4859.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #11	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4835.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #12	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4855.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #13	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4805.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #14	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4849.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #15	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4821.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #16	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4841.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #17	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4857.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #18	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4845.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #19	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4850.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #2	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4825.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #20	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4800.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #21	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4840.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #22	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4844.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #23	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4835.6	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #24	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4799.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #25	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4816.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #26	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4825.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #27	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4862.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #28	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4826.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #29	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4846.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #3	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4851.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #30	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4852.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #31	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4815.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #32	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4837.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #33	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4837.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #34	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4848.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #35	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4803.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #36	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4817.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #37	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4794.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #38	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4784.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #39	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4815.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #4	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4800.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #40	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4777.4	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #41	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4813.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #42	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4846.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #43	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4803.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #44	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4835.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #45	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4790.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #46	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4818.8	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #47	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4830.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #48	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4821.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #49	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4812.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #5	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4845.1	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #50	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4843.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #51	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4836.9	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #52	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4822.2	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #53	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4860.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #54	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4842.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #55	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4831.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #56	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)COC1OC(CO)C(O)C(O)C1O	4854.3	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #6	C/C(=C\CN(C1=NC=NC2=C1N=CN2C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4823.5	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #7	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4836.7	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #8	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4866.0	Semi standard non polar	33892256
trans-Zeatin-O-glucoside riboside,3TBDMS,isomer #9	C/C(=C\CNC1=NC=NC2=C1N=CN2C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O)COC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4815.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - trans-Zeatin-O-glucoside riboside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0f7k-3201900000-69e3f6d8aa73a38185f4	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - trans-Zeatin-O-glucoside riboside GC-MS (2 TMS) - 70eV, Positive	splash10-052o-3421439000-fef00f1f161b85110254	2017-10-06	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 10V, Positive-QTOF	splash10-01q9-0039210000-1d45b151b5f5bb821657	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 20V, Positive-QTOF	splash10-0j59-1398000000-f7904b4a45757f07aeb4	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 40V, Positive-QTOF	splash10-01q9-2596000000-143213fcd496bd54078b	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 10V, Negative-QTOF	splash10-03di-0458790000-48c035ac56bbd0328038	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 20V, Negative-QTOF	splash10-01q9-1659200000-5a37d540f9442e72b932	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 40V, Negative-QTOF	splash10-01q9-5964000000-22010f97b6eaaf94e7f7	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 10V, Positive-QTOF	splash10-03di-0205390000-51f6bcf306da8ce18b15	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 20V, Positive-QTOF	splash10-0udi-1097200000-79d357b7784d1f1484b4	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 40V, Positive-QTOF	splash10-0udl-2094300000-4782bc202de3f7cc9c7c	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 10V, Negative-QTOF	splash10-03di-0301190000-6aa07b21a4856f697bbc	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 20V, Negative-QTOF	splash10-052f-4005900000-17ac32856ad4cd7d50fc	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - trans-Zeatin-O-glucoside riboside 40V, Negative-QTOF	splash10-014i-5392000000-1a3b44b3c357409a32bb	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB010861

KNApSAcK ID

C00007550

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131751341

PDB ID

Not Available

ChEBI ID

172726

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for trans-Zeatin-O-glucoside riboside (HMDB0032880)

MOL for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

3D MOL for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

3D SDF for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

3D-SDF for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

PDB for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

3D PDB for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

SMILES for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

INCHI for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

Structure for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

3D Structure for HMDB0032880 (trans-Zeatin-O-glucoside riboside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra