Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 18:25:06 UTC |
---|
Update Date | 2022-03-07 02:53:48 UTC |
---|
HMDB ID | HMDB0033666 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | KB 2 |
---|
Description | KB 2 belongs to the class of organic compounds known as 3-prenylated flavones. These are flavones that features a C5-isoprenoid substituent at the 3-position. Thus, KB 2 is considered to be a flavonoid. In humans, KB 2 is involved in the P53 signaling pathway. KB 2 has been detected, but not quantified in, breadfruits (Artocarpus altilis) and fruits. This could make KB 2 a potential biomarker for the consumption of these foods. KB 2 is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Based on a literature review a significant number of articles have been published on KB 2. |
---|
Structure | CC(C)(O)CCC1=C(OC2=C(C(O)=CC3=C2C=CC(C)(C)O3)C1=O)C1=CC(O)=C(O)C=C1O InChI=1S/C25H26O8/c1-24(2,31)7-5-13-21(30)20-18(29)11-19-12(6-8-25(3,4)33-19)23(20)32-22(13)14-9-16(27)17(28)10-15(14)26/h6,8-11,26-29,31H,5,7H2,1-4H3 |
---|
Synonyms | Value | Source |
---|
5,2',4',5'-Tetrahydroxy-3-(3-hydroxy-3-methylbutyl)-6'',6''-dimethylpyrano[2'',3'':7,8]flavone | HMDB | KB-2 | HMDB | Phosphomannan | HMDB | Phosphomannan backbone | HMDB |
|
---|
Chemical Formula | C25H26O8 |
---|
Average Molecular Weight | 454.4691 |
---|
Monoisotopic Molecular Weight | 454.162767808 |
---|
IUPAC Name | 5-hydroxy-3-(3-hydroxy-3-methylbutyl)-8,8-dimethyl-2-(2,4,5-trihydroxyphenyl)-4H,8H-pyrano[2,3-h]chromen-4-one |
---|
Traditional Name | 5-hydroxy-3-(3-hydroxy-3-methylbutyl)-8,8-dimethyl-2-(2,4,5-trihydroxyphenyl)pyrano[2,3-h]chromen-4-one |
---|
CAS Registry Number | 133740-64-4 |
---|
SMILES | CC(C)(O)CCC1=C(OC2=C(C(O)=CC3=C2C=CC(C)(C)O3)C1=O)C1=CC(O)=C(O)C=C1O |
---|
InChI Identifier | InChI=1S/C25H26O8/c1-24(2,31)7-5-13-21(30)20-18(29)11-19-12(6-8-25(3,4)33-19)23(20)32-22(13)14-9-16(27)17(28)10-15(14)26/h6,8-11,26-29,31H,5,7H2,1-4H3 |
---|
InChI Key | HENAAGIOPZLIKO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as 3-prenylated flavones. These are flavones that features a C5-isoprenoid substituent at the 3-position. |
---|
Kingdom | Organic compounds |
---|
Super Class | Phenylpropanoids and polyketides |
---|
Class | Flavonoids |
---|
Sub Class | Flavones |
---|
Direct Parent | 3-prenylated flavones |
---|
Alternative Parents | |
---|
Substituents | - 3-prenylated flavone
- Pyranoflavonoid
- 3'-hydroxyflavonoid
- 4'-hydroxyflavonoid
- 5-hydroxyflavonoid
- Hydroxyflavonoid
- Pyranochromene
- 2,2-dimethyl-1-benzopyran
- Chromone
- Benzopyran
- 1-benzopyran
- Hydroxyquinol derivative
- 1-hydroxy-2-unsubstituted benzenoid
- Alkyl aryl ether
- Phenol
- Pyranone
- Monocyclic benzene moiety
- Benzenoid
- Pyran
- Vinylogous acid
- Heteroaromatic compound
- Tertiary alcohol
- Ether
- Organoheterocyclic compound
- Oxacycle
- Polyol
- Organooxygen compound
- Organic oxide
- Organic oxygen compound
- Alcohol
- Hydrocarbon derivative
- Aromatic heteropolycyclic compound
|
---|
Molecular Framework | Aromatic heteropolycyclic compounds |
---|
External Descriptors | |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | 166 - 168 °C | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
KB 2,1TMS,isomer #1 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3805.9 | Semi standard non polar | 33892256 | KB 2,1TMS,isomer #2 | CC(C)(O)CCC1=C(C2=CC(O)=C(O)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3698.6 | Semi standard non polar | 33892256 | KB 2,1TMS,isomer #3 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3676.2 | Semi standard non polar | 33892256 | KB 2,1TMS,isomer #4 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3702.2 | Semi standard non polar | 33892256 | KB 2,1TMS,isomer #5 | CC(C)(O)CCC1=C(C2=CC(O)=C(O)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3688.7 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #1 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3689.0 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #10 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3585.9 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #2 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3664.2 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #3 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3686.3 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #4 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3674.3 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #5 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3575.8 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #6 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3601.8 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #7 | CC(C)(O)CCC1=C(C2=CC(O)=C(O)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3584.0 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #8 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3632.7 | Semi standard non polar | 33892256 | KB 2,2TMS,isomer #9 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3586.4 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #1 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3578.0 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #10 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3575.7 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #2 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3600.8 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #3 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O)=C(O)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3592.1 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #4 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3652.9 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #5 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3582.8 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #6 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3583.2 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #7 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3570.5 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #8 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3528.3 | Semi standard non polar | 33892256 | KB 2,3TMS,isomer #9 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3528.1 | Semi standard non polar | 33892256 | KB 2,4TMS,isomer #1 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3594.2 | Semi standard non polar | 33892256 | KB 2,4TMS,isomer #2 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3590.6 | Semi standard non polar | 33892256 | KB 2,4TMS,isomer #3 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3591.4 | Semi standard non polar | 33892256 | KB 2,4TMS,isomer #4 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3595.0 | Semi standard non polar | 33892256 | KB 2,4TMS,isomer #5 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C)=C2C1=O | 3539.2 | Semi standard non polar | 33892256 | KB 2,5TMS,isomer #1 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C)C3=C2OC(C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C2O[Si](C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C)C3=O)O1 | 3606.6 | Semi standard non polar | 33892256 | KB 2,1TBDMS,isomer #1 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4090.0 | Semi standard non polar | 33892256 | KB 2,1TBDMS,isomer #2 | CC(C)(O)CCC1=C(C2=CC(O)=C(O)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 3965.3 | Semi standard non polar | 33892256 | KB 2,1TBDMS,isomer #3 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3936.3 | Semi standard non polar | 33892256 | KB 2,1TBDMS,isomer #4 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3969.8 | Semi standard non polar | 33892256 | KB 2,1TBDMS,isomer #5 | CC(C)(O)CCC1=C(C2=CC(O)=C(O)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 3945.4 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #1 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC(O)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4204.8 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #10 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 4070.8 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #2 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4181.9 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #3 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4215.1 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #4 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O)C=C2O[Si](C)(C)C(C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4190.3 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #5 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 4053.1 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #6 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 4082.1 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #7 | CC(C)(O)CCC1=C(C2=CC(O)=C(O)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 4050.5 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #8 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 4091.1 | Semi standard non polar | 33892256 | KB 2,2TBDMS,isomer #9 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 4066.8 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #1 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4250.5 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #10 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O)=C2C1=O | 4165.1 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #2 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4280.6 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #3 | CC1(C)C=CC2=C(C=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC(O)=C(O)C=C2O[Si](C)(C)C(C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4254.6 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #4 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C2O)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4293.8 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #5 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O[Si](C)(C)C(C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4276.8 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #6 | CC1(C)C=CC2=C(C=C(O)C3=C2OC(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O[Si](C)(C)C(C)(C)C)=C(CCC(C)(C)O[Si](C)(C)C(C)(C)C)C3=O)O1 | 4280.6 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #7 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C2O)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 4161.8 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #8 | CC(C)(O)CCC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 4150.9 | Semi standard non polar | 33892256 | KB 2,3TBDMS,isomer #9 | CC(C)(O)CCC1=C(C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C2O[Si](C)(C)C(C)(C)C)OC2=C3C=CC(C)(C)OC3=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O | 4152.9 | Semi standard non polar | 33892256 |
|
---|