Showing metabocard for (3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside (HMDB0035347)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 20:19:00 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:54:28 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0035347 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | (3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | (3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units (3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside is an extremely weak basic (essentially neutral) compound (based on its pKa). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)Mrv0541 02241209002D 76 83 0 0 0 0 999 V2000 -4.7747 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7747 -1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0603 -1.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 -1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0603 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -1.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 -1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 0.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 1.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 0.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 -0.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0516 0.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 0.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 1.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2855 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9996 1.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7139 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4282 1.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1425 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4282 0.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1428 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 2.6015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3571 1.2047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 -0.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 1.9341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 0.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 0.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4732 -2.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6489 -2.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4903 -1.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2153 3.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5869 3.6007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8125 4.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2374 4.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5649 4.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7933 3.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5943 3.7893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1428 5.3801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4630 5.7819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6135 4.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1875 4.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0131 4.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4260 3.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2517 3.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6646 4.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2517 4.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4260 4.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0131 5.4324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6646 5.4324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4903 4.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6646 2.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3923 3.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8053 4.2915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6324 4.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0465 3.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6324 2.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8053 2.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3923 2.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0465 2.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8723 3.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0465 5.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6324 5.7228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -2.5987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4199 -3.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9966 -3.9873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7749 -4.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9782 -4.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4029 -4.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6245 -3.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0452 -3.0199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6035 -4.6039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7566 -5.7819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 34 1 0 0 0 0 3 4 1 0 0 0 0 3 32 1 0 0 0 0 3 33 1 0 0 0 0 4 5 1 0 0 0 0 4 7 1 0 0 0 0 5 6 1 0 0 0 0 5 10 1 0 0 0 0 5 31 1 0 0 0 0 7 8 1 0 0 0 0 7 67 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 30 1 0 0 0 0 10 14 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 28 1 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 13 14 1 0 0 0 0 13 29 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 27 1 0 0 0 0 18 19 1 0 0 0 0 18 25 1 0 0 0 0 18 26 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 22 24 1 0 0 0 0 26 35 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 44 1 0 0 0 0 38 39 1 0 0 0 0 38 43 1 0 0 0 0 39 40 1 0 0 0 0 39 42 1 0 0 0 0 40 41 1 0 0 0 0 41 56 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 55 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 50 53 1 0 0 0 0 51 52 1 0 0 0 0 56 57 1 0 0 0 0 56 61 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 65 1 0 0 0 0 59 60 1 0 0 0 0 59 64 1 0 0 0 0 60 61 1 0 0 0 0 60 63 1 0 0 0 0 61 62 1 0 0 0 0 65 66 1 0 0 0 0 67 68 1 0 0 0 0 68 69 1 0 0 0 0 68 73 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 71 72 1 0 0 0 0 71 76 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 73 74 1 0 0 0 0 M END 3D MOL for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)HMDB0035347 RDKit 3D (3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rh... 166173 0 0 0 0 0 0 0 0999 V2000 6.0581 -3.1277 -0.8072 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0067 -4.0845 -0.4180 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1067 -5.4800 -0.8931 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9954 -3.7271 0.3333 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9048 -4.5839 0.7783 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5172 -4.2604 0.4303 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9279 -2.9707 0.8763 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5427 -3.0029 0.3811 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5353 -1.8608 0.2549 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3634 -1.7865 -1.0961 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4501 -0.7098 -1.3393 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2070 -0.5141 -2.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3013 -0.5504 -2.8437 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7787 -0.3164 -4.0998 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5121 0.9081 -4.6497 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6930 1.6447 -4.8835 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2748 2.9317 -5.2697 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4095 3.9293 -5.2215 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7528 2.8942 -6.6898 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6044 3.5610 -7.5528 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6291 1.4367 -7.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9048 1.3098 -8.2686 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8575 0.7381 -5.9935 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4773 1.1749 -5.9745 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7278 -1.6159 -3.5804 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1930 -2.6800 -3.4939 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1290 -2.0338 -3.3402 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0253 -1.7137 -4.3118 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5456 -1.5001 -1.9565 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7862 -0.1231 -2.0377 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1004 0.1725 -1.7996 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1271 0.9667 -0.6397 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3148 1.6532 -0.5593 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5585 2.1832 0.8608 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7783 2.8568 0.8189 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1789 2.8869 -1.4329 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4184 3.8657 -0.7714 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4113 2.5022 -2.6732 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9926 3.1814 -3.7563 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6578 1.0297 -2.9232 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0212 0.8623 -3.1054 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9094 -2.7510 2.3699 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2470 -2.6324 2.7798 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1824 -3.7972 3.1304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9517 -3.1319 3.9193 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4826 -1.7596 4.0549 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4073 -1.7348 5.2774 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1805 -1.4989 2.7572 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9600 -0.2483 2.8488 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3365 -0.4724 2.9674 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5389 0.7016 3.9228 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8775 0.6476 4.3725 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7458 1.8303 3.9783 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 1.8301 5.0768 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0205 3.0934 4.2540 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5282 3.8841 3.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6522 3.2812 1.7702 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5549 4.3116 0.7990 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9446 2.5545 1.5277 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6701 1.7803 0.2553 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9051 3.6593 1.0978 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4674 1.7337 2.6744 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8844 0.3619 2.2951 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2689 0.2899 2.0004 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6482 -0.1713 0.8036 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3437 -1.3901 0.8464 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5138 -1.9285 -0.4106 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0789 -0.9959 -1.4152 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9181 -1.4406 -2.7282 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6153 0.4156 -1.3557 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4215 0.6137 -2.0730 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4385 0.8684 0.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7024 1.0681 0.6141 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6610 -0.7344 3.2792 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5674 -0.6793 4.2550 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1750 -1.1131 5.6137 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0780 -3.6094 -0.7602 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1388 -2.2700 -0.0769 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9484 -2.7466 -1.8368 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3185 -6.2112 -0.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9293 -5.5925 -1.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1743 -5.7141 -1.4466 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9489 -2.6718 0.6703 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2010 -5.6287 0.4075 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9973 -4.6835 1.8825 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2750 -4.4742 -0.6486 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8758 -5.0625 0.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6580 -3.6688 -0.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1197 -3.4300 1.2202 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8771 -1.9982 0.0620 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8741 -2.7168 -1.4439 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5249 0.4843 -3.0538 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6968 0.2459 -2.1786 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7237 -1.5081 -2.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8925 1.5708 -4.0316 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4869 3.3226 -4.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1201 4.7555 -5.9101 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5379 4.3802 -4.2262 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3507 3.5070 -5.6423 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7531 3.3701 -6.7784 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4271 3.0835 -7.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6264 0.9531 -7.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2253 1.9856 -8.9024 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8108 -0.3460 -6.3079 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6519 1.8365 -6.7023 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6317 -1.2550 -4.6379 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4298 -3.0439 -4.3817 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1398 -3.1455 -3.2202 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6838 -0.9865 -4.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4802 -1.9713 -1.7333 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7335 -0.6959 -1.5867 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1943 1.0448 -0.7919 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6072 1.2788 1.5045 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7489 2.8738 1.1252 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2353 2.7715 -0.0479 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1444 3.3414 -1.6818 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5764 4.0821 -1.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3301 2.7203 -2.5872 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3588 3.8185 -4.1822 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1663 0.7978 -3.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2806 1.3513 -3.9056 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3460 -3.2287 3.5754 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2247 -4.6406 2.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9290 -4.2637 3.8426 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8774 -3.3876 3.4651 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9408 -3.6764 4.9156 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0719 -0.9679 6.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2998 -2.6795 5.9034 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4742 -1.6927 5.0852 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6413 -1.4015 1.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8435 0.2861 1.8575 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7101 -0.0479 3.7730 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3028 0.6130 4.7655 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8347 1.7263 3.5817 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7716 0.8029 5.5048 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4267 1.7875 6.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6795 1.1766 4.8281 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3012 2.8737 5.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6050 3.8351 4.8907 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1598 2.8597 4.9575 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5710 4.1188 3.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9770 4.9252 3.0420 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2045 2.6034 1.4797 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3903 4.5690 0.7774 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8976 0.9950 0.3679 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5502 1.5332 -0.3155 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1342 2.5341 -0.4130 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8704 3.3976 1.6131 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0686 3.6055 0.0275 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5722 4.6581 1.4526 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4630 2.2687 2.8823 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4030 0.0701 1.3458 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7569 -0.4113 0.1892 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4801 -2.2175 -0.7643 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0806 -2.8631 -0.3429 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1977 -0.9887 -1.2475 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -2.4213 -2.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3461 1.1252 -1.8250 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4968 1.2921 -2.7622 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8777 1.8284 0.1197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6603 1.7988 1.2821 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6593 -0.9618 3.7728 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 -1.6666 2.6571 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8384 -0.4889 6.4400 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9738 -2.1548 5.8637 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3059 -1.0645 5.5665 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 12 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 7 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 59 61 1 0 59 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 63 74 1 0 74 75 1 0 75 76 1 0 29 10 1 0 40 31 1 0 48 42 1 0 75 52 1 0 23 15 1 0 75 46 1 0 62 53 1 0 72 65 1 0 1 77 1 0 1 78 1 0 1 79 1 0 3 80 1 0 3 81 1 0 3 82 1 0 4 83 1 0 5 84 1 0 5 85 1 0 6 86 1 0 6 87 1 0 8 88 1 0 8 89 1 0 8 90 1 0 10 91 1 0 12 92 1 0 13 93 1 0 13 94 1 0 15 95 1 0 17 96 1 0 18 97 1 0 18 98 1 0 18 99 1 0 19100 1 0 20101 1 0 21102 1 0 22103 1 0 23104 1 0 24105 1 0 25106 1 0 26107 1 0 27108 1 0 28109 1 0 29110 1 0 31111 1 0 33112 1 0 34113 1 0 34114 1 0 35115 1 0 36116 1 0 37117 1 0 38118 1 0 39119 1 0 40120 1 0 41121 1 0 43122 1 0 44123 1 0 44124 1 0 45125 1 0 45126 1 0 47127 1 0 47128 1 0 47129 1 0 48130 1 0 49131 1 0 50132 1 0 51133 1 0 51134 1 0 52135 1 0 54136 1 0 54137 1 0 54138 1 0 55139 1 0 55140 1 0 56141 1 0 56142 1 0 57143 1 0 58144 1 0 60145 1 0 60146 1 0 60147 1 0 61148 1 0 61149 1 0 61150 1 0 62151 1 0 63152 1 0 65153 1 0 67154 1 0 67155 1 0 68156 1 0 69157 1 0 70158 1 0 71159 1 0 72160 1 0 73161 1 0 74162 1 0 74163 1 0 76164 1 0 76165 1 0 76166 1 0 M END 3D SDF for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)Mrv0541 02241209002D 76 83 0 0 0 0 999 V2000 -4.7747 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7747 -1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0603 -1.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 -1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0603 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -1.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 -1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 0.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 1.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 0.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 -0.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0516 0.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 0.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 1.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2855 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9996 1.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7139 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4282 1.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1425 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4282 0.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1428 2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4287 2.6015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3571 1.2047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 -0.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 1.9341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9203 0.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 0.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4732 -2.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6489 -2.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4903 -1.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2153 3.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5869 3.6007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8125 4.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2374 4.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5649 4.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7933 3.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5943 3.7893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1428 5.3801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4630 5.7819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6135 4.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1875 4.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0131 4.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4260 3.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2517 3.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6646 4.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2517 4.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4260 4.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0131 5.4324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6646 5.4324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4903 4.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6646 2.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3923 3.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8053 4.2915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6324 4.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0465 3.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6324 2.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8053 2.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3923 2.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0465 2.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8723 3.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0465 5.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6324 5.7228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6332 -2.5987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4199 -3.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9966 -3.9873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7749 -4.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9782 -4.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4029 -4.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6245 -3.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0452 -3.0199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6035 -4.6039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7566 -5.7819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 34 1 0 0 0 0 3 4 1 0 0 0 0 3 32 1 0 0 0 0 3 33 1 0 0 0 0 4 5 1 0 0 0 0 4 7 1 0 0 0 0 5 6 1 0 0 0 0 5 10 1 0 0 0 0 5 31 1 0 0 0 0 7 8 1 0 0 0 0 7 67 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 30 1 0 0 0 0 10 14 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 28 1 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 13 14 1 0 0 0 0 13 29 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 27 1 0 0 0 0 18 19 1 0 0 0 0 18 25 1 0 0 0 0 18 26 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 22 24 1 0 0 0 0 26 35 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 44 1 0 0 0 0 38 39 1 0 0 0 0 38 43 1 0 0 0 0 39 40 1 0 0 0 0 39 42 1 0 0 0 0 40 41 1 0 0 0 0 41 56 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 55 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 50 53 1 0 0 0 0 51 52 1 0 0 0 0 56 57 1 0 0 0 0 56 61 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 65 1 0 0 0 0 59 60 1 0 0 0 0 59 64 1 0 0 0 0 60 61 1 0 0 0 0 60 63 1 0 0 0 0 61 62 1 0 0 0 0 65 66 1 0 0 0 0 67 68 1 0 0 0 0 68 69 1 0 0 0 0 68 73 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 71 72 1 0 0 0 0 71 76 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 73 74 1 0 0 0 0 M END > <DATABASE_ID> HMDB0035347 > <DATABASE_NAME> hmdb > <SMILES> CC1OC(OCC2OC(OC(C)(CCC=C(C)C)C3(O)CCC4(C)C3C(O)CC3C5(C)CCC(O)C(C)(C)C5C(CC43C)OC3OCC(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C53H90O23/c1-22(2)11-10-13-52(9,76-47-41(75-46-40(67)36(63)33(60)27(19-54)73-46)37(64)34(61)28(74-47)21-70-44-39(66)35(62)31(58)23(3)71-44)53(68)16-15-50(7)42(53)24(55)17-29-49(6)14-12-30(57)48(4,5)43(49)26(18-51(29,50)8)72-45-38(65)32(59)25(56)20-69-45/h11,23-47,54-68H,10,12-21H2,1-9H3 > <INCHI_KEY> OZEDEQJLFBHIEM-UHFFFAOYSA-N > <FORMULA> C53H90O23 > <MOLECULAR_WEIGHT> 1095.2679 > <EXACT_MASS> 1094.587289186 > <JCHEM_ACCEPTOR_COUNT> 23 > <JCHEM_AVERAGE_POLARIZABILITY> 115.74994979393523 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 15 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-({3,4-dihydroxy-6-[(6-methyl-2-{5,14,16-trihydroxy-2,6,6,10,11-pentamethyl-8-[(3,4,5-trihydroxyoxan-2-yl)oxy]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl}hept-5-en-2-yl)oxy]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl}methoxy)-6-methyloxane-3,4,5-triol > <ALOGPS_LOGP> -0.31 > <JCHEM_LOGP> -2.222713974000002 > <ALOGPS_LOGS> -2.52 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.186672325087496 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.753189389874882 > <JCHEM_PKA_STRONGEST_BASIC> -3.6489652750535706 > <JCHEM_POLAR_SURFACE_AREA> 377.2900000000001 > <JCHEM_REFRACTIVITY> 262.32770000000005 > <JCHEM_ROTATABLE_BOND_COUNT> 14 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 3.27e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-({3,4-dihydroxy-6-[(6-methyl-2-{5,14,16-trihydroxy-2,6,6,10,11-pentamethyl-8-[(3,4,5-trihydroxyoxan-2-yl)oxy]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl}hept-5-en-2-yl)oxy]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl}methoxy)-6-methyloxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)HMDB0035347 RDKit 3D (3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rh... 166173 0 0 0 0 0 0 0 0999 V2000 6.0581 -3.1277 -0.8072 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0067 -4.0845 -0.4180 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1067 -5.4800 -0.8931 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9954 -3.7271 0.3333 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9048 -4.5839 0.7783 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5172 -4.2604 0.4303 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9279 -2.9707 0.8763 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5427 -3.0029 0.3811 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5353 -1.8608 0.2549 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3634 -1.7865 -1.0961 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4501 -0.7098 -1.3393 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2070 -0.5141 -2.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3013 -0.5504 -2.8437 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7787 -0.3164 -4.0998 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5121 0.9081 -4.6497 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6930 1.6447 -4.8835 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2748 2.9317 -5.2697 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4095 3.9293 -5.2215 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7528 2.8942 -6.6898 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6044 3.5610 -7.5528 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6291 1.4367 -7.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9048 1.3098 -8.2686 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8575 0.7381 -5.9935 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4773 1.1749 -5.9745 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7278 -1.6159 -3.5804 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1930 -2.6800 -3.4939 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1290 -2.0338 -3.3402 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0253 -1.7137 -4.3118 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5456 -1.5001 -1.9565 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7862 -0.1231 -2.0377 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1004 0.1725 -1.7996 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1271 0.9667 -0.6397 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3148 1.6532 -0.5593 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5585 2.1832 0.8608 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7783 2.8568 0.8189 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1789 2.8869 -1.4329 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4184 3.8657 -0.7714 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4113 2.5022 -2.6732 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9926 3.1814 -3.7563 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6578 1.0297 -2.9232 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0212 0.8623 -3.1054 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9094 -2.7510 2.3699 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2470 -2.6324 2.7798 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1824 -3.7972 3.1304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9517 -3.1319 3.9193 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4826 -1.7596 4.0549 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4073 -1.7348 5.2774 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1805 -1.4989 2.7572 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9600 -0.2483 2.8488 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3365 -0.4724 2.9674 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5389 0.7016 3.9228 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8775 0.6476 4.3725 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7458 1.8303 3.9783 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 1.8301 5.0768 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0205 3.0934 4.2540 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5282 3.8841 3.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6522 3.2812 1.7702 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5549 4.3116 0.7990 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9446 2.5545 1.5277 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6701 1.7803 0.2553 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9051 3.6593 1.0978 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4674 1.7337 2.6744 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8844 0.3619 2.2951 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2689 0.2899 2.0004 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6482 -0.1713 0.8036 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3437 -1.3901 0.8464 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5138 -1.9285 -0.4106 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0789 -0.9959 -1.4152 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9181 -1.4406 -2.7282 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6153 0.4156 -1.3557 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4215 0.6137 -2.0730 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4385 0.8684 0.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7024 1.0681 0.6141 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6610 -0.7344 3.2792 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5674 -0.6793 4.2550 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1750 -1.1131 5.6137 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0780 -3.6094 -0.7602 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1388 -2.2700 -0.0769 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9484 -2.7466 -1.8368 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3185 -6.2112 -0.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9293 -5.5925 -1.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1743 -5.7141 -1.4466 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9489 -2.6718 0.6703 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2010 -5.6287 0.4075 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9973 -4.6835 1.8825 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2750 -4.4742 -0.6486 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8758 -5.0625 0.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6580 -3.6688 -0.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1197 -3.4300 1.2202 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8771 -1.9982 0.0620 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8741 -2.7168 -1.4439 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5249 0.4843 -3.0538 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6968 0.2459 -2.1786 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7237 -1.5081 -2.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8925 1.5708 -4.0316 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4869 3.3226 -4.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1201 4.7555 -5.9101 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5379 4.3802 -4.2262 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3507 3.5070 -5.6423 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7531 3.3701 -6.7784 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4271 3.0835 -7.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6264 0.9531 -7.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2253 1.9856 -8.9024 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8108 -0.3460 -6.3079 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6519 1.8365 -6.7023 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6317 -1.2550 -4.6379 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4298 -3.0439 -4.3817 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1398 -3.1455 -3.2202 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6838 -0.9865 -4.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4802 -1.9713 -1.7333 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7335 -0.6959 -1.5867 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1943 1.0448 -0.7919 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6072 1.2788 1.5045 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7489 2.8738 1.1252 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2353 2.7715 -0.0479 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1444 3.3414 -1.6818 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5764 4.0821 -1.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3301 2.7203 -2.5872 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3588 3.8185 -4.1822 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1663 0.7978 -3.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2806 1.3513 -3.9056 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3460 -3.2287 3.5754 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2247 -4.6406 2.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9290 -4.2637 3.8426 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8774 -3.3876 3.4651 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9408 -3.6764 4.9156 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0719 -0.9679 6.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2998 -2.6795 5.9034 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4742 -1.6927 5.0852 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6413 -1.4015 1.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8435 0.2861 1.8575 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7101 -0.0479 3.7730 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3028 0.6130 4.7655 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8347 1.7263 3.5817 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7716 0.8029 5.5048 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4267 1.7875 6.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6795 1.1766 4.8281 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3012 2.8737 5.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6050 3.8351 4.8907 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1598 2.8597 4.9575 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5710 4.1188 3.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9770 4.9252 3.0420 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2045 2.6034 1.4797 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3903 4.5690 0.7774 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8976 0.9950 0.3679 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5502 1.5332 -0.3155 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1342 2.5341 -0.4130 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8704 3.3976 1.6131 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0686 3.6055 0.0275 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5722 4.6581 1.4526 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4630 2.2687 2.8823 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4030 0.0701 1.3458 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7569 -0.4113 0.1892 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4801 -2.2175 -0.7643 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0806 -2.8631 -0.3429 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1977 -0.9887 -1.2475 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -2.4213 -2.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3461 1.1252 -1.8250 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4968 1.2921 -2.7622 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8777 1.8284 0.1197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6603 1.7988 1.2821 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6593 -0.9618 3.7728 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 -1.6666 2.6571 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8384 -0.4889 6.4400 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9738 -2.1548 5.8637 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3059 -1.0645 5.5665 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 12 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 7 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 59 61 1 0 59 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 63 74 1 0 74 75 1 0 75 76 1 0 29 10 1 0 40 31 1 0 48 42 1 0 75 52 1 0 23 15 1 0 75 46 1 0 62 53 1 0 72 65 1 0 1 77 1 0 1 78 1 0 1 79 1 0 3 80 1 0 3 81 1 0 3 82 1 0 4 83 1 0 5 84 1 0 5 85 1 0 6 86 1 0 6 87 1 0 8 88 1 0 8 89 1 0 8 90 1 0 10 91 1 0 12 92 1 0 13 93 1 0 13 94 1 0 15 95 1 0 17 96 1 0 18 97 1 0 18 98 1 0 18 99 1 0 19100 1 0 20101 1 0 21102 1 0 22103 1 0 23104 1 0 24105 1 0 25106 1 0 26107 1 0 27108 1 0 28109 1 0 29110 1 0 31111 1 0 33112 1 0 34113 1 0 34114 1 0 35115 1 0 36116 1 0 37117 1 0 38118 1 0 39119 1 0 40120 1 0 41121 1 0 43122 1 0 44123 1 0 44124 1 0 45125 1 0 45126 1 0 47127 1 0 47128 1 0 47129 1 0 48130 1 0 49131 1 0 50132 1 0 51133 1 0 51134 1 0 52135 1 0 54136 1 0 54137 1 0 54138 1 0 55139 1 0 55140 1 0 56141 1 0 56142 1 0 57143 1 0 58144 1 0 60145 1 0 60146 1 0 60147 1 0 61148 1 0 61149 1 0 61150 1 0 62151 1 0 63152 1 0 65153 1 0 67154 1 0 67155 1 0 68156 1 0 69157 1 0 70158 1 0 71159 1 0 72160 1 0 73161 1 0 74162 1 0 74163 1 0 76164 1 0 76165 1 0 76166 1 0 M END PDB for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 -8.913 -0.998 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -8.913 -2.539 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -7.579 -3.310 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -6.249 -2.539 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -6.249 -0.998 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -7.579 -0.230 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -4.915 -3.310 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -3.585 -2.539 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -3.585 -0.998 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -4.915 -0.230 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -2.257 -0.230 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -2.257 1.304 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -3.585 2.069 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -4.915 1.304 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 -0.800 -0.703 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 0.096 0.538 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -0.800 1.774 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -0.800 3.315 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 0.533 4.083 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.866 3.315 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 3.199 4.083 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 4.533 3.315 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 5.866 4.083 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 4.533 1.774 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -2.133 4.083 0.000 0.00 0.00 C+0 HETATM 26 O UNK 0 -0.800 4.856 0.000 0.00 0.00 O+0 HETATM 27 O UNK 0 0.667 2.249 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 -2.257 -1.771 0.000 0.00 0.00 C+0 HETATM 29 O UNK 0 -3.585 3.610 0.000 0.00 0.00 O+0 HETATM 30 C UNK 0 -3.585 0.538 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -6.249 0.538 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -8.350 -4.643 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -6.811 -4.643 0.000 0.00 0.00 C+0 HETATM 34 O UNK 0 -10.248 -3.310 0.000 0.00 0.00 O+0 HETATM 35 C UNK 0 -0.402 6.346 0.000 0.00 0.00 C+0 HETATM 36 O UNK 0 1.095 6.721 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 1.517 8.204 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 0.443 9.311 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -1.054 8.936 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -1.481 7.451 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 -2.976 7.073 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 -2.133 10.043 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 0.864 10.793 0.000 0.00 0.00 O+0 HETATM 44 C UNK 0 3.012 8.578 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 4.083 7.471 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 5.624 7.471 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 6.395 6.136 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 7.937 6.136 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 8.707 7.471 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 7.937 8.805 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 6.395 8.805 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 5.624 10.140 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 8.707 10.140 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 10.248 7.471 0.000 0.00 0.00 O+0 HETATM 55 C UNK 0 8.707 4.800 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 -4.466 6.675 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 -5.237 8.011 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 -6.780 8.011 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -7.554 6.675 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -6.780 5.337 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -5.237 5.337 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 -4.466 4.003 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 -7.554 4.003 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 -9.095 6.675 0.000 0.00 0.00 O+0 HETATM 65 C UNK 0 -7.554 9.347 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 -6.780 10.683 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 -4.915 -4.851 0.000 0.00 0.00 O+0 HETATM 68 C UNK 0 -4.517 -6.341 0.000 0.00 0.00 C+0 HETATM 69 O UNK 0 -5.594 -7.443 0.000 0.00 0.00 O+0 HETATM 70 C UNK 0 -5.180 -8.925 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 -3.693 -9.308 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 -2.619 -8.211 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -3.032 -6.734 0.000 0.00 0.00 C+0 HETATM 74 O UNK 0 -1.951 -5.637 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 -1.126 -8.594 0.000 0.00 0.00 O+0 HETATM 76 O UNK 0 -3.279 -10.793 0.000 0.00 0.00 O+0 CONECT 1 2 6 CONECT 2 1 3 34 CONECT 3 2 4 32 33 CONECT 4 3 5 7 CONECT 5 4 6 10 31 CONECT 6 1 5 CONECT 7 4 8 67 CONECT 8 7 9 CONECT 9 8 10 11 30 CONECT 10 5 9 14 CONECT 11 9 12 15 28 CONECT 12 11 13 17 CONECT 13 12 14 29 CONECT 14 10 13 CONECT 15 11 16 CONECT 16 15 17 CONECT 17 12 16 18 27 CONECT 18 17 19 25 26 CONECT 19 18 20 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 21 23 24 CONECT 23 22 CONECT 24 22 CONECT 25 18 CONECT 26 18 35 CONECT 27 17 CONECT 28 11 CONECT 29 13 CONECT 30 9 CONECT 31 5 CONECT 32 3 CONECT 33 3 CONECT 34 2 CONECT 35 26 36 40 CONECT 36 35 37 CONECT 37 36 38 44 CONECT 38 37 39 43 CONECT 39 38 40 42 CONECT 40 35 39 41 CONECT 41 40 56 CONECT 42 39 CONECT 43 38 CONECT 44 37 45 CONECT 45 44 46 CONECT 46 45 47 51 CONECT 47 46 48 CONECT 48 47 49 55 CONECT 49 48 50 54 CONECT 50 49 51 53 CONECT 51 46 50 52 CONECT 52 51 CONECT 53 50 CONECT 54 49 CONECT 55 48 CONECT 56 41 57 61 CONECT 57 56 58 CONECT 58 57 59 65 CONECT 59 58 60 64 CONECT 60 59 61 63 CONECT 61 56 60 62 CONECT 62 61 CONECT 63 60 CONECT 64 59 CONECT 65 58 66 CONECT 66 65 CONECT 67 7 68 CONECT 68 67 69 73 CONECT 69 68 70 CONECT 70 69 71 CONECT 71 70 72 76 CONECT 72 71 73 75 CONECT 73 68 72 74 CONECT 74 73 CONECT 75 72 CONECT 76 71 MASTER 0 0 0 0 0 0 0 0 76 0 166 0 END 3D PDB for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)COMPND HMDB0035347 HETATM 1 C1 UNL 1 6.058 -3.128 -0.807 1.00 0.00 C HETATM 2 C2 UNL 1 5.007 -4.084 -0.418 1.00 0.00 C HETATM 3 C3 UNL 1 5.107 -5.480 -0.893 1.00 0.00 C HETATM 4 C4 UNL 1 3.995 -3.727 0.333 1.00 0.00 C HETATM 5 C5 UNL 1 2.905 -4.584 0.778 1.00 0.00 C HETATM 6 C6 UNL 1 1.517 -4.260 0.430 1.00 0.00 C HETATM 7 C7 UNL 1 0.928 -2.971 0.876 1.00 0.00 C HETATM 8 C8 UNL 1 -0.543 -3.003 0.381 1.00 0.00 C HETATM 9 O1 UNL 1 1.535 -1.861 0.255 1.00 0.00 O HETATM 10 C9 UNL 1 1.363 -1.787 -1.096 1.00 0.00 C HETATM 11 O2 UNL 1 0.450 -0.710 -1.339 1.00 0.00 O HETATM 12 C10 UNL 1 0.207 -0.514 -2.692 1.00 0.00 C HETATM 13 C11 UNL 1 -1.301 -0.550 -2.844 1.00 0.00 C HETATM 14 O3 UNL 1 -1.779 -0.316 -4.100 1.00 0.00 O HETATM 15 C12 UNL 1 -1.512 0.908 -4.650 1.00 0.00 C HETATM 16 O4 UNL 1 -2.693 1.645 -4.884 1.00 0.00 O HETATM 17 C13 UNL 1 -2.275 2.932 -5.270 1.00 0.00 C HETATM 18 C14 UNL 1 -3.409 3.929 -5.222 1.00 0.00 C HETATM 19 C15 UNL 1 -1.753 2.894 -6.690 1.00 0.00 C HETATM 20 O5 UNL 1 -2.604 3.561 -7.553 1.00 0.00 O HETATM 21 C16 UNL 1 -1.629 1.437 -7.106 1.00 0.00 C HETATM 22 O6 UNL 1 -0.905 1.310 -8.269 1.00 0.00 O HETATM 23 C17 UNL 1 -0.858 0.738 -5.993 1.00 0.00 C HETATM 24 O7 UNL 1 0.477 1.175 -5.974 1.00 0.00 O HETATM 25 C18 UNL 1 0.728 -1.616 -3.580 1.00 0.00 C HETATM 26 O8 UNL 1 -0.193 -2.680 -3.494 1.00 0.00 O HETATM 27 C19 UNL 1 2.129 -2.034 -3.340 1.00 0.00 C HETATM 28 O9 UNL 1 3.025 -1.714 -4.312 1.00 0.00 O HETATM 29 C20 UNL 1 2.546 -1.500 -1.956 1.00 0.00 C HETATM 30 O10 UNL 1 2.786 -0.123 -2.038 1.00 0.00 O HETATM 31 C21 UNL 1 4.100 0.173 -1.800 1.00 0.00 C HETATM 32 O11 UNL 1 4.127 0.967 -0.640 1.00 0.00 O HETATM 33 C22 UNL 1 5.315 1.653 -0.559 1.00 0.00 C HETATM 34 C23 UNL 1 5.558 2.183 0.861 1.00 0.00 C HETATM 35 O12 UNL 1 6.778 2.857 0.819 1.00 0.00 O HETATM 36 C24 UNL 1 5.179 2.887 -1.433 1.00 0.00 C HETATM 37 O13 UNL 1 4.418 3.866 -0.771 1.00 0.00 O HETATM 38 C25 UNL 1 4.411 2.502 -2.673 1.00 0.00 C HETATM 39 O14 UNL 1 4.993 3.181 -3.756 1.00 0.00 O HETATM 40 C26 UNL 1 4.658 1.030 -2.923 1.00 0.00 C HETATM 41 O15 UNL 1 6.021 0.862 -3.105 1.00 0.00 O HETATM 42 C27 UNL 1 0.909 -2.751 2.370 1.00 0.00 C HETATM 43 O16 UNL 1 2.247 -2.632 2.780 1.00 0.00 O HETATM 44 C28 UNL 1 0.182 -3.797 3.130 1.00 0.00 C HETATM 45 C29 UNL 1 -0.952 -3.132 3.919 1.00 0.00 C HETATM 46 C30 UNL 1 -0.483 -1.760 4.055 1.00 0.00 C HETATM 47 C31 UNL 1 0.407 -1.735 5.277 1.00 0.00 C HETATM 48 C32 UNL 1 0.180 -1.499 2.757 1.00 0.00 C HETATM 49 C33 UNL 1 0.960 -0.248 2.849 1.00 0.00 C HETATM 50 O17 UNL 1 2.336 -0.472 2.967 1.00 0.00 O HETATM 51 C34 UNL 1 0.539 0.702 3.923 1.00 0.00 C HETATM 52 C35 UNL 1 -0.877 0.648 4.372 1.00 0.00 C HETATM 53 C36 UNL 1 -1.746 1.830 3.978 1.00 0.00 C HETATM 54 C37 UNL 1 -2.858 1.830 5.077 1.00 0.00 C HETATM 55 C38 UNL 1 -1.021 3.093 4.254 1.00 0.00 C HETATM 56 C39 UNL 1 -0.528 3.884 3.106 1.00 0.00 C HETATM 57 C40 UNL 1 -0.652 3.281 1.770 1.00 0.00 C HETATM 58 O18 UNL 1 -0.555 4.312 0.799 1.00 0.00 O HETATM 59 C41 UNL 1 -1.945 2.555 1.528 1.00 0.00 C HETATM 60 C42 UNL 1 -1.670 1.780 0.255 1.00 0.00 C HETATM 61 C43 UNL 1 -2.905 3.659 1.098 1.00 0.00 C HETATM 62 C44 UNL 1 -2.467 1.734 2.674 1.00 0.00 C HETATM 63 C45 UNL 1 -2.884 0.362 2.295 1.00 0.00 C HETATM 64 O19 UNL 1 -4.269 0.290 2.000 1.00 0.00 O HETATM 65 C46 UNL 1 -4.648 -0.171 0.804 1.00 0.00 C HETATM 66 O20 UNL 1 -5.344 -1.390 0.846 1.00 0.00 O HETATM 67 C47 UNL 1 -5.514 -1.928 -0.411 1.00 0.00 C HETATM 68 C48 UNL 1 -6.079 -0.996 -1.415 1.00 0.00 C HETATM 69 O21 UNL 1 -5.918 -1.441 -2.728 1.00 0.00 O HETATM 70 C49 UNL 1 -5.615 0.416 -1.356 1.00 0.00 C HETATM 71 O22 UNL 1 -4.422 0.614 -2.073 1.00 0.00 O HETATM 72 C50 UNL 1 -5.438 0.868 0.053 1.00 0.00 C HETATM 73 O23 UNL 1 -6.702 1.068 0.614 1.00 0.00 O HETATM 74 C51 UNL 1 -2.661 -0.734 3.279 1.00 0.00 C HETATM 75 C52 UNL 1 -1.567 -0.679 4.255 1.00 0.00 C HETATM 76 C53 UNL 1 -2.175 -1.113 5.614 1.00 0.00 C HETATM 77 H1 UNL 1 7.078 -3.609 -0.760 1.00 0.00 H HETATM 78 H2 UNL 1 6.139 -2.270 -0.077 1.00 0.00 H HETATM 79 H3 UNL 1 5.948 -2.747 -1.837 1.00 0.00 H HETATM 80 H4 UNL 1 5.319 -6.211 -0.087 1.00 0.00 H HETATM 81 H5 UNL 1 5.929 -5.593 -1.642 1.00 0.00 H HETATM 82 H6 UNL 1 4.174 -5.714 -1.447 1.00 0.00 H HETATM 83 H7 UNL 1 3.949 -2.672 0.670 1.00 0.00 H HETATM 84 H8 UNL 1 3.201 -5.629 0.407 1.00 0.00 H HETATM 85 H9 UNL 1 2.997 -4.684 1.882 1.00 0.00 H HETATM 86 H10 UNL 1 1.275 -4.474 -0.649 1.00 0.00 H HETATM 87 H11 UNL 1 0.876 -5.062 0.947 1.00 0.00 H HETATM 88 H12 UNL 1 -0.658 -3.669 -0.472 1.00 0.00 H HETATM 89 H13 UNL 1 -1.120 -3.430 1.220 1.00 0.00 H HETATM 90 H14 UNL 1 -0.877 -1.998 0.062 1.00 0.00 H HETATM 91 H15 UNL 1 0.874 -2.717 -1.444 1.00 0.00 H HETATM 92 H16 UNL 1 0.525 0.484 -3.054 1.00 0.00 H HETATM 93 H17 UNL 1 -1.697 0.246 -2.179 1.00 0.00 H HETATM 94 H18 UNL 1 -1.724 -1.508 -2.460 1.00 0.00 H HETATM 95 H19 UNL 1 -0.892 1.571 -4.032 1.00 0.00 H HETATM 96 H20 UNL 1 -1.487 3.323 -4.567 1.00 0.00 H HETATM 97 H21 UNL 1 -3.120 4.755 -5.910 1.00 0.00 H HETATM 98 H22 UNL 1 -3.538 4.380 -4.226 1.00 0.00 H HETATM 99 H23 UNL 1 -4.351 3.507 -5.642 1.00 0.00 H HETATM 100 H24 UNL 1 -0.753 3.370 -6.778 1.00 0.00 H HETATM 101 H25 UNL 1 -3.427 3.083 -7.754 1.00 0.00 H HETATM 102 H26 UNL 1 -2.626 0.953 -7.135 1.00 0.00 H HETATM 103 H27 UNL 1 -1.225 1.986 -8.902 1.00 0.00 H HETATM 104 H28 UNL 1 -0.811 -0.346 -6.308 1.00 0.00 H HETATM 105 H29 UNL 1 0.652 1.837 -6.702 1.00 0.00 H HETATM 106 H30 UNL 1 0.632 -1.255 -4.638 1.00 0.00 H HETATM 107 H31 UNL 1 -0.430 -3.044 -4.382 1.00 0.00 H HETATM 108 H32 UNL 1 2.140 -3.146 -3.220 1.00 0.00 H HETATM 109 H33 UNL 1 2.684 -0.987 -4.872 1.00 0.00 H HETATM 110 H34 UNL 1 3.480 -1.971 -1.733 1.00 0.00 H HETATM 111 H35 UNL 1 4.733 -0.696 -1.587 1.00 0.00 H HETATM 112 H36 UNL 1 6.194 1.045 -0.792 1.00 0.00 H HETATM 113 H37 UNL 1 5.607 1.279 1.505 1.00 0.00 H HETATM 114 H38 UNL 1 4.749 2.874 1.125 1.00 0.00 H HETATM 115 H39 UNL 1 7.235 2.772 -0.048 1.00 0.00 H HETATM 116 H40 UNL 1 6.144 3.341 -1.682 1.00 0.00 H HETATM 117 H41 UNL 1 3.576 4.082 -1.259 1.00 0.00 H HETATM 118 H42 UNL 1 3.330 2.720 -2.587 1.00 0.00 H HETATM 119 H43 UNL 1 4.359 3.818 -4.182 1.00 0.00 H HETATM 120 H44 UNL 1 4.166 0.798 -3.891 1.00 0.00 H HETATM 121 H45 UNL 1 6.281 1.351 -3.906 1.00 0.00 H HETATM 122 H46 UNL 1 2.346 -3.229 3.575 1.00 0.00 H HETATM 123 H47 UNL 1 -0.225 -4.641 2.574 1.00 0.00 H HETATM 124 H48 UNL 1 0.929 -4.264 3.843 1.00 0.00 H HETATM 125 H49 UNL 1 -1.877 -3.388 3.465 1.00 0.00 H HETATM 126 H50 UNL 1 -0.941 -3.676 4.916 1.00 0.00 H HETATM 127 H51 UNL 1 0.072 -0.968 6.038 1.00 0.00 H HETATM 128 H52 UNL 1 0.300 -2.679 5.903 1.00 0.00 H HETATM 129 H53 UNL 1 1.474 -1.693 5.085 1.00 0.00 H HETATM 130 H54 UNL 1 -0.641 -1.402 1.992 1.00 0.00 H HETATM 131 H55 UNL 1 0.844 0.286 1.857 1.00 0.00 H HETATM 132 H56 UNL 1 2.710 -0.048 3.773 1.00 0.00 H HETATM 133 H57 UNL 1 1.303 0.613 4.765 1.00 0.00 H HETATM 134 H58 UNL 1 0.835 1.726 3.582 1.00 0.00 H HETATM 135 H59 UNL 1 -0.772 0.803 5.505 1.00 0.00 H HETATM 136 H60 UNL 1 -2.427 1.787 6.069 1.00 0.00 H HETATM 137 H61 UNL 1 -3.680 1.177 4.828 1.00 0.00 H HETATM 138 H62 UNL 1 -3.301 2.874 5.010 1.00 0.00 H HETATM 139 H63 UNL 1 -1.605 3.835 4.891 1.00 0.00 H HETATM 140 H64 UNL 1 -0.160 2.860 4.958 1.00 0.00 H HETATM 141 H65 UNL 1 0.571 4.119 3.254 1.00 0.00 H HETATM 142 H66 UNL 1 -0.977 4.925 3.042 1.00 0.00 H HETATM 143 H67 UNL 1 0.205 2.603 1.480 1.00 0.00 H HETATM 144 H68 UNL 1 0.390 4.569 0.777 1.00 0.00 H HETATM 145 H69 UNL 1 -0.898 0.995 0.368 1.00 0.00 H HETATM 146 H70 UNL 1 -2.550 1.533 -0.316 1.00 0.00 H HETATM 147 H71 UNL 1 -1.134 2.534 -0.413 1.00 0.00 H HETATM 148 H72 UNL 1 -3.870 3.398 1.613 1.00 0.00 H HETATM 149 H73 UNL 1 -3.069 3.605 0.028 1.00 0.00 H HETATM 150 H74 UNL 1 -2.572 4.658 1.453 1.00 0.00 H HETATM 151 H75 UNL 1 -3.463 2.269 2.882 1.00 0.00 H HETATM 152 H76 UNL 1 -2.403 0.070 1.346 1.00 0.00 H HETATM 153 H77 UNL 1 -3.757 -0.411 0.189 1.00 0.00 H HETATM 154 H78 UNL 1 -4.480 -2.218 -0.764 1.00 0.00 H HETATM 155 H79 UNL 1 -6.081 -2.863 -0.343 1.00 0.00 H HETATM 156 H80 UNL 1 -7.198 -0.989 -1.248 1.00 0.00 H HETATM 157 H81 UNL 1 -5.715 -2.421 -2.755 1.00 0.00 H HETATM 158 H82 UNL 1 -6.346 1.125 -1.825 1.00 0.00 H HETATM 159 H83 UNL 1 -4.497 1.292 -2.762 1.00 0.00 H HETATM 160 H84 UNL 1 -4.878 1.828 0.120 1.00 0.00 H HETATM 161 H85 UNL 1 -6.660 1.799 1.282 1.00 0.00 H HETATM 162 H86 UNL 1 -3.659 -0.962 3.773 1.00 0.00 H HETATM 163 H87 UNL 1 -2.533 -1.667 2.657 1.00 0.00 H HETATM 164 H88 UNL 1 -1.838 -0.489 6.440 1.00 0.00 H HETATM 165 H89 UNL 1 -1.974 -2.155 5.864 1.00 0.00 H HETATM 166 H90 UNL 1 -3.306 -1.064 5.567 1.00 0.00 H CONECT 1 2 77 78 79 CONECT 2 3 4 4 CONECT 3 80 81 82 CONECT 4 5 83 CONECT 5 6 84 85 CONECT 6 7 86 87 CONECT 7 8 9 42 CONECT 8 88 89 90 CONECT 9 10 CONECT 10 11 29 91 CONECT 11 12 CONECT 12 13 25 92 CONECT 13 14 93 94 CONECT 14 15 CONECT 15 16 23 95 CONECT 16 17 CONECT 17 18 19 96 CONECT 18 97 98 99 CONECT 19 20 21 100 CONECT 20 101 CONECT 21 22 23 102 CONECT 22 103 CONECT 23 24 104 CONECT 24 105 CONECT 25 26 27 106 CONECT 26 107 CONECT 27 28 29 108 CONECT 28 109 CONECT 29 30 110 CONECT 30 31 CONECT 31 32 40 111 CONECT 32 33 CONECT 33 34 36 112 CONECT 34 35 113 114 CONECT 35 115 CONECT 36 37 38 116 CONECT 37 117 CONECT 38 39 40 118 CONECT 39 119 CONECT 40 41 120 CONECT 41 121 CONECT 42 43 44 48 CONECT 43 122 CONECT 44 45 123 124 CONECT 45 46 125 126 CONECT 46 47 48 75 CONECT 47 127 128 129 CONECT 48 49 130 CONECT 49 50 51 131 CONECT 50 132 CONECT 51 52 133 134 CONECT 52 53 75 135 CONECT 53 54 55 62 CONECT 54 136 137 138 CONECT 55 56 139 140 CONECT 56 57 141 142 CONECT 57 58 59 143 CONECT 58 144 CONECT 59 60 61 62 CONECT 60 145 146 147 CONECT 61 148 149 150 CONECT 62 63 151 CONECT 63 64 74 152 CONECT 64 65 CONECT 65 66 72 153 CONECT 66 67 CONECT 67 68 154 155 CONECT 68 69 70 156 CONECT 69 157 CONECT 70 71 72 158 CONECT 71 159 CONECT 72 73 160 CONECT 73 161 CONECT 74 75 162 163 CONECT 75 76 CONECT 76 164 165 166 END SMILES for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)CC1OC(OCC2OC(OC(C)(CCC=C(C)C)C3(O)CCC4(C)C3C(O)CC3C5(C)CCC(O)C(C)(C)C5C(CC43C)OC3OCC(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O INCHI for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)InChI=1S/C53H90O23/c1-22(2)11-10-13-52(9,76-47-41(75-46-40(67)36(63)33(60)27(19-54)73-46)37(64)34(61)28(74-47)21-70-44-39(66)35(62)31(58)23(3)71-44)53(68)16-15-50(7)42(53)24(55)17-29-49(6)14-12-30(57)48(4,5)43(49)26(18-51(29,50)8)72-45-38(65)32(59)25(56)20-69-45/h11,23-47,54-68H,10,12-21H2,1-9H3 Structure for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside)3D Structure for HMDB0035347 ((3b,6a,12b,17a,20S)-Dammar-24-ene-3,6,12,17,20-pentol 20-[glucosyl-(1->2)-[rhamnosyl-(1->6)]-glucoside] 6-xyloside) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C53H90O23 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1095.2679 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1094.587289186 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-({3,4-dihydroxy-6-[(6-methyl-2-{5,14,16-trihydroxy-2,6,6,10,11-pentamethyl-8-[(3,4,5-trihydroxyoxan-2-yl)oxy]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl}hept-5-en-2-yl)oxy]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl}methoxy)-6-methyloxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-({3,4-dihydroxy-6-[(6-methyl-2-{5,14,16-trihydroxy-2,6,6,10,11-pentamethyl-8-[(3,4,5-trihydroxyoxan-2-yl)oxy]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl}hept-5-en-2-yl)oxy]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl}methoxy)-6-methyloxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 251101-56-1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OCC2OC(OC(C)(CCC=C(C)C)C3(O)CCC4(C)C3C(O)CC3C5(C)CCC(O)C(C)(C)C5C(CC43C)OC3OCC(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C53H90O23/c1-22(2)11-10-13-52(9,76-47-41(75-46-40(67)36(63)33(60)27(19-54)73-46)37(64)34(61)28(74-47)21-70-44-39(66)35(62)31(58)23(3)71-44)53(68)16-15-50(7)42(53)24(55)17-29-49(6)14-12-30(57)48(4,5)43(49)26(18-51(29,50)8)72-45-38(65)32(59)25(56)20-69-45/h11,23-47,54-68H,10,12-21H2,1-9H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | OZEDEQJLFBHIEM-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB014019 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131751718 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|