Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 17:56:52 UTC |
---|
Update Date | 2022-03-07 02:53:38 UTC |
---|
HMDB ID | HMDB0033234 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Ganoderic acid beta |
---|
Description | Ganoderic acid beta, also known as ganoderate b, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Ganoderic acid beta is an extremely weak basic (essentially neutral) compound (based on its pKa). |
---|
Structure | CC(CC\C=C(/C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O InChI=1S/C30H44O6/c1-16(9-8-10-17(2)26(35)36)18-13-23(34)30(7)25-19(31)14-21-27(3,4)22(33)11-12-28(21,5)24(25)20(32)15-29(18,30)6/h10,16,18-19,21-22,31,33H,8-9,11-15H2,1-7H3,(H,35,36)/b17-10+ |
---|
Synonyms | Value | Source |
---|
Ganoderate b | Generator | Ganoderate beta | Generator | Ganoderate β | Generator | Ganoderic acid b | Generator | Ganoderic acid β | Generator | Ganoderic acid b? | HMDB | (2E)-6-{5,9-dihydroxy-2,6,6,11,15-pentamethyl-12,17-dioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl}-2-methylhept-2-enoate | Generator |
|
---|
Chemical Formula | C30H44O6 |
---|
Average Molecular Weight | 500.6668 |
---|
Monoisotopic Molecular Weight | 500.31378914 |
---|
IUPAC Name | (2E)-6-{5,9-dihydroxy-2,6,6,11,15-pentamethyl-12,17-dioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl}-2-methylhept-2-enoic acid |
---|
Traditional Name | (2E)-6-{5,9-dihydroxy-2,6,6,11,15-pentamethyl-12,17-dioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl}-2-methylhept-2-enoic acid |
---|
CAS Registry Number | 217476-76-1 |
---|
SMILES | CC(CC\C=C(/C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O |
---|
InChI Identifier | InChI=1S/C30H44O6/c1-16(9-8-10-17(2)26(35)36)18-13-23(34)30(7)25-19(31)14-21-27(3,4)22(33)11-12-28(21,5)24(25)20(32)15-29(18,30)6/h10,16,18-19,21-22,31,33H,8-9,11-15H2,1-7H3,(H,35,36)/b17-10+ |
---|
InChI Key | NJZMSAAKSXZIEC-LICLKQGHSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Prenol lipids |
---|
Sub Class | Triterpenoids |
---|
Direct Parent | Triterpenoids |
---|
Alternative Parents | |
---|
Substituents | - Triterpenoid
- Dihydroxy bile acid, alcohol, or derivatives
- Hydroxy bile acid, alcohol, or derivatives
- Bile acid, alcohol, or derivatives
- Steroid acid
- 3-hydroxysteroid
- Hydroxysteroid
- 11-oxosteroid
- 7-hydroxysteroid
- 15-oxosteroid
- Oxosteroid
- Steroid
- Medium-chain fatty acid
- Hydroxy fatty acid
- Cyclohexenone
- Unsaturated fatty acid
- Fatty acid
- Fatty acyl
- Cyclic alcohol
- Secondary alcohol
- Ketone
- Carboxylic acid derivative
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Organic oxygen compound
- Hydrocarbon derivative
- Organooxygen compound
- Carbonyl group
- Organic oxide
- Alcohol
- Aliphatic homopolycyclic compound
|
---|
Molecular Framework | Aliphatic homopolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | 187 - 189 °C | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Ganoderic acid beta,1TMS,isomer #1 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3996.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TMS,isomer #2 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O | 4079.3 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TMS,isomer #3 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 4058.2 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TMS,isomer #4 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O | 3947.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TMS,isomer #5 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O | 3958.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #1 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3909.5 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #10 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O | 3726.6 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #2 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3896.6 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #3 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3780.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #4 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3795.4 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #5 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3961.5 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #6 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O | 3816.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #7 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O | 3840.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #8 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3817.3 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TMS,isomer #9 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3805.7 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #1 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3792.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #10 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3603.5 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #2 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3681.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #3 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3703.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #4 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3678.3 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #5 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3668.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #6 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3604.7 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #7 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3709.3 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #8 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3705.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TMS,isomer #9 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O | 3617.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #1 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3598.4 | Semi standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #1 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3589.6 | Standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #2 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3598.5 | Semi standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #2 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3739.4 | Standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #3 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3537.5 | Semi standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #3 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C | 3586.8 | Standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #4 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3530.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #4 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3597.9 | Standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #5 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3550.6 | Semi standard non polar | 33892256 | Ganoderic acid beta,4TMS,isomer #5 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O | 3572.6 | Standard non polar | 33892256 | Ganoderic acid beta,5TMS,isomer #1 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3480.3 | Semi standard non polar | 33892256 | Ganoderic acid beta,5TMS,isomer #1 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3582.4 | Standard non polar | 33892256 | Ganoderic acid beta,1TBDMS,isomer #1 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4235.6 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TBDMS,isomer #2 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O | 4313.2 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TBDMS,isomer #3 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4295.6 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TBDMS,isomer #4 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O | 4185.5 | Semi standard non polar | 33892256 | Ganoderic acid beta,1TBDMS,isomer #5 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O | 4202.4 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #1 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4375.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #10 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O | 4180.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #2 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4363.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #3 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4239.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #4 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4241.2 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #5 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4434.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #6 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O | 4283.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #7 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O | 4295.7 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #8 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4285.8 | Semi standard non polar | 33892256 | Ganoderic acid beta,2TBDMS,isomer #9 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4272.4 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #1 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4493.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #10 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4260.1 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #2 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4363.0 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #3 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4367.6 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #4 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4360.9 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #5 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4337.2 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #6 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O[Si](C)(C)C(C)(C)C | 4209.7 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #7 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4393.7 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #8 | C/C(=C\CCC(C)C1CC(=O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O[Si](C)(C)C(C)(C)C)C(=O)O | 4375.3 | Semi standard non polar | 33892256 | Ganoderic acid beta,3TBDMS,isomer #9 | C/C(=C\CCC(C)C1C=C(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3O)C(=O)O | 4254.1 | Semi standard non polar | 33892256 |
|
---|