Showing metabocard for Pavetannin D1 (HMDB0037671)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 22:55:55 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:55:27 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0037671 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Pavetannin D1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Pavetannin D1 belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. Pavetannin D1 has been detected, but not quantified in, herbs and spices. This could make pavetannin D1 a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Pavetannin D1. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0037671 (Pavetannin D1)Mrv0541 05061309562D 105120 0 0 0 0 999 V2000 -0.8271 0.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1001 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6011 0.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3281 0.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0294 0.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7564 0.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4576 0.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1846 0.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8858 0.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8600 1.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1330 1.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7038 -2.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2704 -3.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6616 -3.9114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4656 2.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5401 3.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8659 3.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9404 4.3398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5613 2.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2883 1.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3141 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6129 0.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6387 -0.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9374 -0.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2104 -0.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5092 -0.9168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4427 3.6472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1170 3.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0425 2.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7168 1.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6423 1.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8935 0.7070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0654 0.9242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3166 0.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2421 -0.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4933 -0.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8190 -0.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0702 -0.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3959 0.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6471 -0.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9728 0.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2240 -0.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4887 0.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3124 -0.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6871 -0.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5965 3.9053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2708 3.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1963 2.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8706 2.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6194 2.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6939 3.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0196 3.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0942 4.5979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2192 1.1824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4704 0.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7961 1.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0473 0.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2469 -1.6288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9957 -1.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6700 -1.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4188 -1.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0931 -1.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5799 1.8130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8529 1.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1517 1.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5753 1.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2765 1.9023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0992 -0.6364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6446 2.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0036 1.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7048 1.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4318 1.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7436 2.3208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9877 -3.8627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5542 -3.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9455 -2.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5120 -1.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3126 -1.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7460 -1.0547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4960 -1.4963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1495 -1.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8238 -1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5726 -1.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7798 -2.0228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6527 -1.0061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3539 -0.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0809 -0.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7822 -0.5268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1841 -4.2598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1583 -3.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4313 -3.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4055 -2.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1067 -1.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8338 -2.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8596 -3.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5866 -3.3905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9895 2.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0406 -4.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0148 -3.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2878 -2.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2620 -2.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9632 -1.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6902 -2.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7160 -2.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4431 -3.3012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 43 1 0 0 0 0 1 64 2 0 0 0 0 2 3 2 0 0 0 0 2 68 1 0 0 0 0 3 4 1 0 0 0 0 3 66 1 0 0 0 0 4 5 1 0 0 0 0 4 86 1 0 0 0 0 5 6 1 0 0 0 0 5 70 2 0 0 0 0 6 7 2 0 0 0 0 6 88 1 0 0 0 0 7 8 1 0 0 0 0 7 72 1 0 0 0 0 8 9 1 0 0 0 0 8 25 1 0 0 0 0 9 10 2 0 0 0 0 9 22 1 0 0 0 0 10 11 1 0 0 0 0 10 19 1 0 0 0 0 12 13 2 0 0 0 0 12 78 1 0 0 0 0 13 14 1 0 0 0 0 13 75 1 0 0 0 0 15 16 2 0 0 0 0 15 30 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 28 2 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 20 97 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 24102 1 0 0 0 0 25 26 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 2 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 34 1 0 0 0 0 32 37 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 36 61 2 0 0 0 0 37 38 2 0 0 0 0 38 39 1 0 0 0 0 38 59 1 0 0 0 0 39 40 1 0 0 0 0 39 55 1 0 0 0 0 40 41 1 0 0 0 0 40 83 2 0 0 0 0 41 42 2 0 0 0 0 41 57 1 0 0 0 0 42 43 1 0 0 0 0 42 81 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 44 79 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 47 52 2 0 0 0 0 48 49 2 0 0 0 0 49 50 1 0 0 0 0 49 56 1 0 0 0 0 50 51 2 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 58 59 1 0 0 0 0 59 60 2 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 65 66 2 0 0 0 0 66 67 1 0 0 0 0 68 79 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 71 72 2 0 0 0 0 72 73 1 0 0 0 0 74 75 1 0 0 0 0 75 76 2 0 0 0 0 76 77 1 0 0 0 0 77 78 2 0 0 0 0 78 79 1 0 0 0 0 79 80 1 0 0 0 0 80 81 1 0 0 0 0 81 82 2 0 0 0 0 82 83 1 0 0 0 0 83 84 1 0 0 0 0 85 86 1 0 0 0 0 86 87 1 0 0 0 0 87 88 1 0 0 0 0 87 93 1 0 0 0 0 89 90 1 0 0 0 0 90 91 2 0 0 0 0 90 95 1 0 0 0 0 91 92 1 0 0 0 0 92 93 2 0 0 0 0 93 94 1 0 0 0 0 94 95 2 0 0 0 0 95 96 1 0 0 0 0 98 99 1 0 0 0 0 99100 2 0 0 0 0 99104 1 0 0 0 0 100101 1 0 0 0 0 101102 2 0 0 0 0 102103 1 0 0 0 0 103104 2 0 0 0 0 104105 1 0 0 0 0 M END 3D MOL for HMDB0037671 (Pavetannin D1)HMDB0037671 RDKit 3D Pavetannin D1 165180 0 0 0 0 0 0 0 0999 V2000 10.9509 3.7479 -3.6805 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0321 3.3006 -2.7279 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7608 2.9808 -3.1256 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7897 2.5268 -2.2158 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5523 2.2200 -2.6602 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1410 2.4109 -0.9170 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4685 2.7438 -0.5150 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4071 3.1835 -1.4011 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6854 2.5708 0.8410 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3004 1.3402 1.4519 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4534 0.4349 1.3297 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7568 0.9073 1.5327 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8692 0.1159 1.4367 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7429 -1.2057 1.1295 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8787 -2.0264 1.0266 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4745 -1.7036 0.9244 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3487 -3.0452 0.6134 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3376 -0.8965 1.0225 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0021 0.8205 0.8579 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2601 0.3654 1.9434 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3116 2.0046 0.2387 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8926 2.0792 0.1701 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3717 3.3937 0.0557 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2562 4.4864 -0.0069 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0461 3.6667 0.0018 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1227 2.6524 0.0568 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7529 2.9463 -0.0019 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5931 1.3550 0.1690 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9425 1.0871 0.2228 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3773 -0.2151 0.3324 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4725 -1.2640 0.1806 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0504 -2.5665 0.5920 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4879 -3.4884 1.4074 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1652 -4.6816 1.6988 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4050 -4.9532 1.1758 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0971 -6.1115 1.4410 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9707 -4.0170 0.3510 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2354 -4.2762 -0.1910 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3081 -2.8549 0.0686 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1259 -0.9790 0.7787 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2364 -2.0603 0.4948 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5773 0.2782 0.2327 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3255 0.7766 0.8579 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2685 1.3005 2.1241 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3921 1.3857 2.9032 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0402 1.7622 2.6240 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1130 1.7116 1.8883 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3142 2.2020 2.4477 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0841 1.1869 0.6074 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1529 0.7301 0.1278 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2125 0.2105 -1.1322 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9138 0.1426 -2.0213 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3052 0.1301 -3.3709 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7031 -0.8235 -3.5512 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3726 -0.9700 -4.7461 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0018 -0.1236 -5.7737 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6517 -0.2365 -6.9984 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0059 0.8311 -5.6235 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3422 1.6655 -6.6818 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6519 0.9568 -4.4089 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5614 -1.0990 -1.8683 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7479 -1.1288 -1.1201 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5772 -2.2144 -1.1917 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7865 -2.2655 -0.4455 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5123 -3.4052 -0.5992 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1468 -1.2389 0.3528 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2813 -0.1244 0.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0918 -0.0661 -0.3091 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2616 1.1417 -0.2652 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7620 1.3281 -1.7230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9363 1.3644 -2.4765 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5804 0.9644 1.2256 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7583 1.0774 1.9838 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6189 0.3950 3.2736 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7297 0.2858 4.1091 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6285 -0.3475 5.3017 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4047 -0.8952 5.6978 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3074 -1.5370 6.9090 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2985 -0.8026 4.8972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0640 -1.3326 5.2530 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4250 -0.1518 3.6850 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7920 0.3654 1.0904 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5656 0.8981 -0.1731 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3589 -1.1181 1.1299 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5104 -1.9668 0.9191 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9107 -2.8975 1.8902 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2103 -3.0594 3.0524 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0246 -3.6985 1.7332 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7985 -3.6341 0.6307 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9190 -4.4380 0.4727 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4328 -2.7214 -0.3573 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3278 -1.9168 -0.2132 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0455 -1.0501 -1.2238 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0032 -0.5714 -2.1487 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3753 0.8700 -1.8872 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3913 1.8287 -2.8751 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7451 3.1329 -2.5715 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0920 3.5328 -1.2981 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4484 4.8347 -0.9654 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0708 2.5449 -0.3069 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4257 2.9628 0.9808 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7198 1.2543 -0.6107 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2941 -1.3231 -2.1531 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3239 -0.6045 -1.5311 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2733 -2.6835 -1.5675 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9580 4.7604 -3.8102 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4350 3.0584 -4.1538 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7652 1.8872 -2.2531 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4170 3.4414 -1.0757 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2036 1.5776 2.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8311 1.9561 1.7717 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8545 0.5201 1.6007 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7785 -1.6141 1.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1277 -3.6592 0.5343 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4131 -1.3907 0.8493 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2717 0.0531 0.1237 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8930 -0.0903 2.5511 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5751 2.8379 1.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9369 5.4249 -0.0835 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6395 4.6792 -0.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4067 3.8753 -0.0780 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2857 -1.3488 -0.9337 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5278 -3.3081 1.8410 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6897 -5.3978 2.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0106 -6.2916 1.0465 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6744 -3.5820 -0.8118 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8029 -2.1506 -0.5877 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2269 -0.9304 1.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6268 -2.5197 -0.2828 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3767 0.0537 -0.8768 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3167 1.1524 2.7194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0078 2.1741 3.6350 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3382 2.5797 3.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0009 -1.4922 -2.7443 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1585 -1.7173 -4.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3795 -0.9122 -7.1423 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1540 1.5492 -7.5584 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4339 1.6775 -4.2239 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3009 -3.0443 -1.8265 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2810 -3.7160 -0.1368 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8928 2.0673 -0.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1635 2.2342 -1.8122 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1797 2.3256 -2.5942 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0767 2.1370 2.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6731 0.7145 3.7972 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4741 -0.4426 5.9612 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0956 -1.6181 7.5077 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2538 -1.2570 4.6601 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5391 -0.0953 3.0554 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7867 0.5257 1.4830 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4554 1.8607 -0.1854 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0464 -1.2327 2.2121 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4147 -2.6557 3.4335 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2998 -4.4076 2.5196 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1433 -5.0877 1.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5698 -0.5660 -3.1823 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1293 1.5701 -3.8696 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7553 3.8858 -3.3647 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4853 5.5201 -1.7224 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4130 2.2560 1.7139 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7244 0.5039 0.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6337 -1.4327 -3.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7601 -1.0950 -0.7975 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9814 -3.4614 -2.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3184 -2.9437 -1.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 4 6 2 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 14 16 1 0 16 17 1 0 16 18 2 0 10 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 2 0 25 26 1 0 26 27 1 0 26 28 2 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 35 37 1 0 37 38 1 0 37 39 2 0 31 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 44 46 2 0 46 47 1 0 47 48 1 0 47 49 2 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 2 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 2 0 52 61 1 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 1 0 64 66 2 0 66 67 1 0 67 68 2 0 68 69 1 0 69 70 1 0 70 71 1 0 67 72 1 0 72 73 1 0 73 74 1 0 74 75 2 0 75 76 1 0 76 77 2 0 77 78 1 0 77 79 1 0 79 80 1 0 79 81 2 0 73 82 1 0 82 83 1 0 82 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 86 88 2 0 88 89 1 0 89 90 1 0 89 91 2 0 91 92 1 0 92 93 1 0 93 94 1 0 94 95 1 0 95 96 2 0 96 97 1 0 97 98 2 0 98 99 1 0 98100 1 0 100101 1 0 100102 2 0 94103 1 0 103104 1 0 103105 1 0 8 2 1 0 18 11 1 0 29 22 2 0 39 32 1 0 50 43 2 0 70 52 1 0 81 74 1 0 92 85 2 0 102 95 1 0 21 6 1 0 42 28 1 0 69 49 1 0 105 91 1 0 60 53 1 0 68 62 1 0 84 66 1 0 1106 1 0 3107 1 0 5108 1 0 8109 1 0 10110 1 0 12111 1 0 13112 1 0 15113 1 0 17114 1 0 18115 1 0 19116 1 0 20117 1 0 21118 1 0 24119 1 0 25120 1 0 27121 1 0 31122 1 0 33123 1 0 34124 1 0 36125 1 0 38126 1 0 39127 1 0 40128 1 0 41129 1 0 42130 1 0 45131 1 0 46132 1 0 48133 1 0 54134 1 0 55135 1 0 57136 1 0 59137 1 0 60138 1 0 63139 1 0 65140 1 0 69141 1 0 70142 1 0 71143 1 0 73144 1 0 75145 1 0 76146 1 0 78147 1 0 80148 1 0 81149 1 0 82150 1 0 83151 1 0 84152 1 0 87153 1 0 88154 1 0 90155 1 0 94156 1 0 96157 1 0 97158 1 0 99159 1 0 101160 1 0 102161 1 0 103162 1 0 104163 1 0 105164 1 0 105165 1 0 M END 3D SDF for HMDB0037671 (Pavetannin D1)Mrv0541 05061309562D 105120 0 0 0 0 999 V2000 -0.8271 0.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1001 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6011 0.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3281 0.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0294 0.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7564 0.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4576 0.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1846 0.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8858 0.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8600 1.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1330 1.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7038 -2.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2704 -3.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6616 -3.9114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4656 2.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5401 3.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8659 3.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9404 4.3398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5613 2.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2883 1.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3141 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6129 0.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6387 -0.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9374 -0.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2104 -0.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5092 -0.9168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4427 3.6472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1170 3.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0425 2.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7168 1.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6423 1.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8935 0.7070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0654 0.9242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3166 0.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2421 -0.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4933 -0.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8190 -0.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0702 -0.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3959 0.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6471 -0.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9728 0.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2240 -0.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4887 0.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3124 -0.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6871 -0.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5965 3.9053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2708 3.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1963 2.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8706 2.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6194 2.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6939 3.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0196 3.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0942 4.5979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2192 1.1824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4704 0.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7961 1.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0473 0.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2469 -1.6288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9957 -1.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6700 -1.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4188 -1.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0931 -1.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5799 1.8130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8529 1.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1517 1.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5753 1.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2765 1.9023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0992 -0.6364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6446 2.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0036 1.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7048 1.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4318 1.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7436 2.3208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9877 -3.8627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5542 -3.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9455 -2.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5120 -1.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3126 -1.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7460 -1.0547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4960 -1.4963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1495 -1.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8238 -1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5726 -1.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7798 -2.0228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6527 -1.0061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3539 -0.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0809 -0.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7822 -0.5268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1841 -4.2598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1583 -3.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4313 -3.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4055 -2.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1067 -1.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8338 -2.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8596 -3.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5866 -3.3905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9895 2.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0406 -4.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0148 -3.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2878 -2.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2620 -2.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9632 -1.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6902 -2.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7160 -2.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4431 -3.3012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 43 1 0 0 0 0 1 64 2 0 0 0 0 2 3 2 0 0 0 0 2 68 1 0 0 0 0 3 4 1 0 0 0 0 3 66 1 0 0 0 0 4 5 1 0 0 0 0 4 86 1 0 0 0 0 5 6 1 0 0 0 0 5 70 2 0 0 0 0 6 7 2 0 0 0 0 6 88 1 0 0 0 0 7 8 1 0 0 0 0 7 72 1 0 0 0 0 8 9 1 0 0 0 0 8 25 1 0 0 0 0 9 10 2 0 0 0 0 9 22 1 0 0 0 0 10 11 1 0 0 0 0 10 19 1 0 0 0 0 12 13 2 0 0 0 0 12 78 1 0 0 0 0 13 14 1 0 0 0 0 13 75 1 0 0 0 0 15 16 2 0 0 0 0 15 30 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 28 2 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 20 97 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 24102 1 0 0 0 0 25 26 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 2 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 31 34 1 0 0 0 0 32 37 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 36 61 2 0 0 0 0 37 38 2 0 0 0 0 38 39 1 0 0 0 0 38 59 1 0 0 0 0 39 40 1 0 0 0 0 39 55 1 0 0 0 0 40 41 1 0 0 0 0 40 83 2 0 0 0 0 41 42 2 0 0 0 0 41 57 1 0 0 0 0 42 43 1 0 0 0 0 42 81 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 44 79 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 47 52 2 0 0 0 0 48 49 2 0 0 0 0 49 50 1 0 0 0 0 49 56 1 0 0 0 0 50 51 2 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 58 59 1 0 0 0 0 59 60 2 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 65 66 2 0 0 0 0 66 67 1 0 0 0 0 68 79 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 71 72 2 0 0 0 0 72 73 1 0 0 0 0 74 75 1 0 0 0 0 75 76 2 0 0 0 0 76 77 1 0 0 0 0 77 78 2 0 0 0 0 78 79 1 0 0 0 0 79 80 1 0 0 0 0 80 81 1 0 0 0 0 81 82 2 0 0 0 0 82 83 1 0 0 0 0 83 84 1 0 0 0 0 85 86 1 0 0 0 0 86 87 1 0 0 0 0 87 88 1 0 0 0 0 87 93 1 0 0 0 0 89 90 1 0 0 0 0 90 91 2 0 0 0 0 90 95 1 0 0 0 0 91 92 1 0 0 0 0 92 93 2 0 0 0 0 93 94 1 0 0 0 0 94 95 2 0 0 0 0 95 96 1 0 0 0 0 98 99 1 0 0 0 0 99100 2 0 0 0 0 99104 1 0 0 0 0 100101 1 0 0 0 0 101102 2 0 0 0 0 102103 1 0 0 0 0 103104 2 0 0 0 0 104105 1 0 0 0 0 M END > <DATABASE_ID> HMDB0037671 > <DATABASE_NAME> hmdb > <SMILES> OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=C5C6C(O)C(OC5=CC(O)=C34)(OC3=C(C4C(O)C(OC5=C(C7C(O)C(OC8=CC(O)=CC(O)=C78)C7=CC=C(O)C(O)=C7)C(O)=CC(O)=C45)C4=CC=C(O)C(O)=C4)C(O)=CC(O)=C63)C3=CC=C(O)C(O)=C3)C3=CC(O)=C(O)C=C3)=C2OC1C1=CC(O)=C(O)C=C1 > <INCHI_IDENTIFIER> InChI=1S/C75H60O30/c76-28-16-41(88)51-49(17-28)100-67(24-2-7-31(78)37(84)12-24)63(96)59(51)53-43(90)20-44(91)54-61(65(98)68(102-71(53)54)25-3-8-32(79)38(85)13-25)56-45(92)21-46(93)57-62-58-50(104-75(74(62)99,105-73(56)57)27-5-10-34(81)40(87)15-27)22-47(94)55-60(64(97)69(103-72(55)58)26-4-9-33(80)39(86)14-26)52-42(89)19-35(82)29-18-48(95)66(101-70(29)52)23-1-6-30(77)36(83)11-23/h1-17,19-22,48,59-69,74,76-99H,18H2 > <INCHI_KEY> ODHOTFAKXJWQIS-UHFFFAOYSA-N > <FORMULA> C75H60O30 > <MOLECULAR_WEIGHT> 1441.2609 > <EXACT_MASS> 1440.31694058 > <JCHEM_ACCEPTOR_COUNT> 30 > <JCHEM_AVERAGE_POLARIZABILITY> 139.7175287277915 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 24 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-16-[2-(3,4-dihydroxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2,8,10,15,17,19-hexaene-6,9,17,19,21-pentol > <ALOGPS_LOGP> 4.49 > <JCHEM_LOGP> 7.552446091666667 > <ALOGPS_LOGS> -3.26 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 16 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 8.954903065886763 > <JCHEM_PKA_STRONGEST_ACIDIC> 8.5741327847787 > <JCHEM_PKA_STRONGEST_BASIC> -5.214622375651921 > <JCHEM_POLAR_SURFACE_AREA> 540.9000000000002 > <JCHEM_REFRACTIVITY> 361.72119999999995 > <JCHEM_ROTATABLE_BOND_COUNT> 8 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 7.94e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-16-[2-(3,4-dihydroxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2,8,10,15,17,19-hexaene-6,9,17,19,21-pentol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0037671 (Pavetannin D1)HMDB0037671 RDKit 3D