Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 18:35:54 UTC

Update Date

2022-03-07 02:53:52 UTC

HMDB ID

HMDB0033824

Secondary Accession Numbers

HMDB33824

Metabolite Identification

Common Name

Isoorientin 7-glucoside

Description

Isoorientin 7-glucoside, also known as lutonarin, belongs to the class of organic compounds known as 6-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C6 atom of the flavonoid backbone. Isoorientin 7-glucoside has been detected, but not quantified in, several different foods, such as barleys (Hordeum vulgare), breakfast cereal, cereals and cereal products, common wheats (Triticum aestivum), and pulses. This could make isoorientin 7-glucoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Isoorientin 7-glucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061307232D          

 43 47  0  0  0  0            999 V2000
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  8  1  1  0  0  0  0
  8  3  2  0  0  0  0
  9  2  1  0  0  0  0
 10  3  1  0  0  0  0
 10  9  2  0  0  0  0
 11  4  1  0  0  0  0
 12  4  2  0  0  0  0
 12  8  1  0  0  0  0
 13  5  2  0  0  0  0
 14  5  1  0  0  0  0
 15  6  1  0  0  0  0
 16  7  1  0  0  0  0
 17 11  1  0  0  0  0
 17 13  1  0  0  0  0
 18 14  2  0  0  0  0
 19 15  1  0  0  0  0
 20 16  1  0  0  0  0
 21 17  2  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 20  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26 18  1  0  0  0  0
 26 24  1  0  0  0  0
 27 25  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30  9  1  0  0  0  0
 31 10  1  0  0  0  0
 32 11  2  0  0  0  0
 33 19  1  0  0  0  0
 34 20  1  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 24  1  0  0  0  0
 39 25  1  0  0  0  0
 40 12  1  0  0  0  0
 40 13  1  0  0  0  0
 41 15  1  0  0  0  0
 41 26  1  0  0  0  0
 42 14  1  0  0  0  0
 42 27  1  0  0  0  0
 43 16  1  0  0  0  0
 43 27  1  0  0  0  0
M  END

HMDB0033824
     RDKit          3D
Isoorientin 7-glucoside
 73 77  0  0  0  0  0  0  0  0999 V2000
    3.9325    2.4501    0.3777 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5959    1.2717    0.1956 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5421    0.2650    0.0345 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1088   -1.0125   -0.1637 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1245   -2.0929   -0.3168 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7041   -3.4021   -0.2417 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6438   -4.4372   -0.3594 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826   -4.1125   -0.5506 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9418   -5.1210   -0.6650 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4226   -2.8069   -0.6326 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7656   -2.5302   -0.8325 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4450   -1.8143   -0.5078 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8516   -1.3561   -0.2162 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9186   -0.4317   -0.0670 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5799   -0.8284   -0.1220 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4170    0.0827    0.0397 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7429   -0.2358    0.0058 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3097   -1.5299   -0.2211 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5082   -1.3408   -0.8286 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4701   -2.2882   -0.7465 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8103   -3.0135   -2.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2917   -2.1219   -2.9987 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3525   -3.2952    0.3504 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5479   -3.8635    0.7381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6751   -2.7039    1.5709 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4530   -3.7861    2.4462 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3436   -2.2088    1.1407 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4344   -3.2936    1.1919 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0838    1.4224    0.2601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2320    2.4090    0.3785 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4890    2.7343   -0.9485 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7414    4.0136   -1.2929 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2371    4.3002   -1.3958 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5100    5.6265   -1.7171 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0099    5.0997   -0.6016 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5333    6.3426   -0.9045 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9400    4.9004    0.8990 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1173    5.6261    1.4760 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0211    3.5079    1.3231 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    3.2259    2.2728 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2193    1.8157    0.3058 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5496    3.1396    0.5060 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2536    0.8856    0.1409 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5702    0.5368    0.0776 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6520   -3.6542   -0.0936 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3498   -5.4713   -0.2972 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7158   -6.0839   -0.6229 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0321   -1.5344   -0.8888 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7969   -0.8059   -0.5786 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4041   -1.8852   -0.2979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5490   -2.1204   -0.7997 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4351   -1.7172   -0.5050 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6545   -3.7380   -1.8347 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9762   -3.5754   -2.4396 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0349   -1.6044   -2.5536 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6705   -4.1149   -0.0180 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8227   -3.4594    1.5954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2923   -1.9911    2.1218 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8361   -4.4562    2.0162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0109   -1.4726    1.9339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5701   -3.9178    0.4674 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1220    1.7919    0.6940 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4094    4.0976   -2.3897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7541    4.0517   -0.4573 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5822    3.6226   -2.2283 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0883    5.8987   -2.5679 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0402    5.0962   -0.9979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2243    7.0397   -0.2551 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8646    5.4616    1.2942 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5039    5.0733    2.1806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9469    3.4521    2.0780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0752    2.2934    2.6177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3095    3.6942    0.5763 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 16 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 29 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 12  5  1  0
 43 14  1  0
 27 18  1  0
 39 30  1  0
  3 44  1  0
  6 45  1  0
  7 46  1  0
  9 47  1  0
 11 48  1  0
 12 49  1  0
 15 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 30 62  1  0
 32 63  1  0
 33 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

  Mrv0541 05061307232D          

 43 47  0  0  0  0            999 V2000
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  8  1  1  0  0  0  0
  8  3  2  0  0  0  0
  9  2  1  0  0  0  0
 10  3  1  0  0  0  0
 10  9  2  0  0  0  0
 11  4  1  0  0  0  0
 12  4  2  0  0  0  0
 12  8  1  0  0  0  0
 13  5  2  0  0  0  0
 14  5  1  0  0  0  0
 15  6  1  0  0  0  0
 16  7  1  0  0  0  0
 17 11  1  0  0  0  0
 17 13  1  0  0  0  0
 18 14  2  0  0  0  0
 19 15  1  0  0  0  0
 20 16  1  0  0  0  0
 21 17  2  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 20  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26 18  1  0  0  0  0
 26 24  1  0  0  0  0
 27 25  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30  9  1  0  0  0  0
 31 10  1  0  0  0  0
 32 11  2  0  0  0  0
 33 19  1  0  0  0  0
 34 20  1  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 24  1  0  0  0  0
 39 25  1  0  0  0  0
 40 12  1  0  0  0  0
 40 13  1  0  0  0  0
 41 15  1  0  0  0  0
 41 26  1  0  0  0  0
 42 14  1  0  0  0  0
 42 27  1  0  0  0  0
 43 16  1  0  0  0  0
 43 27  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0033824

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2=C(C3OC(CO)C(O)C(O)C3O)C(O)=C3C(=O)C=C(OC3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c28-6-15-19(33)22(36)24(38)26(41-15)18-14(42-27-25(39)23(37)20(34)16(7-29)43-27)5-13-17(21(18)35)11(32)4-12(40-13)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2

> <INCHI_KEY>
OQKYVRDRDIXQMK-UHFFFAOYSA-N

> <FORMULA>
C27H30O16

> <MOLECULAR_WEIGHT>
610.5175

> <EXACT_MASS>
610.153384912

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
58.89273048175346

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(3,4-dihydroxyphenyl)-5-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.96

> <JCHEM_LOGP>
-2.6222651863333337

> <ALOGPS_LOGS>
-1.96

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
8.796326961154302

> <JCHEM_PKA_STRONGEST_ACIDIC>
7.987431178154968

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6483953479534437

> <JCHEM_POLAR_SURFACE_AREA>
276.52

> <JCHEM_REFRACTIVITY>
140.15749999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
6.69e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxyphenyl)-5-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0033824
     RDKit          3D
Isoorientin 7-glucoside
 73 77  0  0  0  0  0  0  0  0999 V2000
    3.9325    2.4501    0.3777 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5959    1.2717    0.1956 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5421    0.2650    0.0345 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1088   -1.0125   -0.1637 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1245   -2.0929   -0.3168 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7041   -3.4021   -0.2417 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6438   -4.4372   -0.3594 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826   -4.1125   -0.5506 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9418   -5.1210   -0.6650 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4226   -2.8069   -0.6326 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7656   -2.5302   -0.8325 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4450   -1.8143   -0.5078 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8516   -1.3561   -0.2162 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9186   -0.4317   -0.0670 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5799   -0.8284   -0.1220 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4170    0.0827    0.0397 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7429   -0.2358    0.0058 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3097   -1.5299   -0.2211 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5082   -1.3408   -0.8286 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4701   -2.2882   -0.7465 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8103   -3.0135   -2.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2917   -2.1219   -2.9987 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3525   -3.2952    0.3504 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5479   -3.8635    0.7381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6751   -2.7039    1.5709 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4530   -3.7861    2.4462 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3436   -2.2088    1.1407 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4344   -3.2936    1.1919 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0838    1.4224    0.2601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2320    2.4090    0.3785 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4890    2.7343   -0.9485 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7414    4.0136   -1.2929 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2371    4.3002   -1.3958 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5100    5.6265   -1.7171 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0099    5.0997   -0.6016 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5333    6.3426   -0.9045 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9400    4.9004    0.8990 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1173    5.6261    1.4760 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0211    3.5079    1.3231 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    3.2259    2.2728 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2193    1.8157    0.3058 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5496    3.1396    0.5060 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2536    0.8856    0.1409 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5702    0.5368    0.0776 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6520   -3.6542   -0.0936 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3498   -5.4713   -0.2972 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7158   -6.0839   -0.6229 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0321   -1.5344   -0.8888 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7969   -0.8059   -0.5786 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4041   -1.8852   -0.2979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5490   -2.1204   -0.7997 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4351   -1.7172   -0.5050 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6545   -3.7380   -1.8347 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9762   -3.5754   -2.4396 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0349   -1.6044   -2.5536 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6705   -4.1149   -0.0180 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8227   -3.4594    1.5954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2923   -1.9911    2.1218 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8361   -4.4562    2.0162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0109   -1.4726    1.9339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5701   -3.9178    0.4674 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1220    1.7919    0.6940 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4094    4.0976   -2.3897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7541    4.0517   -0.4573 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5822    3.6226   -2.2283 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0883    5.8987   -2.5679 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0402    5.0962   -0.9979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2243    7.0397   -0.2551 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8646    5.4616    1.2942 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5039    5.0733    2.1806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9469    3.4521    2.0780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0752    2.2934    2.6177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3095    3.6942    0.5763 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 16 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 29 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 12  5  1  0
 43 14  1  0
 27 18  1  0
 39 30  1  0
  3 44  1  0
  6 45  1  0
  7 46  1  0
  9 47  1  0
 11 48  1  0
 12 49  1  0
 15 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 30 62  1  0
 32 63  1  0
 33 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       9.336  -6.930   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      10.669   4.620   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       9.336  -5.390   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      10.669  -4.620   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      10.669  -3.080   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       6.668   3.850   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       9.336  -2.310   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       8.002  -3.080   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      10.669  -7.700   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      12.003   3.850   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -4.001   2.310   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -1.334   3.850   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      12.003  -5.390   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       8.002   6.160   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       5.335  -4.620   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      12.003  -2.310   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       5.335   4.620   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       8.002  -4.620   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       8.002   0.000   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
CONECT    1    2    8                                                       
CONECT    2    1    9                                                       
CONECT    3    8   10                                                       
CONECT    4   11   12                                                       
CONECT    5   13   14                                                       
CONECT    6   15   28                                                       
CONECT    7   16   29                                                       
CONECT    8    1    3   12                                                  
CONECT    9    2   10   30                                                  
CONECT   10    3    9   31                                                  
CONECT   11    4   17   32                                                  
CONECT   12    4    8   40                                                  
CONECT   13    5   17   40                                                  
CONECT   14    5   18   42                                                  
CONECT   15    6   19   41                                                  
CONECT   16    7   20   43                                                  
CONECT   17   11   13   21                                                  
CONECT   18   14   21   26                                                  
CONECT   19   15   22   33                                                  
CONECT   20   16   23   34                                                  
CONECT   21   17   18   35                                                  
CONECT   22   19   24   36                                                  
CONECT   23   20   25   37                                                  
CONECT   24   22   26   38                                                  
CONECT   25   23   27   39                                                  
CONECT   26   18   24   41                                                  
CONECT   27   25   42   43                                                  
CONECT   28    6                                                            
CONECT   29    7                                                            
CONECT   30    9                                                            
CONECT   31   10                                                            
CONECT   32   11                                                            
CONECT   33   19                                                            
CONECT   34   20                                                            
CONECT   35   21                                                            
CONECT   36   22                                                            
CONECT   37   23                                                            
CONECT   38   24                                                            
CONECT   39   25                                                            
CONECT   40   12   13                                                       
CONECT   41   15   26                                                       
CONECT   42   14   27                                                       
CONECT   43   16   27                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0033824
HETATM    1  O1  UNL     1       3.933   2.450   0.378  1.00  0.00           O  
HETATM    2  C1  UNL     1       3.596   1.272   0.196  1.00  0.00           C  
HETATM    3  C2  UNL     1       4.542   0.265   0.034  1.00  0.00           C  
HETATM    4  C3  UNL     1       4.109  -1.012  -0.164  1.00  0.00           C  
HETATM    5  C4  UNL     1       5.124  -2.093  -0.317  1.00  0.00           C  
HETATM    6  C5  UNL     1       4.704  -3.402  -0.242  1.00  0.00           C  
HETATM    7  C6  UNL     1       5.644  -4.437  -0.359  1.00  0.00           C  
HETATM    8  C7  UNL     1       6.983  -4.112  -0.551  1.00  0.00           C  
HETATM    9  O2  UNL     1       7.942  -5.121  -0.665  1.00  0.00           O  
HETATM   10  C8  UNL     1       7.423  -2.807  -0.633  1.00  0.00           C  
HETATM   11  O3  UNL     1       8.766  -2.530  -0.833  1.00  0.00           O  
HETATM   12  C9  UNL     1       6.445  -1.814  -0.508  1.00  0.00           C  
HETATM   13  O4  UNL     1       2.852  -1.356  -0.216  1.00  0.00           O  
HETATM   14  C10 UNL     1       1.919  -0.432  -0.067  1.00  0.00           C  
HETATM   15  C11 UNL     1       0.580  -0.828  -0.122  1.00  0.00           C  
HETATM   16  C12 UNL     1      -0.417   0.083   0.040  1.00  0.00           C  
HETATM   17  O5  UNL     1      -1.743  -0.236   0.006  1.00  0.00           O  
HETATM   18  C13 UNL     1      -2.310  -1.530  -0.221  1.00  0.00           C  
HETATM   19  O6  UNL     1      -3.508  -1.341  -0.829  1.00  0.00           O  
HETATM   20  C14 UNL     1      -4.470  -2.288  -0.746  1.00  0.00           C  
HETATM   21  C15 UNL     1      -4.810  -3.013  -2.027  1.00  0.00           C  
HETATM   22  O7  UNL     1      -5.292  -2.122  -2.999  1.00  0.00           O  
HETATM   23  C16 UNL     1      -4.353  -3.295   0.350  1.00  0.00           C  
HETATM   24  O8  UNL     1      -5.548  -3.863   0.738  1.00  0.00           O  
HETATM   25  C17 UNL     1      -3.675  -2.704   1.571  1.00  0.00           C  
HETATM   26  O9  UNL     1      -3.453  -3.786   2.446  1.00  0.00           O  
HETATM   27  C18 UNL     1      -2.344  -2.209   1.141  1.00  0.00           C  
HETATM   28  O10 UNL     1      -1.434  -3.294   1.192  1.00  0.00           O  
HETATM   29  C19 UNL     1      -0.084   1.422   0.260  1.00  0.00           C  
HETATM   30  C20 UNL     1      -1.232   2.409   0.378  1.00  0.00           C  
HETATM   31  O11 UNL     1      -1.489   2.734  -0.948  1.00  0.00           O  
HETATM   32  C21 UNL     1      -1.741   4.014  -1.293  1.00  0.00           C  
HETATM   33  C22 UNL     1      -3.237   4.300  -1.396  1.00  0.00           C  
HETATM   34  O12 UNL     1      -3.510   5.627  -1.717  1.00  0.00           O  
HETATM   35  C23 UNL     1      -1.010   5.100  -0.602  1.00  0.00           C  
HETATM   36  O13 UNL     1      -1.533   6.343  -0.904  1.00  0.00           O  
HETATM   37  C24 UNL     1      -0.940   4.900   0.899  1.00  0.00           C  
HETATM   38  O14 UNL     1       0.117   5.626   1.476  1.00  0.00           O  
HETATM   39  C25 UNL     1      -1.021   3.508   1.323  1.00  0.00           C  
HETATM   40  O15 UNL     1      -0.001   3.226   2.273  1.00  0.00           O  
HETATM   41  C26 UNL     1       1.219   1.816   0.306  1.00  0.00           C  
HETATM   42  O16 UNL     1       1.550   3.140   0.506  1.00  0.00           O  
HETATM   43  C27 UNL     1       2.254   0.886   0.141  1.00  0.00           C  
HETATM   44  H1  UNL     1       5.570   0.537   0.078  1.00  0.00           H  
HETATM   45  H2  UNL     1       3.652  -3.654  -0.094  1.00  0.00           H  
HETATM   46  H3  UNL     1       5.350  -5.471  -0.297  1.00  0.00           H  
HETATM   47  H4  UNL     1       7.716  -6.084  -0.623  1.00  0.00           H  
HETATM   48  H5  UNL     1       9.032  -1.534  -0.889  1.00  0.00           H  
HETATM   49  H6  UNL     1       6.797  -0.806  -0.579  1.00  0.00           H  
HETATM   50  H7  UNL     1       0.404  -1.885  -0.298  1.00  0.00           H  
HETATM   51  H8  UNL     1      -1.549  -2.120  -0.800  1.00  0.00           H  
HETATM   52  H9  UNL     1      -5.435  -1.717  -0.505  1.00  0.00           H  
HETATM   53  H10 UNL     1      -5.654  -3.738  -1.835  1.00  0.00           H  
HETATM   54  H11 UNL     1      -3.976  -3.575  -2.440  1.00  0.00           H  
HETATM   55  H12 UNL     1      -6.035  -1.604  -2.554  1.00  0.00           H  
HETATM   56  H13 UNL     1      -3.670  -4.115  -0.018  1.00  0.00           H  
HETATM   57  H14 UNL     1      -5.823  -3.459   1.595  1.00  0.00           H  
HETATM   58  H15 UNL     1      -4.292  -1.991   2.122  1.00  0.00           H  
HETATM   59  H16 UNL     1      -2.836  -4.456   2.016  1.00  0.00           H  
HETATM   60  H17 UNL     1      -2.011  -1.473   1.934  1.00  0.00           H  
HETATM   61  H18 UNL     1      -1.570  -3.918   0.467  1.00  0.00           H  
HETATM   62  H19 UNL     1      -2.122   1.792   0.694  1.00  0.00           H  
HETATM   63  H20 UNL     1      -1.409   4.098  -2.390  1.00  0.00           H  
HETATM   64  H21 UNL     1      -3.754   4.052  -0.457  1.00  0.00           H  
HETATM   65  H22 UNL     1      -3.582   3.623  -2.228  1.00  0.00           H  
HETATM   66  H23 UNL     1      -3.088   5.899  -2.568  1.00  0.00           H  
HETATM   67  H24 UNL     1       0.040   5.096  -0.998  1.00  0.00           H  
HETATM   68  H25 UNL     1      -1.224   7.040  -0.255  1.00  0.00           H  
HETATM   69  H26 UNL     1      -1.865   5.462   1.294  1.00  0.00           H  
HETATM   70  H27 UNL     1       0.504   5.073   2.181  1.00  0.00           H  
HETATM   71  H28 UNL     1      -1.947   3.452   2.078  1.00  0.00           H  
HETATM   72  H29 UNL     1      -0.075   2.293   2.618  1.00  0.00           H  
HETATM   73  H30 UNL     1       2.310   3.694   0.576  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   43
CONECT    3    4    4   44
CONECT    4    5   13
CONECT    5    6    6   12
CONECT    6    7   45
CONECT    7    8    8   46
CONECT    8    9   10
CONECT    9   47
CONECT   10   11   12   12
CONECT   11   48
CONECT   12   49
CONECT   13   14
CONECT   14   15   15   43
CONECT   15   16   50
CONECT   16   17   29   29
CONECT   17   18
CONECT   18   19   27   51
CONECT   19   20
CONECT   20   21   23   52
CONECT   21   22   53   54
CONECT   22   55
CONECT   23   24   25   56
CONECT   24   57
CONECT   25   26   27   58
CONECT   26   59
CONECT   27   28   60
CONECT   28   61
CONECT   29   30   41
CONECT   30   31   39   62
CONECT   31   32
CONECT   32   33   35   63
CONECT   33   34   64   65
CONECT   34   66
CONECT   35   36   37   67
CONECT   36   68
CONECT   37   38   39   69
CONECT   38   70
CONECT   39   40   71
CONECT   40   72
CONECT   41   42   43   43
CONECT   42   73
END

HMDB0033824
     RDKit          3D
Isoorientin 7-glucoside
 73 77  0  0  0  0  0  0  0  0999 V2000
    3.9325    2.4501    0.3777 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5959    1.2717    0.1956 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5421    0.2650    0.0345 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1088   -1.0125   -0.1637 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1245   -2.0929   -0.3168 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7041   -3.4021   -0.2417 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6438   -4.4372   -0.3594 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826   -4.1125   -0.5506 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9418   -5.1210   -0.6650 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4226   -2.8069   -0.6326 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7656   -2.5302   -0.8325 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4450   -1.8143   -0.5078 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8516   -1.3561   -0.2162 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9186   -0.4317   -0.0670 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5799   -0.8284   -0.1220 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4170    0.0827    0.0397 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7429   -0.2358    0.0058 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3097   -1.5299   -0.2211 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5082   -1.3408   -0.8286 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4701   -2.2882   -0.7465 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8103   -3.0135   -2.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2917   -2.1219   -2.9987 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3525   -3.2952    0.3504 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5479   -3.8635    0.7381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6751   -2.7039    1.5709 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4530   -3.7861    2.4462 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3436   -2.2088    1.1407 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4344   -3.2936    1.1919 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0838    1.4224    0.2601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2320    2.4090    0.3785 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4890    2.7343   -0.9485 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7414    4.0136   -1.2929 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2371    4.3002   -1.3958 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5100    5.6265   -1.7171 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0099    5.0997   -0.6016 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5333    6.3426   -0.9045 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9400    4.9004    0.8990 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1173    5.6261    1.4760 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0211    3.5079    1.3231 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    3.2259    2.2728 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2193    1.8157    0.3058 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5496    3.1396    0.5060 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2536    0.8856    0.1409 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5702    0.5368    0.0776 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6520   -3.6542   -0.0936 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3498   -5.4713   -0.2972 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7158   -6.0839   -0.6229 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0321   -1.5344   -0.8888 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7969   -0.8059   -0.5786 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4041   -1.8852   -0.2979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5490   -2.1204   -0.7997 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4351   -1.7172   -0.5050 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6545   -3.7380   -1.8347 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9762   -3.5754   -2.4396 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0349   -1.6044   -2.5536 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6705   -4.1149   -0.0180 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8227   -3.4594    1.5954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2923   -1.9911    2.1218 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8361   -4.4562    2.0162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0109   -1.4726    1.9339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5701   -3.9178    0.4674 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1220    1.7919    0.6940 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4094    4.0976   -2.3897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7541    4.0517   -0.4573 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5822    3.6226   -2.2283 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0883    5.8987   -2.5679 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0402    5.0962   -0.9979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2243    7.0397   -0.2551 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8646    5.4616    1.2942 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5039    5.0733    2.1806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9469    3.4521    2.0780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0752    2.2934    2.6177 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3095    3.6942    0.5763 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 16 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 29 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 12  5  1  0
 43 14  1  0
 27 18  1  0
 39 30  1  0
  3 44  1  0
  6 45  1  0
  7 46  1  0
  9 47  1  0
 11 48  1  0
 12 49  1  0
 15 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 30 62  1  0
 32 63  1  0
 33 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Lutonarin	MeSH

Chemical Formula

C₂₇H₃₀O₁₆

Average Molecular Weight

610.5175

Monoisotopic Molecular Weight

610.153384912

IUPAC Name

2-(3,4-dihydroxyphenyl)-5-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-chromen-4-one

Traditional Name

2-(3,4-dihydroxyphenyl)-5-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}chromen-4-one

CAS Registry Number

35450-86-3

SMILES

OCC1OC(OC2=C(C3OC(CO)C(O)C(O)C3O)C(O)=C3C(=O)C=C(OC3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O16/c28-6-15-19(33)22(36)24(38)26(41-15)18-14(42-27-25(39)23(37)20(34)16(7-29)43-27)5-13-17(21(18)35)11(32)4-12(40-13)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2

InChI Key

OQKYVRDRDIXQMK-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as 6-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C6 atom of the flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

O-methylated flavonoids

Direct Parent

6-O-methylated flavonoids

Alternative Parents

Substituents

3p-methoxyflavonoid-skeleton
3-methoxyflavonoid-skeleton
6-methoxyflavonoid-skeleton
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Hydroxyflavonoid
3-methoxychromone
Chromone
Benzopyran
Methoxyphenol
1-benzopyran
Phenoxy compound
Anisole
Methoxybenzene
Phenol ether
Pyranone
Phenol
Alkyl aryl ether
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Benzenoid
Pyran
Monocyclic benzene moiety
Vinylogous acid
Heteroaromatic compound
Organoheterocyclic compound
Oxacycle
Ether
Organic oxygen compound
Hydrocarbon derivative
Organic oxide
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Flavones and Flavonols (LMPK12112999 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0033824)
Cytoplasm (HMDB: HMDB0033824)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0033824)

Source

Exogenous

Exogenous (HMDB: HMDB0033824)

Food

Food (HMDB: HMDB0033824)

Cereal and cereal product

Cereal

Barley (FooDB: FOOD00088)
Common wheat (FooDB: FOOD00187)

Cereal product

Breakfast cereal (FooDB: FOOD00270)

Cereals and cereal products (FooDB: FOOD00858)

Pulse

Pulses (FooDB: FOOD00867)

Not Available

Nutrient (HMDB: HMDB0033824)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	239 - 242 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	6.69 g/L	ALOGPS
logP	-0.96	ALOGPS
logP	-2.6	ChemAxon
logS	-2	ALOGPS
pKa (Strongest Acidic)	7.99	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	276.52 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	140.16 m³·mol⁻¹	ChemAxon
Polarizability	58.89 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	232.618	30932474
DeepCCS	[M-H]-	230.632	30932474
DeepCCS	[M-2H]-	263.871	30932474
DeepCCS	[M+Na]+	238.358	30932474
AllCCS	[M+H]+	235.5	32859911
AllCCS	[M+H-H2O]+	234.1	32859911
AllCCS	[M+NH4]+	236.8	32859911
AllCCS	[M+Na]+	237.2	32859911
AllCCS	[M-H]-	236.1	32859911
AllCCS	[M+Na-2H]-	238.5	32859911
AllCCS	[M+HCOO]-	241.3	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Isoorientin 7-glucoside	OCC1OC(OC2=C(C3OC(CO)C(O)C(O)C3O)C(O)=C3C(=O)C=C(OC3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O	5426.2	Standard polar	33892256
Isoorientin 7-glucoside	OCC1OC(OC2=C(C3OC(CO)C(O)C(O)C3O)C(O)=C3C(=O)C=C(OC3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O	5233.9	Standard non polar	33892256
Isoorientin 7-glucoside	OCC1OC(OC2=C(C3OC(CO)C(O)C(O)C3O)C(O)=C3C(=O)C=C(OC3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O	5908.8	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Isoorientin 7-glucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5691.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #10	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	5750.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #11	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5759.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5713.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #3	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5759.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #4	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5772.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #5	C[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5750.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #6	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5687.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #7	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5790.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #8	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5789.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TMS,isomer #9	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5755.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5638.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5624.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5624.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5623.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5634.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5639.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5622.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5604.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5628.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5628.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5634.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5622.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #20	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5655.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #21	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5648.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #22	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5664.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #23	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5655.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #24	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5636.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #25	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5625.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #26	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5646.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #27	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O[Si](C)(C)C	5679.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #28	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5652.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #29	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	5640.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5599.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #30	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5663.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5645.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5624.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #33	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5617.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #34	C[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O[Si](C)(C)C	5672.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #35	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5651.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #36	C[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5645.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #37	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5662.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #38	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5658.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #39	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5640.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5600.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #40	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5622.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #41	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5632.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #42	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5618.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #43	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5636.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #44	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5650.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #45	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5634.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #46	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5654.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #47	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5628.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #48	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5659.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #49	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5643.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5613.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #50	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5672.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #51	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5647.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #52	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5677.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #53	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O	5655.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #54	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O[Si](C)(C)C	5685.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #55	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O[Si](C)(C)C	5659.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5618.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5610.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5633.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5621.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5508.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5446.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #100	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5474.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5518.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #102	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5514.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5506.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #104	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5447.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #105	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5495.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #106	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5491.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #107	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5515.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #108	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5507.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #109	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5588.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5460.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #110	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5495.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #111	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5470.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #112	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5501.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #113	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5560.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #114	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O	5554.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #115	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5537.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5460.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #117	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5436.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #118	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5471.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #119	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	5544.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5461.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #120	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5568.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5507.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #122	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5482.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #123	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5513.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #124	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5574.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5457.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5518.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #127	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5492.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #128	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5430.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #129	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5498.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5446.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #130	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5515.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #131	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5523.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #132	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5496.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #133	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5515.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #134	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O	5560.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #135	C[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5554.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #136	C[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5582.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #137	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5490.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #138	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5464.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #139	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5493.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5473.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #140	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5535.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #141	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5510.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #142	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5526.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #143	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5483.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #144	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5518.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #145	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5459.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #146	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5523.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #147	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5535.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #148	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5505.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #149	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5479.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5514.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #150	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5553.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #151	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5465.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #152	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5440.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #153	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5512.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #154	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5487.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #155	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5510.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #156	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5504.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #157	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5523.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #158	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5534.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #159	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5536.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5465.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #160	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O[Si](C)(C)C	5501.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #161	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5545.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #162	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5526.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #163	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5545.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #164	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O	5559.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #165	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5608.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5495.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5463.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5486.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5473.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5470.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5481.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5525.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5493.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5508.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5507.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5498.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5506.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5527.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5505.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5488.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5511.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5530.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5518.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5542.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5514.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5525.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5530.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5535.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5503.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5518.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5487.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5545.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5522.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5528.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5565.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5560.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5546.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5532.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5534.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5499.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5475.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5474.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5494.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5528.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5516.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5526.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5555.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5469.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5444.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #57	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5474.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #58	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5519.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #59	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5503.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5496.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #60	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5518.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #61	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5515.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #62	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5493.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #63	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5507.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #64	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5544.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #65	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5533.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #66	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5541.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #67	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5501.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5461.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5501.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5535.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5481.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #71	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5500.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #72	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5431.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #73	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5478.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #74	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5458.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #75	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5477.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #76	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5489.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #77	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5477.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #78	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5494.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #79	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5531.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5489.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #80	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5536.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #81	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5540.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5510.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #83	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5485.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #84	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5514.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #85	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5559.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #86	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5549.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #87	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5559.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #88	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5547.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #89	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5580.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5517.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5475.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #91	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5448.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #92	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5485.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #93	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5535.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #94	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	5540.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #95	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5523.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #96	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5499.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #97	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5529.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #98	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5560.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,3TMS,isomer #99	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5574.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5332.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5273.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #100	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5373.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #101	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5408.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #102	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5418.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #103	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5374.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #104	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5399.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #105	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5413.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #106	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5371.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5393.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #108	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5415.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #109	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5421.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5260.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #110	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5387.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5423.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5379.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #113	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5402.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #114	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5406.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5411.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5378.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5425.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #118	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5433.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #119	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5395.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5283.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #120	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5484.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #121	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5435.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #122	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5347.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #123	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5312.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #124	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5327.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #125	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5383.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #126	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5366.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #127	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5380.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #128	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5375.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #129	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5339.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5353.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #130	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5351.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #131	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5405.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #132	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5388.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #133	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5401.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #134	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5382.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #135	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5302.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #136	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5362.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #137	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5349.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #138	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5357.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #139	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5276.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5285.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #140	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5334.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #141	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5320.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #142	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5330.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #143	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5345.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #144	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5327.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #145	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5343.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #146	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5393.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #147	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5404.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #148	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5395.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #149	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5374.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5324.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #150	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5345.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #151	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5355.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #152	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5418.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #153	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5399.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #154	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5415.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #155	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5340.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #156	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5250.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #157	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5322.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #158	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5311.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #159	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5319.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5319.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #160	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5219.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #161	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5292.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #162	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5279.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #163	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5289.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #164	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5310.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #165	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5288.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #166	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5309.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #167	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5369.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #168	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5382.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #169	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5373.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5303.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #170	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5398.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #171	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5319.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #172	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5379.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #173	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5355.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #174	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5373.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #175	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5289.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #176	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5350.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #177	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5327.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #178	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5345.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #179	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5356.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5322.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #180	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5336.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #181	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5357.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #182	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5408.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #183	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5419.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #184	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5409.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #185	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5328.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #186	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5382.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #187	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5353.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #188	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5374.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #189	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5297.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5362.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #190	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5277.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #191	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5297.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #192	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5353.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #193	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5371.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #194	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5360.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #195	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5272.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #196	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5250.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #197	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5269.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #198	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5323.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #199	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5340.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5332.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5305.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #200	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5330.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #201	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5333.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #202	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5351.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #203	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5338.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #204	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5422.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #205	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5313.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #206	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5384.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #207	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5384.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #208	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5365.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #209	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5393.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5341.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #210	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5412.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #211	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5283.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #212	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5358.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #213	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5353.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #214	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5333.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #215	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5358.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #216	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5347.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #217	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5351.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #218	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5335.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #219	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5362.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5331.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #220	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5447.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #221	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O	5428.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #222	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O[Si](C)(C)C	5404.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #223	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O	5424.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #224	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5401.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #225	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5461.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #226	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O	5401.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #227	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5370.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #228	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5366.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #229	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5438.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5336.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #230	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O[Si](C)(C)C	5449.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #231	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5267.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #232	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5349.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #233	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5347.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #234	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O[Si](C)(C)C	5370.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #235	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5235.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #236	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5320.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #237	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5314.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #238	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5307.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #239	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5314.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5373.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #240	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	5424.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #241	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5321.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #242	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5395.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #243	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5400.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #244	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5425.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #245	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5290.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #246	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5369.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #247	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5367.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #248	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5361.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #249	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5364.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5321.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #250	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5465.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #251	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5301.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #252	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5308.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #253	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5335.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #254	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5404.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #255	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5407.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #256	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5412.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #257	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5275.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #258	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5276.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #259	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5377.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5350.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #260	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5368.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #261	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5298.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #262	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5389.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #263	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5357.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #264	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5384.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #265	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5400.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #266	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5268.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #267	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5363.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #268	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5327.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #269	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5351.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5339.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #270	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5354.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #271	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5316.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #272	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5348.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #273	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C1O	5436.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #274	C[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O[Si](C)(C)C	5412.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #275	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5451.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #276	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5251.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #277	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5354.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #278	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O	5391.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #279	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O[Si](C)(C)C	5360.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5361.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #280	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5221.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #281	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5326.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #282	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5362.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #283	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5314.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #284	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5349.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #285	C[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O[Si](C)(C)C	5456.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #286	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5302.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #287	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5403.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #288	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5412.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #289	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5270.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5315.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #290	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5376.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #291	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5368.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #292	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5304.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #293	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5315.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #294	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5411.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #295	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5275.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #296	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O	5324.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #297	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5372.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #298	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5404.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #299	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5421.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5347.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5342.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #300	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	5297.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #301	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5341.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #302	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5372.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #303	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5337.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #304	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5366.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #305	C[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5470.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #306	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O	5411.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #307	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5381.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #308	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5369.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #309	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5274.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5383.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #310	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O[Si](C)(C)C	5385.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #311	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5244.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #312	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5333.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #313	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5435.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #314	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5302.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #315	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5346.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #316	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5410.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #317	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O	5319.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #318	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)=CC=C1O	5294.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #319	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O	5353.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5328.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #320	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5321.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #321	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C	5374.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #322	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O	5345.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #323	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5319.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #324	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O[Si](C)(C)C	5321.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #325	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5385.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #326	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)=CC=C1O	5424.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #327	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1O[Si](C)(C)C	5418.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #328	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5448.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #329	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O[Si](C)(C)C	5453.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5358.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #330	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1O	5452.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5400.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5408.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5373.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5250.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5243.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5230.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5335.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5254.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5328.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5261.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5301.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5290.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5268.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5290.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5332.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5272.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5313.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5360.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5303.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5299.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5344.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5291.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5321.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O	5308.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5334.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5287.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5314.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5354.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5426.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5299.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5330.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5371.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5380.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5343.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5317.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5296.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5316.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5352.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5306.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5363.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5331.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5313.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5317.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5363.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5310.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5339.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5319.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5348.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5294.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5323.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5403.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5365.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5316.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5343.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5393.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5418.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5364.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5362.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5371.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5395.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5353.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	5281.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C	5377.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #91	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5360.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #92	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5374.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #93	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C)C1O	5336.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #94	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5358.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #95	C[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C)C(O)C1O	5396.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #96	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5354.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #97	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5378.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #98	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5406.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,4TMS,isomer #99	C[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5403.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5884.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	5982.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	5989.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5893.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5987.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	6003.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5980.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5910.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	5961.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	5969.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	5985.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)C(O)C(O)C1O	6029.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	6007.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	6002.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5993.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	6012.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	6012.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5981.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5993.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	6012.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	6006.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5997.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)C(O)C(O)C1O	6002.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	6039.3	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	6025.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	6049.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	6038.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	6005.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	6017.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C(C)(C)C)C1O	6041.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O[Si](C)(C)C(C)(C)C	6044.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	6048.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C1O	6034.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O[Si](C)(C)C(C)(C)C)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	6005.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	6051.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	6057.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	6025.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	6022.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	6053.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O	6049.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C3=C(C=C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	6037.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O	6061.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	6056.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	6027.2	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5978.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	6022.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	6037.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	6029.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	6039.5	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O	6049.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)=CC=C1O	6023.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C3O2)=CC=C1O	6044.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C3O2)=CC=C1O	6028.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	6043.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1O[Si](C)(C)C(C)(C)C	6045.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5991.4	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C3O2)C=C1O	6073.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C3O2)C=C1O	6059.9	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1O	6072.6	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C(C)(C)C)C1O	6066.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1C(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	6081.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C1O[Si](C)(C)C(C)(C)C	6051.0	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	5999.8	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O)C1O	6001.7	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	6027.1	Semi standard non polar	33892256
Isoorientin 7-glucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC3=C(C(O)=C2C2OC(CO)C(O)C(O)C2O)C(=O)C=C(C2=CC=C(O)C(O)=C2)O3)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	6021.6	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0hoy-1100290000-99beddae3bcca995f60c	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (1 TMS) - 70eV, Positive	splash10-0fkc-3200059000-117878e46f221636e448	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_1_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isoorientin 7-glucoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 10V, Positive-QTOF	splash10-01pn-0000943000-39ad3954ed85c81aca25	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 20V, Positive-QTOF	splash10-001j-0100910000-bcb5417a41ca560f3177	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 40V, Positive-QTOF	splash10-02wa-0239810000-66aeb2c3abba3dbb983e	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 10V, Negative-QTOF	splash10-0a4i-1101879000-808de32bac811874e187	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 20V, Negative-QTOF	splash10-054k-3204940000-d1b2cf77326ec74e6b48	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 40V, Negative-QTOF	splash10-054k-4117900000-07df7ee97a9b49b3b72c	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 10V, Positive-QTOF	splash10-01ot-0000904000-8b88a7164b5b384e7a28	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 20V, Positive-QTOF	splash10-0002-0000901000-749ed27a173f937517ad	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 40V, Positive-QTOF	splash10-0002-0000900000-6cdaf2bc31caca882f1d	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 10V, Negative-QTOF	splash10-0a4i-0000009000-6b4064f5213fdb493c4d	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 20V, Negative-QTOF	splash10-0a4j-0000509000-27ba7932f87962d84df6	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isoorientin 7-glucoside 40V, Negative-QTOF	splash10-0002-0000901000-f95e4268bdb224256e7c	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB011989

KNApSAcK ID

C00006206

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

15592799

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Isoorientin 7-glucoside (HMDB0033824)

MOL for HMDB0033824 (Isoorientin 7-glucoside)

3D MOL for HMDB0033824 (Isoorientin 7-glucoside)

3D SDF for HMDB0033824 (Isoorientin 7-glucoside)

3D-SDF for HMDB0033824 (Isoorientin 7-glucoside)

PDB for HMDB0033824 (Isoorientin 7-glucoside)

3D PDB for HMDB0033824 (Isoorientin 7-glucoside)

SMILES for HMDB0033824 (Isoorientin 7-glucoside)

INCHI for HMDB0033824 (Isoorientin 7-glucoside)

Structure for HMDB0033824 (Isoorientin 7-glucoside)

3D Structure for HMDB0033824 (Isoorientin 7-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra