Showing metabocard for Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside] (HMDB0035498)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 20:30:17 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:54:32 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0035498 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside] | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside] is found in fruits. Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside] is a constituent of Cyclanthera pedata (achoccha) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])Mrv0541 05061308312D 71 77 0 0 0 0 999 V2000 2.2973 -2.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3640 -5.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2253 1.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1973 2.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9716 0.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6284 -1.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4662 0.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9503 0.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0886 -0.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9215 -2.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7336 -1.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7609 0.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2672 1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1382 -0.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4774 -1.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5745 0.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3875 -3.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3906 -1.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5776 -1.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4482 -5.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4081 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3897 -1.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6700 -0.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1602 -1.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3261 -0.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5754 -3.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1103 -0.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0139 -1.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9436 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7624 0.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0458 -0.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7285 -6.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6421 0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5406 -6.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3618 0.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2315 -3.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0724 -6.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4503 0.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9512 -2.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0436 -3.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9309 -0.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4830 -2.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7921 -5.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9821 0.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0845 1.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8261 -1.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1064 -0.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4821 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4373 0.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9194 -2.7626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0972 2.7600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9362 -1.3437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6327 1.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2306 0.8721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2336 -1.1154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1966 -7.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4542 -0.1444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8209 -7.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8936 1.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6997 -4.3643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8845 -6.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7306 1.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1391 -2.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7859 0.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2027 -1.5511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9800 -5.1403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7942 0.4364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2951 -2.4722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7018 -0.4847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3239 -4.6548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9017 1.3445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11 10 1 0 0 0 0 13 12 1 0 0 0 0 19 1 1 0 0 0 0 20 2 1 0 0 0 0 21 3 1 0 0 0 0 22 10 1 0 0 0 0 22 19 2 0 0 0 0 23 14 2 0 0 0 0 23 22 1 0 0 0 0 24 15 1 0 0 0 0 25 14 1 0 0 0 0 26 17 1 0 0 0 0 27 18 1 0 0 0 0 28 11 1 0 0 0 0 29 12 1 0 0 0 0 30 16 1 0 0 0 0 31 19 1 0 0 0 0 31 25 2 0 0 0 0 32 20 1 0 0 0 0 33 27 1 0 0 0 0 34 32 1 0 0 0 0 35 33 1 0 0 0 0 37 34 1 0 0 0 0 38 35 1 0 0 0 0 39 36 1 0 0 0 0 40 26 1 0 0 0 0 40 36 1 0 0 0 0 41 24 1 0 0 0 0 42 39 1 0 0 0 0 43 37 1 0 0 0 0 44 38 1 0 0 0 0 45 4 1 0 0 0 0 45 5 1 0 0 0 0 45 13 1 0 0 0 0 46 6 1 0 0 0 0 46 15 1 0 0 0 0 46 28 1 0 0 0 0 47 7 1 0 0 0 0 47 16 1 0 0 0 0 47 41 1 0 0 0 0 47 46 1 0 0 0 0 48 8 1 0 0 0 0 48 23 1 0 0 0 0 48 28 1 0 0 0 0 48 30 1 0 0 0 0 49 9 1 0 0 0 0 49 29 1 0 0 0 0 49 41 1 0 0 0 0 50 17 1 0 0 0 0 51 21 2 0 0 0 0 52 24 1 0 0 0 0 53 29 2 0 0 0 0 54 30 2 0 0 0 0 55 31 1 0 0 0 0 56 32 1 0 0 0 0 57 33 1 0 0 0 0 58 34 1 0 0 0 0 59 35 1 0 0 0 0 60 36 1 0 0 0 0 61 37 1 0 0 0 0 62 38 1 0 0 0 0 63 39 1 0 0 0 0 64 49 1 0 0 0 0 65 18 1 0 0 0 0 65 42 1 0 0 0 0 66 20 1 0 0 0 0 66 43 1 0 0 0 0 67 25 1 0 0 0 0 67 44 1 0 0 0 0 68 26 1 0 0 0 0 68 42 1 0 0 0 0 69 27 1 0 0 0 0 69 44 1 0 0 0 0 70 40 1 0 0 0 0 70 43 1 0 0 0 0 71 21 1 0 0 0 0 71 45 1 0 0 0 0 M END 3D MOL for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])HMDB0035498 RDKit 3D Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside] 145151 0 0 0 0 0 0 0 0999 V2000 14.2755 0.1845 -4.8549 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2178 -0.6210 -4.1677 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8138 -1.6943 -4.6731 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7061 -0.1755 -2.9935 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6863 -0.8477 -2.2217 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1496 -2.2444 -1.8510 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6812 -0.0353 -0.9261 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4367 -0.8347 -3.0015 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2344 -1.4875 -2.4566 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6327 -0.9496 -1.2138 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8989 0.1831 -0.9140 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7344 -1.7816 -0.3584 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5227 -2.0743 0.9149 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7619 -3.0722 -1.0029 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3289 -1.5047 -0.2416 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7396 -2.6240 0.6461 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5963 -3.1867 0.0275 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3229 -2.0199 1.9270 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5117 -0.5142 1.8131 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6790 -0.1666 2.6867 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3396 0.2112 2.4713 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6697 1.6210 2.8261 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7822 2.6968 2.3819 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3823 2.3252 2.1490 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0555 1.0391 1.9179 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7105 0.7542 1.7058 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3001 1.7016 1.7201 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5904 1.2845 1.4990 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7528 1.9557 1.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4583 1.8947 0.2655 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3181 2.9831 0.2081 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3285 3.0100 -0.8742 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1264 1.9751 -1.0095 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9252 1.4136 -0.1034 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2935 1.7864 -0.3045 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8970 1.0039 -1.2881 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2168 1.7220 -1.5933 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0312 1.7896 -0.4719 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2014 -0.3775 -0.7576 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5414 -1.2505 -1.7564 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8185 -1.8020 -1.6424 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6449 -3.1796 -1.4927 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8195 -3.8389 -1.1793 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8725 -4.2397 0.2635 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0402 -3.0635 -1.6366 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.1732 -3.8794 -1.7064 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7032 -2.5394 -3.0203 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.8382 -2.0217 -3.6509 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6617 -1.4447 -2.8344 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9121 -1.2526 -3.9942 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0239 -0.8634 0.0683 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3958 -0.9689 1.3899 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7763 -0.0675 -0.1097 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0995 -0.4403 -1.2844 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7981 3.5432 1.4889 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1774 4.8035 1.7961 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7430 2.6515 2.6864 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2092 3.3915 3.7712 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7881 1.4663 2.5095 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2384 1.1382 3.7204 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0756 3.0304 1.9655 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8395 4.0331 2.0012 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4270 3.3014 2.1733 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8699 4.7131 2.4288 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0135 -0.1082 1.9353 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2666 -1.1448 2.8236 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1352 -0.6039 0.5668 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2040 -1.3222 0.1742 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2716 -0.2737 -0.2737 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6640 -0.3280 0.3497 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2362 1.0086 -0.0510 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9497 0.6853 -4.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8676 0.9731 -5.5036 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9146 -0.5499 -5.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2061 -2.2031 -1.5103 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0225 -2.8876 -2.7491 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5533 -2.6257 -0.9911 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2749 -0.5651 -0.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8054 0.0351 -0.6792 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4053 1.0091 -1.0727 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6809 -1.1683 -4.0393 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1780 0.2672 -3.1636 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4221 -2.5903 -2.3731 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4188 -1.3587 -3.2391 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4055 -2.7043 0.5807 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0141 -1.1619 1.3111 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9808 -2.6822 1.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4628 -2.9645 -1.9444 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8783 -1.7487 -1.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4452 -3.4721 0.7065 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5425 -4.1438 0.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2996 -2.3198 2.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9508 -2.4510 2.7526 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1442 -1.0719 3.1848 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4030 0.4317 3.6117 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4798 0.3904 2.2297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3767 -0.3183 3.4933 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6834 1.8357 2.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8736 1.7796 3.9313 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7688 3.5449 3.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1342 3.2012 1.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3846 -0.2812 1.5036 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6594 3.0398 1.6788 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5463 3.8187 -0.1587 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8452 3.2374 -1.8826 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9623 3.9572 -0.6378 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7479 1.8124 0.9137 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3271 0.9092 -2.2086 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7649 1.2471 -2.4054 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9847 2.8021 -1.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5528 2.0688 0.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0934 -0.2868 -0.0686 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3368 -1.3985 -0.7310 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8176 -4.7822 -1.7913 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8053 -4.3026 0.6245 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3750 -3.4934 0.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3418 -5.2426 0.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2032 -2.1957 -0.9827 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9529 -4.6948 -2.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2333 -3.3130 -3.6637 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5321 -1.2053 -4.1268 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2783 -0.5149 -2.6456 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8032 -2.0988 -4.4730 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7743 -1.9139 -0.2697 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3696 -0.8601 1.5142 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0769 -0.3961 0.7159 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2964 -1.3787 -1.5161 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8727 3.8686 1.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5050 5.4200 1.1149 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7328 2.2979 3.0274 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8236 4.1639 3.9151 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3179 0.6120 2.0892 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1418 0.1567 3.8463 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6978 4.9847 2.1714 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1752 5.4091 1.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9756 4.9315 3.4931 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8625 4.8952 1.9479 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3165 -0.7146 3.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8547 -1.3528 3.7499 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9597 -2.0220 2.2544 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2322 -1.0050 -1.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0935 0.6976 -0.8230 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0626 1.3921 0.4971 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4062 0.9835 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4270 1.8107 0.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 5 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 12 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 39 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 31 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 27 61 1 0 61 62 1 0 61 63 2 0 63 64 1 0 25 65 1 0 65 66 1 0 65 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 70 71 1 0 70 15 1 0 70 19 1 0 65 21 1 0 63 24 1 0 59 29 1 0 53 34 1 0 49 41 1 0 1 72 1 0 1 73 1 0 1 74 1 0 6 75 1 0 6 76 1 0 6 77 1 0 7 78 1 0 7 79 1 0 7 80 1 0 8 81 1 0 8 82 1 0 9 83 1 0 9 84 1 0 13 85 1 0 13 86 1 0 13 87 1 0 14 88 1 0 15 89 1 0 16 90 1 0 17 91 1 0 18 92 1 0 18 93 1 0 20 94 1 0 20 95 1 0 20 96 1 0 21 97 1 0 22 98 1 0 22 99 1 0 23100 1 0 23101 1 0 26102 1 0 29103 1 0 31104 1 0 32105 1 0 32106 1 0 34107 1 0 36108 1 0 37109 1 0 37110 1 0 38111 1 0 39112 1 0 41113 1 0 43114 1 0 44115 1 0 44116 1 0 44117 1 0 45118 1 0 46119 1 0 47120 1 0 48121 1 0 49122 1 0 50123 1 0 51124 1 0 52125 1 0 53126 1 0 54127 1 0 55128 1 0 56129 1 0 57130 1 0 58131 1 0 59132 1 0 60133 1 0 62134 1 0 64135 1 0 64136 1 0 64137 1 0 66138 1 0 66139 1 0 66140 1 0 69141 1 0 69142 1 0 71143 1 0 71144 1 0 71145 1 0 M END 3D SDF for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])Mrv0541 05061308312D 71 77 0 0 0 0 999 V2000 2.2973 -2.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3640 -5.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2253 1.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1973 2.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9716 0.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6284 -1.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4662 0.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9503 0.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0886 -0.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9215 -2.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7336 -1.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7609 0.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2672 1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1382 -0.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4774 -1.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5745 0.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3875 -3.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3906 -1.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5776 -1.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4482 -5.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4081 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3897 -1.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6700 -0.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1602 -1.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3261 -0.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5754 -3.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1103 -0.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0139 -1.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9436 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7624 0.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0458 -0.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7285 -6.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6421 0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5406 -6.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3618 0.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2315 -3.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0724 -6.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4503 0.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9512 -2.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0436 -3.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9309 -0.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4830 -2.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7921 -5.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9821 0.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0845 1.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8261 -1.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1064 -0.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4821 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4373 0.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9194 -2.7626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0972 2.7600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9362 -1.3437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6327 1.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2306 0.8721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2336 -1.1154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1966 -7.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4542 -0.1444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8209 -7.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8936 1.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6997 -4.3643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8845 -6.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7306 1.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1391 -2.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7859 0.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2027 -1.5511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9800 -5.1403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7942 0.4364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2951 -2.4722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7018 -0.4847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3239 -4.6548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9017 1.3445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11 10 1 0 0 0 0 13 12 1 0 0 0 0 19 1 1 0 0 0 0 20 2 1 0 0 0 0 21 3 1 0 0 0 0 22 10 1 0 0 0 0 22 19 2 0 0 0 0 23 14 2 0 0 0 0 23 22 1 0 0 0 0 24 15 1 0 0 0 0 25 14 1 0 0 0 0 26 17 1 0 0 0 0 27 18 1 0 0 0 0 28 11 1 0 0 0 0 29 12 1 0 0 0 0 30 16 1 0 0 0 0 31 19 1 0 0 0 0 31 25 2 0 0 0 0 32 20 1 0 0 0 0 33 27 1 0 0 0 0 34 32 1 0 0 0 0 35 33 1 0 0 0 0 37 34 1 0 0 0 0 38 35 1 0 0 0 0 39 36 1 0 0 0 0 40 26 1 0 0 0 0 40 36 1 0 0 0 0 41 24 1 0 0 0 0 42 39 1 0 0 0 0 43 37 1 0 0 0 0 44 38 1 0 0 0 0 45 4 1 0 0 0 0 45 5 1 0 0 0 0 45 13 1 0 0 0 0 46 6 1 0 0 0 0 46 15 1 0 0 0 0 46 28 1 0 0 0 0 47 7 1 0 0 0 0 47 16 1 0 0 0 0 47 41 1 0 0 0 0 47 46 1 0 0 0 0 48 8 1 0 0 0 0 48 23 1 0 0 0 0 48 28 1 0 0 0 0 48 30 1 0 0 0 0 49 9 1 0 0 0 0 49 29 1 0 0 0 0 49 41 1 0 0 0 0 50 17 1 0 0 0 0 51 21 2 0 0 0 0 52 24 1 0 0 0 0 53 29 2 0 0 0 0 54 30 2 0 0 0 0 55 31 1 0 0 0 0 56 32 1 0 0 0 0 57 33 1 0 0 0 0 58 34 1 0 0 0 0 59 35 1 0 0 0 0 60 36 1 0 0 0 0 61 37 1 0 0 0 0 62 38 1 0 0 0 0 63 39 1 0 0 0 0 64 49 1 0 0 0 0 65 18 1 0 0 0 0 65 42 1 0 0 0 0 66 20 1 0 0 0 0 66 43 1 0 0 0 0 67 25 1 0 0 0 0 67 44 1 0 0 0 0 68 26 1 0 0 0 0 68 42 1 0 0 0 0 69 27 1 0 0 0 0 69 44 1 0 0 0 0 70 40 1 0 0 0 0 70 43 1 0 0 0 0 71 21 1 0 0 0 0 71 45 1 0 0 0 0 M END > <DATABASE_ID> HMDB0035498 > <DATABASE_NAME> hmdb > <SMILES> CC1OC(OC2C(CO)OC(OCC3OC(OC4=C(O)C(C)=C5CCC6C7(C)CC(O)C(C(C)(O)C(=O)CCC(C)(C)OC(C)=O)C7(C)CC(=O)C6(C)C5=C4)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C49H74O22/c1-19-22-10-11-28-46(6)15-24(52)41(49(9,64)29(53)12-13-45(4,5)71-21(3)51)47(46,7)16-30(54)48(28,8)23(22)14-25(31(19)55)67-44-38(62)35(59)33(57)27(69-44)18-65-42-39(63)36(60)40(26(17-50)68-42)70-43-37(61)34(58)32(56)20(2)66-43/h14,20,24,26-28,32-44,50,52,55-64H,10-13,15-18H2,1-9H3 > <INCHI_KEY> MTLIDTCASADKNT-UHFFFAOYSA-N > <FORMULA> C49H74O22 > <MOLECULAR_WEIGHT> 1015.0987 > <EXACT_MASS> 1014.467174052 > <JCHEM_ACCEPTOR_COUNT> 21 > <JCHEM_AVERAGE_POLARIZABILITY> 105.30819201388353 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 12 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 6-(4-{[6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-5,13-dihydroxy-1,6,11,15-tetramethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-2,4,6-trien-14-yl)-6-hydroxy-2-methyl-5-oxoheptan-2-yl acetate > <ALOGPS_LOGP> 1.11 > <JCHEM_LOGP> -0.7616836633333397 > <ALOGPS_LOGS> -2.94 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 7 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 11.77614129199247 > <JCHEM_PKA_STRONGEST_ACIDIC> 10.225512791214213 > <JCHEM_PKA_STRONGEST_BASIC> -3.6765054853622106 > <JCHEM_POLAR_SURFACE_AREA> 358.5800000000001 > <JCHEM_REFRACTIVITY> 241.91240000000008 > <JCHEM_ROTATABLE_BOND_COUNT> 15 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.17e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 6-(4-{[6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-5,13-dihydroxy-1,6,11,15-tetramethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-2,4,6-trien-14-yl)-6-hydroxy-2-methyl-5-oxoheptan-2-yl acetate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])HMDB0035498 RDKit 3D Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside] 145151 0 0 0 0 0 0 0 0999 V2000 14.2755 0.1845 -4.8549 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2178 -0.6210 -4.1677 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8138 -1.6943 -4.6731 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7061 -0.1755 -2.9935 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6863 -0.8477 -2.2217 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1496 -2.2444 -1.8510 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6812 -0.0353 -0.9261 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4367 -0.8347 -3.0015 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2344 -1.4875 -2.4566 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6327 -0.9496 -1.2138 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8989 0.1831 -0.9140 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7344 -1.7816 -0.3584 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5227 -2.0743 0.9149 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7619 -3.0722 -1.0029 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3289 -1.5047 -0.2416 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7396 -2.6240 0.6461 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5963 -3.1867 0.0275 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3229 -2.0199 1.9270 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5117 -0.5142 1.8131 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6790 -0.1666 2.6867 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3396 0.2112 2.4713 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6697 1.6210 2.8261 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7822 2.6968 2.3819 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3823 2.3252 2.1490 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0555 1.0391 1.9179 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7105 0.7542 1.7058 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3001 1.7016 1.7201 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5904 1.2845 1.4990 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7528 1.9557 1.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4583 1.8947 0.2655 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3181 2.9831 0.2081 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3285 3.0100 -0.8742 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1264 1.9751 -1.0095 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9252 1.4136 -0.1034 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2935 1.7864 -0.3045 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8970 1.0039 -1.2881 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2168 1.7220 -1.5933 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0312 1.7896 -0.4719 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2014 -0.3775 -0.7576 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5414 -1.2505 -1.7564 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8185 -1.8020 -1.6424 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6449 -3.1796 -1.4927 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8195 -3.8389 -1.1793 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8725 -4.2397 0.2635 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0402 -3.0635 -1.6366 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.1732 -3.8794 -1.7064 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7032 -2.5394 -3.0203 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.8382 -2.0217 -3.6509 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6617 -1.4447 -2.8344 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9121 -1.2526 -3.9942 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0239 -0.8634 0.0683 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3958 -0.9689 1.3899 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7763 -0.0675 -0.1097 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0995 -0.4403 -1.2844 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7981 3.5432 1.4889 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1774 4.8035 1.7961 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7430 2.6515 2.6864 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2092 3.3915 3.7712 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7881 1.4663 2.5095 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2384 1.1382 3.7204 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0756 3.0304 1.9655 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8395 4.0331 2.0012 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4270 3.3014 2.1733 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8699 4.7131 2.4288 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0135 -0.1082 1.9353 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2666 -1.1448 2.8236 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1352 -0.6039 0.5668 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2040 -1.3222 0.1742 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2716 -0.2737 -0.2737 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6640 -0.3280 0.3497 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2362 1.0086 -0.0510 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9497 0.6853 -4.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8676 0.9731 -5.5036 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9146 -0.5499 -5.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2061 -2.2031 -1.5103 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0225 -2.8876 -2.7491 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5533 -2.6257 -0.9911 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2749 -0.5651 -0.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8054 0.0351 -0.6792 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4053 1.0091 -1.0727 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6809 -1.1683 -4.0393 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1780 0.2672 -3.1636 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4221 -2.5903 -2.3731 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4188 -1.3587 -3.2391 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4055 -2.7043 0.5807 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0141 -1.1619 1.3111 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9808 -2.6822 1.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4628 -2.9645 -1.9444 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8783 -1.7487 -1.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4452 -3.4721 0.7065 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5425 -4.1438 0.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2996 -2.3198 2.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9508 -2.4510 2.7526 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1442 -1.0719 3.1848 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4030 0.4317 3.6117 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4798 0.3904 2.2297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3767 -0.3183 3.4933 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6834 1.8357 2.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8736 1.7796 3.9313 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7688 3.5449 3.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1342 3.2012 1.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3846 -0.2812 1.5036 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6594 3.0398 1.6788 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5463 3.8187 -0.1587 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8452 3.2374 -1.8826 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9623 3.9572 -0.6378 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7479 1.8124 0.9137 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3271 0.9092 -2.2086 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7649 1.2471 -2.4054 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9847 2.8021 -1.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5528 2.0688 0.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0934 -0.2868 -0.0686 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3368 -1.3985 -0.7310 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8176 -4.7822 -1.7913 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8053 -4.3026 0.6245 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3750 -3.4934 0.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3418 -5.2426 0.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2032 -2.1957 -0.9827 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9529 -4.6948 -2.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2333 -3.3130 -3.6637 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5321 -1.2053 -4.1268 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2783 -0.5149 -2.6456 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8032 -2.0988 -4.4730 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7743 -1.9139 -0.2697 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3696 -0.8601 1.5142 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0769 -0.3961 0.7159 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2964 -1.3787 -1.5161 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8727 3.8686 1.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5050 5.4200 1.1149 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7328 2.2979 3.0274 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8236 4.1639 3.9151 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3179 0.6120 2.0892 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1418 0.1567 3.8463 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6978 4.9847 2.1714 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1752 5.4091 1.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9756 4.9315 3.4931 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8625 4.8952 1.9479 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3165 -0.7146 3.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8547 -1.3528 3.7499 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9597 -2.0220 2.2544 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2322 -1.0050 -1.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0935 0.6976 -0.8230 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0626 1.3921 0.4971 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4062 0.9835 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4270 1.8107 0.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 5 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 12 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 39 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 31 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 27 61 1 0 61 62 1 0 61 63 2 0 63 64 1 0 25 65 1 0 65 66 1 0 65 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 70 71 1 0 70 15 1 0 70 19 1 0 65 21 1 0 63 24 1 0 59 29 1 0 53 34 1 0 49 41 1 0 1 72 1 0 1 73 1 0 1 74 1 0 6 75 1 0 6 76 1 0 6 77 1 0 7 78 1 0 7 79 1 0 7 80 1 0 8 81 1 0 8 82 1 0 9 83 1 0 9 84 1 0 13 85 1 0 13 86 1 0 13 87 1 0 14 88 1 0 15 89 1 0 16 90 1 0 17 91 1 0 18 92 1 0 18 93 1 0 20 94 1 0 20 95 1 0 20 96 1 0 21 97 1 0 22 98 1 0 22 99 1 0 23100 1 0 23101 1 0 26102 1 0 29103 1 0 31104 1 0 32105 1 0 32106 1 0 34107 1 0 36108 1 0 37109 1 0 37110 1 0 38111 1 0 39112 1 0 41113 1 0 43114 1 0 44115 1 0 44116 1 0 44117 1 0 45118 1 0 46119 1 0 47120 1 0 48121 1 0 49122 1 0 50123 1 0 51124 1 0 52125 1 0 53126 1 0 54127 1 0 55128 1 0 56129 1 0 57130 1 0 58131 1 0 59132 1 0 60133 1 0 62134 1 0 64135 1 0 64136 1 0 64137 1 0 66138 1 0 66139 1 0 66140 1 0 69141 1 0 69142 1 0 71143 1 0 71144 1 0 71145 1 0 M END PDB for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 4.288 -4.437 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 0.679 -10.501 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 22.821 3.515 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 19.035 4.246 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 18.614 1.195 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 10.506 -3.399 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 12.070 0.930 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 7.374 0.179 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 15.099 -0.235 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 7.320 -3.895 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 8.836 -3.624 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 16.354 1.715 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 17.299 2.931 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 5.858 -0.092 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 12.091 -2.849 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 10.406 0.722 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -6.323 -6.334 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -0.729 -2.624 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 4.812 -2.988 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -0.837 -10.773 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 21.295 3.725 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 6.327 -2.717 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 6.851 -1.269 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 13.366 -1.985 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 4.342 -0.363 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -4.807 -6.063 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -0.206 -1.176 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 9.359 -2.175 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 14.828 1.926 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 8.890 0.451 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 3.819 -1.811 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -1.360 -12.221 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -1.199 0.001 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -2.876 -12.492 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 -0.675 1.450 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -2.299 -6.969 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -3.868 -11.315 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 0.841 1.721 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -1.776 -5.521 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -3.815 -7.240 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 12.938 -0.506 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -2.768 -4.344 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 -3.345 -9.866 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 1.833 0.544 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 18.824 2.720 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 10.875 -1.904 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 11.399 -0.456 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 8.367 -0.998 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 13.883 0.710 0.000 0.00 0.00 C+0 HETATM 50 O UNK 0 -7.316 -5.157 0.000 0.00 0.00 O+0 HETATM 51 O UNK 0 20.715 5.152 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 14.814 -2.508 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 14.248 3.352 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 7.897 1.628 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 2.303 -2.082 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -0.367 -13.398 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 -2.715 -0.270 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 -3.399 -13.940 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 -1.668 2.627 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 -1.306 -8.147 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 -5.384 -11.586 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 1.364 3.169 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 -0.260 -5.250 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 12.667 1.655 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 -2.245 -2.895 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 -1.829 -9.595 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 3.349 0.815 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 -4.284 -4.615 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 1.310 -0.905 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 -4.338 -8.689 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 20.350 2.510 0.000 0.00 0.00 O+0 CONECT 1 19 CONECT 2 20 CONECT 3 21 CONECT 4 45 CONECT 5 45 CONECT 6 46 CONECT 7 47 CONECT 8 48 CONECT 9 49 CONECT 10 11 22 CONECT 11 10 28 CONECT 12 13 29 CONECT 13 12 45 CONECT 14 23 25 CONECT 15 24 46 CONECT 16 30 47 CONECT 17 26 50 CONECT 18 27 65 CONECT 19 1 22 31 CONECT 20 2 32 66 CONECT 21 3 51 71 CONECT 22 10 19 23 CONECT 23 14 22 48 CONECT 24 15 41 52 CONECT 25 14 31 67 CONECT 26 17 40 68 CONECT 27 18 33 69 CONECT 28 11 46 48 CONECT 29 12 49 53 CONECT 30 16 48 54 CONECT 31 19 25 55 CONECT 32 20 34 56 CONECT 33 27 35 57 CONECT 34 32 37 58 CONECT 35 33 38 59 CONECT 36 39 40 60 CONECT 37 34 43 61 CONECT 38 35 44 62 CONECT 39 36 42 63 CONECT 40 26 36 70 CONECT 41 24 47 49 CONECT 42 39 65 68 CONECT 43 37 66 70 CONECT 44 38 67 69 CONECT 45 4 5 13 71 CONECT 46 6 15 28 47 CONECT 47 7 16 41 46 CONECT 48 8 23 28 30 CONECT 49 9 29 41 64 CONECT 50 17 CONECT 51 21 CONECT 52 24 CONECT 53 29 CONECT 54 30 CONECT 55 31 CONECT 56 32 CONECT 57 33 CONECT 58 34 CONECT 59 35 CONECT 60 36 CONECT 61 37 CONECT 62 38 CONECT 63 39 CONECT 64 49 CONECT 65 18 42 CONECT 66 20 43 CONECT 67 25 44 CONECT 68 26 42 CONECT 69 27 44 CONECT 70 40 43 CONECT 71 21 45 MASTER 0 0 0 0 0 0 0 0 71 0 154 0 END 3D PDB for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])COMPND HMDB0035498 HETATM 1 C1 UNL 1 14.275 0.185 -4.855 1.00 0.00 C HETATM 2 C2 UNL 1 13.218 -0.621 -4.168 1.00 0.00 C HETATM 3 O1 UNL 1 12.814 -1.694 -4.673 1.00 0.00 O HETATM 4 O2 UNL 1 12.706 -0.176 -2.993 1.00 0.00 O HETATM 5 C3 UNL 1 11.686 -0.848 -2.222 1.00 0.00 C HETATM 6 C4 UNL 1 12.150 -2.244 -1.851 1.00 0.00 C HETATM 7 C5 UNL 1 11.681 -0.035 -0.926 1.00 0.00 C HETATM 8 C6 UNL 1 10.437 -0.835 -3.002 1.00 0.00 C HETATM 9 C7 UNL 1 9.234 -1.488 -2.457 1.00 0.00 C HETATM 10 C8 UNL 1 8.633 -0.950 -1.214 1.00 0.00 C HETATM 11 O3 UNL 1 8.899 0.183 -0.914 1.00 0.00 O HETATM 12 C9 UNL 1 7.734 -1.782 -0.358 1.00 0.00 C HETATM 13 C10 UNL 1 8.523 -2.074 0.915 1.00 0.00 C HETATM 14 O4 UNL 1 7.762 -3.072 -1.003 1.00 0.00 O HETATM 15 C11 UNL 1 6.329 -1.505 -0.242 1.00 0.00 C HETATM 16 C12 UNL 1 5.740 -2.624 0.646 1.00 0.00 C HETATM 17 O5 UNL 1 4.596 -3.187 0.027 1.00 0.00 O HETATM 18 C13 UNL 1 5.323 -2.020 1.927 1.00 0.00 C HETATM 19 C14 UNL 1 5.512 -0.514 1.813 1.00 0.00 C HETATM 20 C15 UNL 1 6.679 -0.167 2.687 1.00 0.00 C HETATM 21 C16 UNL 1 4.340 0.211 2.471 1.00 0.00 C HETATM 22 C17 UNL 1 4.670 1.621 2.826 1.00 0.00 C HETATM 23 C18 UNL 1 3.782 2.697 2.382 1.00 0.00 C HETATM 24 C19 UNL 1 2.382 2.325 2.149 1.00 0.00 C HETATM 25 C20 UNL 1 2.056 1.039 1.918 1.00 0.00 C HETATM 26 C21 UNL 1 0.710 0.754 1.706 1.00 0.00 C HETATM 27 C22 UNL 1 -0.300 1.702 1.720 1.00 0.00 C HETATM 28 O6 UNL 1 -1.590 1.285 1.499 1.00 0.00 O HETATM 29 C23 UNL 1 -2.753 1.956 1.495 1.00 0.00 C HETATM 30 O7 UNL 1 -3.458 1.895 0.266 1.00 0.00 O HETATM 31 C24 UNL 1 -4.318 2.983 0.208 1.00 0.00 C HETATM 32 C25 UNL 1 -5.328 3.010 -0.874 1.00 0.00 C HETATM 33 O8 UNL 1 -6.126 1.975 -1.009 1.00 0.00 O HETATM 34 C26 UNL 1 -6.925 1.414 -0.103 1.00 0.00 C HETATM 35 O9 UNL 1 -8.294 1.786 -0.304 1.00 0.00 O HETATM 36 C27 UNL 1 -8.897 1.004 -1.288 1.00 0.00 C HETATM 37 C28 UNL 1 -10.217 1.722 -1.593 1.00 0.00 C HETATM 38 O10 UNL 1 -11.031 1.790 -0.472 1.00 0.00 O HETATM 39 C29 UNL 1 -9.201 -0.377 -0.758 1.00 0.00 C HETATM 40 O11 UNL 1 -9.541 -1.250 -1.756 1.00 0.00 O HETATM 41 C30 UNL 1 -10.819 -1.802 -1.642 1.00 0.00 C HETATM 42 O12 UNL 1 -10.645 -3.180 -1.493 1.00 0.00 O HETATM 43 C31 UNL 1 -11.819 -3.839 -1.179 1.00 0.00 C HETATM 44 C32 UNL 1 -11.873 -4.240 0.264 1.00 0.00 C HETATM 45 C33 UNL 1 -13.040 -3.063 -1.637 1.00 0.00 C HETATM 46 O13 UNL 1 -14.173 -3.879 -1.706 1.00 0.00 O HETATM 47 C34 UNL 1 -12.703 -2.539 -3.020 1.00 0.00 C HETATM 48 O14 UNL 1 -13.838 -2.022 -3.651 1.00 0.00 O HETATM 49 C35 UNL 1 -11.662 -1.445 -2.834 1.00 0.00 C HETATM 50 O15 UNL 1 -10.912 -1.253 -3.994 1.00 0.00 O HETATM 51 C36 UNL 1 -8.024 -0.863 0.068 1.00 0.00 C HETATM 52 O16 UNL 1 -8.396 -0.969 1.390 1.00 0.00 O HETATM 53 C37 UNL 1 -6.776 -0.067 -0.110 1.00 0.00 C HETATM 54 O17 UNL 1 -6.100 -0.440 -1.284 1.00 0.00 O HETATM 55 C38 UNL 1 -4.798 3.543 1.489 1.00 0.00 C HETATM 56 O18 UNL 1 -4.177 4.803 1.796 1.00 0.00 O HETATM 57 C39 UNL 1 -4.743 2.651 2.686 1.00 0.00 C HETATM 58 O19 UNL 1 -4.209 3.391 3.771 1.00 0.00 O HETATM 59 C40 UNL 1 -3.788 1.466 2.510 1.00 0.00 C HETATM 60 O20 UNL 1 -3.238 1.138 3.720 1.00 0.00 O HETATM 61 C41 UNL 1 0.076 3.030 1.966 1.00 0.00 C HETATM 62 O21 UNL 1 -0.840 4.033 2.001 1.00 0.00 O HETATM 63 C42 UNL 1 1.427 3.301 2.173 1.00 0.00 C HETATM 64 C43 UNL 1 1.870 4.713 2.429 1.00 0.00 C HETATM 65 C44 UNL 1 3.013 -0.108 1.935 1.00 0.00 C HETATM 66 C45 UNL 1 2.267 -1.145 2.824 1.00 0.00 C HETATM 67 C46 UNL 1 3.135 -0.604 0.567 1.00 0.00 C HETATM 68 O22 UNL 1 2.204 -1.322 0.174 1.00 0.00 O HETATM 69 C47 UNL 1 4.272 -0.274 -0.274 1.00 0.00 C HETATM 70 C48 UNL 1 5.664 -0.328 0.350 1.00 0.00 C HETATM 71 C49 UNL 1 6.236 1.009 -0.051 1.00 0.00 C HETATM 72 H1 UNL 1 14.950 0.685 -4.133 1.00 0.00 H HETATM 73 H2 UNL 1 13.868 0.973 -5.504 1.00 0.00 H HETATM 74 H3 UNL 1 14.915 -0.550 -5.396 1.00 0.00 H HETATM 75 H4 UNL 1 13.206 -2.203 -1.510 1.00 0.00 H HETATM 76 H5 UNL 1 12.023 -2.888 -2.749 1.00 0.00 H HETATM 77 H6 UNL 1 11.553 -2.626 -0.991 1.00 0.00 H HETATM 78 H7 UNL 1 11.275 -0.565 -0.070 1.00 0.00 H HETATM 79 H8 UNL 1 12.805 0.035 -0.679 1.00 0.00 H HETATM 80 H9 UNL 1 11.405 1.009 -1.073 1.00 0.00 H HETATM 81 H10 UNL 1 10.681 -1.168 -4.039 1.00 0.00 H HETATM 82 H11 UNL 1 10.178 0.267 -3.164 1.00 0.00 H HETATM 83 H12 UNL 1 9.422 -2.590 -2.373 1.00 0.00 H HETATM 84 H13 UNL 1 8.419 -1.359 -3.239 1.00 0.00 H HETATM 85 H14 UNL 1 9.405 -2.704 0.581 1.00 0.00 H HETATM 86 H15 UNL 1 9.014 -1.162 1.311 1.00 0.00 H HETATM 87 H16 UNL 1 7.981 -2.682 1.603 1.00 0.00 H HETATM 88 H17 UNL 1 7.463 -2.965 -1.944 1.00 0.00 H HETATM 89 H18 UNL 1 5.878 -1.749 -1.267 1.00 0.00 H HETATM 90 H19 UNL 1 6.445 -3.472 0.707 1.00 0.00 H HETATM 91 H20 UNL 1 4.543 -4.144 0.197 1.00 0.00 H HETATM 92 H21 UNL 1 4.300 -2.320 2.200 1.00 0.00 H HETATM 93 H22 UNL 1 5.951 -2.451 2.753 1.00 0.00 H HETATM 94 H23 UNL 1 7.144 -1.072 3.185 1.00 0.00 H HETATM 95 H24 UNL 1 6.403 0.432 3.612 1.00 0.00 H HETATM 96 H25 UNL 1 7.480 0.390 2.230 1.00 0.00 H HETATM 97 H26 UNL 1 4.377 -0.318 3.493 1.00 0.00 H HETATM 98 H27 UNL 1 5.683 1.836 2.381 1.00 0.00 H HETATM 99 H28 UNL 1 4.874 1.780 3.931 1.00 0.00 H HETATM 100 H29 UNL 1 3.769 3.545 3.133 1.00 0.00 H HETATM 101 H30 UNL 1 4.134 3.201 1.452 1.00 0.00 H HETATM 102 H31 UNL 1 0.385 -0.281 1.504 1.00 0.00 H HETATM 103 H32 UNL 1 -2.659 3.040 1.679 1.00 0.00 H HETATM 104 H33 UNL 1 -3.546 3.819 -0.159 1.00 0.00 H HETATM 105 H34 UNL 1 -4.845 3.237 -1.883 1.00 0.00 H HETATM 106 H35 UNL 1 -5.962 3.957 -0.638 1.00 0.00 H HETATM 107 H36 UNL 1 -6.748 1.812 0.914 1.00 0.00 H HETATM 108 H37 UNL 1 -8.327 0.909 -2.209 1.00 0.00 H HETATM 109 H38 UNL 1 -10.765 1.247 -2.405 1.00 0.00 H HETATM 110 H39 UNL 1 -9.985 2.802 -1.847 1.00 0.00 H HETATM 111 H40 UNL 1 -10.553 2.069 0.350 1.00 0.00 H HETATM 112 H41 UNL 1 -10.093 -0.287 -0.069 1.00 0.00 H HETATM 113 H42 UNL 1 -11.337 -1.399 -0.731 1.00 0.00 H HETATM 114 H43 UNL 1 -11.818 -4.782 -1.791 1.00 0.00 H HETATM 115 H44 UNL 1 -10.805 -4.303 0.624 1.00 0.00 H HETATM 116 H45 UNL 1 -12.375 -3.493 0.904 1.00 0.00 H HETATM 117 H46 UNL 1 -12.342 -5.243 0.347 1.00 0.00 H HETATM 118 H47 UNL 1 -13.203 -2.196 -0.983 1.00 0.00 H HETATM 119 H48 UNL 1 -13.953 -4.695 -2.235 1.00 0.00 H HETATM 120 H49 UNL 1 -12.233 -3.313 -3.664 1.00 0.00 H HETATM 121 H50 UNL 1 -13.532 -1.205 -4.127 1.00 0.00 H HETATM 122 H51 UNL 1 -12.278 -0.515 -2.646 1.00 0.00 H HETATM 123 H52 UNL 1 -10.803 -2.099 -4.473 1.00 0.00 H HETATM 124 H53 UNL 1 -7.774 -1.914 -0.270 1.00 0.00 H HETATM 125 H54 UNL 1 -9.370 -0.860 1.514 1.00 0.00 H HETATM 126 H55 UNL 1 -6.077 -0.396 0.716 1.00 0.00 H HETATM 127 H56 UNL 1 -6.296 -1.379 -1.516 1.00 0.00 H HETATM 128 H57 UNL 1 -5.873 3.869 1.358 1.00 0.00 H HETATM 129 H58 UNL 1 -4.505 5.420 1.115 1.00 0.00 H HETATM 130 H59 UNL 1 -5.733 2.298 3.027 1.00 0.00 H HETATM 131 H60 UNL 1 -4.824 4.164 3.915 1.00 0.00 H HETATM 132 H61 UNL 1 -4.318 0.612 2.089 1.00 0.00 H HETATM 133 H62 UNL 1 -3.142 0.157 3.846 1.00 0.00 H HETATM 134 H63 UNL 1 -0.698 4.985 2.171 1.00 0.00 H HETATM 135 H64 UNL 1 1.175 5.409 1.942 1.00 0.00 H HETATM 136 H65 UNL 1 1.976 4.931 3.493 1.00 0.00 H HETATM 137 H66 UNL 1 2.863 4.895 1.948 1.00 0.00 H HETATM 138 H67 UNL 1 1.316 -0.715 3.235 1.00 0.00 H HETATM 139 H68 UNL 1 2.855 -1.353 3.750 1.00 0.00 H HETATM 140 H69 UNL 1 1.960 -2.022 2.254 1.00 0.00 H HETATM 141 H70 UNL 1 4.232 -1.005 -1.159 1.00 0.00 H HETATM 142 H71 UNL 1 4.094 0.698 -0.823 1.00 0.00 H HETATM 143 H72 UNL 1 7.063 1.392 0.497 1.00 0.00 H HETATM 144 H73 UNL 1 6.406 0.983 -1.142 1.00 0.00 H HETATM 145 H74 UNL 1 5.427 1.811 0.027 1.00 0.00 H CONECT 1 2 72 73 74 CONECT 2 3 3 4 CONECT 4 5 CONECT 5 6 7 8 CONECT 6 75 76 77 CONECT 7 78 79 80 CONECT 8 9 81 82 CONECT 9 10 83 84 CONECT 10 11 11 12 CONECT 12 13 14 15 CONECT 13 85 86 87 CONECT 14 88 CONECT 15 16 70 89 CONECT 16 17 18 90 CONECT 17 91 CONECT 18 19 92 93 CONECT 19 20 21 70 CONECT 20 94 95 96 CONECT 21 22 65 97 CONECT 22 23 98 99 CONECT 23 24 100 101 CONECT 24 25 25 63 CONECT 25 26 65 CONECT 26 27 27 102 CONECT 27 28 61 CONECT 28 29 CONECT 29 30 59 103 CONECT 30 31 CONECT 31 32 55 104 CONECT 32 33 105 106 CONECT 33 34 CONECT 34 35 53 107 CONECT 35 36 CONECT 36 37 39 108 CONECT 37 38 109 110 CONECT 38 111 CONECT 39 40 51 112 CONECT 40 41 CONECT 41 42 49 113 CONECT 42 43 CONECT 43 44 45 114 CONECT 44 115 116 117 CONECT 45 46 47 118 CONECT 46 119 CONECT 47 48 49 120 CONECT 48 121 CONECT 49 50 122 CONECT 50 123 CONECT 51 52 53 124 CONECT 52 125 CONECT 53 54 126 CONECT 54 127 CONECT 55 56 57 128 CONECT 56 129 CONECT 57 58 59 130 CONECT 58 131 CONECT 59 60 132 CONECT 60 133 CONECT 61 62 63 63 CONECT 62 134 CONECT 63 64 CONECT 64 135 136 137 CONECT 65 66 67 CONECT 66 138 139 140 CONECT 67 68 68 69 CONECT 69 70 141 142 CONECT 70 71 CONECT 71 143 144 145 END SMILES for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])CC1OC(OC2C(CO)OC(OCC3OC(OC4=C(O)C(C)=C5CCC6C7(C)CC(O)C(C(C)(O)C(=O)CCC(C)(C)OC(C)=O)C7(C)CC(=O)C6(C)C5=C4)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O INCHI for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside])InChI=1S/C49H74O22/c1-19-22-10-11-28-46(6)15-24(52)41(49(9,64)29(53)12-13-45(4,5)71-21(3)51)47(46,7)16-30(54)48(28,8)23(22)14-25(31(19)55)67-44-38(62)35(59)33(57)27(69-44)18-65-42-39(63)36(60)40(26(17-50)68-42)70-43-37(61)34(58)32(56)20(2)66-43/h14,20,24,26-28,32-44,50,52,55-64H,10-13,15-18H2,1-9H3 3D Structure for HMDB0035498 (Fevicordin B 2-[rhamnosyl-(1->4)-glucosyl-(1->6)-glucoside]) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C49H74O22 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1015.0987 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1014.467174052 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 6-(4-{[6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-5,13-dihydroxy-1,6,11,15-tetramethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-2,4,6-trien-14-yl)-6-hydroxy-2-methyl-5-oxoheptan-2-yl acetate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 6-(4-{[6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-5,13-dihydroxy-1,6,11,15-tetramethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-2,4,6-trien-14-yl)-6-hydroxy-2-methyl-5-oxoheptan-2-yl acetate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 178062-93-6 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OC2C(CO)OC(OCC3OC(OC4=C(O)C(C)=C5CCC6C7(C)CC(O)C(C(C)(O)C(=O)CCC(C)(C)OC(C)=O)C7(C)CC(=O)C6(C)C5=C4)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C49H74O22/c1-19-22-10-11-28-46(6)15-24(52)41(49(9,64)29(53)12-13-45(4,5)71-21(3)51)47(46,7)16-30(54)48(28,8)23(22)14-25(31(19)55)67-44-38(62)35(59)33(57)27(69-44)18-65-42-39(63)36(60)40(26(17-50)68-42)70-43-37(61)34(58)32(56)20(2)66-43/h14,20,24,26-28,32-44,50,52,55-64H,10-13,15-18H2,1-9H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | MTLIDTCASADKNT-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|