Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:47:07 UTC

Update Date

2022-03-07 02:55:23 UTC

HMDB ID

HMDB0037534

Secondary Accession Numbers

HMDB37534

Metabolite Identification

Common Name

Panasenoside

Description

Panasenoside, also known as lilyn, belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Based on a literature review a small amount of articles have been published on Panasenoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02241211002D          

 43 47  0  0  0  0            999 V2000
    1.8372    3.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5120    2.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5120    1.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873    1.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873    2.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2619    3.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9123   -0.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8372    0.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5120    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5120    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2619    1.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8372    1.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0873    1.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0873    0.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3374    0.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5997   -0.5624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -1.0497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -1.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3374   -2.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4121   -3.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1621   -3.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873   -2.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -1.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871   -2.3248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3374    1.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3377    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3377    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873    0.1874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873   -0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -1.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871   -0.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    0.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9245    0.3002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9245    0.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2247    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2247    1.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9496    0.1127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2869    0.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2869    0.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    1.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9496    0.8247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  6  2  0  0  0  0
  2  3  2  0  0  0  0
  2  7  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  5 27  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 15  2  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 13 14  2  0  0  0  0
 14 15  1  0  0  0  0
 14 26  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  2  0  0  0  0
 16 28  1  0  0  0  0
 18 19  1  0  0  0  0
 18 30  1  0  0  0  0
 19 20  1  0  0  0  0
 19 23  1  0  0  0  0
 20 21  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 31  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  2  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 33 39  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 35 41  1  0  0  0  0
 36 37  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  1  0  0  0  0
 40 43  1  0  0  0  0
 41 42  1  0  0  0  0
M  END

HMDB0037534
     RDKit          3D
Panasenoside
 73 77  0  0  0  0  0  0  0  0999 V2000
    2.7772    2.5152   -1.0292 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2488    1.3823   -0.9369 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025    0.4400   -0.1867 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3670    0.9031    0.3460 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0800    1.0946   -0.1126 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0743    2.3545   -0.7533 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0806    3.4177    0.1072 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1820    4.7191   -0.6185 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454    4.7886   -1.6597 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5551    3.3548    0.5481 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9113    4.4863    1.2508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6307    2.1570    1.4342 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9421    1.9865    1.8350 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0563    0.9134    0.8055 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1467    0.2500    0.1958 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4573   -0.9491    0.8229 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7625   -0.9508    1.3199 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7158   -0.7595    0.3474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0096   -0.3893    1.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7872    0.7707    1.7693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8533   -2.0163   -0.4574 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0302   -2.7088   -0.1608 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6749   -2.9039   -0.1883 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8248   -3.5453    1.0525 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3722   -2.1204   -0.1453 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0553   -1.6500   -1.4216 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0377   -0.8072   -0.0945 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5014   -1.9494    0.6120 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2173   -2.0969    1.0138 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7608   -3.1885    1.7914 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6482   -4.1670    2.1713 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1774   -5.2204    2.9292 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9546   -4.0405    1.7744 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3783   -2.9749    1.0216 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2141   -1.0749   -0.7025 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9041   -0.2196   -1.3910 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1029   -0.5560   -1.9897 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8427    0.3407   -2.7212 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0528   -0.0212   -3.3182 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3521    1.6146   -2.8484 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1429    2.0251   -2.2680 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7293    3.2913   -2.4384 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4447    1.0920   -1.5493 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500    0.3935   -0.9984 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5528    3.3816    0.9977 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2197    4.7426   -0.9466 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0500    5.5660    0.0857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2462    5.6259   -1.5538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429    3.1817   -0.3559 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4279    4.5185    2.0951 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0237    2.3926    2.3558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4611    2.8394    1.8023 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7551    0.2657    1.6602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   -1.1524    1.6685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3867    0.0515   -0.3376 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2419   -1.2393    1.7315 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8124   -0.1992    0.3222 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6060    1.3274    1.7708 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8740   -1.8277   -1.5517 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0186   -3.0882    0.7501 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5346   -3.6626   -0.9998 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3041   -4.3990    0.9879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5883   -2.8455    0.1389 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0756   -1.7078   -1.5410 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4980   -1.3774    0.7052 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2741   -3.2607    2.0902 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8106   -6.0855    2.5292 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6626   -4.7892    2.0606 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4206   -2.8964    0.7205 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4425   -1.5883   -1.8522 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9254    0.0943   -2.7851 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9547    2.3131   -3.4336 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9823    3.8379   -2.1755 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
  3 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 27 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 14  5  1  0
 25 16  1  0
 34 28  1  0
 43 36  1  0
  5 44  1  0
  7 45  1  0
  8 46  1  0
  8 47  1  0
  9 48  1  0
 10 49  1  0
 11 50  1  0
 12 51  1  0
 13 52  1  0
 14 53  1  0
 16 54  1  0
 18 55  1  0
 19 56  1  0
 19 57  1  0
 20 58  1  0
 21 59  1  0
 22 60  1  0
 23 61  1  0
 24 62  1  0
 25 63  1  0
 26 64  1  0
 29 65  1  0
 30 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 37 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END


  Mrv0541 02241211002D          

 43 47  0  0  0  0            999 V2000
    1.8372    3.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5120    2.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5120    1.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873    1.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873    2.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2619    3.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9123   -0.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8372    0.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5120    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5120    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2619    1.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8372    1.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0873    1.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0873    0.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3374    0.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5997   -0.5624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -1.0497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -1.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3374   -2.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4121   -3.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1621   -3.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873   -2.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -1.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871   -2.3248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3374    1.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3377    1.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3377    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873    0.1874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873   -0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -1.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871   -0.6372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    0.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9245    0.3002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9245    0.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2247    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2247    1.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9496    0.1127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2869    0.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2869    0.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    1.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9496    0.8247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  6  2  0  0  0  0
  2  3  2  0  0  0  0
  2  7  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  5 27  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 15  2  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 13 14  2  0  0  0  0
 14 15  1  0  0  0  0
 14 26  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  2  0  0  0  0
 16 28  1  0  0  0  0
 18 19  1  0  0  0  0
 18 30  1  0  0  0  0
 19 20  1  0  0  0  0
 19 23  1  0  0  0  0
 20 21  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 31  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  2  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 33 39  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 35 41  1  0  0  0  0
 36 37  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  1  0  0  0  0
 40 43  1  0  0  0  0
 41 42  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037534

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c28-7-14-17(33)20(36)22(38)26(40-14)43-25-21(37)18(34)15(8-29)41-27(25)42-24-19(35)16-12(32)5-11(31)6-13(16)39-23(24)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-22,25-34,36-38H,7-8H2

> <INCHI_KEY>
LKZDFKLGDGSGEO-UHFFFAOYSA-N

> <FORMULA>
C27H30O16

> <MOLECULAR_WEIGHT>
610.5175

> <EXACT_MASS>
610.153384912

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
57.71470671718513

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.55

> <JCHEM_LOGP>
-1.6121056200000001

> <ALOGPS_LOGS>
-2.00

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.440182640290905

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.43388884531602

> <JCHEM_PKA_STRONGEST_BASIC>
-3.648377595763173

> <JCHEM_POLAR_SURFACE_AREA>
265.5199999999999

> <JCHEM_REFRACTIVITY>
139.70789999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
6.07e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037534
     RDKit          3D
Panasenoside
 73 77  0  0  0  0  0  0  0  0999 V2000
    2.7772    2.5152   -1.0292 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2488    1.3823   -0.9369 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025    0.4400   -0.1867 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3670    0.9031    0.3460 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0800    1.0946   -0.1126 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0743    2.3545   -0.7533 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0806    3.4177    0.1072 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1820    4.7191   -0.6185 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454    4.7886   -1.6597 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5551    3.3548    0.5481 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9113    4.4863    1.2508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6307    2.1570    1.4342 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9421    1.9865    1.8350 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0563    0.9134    0.8055 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1467    0.2500    0.1958 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4573   -0.9491    0.8229 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7625   -0.9508    1.3199 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7158   -0.7595    0.3474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0096   -0.3893    1.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7872    0.7707    1.7693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8533   -2.0163   -0.4574 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0302   -2.7088   -0.1608 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6749   -2.9039   -0.1883 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8248   -3.5453    1.0525 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3722   -2.1204   -0.1453 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0553   -1.6500   -1.4216 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0377   -0.8072   -0.0945 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5014   -1.9494    0.6120 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2173   -2.0969    1.0138 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7608   -3.1885    1.7914 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6482   -4.1670    2.1713 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1774   -5.2204    2.9292 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9546   -4.0405    1.7744 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3783   -2.9749    1.0216 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2141   -1.0749   -0.7025 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9041   -0.2196   -1.3910 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1029   -0.5560   -1.9897 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8427    0.3407   -2.7212 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0528   -0.0212   -3.3182 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3521    1.6146   -2.8484 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1429    2.0251   -2.2680 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7293    3.2913   -2.4384 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4447    1.0920   -1.5493 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500    0.3935   -0.9984 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5528    3.3816    0.9977 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2197    4.7426   -0.9466 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0500    5.5660    0.0857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2462    5.6259   -1.5538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429    3.1817   -0.3559 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4279    4.5185    2.0951 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0237    2.3926    2.3558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4611    2.8394    1.8023 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7551    0.2657    1.6602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   -1.1524    1.6685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3867    0.0515   -0.3376 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2419   -1.2393    1.7315 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8124   -0.1992    0.3222 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6060    1.3274    1.7708 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8740   -1.8277   -1.5517 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0186   -3.0882    0.7501 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5346   -3.6626   -0.9998 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3041   -4.3990    0.9879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5883   -2.8455    0.1389 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0756   -1.7078   -1.5410 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4980   -1.3774    0.7052 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2741   -3.2607    2.0902 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8106   -6.0855    2.5292 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6626   -4.7892    2.0606 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4206   -2.8964    0.7205 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4425   -1.5883   -1.8522 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9254    0.0943   -2.7851 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9547    2.3131   -3.4336 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9823    3.8379   -2.1755 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
  3 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 27 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 14  5  1  0
 25 16  1  0
 34 28  1  0
 43 36  1  0
  5 44  1  0
  7 45  1  0
  8 46  1  0
  8 47  1  0
  9 48  1  0
 10 49  1  0
 11 50  1  0
 12 51  1  0
 13 52  1  0
 14 53  1  0
 16 54  1  0
 18 55  1  0
 19 56  1  0
 19 57  1  0
 20 58  1  0
 21 59  1  0
 22 60  1  0
 23 61  1  0
 24 62  1  0
 25 63  1  0
 26 64  1  0
 29 65  1  0
 30 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 37 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  C   UNK     0       3.429   5.879   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       4.689   5.039   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       4.689   3.499   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       3.429   2.730   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       2.030   3.499   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       2.030   5.039   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0       6.089   5.879   0.000  0.00  0.00           O+0
HETATM    8  O   UNK     0      -3.570  -1.189   0.000  0.00  0.00           O+0
HETATM    9  C   UNK     0      -3.429   0.350   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -4.689   1.189   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -4.689   2.730   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0      -6.089   3.499   0.000  0.00  0.00           O+0
HETATM   13  C   UNK     0      -3.429   3.639   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -2.030   2.869   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -2.030   1.330   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -0.630   0.560   0.000  0.00  0.00           C+0
HETATM   17  O   UNK     0      -1.119  -1.050   0.000  0.00  0.00           O+0
HETATM   18  O   UNK     0       0.770  -1.959   0.000  0.00  0.00           O+0
HETATM   19  C   UNK     0       0.770  -3.500   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -0.630  -4.340   0.000  0.00  0.00           C+0
HETATM   21  O   UNK     0      -0.769  -5.879   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0       2.169  -5.879   0.000  0.00  0.00           O+0
HETATM   23  C   UNK     0       2.030  -4.340   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       3.429  -3.500   0.000  0.00  0.00           C+0
HETATM   25  O   UNK     0       4.829  -4.340   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0      -0.630   3.499   0.000  0.00  0.00           O+0
HETATM   27  C   UNK     0       0.630   2.730   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       0.630   1.189   0.000  0.00  0.00           C+0
HETATM   29  O   UNK     0       2.030   0.350   0.000  0.00  0.00           O+0
HETATM   30  C   UNK     0       2.030  -1.189   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0       3.429  -1.959   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0       4.829  -1.189   0.000  0.00  0.00           O+0
HETATM   33  C   UNK     0       4.829   0.210   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0       5.459   0.560   0.000  0.00  0.00           O+0
HETATM   35  C   UNK     0       5.459   1.260   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0       6.019   1.539   0.000  0.00  0.00           C+0
HETATM   37  O   UNK     0       6.019   2.309   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       3.639   0.210   0.000  0.00  0.00           O+0
HETATM   39  C   UNK     0       4.269   0.560   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0       4.269   1.260   0.000  0.00  0.00           C+0
HETATM   41  C   UNK     0       4.829   1.539   0.000  0.00  0.00           C+0
HETATM   42  O   UNK     0       4.829   2.309   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       3.639   1.539   0.000  0.00  0.00           O+0
CONECT    1    2    6                                                       
CONECT    2    1    3    7                                                  
CONECT    3    2    4                                                       
CONECT    4    3    5                                                       
CONECT    5    4    6   27                                                  
CONECT    6    1    5                                                       
CONECT    7    2                                                            
CONECT    8    9                                                            
CONECT    9    8   10   15                                                  
CONECT   10    9   11                                                       
CONECT   11   10   12   13                                                  
CONECT   12   11                                                            
CONECT   13   11   14                                                       
CONECT   14   13   15   26                                                  
CONECT   15    9   14   16                                                  
CONECT   16   15   17   28                                                  
CONECT   17   16                                                            
CONECT   18   19   30                                                       
CONECT   19   18   20   23                                                  
CONECT   20   19   21                                                       
CONECT   21   20                                                            
CONECT   22   23                                                            
CONECT   23   19   22   24                                                  
CONECT   24   23   25   31                                                  
CONECT   25   24                                                            
CONECT   26   14   27                                                       
CONECT   27    5   26   28                                                  
CONECT   28   16   27   29                                                  
CONECT   29   28   30                                                       
CONECT   30   18   29   31                                                  
CONECT   31   24   30   32                                                  
CONECT   32   31   33                                                       
CONECT   33   32   34   39                                                  
CONECT   34   33   35                                                       
CONECT   35   34   36   41                                                  
CONECT   36   35   37                                                       
CONECT   37   36                                                            
CONECT   38   39                                                            
CONECT   39   33   38   40                                                  
CONECT   40   39   41   43                                                  
CONECT   41   35   40   42                                                  
CONECT   42   41                                                            
CONECT   43   40                                                            
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0037534
HETATM    1  O1  UNL     1       2.777   2.515  -1.029  1.00  0.00           O  
HETATM    2  C1  UNL     1       3.249   1.382  -0.937  1.00  0.00           C  
HETATM    3  C2  UNL     1       2.503   0.440  -0.187  1.00  0.00           C  
HETATM    4  O2  UNL     1       1.367   0.903   0.346  1.00  0.00           O  
HETATM    5  C3  UNL     1       0.080   1.095  -0.113  1.00  0.00           C  
HETATM    6  O3  UNL     1       0.074   2.354  -0.753  1.00  0.00           O  
HETATM    7  C4  UNL     1      -0.081   3.418   0.107  1.00  0.00           C  
HETATM    8  C5  UNL     1       0.182   4.719  -0.619  1.00  0.00           C  
HETATM    9  O4  UNL     1      -0.745   4.789  -1.660  1.00  0.00           O  
HETATM   10  C6  UNL     1      -1.555   3.355   0.548  1.00  0.00           C  
HETATM   11  O5  UNL     1      -1.911   4.486   1.251  1.00  0.00           O  
HETATM   12  C7  UNL     1      -1.631   2.157   1.434  1.00  0.00           C  
HETATM   13  O6  UNL     1      -2.942   1.987   1.835  1.00  0.00           O  
HETATM   14  C8  UNL     1      -1.056   0.913   0.805  1.00  0.00           C  
HETATM   15  O7  UNL     1      -2.147   0.250   0.196  1.00  0.00           O  
HETATM   16  C9  UNL     1      -2.457  -0.949   0.823  1.00  0.00           C  
HETATM   17  O8  UNL     1      -3.762  -0.951   1.320  1.00  0.00           O  
HETATM   18  C10 UNL     1      -4.716  -0.759   0.347  1.00  0.00           C  
HETATM   19  C11 UNL     1      -6.010  -0.389   1.051  1.00  0.00           C  
HETATM   20  O9  UNL     1      -5.787   0.771   1.769  1.00  0.00           O  
HETATM   21  C12 UNL     1      -4.853  -2.016  -0.457  1.00  0.00           C  
HETATM   22  O10 UNL     1      -6.030  -2.709  -0.161  1.00  0.00           O  
HETATM   23  C13 UNL     1      -3.675  -2.904  -0.188  1.00  0.00           C  
HETATM   24  O11 UNL     1      -3.825  -3.545   1.053  1.00  0.00           O  
HETATM   25  C14 UNL     1      -2.372  -2.120  -0.145  1.00  0.00           C  
HETATM   26  O12 UNL     1      -2.055  -1.650  -1.422  1.00  0.00           O  
HETATM   27  C15 UNL     1       3.038  -0.807  -0.095  1.00  0.00           C  
HETATM   28  C16 UNL     1       2.501  -1.949   0.612  1.00  0.00           C  
HETATM   29  C17 UNL     1       1.217  -2.097   1.014  1.00  0.00           C  
HETATM   30  C18 UNL     1       0.761  -3.188   1.791  1.00  0.00           C  
HETATM   31  C19 UNL     1       1.648  -4.167   2.171  1.00  0.00           C  
HETATM   32  O13 UNL     1       1.177  -5.220   2.929  1.00  0.00           O  
HETATM   33  C20 UNL     1       2.955  -4.041   1.774  1.00  0.00           C  
HETATM   34  C21 UNL     1       3.378  -2.975   1.022  1.00  0.00           C  
HETATM   35  O14 UNL     1       4.214  -1.075  -0.703  1.00  0.00           O  
HETATM   36  C22 UNL     1       4.904  -0.220  -1.391  1.00  0.00           C  
HETATM   37  C23 UNL     1       6.103  -0.556  -1.990  1.00  0.00           C  
HETATM   38  C24 UNL     1       6.843   0.341  -2.721  1.00  0.00           C  
HETATM   39  O15 UNL     1       8.053  -0.021  -3.318  1.00  0.00           O  
HETATM   40  C25 UNL     1       6.352   1.615  -2.848  1.00  0.00           C  
HETATM   41  C26 UNL     1       5.143   2.025  -2.268  1.00  0.00           C  
HETATM   42  O16 UNL     1       4.729   3.291  -2.438  1.00  0.00           O  
HETATM   43  C27 UNL     1       4.445   1.092  -1.549  1.00  0.00           C  
HETATM   44  H1  UNL     1      -0.050   0.394  -0.998  1.00  0.00           H  
HETATM   45  H2  UNL     1       0.553   3.382   0.998  1.00  0.00           H  
HETATM   46  H3  UNL     1       1.220   4.743  -0.947  1.00  0.00           H  
HETATM   47  H4  UNL     1       0.050   5.566   0.086  1.00  0.00           H  
HETATM   48  H5  UNL     1      -1.246   5.626  -1.554  1.00  0.00           H  
HETATM   49  H6  UNL     1      -2.143   3.182  -0.356  1.00  0.00           H  
HETATM   50  H7  UNL     1      -1.428   4.519   2.095  1.00  0.00           H  
HETATM   51  H8  UNL     1      -1.024   2.393   2.356  1.00  0.00           H  
HETATM   52  H9  UNL     1      -3.461   2.839   1.802  1.00  0.00           H  
HETATM   53  H10 UNL     1      -0.755   0.266   1.660  1.00  0.00           H  
HETATM   54  H11 UNL     1      -1.778  -1.152   1.669  1.00  0.00           H  
HETATM   55  H12 UNL     1      -4.387   0.052  -0.338  1.00  0.00           H  
HETATM   56  H13 UNL     1      -6.242  -1.239   1.731  1.00  0.00           H  
HETATM   57  H14 UNL     1      -6.812  -0.199   0.322  1.00  0.00           H  
HETATM   58  H15 UNL     1      -6.606   1.327   1.771  1.00  0.00           H  
HETATM   59  H16 UNL     1      -4.874  -1.828  -1.552  1.00  0.00           H  
HETATM   60  H17 UNL     1      -6.019  -3.088   0.750  1.00  0.00           H  
HETATM   61  H18 UNL     1      -3.535  -3.663  -1.000  1.00  0.00           H  
HETATM   62  H19 UNL     1      -4.304  -4.399   0.988  1.00  0.00           H  
HETATM   63  H20 UNL     1      -1.588  -2.845   0.139  1.00  0.00           H  
HETATM   64  H21 UNL     1      -1.076  -1.708  -1.541  1.00  0.00           H  
HETATM   65  H22 UNL     1       0.498  -1.377   0.705  1.00  0.00           H  
HETATM   66  H23 UNL     1      -0.274  -3.261   2.090  1.00  0.00           H  
HETATM   67  H24 UNL     1       0.811  -6.086   2.529  1.00  0.00           H  
HETATM   68  H25 UNL     1       3.663  -4.789   2.061  1.00  0.00           H  
HETATM   69  H26 UNL     1       4.421  -2.896   0.721  1.00  0.00           H  
HETATM   70  H27 UNL     1       6.443  -1.588  -1.852  1.00  0.00           H  
HETATM   71  H28 UNL     1       8.925   0.094  -2.785  1.00  0.00           H  
HETATM   72  H29 UNL     1       6.955   2.313  -3.434  1.00  0.00           H  
HETATM   73  H30 UNL     1       3.982   3.838  -2.175  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   43
CONECT    3    4   27   27
CONECT    4    5
CONECT    5    6   14   44
CONECT    6    7
CONECT    7    8   10   45
CONECT    8    9   46   47
CONECT    9   48
CONECT   10   11   12   49
CONECT   11   50
CONECT   12   13   14   51
CONECT   13   52
CONECT   14   15   53
CONECT   15   16
CONECT   16   17   25   54
CONECT   17   18
CONECT   18   19   21   55
CONECT   19   20   56   57
CONECT   20   58
CONECT   21   22   23   59
CONECT   22   60
CONECT   23   24   25   61
CONECT   24   62
CONECT   25   26   63
CONECT   26   64
CONECT   27   28   35
CONECT   28   29   29   34
CONECT   29   30   65
CONECT   30   31   31   66
CONECT   31   32   33
CONECT   32   67
CONECT   33   34   34   68
CONECT   34   69
CONECT   35   36
CONECT   36   37   37   43
CONECT   37   38   70
CONECT   38   39   40   40
CONECT   39   71
CONECT   40   41   72
CONECT   41   42   43   43
CONECT   42   73
END

HMDB0037534
     RDKit          3D
Panasenoside
 73 77  0  0  0  0  0  0  0  0999 V2000
    2.7772    2.5152   -1.0292 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2488    1.3823   -0.9369 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025    0.4400   -0.1867 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3670    0.9031    0.3460 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0800    1.0946   -0.1126 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0743    2.3545   -0.7533 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0806    3.4177    0.1072 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1820    4.7191   -0.6185 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454    4.7886   -1.6597 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5551    3.3548    0.5481 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9113    4.4863    1.2508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6307    2.1570    1.4342 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9421    1.9865    1.8350 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0563    0.9134    0.8055 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1467    0.2500    0.1958 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4573   -0.9491    0.8229 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7625   -0.9508    1.3199 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7158   -0.7595    0.3474 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0096   -0.3893    1.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7872    0.7707    1.7693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8533   -2.0163   -0.4574 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0302   -2.7088   -0.1608 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6749   -2.9039   -0.1883 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8248   -3.5453    1.0525 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3722   -2.1204   -0.1453 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0553   -1.6500   -1.4216 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0377   -0.8072   -0.0945 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5014   -1.9494    0.6120 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2173   -2.0969    1.0138 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7608   -3.1885    1.7914 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6482   -4.1670    2.1713 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1774   -5.2204    2.9292 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9546   -4.0405    1.7744 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3783   -2.9749    1.0216 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2141   -1.0749   -0.7025 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9041   -0.2196   -1.3910 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1029   -0.5560   -1.9897 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8427    0.3407   -2.7212 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0528   -0.0212   -3.3182 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3521    1.6146   -2.8484 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1429    2.0251   -2.2680 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7293    3.2913   -2.4384 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4447    1.0920   -1.5493 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500    0.3935   -0.9984 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5528    3.3816    0.9977 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2197    4.7426   -0.9466 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0500    5.5660    0.0857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2462    5.6259   -1.5538 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429    3.1817   -0.3559 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4279    4.5185    2.0951 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0237    2.3926    2.3558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4611    2.8394    1.8023 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7551    0.2657    1.6602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   -1.1524    1.6685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3867    0.0515   -0.3376 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2419   -1.2393    1.7315 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8124   -0.1992    0.3222 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6060    1.3274    1.7708 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8740   -1.8277   -1.5517 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0186   -3.0882    0.7501 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5346   -3.6626   -0.9998 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3041   -4.3990    0.9879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5883   -2.8455    0.1389 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0756   -1.7078   -1.5410 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4980   -1.3774    0.7052 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2741   -3.2607    2.0902 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8106   -6.0855    2.5292 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6626   -4.7892    2.0606 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4206   -2.8964    0.7205 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4425   -1.5883   -1.8522 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9254    0.0943   -2.7851 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9547    2.3131   -3.4336 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9823    3.8379   -2.1755 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
  3 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 27 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 14  5  1  0
 25 16  1  0
 34 28  1  0
 43 36  1  0
  5 44  1  0
  7 45  1  0
  8 46  1  0
  8 47  1  0
  9 48  1  0
 10 49  1  0
 11 50  1  0
 12 51  1  0
 13 52  1  0
 14 53  1  0
 16 54  1  0
 18 55  1  0
 19 56  1  0
 19 57  1  0
 20 58  1  0
 21 59  1  0
 22 60  1  0
 23 61  1  0
 24 62  1  0
 25 63  1  0
 26 64  1  0
 29 65  1  0
 30 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 37 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Lilyn	HMDB

Chemical Formula

C₂₇H₃₀O₁₆

Average Molecular Weight

610.5175

Monoisotopic Molecular Weight

610.153384912

IUPAC Name

3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

Traditional Name

3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

CAS Registry Number

31512-06-8

SMILES

OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O16/c28-7-14-17(33)20(36)22(38)26(40-14)43-25-21(37)18(34)15(8-29)41-27(25)42-24-19(35)16-12(32)5-11(31)6-13(16)39-23(24)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-22,25-34,36-38H,7-8H2

InChI Key

LKZDFKLGDGSGEO-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-3-O-glycosides

Alternative Parents

Substituents

Flavonoid-3-o-glycoside
Hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
O-glycosyl compound
Glycosyl compound
Chromone
Disaccharide
Benzopyran
1-benzopyran
1-hydroxy-4-unsubstituted benzenoid
Phenol
1-hydroxy-2-unsubstituted benzenoid
Pyranone
Monocyclic benzene moiety
Oxane
Pyran
Benzenoid
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Organoheterocyclic compound
Oxacycle
Acetal
Polyol
Primary alcohol
Organic oxide
Organic oxygen compound
Alcohol
Hydrocarbon derivative
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037534)
Cytoplasm (HMDB: HMDB0037534)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037534)

Source

Exogenous

Food

Food (HMDB: HMDB0037534)

Tea

Endogenous

Plant

Plant (HMDB: HMDB0037534)

Not Available

Nutrient (HMDB: HMDB0037534)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	225 - 228 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	24510 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	6.07 g/L	ALOGPS
logP	-0.55	ALOGPS
logP	-1.6	ChemAxon
logS	-2	ALOGPS
pKa (Strongest Acidic)	6.43	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	265.52 Å²	ChemAxon
Rotatable Bond Count	7	ChemAxon
Refractivity	139.71 m³·mol⁻¹	ChemAxon
Polarizability	57.71 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	227.801	30932474
DeepCCS	[M-H]-	225.599	30932474
DeepCCS	[M-2H]-	258.84	30932474
DeepCCS	[M+Na]+	233.665	30932474
AllCCS	[M+H]+	231.5	32859911
AllCCS	[M+H-H2O]+	230.2	32859911
AllCCS	[M+NH4]+	232.6	32859911
AllCCS	[M+Na]+	232.9	32859911
AllCCS	[M-H]-	227.2	32859911
AllCCS	[M+Na-2H]-	229.2	32859911
AllCCS	[M+HCOO]-	231.6	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Panasenoside	OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(O)C(O)C1O	5561.2	Standard polar	33892256
Panasenoside	OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(O)C(O)C1O	5362.4	Standard non polar	33892256
Panasenoside	OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(O)C(O)C1O	5753.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Panasenoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5560.6	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C1O	5580.8	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #2	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C1OC1OC(CO)C(O)C(O)C1O	5593.3	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #3	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C1O	5578.4	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5557.1	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5618.7	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5603.5	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #7	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5603.9	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #8	C[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)OC(CO)C(O)C1O	5581.7	Semi standard non polar	33892256
Panasenoside,1TMS,isomer #9	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C1O	5576.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5473.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C	5499.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5476.6	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5499.2	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5502.2	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #14	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5486.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #15	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O	5476.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #16	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C1O	5465.5	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #17	C[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5479.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5487.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #19	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5487.2	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5470.8	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #20	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5489.1	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #21	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5477.2	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #22	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O	5462.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #23	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O	5452.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #24	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O	5465.1	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5482.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5481.8	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5468.1	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5453.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5448.0	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5459.3	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5459.4	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5467.3	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5486.2	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5467.5	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5485.5	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #35	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5511.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5494.5	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5474.1	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5454.6	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5473.6	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5452.8	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5483.3	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5464.1	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5482.9	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O	5460.0	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #44	C[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C	5476.6	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C	5471.6	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5446.6	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5460.8	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5453.7	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5443.5	Semi standard non polar	33892256
Panasenoside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5455.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5368.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5322.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #100	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5310.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #101	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5334.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #102	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5291.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #103	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5323.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5369.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #105	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5344.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #106	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5341.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5397.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #108	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5345.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #109	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5357.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5320.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #110	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5389.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5363.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #112	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5317.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5350.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #114	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5304.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #115	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5310.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #116	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5306.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #117	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5349.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5342.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5352.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5321.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #120	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5321.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5329.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5308.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5335.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5299.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5293.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5294.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5296.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5337.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5277.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5310.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5345.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5315.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5308.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5295.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5313.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5306.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5292.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5281.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5343.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5300.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5299.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5283.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5304.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5289.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5301.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5305.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5397.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5382.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5373.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5333.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #40	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5341.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #41	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5333.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #42	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5310.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #43	C[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5327.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5354.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5343.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5324.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5328.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5305.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5324.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5334.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5384.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5351.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5359.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5322.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5356.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #55	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5319.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5350.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5320.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5350.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #59	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5317.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5341.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #60	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5282.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #61	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5313.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #62	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5310.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #63	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5308.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #64	C[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	5315.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5382.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5372.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5351.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5366.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5340.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5318.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5355.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5389.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5357.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5363.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5327.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5352.5	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5322.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5352.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5322.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5345.2	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5346.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #80	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5320.7	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #81	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5285.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #82	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5308.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #83	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O	5302.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #84	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O	5306.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #85	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5306.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5381.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5354.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5360.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5330.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5306.6	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5357.0	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #91	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5320.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #92	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5344.8	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #93	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5315.3	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #94	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5341.1	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #95	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5318.9	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #96	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5282.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #97	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5308.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #98	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5309.4	Semi standard non polar	33892256
Panasenoside,3TMS,isomer #99	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5307.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5210.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5181.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #100	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5199.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #101	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5149.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #102	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5177.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #103	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5183.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #104	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5193.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #105	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C	5186.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #106	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5246.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5215.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #108	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5236.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #109	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5187.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5199.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #110	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5224.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5185.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5228.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #113	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5180.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #114	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5212.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5197.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5141.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5172.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #118	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5207.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #119	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5198.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5165.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #120	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5200.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5207.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5240.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5185.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5232.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5208.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5150.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #127	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5194.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #128	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5195.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #129	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5194.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5220.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #130	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5193.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #131	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5183.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #132	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5114.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #133	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5164.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #134	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5192.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #135	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5188.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #136	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5188.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #137	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5158.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #138	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5151.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #139	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5153.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5246.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #140	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5192.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #141	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5266.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #142	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5240.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #143	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5260.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #144	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5215.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #145	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5247.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #146	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5207.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #147	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5258.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #148	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5211.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #149	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5238.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5227.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #150	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5230.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #151	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5178.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #152	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5203.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #153	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5239.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #154	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5226.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #155	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5228.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #156	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5219.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #157	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5247.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #158	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5194.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #159	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5233.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5225.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #160	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5215.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #161	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5159.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #162	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5196.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #163	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5202.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #164	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5196.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #165	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5193.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #166	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5191.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #167	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5125.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #168	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5164.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #169	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5197.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5199.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #170	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5188.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #171	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5187.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #172	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5163.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #173	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5149.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #174	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5151.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #175	C[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5183.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #176	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5231.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #177	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5262.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #178	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5211.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #179	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5253.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5240.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #180	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5230.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #181	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5175.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #182	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5216.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #183	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5222.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #184	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5220.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #185	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5216.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #186	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5196.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #187	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5136.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #188	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5177.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #189	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5212.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5215.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #190	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5205.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #191	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5204.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #192	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5176.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #193	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5164.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #194	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5166.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #195	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5209.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #196	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5176.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #197	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5168.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #198	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5235.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #199	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5167.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5252.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5198.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #200	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5167.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5219.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #202	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5223.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #203	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5237.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #204	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5233.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #205	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5230.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #206	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5203.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #207	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5198.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #208	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5193.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #209	C[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)=C(C1=CC=C(O)C=C1)O2	5187.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5170.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #210	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5227.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5216.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5194.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5161.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5208.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5197.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5214.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5216.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5172.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5229.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5152.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5148.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5163.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5131.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5185.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5234.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5210.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5206.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5184.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5225.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5221.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5203.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5179.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5161.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5205.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5181.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5155.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5201.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5192.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5203.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5209.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5239.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5200.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5173.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5161.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5143.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5189.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5162.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5135.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5117.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5167.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5139.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5203.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5112.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5164.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5149.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5164.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5170.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5257.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5217.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5210.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5240.5	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5195.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5250.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5180.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5214.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5205.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5193.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5210.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5171.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5161.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5193.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5158.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5174.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5211.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5181.6	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5163.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5177.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5183.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5208.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5288.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5283.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5253.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5279.4	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5246.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5190.1	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5256.7	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #91	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)C=C1	5262.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)C=C1	5233.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5235.0	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5188.8	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5223.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5201.9	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5230.2	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #98	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5185.3	Semi standard non polar	33892256
Panasenoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5217.7	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5765.5	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C1O	5820.1	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C1OC1OC(CO)C(O)C(O)C1O	5820.1	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C1O	5811.2	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5765.4	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5810.8	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5787.0	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5797.9	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)OC(CO)C(O)C1O	5811.7	Semi standard non polar	33892256
Panasenoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C1O	5810.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5841.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C	5854.7	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5842.0	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5862.7	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5866.6	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5839.3	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5843.5	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5814.5	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	5817.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5842.0	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5856.3	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5836.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5860.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5834.3	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5836.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O	5807.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5806.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5849.8	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5844.0	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5814.5	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5816.6	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5789.0	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5806.3	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OCC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5792.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5824.1	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5853.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(C3=CC=C(O)C=C3)OC2=C1	5826.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=O)C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(C3=CC=C(O)C=C3)OC2=C1	5828.1	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5877.7	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)C=C1	5849.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)=C(C1=CC=C(O)C=C1)O2	5832.0	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)=C(C1=CC=C(O)C=C1)O2	5803.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(=O)C(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)=C(C1=CC=C(O)C=C1)O2	5805.2	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5809.4	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5848.8	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5817.9	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)C=C1	5821.6	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5807.4	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5811.8	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5817.7	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5815.3	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5823.5	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5793.1	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5798.0	Semi standard non polar	33892256
Panasenoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=C(C4=CC=C(O)C=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5807.2	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-005c-2411190000-66ac72b33ce4e5d29b80	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (1 TMS) - 70eV, Positive	splash10-0uxr-6512109000-bd30a45dd8d44cb3e6b9	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Panasenoside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside LC-ESI-qTof , Positive-QTOF	splash10-000i-0392000000-79fc4238249a2ada2333	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside Linear Ion Trap , negative-QTOF	splash10-003i-0091500000-eba631719c3e28ea4c2f	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside Linear Ion Trap , negative-QTOF	splash10-003i-0091500000-3924a397a278f18739ed	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside , negative-QTOF	splash10-0a59-0090006000-cef0b76814e5383134f1	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside , negative-QTOF	splash10-0a59-0090008000-875277212f205a926c69	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside Linear Ion Trap , positive-QTOF	splash10-000b-0042920000-1ef24d0fa4f30e044a6e	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Panasenoside Linear Ion Trap , positive-QTOF	splash10-000b-0061920000-718b4b0999bbbf427fd9	2017-09-14	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 10V, Positive-QTOF	splash10-000i-0290732000-75814590fc661678b82e	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 20V, Positive-QTOF	splash10-000i-0190300000-65a71ab2a458308ecc39	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 40V, Positive-QTOF	splash10-000i-0690100000-9ca88f4c5b4169de2e38	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 10V, Positive-QTOF	splash10-000i-0290732000-75814590fc661678b82e	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 20V, Positive-QTOF	splash10-000i-0190300000-65a71ab2a458308ecc39	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 40V, Positive-QTOF	splash10-000i-0690100000-9ca88f4c5b4169de2e38	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 10V, Positive-QTOF	splash10-000i-0290732000-75814590fc661678b82e	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 20V, Positive-QTOF	splash10-000i-0190300000-65a71ab2a458308ecc39	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 40V, Positive-QTOF	splash10-000i-0690100000-9ca88f4c5b4169de2e38	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 10V, Negative-QTOF	splash10-0a70-2793867000-1ec7520be8e3dc6cb0cc	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 20V, Negative-QTOF	splash10-000i-2791320000-a480ab4f496787f4964e	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 40V, Negative-QTOF	splash10-000i-4890000000-ef0ac3e9cb12d79b1519	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 10V, Negative-QTOF	splash10-0a70-2793867000-1ec7520be8e3dc6cb0cc	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 20V, Negative-QTOF	splash10-000i-2791320000-a480ab4f496787f4964e	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 40V, Negative-QTOF	splash10-000i-4890000000-ef0ac3e9cb12d79b1519	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 10V, Negative-QTOF	splash10-0a70-2793867000-1ec7520be8e3dc6cb0cc	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 20V, Negative-QTOF	splash10-000i-2791320000-a480ab4f496787f4964e	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Panasenoside 40V, Negative-QTOF	splash10-000i-4890000000-ef0ac3e9cb12d79b1519	2015-04-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016616

KNApSAcK ID

C00005164

Chemspider ID

10774918

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

13647412

PDB ID

Not Available

ChEBI ID

139414

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1861831

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Panasenoside (HMDB0037534)

MOL for HMDB0037534 (Panasenoside)

3D MOL for HMDB0037534 (Panasenoside)

3D SDF for HMDB0037534 (Panasenoside)

3D-SDF for HMDB0037534 (Panasenoside)

PDB for HMDB0037534 (Panasenoside)

3D PDB for HMDB0037534 (Panasenoside)

SMILES for HMDB0037534 (Panasenoside)

INCHI for HMDB0037534 (Panasenoside)

Structure for HMDB0037534 (Panasenoside)

3D Structure for HMDB0037534 (Panasenoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra