Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 19:10:59 UTC

Update Date

2022-03-07 02:54:04 UTC

HMDB ID

HMDB0034359

Secondary Accession Numbers

HMDB34359

Metabolite Identification

Common Name

Myricetin 3'-glucoside

Description

Myricetin 3'-glucoside belongs to the class of organic compounds known as flavonoid o-glycosides. Flavonoid O-glycosides are compounds containing a carbohydrate moiety which is O-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone. Myricetin 3'-glucoside has been detected, but not quantified in, several different foods, such as red tea, green tea, fruits, herbal tea, and teas (Camellia sinensis). This could make myricetin 3'-glucoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Myricetin 3'-glucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061307452D          

 34 37  0  0  0  0            999 V2000
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  1  2  0  0  0  0
  6  2  1  0  0  0  0
  7  3  2  0  0  0  0
  7  4  1  0  0  0  0
  8  3  1  0  0  0  0
  9  1  1  0  0  0  0
 10  4  2  0  0  0  0
 11  2  2  0  0  0  0
 12  5  1  0  0  0  0
 13  8  2  0  0  0  0
 13 10  1  0  0  0  0
 14  9  2  0  0  0  0
 14 11  1  0  0  0  0
 15 12  1  0  0  0  0
 16 13  1  0  0  0  0
 17 15  1  0  0  0  0
 18 16  1  0  0  0  0
 19 17  1  0  0  0  0
 20  6  1  0  0  0  0
 20 18  2  0  0  0  0
 21 19  1  0  0  0  0
 22  5  1  0  0  0  0
 23  7  1  0  0  0  0
 24  8  1  0  0  0  0
 25  9  1  0  0  0  0
 26 14  1  0  0  0  0
 27 15  1  0  0  0  0
 28 16  2  0  0  0  0
 29 17  1  0  0  0  0
 30 18  1  0  0  0  0
 31 19  1  0  0  0  0
 32 10  1  0  0  0  0
 32 20  1  0  0  0  0
 33 11  1  0  0  0  0
 33 21  1  0  0  0  0
 34 12  1  0  0  0  0
 34 21  1  0  0  0  0
M  END

HMDB0034359
     RDKit          3D
Myricetin 3'-glucoside
 54 57  0  0  0  0  0  0  0  0999 V2000
    3.7616   -2.7578   -1.6398 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8550   -1.7062   -0.9777 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465   -1.0969   -0.5876 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4591   -1.6950   -0.9584 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254    0.0506    0.1350 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5702    0.7719    0.5953 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7582    1.9373    1.3314 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7053    2.6778    1.8028 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8922    3.8485    2.5423 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6071    2.2834    1.5576 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6489    3.0389    2.0385 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8453    1.1337    0.8316 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0123    0.6189    0.5099 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3087    0.4992    0.4385 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7400    0.6000   -0.8982 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1129    0.4357   -1.0135 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4787    0.7058   -2.4569 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7807   -0.2204   -3.2382 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5437   -0.9777   -0.6910 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6656   -0.9081    0.1289 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4683   -1.7152    0.0797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5298   -2.2030   -0.8121 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8402   -0.7825    1.0675 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6724   -0.5253    2.1504 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2945    0.4047    0.3673 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9209    0.5690    0.4556 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0561    0.0535    0.1250 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2643    0.6511    0.4954 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4641    0.1018    0.1431 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6887    0.6946    0.5103 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4463   -1.0517   -0.5836 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2456   -1.6831   -0.9752 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3440   -2.8221   -1.6934 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0431   -1.1265   -0.6184 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3982   -2.5403   -1.4906 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7393    2.3024    1.5591 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8316    4.1800    2.7489 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6169    2.8975    1.9526 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8919    1.3147    0.9600 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6300    1.1837   -0.3905 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5585    0.5155   -2.6527 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1487    1.7102   -2.7771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8091   -0.0965   -3.1698 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7997   -1.5233   -1.6096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7028   -0.0618    0.6353 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8877   -2.5617    0.6612 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2192   -3.0899   -0.5035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9503   -1.3111    1.4891 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0988   -0.2762    2.9346 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0323   -0.4712   -0.1857 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2101    1.5646    1.0713 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1003    1.3736   -0.1234 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3999   -1.4843   -0.8610 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7151   -3.4303   -2.0735 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 12 25  2  0
  5 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34  2  1  0
 25  6  1  0
 34 27  1  0
 23 14  1  0
  4 35  1  0
  7 36  1  0
  9 37  1  0
 11 38  1  0
 14 39  1  0
 16 40  1  0
 17 41  1  0
 17 42  1  0
 18 43  1  0
 19 44  1  0
 20 45  1  0
 21 46  1  0
 22 47  1  0
 23 48  1  0
 24 49  1  0
 25 50  1  0
 28 51  1  0
 30 52  1  0
 31 53  1  0
 33 54  1  0
M  END

  Mrv0541 05061307452D          

 34 37  0  0  0  0            999 V2000
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  1  2  0  0  0  0
  6  2  1  0  0  0  0
  7  3  2  0  0  0  0
  7  4  1  0  0  0  0
  8  3  1  0  0  0  0
  9  1  1  0  0  0  0
 10  4  2  0  0  0  0
 11  2  2  0  0  0  0
 12  5  1  0  0  0  0
 13  8  2  0  0  0  0
 13 10  1  0  0  0  0
 14  9  2  0  0  0  0
 14 11  1  0  0  0  0
 15 12  1  0  0  0  0
 16 13  1  0  0  0  0
 17 15  1  0  0  0  0
 18 16  1  0  0  0  0
 19 17  1  0  0  0  0
 20  6  1  0  0  0  0
 20 18  2  0  0  0  0
 21 19  1  0  0  0  0
 22  5  1  0  0  0  0
 23  7  1  0  0  0  0
 24  8  1  0  0  0  0
 25  9  1  0  0  0  0
 26 14  1  0  0  0  0
 27 15  1  0  0  0  0
 28 16  2  0  0  0  0
 29 17  1  0  0  0  0
 30 18  1  0  0  0  0
 31 19  1  0  0  0  0
 32 10  1  0  0  0  0
 32 20  1  0  0  0  0
 33 11  1  0  0  0  0
 33 21  1  0  0  0  0
 34 12  1  0  0  0  0
 34 21  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0034359

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2=CC(=CC(O)=C2O)C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C21H20O13/c22-5-12-15(27)17(29)19(31)21(34-12)33-11-2-6(1-9(25)14(11)26)20-18(30)16(28)13-8(24)3-7(23)4-10(13)32-20/h1-4,12,15,17,19,21-27,29-31H,5H2

> <INCHI_KEY>
ZJYAVUPWMNHHEU-UHFFFAOYSA-N

> <FORMULA>
C21H20O13

> <MOLECULAR_WEIGHT>
480.3757

> <EXACT_MASS>
480.090390726

> <JCHEM_ACCEPTOR_COUNT>
13

> <JCHEM_AVERAGE_POLARIZABILITY>
44.70857099128679

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(3,4-dihydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-3,5,7-trihydroxy-4H-chromen-4-one

> <ALOGPS_LOGP>
0.44

> <JCHEM_LOGP>
-0.41533395100000037

> <ALOGPS_LOGS>
-2.33

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.468057620276266

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.441442029174809

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6483953659570156

> <JCHEM_POLAR_SURFACE_AREA>
226.82999999999996

> <JCHEM_REFRACTIVITY>
110.9875

> <JCHEM_ROTATABLE_BOND_COUNT>
4

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.23e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-3,5,7-trihydroxychromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0034359
     RDKit          3D
Myricetin 3'-glucoside
 54 57  0  0  0  0  0  0  0  0999 V2000
    3.7616   -2.7578   -1.6398 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8550   -1.7062   -0.9777 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465   -1.0969   -0.5876 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4591   -1.6950   -0.9584 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254    0.0506    0.1350 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5702    0.7719    0.5953 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7582    1.9373    1.3314 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7053    2.6778    1.8028 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8922    3.8485    2.5423 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6071    2.2834    1.5576 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6489    3.0389    2.0385 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8453    1.1337    0.8316 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0123    0.6189    0.5099 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3087    0.4992    0.4385 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7400    0.6000   -0.8982 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1129    0.4357   -1.0135 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4787    0.7058   -2.4569 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7807   -0.2204   -3.2382 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5437   -0.9777   -0.6910 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6656   -0.9081    0.1289 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4683   -1.7152    0.0797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5298   -2.2030   -0.8121 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8402   -0.7825    1.0675 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6724   -0.5253    2.1504 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2945    0.4047    0.3673 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9209    0.5690    0.4556 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0561    0.0535    0.1250 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2643    0.6511    0.4954 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4641    0.1018    0.1431 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6887    0.6946    0.5103 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4463   -1.0517   -0.5836 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2456   -1.6831   -0.9752 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3440   -2.8221   -1.6934 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0431   -1.1265   -0.6184 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3982   -2.5403   -1.4906 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7393    2.3024    1.5591 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8316    4.1800    2.7489 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6169    2.8975    1.9526 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8919    1.3147    0.9600 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6300    1.1837   -0.3905 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5585    0.5155   -2.6527 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1487    1.7102   -2.7771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8091   -0.0965   -3.1698 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7997   -1.5233   -1.6096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7028   -0.0618    0.6353 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8877   -2.5617    0.6612 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2192   -3.0899   -0.5035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9503   -1.3111    1.4891 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0988   -0.2762    2.9346 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0323   -0.4712   -0.1857 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2101    1.5646    1.0713 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1003    1.3736   -0.1234 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3999   -1.4843   -0.8610 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7151   -3.4303   -2.0735 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 12 25  2  0
  5 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34  2  1  0
 25  6  1  0
 34 27  1  0
 23 14  1  0
  4 35  1  0
  7 36  1  0
  9 37  1  0
 11 38  1  0
 14 39  1  0
 16 40  1  0
 17 41  1  0
 17 42  1  0
 18 43  1  0
 19 44  1  0
 20 45  1  0
 21 46  1  0
 22 47  1  0
 23 48  1  0
 24 49  1  0
 25 50  1  0
 28 51  1  0
 30 52  1  0
 31 53  1  0
 33 54  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      12.003   3.850   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      12.003   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      13.337   1.540   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      13.337   0.000   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      12.003  -0.770   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      10.669   0.000   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0      13.337   4.620   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      14.671   2.310   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      14.671  -0.770   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      12.003  -2.310   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      10.669   1.540   0.000  0.00  0.00           O+0
CONECT    1    6    9                                                       
CONECT    2    6   11                                                       
CONECT    3    7    8                                                       
CONECT    4    7   10                                                       
CONECT    5   12   22                                                       
CONECT    6    1    2   20                                                  
CONECT    7    3    4   23                                                  
CONECT    8    3   13   24                                                  
CONECT    9    1   14   25                                                  
CONECT   10    4   13   32                                                  
CONECT   11    2   14   33                                                  
CONECT   12    5   15   34                                                  
CONECT   13    8   10   16                                                  
CONECT   14    9   11   26                                                  
CONECT   15   12   17   27                                                  
CONECT   16   13   18   28                                                  
CONECT   17   15   19   29                                                  
CONECT   18   16   20   30                                                  
CONECT   19   17   21   31                                                  
CONECT   20    6   18   32                                                  
CONECT   21   19   33   34                                                  
CONECT   22    5                                                            
CONECT   23    7                                                            
CONECT   24    8                                                            
CONECT   25    9                                                            
CONECT   26   14                                                            
CONECT   27   15                                                            
CONECT   28   16                                                            
CONECT   29   17                                                            
CONECT   30   18                                                            
CONECT   31   19                                                            
CONECT   32   10   20                                                       
CONECT   33   11   21                                                       
CONECT   34   12   21                                                       
MASTER        0    0    0    0    0    0    0    0   34    0   74    0
END

COMPND    HMDB0034359
HETATM    1  O1  UNL     1       3.762  -2.758  -1.640  1.00  0.00           O  
HETATM    2  C1  UNL     1       3.855  -1.706  -0.978  1.00  0.00           C  
HETATM    3  C2  UNL     1       2.646  -1.097  -0.588  1.00  0.00           C  
HETATM    4  O2  UNL     1       1.459  -1.695  -0.958  1.00  0.00           O  
HETATM    5  C3  UNL     1       2.725   0.051   0.135  1.00  0.00           C  
HETATM    6  C4  UNL     1       1.570   0.772   0.595  1.00  0.00           C  
HETATM    7  C5  UNL     1       1.758   1.937   1.331  1.00  0.00           C  
HETATM    8  C6  UNL     1       0.705   2.678   1.803  1.00  0.00           C  
HETATM    9  O3  UNL     1       0.892   3.848   2.542  1.00  0.00           O  
HETATM   10  C7  UNL     1      -0.607   2.283   1.558  1.00  0.00           C  
HETATM   11  O4  UNL     1      -1.649   3.039   2.038  1.00  0.00           O  
HETATM   12  C8  UNL     1      -0.845   1.134   0.832  1.00  0.00           C  
HETATM   13  O5  UNL     1      -2.012   0.619   0.510  1.00  0.00           O  
HETATM   14  C9  UNL     1      -3.309   0.499   0.439  1.00  0.00           C  
HETATM   15  O6  UNL     1      -3.740   0.600  -0.898  1.00  0.00           O  
HETATM   16  C10 UNL     1      -5.113   0.436  -1.014  1.00  0.00           C  
HETATM   17  C11 UNL     1      -5.479   0.706  -2.457  1.00  0.00           C  
HETATM   18  O7  UNL     1      -4.781  -0.220  -3.238  1.00  0.00           O  
HETATM   19  C12 UNL     1      -5.544  -0.978  -0.691  1.00  0.00           C  
HETATM   20  O8  UNL     1      -6.666  -0.908   0.129  1.00  0.00           O  
HETATM   21  C13 UNL     1      -4.468  -1.715   0.080  1.00  0.00           C  
HETATM   22  O9  UNL     1      -3.530  -2.203  -0.812  1.00  0.00           O  
HETATM   23  C14 UNL     1      -3.840  -0.783   1.068  1.00  0.00           C  
HETATM   24  O10 UNL     1      -4.672  -0.525   2.150  1.00  0.00           O  
HETATM   25  C15 UNL     1       0.295   0.405   0.367  1.00  0.00           C  
HETATM   26  O11 UNL     1       3.921   0.569   0.456  1.00  0.00           O  
HETATM   27  C16 UNL     1       5.056   0.053   0.125  1.00  0.00           C  
HETATM   28  C17 UNL     1       6.264   0.651   0.495  1.00  0.00           C  
HETATM   29  C18 UNL     1       7.464   0.102   0.143  1.00  0.00           C  
HETATM   30  O12 UNL     1       8.689   0.695   0.510  1.00  0.00           O  
HETATM   31  C19 UNL     1       7.446  -1.052  -0.584  1.00  0.00           C  
HETATM   32  C20 UNL     1       6.246  -1.683  -0.975  1.00  0.00           C  
HETATM   33  O13 UNL     1       6.344  -2.822  -1.693  1.00  0.00           O  
HETATM   34  C21 UNL     1       5.043  -1.127  -0.618  1.00  0.00           C  
HETATM   35  H1  UNL     1       1.398  -2.540  -1.491  1.00  0.00           H  
HETATM   36  H2  UNL     1       2.739   2.302   1.559  1.00  0.00           H  
HETATM   37  H3  UNL     1       1.832   4.180   2.749  1.00  0.00           H  
HETATM   38  H4  UNL     1      -2.617   2.897   1.953  1.00  0.00           H  
HETATM   39  H5  UNL     1      -3.892   1.315   0.960  1.00  0.00           H  
HETATM   40  H6  UNL     1      -5.630   1.184  -0.391  1.00  0.00           H  
HETATM   41  H7  UNL     1      -6.558   0.515  -2.653  1.00  0.00           H  
HETATM   42  H8  UNL     1      -5.149   1.710  -2.777  1.00  0.00           H  
HETATM   43  H9  UNL     1      -3.809  -0.097  -3.170  1.00  0.00           H  
HETATM   44  H10 UNL     1      -5.800  -1.523  -1.610  1.00  0.00           H  
HETATM   45  H11 UNL     1      -6.703  -0.062   0.635  1.00  0.00           H  
HETATM   46  H12 UNL     1      -4.888  -2.562   0.661  1.00  0.00           H  
HETATM   47  H13 UNL     1      -3.219  -3.090  -0.504  1.00  0.00           H  
HETATM   48  H14 UNL     1      -2.950  -1.311   1.489  1.00  0.00           H  
HETATM   49  H15 UNL     1      -4.099  -0.276   2.935  1.00  0.00           H  
HETATM   50  H16 UNL     1       0.032  -0.471  -0.186  1.00  0.00           H  
HETATM   51  H17 UNL     1       6.210   1.565   1.071  1.00  0.00           H  
HETATM   52  H18 UNL     1       9.100   1.374  -0.123  1.00  0.00           H  
HETATM   53  H19 UNL     1       8.400  -1.484  -0.861  1.00  0.00           H  
HETATM   54  H20 UNL     1       5.715  -3.430  -2.073  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   34
CONECT    3    4    5    5
CONECT    4   35
CONECT    5    6   26
CONECT    6    7    7   25
CONECT    7    8   36
CONECT    8    9   10   10
CONECT    9   37
CONECT   10   11   12
CONECT   11   38
CONECT   12   13   25   25
CONECT   13   14
CONECT   14   15   23   39
CONECT   15   16
CONECT   16   17   19   40
CONECT   17   18   41   42
CONECT   18   43
CONECT   19   20   21   44
CONECT   20   45
CONECT   21   22   23   46
CONECT   22   47
CONECT   23   24   48
CONECT   24   49
CONECT   25   50
CONECT   26   27
CONECT   27   28   28   34
CONECT   28   29   51
CONECT   29   30   31   31
CONECT   30   52
CONECT   31   32   53
CONECT   32   33   34   34
CONECT   33   54
END

HMDB0034359
     RDKit          3D
Myricetin 3'-glucoside
 54 57  0  0  0  0  0  0  0  0999 V2000
    3.7616   -2.7578   -1.6398 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8550   -1.7062   -0.9777 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465   -1.0969   -0.5876 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4591   -1.6950   -0.9584 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254    0.0506    0.1350 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5702    0.7719    0.5953 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7582    1.9373    1.3314 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7053    2.6778    1.8028 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8922    3.8485    2.5423 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6071    2.2834    1.5576 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6489    3.0389    2.0385 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8453    1.1337    0.8316 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0123    0.6189    0.5099 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3087    0.4992    0.4385 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7400    0.6000   -0.8982 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1129    0.4357   -1.0135 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4787    0.7058   -2.4569 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7807   -0.2204   -3.2382 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5437   -0.9777   -0.6910 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6656   -0.9081    0.1289 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4683   -1.7152    0.0797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5298   -2.2030   -0.8121 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8402   -0.7825    1.0675 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6724   -0.5253    2.1504 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2945    0.4047    0.3673 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9209    0.5690    0.4556 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0561    0.0535    0.1250 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2643    0.6511    0.4954 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4641    0.1018    0.1431 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6887    0.6946    0.5103 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4463   -1.0517   -0.5836 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2456   -1.6831   -0.9752 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3440   -2.8221   -1.6934 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0431   -1.1265   -0.6184 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3982   -2.5403   -1.4906 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7393    2.3024    1.5591 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8316    4.1800    2.7489 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6169    2.8975    1.9526 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8919    1.3147    0.9600 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6300    1.1837   -0.3905 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5585    0.5155   -2.6527 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1487    1.7102   -2.7771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8091   -0.0965   -3.1698 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7997   -1.5233   -1.6096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7028   -0.0618    0.6353 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8877   -2.5617    0.6612 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2192   -3.0899   -0.5035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9503   -1.3111    1.4891 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0988   -0.2762    2.9346 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0323   -0.4712   -0.1857 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2101    1.5646    1.0713 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1003    1.3736   -0.1234 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3999   -1.4843   -0.8610 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7151   -3.4303   -2.0735 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 12 25  2  0
  5 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 34  2  1  0
 25  6  1  0
 34 27  1  0
 23 14  1  0
  4 35  1  0
  7 36  1  0
  9 37  1  0
 11 38  1  0
 14 39  1  0
 16 40  1  0
 17 41  1  0
 17 42  1  0
 18 43  1  0
 19 44  1  0
 20 45  1  0
 21 46  1  0
 22 47  1  0
 23 48  1  0
 24 49  1  0
 25 50  1  0
 28 51  1  0
 30 52  1  0
 31 53  1  0
 33 54  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
3'-(Glucopyranosyloxy)-3,4',5,5',7-pentahydroxy-flavone	HMDB
3'-(Glucopyranosyloxy)-3,4',5,5',7-pentahydroxyflavone	HMDB
Cannabiscitrin	HMDB

Chemical Formula

C₂₁H₂₀O₁₃

Average Molecular Weight

480.3757

Monoisotopic Molecular Weight

480.090390726

IUPAC Name

2-(3,4-dihydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-3,5,7-trihydroxy-4H-chromen-4-one

Traditional Name

2-(3,4-dihydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)-3,5,7-trihydroxychromen-4-one

CAS Registry Number

520-14-9

SMILES

OCC1OC(OC2=CC(=CC(O)=C2O)C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C21H20O13/c22-5-12-15(27)17(29)19(31)21(34-12)33-11-2-6(1-9(25)14(11)26)20-18(30)16(28)13-8(24)3-7(23)4-10(13)32-20/h1-4,12,15,17,19,21-27,29-31H,5H2

InChI Key

ZJYAVUPWMNHHEU-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid o-glycosides. Flavonoid O-glycosides are compounds containing a carbohydrate moiety which is O-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid O-glycosides

Alternative Parents

Substituents

Flavonoid o-glycoside
Flavonoid-3p-o-glycoside
3-hydroxyflavone
Hydroxyflavonoid
3'-hydroxyflavonoid
3-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Phenolic glycoside
Hexose monosaccharide
Chromone
Glycosyl compound
O-glycosyl compound
1-benzopyran
Benzopyran
Phenoxy compound
Phenol ether
Catechol
Pyranone
1-hydroxy-2-unsubstituted benzenoid
1-hydroxy-4-unsubstituted benzenoid
Phenol
Monocyclic benzene moiety
Benzenoid
Pyran
Oxane
Monosaccharide
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Organoheterocyclic compound
Acetal
Polyol
Oxacycle
Hydrocarbon derivative
Organic oxide
Organic oxygen compound
Alcohol
Primary alcohol
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0034359)
Cytoplasm (HMDB: HMDB0034359)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0034359)

Source

Exogenous

Exogenous (HMDB: HMDB0034359)

Food

Food (HMDB: HMDB0034359)

Tea

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0034359)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0034359)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	220 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	2.23 g/L	ALOGPS
logP	0.44	ALOGPS
logP	-0.42	ChemAxon
logS	-2.3	ALOGPS
pKa (Strongest Acidic)	6.44	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	13	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	226.83 Å²	ChemAxon
Rotatable Bond Count	4	ChemAxon
Refractivity	110.99 m³·mol⁻¹	ChemAxon
Polarizability	44.71 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	205.507	30932474
DeepCCS	[M-H]-	203.112	30932474
DeepCCS	[M-2H]-	235.995	30932474
DeepCCS	[M+Na]+	211.42	30932474
AllCCS	[M+H]+	207.3	32859911
AllCCS	[M+H-H2O]+	205.1	32859911
AllCCS	[M+NH4]+	209.3	32859911
AllCCS	[M+Na]+	209.9	32859911
AllCCS	[M-H]-	203.9	32859911
AllCCS	[M+Na-2H]-	204.4	32859911
AllCCS	[M+HCOO]-	205.2	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Myricetin 3'-glucoside	OCC1OC(OC2=CC(=CC(O)=C2O)C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C(O)C(O)C1O	6123.4	Standard polar	33892256
Myricetin 3'-glucoside	OCC1OC(OC2=CC(=CC(O)=C2O)C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C(O)C(O)C1O	4485.9	Standard non polar	33892256
Myricetin 3'-glucoside	OCC1OC(OC2=CC(=CC(O)=C2O)C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C(O)C(O)C1O	4661.4	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Myricetin 3'-glucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4673.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #2	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	4701.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #3	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4629.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #4	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4617.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O)=C1)O2	4684.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4764.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #7	C[Si](C)(C)OC1C(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)OC(CO)C(O)C1O	4703.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #8	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C1O	4699.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TMS,isomer #9	C[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C1O	4693.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4609.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #10	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	4589.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #11	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	4532.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O	4571.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O	4564.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #14	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O	4586.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #15	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C	4511.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4549.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #17	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4512.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #18	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4467.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #19	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4489.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4562.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #20	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4482.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #21	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4509.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #22	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4510.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #23	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4498.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #24	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	4523.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #25	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4562.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #26	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4521.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #27	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4579.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #28	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C1)O2	4557.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #29	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C1)O2	4538.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4519.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #30	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C1)O2	4571.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4591.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4577.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4608.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #34	C[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C1O	4561.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #35	C[Si](C)(C)OC1C(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)OC(CO)C(O)C1O[Si](C)(C)C	4586.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #36	C[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C1O[Si](C)(C)C	4563.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4577.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4506.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4572.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4564.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4559.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TMS,isomer #9	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4622.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4408.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4364.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4446.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4394.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4429.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4379.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4327.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4423.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4375.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4407.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4382.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4398.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4472.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4420.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4451.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4409.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4367.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4391.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4491.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4486.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4470.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #29	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4428.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4456.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #30	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4407.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #31	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4457.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4428.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4473.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #34	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4428.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #35	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	4386.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #36	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O	4415.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #37	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O	4386.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O	4431.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C	4393.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4401.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #40	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O	4376.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #41	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O	4354.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #42	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O	4389.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #43	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C	4354.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #44	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O	4439.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #45	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O	4445.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #46	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O[Si](C)(C)C	4385.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #47	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4480.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #48	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4372.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #49	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4406.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4482.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4367.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4357.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4405.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4376.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4420.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #55	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4338.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #56	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4362.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #57	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4328.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #58	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4373.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #59	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4330.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4433.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #60	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4303.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #61	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4338.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #62	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4382.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #63	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4382.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #64	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4416.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #65	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4379.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #66	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	4397.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #67	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4399.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #68	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4371.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #69	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	4412.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4463.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4367.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #71	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4339.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #72	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4408.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #73	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4378.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4384.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4410.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4370.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4425.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C1)O2	4419.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C1)O2	4421.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4371.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #80	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C1)O2	4455.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #81	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4455.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #82	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4456.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #83	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4492.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #84	C[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4508.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4417.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4257.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4272.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #100	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4305.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #101	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4313.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #102	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4215.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #103	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4169.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #104	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4232.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #105	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4247.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #106	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4260.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #107	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4267.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #108	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4238.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #109	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4254.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4324.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #110	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4258.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #111	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4338.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #112	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	4324.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #113	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4291.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #114	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4262.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #115	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4311.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #116	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4277.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #117	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4270.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #118	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4312.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #119	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4278.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4307.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #120	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4213.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #121	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4277.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4282.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4297.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4304.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C1)O2	4357.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #126	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4396.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4362.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4286.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4347.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4337.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4264.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4323.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4393.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4278.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4406.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4373.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4241.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4205.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4303.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4247.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4296.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4262.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4328.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4255.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4236.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4313.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4296.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4227.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4284.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4363.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4377.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4344.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4255.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4311.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4259.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4338.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4299.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4280.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4233.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4272.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4343.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4377.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4324.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4334.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4290.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4325.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4260.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4374.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4389.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4357.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4349.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4360.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4333.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4458.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #57	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4248.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #58	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4275.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #59	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4226.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4322.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #60	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4276.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #61	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4284.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #62	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4277.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #63	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4219.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #64	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4288.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #65	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4282.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #66	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4308.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #67	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4327.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #68	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4317.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4335.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4275.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4274.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #71	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4334.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #72	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O	4245.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #73	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O	4194.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #74	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O	4257.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #75	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C	4249.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #76	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O	4272.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #77	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O	4290.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #78	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O[Si](C)(C)C	4273.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #79	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4293.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4240.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #80	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4230.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #81	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4293.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #82	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O	4265.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #83	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O	4285.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #84	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O[Si](C)(C)C	4278.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #85	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4285.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #86	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4240.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #87	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4286.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #88	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4371.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #89	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4303.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4335.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #90	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4317.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #91	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4324.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4210.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4246.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4208.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4249.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4248.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4196.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #98	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4265.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4290.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O	4139.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4200.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #100	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4222.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #101	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4235.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #102	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4202.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #103	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4228.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #104	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4217.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #105	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4289.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #106	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)OC2=C1	4150.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #107	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4118.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #108	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4154.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #109	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4176.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4156.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #110	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4195.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #111	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4193.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #112	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4170.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #113	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4193.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #114	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4188.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #115	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4256.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #116	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4137.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #117	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4160.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #118	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4154.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #119	C[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4220.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4185.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #120	C[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4219.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #121	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4252.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #122	C[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)OC2=CC(O)=CC(O[Si](C)(C)C)=C2C1=O	4224.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #123	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)OC2=C1	4163.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #124	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)OC2=C1	4190.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #125	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4188.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #126	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)OC2=C1	4255.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4253.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4270.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4234.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4198.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4229.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4164.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4205.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O	4114.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4209.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4142.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4188.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4258.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4281.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4237.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4282.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4209.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4260.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4269.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O	4217.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4277.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4251.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4254.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4262.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4238.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4356.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4153.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4201.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4134.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4180.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O	4144.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4177.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4107.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4157.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4236.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4261.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4215.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4240.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4165.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4218.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4239.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C	4193.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4253.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4220.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4220.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4235.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4206.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4331.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4238.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4180.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4223.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4251.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O)C1O	4179.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4270.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4234.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4231.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4252.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4214.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4333.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4293.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4305.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4284.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4346.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O[Si](C)(C)C)C(O)C1O	4225.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4329.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #71	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4171.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #72	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4144.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #73	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4177.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #74	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4175.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #75	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4194.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #76	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4213.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #77	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4226.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #78	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4214.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #79	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4186.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O[Si](C)(C)C)C1O	4178.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #80	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4231.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #81	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4181.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #82	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4203.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #83	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4216.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #84	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4201.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #85	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4172.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #86	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4235.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #87	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4266.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #88	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4242.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #89	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4263.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C4O3)=CC(O[Si](C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C	4206.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #90	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	4264.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #91	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O	4152.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #92	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O	4178.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #93	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1O[Si](C)(C)C	4177.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #94	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4172.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #95	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4131.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #96	C[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4191.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #97	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1O	4236.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #98	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1O[Si](C)(C)C	4202.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,5TMS,isomer #99	C[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1O[Si](C)(C)C	4223.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4906.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	4942.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4898.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4900.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O)=C1)O2	4914.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	4954.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)OC(CO)C(O)C1O	4977.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C1O	4969.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C1O	4973.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	5047.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	5010.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	4997.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=C1O	5021.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=C1O	5010.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=C1O	5029.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C(C)(C)C	4987.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	5022.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4978.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	4970.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4979.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	5006.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4971.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4987.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4977.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4964.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	4987.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	5007.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O	4970.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	5023.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C1)O2	4992.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C1)O2	4977.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	4995.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C1)O2	4996.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3)OC2=C1	5035.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)OC2=C1	5022.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5038.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5045.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5062.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5028.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O)C(O)C1O	5034.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4997.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5035.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5022.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5013.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5050.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	5087.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5044.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5070.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5058.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5050.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O)C(O)C1O	5044.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5023.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5027.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5019.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5013.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5062.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	5053.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5084.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5082.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5067.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5061.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5058.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5043.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5086.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5086.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5068.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5130.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O)C(O)C1O	5113.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5078.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5106.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5097.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5106.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(OC4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5118.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O	5047.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=C1O	5059.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=C1O	5048.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=C1O	5062.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C(C)(C)C	5074.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5089.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=C1O	5014.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=C1O	5001.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=C1O	5021.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1O[Si](C)(C)C(C)(C)C	5038.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)=C1O	5042.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)=C1O	5062.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=C1O[Si](C)(C)C(C)(C)C	5044.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)=C1O	5065.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=C1O[Si](C)(C)C(C)(C)C	5035.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1=CC(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C	5051.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5106.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	5106.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	5063.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3)OC2=C1	5083.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)OC2=C1	5077.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5085.0	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O	5035.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5034.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5024.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5037.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5003.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5100.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4988.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5008.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5024.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #63	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5043.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #64	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=C(O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5047.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #65	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C2)OC2=CC(O)=CC(O)=C2C1=O	4982.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #66	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	5004.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #67	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3)OC2=C1	5038.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #68	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O	5005.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #69	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C2)OC2=CC(O)=CC(O)=C2C1=O	5001.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5087.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #70	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)OC2=C1	5023.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #71	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C2)OC2=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O	4991.5	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #72	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5042.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #73	CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=C(O)C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C2)OC2=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O	5008.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #74	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O)=C3)OC2=C1	5059.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #75	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3)OC2=C1	5083.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #76	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)OC2=C1	5070.2	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #77	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5080.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #78	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C1)O2	5026.9	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #79	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C1)O2	5046.8	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O[Si](C)(C)C(C)(C)C)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O)=C2O)C(O)C(O)C1O	5019.3	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #80	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(O)=C(C1=CC(O)=C(O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C1)O2	5049.1	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #81	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)OC2=C1	5070.4	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #82	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5090.6	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #83	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(O)=C(C3=CC(O)=C(O)C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	5092.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #84	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(C3=C(O)C(=O)C4=C(O)C=C(O)C=C4O3)=CC(O)=C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5055.7	Semi standard non polar	33892256
Myricetin 3'-glucoside,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(C3=C(O)C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C4O3)=CC(O[Si](C)(C)C(C)(C)C)=C2O)C(O)C(O)C1O	5074.3	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Myricetin 3'-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-03xr-7804900000-2a0e1210c03a612b4a53	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Myricetin 3'-glucoside GC-MS (3 TMS) - 70eV, Positive	splash10-001r-3620009000-8db5f8a0261640ab1a63	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Myricetin 3'-glucoside GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 10V, Positive-QTOF	splash10-0159-0109600000-d26c3a64b2fdb00b007d	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 20V, Positive-QTOF	splash10-014i-0109100000-2746030ca4838f30f770	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 40V, Positive-QTOF	splash10-0ufr-1924000000-0150638255925d573913	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 10V, Negative-QTOF	splash10-00or-1305900000-4a377d34e207873e7510	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 20V, Negative-QTOF	splash10-014i-1239300000-d0de57d0d9dbc2aaa1d3	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 40V, Negative-QTOF	splash10-014i-5955000000-e0835ee648e2c8b73abd	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 10V, Negative-QTOF	splash10-004i-0000900000-19766d9990e1a346369a	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 20V, Negative-QTOF	splash10-004i-0520900000-7c047cacf584cf45bc39	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 40V, Negative-QTOF	splash10-0fy9-1920300000-06db84176497e08e1f1a	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 10V, Positive-QTOF	splash10-001i-0000900000-07288a61fb99106c421e	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 20V, Positive-QTOF	splash10-001i-0000900000-9738d877abcec2c99533	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Myricetin 3'-glucoside 40V, Positive-QTOF	splash10-0uyi-2900300000-26d6edacf42f20aee0f0	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB012725

KNApSAcK ID

C00005734

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

12302392

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Myricetin 3'-glucoside (HMDB0034359)

MOL for HMDB0034359 (Myricetin 3'-glucoside)

3D MOL for HMDB0034359 (Myricetin 3'-glucoside)

3D SDF for HMDB0034359 (Myricetin 3'-glucoside)

3D-SDF for HMDB0034359 (Myricetin 3'-glucoside)

PDB for HMDB0034359 (Myricetin 3'-glucoside)

3D PDB for HMDB0034359 (Myricetin 3'-glucoside)

SMILES for HMDB0034359 (Myricetin 3'-glucoside)

INCHI for HMDB0034359 (Myricetin 3'-glucoside)

Structure for HMDB0034359 (Myricetin 3'-glucoside)

3D Structure for HMDB0034359 (Myricetin 3'-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra