Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 19:15:05 UTC

Update Date

2022-03-07 02:54:05 UTC

HMDB ID

HMDB0034410

Secondary Accession Numbers

HMDB34410

Metabolite Identification

Common Name

Mangiferin

Description

Mangiferin belongs to the class of organic compounds known as xanthones. These are polycyclic aromatic compounds containing a xanthene moiety conjugated to a ketone group at carbon 9. Xanthene is a tricyclic compound made up of two benzene rings linearly fused to each other through a pyran ring. Mangiferin has been detected, but not quantified in, fruits and mangos (Mangifera indica). This could make mangiferin a potential biomarker for the consumption of these foods. Based on a literature review a small amount of articles have been published on Mangiferin.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061307482D          

 30 33  0  0  0  0            999 V2000
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0  0  0  0
  6  1  2  0  0  0  0
  7  2  2  0  0  0  0
  7  6  1  0  0  0  0
  8  3  2  0  0  0  0
  9  2  1  0  0  0  0
  9  5  2  0  0  0  0
 10  3  1  0  0  0  0
 11  4  1  0  0  0  0
 12  8  1  0  0  0  0
 13 10  2  0  0  0  0
 14  5  1  0  0  0  0
 14 13  1  0  0  0  0
 15 11  1  0  0  0  0
 16 12  2  0  0  0  0
 16 13  1  0  0  0  0
 17 15  1  0  0  0  0
 18 17  1  0  0  0  0
 19 12  1  0  0  0  0
 19 18  1  0  0  0  0
 20  4  1  0  0  0  0
 21  6  1  0  0  0  0
 22  7  1  0  0  0  0
 23  8  1  0  0  0  0
 24 14  2  0  0  0  0
 25 15  1  0  0  0  0
 26 16  1  0  0  0  0
 27 17  1  0  0  0  0
 28 18  1  0  0  0  0
 29  9  1  0  0  0  0
 29 10  1  0  0  0  0
 30 11  1  0  0  0  0
 30 19  1  0  0  0  0
M  END

HMDB0034410
     RDKit          3D
Mangiferin
 48 51  0  0  0  0  0  0  0  0999 V2000
    2.8724    1.6395    0.6500 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8715    0.4850    0.1665 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0882   -0.1366   -0.0946 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2874    0.4840    0.1679 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5207   -0.1286   -0.0868 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6863    0.5483    0.2016 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5549   -1.3912   -0.6172 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7426   -2.0598   -0.8938 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3400   -2.0242   -0.8857 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1224   -1.4010   -0.6244 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9702   -1.9886   -0.8678 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8098   -1.4238   -0.6291 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6398   -2.1123   -0.9105 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5852   -1.5579   -0.6764 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7576   -2.2886   -0.9737 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7169   -0.2448   -0.1309 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0549    0.1794    0.1410 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0323   -0.5734   -0.5593 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2217   -0.5661    0.1606 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4543   -0.5185   -0.7334 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4659   -1.6524   -1.5503 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3211    0.4113    1.2625 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7028    0.7345    1.3913 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.7054    1.1263 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9886    2.0174    2.3353 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4884    1.5704    0.1004 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6185    2.6012    0.1619 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4387    0.4475    0.1563 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3710    1.7023    0.6904 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6647   -0.1517   -0.0978 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2101    1.4828    0.5858 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5979    0.1962    0.0587 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6421   -1.6505   -0.7117 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3693   -3.0272   -1.3044 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -3.1269   -1.3268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6538   -3.1961   -1.3538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2629   -0.2112    1.2460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2768   -1.6049    0.6207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3832   -0.5825   -0.1013 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5290    0.4283   -1.2901 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6328   -1.7296   -2.0964 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0961   -0.1111    2.2418 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8831    1.6542    1.0771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2567    2.5817    0.8800 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3800    1.2786    2.6537 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9898    1.7056   -0.9474 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0785    3.4412    0.3844 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9361    2.3929    1.0031 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 16 28  1  0
 28 29  1  0
 28 30  2  0
 30  2  1  0
 10  3  1  0
 30 12  1  0
 26 17  1  0
  4 31  1  0
  6 32  1  0
  8 33  1  0
  9 34  1  0
 13 35  1  0
 15 36  1  0
 17 37  1  0
 19 38  1  0
 20 39  1  0
 20 40  1  0
 21 41  1  0
 22 42  1  0
 23 43  1  0
 24 44  1  0
 25 45  1  0
 26 46  1  0
 27 47  1  0
 29 48  1  0
M  END

  Mrv0541 05061307482D          

 30 33  0  0  0  0            999 V2000
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0  0  0  0
  6  1  2  0  0  0  0
  7  2  2  0  0  0  0
  7  6  1  0  0  0  0
  8  3  2  0  0  0  0
  9  2  1  0  0  0  0
  9  5  2  0  0  0  0
 10  3  1  0  0  0  0
 11  4  1  0  0  0  0
 12  8  1  0  0  0  0
 13 10  2  0  0  0  0
 14  5  1  0  0  0  0
 14 13  1  0  0  0  0
 15 11  1  0  0  0  0
 16 12  2  0  0  0  0
 16 13  1  0  0  0  0
 17 15  1  0  0  0  0
 18 17  1  0  0  0  0
 19 12  1  0  0  0  0
 19 18  1  0  0  0  0
 20  4  1  0  0  0  0
 21  6  1  0  0  0  0
 22  7  1  0  0  0  0
 23  8  1  0  0  0  0
 24 14  2  0  0  0  0
 25 15  1  0  0  0  0
 26 16  1  0  0  0  0
 27 17  1  0  0  0  0
 28 18  1  0  0  0  0
 29  9  1  0  0  0  0
 29 10  1  0  0  0  0
 30 11  1  0  0  0  0
 30 19  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0034410

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC3=C(C=C(O)C(O)=C3)C2=O)C=C1O

> <INCHI_IDENTIFIER>
InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2

> <INCHI_KEY>
AEDDIBAIWPIIBD-UHFFFAOYSA-N

> <FORMULA>
C19H18O11

> <MOLECULAR_WEIGHT>
422.3396

> <EXACT_MASS>
422.084911418

> <JCHEM_ACCEPTOR_COUNT>
10

> <JCHEM_AVERAGE_POLARIZABILITY>
40.0030531428138

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
1

> <JCHEM_IUPAC>
1,3,6,7-tetrahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-9H-xanthen-9-one

> <ALOGPS_LOGP>
-0.09

> <JCHEM_LOGP>
-0.3619419713333333

> <ALOGPS_LOGS>
-1.92

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
7.705292920734624

> <JCHEM_PKA_STRONGEST_ACIDIC>
7.0200909635825255

> <JCHEM_PKA_STRONGEST_BASIC>
-2.979192626943851

> <JCHEM_POLAR_SURFACE_AREA>
197.36999999999998

> <JCHEM_REFRACTIVITY>
97.8582

> <JCHEM_ROTATABLE_BOND_COUNT>
2

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
5.02e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
mangiferin

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0034410
     RDKit          3D
Mangiferin
 48 51  0  0  0  0  0  0  0  0999 V2000
    2.8724    1.6395    0.6500 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8715    0.4850    0.1665 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0882   -0.1366   -0.0946 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2874    0.4840    0.1679 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5207   -0.1286   -0.0868 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6863    0.5483    0.2016 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5549   -1.3912   -0.6172 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7426   -2.0598   -0.8938 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3400   -2.0242   -0.8857 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1224   -1.4010   -0.6244 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9702   -1.9886   -0.8678 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8098   -1.4238   -0.6291 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6398   -2.1123   -0.9105 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5852   -1.5579   -0.6764 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7576   -2.2886   -0.9737 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7169   -0.2448   -0.1309 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0549    0.1794    0.1410 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0323   -0.5734   -0.5593 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2217   -0.5661    0.1606 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4543   -0.5185   -0.7334 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4659   -1.6524   -1.5503 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3211    0.4113    1.2625 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7028    0.7345    1.3913 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.7054    1.1263 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9886    2.0174    2.3353 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4884    1.5704    0.1004 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6185    2.6012    0.1619 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4387    0.4475    0.1563 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3710    1.7023    0.6904 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6647   -0.1517   -0.0978 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2101    1.4828    0.5858 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5979    0.1962    0.0587 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6421   -1.6505   -0.7117 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3693   -3.0272   -1.3044 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -3.1269   -1.3268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6538   -3.1961   -1.3538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2629   -0.2112    1.2460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2768   -1.6049    0.6207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3832   -0.5825   -0.1013 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5290    0.4283   -1.2901 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6328   -1.7296   -2.0964 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0961   -0.1111    2.2418 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8831    1.6542    1.0771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2567    2.5817    0.8800 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3800    1.2786    2.6537 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9898    1.7056   -0.9474 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0785    3.4412    0.3844 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9361    2.3929    1.0031 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 16 28  1  0
 28 29  1  0
 28 30  2  0
 30  2  1  0
 10  3  1  0
 30 12  1  0
 26 17  1  0
  4 31  1  0
  6 32  1  0
  8 33  1  0
  9 34  1  0
 13 35  1  0
 15 36  1  0
 17 37  1  0
 19 38  1  0
 20 39  1  0
 20 40  1  0
 21 41  1  0
 22 42  1  0
 23 43  1  0
 24 44  1  0
 25 45  1  0
 26 46  1  0
 27 47  1  0
 29 48  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       9.336   2.310   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       6.668   3.850   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0      -5.335   1.540   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0      10.669   1.540   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0      10.669   4.620   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       0.000   4.620   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       5.335   0.000   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0      -4.001  -0.770   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      -1.334  -2.310   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       1.334  -0.770   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       5.335   4.620   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -1.334   2.310   0.000  0.00  0.00           O+0
CONECT    1    5    6                                                       
CONECT    2    7    9                                                       
CONECT    3    8   10                                                       
CONECT    4   11   20                                                       
CONECT    5    1    9   14                                                  
CONECT    6    1    7   21                                                  
CONECT    7    2    6   22                                                  
CONECT    8    3   12   23                                                  
CONECT    9    2    5   29                                                  
CONECT   10    3   13   29                                                  
CONECT   11    4   15   30                                                  
CONECT   12    8   16   19                                                  
CONECT   13   10   14   16                                                  
CONECT   14    5   13   24                                                  
CONECT   15   11   17   25                                                  
CONECT   16   12   13   26                                                  
CONECT   17   15   18   27                                                  
CONECT   18   17   19   28                                                  
CONECT   19   12   18   30                                                  
CONECT   20    4                                                            
CONECT   21    6                                                            
CONECT   22    7                                                            
CONECT   23    8                                                            
CONECT   24   14                                                            
CONECT   25   15                                                            
CONECT   26   16                                                            
CONECT   27   17                                                            
CONECT   28   18                                                            
CONECT   29    9   10                                                       
CONECT   30   11   19                                                       
MASTER        0    0    0    0    0    0    0    0   30    0   66    0
END

COMPND    HMDB0034410
HETATM    1  O1  UNL     1       2.872   1.639   0.650  1.00  0.00           O  
HETATM    2  C1  UNL     1       2.871   0.485   0.167  1.00  0.00           C  
HETATM    3  C2  UNL     1       4.088  -0.137  -0.095  1.00  0.00           C  
HETATM    4  C3  UNL     1       5.287   0.484   0.168  1.00  0.00           C  
HETATM    5  C4  UNL     1       6.521  -0.129  -0.087  1.00  0.00           C  
HETATM    6  O2  UNL     1       7.686   0.548   0.202  1.00  0.00           O  
HETATM    7  C5  UNL     1       6.555  -1.391  -0.617  1.00  0.00           C  
HETATM    8  O3  UNL     1       7.743  -2.060  -0.894  1.00  0.00           O  
HETATM    9  C6  UNL     1       5.340  -2.024  -0.886  1.00  0.00           C  
HETATM   10  C7  UNL     1       4.122  -1.401  -0.624  1.00  0.00           C  
HETATM   11  O4  UNL     1       2.970  -1.989  -0.868  1.00  0.00           O  
HETATM   12  C8  UNL     1       1.810  -1.424  -0.629  1.00  0.00           C  
HETATM   13  C9  UNL     1       0.640  -2.112  -0.911  1.00  0.00           C  
HETATM   14  C10 UNL     1      -0.585  -1.558  -0.676  1.00  0.00           C  
HETATM   15  O5  UNL     1      -1.758  -2.289  -0.974  1.00  0.00           O  
HETATM   16  C11 UNL     1      -0.717  -0.245  -0.131  1.00  0.00           C  
HETATM   17  C12 UNL     1      -2.055   0.179   0.141  1.00  0.00           C  
HETATM   18  O6  UNL     1      -3.032  -0.573  -0.559  1.00  0.00           O  
HETATM   19  C13 UNL     1      -4.222  -0.566   0.161  1.00  0.00           C  
HETATM   20  C14 UNL     1      -5.454  -0.518  -0.733  1.00  0.00           C  
HETATM   21  O7  UNL     1      -5.466  -1.652  -1.550  1.00  0.00           O  
HETATM   22  C15 UNL     1      -4.321   0.411   1.262  1.00  0.00           C  
HETATM   23  O8  UNL     1      -5.703   0.735   1.391  1.00  0.00           O  
HETATM   24  C16 UNL     1      -3.619   1.705   1.126  1.00  0.00           C  
HETATM   25  O9  UNL     1      -2.989   2.017   2.335  1.00  0.00           O  
HETATM   26  C17 UNL     1      -2.488   1.570   0.100  1.00  0.00           C  
HETATM   27  O10 UNL     1      -1.619   2.601   0.162  1.00  0.00           O  
HETATM   28  C18 UNL     1       0.439   0.447   0.156  1.00  0.00           C  
HETATM   29  O11 UNL     1       0.371   1.702   0.690  1.00  0.00           O  
HETATM   30  C19 UNL     1       1.665  -0.152  -0.098  1.00  0.00           C  
HETATM   31  H1  UNL     1       5.210   1.483   0.586  1.00  0.00           H  
HETATM   32  H2  UNL     1       8.598   0.196   0.059  1.00  0.00           H  
HETATM   33  H3  UNL     1       8.642  -1.651  -0.712  1.00  0.00           H  
HETATM   34  H4  UNL     1       5.369  -3.027  -1.304  1.00  0.00           H  
HETATM   35  H5  UNL     1       0.713  -3.127  -1.327  1.00  0.00           H  
HETATM   36  H6  UNL     1      -1.654  -3.196  -1.354  1.00  0.00           H  
HETATM   37  H7  UNL     1      -2.263  -0.211   1.246  1.00  0.00           H  
HETATM   38  H8  UNL     1      -4.277  -1.605   0.621  1.00  0.00           H  
HETATM   39  H9  UNL     1      -6.383  -0.583  -0.101  1.00  0.00           H  
HETATM   40  H10 UNL     1      -5.529   0.428  -1.290  1.00  0.00           H  
HETATM   41  H11 UNL     1      -4.633  -1.730  -2.096  1.00  0.00           H  
HETATM   42  H12 UNL     1      -4.096  -0.111   2.242  1.00  0.00           H  
HETATM   43  H13 UNL     1      -5.883   1.654   1.077  1.00  0.00           H  
HETATM   44  H14 UNL     1      -4.257   2.582   0.880  1.00  0.00           H  
HETATM   45  H15 UNL     1      -2.380   1.279   2.654  1.00  0.00           H  
HETATM   46  H16 UNL     1      -2.990   1.706  -0.947  1.00  0.00           H  
HETATM   47  H17 UNL     1      -2.078   3.441   0.384  1.00  0.00           H  
HETATM   48  H18 UNL     1       0.936   2.393   1.003  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   30
CONECT    3    4    4   10
CONECT    4    5   31
CONECT    5    6    7    7
CONECT    6   32
CONECT    7    8    9
CONECT    8   33
CONECT    9   10   10   34
CONECT   10   11
CONECT   11   12
CONECT   12   13   13   30
CONECT   13   14   35
CONECT   14   15   16   16
CONECT   15   36
CONECT   16   17   28
CONECT   17   18   26   37
CONECT   18   19
CONECT   19   20   22   38
CONECT   20   21   39   40
CONECT   21   41
CONECT   22   23   24   42
CONECT   23   43
CONECT   24   25   26   44
CONECT   25   45
CONECT   26   27   46
CONECT   27   47
CONECT   28   29   30   30
CONECT   29   48
END

HMDB0034410
     RDKit          3D
Mangiferin
 48 51  0  0  0  0  0  0  0  0999 V2000
    2.8724    1.6395    0.6500 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8715    0.4850    0.1665 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0882   -0.1366   -0.0946 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2874    0.4840    0.1679 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5207   -0.1286   -0.0868 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6863    0.5483    0.2016 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5549   -1.3912   -0.6172 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7426   -2.0598   -0.8938 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3400   -2.0242   -0.8857 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1224   -1.4010   -0.6244 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9702   -1.9886   -0.8678 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8098   -1.4238   -0.6291 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6398   -2.1123   -0.9105 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5852   -1.5579   -0.6764 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7576   -2.2886   -0.9737 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7169   -0.2448   -0.1309 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0549    0.1794    0.1410 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0323   -0.5734   -0.5593 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2217   -0.5661    0.1606 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4543   -0.5185   -0.7334 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4659   -1.6524   -1.5503 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3211    0.4113    1.2625 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7028    0.7345    1.3913 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.7054    1.1263 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9886    2.0174    2.3353 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4884    1.5704    0.1004 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6185    2.6012    0.1619 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4387    0.4475    0.1563 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3710    1.7023    0.6904 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6647   -0.1517   -0.0978 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2101    1.4828    0.5858 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5979    0.1962    0.0587 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6421   -1.6505   -0.7117 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3693   -3.0272   -1.3044 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -3.1269   -1.3268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6538   -3.1961   -1.3538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2629   -0.2112    1.2460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2768   -1.6049    0.6207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3832   -0.5825   -0.1013 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5290    0.4283   -1.2901 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6328   -1.7296   -2.0964 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0961   -0.1111    2.2418 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8831    1.6542    1.0771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2567    2.5817    0.8800 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3800    1.2786    2.6537 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9898    1.7056   -0.9474 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0785    3.4412    0.3844 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9361    2.3929    1.0031 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 16 28  1  0
 28 29  1  0
 28 30  2  0
 30  2  1  0
 10  3  1  0
 30 12  1  0
 26 17  1  0
  4 31  1  0
  6 32  1  0
  8 33  1  0
  9 34  1  0
 13 35  1  0
 15 36  1  0
 17 37  1  0
 19 38  1  0
 20 39  1  0
 20 40  1  0
 21 41  1  0
 22 42  1  0
 23 43  1  0
 24 44  1  0
 25 45  1  0
 26 46  1  0
 27 47  1  0
 29 48  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
1,3,6,7-Tetrahydroxyxanthone C2-beta-D-glucoside	HMDB
2-b-D-Glucopyranosyl-1,3,6,7-tetrahydroxy-9H-xanthen-9-one, 9ci	HMDB
Alpizarin	HMDB
Alpizarine	HMDB
Aphloiol	HMDB
Chedisaride	HMDB
Chinoinin	HMDB
Chinomin	HMDB
Chinomine	HMDB
Euxanthogen	HMDB
Hedysarid	HMDB
Hedysaride	HMDB
Mangiferin from mangifera indica bark	HMDB
Mannipherin	HMDB

Chemical Formula

C₁₉H₁₈O₁₁

Average Molecular Weight

422.3396

Monoisotopic Molecular Weight

422.084911418

IUPAC Name

1,3,6,7-tetrahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-9H-xanthen-9-one

Traditional Name

mangiferin

CAS Registry Number

4773-96-0

SMILES

OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC3=C(C=C(O)C(O)=C3)C2=O)C=C1O

InChI Identifier

InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2

InChI Key

AEDDIBAIWPIIBD-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as xanthones. These are polycyclic aromatic compounds containing a xanthene moiety conjugated to a ketone group at carbon 9. Xanthene is a tricyclic compound made up of two benzene rings linearly fused to each other through a pyran ring.

Kingdom

Organic compounds

Super Class

Organoheterocyclic compounds

Class

Benzopyrans

Sub Class

1-benzopyrans

Direct Parent

Xanthones

Alternative Parents

Substituents

Phenolic glycoside
Xanthone
Hexose monosaccharide
C-glycosyl compound
Chromone
Glycosyl compound
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Pyranone
Benzenoid
Pyran
Oxane
Monosaccharide
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Oxacycle
Polyol
Dialkyl ether
Ether
Hydrocarbon derivative
Organic oxygen compound
Organic oxide
Organooxygen compound
Primary alcohol
Alcohol
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0034410)
Cytoplasm (HMDB: HMDB0034410)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0034410)

Source

Exogenous

Exogenous (HMDB: HMDB0034410)

Food

Food (HMDB: HMDB0034410)

Fruit

Tropical fruit

Mango (FooDB: FOOD00106)

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0034410)

Process

Not Available

Role

Biological role

Pro-oxidant (HMDB: HMDB0034410)

Industrial application

Pharmaceutical industry

Antimicrobial agent

Antiviral

Antiviral (HMDB: HMDB0034410)

Antidiabetic (HMDB: HMDB0034410)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	278 - 280 °C	Not Available
Boiling Point	842.70 °C. @ 760.00 mm Hg (est)	The Good Scents Company Information System
Water Solubility	467.8 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	0.130 (est)	The Good Scents Company Information System

Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct Type	Data Source	CCS Value (Å²)	Reference
[M-H]-	Baker	195.814	30932474
[M+H]+	Baker	196.618	30932474

Predicted Molecular Properties

Property	Value	Source
Water Solubility	5.02 g/L	ALOGPS
logP	-0.09	ALOGPS
logP	-0.36	ChemAxon
logS	-1.9	ALOGPS
pKa (Strongest Acidic)	7.02	ChemAxon
pKa (Strongest Basic)	-3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	10	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	197.37 Å²	ChemAxon
Rotatable Bond Count	2	ChemAxon
Refractivity	97.86 m³·mol⁻¹	ChemAxon
Polarizability	40 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	Yes	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	190.46	30932474
DeepCCS	[M-H]-	188.089	30932474
DeepCCS	[M-2H]-	221.505	30932474
DeepCCS	[M+Na]+	196.688	30932474
AllCCS	[M+H]+	198.3	32859911
AllCCS	[M+H-H2O]+	195.6	32859911
AllCCS	[M+NH4]+	200.7	32859911
AllCCS	[M+Na]+	201.4	32859911
AllCCS	[M-H]-	196.0	32859911
AllCCS	[M+Na-2H]-	196.3	32859911
AllCCS	[M+HCOO]-	196.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Mangiferin	OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC3=C(C=C(O)C(O)=C3)C2=O)C=C1O	5402.6	Standard polar	33892256
Mangiferin	OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC3=C(C=C(O)C(O)=C3)C2=O)C=C1O	3450.7	Standard non polar	33892256
Mangiferin	OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC3=C(C=C(O)C(O)=C3)C2=O)C=C1O	4240.8	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Mangiferin,1TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4154.9	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #2	C[Si](C)(C)OC1C(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)OC(CO)C(O)C1O	4165.4	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #3	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C1O	4209.4	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C1O	4185.6	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #5	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4151.0	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #6	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O)C(O)=C1C2=O	4178.4	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #7	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4181.5	Semi standard non polar	33892256
Mangiferin,1TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4166.0	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4055.5	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #10	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C1C2=O	4054.9	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #11	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4041.1	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #12	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C1O	4050.9	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #13	C[Si](C)(C)OC1C(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)OC(CO)C(O)C1O[Si](C)(C)C	4078.0	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #14	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C1O[Si](C)(C)C	4079.0	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #15	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4068.0	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	4046.2	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #17	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C1C2=O	4048.5	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #18	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4043.3	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #19	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4061.2	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4065.6	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #20	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C=C1O2	4051.9	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #21	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C1C2=O	4051.6	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #22	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4040.2	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #23	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4112.5	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #24	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4092.7	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #25	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C1C2=O	4095.7	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O)C3O)C(O)=C1C2=O	4093.7	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4102.7	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	4088.3	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4063.5	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4024.9	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4045.9	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4064.8	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4049.1	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4063.8	Semi standard non polar	33892256
Mangiferin,2TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	4055.6	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	3924.1	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3922.2	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3936.9	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3899.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3915.7	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3915.8	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3929.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3900.4	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3908.9	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3908.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3948.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	3925.1	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3949.5	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3956.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3909.8	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #23	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C1C2=O	3915.4	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #24	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3964.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #25	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3937.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3952.6	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3921.8	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3941.9	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #29	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3906.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3940.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3989.9	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3902.8	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C1C2=O	3914.7	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C1C2=O	3937.6	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #34	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	3922.1	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #35	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	3930.2	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #36	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4010.5	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	3960.5	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #38	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3948.9	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #39	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C1C2=O	3942.4	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3928.9	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #40	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	3940.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #41	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3889.2	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #42	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C1C2=O	3897.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #43	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	3941.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3871.8	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #45	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3969.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #46	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C1C2=O	3870.2	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	3908.2	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C1C2=O	3911.7	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	3959.8	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3933.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C=C1O2	3901.3	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C=C1O2	3980.7	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)=C1C2=O	3897.6	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	3957.7	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C1C2=O	3963.5	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	3991.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	4011.5	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3937.0	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	3980.6	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3903.4	Semi standard non polar	33892256
Mangiferin,3TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3923.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	3859.5	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3830.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3805.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3835.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3856.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3869.4	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3874.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3828.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3858.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3843.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3860.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3763.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3729.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3724.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3748.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3810.8	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3826.0	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3830.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3735.0	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3733.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3753.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3810.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3759.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3826.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3829.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3815.5	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3833.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3838.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3911.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #36	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3765.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3775.0	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #38	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3778.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #39	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3853.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3763.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #40	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3785.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #41	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C1C2=O	3773.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #42	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C1C2=O	3783.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #43	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3835.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3843.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #45	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3898.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #46	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3861.4	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3732.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3858.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3736.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3778.5	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3867.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3828.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3738.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3742.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C1C2=O	3861.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #55	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	3856.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3780.5	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #57	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C1C2=O	3788.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #58	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	3837.6	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #59	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3741.5	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3768.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #60	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3868.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #61	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C1C2=O	3749.3	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #62	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3785.8	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #63	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3822.0	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #64	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C1C2=O	3786.9	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #65	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3789.7	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	3763.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #67	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	3846.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #68	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)=C1C2=O	3769.1	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #69	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C=C1O2	3819.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3765.2	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #70	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	3892.0	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3770.4	Semi standard non polar	33892256
Mangiferin,4TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3784.2	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	3736.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3723.1	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3668.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3734.6	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3677.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3711.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3716.9	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3722.2	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3743.2	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3761.2	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3754.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3755.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3828.5	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3711.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3712.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3720.4	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3792.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3804.5	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3806.4	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3669.1	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3680.4	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3685.9	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3758.4	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3787.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3672.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3685.2	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3689.6	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3786.6	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3804.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #36	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3743.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3705.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #38	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3779.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #39	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3714.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3764.1	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #40	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3779.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #41	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3779.6	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #42	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3705.2	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #43	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3716.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C1C2=O	3746.4	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #45	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	3774.1	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #46	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3698.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3830.3	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C=C1O2	3737.4	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3735.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3671.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3705.0	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3709.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3786.5	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C1C2=O	3710.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C=C1O2	3740.6	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3776.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C=C1O2	3771.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3739.7	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3680.8	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3711.9	Semi standard non polar	33892256
Mangiferin,5TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3716.7	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3708.1	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3711.4	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3670.9	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3685.7	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3671.5	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3705.3	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3717.4	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3696.7	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3719.8	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3702.2	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3793.7	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3730.1	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3691.6	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3684.8	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3688.4	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #23	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3761.5	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #24	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3731.9	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #25	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C1O2	3722.1	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C1C2=O	3684.3	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C=C1O2	3727.9	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)C(=O)C1=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C=C1O2	3719.0	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3707.0	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3736.1	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3748.3	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3736.2	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3677.6	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3693.6	Semi standard non polar	33892256
Mangiferin,6TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC4=CC(O[Si](C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3679.2	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4415.1	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)OC(CO)C(O)C1O	4468.9	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C1O	4495.6	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C1O	4465.9	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4424.4	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O)C(O)=C1C2=O	4420.6	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4426.1	Semi standard non polar	33892256
Mangiferin,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4412.8	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4533.1	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4540.7	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4552.6	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	4560.1	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4581.1	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	4566.9	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4541.5	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4540.4	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C1C2=O	4537.7	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4550.2	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4532.3	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4533.6	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O)C=C1O2	4525.4	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)=C1C2=O	4523.6	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4538.5	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4598.4	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4561.5	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4559.5	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O)C3O)C(O)=C1C2=O	4550.9	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4549.9	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4548.2	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4534.0	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4541.1	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4538.0	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4556.7	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4518.9	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4544.5	Semi standard non polar	33892256
Mangiferin,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4542.8	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4624.6	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4609.5	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4584.4	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4589.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4597.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4614.0	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4589.7	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4580.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4594.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4575.5	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4604.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4629.2	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4621.9	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4607.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4623.2	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4629.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4648.7	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4605.9	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4609.2	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4589.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4602.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4592.6	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4627.6	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4640.0	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4597.6	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4589.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4599.9	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4590.6	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4585.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4628.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4592.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4587.7	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C1C2=O	4585.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4610.2	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4572.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4614.7	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C1C2=O	4621.8	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4637.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4588.4	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4628.8	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4591.5	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4603.3	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)=C1C2=O	4608.4	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4624.9	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4621.9	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O)C=C1O2	4574.8	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O)C=C1O2	4608.2	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4577.5	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4688.0	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4694.0	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C=C1O2	4674.2	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4693.8	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4603.6	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4636.1	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4583.8	Semi standard non polar	33892256
Mangiferin,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4592.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O	4749.8	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4671.5	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4700.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4664.5	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4684.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4697.8	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4686.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4669.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4713.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4726.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4698.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4680.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4608.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4662.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4608.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4670.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4676.1	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4670.1	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4605.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4661.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4605.5	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4672.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4673.0	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4678.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4669.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4632.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4649.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4639.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC4=CC(O)=C(O)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4709.8	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4678.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4688.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4706.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4747.1	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4728.0	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4711.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4684.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4692.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4680.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4683.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C(=O)C1=CC(O)=C(O)C=C1O2	4672.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4673.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4626.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4705.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4633.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4672.0	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4710.8	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C=C1O2	4682.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4629.0	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4633.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)=C1C2=O	4673.8	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C1C(=O)C1=CC(O)=C(O)C=C1O2	4630.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4688.1	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C1C2=O	4691.0	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C(=O)C1=CC(O)=C(O)C=C1O2	4662.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4632.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4682.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4696.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4632.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4739.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #63	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4738.2	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #64	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4742.4	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #65	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C=C1O2	4677.5	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #66	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4692.5	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #67	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4724.3	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #68	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)OC1=CC(O[Si](C)(C)C(C)(C)C)=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)=C1C2=O	4693.9	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #69	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O)C=C1O2	4661.8	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4676.6	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #70	CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)C(=O)C1=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C=C1O2	4776.7	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4731.5	Semi standard non polar	33892256
Mangiferin,4TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC4=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C4C(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4673.9	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (Non-derivatized) - 70eV, Positive	splash10-00di-4369200000-758a8c37611a4a7f8cbb	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (3 TMS) - 70eV, Positive	splash10-00di-2500559000-5d3358daf4e39fc9144e	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (TMS_4_44) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (TMS_5_43) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (TMS_5_45) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (TMS_6_26) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (TBDMS_4_44) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS (TBDMS_4_49) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Mangiferin GC-MS ("Mangiferin,4TMS,#44" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Mangiferin LC-ESI-qTof , Positive-QTOF	splash10-00di-0293000000-2addce902839fbc00317	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Mangiferin , positive-QTOF	splash10-00di-0293000000-2addce902839fbc00317	2017-09-14	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 10V, Positive-QTOF	splash10-05fr-0001900000-7e039093fc42c12265a7	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 20V, Positive-QTOF	splash10-05fr-5434900000-c6fdaad6c039bb9da77b	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 40V, Positive-QTOF	splash10-05tr-2091000000-17854a2e630e3479b4af	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 10V, Negative-QTOF	splash10-00di-0012900000-6f9ea5579c6507c5227c	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 20V, Negative-QTOF	splash10-0fk9-9467600000-db194aa8dbd21e8b7e23	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 40V, Negative-QTOF	splash10-052f-9361000000-8b32c733e44c1b73dbab	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 10V, Positive-QTOF	splash10-00di-0010900000-d25c0a3b3a1a7dd3f955	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 20V, Positive-QTOF	splash10-00di-0192400000-77f0d8f1633f0093a85a	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 40V, Positive-QTOF	splash10-00di-3292000000-763751747c4de0e22fc8	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 10V, Negative-QTOF	splash10-00di-0013900000-92c719952c2fc11a9eb4	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 20V, Negative-QTOF	splash10-0pi3-0059300000-49f10ed9e69fe7ca8825	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Mangiferin 40V, Negative-QTOF	splash10-0ab9-4194000000-36db5d0560a3e108b190	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

KNApSAcK ID

Chemspider ID

KEGG Compound ID

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Mangiferin

METLIN ID

Not Available

PubChem Compound

5358385

PDB ID

Not Available

ChEBI ID

6682

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1699751

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Zheng MS, Lu ZY: Antiviral effect of mangiferin and isomangiferin on herpes simplex virus. Chin Med J (Engl). 1990 Feb;103(2):160-5. [PubMed:2167819 ]
Gottlieb M, Leal-Campanario R, Campos-Esparza MR, Sanchez-Gomez MV, Alberdi E, Arranz A, Delgado-Garcia JM, Gruart A, Matute C: Neuroprotection by two polyphenols following excitotoxicity and experimental ischemia. Neurobiol Dis. 2006 Aug;23(2):374-86. Epub 2006 Jun 27. [PubMed:16806951 ]
Muruganandan S, Srinivasan K, Gupta S, Gupta PK, Lal J: Effect of mangiferin on hyperglycemia and atherogenicity in streptozotocin diabetic rats. J Ethnopharmacol. 2005 Mar 21;97(3):497-501. [PubMed:15740886 ]
Pardo-Andreu GL, Cavalheiro RA, Dorta DJ, Naal Z, Delgado R, Vercesi AE, Curti C: Fe(III) shifts the mitochondria permeability transition-eliciting capacity of mangiferin to protection of organelle. J Pharmacol Exp Ther. 2007 Feb;320(2):646-53. Epub 2006 Oct 26. [PubMed:17068204 ]
Prabhu S, Jainu M, Sabitha KE, Devi CS: Cardioprotective effect of mangiferin on isoproterenol induced myocardial infarction in rats. Indian J Exp Biol. 2006 Mar;44(3):209-15. [PubMed:16538859 ]
(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Mangiferin (HMDB0034410)

MOL for HMDB0034410 (Mangiferin)

3D MOL for HMDB0034410 (Mangiferin)

3D SDF for HMDB0034410 (Mangiferin)

3D-SDF for HMDB0034410 (Mangiferin)

PDB for HMDB0034410 (Mangiferin)

3D PDB for HMDB0034410 (Mangiferin)

SMILES for HMDB0034410 (Mangiferin)

INCHI for HMDB0034410 (Mangiferin)

Structure for HMDB0034410 (Mangiferin)

3D Structure for HMDB0034410 (Mangiferin)

Experimental Collision Cross Sections

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra