Showing metabocard for Viniferol A (HMDB0036352)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 21:29:10 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:54:53 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0036352 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Viniferol A | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Viniferol A belongs to the class of organic compounds known as 2-arylbenzofuran flavonoids. These are phenylpropanoids containing the 2-phenylbenzofuran moiety. Viniferol A is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, viniferol a has been detected, but not quantified in, alcoholic beverages and fruits. This could make viniferol a a potential biomarker for the consumption of these foods. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0036352 (Viniferol A)Mrv0541 05061309052D 68 79 0 0 1 0 999 V2000 5.7301 -3.7235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -3.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -3.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -4.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -4.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -5.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -6.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -9.9218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -9.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -5.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -3.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -3.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -3.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1459 -6.1872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1459 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8706 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8706 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1459 -8.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -6.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -5.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -5.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -4.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -5.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -5.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -6.1983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -8.6732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -9.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -10.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -11.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -10.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -9.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -9.9218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -1.2486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -3.7235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5952 -8.6621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3825 -4.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -11.1481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 29 1 0 0 0 0 3 4 1 0 0 0 0 3 35 1 0 0 0 0 4 28 1 0 0 0 0 4 5 2 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 7 41 1 0 0 0 0 8 9 1 0 0 0 0 8 28 2 0 0 0 0 9 10 1 0 0 0 0 9 42 1 0 0 0 0 10 24 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 28 1 0 0 0 0 12 13 1 0 0 0 0 12 48 1 0 0 0 0 13 18 2 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 14 54 1 0 0 0 0 15 16 1 0 0 0 0 16 17 2 0 0 0 0 16 55 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 23 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 56 1 0 0 0 0 21 22 1 0 0 0 0 22 27 1 0 0 0 0 22 23 2 0 0 0 0 23 24 1 0 0 0 0 24 25 2 0 0 0 0 25 26 1 0 0 0 0 26 27 2 0 0 0 0 26 62 1 0 0 0 0 29 30 1 0 0 0 0 29 34 2 0 0 0 0 30 31 2 0 0 0 0 31 32 1 0 0 0 0 32 33 2 0 0 0 0 32 63 1 0 0 0 0 33 34 1 0 0 0 0 35 36 2 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 37 64 1 0 0 0 0 38 39 1 0 0 0 0 39 40 2 0 0 0 0 39 65 1 0 0 0 0 42 43 1 0 0 0 0 42 47 2 0 0 0 0 43 44 2 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 45 66 1 0 0 0 0 46 47 1 0 0 0 0 48 49 2 0 0 0 0 48 53 1 0 0 0 0 49 50 1 0 0 0 0 50 51 2 0 0 0 0 51 52 1 0 0 0 0 51 67 1 0 0 0 0 52 53 2 0 0 0 0 56 57 1 0 0 0 0 56 61 2 0 0 0 0 57 58 2 0 0 0 0 58 59 1 0 0 0 0 59 60 2 0 0 0 0 59 68 1 0 0 0 0 60 61 1 0 0 0 0 M END 3D MOL for HMDB0036352 (Viniferol A)HMDB0036352 RDKit 3D Viniferol A 110121 0 0 0 0 0 0 0 0999 V2000 -8.0371 -4.5124 -1.9466 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1289 -3.4623 -1.7766 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5825 -2.2510 -1.2973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7271 -1.1878 -1.1126 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3751 -1.3171 -1.4095 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4976 -0.1773 -1.2414 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9657 0.7761 -0.2547 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8242 1.5949 -0.0446 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6850 2.9320 0.2396 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4219 3.5285 0.3973 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3793 4.8909 0.6888 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3458 2.7156 0.2538 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4441 1.3397 -0.0278 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6787 0.7943 -0.1776 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1743 -0.5259 -0.5053 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5520 -1.4012 0.6141 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2914 -1.0194 1.6818 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6520 -1.8744 2.7144 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4060 -1.4448 3.7815 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2333 -3.1785 2.6461 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4655 -3.6208 1.5618 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0539 -4.9620 1.5246 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1390 -2.7419 0.5747 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0243 0.8624 0.0232 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2768 -0.5263 0.1457 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5441 -1.4308 -0.9429 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3205 -2.8045 -0.8151 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5541 -3.6842 -1.8422 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0228 -3.2416 -3.0503 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2702 -4.1256 -4.1204 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2511 -1.9174 -3.2113 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0106 -1.0313 -2.1622 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2592 -0.6858 1.3159 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5729 -1.1783 2.3808 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7729 -1.4986 2.2332 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1393 -1.3829 3.6225 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4586 -1.0800 3.8129 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0879 -1.2607 5.0341 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1752 -0.5690 2.7102 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6086 -0.3719 1.4880 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6094 0.1188 0.5888 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2754 1.3501 -0.2023 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4937 1.8600 -0.5484 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6486 2.9952 -1.3825 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5448 3.6150 -1.8699 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6829 4.7418 -2.7001 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3184 3.1173 -1.5333 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1333 1.9955 -0.7040 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6647 1.9305 -0.7035 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1317 3.0831 0.1882 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2147 4.4232 -0.2654 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1332 5.2982 0.3276 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2573 6.6119 -0.0149 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4623 7.1380 -0.9821 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6030 8.4861 -1.3202 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4470 6.3393 -1.5937 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5827 5.0095 -1.2569 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5474 1.1481 0.0010 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0033 0.2743 1.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8075 -0.9985 0.8887 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9005 -1.5452 -0.3930 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6434 -2.7023 -0.5707 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2808 -3.3075 0.4891 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0151 -4.4656 0.2701 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1720 -2.7475 1.7360 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4342 -1.5872 1.9474 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9089 -2.5073 -1.8854 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7960 -3.5732 -2.0644 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7228 -5.4126 -2.2989 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6366 -2.1249 -1.0580 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1248 -0.2366 -0.7289 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1924 0.3472 -2.1539 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5726 3.5444 0.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2330 5.3987 0.7734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5907 -1.0652 -1.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6272 -0.0116 1.7806 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4185 -1.4835 3.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4624 -3.9113 3.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3027 -5.5978 2.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5405 -3.1075 -0.2494 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1870 1.2288 1.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6826 -0.9502 0.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0480 -3.2069 0.1131 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3761 -4.7594 -1.7347 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1814 -4.5532 -4.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6274 -1.5552 -4.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2150 -0.0232 -2.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3337 -1.8644 2.9780 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5237 -1.7779 4.4140 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5244 -2.1724 5.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1971 -0.3478 2.9554 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6738 -0.7488 -0.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6355 3.3730 -1.6343 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8961 5.2266 -3.0786 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4900 3.6187 -2.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2617 2.0846 -1.7397 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4866 2.9455 1.2253 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7791 4.9059 1.1010 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9872 7.2827 0.4643 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2626 9.0862 -0.8842 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0877 6.7692 -2.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3059 4.4026 -1.7619 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1673 0.7655 1.9662 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3975 -1.0494 -1.2004 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7037 -3.1107 -1.5688 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6410 -5.3917 0.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6525 -3.1843 2.5979 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3846 -1.1800 2.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8722 -2.6988 -2.1630 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4343 -4.5239 -2.4418 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 10 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 18 20 2 0 20 21 1 0 21 22 1 0 21 23 2 0 13 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 29 31 1 0 31 32 2 0 25 33 1 0 33 34 2 0 34 35 1 0 34 36 1 0 36 37 2 0 37 38 1 0 37 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 2 0 45 46 1 0 45 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 2 0 52 53 1 0 53 54 2 0 54 55 1 0 54 56 1 0 56 57 2 0 43 58 1 0 58 59 1 0 59 60 1 0 60 61 2 0 61 62 1 0 62 63 2 0 63 64 1 0 63 65 1 0 65 66 2 0 5 67 1 0 67 68 2 0 68 2 1 0 15 6 1 0 23 16 1 0 49 24 1 0 57 51 1 0 66 60 1 0 14 8 1 0 32 26 1 0 40 33 1 0 59 41 1 0 50 12 1 0 48 42 1 0 1 69 1 0 3 70 1 0 4 71 1 0 6 72 1 0 9 73 1 0 11 74 1 0 15 75 1 0 17 76 1 0 19 77 1 0 20 78 1 0 22 79 1 0 23 80 1 0 24 81 1 0 25 82 1 0 27 83 1 0 28 84 1 0 30 85 1 0 31 86 1 0 32 87 1 0 35 88 1 0 36 89 1 0 38 90 1 0 39 91 1 0 41 92 1 0 44 93 1 0 46 94 1 0 47 95 1 0 49 96 1 0 50 97 1 0 52 98 1 0 53 99 1 0 55100 1 0 56101 1 0 57102 1 0 59103 1 0 61104 1 0 62105 1 0 64106 1 0 65107 1 0 66108 1 0 67109 1 0 68110 1 0 M END 3D SDF for HMDB0036352 (Viniferol A)Mrv0541 05061309052D 68 79 0 0 1 0 999 V2000 5.7301 -3.7235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -3.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -3.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -4.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -4.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -5.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -6.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -9.9218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -8.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -9.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -5.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7301 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -3.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -3.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -3.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1459 -6.1872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1459 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8706 -7.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8706 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1459 -8.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -8.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -6.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -5.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5897 -5.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -4.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -5.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -5.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -6.1983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -8.6732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -9.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1404 -10.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -11.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -10.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7135 -9.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -9.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4436 -9.9218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0055 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8539 -1.2486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -3.7235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5952 -8.6621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3825 -4.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -11.1481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 29 1 0 0 0 0 3 4 1 0 0 0 0 3 35 1 0 0 0 0 4 28 1 0 0 0 0 4 5 2 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 7 41 1 0 0 0 0 8 9 1 0 0 0 0 8 28 2 0 0 0 0 9 10 1 0 0 0 0 9 42 1 0 0 0 0 10 24 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 28 1 0 0 0 0 12 13 1 0 0 0 0 12 48 1 0 0 0 0 13 18 2 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 14 54 1 0 0 0 0 15 16 1 0 0 0 0 16 17 2 0 0 0 0 16 55 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 23 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 56 1 0 0 0 0 21 22 1 0 0 0 0 22 27 1 0 0 0 0 22 23 2 0 0 0 0 23 24 1 0 0 0 0 24 25 2 0 0 0 0 25 26 1 0 0 0 0 26 27 2 0 0 0 0 26 62 1 0 0 0 0 29 30 1 0 0 0 0 29 34 2 0 0 0 0 30 31 2 0 0 0 0 31 32 1 0 0 0 0 32 33 2 0 0 0 0 32 63 1 0 0 0 0 33 34 1 0 0 0 0 35 36 2 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 37 64 1 0 0 0 0 38 39 1 0 0 0 0 39 40 2 0 0 0 0 39 65 1 0 0 0 0 42 43 1 0 0 0 0 42 47 2 0 0 0 0 43 44 2 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 45 66 1 0 0 0 0 46 47 1 0 0 0 0 48 49 2 0 0 0 0 48 53 1 0 0 0 0 49 50 1 0 0 0 0 50 51 2 0 0 0 0 51 52 1 0 0 0 0 51 67 1 0 0 0 0 52 53 2 0 0 0 0 56 57 1 0 0 0 0 56 61 2 0 0 0 0 57 58 2 0 0 0 0 58 59 1 0 0 0 0 59 60 2 0 0 0 0 59 68 1 0 0 0 0 60 61 1 0 0 0 0 M END > <DATABASE_ID> HMDB0036352 > <DATABASE_NAME> hmdb > <SMILES> OC1=CC=C(C=C1)C1OC2=C(C1C1=CC(O)=CC(O)=C1)C1=C(C(C3C1C(C1=CC=C(O)C=C1)C1=C(C=C(O)C=C1O)C1C(OC4=C1C3=CC(O)=C4)C1=CC=C(O)C=C1)C1=CC=C(O)C=C1)C(O)=C2 > <INCHI_IDENTIFIER> InChI=1S/C56H42O12/c57-30-9-1-25(2-10-30)44-47-38(20-36(63)22-40(47)65)50-48-39(21-37(64)23-42(48)67-56(50)28-7-15-33(60)16-8-28)49-45(26-3-11-31(58)12-4-26)51-41(66)24-43-52(54(51)53(44)49)46(29-17-34(61)19-35(62)18-29)55(68-43)27-5-13-32(59)14-6-27/h1-24,44-46,49-50,53,55-66H > <INCHI_KEY> LSNFJDFYAZDWFX-UHFFFAOYSA-N > <FORMULA> C56H42O12 > <MOLECULAR_WEIGHT> 906.9255 > <EXACT_MASS> 906.267626808 > <JCHEM_ACCEPTOR_COUNT> 12 > <JCHEM_AVERAGE_POLARIZABILITY> 92.50335293566448 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 10-(3,5-dihydroxyphenyl)-3,9,14,22-tetrakis(4-hydroxyphenyl)-8,23-dioxaheptacyclo[19.6.1.0²,¹³.0⁴,¹².0⁷,¹¹.0¹⁵,²⁰.0²⁴,²⁸]octacosa-1(27),4(12),5,7(11),15(20),16,18,24(28),25-nonaene-5,16,18,26-tetrol > <ALOGPS_LOGP> 6.09 > <JCHEM_LOGP> 10.430361719333334 > <ALOGPS_LOGS> -5.87 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 12 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 9.054614313817067 > <JCHEM_PKA_STRONGEST_ACIDIC> 8.664746234933936 > <JCHEM_PKA_STRONGEST_BASIC> -5.453814625357972 > <JCHEM_POLAR_SURFACE_AREA> 220.75999999999996 > <JCHEM_REFRACTIVITY> 253.10999999999999 > <JCHEM_ROTATABLE_BOND_COUNT> 5 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.23e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> 10-(3,5-dihydroxyphenyl)-3,9,14,22-tetrakis(4-hydroxyphenyl)-8,23-dioxaheptacyclo[19.6.1.0²,¹³.0⁴,¹².0⁷,¹¹.0¹⁵,²⁰.0²⁴,²⁸]octacosa-1(27),4(12),5,7(11),15(20),16,18,24(28),25-nonaene-5,16,18,26-tetrol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0036352 (Viniferol A)HMDB0036352 RDKit 3D Viniferol A 110121 0 0 0 0 0 0 0 0999 V2000 -8.0371 -4.5124 -1.9466 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1289 -3.4623 -1.7766 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5825 -2.2510 -1.2973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7271 -1.1878 -1.1126 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3751 -1.3171 -1.4095 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4976 -0.1773 -1.2414 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9657 0.7761 -0.2547 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8242 1.5949 -0.0446 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6850 2.9320 0.2396 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4219 3.5285 0.3973 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3793 4.8909 0.6888 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3458 2.7156 0.2538 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4441 1.3397 -0.0278 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6787 0.7943 -0.1776 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1743 -0.5259 -0.5053 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5520 -1.4012 0.6141 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2914 -1.0194 1.6818 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6520 -1.8744 2.7144 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4060 -1.4448 3.7815 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2333 -3.1785 2.6461 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4655 -3.6208 1.5618 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0539 -4.9620 1.5246 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1390 -2.7419 0.5747 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0243 0.8624 0.0232 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2768 -0.5263 0.1457 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5441 -1.4308 -0.9429 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3205 -2.8045 -0.8151 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5541 -3.6842 -1.8422 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0228 -3.2416 -3.0503 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2702 -4.1256 -4.1204 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2511 -1.9174 -3.2113 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0106 -1.0313 -2.1622 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2592 -0.6858 1.3159 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5729 -1.1783 2.3808 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7729 -1.4986 2.2332 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1393 -1.3829 3.6225 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4586 -1.0800 3.8129 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0879 -1.2607 5.0341 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1752 -0.5690 2.7102 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6086 -0.3719 1.4880 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6094 0.1188 0.5888 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2754 1.3501 -0.2023 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4937 1.8600 -0.5484 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6486 2.9952 -1.3825 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5448 3.6150 -1.8699 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6829 4.7418 -2.7001 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3184 3.1173 -1.5333 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1333 1.9955 -0.7040 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6647 1.9305 -0.7035 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1317 3.0831 0.1882 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2147 4.4232 -0.2654 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1332 5.2982 0.3276 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2573 6.6119 -0.0149 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4623 7.1380 -0.9821 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6030 8.4861 -1.3202 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4470 6.3393 -1.5937 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5827 5.0095 -1.2569 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5474 1.1481 0.0010 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0033 0.2743 1.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8075 -0.9985 0.8887 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9005 -1.5452 -0.3930 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6434 -2.7023 -0.5707 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2808 -3.3075 0.4891 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0151 -4.4656 0.2701 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1720 -2.7475 1.7360 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4342 -1.5872 1.9474 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9089 -2.5073 -1.8854 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7960 -3.5732 -2.0644 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7228 -5.4126 -2.2989 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6366 -2.1249 -1.0580 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1248 -0.2366 -0.7289 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1924 0.3472 -2.1539 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5726 3.5444 0.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2330 5.3987 0.7734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5907 -1.0652 -1.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6272 -0.0116 1.7806 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4185 -1.4835 3.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4624 -3.9113 3.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3027 -5.5978 2.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5405 -3.1075 -0.2494 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1870 1.2288 1.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6826 -0.9502 0.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0480 -3.2069 0.1131 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3761 -4.7594 -1.7347 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1814 -4.5532 -4.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6274 -1.5552 -4.1790 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2150 -0.0232 -2.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3337 -1.8644 2.9780 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5237 -1.7779 4.4140 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5244 -2.1724 5.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1971 -0.3478 2.9554 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6738 -0.7488 -0.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6355 3.3730 -1.6343 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8961 5.2266 -3.0786 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4900 3.6187 -2.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2617 2.0846 -1.7397 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4866 2.9455 1.2253 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7791 4.9059 1.1010 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9872 7.2827 0.4643 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2626 9.0862 -0.8842 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0877 6.7692 -2.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3059 4.4026 -1.7619 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1673 0.7655 1.9662 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3975 -1.0494 -1.2004 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7037 -3.1107 -1.5688 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6410 -5.3917 0.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6525 -3.1843 2.5979 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3846 -1.1800 2.9519 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8722 -2.6988 -2.1630 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4343 -4.5239 -2.4418 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 10 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 18 20 2 0 20 21 1 0 21 22 1 0 21 23 2 0 13 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 29 31 1 0 31 32 2 0 25 33 1 0 33 34 2 0 34 35 1 0 34 36 1 0 36 37 2 0 37 38 1 0 37 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 2 0 45 46 1 0 45 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 2 0 52 53 1 0 53 54 2 0 54 55 1 0 54 56 1 0 56 57 2 0 43 58 1 0 58 59 1 0 59 60 1 0 60 61 2 0 61 62 1 0 62 63 2 0 63 64 1 0 63 65 1 0 65 66 2 0 5 67 1 0 67 68 2 0 68 2 1 0 15 6 1 0 23 16 1 0 49 24 1 0 57 51 1 0 66 60 1 0 14 8 1 0 32 26 1 0 40 33 1 0 59 41 1 0 50 12 1 0 48 42 1 0 1 69 1 0 3 70 1 0 4 71 1 0 6 72 1 0 9 73 1 0 11 74 1 0 15 75 1 0 17 76 1 0 19 77 1 0 20 78 1 0 22 79 1 0 23 80 1 0 24 81 1 0 25 82 1 0 27 83 1 0 28 84 1 0 30 85 1 0 31 86 1 0 32 87 1 0 35 88 1 0 36 89 1 0 38 90 1 0 39 91 1 0 41 92 1 0 44 93 1 0 46 94 1 0 47 95 1 0 49 96 1 0 50 97 1 0 52 98 1 0 53 99 1 0 55100 1 0 56101 1 0 57102 1 0 59103 1 0 61104 1 0 62105 1 0 64106 1 0 65107 1 0 66108 1 0 67109 1 0 68110 1 0 M END PDB for HMDB0036352 (Viniferol A)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 O UNK 0 10.696 -6.951 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 9.344 -6.181 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 8.032 -6.951 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 9.344 -9.281 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 10.696 -8.490 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 12.028 -9.281 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 12.028 -10.800 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 10.696 -11.549 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 10.696 -13.110 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 9.344 -13.901 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 8.032 -13.110 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 5.327 -13.110 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 3.995 -13.901 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 2.684 -13.110 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 1.332 -13.901 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 1.332 -15.420 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 2.684 -16.190 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 3.995 -15.420 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 5.327 -16.190 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 5.327 -17.730 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 6.701 -18.521 0.000 0.00 0.00 O+0 HETATM 22 C UNK 0 8.032 -17.730 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 8.032 -16.190 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 9.344 -15.420 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 10.696 -16.190 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 10.696 -17.730 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 9.344 -18.521 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 9.344 -10.800 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 9.344 -4.620 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 8.032 -3.871 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 8.032 -2.310 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 9.344 -1.540 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 10.696 -2.310 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 10.696 -3.871 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 6.701 -6.181 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 6.701 -4.620 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 5.327 -3.871 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 3.995 -4.620 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 3.995 -6.181 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 5.327 -6.951 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 13.339 -11.549 0.000 0.00 0.00 O+0 HETATM 42 C UNK 0 12.028 -13.901 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 13.339 -13.110 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 14.692 -13.901 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 14.692 -15.420 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 13.339 -16.169 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 12.028 -15.420 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 5.327 -11.778 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 6.701 -11.008 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 6.701 -9.489 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 5.327 -8.698 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 3.995 -9.489 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 3.995 -11.008 0.000 0.00 0.00 C+0 HETATM 54 O UNK 0 2.684 -11.570 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 0.000 -16.190 0.000 0.00 0.00 O+0 HETATM 56 C UNK 0 3.995 -18.521 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 3.995 -20.040 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 2.684 -20.810 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 1.332 -20.040 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 1.332 -18.521 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 2.684 -17.730 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 12.028 -18.521 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 9.344 0.000 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 5.327 -2.331 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 2.684 -6.951 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 16.044 -16.169 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 4.447 -7.694 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 0.000 -20.810 0.000 0.00 0.00 O+0 CONECT 1 5 2 CONECT 2 1 3 29 CONECT 3 2 4 35 CONECT 4 3 28 5 CONECT 5 1 4 6 CONECT 6 5 7 CONECT 7 6 8 41 CONECT 8 7 9 28 CONECT 9 8 10 42 CONECT 10 9 24 11 CONECT 11 10 12 28 CONECT 12 11 13 48 CONECT 13 12 18 14 CONECT 14 13 15 54 CONECT 15 14 16 CONECT 16 15 17 55 CONECT 17 16 18 CONECT 18 13 17 19 CONECT 19 18 23 20 CONECT 20 19 21 56 CONECT 21 20 22 CONECT 22 21 27 23 CONECT 23 19 22 24 CONECT 24 10 23 25 CONECT 25 24 26 CONECT 26 25 27 62 CONECT 27 22 26 CONECT 28 4 8 11 CONECT 29 2 30 34 CONECT 30 29 31 CONECT 31 30 32 CONECT 32 31 33 63 CONECT 33 32 34 CONECT 34 29 33 CONECT 35 3 36 40 CONECT 36 35 37 CONECT 37 36 38 64 CONECT 38 37 39 CONECT 39 38 40 65 CONECT 40 35 39 CONECT 41 7 CONECT 42 9 43 47 CONECT 43 42 44 CONECT 44 43 45 CONECT 45 44 46 66 CONECT 46 45 47 CONECT 47 42 46 CONECT 48 12 49 53 CONECT 49 48 50 CONECT 50 49 51 CONECT 51 50 52 67 CONECT 52 51 53 CONECT 53 48 52 CONECT 54 14 CONECT 55 16 CONECT 56 20 57 61 CONECT 57 56 58 CONECT 58 57 59 CONECT 59 58 60 68 CONECT 60 59 61 CONECT 61 56 60 CONECT 62 26 CONECT 63 32 CONECT 64 37 CONECT 65 39 CONECT 66 45 CONECT 67 51 CONECT 68 59 MASTER 0 0 0 0 0 0 0 0 68 0 158 0 END 3D PDB for HMDB0036352 (Viniferol A)COMPND HMDB0036352 HETATM 1 O1 UNL 1 -8.037 -4.512 -1.947 1.00 0.00 O HETATM 2 C1 UNL 1 -7.129 -3.462 -1.777 1.00 0.00 C HETATM 3 C2 UNL 1 -7.583 -2.251 -1.297 1.00 0.00 C HETATM 4 C3 UNL 1 -6.727 -1.188 -1.113 1.00 0.00 C HETATM 5 C4 UNL 1 -5.375 -1.317 -1.410 1.00 0.00 C HETATM 6 C5 UNL 1 -4.498 -0.177 -1.241 1.00 0.00 C HETATM 7 O2 UNL 1 -4.966 0.776 -0.255 1.00 0.00 O HETATM 8 C6 UNL 1 -3.824 1.595 -0.045 1.00 0.00 C HETATM 9 C7 UNL 1 -3.685 2.932 0.240 1.00 0.00 C HETATM 10 C8 UNL 1 -2.422 3.528 0.397 1.00 0.00 C HETATM 11 O3 UNL 1 -2.379 4.891 0.689 1.00 0.00 O HETATM 12 C9 UNL 1 -1.346 2.716 0.254 1.00 0.00 C HETATM 13 C10 UNL 1 -1.444 1.340 -0.028 1.00 0.00 C HETATM 14 C11 UNL 1 -2.679 0.794 -0.178 1.00 0.00 C HETATM 15 C12 UNL 1 -3.174 -0.526 -0.505 1.00 0.00 C HETATM 16 C13 UNL 1 -3.552 -1.401 0.614 1.00 0.00 C HETATM 17 C14 UNL 1 -4.291 -1.019 1.682 1.00 0.00 C HETATM 18 C15 UNL 1 -4.652 -1.874 2.714 1.00 0.00 C HETATM 19 O4 UNL 1 -5.406 -1.445 3.782 1.00 0.00 O HETATM 20 C16 UNL 1 -4.233 -3.178 2.646 1.00 0.00 C HETATM 21 C17 UNL 1 -3.466 -3.621 1.562 1.00 0.00 C HETATM 22 O5 UNL 1 -3.054 -4.962 1.525 1.00 0.00 O HETATM 23 C18 UNL 1 -3.139 -2.742 0.575 1.00 0.00 C HETATM 24 C19 UNL 1 -0.024 0.862 0.023 1.00 0.00 C HETATM 25 C20 UNL 1 0.277 -0.526 0.146 1.00 0.00 C HETATM 26 C21 UNL 1 0.544 -1.431 -0.943 1.00 0.00 C HETATM 27 C22 UNL 1 0.320 -2.804 -0.815 1.00 0.00 C HETATM 28 C23 UNL 1 0.554 -3.684 -1.842 1.00 0.00 C HETATM 29 C24 UNL 1 1.023 -3.242 -3.050 1.00 0.00 C HETATM 30 O6 UNL 1 1.270 -4.126 -4.120 1.00 0.00 O HETATM 31 C25 UNL 1 1.251 -1.917 -3.211 1.00 0.00 C HETATM 32 C26 UNL 1 1.011 -1.031 -2.162 1.00 0.00 C HETATM 33 C27 UNL 1 1.259 -0.686 1.316 1.00 0.00 C HETATM 34 C28 UNL 1 0.573 -1.178 2.381 1.00 0.00 C HETATM 35 O7 UNL 1 -0.773 -1.499 2.233 1.00 0.00 O HETATM 36 C29 UNL 1 1.139 -1.383 3.622 1.00 0.00 C HETATM 37 C30 UNL 1 2.459 -1.080 3.813 1.00 0.00 C HETATM 38 O8 UNL 1 3.088 -1.261 5.034 1.00 0.00 O HETATM 39 C31 UNL 1 3.175 -0.569 2.710 1.00 0.00 C HETATM 40 C32 UNL 1 2.609 -0.372 1.488 1.00 0.00 C HETATM 41 C33 UNL 1 3.609 0.119 0.589 1.00 0.00 C HETATM 42 C34 UNL 1 3.275 1.350 -0.202 1.00 0.00 C HETATM 43 C35 UNL 1 4.494 1.860 -0.548 1.00 0.00 C HETATM 44 C36 UNL 1 4.649 2.995 -1.382 1.00 0.00 C HETATM 45 C37 UNL 1 3.545 3.615 -1.870 1.00 0.00 C HETATM 46 O9 UNL 1 3.683 4.742 -2.700 1.00 0.00 O HETATM 47 C38 UNL 1 2.318 3.117 -1.533 1.00 0.00 C HETATM 48 C39 UNL 1 2.133 1.996 -0.704 1.00 0.00 C HETATM 49 C40 UNL 1 0.665 1.930 -0.704 1.00 0.00 C HETATM 50 C41 UNL 1 0.132 3.083 0.188 1.00 0.00 C HETATM 51 C42 UNL 1 0.215 4.423 -0.265 1.00 0.00 C HETATM 52 C43 UNL 1 1.133 5.298 0.328 1.00 0.00 C HETATM 53 C44 UNL 1 1.257 6.612 -0.015 1.00 0.00 C HETATM 54 C45 UNL 1 0.462 7.138 -0.982 1.00 0.00 C HETATM 55 O10 UNL 1 0.603 8.486 -1.320 1.00 0.00 O HETATM 56 C46 UNL 1 -0.447 6.339 -1.594 1.00 0.00 C HETATM 57 C47 UNL 1 -0.583 5.009 -1.257 1.00 0.00 C HETATM 58 O11 UNL 1 5.547 1.148 0.001 1.00 0.00 O HETATM 59 C48 UNL 1 5.003 0.274 1.008 1.00 0.00 C HETATM 60 C49 UNL 1 5.807 -0.998 0.889 1.00 0.00 C HETATM 61 C50 UNL 1 5.900 -1.545 -0.393 1.00 0.00 C HETATM 62 C51 UNL 1 6.643 -2.702 -0.571 1.00 0.00 C HETATM 63 C52 UNL 1 7.281 -3.308 0.489 1.00 0.00 C HETATM 64 O12 UNL 1 8.015 -4.466 0.270 1.00 0.00 O HETATM 65 C53 UNL 1 7.172 -2.748 1.736 1.00 0.00 C HETATM 66 C54 UNL 1 6.434 -1.587 1.947 1.00 0.00 C HETATM 67 C55 UNL 1 -4.909 -2.507 -1.885 1.00 0.00 C HETATM 68 C56 UNL 1 -5.796 -3.573 -2.064 1.00 0.00 C HETATM 69 H1 UNL 1 -7.723 -5.413 -2.299 1.00 0.00 H HETATM 70 H2 UNL 1 -8.637 -2.125 -1.058 1.00 0.00 H HETATM 71 H3 UNL 1 -7.125 -0.237 -0.729 1.00 0.00 H HETATM 72 H4 UNL 1 -4.192 0.347 -2.154 1.00 0.00 H HETATM 73 H5 UNL 1 -4.573 3.544 0.347 1.00 0.00 H HETATM 74 H6 UNL 1 -3.233 5.399 0.773 1.00 0.00 H HETATM 75 H7 UNL 1 -2.591 -1.065 -1.281 1.00 0.00 H HETATM 76 H8 UNL 1 -4.627 -0.012 1.781 1.00 0.00 H HETATM 77 H9 UNL 1 -6.419 -1.484 3.780 1.00 0.00 H HETATM 78 H10 UNL 1 -4.462 -3.911 3.396 1.00 0.00 H HETATM 79 H11 UNL 1 -3.303 -5.598 2.261 1.00 0.00 H HETATM 80 H12 UNL 1 -2.540 -3.108 -0.249 1.00 0.00 H HETATM 81 H13 UNL 1 0.187 1.229 1.172 1.00 0.00 H HETATM 82 H14 UNL 1 -0.683 -0.950 0.641 1.00 0.00 H HETATM 83 H15 UNL 1 -0.048 -3.207 0.113 1.00 0.00 H HETATM 84 H16 UNL 1 0.376 -4.759 -1.735 1.00 0.00 H HETATM 85 H17 UNL 1 2.181 -4.553 -4.228 1.00 0.00 H HETATM 86 H18 UNL 1 1.627 -1.555 -4.179 1.00 0.00 H HETATM 87 H19 UNL 1 1.215 -0.023 -2.400 1.00 0.00 H HETATM 88 H20 UNL 1 -1.334 -1.864 2.978 1.00 0.00 H HETATM 89 H21 UNL 1 0.524 -1.778 4.414 1.00 0.00 H HETATM 90 H22 UNL 1 3.524 -2.172 5.187 1.00 0.00 H HETATM 91 H23 UNL 1 4.197 -0.348 2.955 1.00 0.00 H HETATM 92 H24 UNL 1 3.674 -0.749 -0.223 1.00 0.00 H HETATM 93 H25 UNL 1 5.635 3.373 -1.634 1.00 0.00 H HETATM 94 H26 UNL 1 2.896 5.227 -3.079 1.00 0.00 H HETATM 95 H27 UNL 1 1.490 3.619 -2.009 1.00 0.00 H HETATM 96 H28 UNL 1 0.262 2.085 -1.740 1.00 0.00 H HETATM 97 H29 UNL 1 0.487 2.946 1.225 1.00 0.00 H HETATM 98 H30 UNL 1 1.779 4.906 1.101 1.00 0.00 H HETATM 99 H31 UNL 1 1.987 7.283 0.464 1.00 0.00 H HETATM 100 H32 UNL 1 1.263 9.086 -0.884 1.00 0.00 H HETATM 101 H33 UNL 1 -1.088 6.769 -2.376 1.00 0.00 H HETATM 102 H34 UNL 1 -1.306 4.403 -1.762 1.00 0.00 H HETATM 103 H35 UNL 1 5.167 0.765 1.966 1.00 0.00 H HETATM 104 H36 UNL 1 5.398 -1.049 -1.200 1.00 0.00 H HETATM 105 H37 UNL 1 6.704 -3.111 -1.569 1.00 0.00 H HETATM 106 H38 UNL 1 7.641 -5.392 0.326 1.00 0.00 H HETATM 107 H39 UNL 1 7.652 -3.184 2.598 1.00 0.00 H HETATM 108 H40 UNL 1 6.385 -1.180 2.952 1.00 0.00 H HETATM 109 H41 UNL 1 -3.872 -2.699 -2.163 1.00 0.00 H HETATM 110 H42 UNL 1 -5.434 -4.524 -2.442 1.00 0.00 H CONECT 1 2 69 CONECT 2 3 3 68 CONECT 3 4 70 CONECT 4 5 5 71 CONECT 5 6 67 CONECT 6 7 15 72 CONECT 7 8 CONECT 8 9 9 14 CONECT 9 10 73 CONECT 10 11 12 12 CONECT 11 74 CONECT 12 13 50 CONECT 13 14 14 24 CONECT 14 15 CONECT 15 16 75 CONECT 16 17 17 23 CONECT 17 18 76 CONECT 18 19 20 20 CONECT 19 77 CONECT 20 21 78 CONECT 21 22 23 23 CONECT 22 79 CONECT 23 80 CONECT 24 25 49 81 CONECT 25 26 33 82 CONECT 26 27 27 32 CONECT 27 28 83 CONECT 28 29 29 84 CONECT 29 30 31 CONECT 30 85 CONECT 31 32 32 86 CONECT 32 87 CONECT 33 34 34 40 CONECT 34 35 36 CONECT 35 88 CONECT 36 37 37 89 CONECT 37 38 39 CONECT 38 90 CONECT 39 40 40 91 CONECT 40 41 CONECT 41 42 59 92 CONECT 42 43 43 48 CONECT 43 44 58 CONECT 44 45 45 93 CONECT 45 46 47 CONECT 46 94 CONECT 47 48 48 95 CONECT 48 49 CONECT 49 50 96 CONECT 50 51 97 CONECT 51 52 52 57 CONECT 52 53 98 CONECT 53 54 54 99 CONECT 54 55 56 CONECT 55 100 CONECT 56 57 57 101 CONECT 57 102 CONECT 58 59 CONECT 59 60 103 CONECT 60 61 61 66 CONECT 61 62 104 CONECT 62 63 63 105 CONECT 63 64 65 CONECT 64 106 CONECT 65 66 66 107 CONECT 66 108 CONECT 67 68 68 109 CONECT 68 110 END SMILES for HMDB0036352 (Viniferol A)OC1=CC=C(C=C1)C1OC2=C(C1C1=CC(O)=CC(O)=C1)C1=C(C(C3C1C(C1=CC=C(O)C=C1)C1=C(C=C(O)C=C1O)C1C(OC4=C1C3=CC(O)=C4)C1=CC=C(O)C=C1)C1=CC=C(O)C=C1)C(O)=C2 INCHI for HMDB0036352 (Viniferol A)InChI=1S/C56H42O12/c57-30-9-1-25(2-10-30)44-47-38(20-36(63)22-40(47)65)50-48-39(21-37(64)23-42(48)67-56(50)28-7-15-33(60)16-8-28)49-45(26-3-11-31(58)12-4-26)51-41(66)24-43-52(54(51)53(44)49)46(29-17-34(61)19-35(62)18-29)55(68-43)27-5-13-32(59)14-6-27/h1-24,44-46,49-50,53,55-66H 3D Structure for HMDB0036352 (Viniferol A) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C56H42O12 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 906.9255 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 906.267626808 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 10-(3,5-dihydroxyphenyl)-3,9,14,22-tetrakis(4-hydroxyphenyl)-8,23-dioxaheptacyclo[19.6.1.0²,¹³.0⁴,¹².0⁷,¹¹.0¹⁵,²⁰.0²⁴,²⁸]octacosa-1(27),4(12),5,7(11),15(20),16,18,24(28),25-nonaene-5,16,18,26-tetrol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 10-(3,5-dihydroxyphenyl)-3,9,14,22-tetrakis(4-hydroxyphenyl)-8,23-dioxaheptacyclo[19.6.1.0²,¹³.0⁴,¹².0⁷,¹¹.0¹⁵,²⁰.0²⁴,²⁸]octacosa-1(27),4(12),5,7(11),15(20),16,18,24(28),25-nonaene-5,16,18,26-tetrol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | OC1=CC=C(C=C1)C1OC2=C(C1C1=CC(O)=CC(O)=C1)C1=C(C(C3C1C(C1=CC=C(O)C=C1)C1=C(C=C(O)C=C1O)C1C(OC4=C1C3=CC(O)=C4)C1=CC=C(O)C=C1)C1=CC=C(O)C=C1)C(O)=C2 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C56H42O12/c57-30-9-1-25(2-10-30)44-47-38(20-36(63)22-40(47)65)50-48-39(21-37(64)23-42(48)67-56(50)28-7-15-33(60)16-8-28)49-45(26-3-11-31(58)12-4-26)51-41(66)24-43-52(54(51)53(44)49)46(29-17-34(61)19-35(62)18-29)55(68-43)27-5-13-32(59)14-6-27/h1-24,44-46,49-50,53,55-66H | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | LSNFJDFYAZDWFX-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as 2-arylbenzofuran flavonoids. These are phenylpropanoids containing the 2-phenylbenzofuran moiety. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | 2-arylbenzofuran flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | 2-arylbenzofuran flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB015226 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 73819536 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|