Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (4) Show 4 proteins XML

Show more...Show more...Show more...

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:38:41 UTC

Update Date

2022-03-07 02:55:18 UTC

HMDB ID

HMDB0037400

Secondary Accession Numbers

HMDB37400

Metabolite Identification

Common Name

(+)-Catechin 6-C-glucoside

Description

(+)-Catechin 6-C-glucoside belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone (+)-Catechin 6-C-glucoside has been detected, but not quantified in, green vegetables. This could make (+)-catechin 6-C-glucoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on (+)-Catechin 6-C-glucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061309462D          

 32 35  0  0  0  0            999 V2000
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  7  1  1  0  0  0  0
  7  3  2  0  0  0  0
  8  4  1  0  0  0  0
  9  2  1  0  0  0  0
 10  3  1  0  0  0  0
 10  9  2  0  0  0  0
 11  5  2  0  0  0  0
 12  4  1  0  0  0  0
 13  5  1  0  0  0  0
 13  8  2  0  0  0  0
 14  6  1  0  0  0  0
 15 11  1  0  0  0  0
 16  8  1  0  0  0  0
 16 15  2  0  0  0  0
 17 14  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20  7  1  0  0  0  0
 20 12  1  0  0  0  0
 21 15  1  0  0  0  0
 21 19  1  0  0  0  0
 22  6  1  0  0  0  0
 23  9  1  0  0  0  0
 24 10  1  0  0  0  0
 25 11  1  0  0  0  0
 26 12  1  0  0  0  0
 27 16  1  0  0  0  0
 28 17  1  0  0  0  0
 29 18  1  0  0  0  0
 30 19  1  0  0  0  0
 31 13  1  0  0  0  0
 31 20  1  0  0  0  0
 32 14  1  0  0  0  0
 32 21  1  0  0  0  0
M  END

HMDB0037400
     RDKit          3D
(+)-Catechin 6-C-glucoside
 56 59  0  0  0  0  0  0  0  0999 V2000
   -7.1694   -0.4539    1.2618 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8755   -0.9195    1.1334 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9438    0.2841    0.9276 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6848   -0.2139    0.8061 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9517    0.5296   -0.1297 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5104    0.3843    0.0601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0124    0.8800    1.2660 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8805    1.4731    2.1997 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3056    0.8161    1.5909 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1805    0.2404    0.6954 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7177   -0.2517   -0.4905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6165   -0.1767   -0.7969 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0812   -0.6719   -1.9839 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6583   -0.8601   -1.4456 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1011   -0.4292   -1.1912 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3497    0.8385   -1.6580 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3862   -0.6031    0.2743 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7887   -0.3404    0.6284 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1512   -0.3078    1.9663 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4624   -0.0577    2.2907 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4002    0.1573    1.2827 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7333    0.4124    1.5874 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0578    0.1283   -0.0429 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9767    0.3400   -1.0544 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7218   -0.1270   -0.3521 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5125    0.1981    1.0700 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5167    0.2221   -1.4608 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7943   -1.1443   -1.6014 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8965    0.9064   -1.5097 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7811    0.2507   -2.3269 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4406    1.1713   -0.1474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3345    2.5357    0.2133 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3595   -0.2836    2.2131 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8374   -1.6059    0.2723 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5306   -1.4968    2.0207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    0.8633    1.8965 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1966    1.6078    0.1056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5720    1.8371    3.0667 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6734    1.2140    2.5476 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4660   -1.1002   -2.6452 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6016   -1.9528   -1.3304 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4440   -0.5404   -2.5079 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -1.1463   -1.7575 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6015    0.8001   -2.6275 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1457   -1.6860    0.4988 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4214   -0.4750    2.7491 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8202   -0.0172    3.3211 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9974    0.4362    2.5625 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7323    0.3209   -2.0347 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4437   -0.1497   -1.3837 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9376    0.6116   -2.3322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7851   -1.4276   -2.5670 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7186    1.9184   -1.9830 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6860   -0.7097   -2.3937 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5596    1.0085   -0.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0041    3.0878   -0.5376 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 17 26  1  0
  5 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31  3  1  0
 12  6  1  0
 25 18  1  0
 26 10  1  0
  1 33  1  0
  2 34  1  0
  2 35  1  0
  3 36  1  0
  5 37  1  0
  8 38  1  0
  9 39  1  0
 13 40  1  0
 14 41  1  0
 14 42  1  0
 15 43  1  0
 16 44  1  0
 17 45  1  0
 19 46  1  0
 20 47  1  0
 22 48  1  0
 24 49  1  0
 25 50  1  0
 27 51  1  0
 28 52  1  0
 29 53  1  0
 30 54  1  0
 31 55  1  0
 32 56  1  0
M  END

  Mrv0541 05061309462D          

 32 35  0  0  0  0            999 V2000
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  7  1  1  0  0  0  0
  7  3  2  0  0  0  0
  8  4  1  0  0  0  0
  9  2  1  0  0  0  0
 10  3  1  0  0  0  0
 10  9  2  0  0  0  0
 11  5  2  0  0  0  0
 12  4  1  0  0  0  0
 13  5  1  0  0  0  0
 13  8  2  0  0  0  0
 14  6  1  0  0  0  0
 15 11  1  0  0  0  0
 16  8  1  0  0  0  0
 16 15  2  0  0  0  0
 17 14  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20  7  1  0  0  0  0
 20 12  1  0  0  0  0
 21 15  1  0  0  0  0
 21 19  1  0  0  0  0
 22  6  1  0  0  0  0
 23  9  1  0  0  0  0
 24 10  1  0  0  0  0
 25 11  1  0  0  0  0
 26 12  1  0  0  0  0
 27 16  1  0  0  0  0
 28 17  1  0  0  0  0
 29 18  1  0  0  0  0
 30 19  1  0  0  0  0
 31 13  1  0  0  0  0
 31 20  1  0  0  0  0
 32 14  1  0  0  0  0
 32 21  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037400

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(C(O)C2)C2=CC(O)=C(O)C=C2)C=C1O

> <INCHI_IDENTIFIER>
InChI=1S/C21H24O11/c22-6-14-17(28)18(29)19(30)21(32-14)15-11(25)5-13-8(16(15)27)4-12(26)20(31-13)7-1-2-9(23)10(24)3-7/h1-3,5,12,14,17-30H,4,6H2

> <INCHI_KEY>
PWMSPKVTJLJDDS-UHFFFAOYSA-N

> <FORMULA>
C21H24O11

> <MOLECULAR_WEIGHT>
452.4087

> <EXACT_MASS>
452.13186161

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_AVERAGE_POLARIZABILITY>
44.10218167178499

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <ALOGPS_LOGP>
-0.64

> <JCHEM_LOGP>
-0.9622138896666665

> <ALOGPS_LOGS>
-2.08

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.38099296581375

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.781192058058062

> <JCHEM_PKA_STRONGEST_BASIC>
-3.292320040483612

> <JCHEM_POLAR_SURFACE_AREA>
200.52999999999997

> <JCHEM_REFRACTIVITY>
107.11799999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
3

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.77e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037400
     RDKit          3D
(+)-Catechin 6-C-glucoside
 56 59  0  0  0  0  0  0  0  0999 V2000
   -7.1694   -0.4539    1.2618 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8755   -0.9195    1.1334 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9438    0.2841    0.9276 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6848   -0.2139    0.8061 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9517    0.5296   -0.1297 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5104    0.3843    0.0601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0124    0.8800    1.2660 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8805    1.4731    2.1997 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3056    0.8161    1.5909 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1805    0.2404    0.6954 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7177   -0.2517   -0.4905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6165   -0.1767   -0.7969 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0812   -0.6719   -1.9839 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6583   -0.8601   -1.4456 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1011   -0.4292   -1.1912 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3497    0.8385   -1.6580 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3862   -0.6031    0.2743 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7887   -0.3404    0.6284 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1512   -0.3078    1.9663 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4624   -0.0577    2.2907 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4002    0.1573    1.2827 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7333    0.4124    1.5874 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0578    0.1283   -0.0429 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9767    0.3400   -1.0544 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7218   -0.1270   -0.3521 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5125    0.1981    1.0700 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5167    0.2221   -1.4608 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7943   -1.1443   -1.6014 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8965    0.9064   -1.5097 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7811    0.2507   -2.3269 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4406    1.1713   -0.1474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3345    2.5357    0.2133 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3595   -0.2836    2.2131 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8374   -1.6059    0.2723 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5306   -1.4968    2.0207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    0.8633    1.8965 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1966    1.6078    0.1056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5720    1.8371    3.0667 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6734    1.2140    2.5476 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4660   -1.1002   -2.6452 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6016   -1.9528   -1.3304 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4440   -0.5404   -2.5079 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -1.1463   -1.7575 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6015    0.8001   -2.6275 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1457   -1.6860    0.4988 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4214   -0.4750    2.7491 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8202   -0.0172    3.3211 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9974    0.4362    2.5625 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7323    0.3209   -2.0347 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4437   -0.1497   -1.3837 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9376    0.6116   -2.3322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7851   -1.4276   -2.5670 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7186    1.9184   -1.9830 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6860   -0.7097   -2.3937 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5596    1.0085   -0.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0041    3.0878   -0.5376 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 17 26  1  0
  5 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31  3  1  0
 12  6  1  0
 25 18  1  0
 26 10  1  0
  1 33  1  0
  2 34  1  0
  2 35  1  0
  3 36  1  0
  5 37  1  0
  8 38  1  0
  9 39  1  0
 13 40  1  0
 14 41  1  0
 14 42  1  0
 15 43  1  0
 16 44  1  0
 17 45  1  0
 19 46  1  0
 20 47  1  0
 22 48  1  0
 24 49  1  0
 25 50  1  0
 27 51  1  0
 28 52  1  0
 29 53  1  0
 30 54  1  0
 31 55  1  0
 32 56  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -5.335   1.540   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -5.335   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       8.002   6.160   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       6.668   6.930   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       5.335   6.160   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0      10.669   4.620   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      -6.668  -0.770   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0      -4.001  -2.310   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0      -2.667   4.620   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0       2.667   6.160   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       9.336   6.930   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       6.668   8.470   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       4.001   6.930   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
CONECT    1    2    7                                                       
CONECT    2    1    9                                                       
CONECT    3    7   10                                                       
CONECT    4    8   12                                                       
CONECT    5   11   13                                                       
CONECT    6   14   22                                                       
CONECT    7    1    3   20                                                  
CONECT    8    4   13   16                                                  
CONECT    9    2   10   23                                                  
CONECT   10    3    9   24                                                  
CONECT   11    5   15   25                                                  
CONECT   12    4   20   26                                                  
CONECT   13    5    8   31                                                  
CONECT   14    6   17   32                                                  
CONECT   15   11   16   21                                                  
CONECT   16    8   15   27                                                  
CONECT   17   14   18   28                                                  
CONECT   18   17   19   29                                                  
CONECT   19   18   21   30                                                  
CONECT   20    7   12   31                                                  
CONECT   21   15   19   32                                                  
CONECT   22    6                                                            
CONECT   23    9                                                            
CONECT   24   10                                                            
CONECT   25   11                                                            
CONECT   26   12                                                            
CONECT   27   16                                                            
CONECT   28   17                                                            
CONECT   29   18                                                            
CONECT   30   19                                                            
CONECT   31   13   20                                                       
CONECT   32   14   21                                                       
MASTER        0    0    0    0    0    0    0    0   32    0   70    0
END

COMPND    HMDB0037400
HETATM    1  O1  UNL     1      -7.169  -0.454   1.262  1.00  0.00           O  
HETATM    2  C1  UNL     1      -5.876  -0.919   1.133  1.00  0.00           C  
HETATM    3  C2  UNL     1      -4.944   0.284   0.928  1.00  0.00           C  
HETATM    4  O2  UNL     1      -3.685  -0.214   0.806  1.00  0.00           O  
HETATM    5  C3  UNL     1      -2.952   0.530  -0.130  1.00  0.00           C  
HETATM    6  C4  UNL     1      -1.510   0.384   0.060  1.00  0.00           C  
HETATM    7  C5  UNL     1      -1.012   0.880   1.266  1.00  0.00           C  
HETATM    8  O3  UNL     1      -1.881   1.473   2.200  1.00  0.00           O  
HETATM    9  C6  UNL     1       0.306   0.816   1.591  1.00  0.00           C  
HETATM   10  C7  UNL     1       1.180   0.240   0.695  1.00  0.00           C  
HETATM   11  C8  UNL     1       0.718  -0.252  -0.490  1.00  0.00           C  
HETATM   12  C9  UNL     1      -0.616  -0.177  -0.797  1.00  0.00           C  
HETATM   13  O4  UNL     1      -1.081  -0.672  -1.984  1.00  0.00           O  
HETATM   14  C10 UNL     1       1.658  -0.860  -1.446  1.00  0.00           C  
HETATM   15  C11 UNL     1       3.101  -0.429  -1.191  1.00  0.00           C  
HETATM   16  O5  UNL     1       3.350   0.838  -1.658  1.00  0.00           O  
HETATM   17  C12 UNL     1       3.386  -0.603   0.274  1.00  0.00           C  
HETATM   18  C13 UNL     1       4.789  -0.340   0.628  1.00  0.00           C  
HETATM   19  C14 UNL     1       5.151  -0.308   1.966  1.00  0.00           C  
HETATM   20  C15 UNL     1       6.462  -0.058   2.291  1.00  0.00           C  
HETATM   21  C16 UNL     1       7.400   0.157   1.283  1.00  0.00           C  
HETATM   22  O6  UNL     1       8.733   0.412   1.587  1.00  0.00           O  
HETATM   23  C17 UNL     1       7.058   0.128  -0.043  1.00  0.00           C  
HETATM   24  O7  UNL     1       7.977   0.340  -1.054  1.00  0.00           O  
HETATM   25  C18 UNL     1       5.722  -0.127  -0.352  1.00  0.00           C  
HETATM   26  O8  UNL     1       2.513   0.198   1.070  1.00  0.00           O  
HETATM   27  C19 UNL     1      -3.517   0.222  -1.461  1.00  0.00           C  
HETATM   28  O9  UNL     1      -3.794  -1.144  -1.601  1.00  0.00           O  
HETATM   29  C20 UNL     1      -4.896   0.906  -1.510  1.00  0.00           C  
HETATM   30  O10 UNL     1      -5.781   0.251  -2.327  1.00  0.00           O  
HETATM   31  C21 UNL     1      -5.441   1.171  -0.147  1.00  0.00           C  
HETATM   32  O11 UNL     1      -5.334   2.536   0.213  1.00  0.00           O  
HETATM   33  H1  UNL     1      -7.360  -0.284   2.213  1.00  0.00           H  
HETATM   34  H2  UNL     1      -5.837  -1.606   0.272  1.00  0.00           H  
HETATM   35  H3  UNL     1      -5.531  -1.497   2.021  1.00  0.00           H  
HETATM   36  H4  UNL     1      -4.984   0.863   1.896  1.00  0.00           H  
HETATM   37  H5  UNL     1      -3.197   1.608   0.106  1.00  0.00           H  
HETATM   38  H6  UNL     1      -1.572   1.837   3.067  1.00  0.00           H  
HETATM   39  H7  UNL     1       0.673   1.214   2.548  1.00  0.00           H  
HETATM   40  H8  UNL     1      -0.466  -1.100  -2.645  1.00  0.00           H  
HETATM   41  H9  UNL     1       1.602  -1.953  -1.330  1.00  0.00           H  
HETATM   42  H10 UNL     1       1.444  -0.540  -2.508  1.00  0.00           H  
HETATM   43  H11 UNL     1       3.742  -1.146  -1.757  1.00  0.00           H  
HETATM   44  H12 UNL     1       3.602   0.800  -2.628  1.00  0.00           H  
HETATM   45  H13 UNL     1       3.146  -1.686   0.499  1.00  0.00           H  
HETATM   46  H14 UNL     1       4.421  -0.475   2.749  1.00  0.00           H  
HETATM   47  H15 UNL     1       6.820  -0.017   3.321  1.00  0.00           H  
HETATM   48  H16 UNL     1       8.997   0.436   2.562  1.00  0.00           H  
HETATM   49  H17 UNL     1       7.732   0.321  -2.035  1.00  0.00           H  
HETATM   50  H18 UNL     1       5.444  -0.150  -1.384  1.00  0.00           H  
HETATM   51  H19 UNL     1      -2.938   0.612  -2.332  1.00  0.00           H  
HETATM   52  H20 UNL     1      -3.785  -1.428  -2.567  1.00  0.00           H  
HETATM   53  H21 UNL     1      -4.719   1.918  -1.983  1.00  0.00           H  
HETATM   54  H22 UNL     1      -5.686  -0.710  -2.394  1.00  0.00           H  
HETATM   55  H23 UNL     1      -6.560   1.008  -0.216  1.00  0.00           H  
HETATM   56  H24 UNL     1      -5.004   3.088  -0.538  1.00  0.00           H  
CONECT    1    2   33
CONECT    2    3   34   35
CONECT    3    4   31   36
CONECT    4    5
CONECT    5    6   27   37
CONECT    6    7    7   12
CONECT    7    8    9
CONECT    8   38
CONECT    9   10   10   39
CONECT   10   11   26
CONECT   11   12   12   14
CONECT   12   13
CONECT   13   40
CONECT   14   15   41   42
CONECT   15   16   17   43
CONECT   16   44
CONECT   17   18   26   45
CONECT   18   19   19   25
CONECT   19   20   46
CONECT   20   21   21   47
CONECT   21   22   23
CONECT   22   48
CONECT   23   24   25   25
CONECT   24   49
CONECT   25   50
CONECT   27   28   29   51
CONECT   28   52
CONECT   29   30   31   53
CONECT   30   54
CONECT   31   32   55
CONECT   32   56
END

HMDB0037400
     RDKit          3D
(+)-Catechin 6-C-glucoside
 56 59  0  0  0  0  0  0  0  0999 V2000
   -7.1694   -0.4539    1.2618 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8755   -0.9195    1.1334 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9438    0.2841    0.9276 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6848   -0.2139    0.8061 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9517    0.5296   -0.1297 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5104    0.3843    0.0601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0124    0.8800    1.2660 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8805    1.4731    2.1997 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3056    0.8161    1.5909 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1805    0.2404    0.6954 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7177   -0.2517   -0.4905 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6165   -0.1767   -0.7969 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0812   -0.6719   -1.9839 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6583   -0.8601   -1.4456 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1011   -0.4292   -1.1912 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3497    0.8385   -1.6580 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3862   -0.6031    0.2743 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7887   -0.3404    0.6284 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1512   -0.3078    1.9663 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4624   -0.0577    2.2907 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4002    0.1573    1.2827 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7333    0.4124    1.5874 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0578    0.1283   -0.0429 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9767    0.3400   -1.0544 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7218   -0.1270   -0.3521 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5125    0.1981    1.0700 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5167    0.2221   -1.4608 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7943   -1.1443   -1.6014 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8965    0.9064   -1.5097 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7811    0.2507   -2.3269 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4406    1.1713   -0.1474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3345    2.5357    0.2133 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3595   -0.2836    2.2131 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8374   -1.6059    0.2723 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5306   -1.4968    2.0207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9837    0.8633    1.8965 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1966    1.6078    0.1056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5720    1.8371    3.0667 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6734    1.2140    2.5476 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4660   -1.1002   -2.6452 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6016   -1.9528   -1.3304 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4440   -0.5404   -2.5079 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -1.1463   -1.7575 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6015    0.8001   -2.6275 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1457   -1.6860    0.4988 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4214   -0.4750    2.7491 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8202   -0.0172    3.3211 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9974    0.4362    2.5625 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7323    0.3209   -2.0347 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4437   -0.1497   -1.3837 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9376    0.6116   -2.3322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7851   -1.4276   -2.5670 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7186    1.9184   -1.9830 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6860   -0.7097   -2.3937 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5596    1.0085   -0.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0041    3.0878   -0.5376 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 17 26  1  0
  5 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31  3  1  0
 12  6  1  0
 25 18  1  0
 26 10  1  0
  1 33  1  0
  2 34  1  0
  2 35  1  0
  3 36  1  0
  5 37  1  0
  8 38  1  0
  9 39  1  0
 13 40  1  0
 14 41  1  0
 14 42  1  0
 15 43  1  0
 16 44  1  0
 17 45  1  0
 19 46  1  0
 20 47  1  0
 22 48  1  0
 24 49  1  0
 25 50  1  0
 27 51  1  0
 28 52  1  0
 29 53  1  0
 30 54  1  0
 31 55  1  0
 32 56  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
6-C-Glucopyranosylcatechin	HMDB
6-Glucopyranosyl-(+)-catechin	HMDB
6-Glucosyl-(+)-catechin	HMDB

Chemical Formula

C₂₁H₂₄O₁₁

Average Molecular Weight

452.4087

Monoisotopic Molecular Weight

452.13186161

IUPAC Name

2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

Traditional Name

2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

CAS Registry Number

105371-27-5

SMILES

OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(C(O)C2)C2=CC(O)=C(O)C=C2)C=C1O

InChI Identifier

InChI=1S/C21H24O11/c22-6-14-17(28)18(29)19(30)21(32-14)15-11(25)5-13-8(16(15)27)4-12(26)20(31-13)7-1-2-9(23)10(24)3-7/h1-3,5,12,14,17-30H,4,6H2

InChI Key

PWMSPKVTJLJDDS-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid C-glycosides

Alternative Parents

Substituents

Catechin
Flavonoid c-glycoside
3'-hydroxyflavonoid
3-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavan-3-ol
Hydroxyflavonoid
Flavan
Phenolic glycoside
Hexose monosaccharide
C-glycosyl compound
Glycosyl compound
Chromane
Benzopyran
1-benzopyran
Catechol
Phenol
Alkyl aryl ether
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Monosaccharide
Oxane
Monocyclic benzene moiety
Benzenoid
Secondary alcohol
Polyol
Oxacycle
Ether
Dialkyl ether
Organoheterocyclic compound
Alcohol
Organic oxygen compound
Primary alcohol
Hydrocarbon derivative
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037400)
Cytoplasm (HMDB: HMDB0037400)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037400)

Source

Exogenous

Exogenous (HMDB: HMDB0037400)

Food

Food (HMDB: HMDB0037400)

Vegetable

Leaf vegetable

Green vegetables (FooDB: FOOD00872)

Endogenous

Plant

Plant (HMDB: HMDB0037400)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0037400)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	3.77 g/L	ALOGPS
logP	-0.64	ALOGPS
logP	-0.96	ChemAxon
logS	-2.1	ALOGPS
pKa (Strongest Acidic)	8.78	ChemAxon
pKa (Strongest Basic)	-3.3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	200.53 Å²	ChemAxon
Rotatable Bond Count	3	ChemAxon
Refractivity	107.12 m³·mol⁻¹	ChemAxon
Polarizability	44.1 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	204.733	31661259
DarkChem	[M-H]-	198.021	31661259
DeepCCS	[M+H]+	196.513	30932474
DeepCCS	[M-H]-	194.118	30932474
DeepCCS	[M-2H]-	227.036	30932474
DeepCCS	[M+Na]+	202.426	30932474
AllCCS	[M+H]+	209.0	32859911
AllCCS	[M+H-H2O]+	206.6	32859911
AllCCS	[M+NH4]+	211.2	32859911
AllCCS	[M+Na]+	211.9	32859911
AllCCS	[M-H]-	205.6	32859911
AllCCS	[M+Na-2H]-	206.5	32859911
AllCCS	[M+HCOO]-	207.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
(+)-Catechin 6-C-glucoside	OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(C(O)C2)C2=CC(O)=C(O)C=C2)C=C1O	4798.7	Standard polar	33892256
(+)-Catechin 6-C-glucoside	OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(C(O)C2)C2=CC(O)=C(O)C=C2)C=C1O	4123.4	Standard non polar	33892256
(+)-Catechin 6-C-glucoside	OCC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(C(O)C2)C2=CC(O)=C(O)C=C2)C=C1O	4472.4	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
(+)-Catechin 6-C-glucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4369.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #2	C[Si](C)(C)OC1C(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)OC(CO)C(O)C1O	4401.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #3	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C1O	4431.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C1O	4422.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #5	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O	4356.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #6	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4378.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #7	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4415.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #8	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O	4438.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O	4403.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4336.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #10	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4305.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #11	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4352.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4374.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4342.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #14	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C1O	4347.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #15	C[Si](C)(C)OC1C(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)OC(CO)C(O)C1O[Si](C)(C)C	4370.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #16	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C1O[Si](C)(C)C	4373.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4348.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #18	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4306.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #19	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4362.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4305.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #20	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4374.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #21	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4337.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4355.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #23	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4308.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #24	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4346.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #25	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O	4390.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #26	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4356.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1O	4344.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #28	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4369.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #29	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4340.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4341.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #30	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O	4320.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O	4359.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4401.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4376.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4359.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #35	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4381.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O	4390.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4373.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4344.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4345.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4351.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4355.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4347.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4216.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4167.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4182.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4175.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4190.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4267.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4239.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4238.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4234.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4242.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4257.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4234.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4228.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4215.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4250.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4191.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4178.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4214.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4239.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4247.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4255.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #29	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4215.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4217.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4208.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4217.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4236.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #33	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4215.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #34	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4179.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #35	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4181.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #36	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4183.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #37	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4184.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4150.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #39	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4186.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4186.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #40	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4234.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #41	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4254.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4263.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #43	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4238.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #44	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4221.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #45	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4232.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #46	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4266.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #47	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4180.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #48	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4195.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #49	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4287.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4207.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4231.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #51	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4180.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #52	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4254.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4237.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4198.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4181.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4219.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4196.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4158.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #59	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4158.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4194.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #60	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4121.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #61	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4173.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #62	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4237.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #63	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4215.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #64	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4241.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #65	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4213.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4233.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O	4222.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #68	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4185.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4186.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4219.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #70	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4153.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #71	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4182.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4258.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #73	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4234.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4271.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1O	4240.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4238.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4205.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	4230.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	4245.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4189.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #80	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	4207.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4275.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #82	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4247.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4311.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4278.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4198.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4084.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4091.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #100	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4075.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4125.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #102	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4040.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4047.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #104	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4020.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4038.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #106	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4011.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4092.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #108	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	4011.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #109	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	4071.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4115.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #110	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3989.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4120.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #112	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4074.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4068.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #114	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4034.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #115	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4065.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #116	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4040.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #117	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4122.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	4031.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	4098.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4119.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #120	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	4010.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4149.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	4091.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	4061.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	4154.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4141.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4174.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4064.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4052.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4073.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4037.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4025.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4044.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4104.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4074.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4121.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4117.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4044.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4022.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4069.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4052.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4071.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4101.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4039.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4031.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	4042.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4053.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4011.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4000.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4025.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4073.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4096.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4086.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4148.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4102.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4073.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4084.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4100.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4082.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4051.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4084.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4149.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4164.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4153.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4127.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	4106.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4129.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4040.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4091.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4104.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4098.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4068.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4079.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4078.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4187.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #57	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4073.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #58	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4063.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #59	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4084.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4079.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4063.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4032.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #62	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4141.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #63	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4123.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #64	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4054.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #65	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4021.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4121.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4052.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #68	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4021.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4079.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4085.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #70	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4054.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4121.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #72	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4105.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4035.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #74	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4001.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #75	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4079.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4028.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #77	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4000.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #78	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4076.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	4040.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	4054.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	4094.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #81	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	4018.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #82	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4177.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4101.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #84	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4083.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #85	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4103.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #86	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4085.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #87	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4160.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #88	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	4117.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #89	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4133.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4117.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4129.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #91	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	4093.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4057.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4114.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4055.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4027.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	4029.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	4002.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #98	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4072.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4091.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	3900.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3898.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #100	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3959.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	4014.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #102	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	4002.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4038.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4035.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4054.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #106	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3922.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	3926.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #108	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	3902.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #109	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	3942.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3910.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #110	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	3924.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4000.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #112	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3889.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3961.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #114	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3876.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #115	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4024.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3906.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #117	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3886.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3985.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3979.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3901.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3946.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3898.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #122	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3877.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3995.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3997.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3952.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4005.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3942.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3966.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3955.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O	3986.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	3925.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	3931.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	3929.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	3877.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	3905.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	3912.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	3909.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4009.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4028.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4020.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	3986.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	3986.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	3992.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3941.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3938.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3957.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3961.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3920.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3934.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3939.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4053.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	3957.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3888.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3888.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3889.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3904.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3873.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3869.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3872.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3965.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3986.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3979.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3967.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3959.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3967.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3920.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3935.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3936.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3939.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3895.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3911.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3916.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4027.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	4027.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #57	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	3999.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #58	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	4018.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #59	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3982.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	3990.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #60	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3997.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #61	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3994.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #62	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3965.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #63	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3979.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #64	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3978.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #65	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4117.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #66	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4023.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #67	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4041.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4033.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4040.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3922.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4021.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #71	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3969.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #72	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3924.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	3931.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #74	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	3906.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #75	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3919.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	3925.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #77	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	3900.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3908.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #79	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3889.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3934.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3996.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #81	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4051.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	3974.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #83	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	3956.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	3933.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #85	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	3914.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #86	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	4000.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #87	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	3934.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #88	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	3914.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #89	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	3990.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3926.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	4003.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #91	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	3943.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #92	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	3922.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #93	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3998.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3883.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #95	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3966.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #96	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3867.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #97	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3887.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #98	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3957.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,5TMS,isomer #99	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3873.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O	3870.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3841.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3896.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3893.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3893.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3830.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3850.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3832.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3810.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3826.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3811.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3810.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3904.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O	3897.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O	3901.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C	3894.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3854.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3870.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3863.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3837.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3851.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3844.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3809.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3962.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3909.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3929.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3918.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3901.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3885.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3863.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3859.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3858.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3818.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3805.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3833.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3826.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3804.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3819.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3813.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3936.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3885.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3905.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3893.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3887.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3793.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3868.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3951.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3961.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3952.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3950.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3934.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3994.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #57	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3854.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #58	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	3838.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #59	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	3816.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3789.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3797.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3779.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #62	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3892.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3791.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #64	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3775.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #65	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3877.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #66	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3880.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	3879.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #68	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	3866.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	3941.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3785.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3917.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3910.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3835.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3906.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #74	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3822.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #75	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3868.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3865.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3981.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	3792.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #79	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	3773.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3831.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	3876.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3914.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3865.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3863.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3866.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,6TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3848.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4602.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)OC(CO)C(O)C1O	4668.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C1O	4692.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C1O	4677.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O	4617.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4636.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4649.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O	4667.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O	4623.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4798.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4797.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4851.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)C=C1O	4857.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)=CC=C1O	4821.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	4829.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4839.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	4829.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4811.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4790.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4844.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4795.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4855.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4818.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4808.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4787.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4827.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O	4856.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4819.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1O	4833.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O	4844.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)=CC=C1O	4814.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O)C(O)C1O	4825.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O	4818.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O	4839.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	4874.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	4851.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4823.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	4849.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O	4851.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4835.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4808.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4818.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4810.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4809.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4818.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4903.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4872.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4868.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4868.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4858.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O)C(O)C1O	4950.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O)C(O)C1O	4920.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4907.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4894.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4881.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4947.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O)C(O)C(O)C1O	4911.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4926.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4925.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4921.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4884.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4881.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4878.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4899.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4910.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4894.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4911.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4945.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4885.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4879.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4903.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)C=C1O	4933.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)=CC=C1O	4895.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4858.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4853.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O	4908.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)=CC=C1O	4868.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4871.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(O)CC3=C2O)C(O)C(O)C1O	4906.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4885.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	4886.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	4935.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	4904.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)C=C1O	4914.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)C=C1O	4917.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	4957.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)=CC=C1O	4869.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)=CC=C1O	4872.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4896.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4892.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4871.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4839.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	4863.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4900.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4855.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4895.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4884.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)C=C1O	4927.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)=CC=C1O	4887.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O	4889.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4895.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)=CC=C1O	4847.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OC1=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4862.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	4913.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #63	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	4879.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #64	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	4937.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #65	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4897.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #66	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4884.4	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #67	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O	4924.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #68	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O)=CC=C1O	4884.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #69	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O	4893.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4884.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #70	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)=CC=C1O	4851.2	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #71	CC(C)(C)[Si](C)(C)OC1=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4854.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #72	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	4905.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #73	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	4873.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #74	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	4938.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #75	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1O	4939.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #76	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O	4970.6	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #77	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)=CC=C1O	4933.9	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #78	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	4951.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #79	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	4968.5	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4881.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #80	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	4921.7	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #81	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	4961.3	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #82	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	4936.0	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #83	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C	4999.8	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #84	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4OC(CO)C(O)C(O)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	4983.1	Semi standard non polar	33892256
(+)-Catechin 6-C-glucoside,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(O)CC3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4917.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0uk9-3109300000-2e3407a578c7bf35984e	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (3 TMS) - 70eV, Positive	splash10-0udi-1400549000-3d3bc28c449b945d7638	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_4_58) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_5_71) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_5_75) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_5_76) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_5_77) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_6_57) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_6_58) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_6_59) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_6_63) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_6_64) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (TMS_6_65) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - (+)-Catechin 6-C-glucoside GC-MS ("(+)-Catechin 6-C-glucoside,4TMS,#58" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 10V, Positive-QTOF	splash10-0udr-0142900000-8d746a1077f9cb353c7f	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 20V, Positive-QTOF	splash10-0uei-2896700000-7d8b17efd0cd408493ba	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 40V, Positive-QTOF	splash10-0f6t-1921100000-0d2a91cf683d65477be0	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 10V, Negative-QTOF	splash10-0udi-0112900000-191af36c2ca65cdd5264	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 20V, Negative-QTOF	splash10-0udi-4934400000-183477aeb3f38fb5cd64	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 40V, Negative-QTOF	splash10-0k95-3920000000-880ca4f155bea3cfedd8	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 10V, Positive-QTOF	splash10-0udi-0002900000-520bdc127b419776a044	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 20V, Positive-QTOF	splash10-0udi-1219500000-e9fb481224d29fd7a32f	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 40V, Positive-QTOF	splash10-01b9-6609100000-3bab37e91c81a8ca3a12	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 10V, Negative-QTOF	splash10-0udi-0002900000-b5be6cf8091c968383b1	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 20V, Negative-QTOF	splash10-0159-1009800000-f92ed7f3a23d6fcd8b7f	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - (+)-Catechin 6-C-glucoside 40V, Negative-QTOF	splash10-05mo-9468400000-e676410522a8a6675b27	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016444

KNApSAcK ID

C00006358

Chemspider ID

35014410

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

59010767

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. Catechol O-methyltransferase

General function:: Involved in magnesium ion binding
Specific function:: Catalyzes the O-methylation, and thereby the inactivation, of catecholamine neurotransmitters and catechol hormones. Also shortens the biological half-lives of certain neuroactive drugs, like L-DOPA, alpha-methyl DOPA and isoproterenol.
Gene Name:: COMT
Uniprot ID:: P21964
Molecular weight:: 30036.77

Reactions

(+)-Catechin 6-C-glucoside → 2-(4-hydroxy-3-methoxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol	details

Enzyme Details

2. Sulfotransferase family cytosolic 2B member 1

General function:: Involved in sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of many hormones, neurotransmitters, drugs and xenobiotic compounds. Sulfonation increases the water solubility of most compounds, and therefore their renal excretion, but it can also result in bioactivation to form active metabolites. Sulfates hydroxysteroids like DHEA. Isoform 1 preferentially sulfonates cholesterol, and isoform 2 avidly sulfonates pregnenolone but not cholesterol.
Gene Name:: SULT2B1
Uniprot ID:: O00204
Molecular weight:: 39598.595

Reactions

(+)-Catechin 6-C-glucoside → ({6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-6-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
(+)-Catechin 6-C-glucoside → {6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-6-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
(+)-Catechin 6-C-glucoside → {2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-6-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
(+)-Catechin 6-C-glucoside → {2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-6-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details

Enzyme Details

3. UDP-glucuronosyltransferase 1-1

General function:: Involved in transferase activity, transferring hexosyl groups
Specific function:: UDPGT is of major importance in the conjugation and subsequent elimination of potentially toxic xenobiotics and endogenous compounds. This isoform glucuronidates bilirubin IX-alpha to form both the IX-alpha-C8 and IX-alpha-C12 monoconjugates and diconjugate. Is also able to catalyze the glucuronidation of 17beta-estradiol, 17alpha-ethinylestradiol, 1-hydroxypyrene, 4-methylumbelliferone, 1-naphthol, paranitrophenol, scopoletin, and umbelliferone.
Gene Name:: UGT1A1
Uniprot ID:: P22309
Molecular weight:: 59590.91

Reactions

(+)-Catechin 6-C-glucoside → 3,4,5-trihydroxy-6-(2-hydroxy-5-{3,5,7-trihydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-2-yl}phenoxy)oxane-2-carboxylic acid	details
(+)-Catechin 6-C-glucoside → 6-{[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-7-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid	details

Enzyme Details

4. Sulfotransferase 1A3

General function:: sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of phenolic monoamines (neurotransmitters such as dopamine, norepinephrine and serotonin) and phenolic and catechol drugs.
Gene Name:: SULT1A3
Uniprot ID:: P0DMM9
Molecular weight:: 34195.96

Reactions

(+)-Catechin 6-C-glucoside → (2-hydroxy-5-{3,5,7-trihydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-1-benzopyran-2-yl}phenyl)oxidanesulfonic acid	details

Showing metabocard for (+)-Catechin 6-C-glucoside (HMDB0037400)

MOL for HMDB0037400 ((+)-Catechin 6-C-glucoside)

3D MOL for HMDB0037400 ((+)-Catechin 6-C-glucoside)

3D SDF for HMDB0037400 ((+)-Catechin 6-C-glucoside)

3D-SDF for HMDB0037400 ((+)-Catechin 6-C-glucoside)

PDB for HMDB0037400 ((+)-Catechin 6-C-glucoside)

3D PDB for HMDB0037400 ((+)-Catechin 6-C-glucoside)

SMILES for HMDB0037400 ((+)-Catechin 6-C-glucoside)

INCHI for HMDB0037400 ((+)-Catechin 6-C-glucoside)

Structure for HMDB0037400 ((+)-Catechin 6-C-glucoside)

3D Structure for HMDB0037400 ((+)-Catechin 6-C-glucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions

Reactions

Reactions

Reactions