Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:49:14 UTC

Update Date

2022-03-07 02:55:24 UTC

HMDB ID

HMDB0037569

Secondary Accession Numbers

HMDB37569

Metabolite Identification

Common Name

Isovitexin 2''-O-arabinoside

Description

Isovitexin 2''-O-arabinoside belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone. Isovitexin 2''-O-arabinoside has been detected, but not quantified in, a few different foods, such as breakfast cereal, cereals and cereal products, and oats (Avena sativa). This could make isovitexin 2''-O-arabinoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Isovitexin 2''-O-arabinoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061309522D          

 40 44  0  0  0  0            999 V2000
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    7.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  2  0  0  0  0
  9  1  2  0  0  0  0
  9  2  1  0  0  0  0
 10  3  2  0  0  0  0
 10  4  1  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 13  8  1  0  0  0  0
 14  5  2  0  0  0  0
 14  9  1  0  0  0  0
 15  6  1  0  0  0  0
 16  7  1  0  0  0  0
 17 11  1  0  0  0  0
 17 15  2  0  0  0  0
 18 12  1  0  0  0  0
 19 13  1  0  0  0  0
 20 16  1  0  0  0  0
 21 17  1  0  0  0  0
 21 18  2  0  0  0  0
 22 20  1  0  0  0  0
 23 19  1  0  0  0  0
 24 18  1  0  0  0  0
 25 22  1  0  0  0  0
 25 24  1  0  0  0  0
 26 23  1  0  0  0  0
 27  7  1  0  0  0  0
 28 10  1  0  0  0  0
 29 11  2  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 19  1  0  0  0  0
 33 20  1  0  0  0  0
 34 21  1  0  0  0  0
 35 22  1  0  0  0  0
 36 23  1  0  0  0  0
 37  8  1  0  0  0  0
 37 26  1  0  0  0  0
 38 14  1  0  0  0  0
 38 15  1  0  0  0  0
 39 16  1  0  0  0  0
 39 24  1  0  0  0  0
 40 25  1  0  0  0  0
 40 26  1  0  0  0  0
M  END

HMDB0037569
     RDKit          3D
Isovitexin 2''-O-arabinoside
 68 72  0  0  0  0  0  0  0  0999 V2000
    1.2875    3.1542    0.5332 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8415    2.1514    0.9993 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5838    2.2000    2.1294 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2114    1.0567    2.6445 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0121    1.0610    3.8954 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7059   -0.1384    4.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3170   -0.2110    5.4413 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3249    0.7679    6.4004 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8883    0.7318    7.5705 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6133    1.9549    6.0316 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0058    2.0413    4.8265 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0612   -0.0403    1.9905 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3198   -0.1579    0.8418 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1955   -1.3626    0.2421 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4474   -1.5320   -0.8689 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3475   -2.8117   -1.4862 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7655   -0.4036   -1.4225 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1382   -0.7444   -2.5107 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4582   -1.1537   -3.6538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1439   -1.1077   -4.8428 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1989   -2.4083   -5.5921 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1946   -3.5156   -4.8821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6333   -0.9819   -4.9381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9614    0.2159   -5.6546 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2464   -0.8281   -3.6049 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5699   -0.4195   -3.5846 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3375    0.1761   -2.7920 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0159    0.5089   -1.7729 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6389    1.1738   -0.9171 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0029    1.0870    0.3637 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1200   -0.2616    0.8161 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5166   -0.2585    1.4317 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7446   -1.2938    2.2760 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4528   -0.1992    0.2522 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7287    0.0463    0.8019 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1052    0.9573   -0.6315 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5488    2.1056    0.0692 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8816    0.8168   -0.8493 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3705    2.0341   -1.1661 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7109    0.9267    0.3449 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7177    3.1052    2.6975 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7196   -0.9058    3.4646 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8910   -1.1219    5.6732 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3199    0.5461    8.3203 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5923    2.7518    6.7731 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4841    2.9894    4.6181 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7286   -2.2143    0.6990 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8637   -3.5564   -0.9322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6740   -1.7274   -2.1177 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3005   -0.2457   -5.4563 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2721   -2.3671   -5.8346 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3490   -2.3755   -6.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2408   -3.4480   -3.9731 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0991   -1.8349   -5.5056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7380    0.6774   -5.2504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1835   -1.7897   -2.9973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0634   -0.9127   -2.8448 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9749    0.9158   -3.5472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5863    2.3118   -1.0961 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1307   -0.9540   -0.0268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3861   -0.4136    1.5883 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6741    0.7136    1.9744 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8030   -1.0225    3.2436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4400   -1.1753   -0.3000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6617    0.5870    1.6359 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7291    0.9564   -1.5716 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8753    2.8313   -0.0174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2109    2.3411   -1.9311 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 17 38  1  0
 38 39  1  0
 38 40  2  0
 40  2  1  0
 11  5  1  0
 40 13  1  0
 27 18  1  0
 36 29  1  0
  3 41  1  0
  6 42  1  0
  7 43  1  0
  9 44  1  0
 10 45  1  0
 11 46  1  0
 14 47  1  0
 16 48  1  0
 18 49  1  0
 20 50  1  0
 21 51  1  0
 21 52  1  0
 22 53  1  0
 23 54  1  0
 24 55  1  0
 25 56  1  0
 26 57  1  0
 27 58  1  0
 29 59  1  0
 31 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 39 68  1  0
M  END


  Mrv0541 05061309522D          

 40 44  0  0  0  0            999 V2000
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    7.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  2  0  0  0  0
  9  1  2  0  0  0  0
  9  2  1  0  0  0  0
 10  3  2  0  0  0  0
 10  4  1  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 13  8  1  0  0  0  0
 14  5  2  0  0  0  0
 14  9  1  0  0  0  0
 15  6  1  0  0  0  0
 16  7  1  0  0  0  0
 17 11  1  0  0  0  0
 17 15  2  0  0  0  0
 18 12  1  0  0  0  0
 19 13  1  0  0  0  0
 20 16  1  0  0  0  0
 21 17  1  0  0  0  0
 21 18  2  0  0  0  0
 22 20  1  0  0  0  0
 23 19  1  0  0  0  0
 24 18  1  0  0  0  0
 25 22  1  0  0  0  0
 25 24  1  0  0  0  0
 26 23  1  0  0  0  0
 27  7  1  0  0  0  0
 28 10  1  0  0  0  0
 29 11  2  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 19  1  0  0  0  0
 33 20  1  0  0  0  0
 34 21  1  0  0  0  0
 35 22  1  0  0  0  0
 36 23  1  0  0  0  0
 37  8  1  0  0  0  0
 37 26  1  0  0  0  0
 38 14  1  0  0  0  0
 38 15  1  0  0  0  0
 39 16  1  0  0  0  0
 39 24  1  0  0  0  0
 40 25  1  0  0  0  0
 40 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037569

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(C(OC2OCC(O)C(O)C2O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC=C(O)C=C2)C=C1O

> <INCHI_IDENTIFIER>
InChI=1S/C26H28O14/c27-7-16-20(33)22(35)25(40-26-23(36)19(32)13(31)8-37-26)24(39-16)18-12(30)6-15-17(21(18)34)11(29)5-14(38-15)9-1-3-10(28)4-2-9/h1-6,13,16,19-20,22-28,30-36H,7-8H2

> <INCHI_KEY>
ACRIYYKEWCXQOS-UHFFFAOYSA-N

> <FORMULA>
C26H28O14

> <MOLECULAR_WEIGHT>
564.4921

> <EXACT_MASS>
564.147905604

> <JCHEM_ACCEPTOR_COUNT>
14

> <JCHEM_AVERAGE_POLARIZABILITY>
55.02443451472298

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
6-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.40

> <JCHEM_LOGP>
-1.1911324750000003

> <ALOGPS_LOGS>
-2.13

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.502072440203145

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.196596413868001

> <JCHEM_PKA_STRONGEST_BASIC>
-3.52658066462764

> <JCHEM_POLAR_SURFACE_AREA>
236.05999999999995

> <JCHEM_REFRACTIVITY>
132.48299999999992

> <JCHEM_ROTATABLE_BOND_COUNT>
5

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
4.16e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
6-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037569
     RDKit          3D
Isovitexin 2''-O-arabinoside
 68 72  0  0  0  0  0  0  0  0999 V2000
    1.2875    3.1542    0.5332 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8415    2.1514    0.9993 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5838    2.2000    2.1294 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2114    1.0567    2.6445 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0121    1.0610    3.8954 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7059   -0.1384    4.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3170   -0.2110    5.4413 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3249    0.7679    6.4004 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8883    0.7318    7.5705 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6133    1.9549    6.0316 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0058    2.0413    4.8265 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0612   -0.0403    1.9905 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3198   -0.1579    0.8418 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1955   -1.3626    0.2421 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4474   -1.5320   -0.8689 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3475   -2.8117   -1.4862 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7655   -0.4036   -1.4225 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1382   -0.7444   -2.5107 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4582   -1.1537   -3.6538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1439   -1.1077   -4.8428 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1989   -2.4083   -5.5921 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1946   -3.5156   -4.8821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6333   -0.9819   -4.9381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9614    0.2159   -5.6546 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2464   -0.8281   -3.6049 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5699   -0.4195   -3.5846 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3375    0.1761   -2.7920 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0159    0.5089   -1.7729 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6389    1.1738   -0.9171 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0029    1.0870    0.3637 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1200   -0.2616    0.8161 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5166   -0.2585    1.4317 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7446   -1.2938    2.2760 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4528   -0.1992    0.2522 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7287    0.0463    0.8019 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1052    0.9573   -0.6315 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5488    2.1056    0.0692 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8816    0.8168   -0.8493 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3705    2.0341   -1.1661 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7109    0.9267    0.3449 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7177    3.1052    2.6975 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7196   -0.9058    3.4646 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8910   -1.1219    5.6732 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3199    0.5461    8.3203 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5923    2.7518    6.7731 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4841    2.9894    4.6181 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7286   -2.2143    0.6990 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8637   -3.5564   -0.9322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6740   -1.7274   -2.1177 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3005   -0.2457   -5.4563 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2721   -2.3671   -5.8346 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3490   -2.3755   -6.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2408   -3.4480   -3.9731 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0991   -1.8349   -5.5056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7380    0.6774   -5.2504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1835   -1.7897   -2.9973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0634   -0.9127   -2.8448 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9749    0.9158   -3.5472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5863    2.3118   -1.0961 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1307   -0.9540   -0.0268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3861   -0.4136    1.5883 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6741    0.7136    1.9744 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8030   -1.0225    3.2436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4400   -1.1753   -0.3000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6617    0.5870    1.6359 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7291    0.9564   -1.5716 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8753    2.8313   -0.0174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2109    2.3411   -1.9311 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 17 38  1  0
 38 39  1  0
 38 40  2  0
 40  2  1  0
 11  5  1  0
 40 13  1  0
 27 18  1  0
 36 29  1  0
  3 41  1  0
  6 42  1  0
  7 43  1  0
  9 44  1  0
 10 45  1  0
 11 46  1  0
 14 47  1  0
 16 48  1  0
 18 49  1  0
 20 50  1  0
 21 51  1  0
 21 52  1  0
 22 53  1  0
 23 54  1  0
 24 55  1  0
 25 56  1  0
 26 57  1  0
 27 58  1  0
 29 59  1  0
 31 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 39 68  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -4.001  -0.770   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       5.335  10.780   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -5.335   0.000   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       4.001  11.550   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667  10.780   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       8.002   6.160   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       6.668   6.930   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       2.667   9.240   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       5.335   6.160   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       4.001   8.470   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      -6.668  -0.770   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       0.000   6.160   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       4.001  13.090   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       1.334  11.550   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       9.336   6.930   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       2.667   6.160   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       6.668   8.470   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       1.334   8.470   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       5.335   9.240   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       4.001   6.930   0.000  0.00  0.00           O+0
CONECT    1    3    9                                                       
CONECT    2    4    9                                                       
CONECT    3    1   10                                                       
CONECT    4    2   10                                                       
CONECT    5   11   14                                                       
CONECT    6   12   15                                                       
CONECT    7   16   27                                                       
CONECT    8   13   37                                                       
CONECT    9    1    2   14                                                  
CONECT   10    3    4   28                                                  
CONECT   11    5   17   29                                                  
CONECT   12    6   18   30                                                  
CONECT   13    8   19   31                                                  
CONECT   14    5    9   38                                                  
CONECT   15    6   17   38                                                  
CONECT   16    7   20   39                                                  
CONECT   17   11   15   21                                                  
CONECT   18   12   21   24                                                  
CONECT   19   13   23   32                                                  
CONECT   20   16   22   33                                                  
CONECT   21   17   18   34                                                  
CONECT   22   20   25   35                                                  
CONECT   23   19   26   36                                                  
CONECT   24   18   25   39                                                  
CONECT   25   22   24   40                                                  
CONECT   26   23   37   40                                                  
CONECT   27    7                                                            
CONECT   28   10                                                            
CONECT   29   11                                                            
CONECT   30   12                                                            
CONECT   31   13                                                            
CONECT   32   19                                                            
CONECT   33   20                                                            
CONECT   34   21                                                            
CONECT   35   22                                                            
CONECT   36   23                                                            
CONECT   37    8   26                                                       
CONECT   38   14   15                                                       
CONECT   39   16   24                                                       
CONECT   40   25   26                                                       
MASTER        0    0    0    0    0    0    0    0   40    0   88    0
END

COMPND    HMDB0037569
HETATM    1  O1  UNL     1       1.288   3.154   0.533  1.00  0.00           O  
HETATM    2  C1  UNL     1       1.842   2.151   0.999  1.00  0.00           C  
HETATM    3  C2  UNL     1       2.584   2.200   2.129  1.00  0.00           C  
HETATM    4  C3  UNL     1       3.211   1.057   2.645  1.00  0.00           C  
HETATM    5  C4  UNL     1       4.012   1.061   3.895  1.00  0.00           C  
HETATM    6  C5  UNL     1       4.706  -0.138   4.209  1.00  0.00           C  
HETATM    7  C6  UNL     1       5.317  -0.211   5.441  1.00  0.00           C  
HETATM    8  C7  UNL     1       5.325   0.768   6.400  1.00  0.00           C  
HETATM    9  O2  UNL     1       5.888   0.732   7.571  1.00  0.00           O  
HETATM   10  C8  UNL     1       4.613   1.955   6.032  1.00  0.00           C  
HETATM   11  C9  UNL     1       4.006   2.041   4.827  1.00  0.00           C  
HETATM   12  O3  UNL     1       3.061  -0.040   1.991  1.00  0.00           O  
HETATM   13  C10 UNL     1       2.320  -0.158   0.842  1.00  0.00           C  
HETATM   14  C11 UNL     1       2.195  -1.363   0.242  1.00  0.00           C  
HETATM   15  C12 UNL     1       1.447  -1.532  -0.869  1.00  0.00           C  
HETATM   16  O4  UNL     1       1.347  -2.812  -1.486  1.00  0.00           O  
HETATM   17  C13 UNL     1       0.766  -0.404  -1.422  1.00  0.00           C  
HETATM   18  C14 UNL     1      -0.138  -0.744  -2.511  1.00  0.00           C  
HETATM   19  O5  UNL     1       0.458  -1.154  -3.654  1.00  0.00           O  
HETATM   20  C15 UNL     1      -0.144  -1.108  -4.843  1.00  0.00           C  
HETATM   21  C16 UNL     1       0.199  -2.408  -5.592  1.00  0.00           C  
HETATM   22  O6  UNL     1      -0.195  -3.516  -4.882  1.00  0.00           O  
HETATM   23  C17 UNL     1      -1.633  -0.982  -4.938  1.00  0.00           C  
HETATM   24  O7  UNL     1      -1.961   0.216  -5.655  1.00  0.00           O  
HETATM   25  C18 UNL     1      -2.246  -0.828  -3.605  1.00  0.00           C  
HETATM   26  O8  UNL     1      -3.570  -0.419  -3.585  1.00  0.00           O  
HETATM   27  C19 UNL     1      -1.337   0.176  -2.792  1.00  0.00           C  
HETATM   28  O9  UNL     1      -2.016   0.509  -1.773  1.00  0.00           O  
HETATM   29  C20 UNL     1      -2.639   1.174  -0.917  1.00  0.00           C  
HETATM   30  O10 UNL     1      -2.003   1.087   0.364  1.00  0.00           O  
HETATM   31  C21 UNL     1      -2.120  -0.262   0.816  1.00  0.00           C  
HETATM   32  C22 UNL     1      -3.517  -0.259   1.432  1.00  0.00           C  
HETATM   33  O11 UNL     1      -3.745  -1.294   2.276  1.00  0.00           O  
HETATM   34  C23 UNL     1      -4.453  -0.199   0.252  1.00  0.00           C  
HETATM   35  O12 UNL     1      -5.729   0.046   0.802  1.00  0.00           O  
HETATM   36  C24 UNL     1      -4.105   0.957  -0.631  1.00  0.00           C  
HETATM   37  O13 UNL     1      -4.549   2.106   0.069  1.00  0.00           O  
HETATM   38  C25 UNL     1       0.882   0.817  -0.849  1.00  0.00           C  
HETATM   39  O14 UNL     1       0.371   2.034  -1.166  1.00  0.00           O  
HETATM   40  C26 UNL     1       1.711   0.927   0.345  1.00  0.00           C  
HETATM   41  H1  UNL     1       2.718   3.105   2.697  1.00  0.00           H  
HETATM   42  H2  UNL     1       4.720  -0.906   3.465  1.00  0.00           H  
HETATM   43  H3  UNL     1       5.891  -1.122   5.673  1.00  0.00           H  
HETATM   44  H4  UNL     1       6.320   0.546   8.320  1.00  0.00           H  
HETATM   45  H5  UNL     1       4.592   2.752   6.773  1.00  0.00           H  
HETATM   46  H6  UNL     1       3.484   2.989   4.618  1.00  0.00           H  
HETATM   47  H7  UNL     1       2.729  -2.214   0.699  1.00  0.00           H  
HETATM   48  H8  UNL     1       1.864  -3.556  -0.932  1.00  0.00           H  
HETATM   49  H9  UNL     1      -0.674  -1.727  -2.118  1.00  0.00           H  
HETATM   50  H10 UNL     1       0.300  -0.246  -5.456  1.00  0.00           H  
HETATM   51  H11 UNL     1       1.272  -2.367  -5.835  1.00  0.00           H  
HETATM   52  H12 UNL     1      -0.349  -2.376  -6.574  1.00  0.00           H  
HETATM   53  H13 UNL     1       0.241  -3.448  -3.973  1.00  0.00           H  
HETATM   54  H14 UNL     1      -2.099  -1.835  -5.506  1.00  0.00           H  
HETATM   55  H15 UNL     1      -2.738   0.677  -5.250  1.00  0.00           H  
HETATM   56  H16 UNL     1      -2.183  -1.790  -2.997  1.00  0.00           H  
HETATM   57  H17 UNL     1      -4.063  -0.913  -2.845  1.00  0.00           H  
HETATM   58  H18 UNL     1      -0.975   0.916  -3.547  1.00  0.00           H  
HETATM   59  H19 UNL     1      -2.586   2.312  -1.096  1.00  0.00           H  
HETATM   60  H20 UNL     1      -2.131  -0.954  -0.027  1.00  0.00           H  
HETATM   61  H21 UNL     1      -1.386  -0.414   1.588  1.00  0.00           H  
HETATM   62  H22 UNL     1      -3.674   0.714   1.974  1.00  0.00           H  
HETATM   63  H23 UNL     1      -3.803  -1.023   3.244  1.00  0.00           H  
HETATM   64  H24 UNL     1      -4.440  -1.175  -0.300  1.00  0.00           H  
HETATM   65  H25 UNL     1      -5.662   0.587   1.636  1.00  0.00           H  
HETATM   66  H26 UNL     1      -4.729   0.956  -1.572  1.00  0.00           H  
HETATM   67  H27 UNL     1      -3.875   2.831  -0.017  1.00  0.00           H  
HETATM   68  H28 UNL     1      -0.211   2.341  -1.931  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   40
CONECT    3    4    4   41
CONECT    4    5   12
CONECT    5    6    6   11
CONECT    6    7   42
CONECT    7    8    8   43
CONECT    8    9   10
CONECT    9   44
CONECT   10   11   11   45
CONECT   11   46
CONECT   12   13
CONECT   13   14   14   40
CONECT   14   15   47
CONECT   15   16   17   17
CONECT   16   48
CONECT   17   18   38
CONECT   18   19   27   49
CONECT   19   20
CONECT   20   21   23   50
CONECT   21   22   51   52
CONECT   22   53
CONECT   23   24   25   54
CONECT   24   55
CONECT   25   26   27   56
CONECT   26   57
CONECT   27   28   58
CONECT   28   29
CONECT   29   30   36   59
CONECT   30   31
CONECT   31   32   60   61
CONECT   32   33   34   62
CONECT   33   63
CONECT   34   35   36   64
CONECT   35   65
CONECT   36   37   66
CONECT   37   67
CONECT   38   39   40   40
CONECT   39   68
END

HMDB0037569
     RDKit          3D
Isovitexin 2''-O-arabinoside
 68 72  0  0  0  0  0  0  0  0999 V2000
    1.2875    3.1542    0.5332 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8415    2.1514    0.9993 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5838    2.2000    2.1294 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2114    1.0567    2.6445 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0121    1.0610    3.8954 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7059   -0.1384    4.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3170   -0.2110    5.4413 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3249    0.7679    6.4004 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8883    0.7318    7.5705 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6133    1.9549    6.0316 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0058    2.0413    4.8265 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0612   -0.0403    1.9905 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3198   -0.1579    0.8418 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1955   -1.3626    0.2421 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4474   -1.5320   -0.8689 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3475   -2.8117   -1.4862 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7655   -0.4036   -1.4225 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1382   -0.7444   -2.5107 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4582   -1.1537   -3.6538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1439   -1.1077   -4.8428 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1989   -2.4083   -5.5921 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1946   -3.5156   -4.8821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6333   -0.9819   -4.9381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9614    0.2159   -5.6546 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2464   -0.8281   -3.6049 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5699   -0.4195   -3.5846 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3375    0.1761   -2.7920 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0159    0.5089   -1.7729 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6389    1.1738   -0.9171 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0029    1.0870    0.3637 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1200   -0.2616    0.8161 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5166   -0.2585    1.4317 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7446   -1.2938    2.2760 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4528   -0.1992    0.2522 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7287    0.0463    0.8019 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1052    0.9573   -0.6315 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5488    2.1056    0.0692 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8816    0.8168   -0.8493 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3705    2.0341   -1.1661 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7109    0.9267    0.3449 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7177    3.1052    2.6975 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7196   -0.9058    3.4646 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8910   -1.1219    5.6732 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3199    0.5461    8.3203 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5923    2.7518    6.7731 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4841    2.9894    4.6181 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7286   -2.2143    0.6990 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8637   -3.5564   -0.9322 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6740   -1.7274   -2.1177 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3005   -0.2457   -5.4563 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2721   -2.3671   -5.8346 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3490   -2.3755   -6.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2408   -3.4480   -3.9731 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0991   -1.8349   -5.5056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7380    0.6774   -5.2504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1835   -1.7897   -2.9973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0634   -0.9127   -2.8448 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9749    0.9158   -3.5472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5863    2.3118   -1.0961 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1307   -0.9540   -0.0268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3861   -0.4136    1.5883 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6741    0.7136    1.9744 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8030   -1.0225    3.2436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4400   -1.1753   -0.3000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6617    0.5870    1.6359 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7291    0.9564   -1.5716 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8753    2.8313   -0.0174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2109    2.3411   -1.9311 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 17 38  1  0
 38 39  1  0
 38 40  2  0
 40  2  1  0
 11  5  1  0
 40 13  1  0
 27 18  1  0
 36 29  1  0
  3 41  1  0
  6 42  1  0
  7 43  1  0
  9 44  1  0
 10 45  1  0
 11 46  1  0
 14 47  1  0
 16 48  1  0
 18 49  1  0
 20 50  1  0
 21 51  1  0
 21 52  1  0
 22 53  1  0
 23 54  1  0
 24 55  1  0
 25 56  1  0
 26 57  1  0
 27 58  1  0
 29 59  1  0
 31 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 39 68  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Not Available

Chemical Formula

C₂₆H₂₈O₁₄

Average Molecular Weight

564.4921

Monoisotopic Molecular Weight

564.147905604

IUPAC Name

6-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

Traditional Name

6-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

CAS Registry Number

53382-71-1

SMILES

OCC1OC(C(OC2OCC(O)C(O)C2O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC=C(O)C=C2)C=C1O

InChI Identifier

InChI=1S/C26H28O14/c27-7-16-20(33)22(35)25(40-26-23(36)19(32)13(31)8-37-26)24(39-16)18-12(30)6-15-17(21(18)34)11(29)5-14(38-15)9-1-3-10(28)4-2-9/h1-6,13,16,19-20,22-28,30-36H,7-8H2

InChI Key

ACRIYYKEWCXQOS-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid C-glycosides

Alternative Parents

Substituents

Flavonoid c-glycoside
Hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Phenolic glycoside
O-glycosyl compound
Glycosyl compound
Disaccharide
Chromone
C-glycosyl compound
1-benzopyran
Benzopyran
1-hydroxy-2-unsubstituted benzenoid
1-hydroxy-4-unsubstituted benzenoid
Pyranone
Phenol
Monocyclic benzene moiety
Benzenoid
Pyran
Oxane
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Ether
Dialkyl ether
Organoheterocyclic compound
Oxacycle
Polyol
Acetal
Hydrocarbon derivative
Organic oxide
Organic oxygen compound
Alcohol
Primary alcohol
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037569)
Cytoplasm (HMDB: HMDB0037569)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037569)

Source

Exogenous

Food

Food (HMDB: HMDB0037569)

Cereal and cereal product

Cereal product

Breakfast cereal (FooDB: FOOD00270)

Cereal

Oat (FooDB: FOOD00022)

Cereals and cereal products (FooDB: FOOD00858)

Endogenous

Plant

Plant (HMDB: HMDB0037569)
Poaceae (HMDB: HMDB0037569)

Not Available

Nutrient (HMDB: HMDB0037569)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	4.16 g/L	ALOGPS
logP	-0.4	ALOGPS
logP	-1.2	ChemAxon
logS	-2.1	ALOGPS
pKa (Strongest Acidic)	6.2	ChemAxon
pKa (Strongest Basic)	-3.5	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	14	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	236.06 Å²	ChemAxon
Rotatable Bond Count	5	ChemAxon
Refractivity	132.48 m³·mol⁻¹	ChemAxon
Polarizability	55.02 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	214.664	30932474
DeepCCS	[M-H]-	212.268	30932474
DeepCCS	[M-2H]-	245.189	30932474
DeepCCS	[M+Na]+	220.577	30932474
AllCCS	[M+H]+	228.9	32859911
AllCCS	[M+H-H2O]+	227.3	32859911
AllCCS	[M+NH4]+	230.4	32859911
AllCCS	[M+Na]+	230.9	32859911
AllCCS	[M-H]-	226.4	32859911
AllCCS	[M+Na-2H]-	228.5	32859911
AllCCS	[M+HCOO]-	231.0	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Isovitexin 2''-O-arabinoside	OCC1OC(C(OC2OCC(O)C(O)C2O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC=C(O)C=C2)C=C1O	5513.4	Standard polar	33892256
Isovitexin 2''-O-arabinoside	OCC1OC(C(OC2OCC(O)C(O)C2O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC=C(O)C=C2)C=C1O	4940.6	Standard non polar	33892256
Isovitexin 2''-O-arabinoside	OCC1OC(C(OC2OCC(O)C(O)C2O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC=C(O)C=C2)C=C1O	5558.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Isovitexin 2''-O-arabinoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5343.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #2	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O	5388.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #3	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C1O	5373.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #4	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)OCC(O)C1O	5373.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #5	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1OC1OCC(O)C(O)C1O	5387.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #6	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C1O	5373.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #7	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5302.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #8	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5401.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5366.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5291.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #10	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5335.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #11	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5300.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #12	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O	5318.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #13	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O	5330.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #14	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O	5304.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #15	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C	5333.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5297.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5308.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #18	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5264.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #19	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C1O	5305.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5302.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #20	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C1O	5318.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #21	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C1O[Si](C)(C)C	5306.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5310.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #23	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5320.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #24	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5274.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #25	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C1O	5306.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #26	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)OCC(O)C1O	5325.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #27	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C1O[Si](C)(C)C	5339.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5314.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #29	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5329.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O	5264.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #30	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5283.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5308.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #32	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5320.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #33	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5274.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5309.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #35	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5293.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5308.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5295.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5281.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5278.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5291.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5290.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5322.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5202.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5167.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5194.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5201.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5211.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5148.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5102.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5124.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5130.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5144.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5198.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O	5168.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5173.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5181.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5189.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5165.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5164.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5170.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5168.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5174.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5218.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #29	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5209.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5200.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5193.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5210.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5211.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5225.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #34	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5214.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #35	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5186.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5207.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #37	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5212.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5228.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5221.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5158.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #40	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5162.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #41	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5160.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #42	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5172.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #43	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5162.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #44	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5241.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #45	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5207.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #46	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5226.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #47	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5217.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #48	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5235.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #49	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5248.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5180.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5160.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5141.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5171.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5172.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5199.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #55	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5133.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5170.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5174.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5215.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #59	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5116.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5182.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #60	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5116.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #61	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5127.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #62	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5229.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #63	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5195.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #64	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C1O[Si](C)(C)C	5206.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #65	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5194.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5172.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #67	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5198.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #68	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5203.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5171.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5198.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5200.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5211.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #72	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5142.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #73	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5145.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #74	C[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OCC(O)C1O	5242.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5231.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5248.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #77	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5170.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5185.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5163.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O	5162.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5158.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5187.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #82	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5163.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5162.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5203.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5204.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O	5054.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5007.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #100	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	4999.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #101	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5008.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #102	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	4945.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	4954.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	4990.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5056.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #106	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5034.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5046.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #108	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4963.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #109	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4945.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5018.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #110	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4955.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #111	C[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C	5071.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #112	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5038.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5037.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #114	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5042.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #115	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	4979.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #116	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	4985.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #117	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5056.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	4995.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	4998.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5028.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5099.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #121	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5000.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5080.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5022.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5030.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5028.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5025.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5027.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5025.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5033.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5005.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4973.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4986.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5010.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5060.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5012.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5062.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5027.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	4963.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5010.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5004.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5018.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5052.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5052.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5042.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5008.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5051.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5036.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4997.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5008.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5041.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5049.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5090.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	4986.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	4990.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	4996.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5047.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5004.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4946.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4936.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4949.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4968.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4970.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5027.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5059.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5039.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5040.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5037.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5052.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5044.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5083.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5026.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5022.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5046.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5074.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5060.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #58	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5051.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #59	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5056.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5052.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5062.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #61	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5064.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #62	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5010.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #63	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5012.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #64	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5018.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #65	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5024.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OCC(O[Si](C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5062.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #67	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5023.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #68	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5023.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #69	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5032.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5034.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #70	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5032.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #71	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5077.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5010.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5012.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5017.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #75	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5027.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5090.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5052.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5054.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #79	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5062.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C1O	4960.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5061.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5102.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #82	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5019.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #83	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4982.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #84	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4983.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #85	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4989.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #86	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	4995.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #87	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5017.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #88	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5094.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #89	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5082.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(OC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5001.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #90	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5077.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #91	C[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5097.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	4987.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5002.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5012.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5044.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	4936.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	4943.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #98	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	4978.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OCC(O)C(O[Si](C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5019.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5544.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O	5628.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C1O	5613.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)OCC(O)C1O	5611.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1OC1OCC(O)C(O)C1O	5619.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C1O	5614.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5543.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5583.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5558.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5682.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5745.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5716.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5747.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5756.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5727.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5758.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O[Si](C)(C)C(C)(C)C)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5689.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5711.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5679.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C1O	5722.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O	5699.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5731.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1C(O)COC(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O)C1O[Si](C)(C)C(C)(C)C	5711.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O[Si](C)(C)C(C)(C)C)C(=O)C=C(C1=CC=C(O)C=C1)O2	5683.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5705.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2OC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5672.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5714.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1C(OC2C(C3=C(O)C=C4OC(C5=CC=C(O)C=C5)=CC(=O)C4=C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OCC(O)C1O	5725.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C	5756.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5699.5	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5723.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(OC2OCC(O)C(O)C2O)C(O)C1O	5672.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5690.0	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5697.1	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5716.6	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OCC(O)C(O)C2O)C(O)=CC2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5685.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5716.9	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O)C=C3O2)C=C1	5705.2	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5717.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5710.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5689.4	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5681.3	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5699.7	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(OC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5705.8	Semi standard non polar	33892256
Isovitexin 2''-O-arabinoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1C1OC(CO)C(O)C(O)C1OC1OCC(O[Si](C)(C)C(C)(C)C)C(O)C1O)C(=O)C=C(C1=CC=C(O)C=C1)O2	5721.7	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0fl1-5332690000-fca4259038849ea619d1	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (1 TMS) - 70eV, Positive	splash10-01c0-3530945000-c641ecd47f8c4032f41f	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS ("Isovitexin 2''-O-arabinoside,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isovitexin 2''-O-arabinoside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 10V, Positive-QTOF	splash10-015a-0100980000-e65665b39b72501170e8	2016-06-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 20V, Positive-QTOF	splash10-0159-0200910000-aac9cdcc5c654a237a96	2016-06-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 40V, Positive-QTOF	splash10-00kb-2389510000-26da34ae41414c4bb955	2016-06-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 10V, Negative-QTOF	splash10-03ea-1210690000-c5aa10a8a4b2f86a2872	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 20V, Negative-QTOF	splash10-01qa-4714930000-8c01a334de882c7ef50d	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 40V, Negative-QTOF	splash10-0007-9826200000-3f478fd706871ce1db8b	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 10V, Negative-QTOF	splash10-03di-0000090000-7dac33c1867ebf2369b9	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 20V, Negative-QTOF	splash10-03di-0000090000-5d8a4e28f213bae4d138	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 40V, Negative-QTOF	splash10-0a4j-0900630000-d29e083ca2321a32cc9a	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 10V, Positive-QTOF	splash10-014i-0000090000-2b44d7c7097dece6794d	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 20V, Positive-QTOF	splash10-014i-0000090000-2b44d7c7097dece6794d	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isovitexin 2''-O-arabinoside 40V, Positive-QTOF	splash10-014j-0300950000-197ae5185fdeb4e04b5b	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016657

KNApSAcK ID

C00014039

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

14427342

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Isovitexin 2''-O-arabinoside (HMDB0037569)

MOL for HMDB0037569 (Isovitexin 2''-O-arabinoside)

3D MOL for HMDB0037569 (Isovitexin 2''-O-arabinoside)

3D SDF for HMDB0037569 (Isovitexin 2''-O-arabinoside)

3D-SDF for HMDB0037569 (Isovitexin 2''-O-arabinoside)

PDB for HMDB0037569 (Isovitexin 2''-O-arabinoside)

3D PDB for HMDB0037569 (Isovitexin 2''-O-arabinoside)

SMILES for HMDB0037569 (Isovitexin 2''-O-arabinoside)

INCHI for HMDB0037569 (Isovitexin 2''-O-arabinoside)

Structure for HMDB0037569 (Isovitexin 2''-O-arabinoside)

3D Structure for HMDB0037569 (Isovitexin 2''-O-arabinoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra