Showing metabocard for Lablaboside C (HMDB0032893)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 17:52:31 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:53:30 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0032893 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Lablaboside C | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Lablaboside C belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. Based on a literature review a small amount of articles have been published on Lablaboside C. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0032893 (Lablaboside C)Mrv0541 02241210532D 88 97 0 0 0 0 999 V2000 1.7861 3.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7916 2.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0807 2.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3630 2.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3479 2.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3437 1.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3739 1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0615 1.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0546 1.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7695 1.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4818 1.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4776 0.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1886 -0.1122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9063 0.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9117 1.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6281 1.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3418 1.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0582 1.5186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6117 -0.9467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6172 -0.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3349 0.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0472 -0.1299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3047 -1.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0389 -1.0195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7319 -1.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4662 -1.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1578 -1.5461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3809 0.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3314 -0.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0478 0.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7586 -0.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2251 -0.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2838 -0.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0308 -1.5200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2148 3.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2216 2.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5094 2.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5163 1.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8040 1.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0863 1.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0917 0.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9635 4.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4984 4.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0250 4.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2325 1.1694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2271 1.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9188 2.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6557 2.0686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6970 1.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4340 0.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4752 0.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3034 3.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3488 2.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0816 2.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7746 2.5954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3680 2.7287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6350 2.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9421 2.8029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5264 -2.5940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2606 -2.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9536 -2.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6880 -2.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3795 -2.7438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9097 -3.4931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1257 1.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8599 0.9466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4824 -3.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1754 -3.8671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1314 -4.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8230 -5.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0552 -3.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7481 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7042 -4.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9699 -4.9919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3972 -5.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3532 -5.8911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2122 -0.3265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9964 3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7307 3.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4223 3.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1578 3.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2182 4.9919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9524 4.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6454 5.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6028 5.8911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3810 4.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0699 5.1404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7865 0.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 43 1 0 0 0 0 2 3 1 0 0 0 0 2 37 1 0 0 0 0 3 4 2 0 0 0 0 3 40 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 6 9 1 0 0 0 0 7 28 1 0 0 0 0 7 40 1 0 0 0 0 7 88 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 30 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 31 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 14 20 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 16 57 1 0 0 0 0 17 18 1 0 0 0 0 17 21 1 0 0 0 0 19 20 1 0 0 0 0 19 23 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 23 24 1 0 0 0 0 23 60 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 25 62 1 0 0 0 0 26 27 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 33 1 0 0 0 0 33 34 1 0 0 0 0 35 36 1 0 0 0 0 35 43 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 46 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 53 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 50 65 1 0 0 0 0 51 77 1 0 0 0 0 52 53 1 0 0 0 0 52 78 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 54 65 1 0 0 0 0 56 57 1 0 0 0 0 57 58 2 0 0 0 0 59 60 1 0 0 0 0 59 67 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 61 64 1 0 0 0 0 62 63 1 0 0 0 0 65 66 1 0 0 0 0 67 68 1 0 0 0 0 67 72 1 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 69 75 1 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 73 74 1 0 0 0 0 73 75 1 0 0 0 0 75 76 1 0 0 0 0 78 79 1 0 0 0 0 78 83 1 0 0 0 0 79 80 1 0 0 0 0 80 81 1 0 0 0 0 80 86 1 0 0 0 0 82 83 1 0 0 0 0 83 84 1 0 0 0 0 84 85 1 0 0 0 0 84 86 1 0 0 0 0 86 87 1 0 0 0 0 M END 3D MOL for HMDB0032893 (Lablaboside C)HMDB0032893 RDKit 3D Lablaboside C 184193 0 0 0 0 0 0 0 0999 V2000 9.2958 -1.3929 2.9409 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2435 -0.4819 2.1662 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4837 0.1525 1.1875 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2683 0.4158 0.0389 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7507 1.4631 -0.6795 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2520 1.1395 -1.9309 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7523 1.5484 -2.0007 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9778 0.6811 -1.2421 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9394 -0.1156 -1.7438 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7213 -0.0224 -2.9448 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2887 -0.9357 -0.7144 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4500 -1.8653 -0.3439 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8023 -2.5060 -1.6817 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7385 -3.0923 -2.4854 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5427 -4.5440 -2.0113 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1770 -3.1843 -3.9329 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3700 -2.4301 -2.4890 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2069 -1.8888 -1.1372 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8792 -1.4721 -0.6259 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0871 -2.3405 -0.0480 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7437 -2.0801 0.5165 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5873 -0.6198 0.9151 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8410 -0.4733 1.3105 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0201 -1.5038 2.4475 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2598 0.8149 1.9244 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6476 0.7435 2.4706 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5615 -0.2549 1.7405 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8262 0.2711 1.9254 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5893 -0.4378 2.8577 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7898 0.3995 3.9914 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0648 -0.3421 5.0902 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9669 -0.5432 6.0265 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8135 -0.0983 5.9560 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2296 -1.3453 7.1668 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6677 -1.6969 4.7407 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3476 -2.1195 5.8842 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6735 -1.5001 3.6188 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2696 -2.7003 3.2531 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9202 -0.8928 2.4035 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7303 0.1507 2.0106 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3988 0.0401 0.8445 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8095 0.0608 1.0980 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9998 1.2660 1.8198 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2815 1.2672 2.5842 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4082 1.1235 1.7782 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7545 2.4803 0.9954 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5769 2.6256 -0.0925 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3129 2.4391 0.4885 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5236 2.5016 1.6539 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1236 1.1047 -0.2001 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0989 1.0311 -1.2170 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5645 0.9277 -2.4888 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8875 -0.3222 -3.0633 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2635 -0.5352 -2.9906 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6061 -1.7036 -3.8836 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0596 0.6971 -3.2533 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1932 0.3019 -4.0056 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3541 1.7513 -4.0340 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2482 1.3877 -5.3793 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0124 2.0310 -3.4142 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0890 2.1583 -4.4556 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1804 -0.3730 0.3318 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4194 0.9619 -0.3475 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0449 -1.3530 -0.4393 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3774 -0.9990 -0.4622 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7197 -0.8437 0.1545 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1965 -0.5462 -1.1877 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0836 0.1661 -1.3717 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0578 0.2150 -0.2285 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1064 1.6744 0.2440 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4502 -0.0614 -0.7056 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5374 0.5466 -2.0850 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5237 0.6591 0.1151 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7322 -0.1697 0.4264 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7243 2.8118 -1.4454 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4293 3.7862 -2.0857 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6549 4.9136 -1.0624 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4824 5.4451 -0.5876 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8156 3.4004 -2.5457 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2255 4.2451 -3.5707 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8788 1.9762 -3.0272 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1525 1.6288 -3.3661 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6878 0.7209 0.4433 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3845 1.2627 -0.6054 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3380 -0.6322 0.7709 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5546 -1.3480 -0.3988 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3197 -1.3815 1.5962 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7962 -2.4940 0.9732 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1224 -2.3398 2.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7195 -1.6865 3.9311 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3646 -0.8427 3.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6597 0.2754 2.8327 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2707 -0.5586 -0.4964 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3798 0.0778 -2.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4985 1.5824 -3.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3238 -1.3034 -0.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0669 -2.5908 0.3737 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5371 -3.3246 -1.4141 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4485 -1.7575 -2.2344 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4999 -4.8731 -2.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1871 -5.2474 -2.5678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6837 -4.6325 -0.9171 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3024 -3.2420 -4.5853 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7600 -2.2716 -4.1414 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8378 -4.0947 -4.0447 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6323 -3.2486 -2.6484 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2265 -1.7543 -3.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4558 -2.8558 -0.5262 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4651 -3.3782 0.0194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6351 -2.7505 1.3856 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0238 -2.4375 -0.2247 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2236 -0.4183 1.7895 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5390 -1.0747 3.3287 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0244 -1.7971 2.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4889 -2.4325 2.0989 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1390 1.7225 1.3583 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5952 0.9437 2.8384 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7286 0.5140 3.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1036 1.7744 2.3849 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5593 -1.2192 2.2925 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9734 -1.3087 3.1600 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9058 0.1858 5.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2644 -0.9487 8.0966 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9132 -2.4706 4.5257 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6133 -3.0767 5.8512 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4159 -0.7781 4.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6702 -3.1000 2.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8173 -1.7062 1.6528 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2031 -0.9323 0.3673 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1819 1.2500 2.6030 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3142 0.4338 3.3181 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4004 2.1932 3.1801 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2365 1.3795 2.2120 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8083 3.4192 1.5930 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2648 3.3196 0.0261 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0748 3.2699 -0.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6082 2.2661 1.3643 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1439 1.0754 -0.6476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4673 0.9506 -2.4169 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4471 -0.8348 -1.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6797 -2.2905 -4.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2837 -2.3871 -3.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0378 -1.3945 -4.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4563 1.1093 -2.3007 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9847 0.8651 -3.7760 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0192 2.6643 -4.0234 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0490 0.8965 -5.6912 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0669 2.9864 -2.8833 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4139 2.7372 -5.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8954 0.8241 -1.3650 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1850 1.5444 0.2358 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5549 1.5902 -0.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8674 -2.3993 -0.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7020 -1.3519 -1.5130 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8382 -1.6614 -1.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8385 -1.9689 0.2295 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9983 0.0837 -1.7068 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2587 -1.4563 -1.8783 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1471 1.2216 -1.7257 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5651 -0.2919 -2.2894 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3131 2.2919 -0.2719 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0372 2.2033 -0.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1692 1.7886 1.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7386 1.3059 -2.2939 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4872 -0.1751 -2.9106 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4480 1.2212 -2.1836 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0509 0.9674 1.0608 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8990 1.5632 -0.3954 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5475 0.5045 0.8026 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5072 -0.8668 1.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8945 4.2742 -2.9454 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2893 4.4522 -0.2560 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3216 5.6638 -1.5583 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6004 5.5695 0.4013 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5671 3.4849 -1.7259 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0932 4.6980 -3.3490 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2205 1.8677 -3.9383 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1574 0.6804 -3.7045 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7337 1.3470 1.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2839 1.5685 -0.3563 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3064 -0.4979 1.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4832 -1.6902 -0.4681 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8788 -1.7672 2.4900 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4908 -2.8674 0.3430 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 14 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 31 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 27 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 62 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 7 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 76 79 1 0 79 80 1 0 79 81 1 0 81 82 1 0 4 83 1 0 83 84 1 0 83 85 1 0 85 86 1 0 85 87 1 0 87 88 1 0 87 2 1 0 81 6 1 0 18 11 1 0 71 19 1 0 74 11 1 0 69 22 1 0 66 23 1 0 39 29 1 0 50 41 1 0 60 52 1 0 1 89 1 0 1 90 1 0 1 91 1 0 2 92 1 0 4 93 1 0 6 94 1 0 7 95 1 0 12 96 1 0 12 97 1 0 13 98 1 0 13 99 1 0 15100 1 0 15101 1 0 15102 1 0 16103 1 0 16104 1 0 16105 1 0 17106 1 0 17107 1 0 18108 1 0 20109 1 0 21110 1 0 21111 1 0 22112 1 0 24113 1 0 24114 1 0 24115 1 0 25116 1 0 25117 1 0 26118 1 0 26119 1 0 27120 1 0 29121 1 0 31122 1 0 34123 1 0 35124 1 0 36125 1 0 37126 1 0 38127 1 0 39128 1 0 41129 1 0 43130 1 0 44131 1 0 44132 1 0 45133 1 0 46134 1 0 47135 1 0 48136 1 0 49137 1 0 50138 1 0 52139 1 0 54140 1 0 55141 1 0 55142 1 0 55143 1 0 56144 1 0 57145 1 0 58146 1 0 59147 1 0 60148 1 0 61149 1 0 63150 1 0 63151 1 0 63152 1 0 64153 1 0 64154 1 0 65155 1 0 66156 1 0 67157 1 0 67158 1 0 68159 1 0 68160 1 0 70161 1 0 70162 1 0 70163 1 0 72164 1 0 72165 1 0 72166 1 0 73167 1 0 73168 1 0 74169 1 0 74170 1 0 76171 1 0 77172 1 0 77173 1 0 78174 1 0 79175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 86182 1 0 87183 1 0 88184 1 0 M END 3D SDF for HMDB0032893 (Lablaboside C)Mrv0541 02241210532D 88 97 0 0 0 0 999 V2000 1.7861 3.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7916 2.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0807 2.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3630 2.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3479 2.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3437 1.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3739 1.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0615 1.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0546 1.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7695 1.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4818 1.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4776 0.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1886 -0.1122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9063 0.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9117 1.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6281 1.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3418 1.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0582 1.5186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6117 -0.9467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6172 -0.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3349 0.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0472 -0.1299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3047 -1.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0389 -1.0195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7319 -1.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4662 -1.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1578 -1.5461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3809 0.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3314 -0.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0478 0.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7586 -0.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2251 -0.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2838 -0.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0308 -1.5200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2148 3.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2216 2.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5094 2.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5163 1.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8040 1.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0863 1.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0917 0.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9635 4.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4984 4.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0250 4.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2325 1.1694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2271 1.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9188 2.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6557 2.0686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6970 1.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4340 0.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4752 0.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3034 3.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3488 2.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0816 2.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7746 2.5954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3680 2.7287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6350 2.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9421 2.8029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5264 -2.5940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2606 -2.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9536 -2.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6880 -2.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3795 -2.7438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9097 -3.4931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1257 1.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8599 0.9466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4824 -3.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1754 -3.8671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1314 -4.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8230 -5.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0552 -3.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7481 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7042 -4.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9699 -4.9919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3972 -5.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3532 -5.8911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2122 -0.3265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9964 3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7307 3.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4223 3.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1578 3.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2182 4.9919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9524 4.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6454 5.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6028 5.8911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3810 4.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0699 5.1404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7865 0.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 43 1 0 0 0 0 2 3 1 0 0 0 0 2 37 1 0 0 0 0 3 4 2 0 0 0 0 3 40 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 6 9 1 0 0 0 0 7 28 1 0 0 0 0 7 40 1 0 0 0 0 7 88 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 30 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 31 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 14 20 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 16 57 1 0 0 0 0 17 18 1 0 0 0 0 17 21 1 0 0 0 0 19 20 1 0 0 0 0 19 23 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 23 24 1 0 0 0 0 23 60 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 25 62 1 0 0 0 0 26 27 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 33 1 0 0 0 0 33 34 1 0 0 0 0 35 36 1 0 0 0 0 35 43 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 46 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 53 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 50 65 1 0 0 0 0 51 77 1 0 0 0 0 52 53 1 0 0 0 0 52 78 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 54 65 1 0 0 0 0 56 57 1 0 0 0 0 57 58 2 0 0 0 0 59 60 1 0 0 0 0 59 67 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 61 64 1 0 0 0 0 62 63 1 0 0 0 0 65 66 1 0 0 0 0 67 68 1 0 0 0 0 67 72 1 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 69 75 1 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 73 74 1 0 0 0 0 73 75 1 0 0 0 0 75 76 1 0 0 0 0 78 79 1 0 0 0 0 78 83 1 0 0 0 0 79 80 1 0 0 0 0 80 81 1 0 0 0 0 80 86 1 0 0 0 0 82 83 1 0 0 0 0 83 84 1 0 0 0 0 84 85 1 0 0 0 0 84 86 1 0 0 0 0 86 87 1 0 0 0 0 M END > <DATABASE_ID> HMDB0032893 > <DATABASE_NAME> hmdb > <SMILES> CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(O)C(O)C(OC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(CO)C(O)C(O)C3OC3OC(C)C(O)C(O)C3O)C2(C)CO)C(O)=O)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C60H96O28/c1-23-32(64)36(68)42(74)49(79-23)85-45-38(70)34(66)27(20-61)81-51(45)87-47-41(73)40(72)44(48(76)77)84-53(47)83-31-12-13-56(5)29(57(31,6)22-63)11-14-59(8)30(56)10-9-25-26-19-55(3,4)15-17-60(26,18-16-58(25,59)7)54(78)88-52-46(39(71)35(67)28(21-62)82-52)86-50-43(75)37(69)33(65)24(2)80-50/h9,23-24,26-47,49-53,61-75H,10-22H2,1-8H3,(H,76,77) > <INCHI_KEY> BHKRIROTIBILJW-UHFFFAOYSA-N > <FORMULA> C60H96O28 > <MOLECULAR_WEIGHT> 1265.3874 > <EXACT_MASS> 1264.608812488 > <JCHEM_ACCEPTOR_COUNT> 27 > <JCHEM_AVERAGE_POLARIZABILITY> 129.38729161593614 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 16 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 6-{[8a-({[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}carbonyl)-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-3,4-dihydroxyoxane-2-carboxylic acid > <ALOGPS_LOGP> 0.49 > <JCHEM_LOGP> -1.6232539280000013 > <ALOGPS_LOGS> -2.84 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 10 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 11.908622962114471 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.317895772187464 > <JCHEM_PKA_STRONGEST_BASIC> -3.6855133093450503 > <JCHEM_POLAR_SURFACE_AREA> 450.1200000000001 > <JCHEM_REFRACTIVITY> 294.2636 > <JCHEM_ROTATABLE_BOND_COUNT> 15 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.84e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 6-{[8a-({[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}carbonyl)-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-3,4-dihydroxyoxane-2-carboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0032893 (Lablaboside C)HMDB0032893 RDKit 3D Lablaboside C 184193 0 0 0 0 0 0 0 0999 V2000 9.2958 -1.3929 2.9409 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2435 -0.4819 2.1662 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4837 0.1525 1.1875 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2683 0.4158 0.0389 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7507 1.4631 -0.6795 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2520 1.1395 -1.9309 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7523 1.5484 -2.0007 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9778 0.6811 -1.2421 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9394 -0.1156 -1.7438 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7213 -0.0224 -2.9448 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2887 -0.9357 -0.7144 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4500 -1.8653 -0.3439 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8023 -2.5060 -1.6817 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7385 -3.0923 -2.4854 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5427 -4.5440 -2.0113 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1770 -3.1843 -3.9329 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3700 -2.4301 -2.4890 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2069 -1.8888 -1.1372 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8792 -1.4721 -0.6259 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0871 -2.3405 -0.0480 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7437 -2.0801 0.5165 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5873 -0.6198 0.9151 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8410 -0.4733 1.3105 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0201 -1.5038 2.4475 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2598 0.8149 1.9244 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6476 0.7435 2.4706 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5615 -0.2549 1.7405 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8262 0.2711 1.9254 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5893 -0.4378 2.8577 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7898 0.3995 3.9914 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0648 -0.3421 5.0902 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9669 -0.5432 6.0265 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8135 -0.0983 5.9560 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2296 -1.3453 7.1668 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6677 -1.6969 4.7407 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3476 -2.1195 5.8842 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6735 -1.5001 3.6188 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2696 -2.7003 3.2531 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9202 -0.8928 2.4035 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7303 0.1507 2.0106 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3988 0.0401 0.8445 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8095 0.0608 1.0980 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9998 1.2660 1.8198 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2815 1.2672 2.5842 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4082 1.1235 1.7782 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7545 2.4803 0.9954 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5769 2.6256 -0.0925 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3129 2.4391 0.4885 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5236 2.5016 1.6539 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1236 1.1047 -0.2001 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0989 1.0311 -1.2170 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5645 0.9277 -2.4888 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8875 -0.3222 -3.0633 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2635 -0.5352 -2.9906 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6061 -1.7036 -3.8836 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0596 0.6971 -3.2533 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1932 0.3019 -4.0056 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3541 1.7513 -4.0340 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2482 1.3877 -5.3793 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0124 2.0310 -3.4142 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0890 2.1583 -4.4556 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1804 -0.3730 0.3318 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4194 0.9619 -0.3475 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0449 -1.3530 -0.4393 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3774 -0.9990 -0.4622 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7197 -0.8437 0.1545 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1965 -0.5462 -1.1877 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0836 0.1661 -1.3717 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0578 0.2150 -0.2285 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1064 1.6744 0.2440 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4502 -0.0614 -0.7056 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5374 0.5466 -2.0850 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5237 0.6591 0.1151 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7322 -0.1697 0.4264 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7243 2.8118 -1.4454 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4293 3.7862 -2.0857 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6549 4.9136 -1.0624 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4824 5.4451 -0.5876 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8156 3.4004 -2.5457 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2255 4.2451 -3.5707 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8788 1.9762 -3.0272 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1525 1.6288 -3.3661 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6878 0.7209 0.4433 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3845 1.2627 -0.6054 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3380 -0.6322 0.7709 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5546 -1.3480 -0.3988 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3197 -1.3815 1.5962 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7962 -2.4940 0.9732 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1224 -2.3398 2.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7195 -1.6865 3.9311 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3646 -0.8427 3.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6597 0.2754 2.8327 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2707 -0.5586 -0.4964 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3798 0.0778 -2.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4985 1.5824 -3.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3238 -1.3034 -0.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0669 -2.5908 0.3737 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5371 -3.3246 -1.4141 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4485 -1.7575 -2.2344 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4999 -4.8731 -2.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1871 -5.2474 -2.5678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6837 -4.6325 -0.9171 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3024 -3.2420 -4.5853 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7600 -2.2716 -4.1414 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8378 -4.0947 -4.0447 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6323 -3.2486 -2.6484 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2265 -1.7543 -3.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4558 -2.8558 -0.5262 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4651 -3.3782 0.0194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6351 -2.7505 1.3856 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0238 -2.4375 -0.2247 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2236 -0.4183 1.7895 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5390 -1.0747 3.3287 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0244 -1.7971 2.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4889 -2.4325 2.0989 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1390 1.7225 1.3583 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5952 0.9437 2.8384 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7286 0.5140 3.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1036 1.7744 2.3849 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5593 -1.2192 2.2925 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9734 -1.3087 3.1600 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9058 0.1858 5.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2644 -0.9487 8.0966 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9132 -2.4706 4.5257 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6133 -3.0767 5.8512 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4159 -0.7781 4.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6702 -3.1000 2.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8173 -1.7062 1.6528 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2031 -0.9323 0.3673 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1819 1.2500 2.6030 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3142 0.4338 3.3181 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4004 2.1932 3.1801 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2365 1.3795 2.2120 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8083 3.4192 1.5930 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2648 3.3196 0.0261 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0748 3.2699 -0.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6082 2.2661 1.3643 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1439 1.0754 -0.6476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4673 0.9506 -2.4169 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4471 -0.8348 -1.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6797 -2.2905 -4.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2837 -2.3871 -3.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0378 -1.3945 -4.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4563 1.1093 -2.3007 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9847 0.8651 -3.7760 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0192 2.6643 -4.0234 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0490 0.8965 -5.6912 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0669 2.9864 -2.8833 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4139 2.7372 -5.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8954 0.8241 -1.3650 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1850 1.5444 0.2358 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5549 1.5902 -0.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8674 -2.3993 -0.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7020 -1.3519 -1.5130 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8382 -1.6614 -1.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8385 -1.9689 0.2295 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9983 0.0837 -1.7068 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2587 -1.4563 -1.8783 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1471 1.2216 -1.7257 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5651 -0.2919 -2.2894 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3131 2.2919 -0.2719 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0372 2.2033 -0.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1692 1.7886 1.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7386 1.3059 -2.2939 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4872 -0.1751 -2.9106 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4480 1.2212 -2.1836 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0509 0.9674 1.0608 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8990 1.5632 -0.3954 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5475 0.5045 0.8026 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5072 -0.8668 1.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8945 4.2742 -2.9454 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2893 4.4522 -0.2560 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3216 5.6638 -1.5583 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6004 5.5695 0.4013 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5671 3.4849 -1.7259 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0932 4.6980 -3.3490 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2205 1.8677 -3.9383 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1574 0.6804 -3.7045 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7337 1.3470 1.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2839 1.5685 -0.3563 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3064 -0.4979 1.3045 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4832 -1.6902 -0.4681 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8788 -1.7672 2.4900 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4908 -2.8674 0.3430 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 14 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 31 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 27 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 62 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 7 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 76 79 1 0 79 80 1 0 79 81 1 0 81 82 1 0 4 83 1 0 83 84 1 0 83 85 1 0 85 86 1 0 85 87 1 0 87 88 1 0 87 2 1 0 81 6 1 0 18 11 1 0 71 19 1 0 74 11 1 0 69 22 1 0 66 23 1 0 39 29 1 0 50 41 1 0 60 52 1 0 1 89 1 0 1 90 1 0 1 91 1 0 2 92 1 0 4 93 1 0 6 94 1 0 7 95 1 0 12 96 1 0 12 97 1 0 13 98 1 0 13 99 1 0 15100 1 0 15101 1 0 15102 1 0 16103 1 0 16104 1 0 16105 1 0 17106 1 0 17107 1 0 18108 1 0 20109 1 0 21110 1 0 21111 1 0 22112 1 0 24113 1 0 24114 1 0 24115 1 0 25116 1 0 25117 1 0 26118 1 0 26119 1 0 27120 1 0 29121 1 0 31122 1 0 34123 1 0 35124 1 0 36125 1 0 37126 1 0 38127 1 0 39128 1 0 41129 1 0 43130 1 0 44131 1 0 44132 1 0 45133 1 0 46134 1 0 47135 1 0 48136 1 0 49137 1 0 50138 1 0 52139 1 0 54140 1 0 55141 1 0 55142 1 0 55143 1 0 56144 1 0 57145 1 0 58146 1 0 59147 1 0 60148 1 0 61149 1 0 63150 1 0 63151 1 0 63152 1 0 64153 1 0 64154 1 0 65155 1 0 66156 1 0 67157 1 0 67158 1 0 68159 1 0 68160 1 0 70161 1 0 70162 1 0 70163 1 0 72164 1 0 72165 1 0 72166 1 0 73167 1 0 73168 1 0 74169 1 0 74170 1 0 76171 1 0 77172 1 0 77173 1 0 78174 1 0 79175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 86182 1 0 87183 1 0 88184 1 0 M END PDB for HMDB0032893 (Lablaboside C)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 3.334 6.785 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 3.344 5.245 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 2.017 4.465 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 0.678 5.224 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -0.649 4.449 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -0.642 2.909 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 0.698 2.147 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -1.981 3.666 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -1.969 2.132 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -3.303 2.891 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -4.633 2.116 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -4.625 0.571 0.000 0.00 0.00 C+0 HETATM 13 O UNK 0 -5.952 -0.209 0.000 0.00 0.00 O+0 HETATM 14 C UNK 0 -7.292 0.553 0.000 0.00 0.00 C+0 HETATM 15 O UNK 0 -7.302 2.096 0.000 0.00 0.00 O+0 HETATM 16 C UNK 0 -8.639 2.853 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -9.971 2.075 0.000 0.00 0.00 C+0 HETATM 18 O UNK 0 -11.309 2.835 0.000 0.00 0.00 O+0 HETATM 19 O UNK 0 -8.609 -1.767 0.000 0.00 0.00 O+0 HETATM 20 C UNK 0 -8.619 -0.225 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -9.958 0.535 0.000 0.00 0.00 C+0 HETATM 22 O UNK 0 -11.288 -0.242 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 -9.902 -2.606 0.000 0.00 0.00 C+0 HETATM 24 O UNK 0 -11.273 -1.903 0.000 0.00 0.00 O+0 HETATM 25 C UNK 0 -12.566 -2.745 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -13.937 -2.047 0.000 0.00 0.00 C+0 HETATM 27 O UNK 0 -15.228 -2.886 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 0.711 0.609 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -0.619 -0.171 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -1.956 0.589 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -3.283 -0.191 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -2.287 -1.364 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -4.263 -1.374 0.000 0.00 0.00 C+0 HETATM 34 O UNK 0 -3.791 -2.837 0.000 0.00 0.00 O+0 HETATM 35 C UNK 0 6.001 6.803 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 6.014 5.263 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 4.684 4.485 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 4.697 2.945 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 3.367 2.165 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 2.028 2.930 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 2.038 1.387 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 3.665 8.735 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 4.664 7.560 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 5.647 8.754 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 6.034 2.183 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 6.024 3.723 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 7.315 4.562 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 8.691 3.861 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 8.768 2.329 0.000 0.00 0.00 O+0 HETATM 50 C UNK 0 10.143 1.628 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 10.220 0.091 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 9.900 6.241 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 9.984 4.701 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 11.352 4.003 0.000 0.00 0.00 C+0 HETATM 55 O UNK 0 12.646 4.845 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -10.020 5.094 0.000 0.00 0.00 O+0 HETATM 57 C UNK 0 -8.652 4.393 0.000 0.00 0.00 C+0 HETATM 58 O UNK 0 -7.359 5.232 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 -8.449 -4.842 0.000 0.00 0.00 O+0 HETATM 60 C UNK 0 -9.820 -4.144 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -11.113 -4.983 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -12.484 -4.285 0.000 0.00 0.00 C+0 HETATM 63 O UNK 0 -13.775 -5.122 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 -11.031 -6.520 0.000 0.00 0.00 O+0 HETATM 65 C UNK 0 11.435 2.468 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 12.805 1.767 0.000 0.00 0.00 O+0 HETATM 67 C UNK 0 -8.367 -6.379 0.000 0.00 0.00 C+0 HETATM 68 O UNK 0 -9.661 -7.219 0.000 0.00 0.00 O+0 HETATM 69 C UNK 0 -9.579 -8.759 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 -10.870 -9.595 0.000 0.00 0.00 C+0 HETATM 71 O UNK 0 -5.703 -6.241 0.000 0.00 0.00 O+0 HETATM 72 C UNK 0 -6.996 -7.080 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -6.915 -8.617 0.000 0.00 0.00 C+0 HETATM 74 O UNK 0 -5.544 -9.318 0.000 0.00 0.00 O+0 HETATM 75 C UNK 0 -8.208 -9.457 0.000 0.00 0.00 C+0 HETATM 76 O UNK 0 -8.126 -10.997 0.000 0.00 0.00 O+0 HETATM 77 O UNK 0 11.596 -0.609 0.000 0.00 0.00 O+0 HETATM 78 C UNK 0 11.193 7.080 0.000 0.00 0.00 C+0 HETATM 79 O UNK 0 12.564 6.377 0.000 0.00 0.00 O+0 HETATM 80 C UNK 0 13.855 7.219 0.000 0.00 0.00 C+0 HETATM 81 C UNK 0 15.228 6.520 0.000 0.00 0.00 C+0 HETATM 82 O UNK 0 9.741 9.318 0.000 0.00 0.00 O+0 HETATM 83 C UNK 0 11.111 8.615 0.000 0.00 0.00 C+0 HETATM 84 C UNK 0 12.405 9.454 0.000 0.00 0.00 C+0 HETATM 85 O UNK 0 12.325 10.997 0.000 0.00 0.00 O+0 HETATM 86 C UNK 0 13.778 8.756 0.000 0.00 0.00 C+0 HETATM 87 O UNK 0 15.064 9.595 0.000 0.00 0.00 O+0 HETATM 88 C UNK 0 1.468 0.812 0.000 0.00 0.00 C+0 CONECT 1 2 43 CONECT 2 1 3 37 CONECT 3 2 4 40 CONECT 4 3 5 CONECT 5 4 6 CONECT 6 5 7 9 CONECT 7 6 28 40 88 CONECT 8 9 CONECT 9 6 8 10 30 CONECT 10 9 11 CONECT 11 10 12 CONECT 12 11 13 31 CONECT 13 12 14 CONECT 14 13 15 20 CONECT 15 14 16 CONECT 16 15 17 57 CONECT 17 16 18 21 CONECT 18 17 CONECT 19 20 23 CONECT 20 14 19 21 CONECT 21 17 20 22 CONECT 22 21 CONECT 23 19 24 60 CONECT 24 23 25 CONECT 25 24 26 62 CONECT 26 25 27 CONECT 27 26 CONECT 28 7 29 CONECT 29 28 30 CONECT 30 9 29 31 CONECT 31 12 30 32 33 CONECT 32 31 CONECT 33 31 34 CONECT 34 33 CONECT 35 36 43 CONECT 36 35 37 CONECT 37 2 36 38 46 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 3 7 39 41 CONECT 41 40 CONECT 42 43 CONECT 43 1 35 42 44 CONECT 44 43 CONECT 45 46 CONECT 46 37 45 47 CONECT 47 46 48 CONECT 48 47 49 53 CONECT 49 48 50 CONECT 50 49 51 65 CONECT 51 50 77 CONECT 52 53 78 CONECT 53 48 52 54 CONECT 54 53 55 65 CONECT 55 54 CONECT 56 57 CONECT 57 16 56 58 CONECT 58 57 CONECT 59 60 67 CONECT 60 23 59 61 CONECT 61 60 62 64 CONECT 62 25 61 63 CONECT 63 62 CONECT 64 61 CONECT 65 50 54 66 CONECT 66 65 CONECT 67 59 68 72 CONECT 68 67 69 CONECT 69 68 70 75 CONECT 70 69 CONECT 71 72 CONECT 72 67 71 73 CONECT 73 72 74 75 CONECT 74 73 CONECT 75 69 73 76 CONECT 76 75 CONECT 77 51 CONECT 78 52 79 83 CONECT 79 78 80 CONECT 80 79 81 86 CONECT 81 80 CONECT 82 83 CONECT 83 78 82 84 CONECT 84 83 85 86 CONECT 85 84 CONECT 86 80 84 87 CONECT 87 86 CONECT 88 7 MASTER 0 0 0 0 0 0 0 0 88 0 194 0 END 3D PDB for HMDB0032893 (Lablaboside C)COMPND HMDB0032893 HETATM 1 C1 UNL 1 9.296 -1.393 2.941 1.00 0.00 C HETATM 2 C2 UNL 1 10.244 -0.482 2.166 1.00 0.00 C HETATM 3 O1 UNL 1 9.484 0.153 1.188 1.00 0.00 O HETATM 4 C3 UNL 1 10.268 0.416 0.039 1.00 0.00 C HETATM 5 O2 UNL 1 9.751 1.463 -0.679 1.00 0.00 O HETATM 6 C4 UNL 1 9.252 1.140 -1.931 1.00 0.00 C HETATM 7 C5 UNL 1 7.752 1.548 -2.001 1.00 0.00 C HETATM 8 O3 UNL 1 6.978 0.681 -1.242 1.00 0.00 O HETATM 9 C6 UNL 1 5.939 -0.116 -1.744 1.00 0.00 C HETATM 10 O4 UNL 1 5.721 -0.022 -2.945 1.00 0.00 O HETATM 11 C7 UNL 1 5.289 -0.936 -0.714 1.00 0.00 C HETATM 12 C8 UNL 1 6.450 -1.865 -0.344 1.00 0.00 C HETATM 13 C9 UNL 1 6.802 -2.506 -1.682 1.00 0.00 C HETATM 14 C10 UNL 1 5.739 -3.092 -2.485 1.00 0.00 C HETATM 15 C11 UNL 1 5.543 -4.544 -2.011 1.00 0.00 C HETATM 16 C12 UNL 1 6.177 -3.184 -3.933 1.00 0.00 C HETATM 17 C13 UNL 1 4.370 -2.430 -2.489 1.00 0.00 C HETATM 18 C14 UNL 1 4.207 -1.889 -1.137 1.00 0.00 C HETATM 19 C15 UNL 1 2.879 -1.472 -0.626 1.00 0.00 C HETATM 20 C16 UNL 1 2.087 -2.341 -0.048 1.00 0.00 C HETATM 21 C17 UNL 1 0.744 -2.080 0.516 1.00 0.00 C HETATM 22 C18 UNL 1 0.587 -0.620 0.915 1.00 0.00 C HETATM 23 C19 UNL 1 -0.841 -0.473 1.311 1.00 0.00 C HETATM 24 C20 UNL 1 -1.020 -1.504 2.447 1.00 0.00 C HETATM 25 C21 UNL 1 -1.260 0.815 1.924 1.00 0.00 C HETATM 26 C22 UNL 1 -2.648 0.743 2.471 1.00 0.00 C HETATM 27 C23 UNL 1 -3.562 -0.255 1.740 1.00 0.00 C HETATM 28 O5 UNL 1 -4.826 0.271 1.925 1.00 0.00 O HETATM 29 C24 UNL 1 -5.589 -0.438 2.858 1.00 0.00 C HETATM 30 O6 UNL 1 -5.790 0.400 3.991 1.00 0.00 O HETATM 31 C25 UNL 1 -6.065 -0.342 5.090 1.00 0.00 C HETATM 32 C26 UNL 1 -4.967 -0.543 6.027 1.00 0.00 C HETATM 33 O7 UNL 1 -3.814 -0.098 5.956 1.00 0.00 O HETATM 34 O8 UNL 1 -5.230 -1.345 7.167 1.00 0.00 O HETATM 35 C27 UNL 1 -6.668 -1.697 4.741 1.00 0.00 C HETATM 36 O9 UNL 1 -7.348 -2.120 5.884 1.00 0.00 O HETATM 37 C28 UNL 1 -7.673 -1.500 3.619 1.00 0.00 C HETATM 38 O10 UNL 1 -8.270 -2.700 3.253 1.00 0.00 O HETATM 39 C29 UNL 1 -6.920 -0.893 2.404 1.00 0.00 C HETATM 40 O11 UNL 1 -7.730 0.151 2.011 1.00 0.00 O HETATM 41 C30 UNL 1 -8.399 0.040 0.844 1.00 0.00 C HETATM 42 O12 UNL 1 -9.809 0.061 1.098 1.00 0.00 O HETATM 43 C31 UNL 1 -10.000 1.266 1.820 1.00 0.00 C HETATM 44 C32 UNL 1 -11.282 1.267 2.584 1.00 0.00 C HETATM 45 O13 UNL 1 -12.408 1.124 1.778 1.00 0.00 O HETATM 46 C33 UNL 1 -9.755 2.480 0.995 1.00 0.00 C HETATM 47 O14 UNL 1 -10.577 2.626 -0.092 1.00 0.00 O HETATM 48 C34 UNL 1 -8.313 2.439 0.488 1.00 0.00 C HETATM 49 O15 UNL 1 -7.524 2.502 1.654 1.00 0.00 O HETATM 50 C35 UNL 1 -8.124 1.105 -0.200 1.00 0.00 C HETATM 51 O16 UNL 1 -9.099 1.031 -1.217 1.00 0.00 O HETATM 52 C36 UNL 1 -8.565 0.928 -2.489 1.00 0.00 C HETATM 53 O17 UNL 1 -8.888 -0.322 -3.063 1.00 0.00 O HETATM 54 C37 UNL 1 -10.264 -0.535 -2.991 1.00 0.00 C HETATM 55 C38 UNL 1 -10.606 -1.704 -3.884 1.00 0.00 C HETATM 56 C39 UNL 1 -11.060 0.697 -3.253 1.00 0.00 C HETATM 57 O18 UNL 1 -12.193 0.302 -4.006 1.00 0.00 O HETATM 58 C40 UNL 1 -10.354 1.751 -4.034 1.00 0.00 C HETATM 59 O19 UNL 1 -10.248 1.388 -5.379 1.00 0.00 O HETATM 60 C41 UNL 1 -9.012 2.031 -3.414 1.00 0.00 C HETATM 61 O20 UNL 1 -8.089 2.158 -4.456 1.00 0.00 O HETATM 62 C42 UNL 1 -3.180 -0.373 0.332 1.00 0.00 C HETATM 63 C43 UNL 1 -3.419 0.962 -0.347 1.00 0.00 C HETATM 64 C44 UNL 1 -4.045 -1.353 -0.439 1.00 0.00 C HETATM 65 O21 UNL 1 -5.377 -0.999 -0.462 1.00 0.00 O HETATM 66 C45 UNL 1 -1.720 -0.844 0.154 1.00 0.00 C HETATM 67 C46 UNL 1 -1.197 -0.546 -1.188 1.00 0.00 C HETATM 68 C47 UNL 1 0.084 0.166 -1.372 1.00 0.00 C HETATM 69 C48 UNL 1 1.058 0.215 -0.228 1.00 0.00 C HETATM 70 C49 UNL 1 1.106 1.674 0.244 1.00 0.00 C HETATM 71 C50 UNL 1 2.450 -0.061 -0.706 1.00 0.00 C HETATM 72 C51 UNL 1 2.537 0.547 -2.085 1.00 0.00 C HETATM 73 C52 UNL 1 3.524 0.659 0.115 1.00 0.00 C HETATM 74 C53 UNL 1 4.732 -0.170 0.426 1.00 0.00 C HETATM 75 O22 UNL 1 7.724 2.812 -1.445 1.00 0.00 O HETATM 76 C54 UNL 1 8.429 3.786 -2.086 1.00 0.00 C HETATM 77 C55 UNL 1 8.655 4.914 -1.062 1.00 0.00 C HETATM 78 O23 UNL 1 7.482 5.445 -0.588 1.00 0.00 O HETATM 79 C56 UNL 1 9.816 3.400 -2.546 1.00 0.00 C HETATM 80 O24 UNL 1 10.226 4.245 -3.571 1.00 0.00 O HETATM 81 C57 UNL 1 9.879 1.976 -3.027 1.00 0.00 C HETATM 82 O25 UNL 1 11.153 1.629 -3.366 1.00 0.00 O HETATM 83 C58 UNL 1 11.688 0.721 0.443 1.00 0.00 C HETATM 84 O26 UNL 1 12.385 1.263 -0.605 1.00 0.00 O HETATM 85 C59 UNL 1 12.338 -0.632 0.771 1.00 0.00 C HETATM 86 O27 UNL 1 12.555 -1.348 -0.399 1.00 0.00 O HETATM 87 C60 UNL 1 11.320 -1.382 1.596 1.00 0.00 C HETATM 88 O28 UNL 1 10.796 -2.494 0.973 1.00 0.00 O HETATM 89 H1 UNL 1 9.122 -2.340 2.393 1.00 0.00 H HETATM 90 H2 UNL 1 9.719 -1.686 3.931 1.00 0.00 H HETATM 91 H3 UNL 1 8.365 -0.843 3.167 1.00 0.00 H HETATM 92 H4 UNL 1 10.660 0.275 2.833 1.00 0.00 H HETATM 93 H5 UNL 1 10.271 -0.559 -0.496 1.00 0.00 H HETATM 94 H6 UNL 1 9.380 0.078 -2.110 1.00 0.00 H HETATM 95 H7 UNL 1 7.499 1.582 -3.073 1.00 0.00 H HETATM 96 H8 UNL 1 7.324 -1.303 -0.014 1.00 0.00 H HETATM 97 H9 UNL 1 6.067 -2.591 0.374 1.00 0.00 H HETATM 98 H10 UNL 1 7.537 -3.325 -1.414 1.00 0.00 H HETATM 99 H11 UNL 1 7.449 -1.758 -2.234 1.00 0.00 H HETATM 100 H12 UNL 1 4.500 -4.873 -2.219 1.00 0.00 H HETATM 101 H13 UNL 1 6.187 -5.247 -2.568 1.00 0.00 H HETATM 102 H14 UNL 1 5.684 -4.633 -0.917 1.00 0.00 H HETATM 103 H15 UNL 1 5.302 -3.242 -4.585 1.00 0.00 H HETATM 104 H16 UNL 1 6.760 -2.272 -4.141 1.00 0.00 H HETATM 105 H17 UNL 1 6.838 -4.095 -4.045 1.00 0.00 H HETATM 106 H18 UNL 1 3.632 -3.249 -2.648 1.00 0.00 H HETATM 107 H19 UNL 1 4.227 -1.754 -3.346 1.00 0.00 H HETATM 108 H20 UNL 1 4.456 -2.856 -0.526 1.00 0.00 H HETATM 109 H21 UNL 1 2.465 -3.378 0.019 1.00 0.00 H HETATM 110 H22 UNL 1 0.635 -2.751 1.386 1.00 0.00 H HETATM 111 H23 UNL 1 0.024 -2.437 -0.225 1.00 0.00 H HETATM 112 H24 UNL 1 1.224 -0.418 1.789 1.00 0.00 H HETATM 113 H25 UNL 1 -1.539 -1.075 3.329 1.00 0.00 H HETATM 114 H26 UNL 1 -0.024 -1.797 2.893 1.00 0.00 H HETATM 115 H27 UNL 1 -1.489 -2.433 2.099 1.00 0.00 H HETATM 116 H28 UNL 1 -1.139 1.722 1.358 1.00 0.00 H HETATM 117 H29 UNL 1 -0.595 0.944 2.838 1.00 0.00 H HETATM 118 H30 UNL 1 -2.729 0.514 3.547 1.00 0.00 H HETATM 119 H31 UNL 1 -3.104 1.774 2.385 1.00 0.00 H HETATM 120 H32 UNL 1 -3.559 -1.219 2.292 1.00 0.00 H HETATM 121 H33 UNL 1 -4.973 -1.309 3.160 1.00 0.00 H HETATM 122 H34 UNL 1 -6.906 0.186 5.640 1.00 0.00 H HETATM 123 H35 UNL 1 -5.264 -0.949 8.097 1.00 0.00 H HETATM 124 H36 UNL 1 -5.913 -2.471 4.526 1.00 0.00 H HETATM 125 H37 UNL 1 -7.613 -3.077 5.851 1.00 0.00 H HETATM 126 H38 UNL 1 -8.416 -0.778 4.023 1.00 0.00 H HETATM 127 H39 UNL 1 -7.670 -3.100 2.563 1.00 0.00 H HETATM 128 H40 UNL 1 -6.817 -1.706 1.653 1.00 0.00 H HETATM 129 H41 UNL 1 -8.203 -0.932 0.367 1.00 0.00 H HETATM 130 H42 UNL 1 -9.182 1.250 2.603 1.00 0.00 H HETATM 131 H43 UNL 1 -11.314 0.434 3.318 1.00 0.00 H HETATM 132 H44 UNL 1 -11.400 2.193 3.180 1.00 0.00 H HETATM 133 H45 UNL 1 -13.237 1.379 2.212 1.00 0.00 H HETATM 134 H46 UNL 1 -9.808 3.419 1.593 1.00 0.00 H HETATM 135 H47 UNL 1 -11.265 3.320 0.026 1.00 0.00 H HETATM 136 H48 UNL 1 -8.075 3.270 -0.193 1.00 0.00 H HETATM 137 H49 UNL 1 -6.608 2.266 1.364 1.00 0.00 H HETATM 138 H50 UNL 1 -7.144 1.075 -0.648 1.00 0.00 H HETATM 139 H51 UNL 1 -7.467 0.951 -2.417 1.00 0.00 H HETATM 140 H52 UNL 1 -10.447 -0.835 -1.912 1.00 0.00 H HETATM 141 H53 UNL 1 -9.680 -2.290 -4.073 1.00 0.00 H HETATM 142 H54 UNL 1 -11.284 -2.387 -3.323 1.00 0.00 H HETATM 143 H55 UNL 1 -11.038 -1.394 -4.862 1.00 0.00 H HETATM 144 H56 UNL 1 -11.456 1.109 -2.301 1.00 0.00 H HETATM 145 H57 UNL 1 -12.985 0.865 -3.776 1.00 0.00 H HETATM 146 H58 UNL 1 -11.019 2.664 -4.023 1.00 0.00 H HETATM 147 H59 UNL 1 -11.049 0.896 -5.691 1.00 0.00 H HETATM 148 H60 UNL 1 -9.067 2.986 -2.883 1.00 0.00 H HETATM 149 H61 UNL 1 -8.414 2.737 -5.177 1.00 0.00 H HETATM 150 H62 UNL 1 -3.895 0.824 -1.365 1.00 0.00 H HETATM 151 H63 UNL 1 -4.185 1.544 0.236 1.00 0.00 H HETATM 152 H64 UNL 1 -2.555 1.590 -0.484 1.00 0.00 H HETATM 153 H65 UNL 1 -3.867 -2.399 -0.107 1.00 0.00 H HETATM 154 H66 UNL 1 -3.702 -1.352 -1.513 1.00 0.00 H HETATM 155 H67 UNL 1 -5.838 -1.661 -1.066 1.00 0.00 H HETATM 156 H68 UNL 1 -1.839 -1.969 0.229 1.00 0.00 H HETATM 157 H69 UNL 1 -1.998 0.084 -1.707 1.00 0.00 H HETATM 158 H70 UNL 1 -1.259 -1.456 -1.878 1.00 0.00 H HETATM 159 H71 UNL 1 -0.147 1.222 -1.726 1.00 0.00 H HETATM 160 H72 UNL 1 0.565 -0.292 -2.289 1.00 0.00 H HETATM 161 H73 UNL 1 0.313 2.292 -0.272 1.00 0.00 H HETATM 162 H74 UNL 1 2.037 2.203 -0.142 1.00 0.00 H HETATM 163 H75 UNL 1 1.169 1.789 1.319 1.00 0.00 H HETATM 164 H76 UNL 1 1.739 1.306 -2.294 1.00 0.00 H HETATM 165 H77 UNL 1 2.487 -0.175 -2.911 1.00 0.00 H HETATM 166 H78 UNL 1 3.448 1.221 -2.184 1.00 0.00 H HETATM 167 H79 UNL 1 3.051 0.967 1.061 1.00 0.00 H HETATM 168 H80 UNL 1 3.899 1.563 -0.395 1.00 0.00 H HETATM 169 H81 UNL 1 5.547 0.504 0.803 1.00 0.00 H HETATM 170 H82 UNL 1 4.507 -0.867 1.259 1.00 0.00 H HETATM 171 H83 UNL 1 7.894 4.274 -2.945 1.00 0.00 H HETATM 172 H84 UNL 1 9.289 4.452 -0.256 1.00 0.00 H HETATM 173 H85 UNL 1 9.322 5.664 -1.558 1.00 0.00 H HETATM 174 H86 UNL 1 7.600 5.569 0.401 1.00 0.00 H HETATM 175 H87 UNL 1 10.567 3.485 -1.726 1.00 0.00 H HETATM 176 H88 UNL 1 11.093 4.698 -3.349 1.00 0.00 H HETATM 177 H89 UNL 1 9.220 1.868 -3.938 1.00 0.00 H HETATM 178 H90 UNL 1 11.157 0.680 -3.705 1.00 0.00 H HETATM 179 H91 UNL 1 11.734 1.347 1.363 1.00 0.00 H HETATM 180 H92 UNL 1 13.284 1.569 -0.356 1.00 0.00 H HETATM 181 H93 UNL 1 13.306 -0.498 1.304 1.00 0.00 H HETATM 182 H94 UNL 1 13.483 -1.690 -0.468 1.00 0.00 H HETATM 183 H95 UNL 1 11.879 -1.767 2.490 1.00 0.00 H HETATM 184 H96 UNL 1 11.491 -2.867 0.343 1.00 0.00 H CONECT 1 2 89 90 91 CONECT 2 3 87 92 CONECT 3 4 CONECT 4 5 83 93 CONECT 5 6 CONECT 6 7 81 94 CONECT 7 8 75 95 CONECT 8 9 CONECT 9 10 10 11 CONECT 11 12 18 74 CONECT 12 13 96 97 CONECT 13 14 98 99 CONECT 14 15 16 17 CONECT 15 100 101 102 CONECT 16 103 104 105 CONECT 17 18 106 107 CONECT 18 19 108 CONECT 19 20 20 71 CONECT 20 21 109 CONECT 21 22 110 111 CONECT 22 23 69 112 CONECT 23 24 25 66 CONECT 24 113 114 115 CONECT 25 26 116 117 CONECT 26 27 118 119 CONECT 27 28 62 120 CONECT 28 29 CONECT 29 30 39 121 CONECT 30 31 CONECT 31 32 35 122 CONECT 32 33 33 34 CONECT 34 123 CONECT 35 36 37 124 CONECT 36 125 CONECT 37 38 39 126 CONECT 38 127 CONECT 39 40 128 CONECT 40 41 CONECT 41 42 50 129 CONECT 42 43 CONECT 43 44 46 130 CONECT 44 45 131 132 CONECT 45 133 CONECT 46 47 48 134 CONECT 47 135 CONECT 48 49 50 136 CONECT 49 137 CONECT 50 51 138 CONECT 51 52 CONECT 52 53 60 139 CONECT 53 54 CONECT 54 55 56 140 CONECT 55 141 142 143 CONECT 56 57 58 144 CONECT 57 145 CONECT 58 59 60 146 CONECT 59 147 CONECT 60 61 148 CONECT 61 149 CONECT 62 63 64 66 CONECT 63 150 151 152 CONECT 64 65 153 154 CONECT 65 155 CONECT 66 67 156 CONECT 67 68 157 158 CONECT 68 69 159 160 CONECT 69 70 71 CONECT 70 161 162 163 CONECT 71 72 73 CONECT 72 164 165 166 CONECT 73 74 167 168 CONECT 74 169 170 CONECT 75 76 CONECT 76 77 79 171 CONECT 77 78 172 173 CONECT 78 174 CONECT 79 80 81 175 CONECT 80 176 CONECT 81 82 177 CONECT 82 178 CONECT 83 84 85 179 CONECT 84 180 CONECT 85 86 87 181 CONECT 86 182 CONECT 87 88 183 CONECT 88 184 END SMILES for HMDB0032893 (Lablaboside C)CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(O)C(O)C(OC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(CO)C(O)C(O)C3OC3OC(C)C(O)C(O)C3O)C2(C)CO)C(O)=O)C(O)C(O)C1O INCHI for HMDB0032893 (Lablaboside C)InChI=1S/C60H96O28/c1-23-32(64)36(68)42(74)49(79-23)85-45-38(70)34(66)27(20-61)81-51(45)87-47-41(73)40(72)44(48(76)77)84-53(47)83-31-12-13-56(5)29(57(31,6)22-63)11-14-59(8)30(56)10-9-25-26-19-55(3,4)15-17-60(26,18-16-58(25,59)7)54(78)88-52-46(39(71)35(67)28(21-62)82-52)86-50-43(75)37(69)33(65)24(2)80-50/h9,23-24,26-47,49-53,61-75H,10-22H2,1-8H3,(H,76,77) 3D Structure for HMDB0032893 (Lablaboside C) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C60H96O28 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1265.3874 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1264.608812488 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 6-{[8a-({[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}carbonyl)-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-3,4-dihydroxyoxane-2-carboxylic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 6-{[8a-({[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}carbonyl)-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-3,4-dihydroxyoxane-2-carboxylic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 209802-42-6 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(O)C(O)C(OC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(CO)C(O)C(O)C3OC3OC(C)C(O)C(O)C3O)C2(C)CO)C(O)=O)C(O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C60H96O28/c1-23-32(64)36(68)42(74)49(79-23)85-45-38(70)34(66)27(20-61)81-51(45)87-47-41(73)40(72)44(48(76)77)84-53(47)83-31-12-13-56(5)29(57(31,6)22-63)11-14-59(8)30(56)10-9-25-26-19-55(3,4)15-17-60(26,18-16-58(25,59)7)54(78)88-52-46(39(71)35(67)28(21-62)82-52)86-50-43(75)37(69)33(65)24(2)80-50/h9,23-24,26-47,49-53,61-75H,10-22H2,1-8H3,(H,76,77) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | BHKRIROTIBILJW-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Terpene glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpene saponins | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB010875 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 85238554 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|