Pavetannin D1 165180 0 0 0 0 0 0 0 0999 V2000 10.9509 3.7479 -3.6805 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0321 3.3006 -2.7279 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7608 2.9808 -3.1256 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7897 2.5268 -2.2158 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5523 2.2200 -2.6602 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1410 2.4109 -0.9170 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4685 2.7438 -0.5150 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4071 3.1835 -1.4011 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6854 2.5708 0.8410 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3004 1.3402 1.4519 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4534 0.4349 1.3297 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7568 0.9073 1.5327 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8692 0.1159 1.4367 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7429 -1.2057 1.1295 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8787 -2.0264 1.0266 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4745 -1.7036 0.9244 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3487 -3.0452 0.6134 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3376 -0.8965 1.0225 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0021 0.8205 0.8579 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2601 0.3654 1.9434 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3116 2.0046 0.2387 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8926 2.0792 0.1701 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3717 3.3937 0.0557 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2562 4.4864 -0.0069 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0461 3.6667 0.0018 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1227 2.6524 0.0568 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7529 2.9463 -0.0019 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5931 1.3550 0.1690 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9425 1.0871 0.2228 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3773 -0.2151 0.3324 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4725 -1.2640 0.1806 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0504 -2.5665 0.5920 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4879 -3.4884 1.4074 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1652 -4.6816 1.6988 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4050 -4.9532 1.1758 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0971 -6.1115 1.4410 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9707 -4.0170 0.3510 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2354 -4.2762 -0.1910 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3081 -2.8549 0.0686 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1259 -0.9790 0.7787 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2364 -2.0603 0.4948 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5773 0.2782 0.2327 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3255 0.7766 0.8579 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2685 1.3005 2.1241 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3921 1.3857 2.9032 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0402 1.7622 2.6240 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1130 1.7116 1.8883 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3142 2.2020 2.4477 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0841 1.1869 0.6074 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1529 0.7301 0.1278 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2125 0.2105 -1.1322 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9138 0.1426 -2.0213 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3052 0.1301 -3.3709 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7031 -0.8235 -3.5512 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3726 -0.9700 -4.7461 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0018 -0.1236 -5.7737 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6517 -0.2365 -6.9984 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0059 0.8311 -5.6235 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3422 1.6655 -6.6818 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6519 0.9568 -4.4089 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5614 -1.0990 -1.8683 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7479 -1.1288 -1.1201 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5772 -2.2144 -1.1917 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7865 -2.2655 -0.4455 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5123 -3.4052 -0.5992 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1468 -1.2389 0.3528 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2813 -0.1244 0.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0918 -0.0661 -0.3091 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2616 1.1417 -0.2652 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7620 1.3281 -1.7230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9363 1.3644 -2.4765 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5804 0.9644 1.2256 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7583 1.0774 1.9838 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6189 0.3950 3.2736 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7297 0.2858 4.1091 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6285 -0.3475 5.3017 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4047 -0.8952 5.6978 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3074 -1.5370 6.9090 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2985 -0.8026 4.8972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0640 -1.3326 5.2530 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4250 -0.1518 3.6850 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7920 0.3654 1.0904 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5656 0.8981 -0.1731 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3589 -1.1181 1.1299 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5104 -1.9668 0.9191 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9107 -2.8975 1.8902 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2103 -3.0594 3.0524 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0246 -3.6985 1.7332 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7985 -3.6341 0.6307 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9190 -4.4380 0.4727 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4328 -2.7214 -0.3573 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3278 -1.9168 -0.2132 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0455 -1.0501 -1.2238 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0032 -0.5714 -2.1487 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3753 0.8700 -1.8872 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3913 1.8287 -2.8751 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7451 3.1329 -2.5715 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0920 3.5328 -1.2981 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4484 4.8347 -0.9654 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0708 2.5449 -0.3069 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4257 2.9628 0.9808 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7198 1.2543 -0.6107 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2941 -1.3231 -2.1531 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3239 -0.6045 -1.5311 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2733 -2.6835 -1.5675 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9580 4.7604 -3.8102 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4350 3.0584 -4.1538 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7652 1.8872 -2.2531 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4170 3.4414 -1.0757 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2036 1.5776 2.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8311 1.9561 1.7717 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8545 0.5201 1.6007 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7785 -1.6141 1.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1277 -3.6592 0.5343 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4131 -1.3907 0.8493 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2717 0.0531 0.1237 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8930 -0.0903 2.5511 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5751 2.8379 1.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9369 5.4249 -0.0835 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6395 4.6792 -0.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4067 3.8753 -0.0780 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2857 -1.3488 -0.9337 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5278 -3.3081 1.8410 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6897 -5.3978 2.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0106 -6.2916 1.0465 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6744 -3.5820 -0.8118 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8029 -2.1506 -0.5877 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2269 -0.9304 1.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6268 -2.5197 -0.2828 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3767 0.0537 -0.8768 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3167 1.1524 2.7194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0078 2.1741 3.6350 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3382 2.5797 3.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0009 -1.4922 -2.7443 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1585 -1.7173 -4.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3795 -0.9122 -7.1423 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1540 1.5492 -7.5584 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4339 1.6775 -4.2239 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3009 -3.0443 -1.8265 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2810 -3.7160 -0.1368 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8928 2.0673 -0.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1635 2.2342 -1.8122 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1797 2.3256 -2.5942 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0767 2.1370 2.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6731 0.7145 3.7972 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4741 -0.4426 5.9612 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0956 -1.6181 7.5077 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2538 -1.2570 4.6601 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5391 -0.0953 3.0554 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7867 0.5257 1.4830 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4554 1.8607 -0.1854 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0464 -1.2327 2.2121 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4147 -2.6557 3.4335 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2998 -4.4076 2.5196 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1433 -5.0877 1.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5698 -0.5660 -3.1823 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1293 1.5701 -3.8696 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7553 3.8858 -3.3647 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4853 5.5201 -1.7224 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4130 2.2560 1.7139 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7244 0.5039 0.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6337 -1.4327 -3.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7601 -1.0950 -0.7975 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9814 -3.4614 -2.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3184 -2.9437 -1.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 4 6 2 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 14 16 1 0 16 17 1 0 16 18 2 0 10 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 2 0 25 26 1 0 26 27 1 0 26 28 2 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 35 37 1 0 37 38 1 0 37 39 2 0 31 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 44 46 2 0 46 47 1 0 47 48 1 0 47 49 2 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 2 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 2 0 52 61 1 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 1 0 64 66 2 0 66 67 1 0 67 68 2 0 68 69 1 0 69 70 1 0 70 71 1 0 67 72 1 0 72 73 1 0 73 74 1 0 74 75 2 0 75 76 1 0 76 77 2 0 77 78 1 0 77 79 1 0 79 80 1 0 79 81 2 0 73 82 1 0 82 83 1 0 82 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 86 88 2 0 88 89 1 0 89 90 1 0 89 91 2 0 91 92 1 0 92 93 1 0 93 94 1 0 94 95 1 0 95 96 2 0 96 97 1 0 97 98 2 0 98 99 1 0 98100 1 0 100101 1 0 100102 2 0 94103 1 0 103104 1 0 103105 1 0 8 2 1 0 18 11 1 0 29 22 2 0 39 32 1 0 50 43 2 0 70 52 1 0 81 74 1 0 92 85 2 0 102 95 1 0 21 6 1 0 42 28 1 0 69 49 1 0 105 91 1 0 60 53 1 0 68 62 1 0 84 66 1 0 1106 1 0 3107 1 0 5108 1 0 8109 1 0 10110 1 0 12111 1 0 13112 1 0 15113 1 0 17114 1 0 18115 1 0 19116 1 0 20117 1 0 21118 1 0 24119 1 0 25120 1 0 27121 1 0 31122 1 0 33123 1 0 34124 1 0 36125 1 0 38126 1 0 39127 1 0 40128 1 0 41129 1 0 42130 1 0 45131 1 0 46132 1 0 48133 1 0 54134 1 0 55135 1 0 57136 1 0 59137 1 0 60138 1 0 63139 1 0 65140 1 0 69141 1 0 70142 1 0 71143 1 0 73144 1 0 75145 1 0 76146 1 0 78147 1 0 80148 1 0 81149 1 0 82150 1 0 83151 1 0 84152 1 0 87153 1 0 88154 1 0 90155 1 0 94156 1 0 96157 1 0 97158 1 0 99159 1 0 101160 1 0 102161 1 0 103162 1 0 104163 1 0 105164 1 0 105165 1 0 M END PDB for HMDB0037671 (Pavetannin D1)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 -1.544 1.117 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -0.187 0.389 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 1.122 1.200 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 2.479 0.472 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 3.788 1.284 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 5.145 0.556 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 6.454 1.367 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 7.811 0.639 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 9.120 1.451 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 9.072 2.990 0.000 0.00 0.00 C+0 HETATM 11 O UNK 0 7.715 3.718 0.000 0.00 0.00 O+0 HETATM 12 C UNK 0 -1.314 -4.635 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -0.505 -5.945 0.000 0.00 0.00 C+0 HETATM 14 O UNK 0 -1.235 -7.301 0.000 0.00 0.00 O+0 HETATM 15 C UNK 0 -13.936 4.146 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 -14.075 5.680 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -12.816 6.567 0.000 0.00 0.00 C+0 HETATM 18 O UNK 0 -12.955 8.101 0.000 0.00 0.00 O+0 HETATM 19 C UNK 0 10.381 3.801 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 11.738 3.073 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 11.786 1.534 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 10.477 0.723 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 10.526 -0.816 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 9.216 -1.628 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 7.859 -0.900 0.000 0.00 0.00 C+0 HETATM 26 O UNK 0 6.551 -1.711 0.000 0.00 0.00 O+0 HETATM 27 O UNK 0 -10.160 6.808 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 -11.418 5.921 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -11.279 4.387 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -12.538 3.500 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -12.399 1.966 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 -11.001 1.320 0.000 0.00 0.00 O+0 HETATM 33 O UNK 0 -15.055 1.725 0.000 0.00 0.00 O+0 HETATM 34 C UNK 0 -13.658 1.079 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 -13.519 -0.455 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -12.121 -1.101 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -10.862 -0.214 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -9.464 -0.860 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -8.206 0.027 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -6.808 -0.620 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -5.549 0.268 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -4.151 -0.379 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 -2.779 0.431 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -2.450 -1.078 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 -1.283 -0.227 0.000 0.00 0.00 O+0 HETATM 46 O UNK 0 -4.847 7.290 0.000 0.00 0.00 O+0 HETATM 47 C UNK 0 -6.105 6.403 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -5.966 4.869 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -7.225 3.982 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -8.623 4.628 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -8.762 6.162 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -7.503 7.049 0.000 0.00 0.00 C+0 HETATM 53 O UNK 0 -7.643 8.583 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 -9.743 2.207 0.000 0.00 0.00 O+0 HETATM 55 C UNK 0 -8.345 1.561 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 -7.086 2.448 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 -5.688 1.802 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 -7.928 -3.040 0.000 0.00 0.00 O+0 HETATM 59 C UNK 0 -9.325 -2.394 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -10.584 -3.281 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -11.982 -2.635 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 -13.240 -3.522 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 -2.949 3.384 0.000 0.00 0.00 O+0 HETATM 64 C UNK 0 -1.592 2.656 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 -0.283 3.468 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 1.074 2.740 0.000 0.00 0.00 C+0 HETATM 67 O UNK 0 2.383 3.551 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 -0.185 -1.188 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 3.070 4.210 0.000 0.00 0.00 O+0 HETATM 70 C UNK 0 3.740 2.823 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 5.049 3.634 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 6.406 2.906 0.000 0.00 0.00 C+0 HETATM 73 O UNK 0 6.988 4.332 0.000 0.00 0.00 O+0 HETATM 74 O UNK 0 1.844 -7.210 0.000 0.00 0.00 O+0 HETATM 75 C UNK 0 1.035 -5.900 0.000 0.00 0.00 C+0 HETATM 76 C UNK 0 1.765 -4.544 0.000 0.00 0.00 C+0 HETATM 77 C UNK 0 0.956 -3.234 0.000 0.00 0.00 C+0 HETATM 78 C UNK 0 -0.584 -3.279 0.000 0.00 0.00 C+0 HETATM 79 C UNK 0 -1.393 -1.969 0.000 0.00 0.00 C+0 HETATM 80 O UNK 0 -2.793 -2.793 0.000 0.00 0.00 O+0 HETATM 81 C UNK 0 -4.012 -1.912 0.000 0.00 0.00 C+0 HETATM 82 C UNK 0 -5.271 -2.800 0.000 0.00 0.00 C+0 HETATM 83 C UNK 0 -6.669 -2.153 0.000 0.00 0.00 C+0 HETATM 84 O UNK 0 -7.056 -3.776 0.000 0.00 0.00 O+0 HETATM 85 O UNK 0 1.218 -1.878 0.000 0.00 0.00 O+0 HETATM 86 C UNK 0 2.527 -1.067 0.000 0.00 0.00 C+0 HETATM 87 C UNK 0 3.884 -1.795 0.000 0.00 0.00 C+0 HETATM 88 O UNK 0 5.193 -0.983 0.000 0.00 0.00 O+0 HETATM 89 O UNK 0 4.077 -7.952 0.000 0.00 0.00 O+0 HETATM 90 C UNK 0 4.029 -6.412 0.000 0.00 0.00 C+0 HETATM 91 C UNK 0 2.672 -5.685 0.000 0.00 0.00 C+0 HETATM 92 C UNK 0 2.624 -4.145 0.000 0.00 0.00 C+0 HETATM 93 C UNK 0 3.933 -3.334 0.000 0.00 0.00 C+0 HETATM 94 C UNK 0 5.290 -4.062 0.000 0.00 0.00 C+0 HETATM 95 C UNK 0 5.338 -5.601 0.000 0.00 0.00 C+0 HETATM 96 O UNK 0 6.695 -6.329 0.000 0.00 0.00 O+0 HETATM 97 O UNK 0 13.047 3.885 0.000 0.00 0.00 O+0 HETATM 98 O UNK 0 9.409 -7.785 0.000 0.00 0.00 O+0 HETATM 99 C UNK 0 9.361 -6.246 0.000 0.00 0.00 C+0 HETATM 100 C UNK 0 8.004 -5.518 0.000 0.00 0.00 C+0 HETATM 101 C UNK 0 7.956 -3.978 0.000 0.00 0.00 C+0 HETATM 102 C UNK 0 9.265 -3.167 0.000 0.00 0.00 C+0 HETATM 103 C UNK 0 10.622 -3.895 0.000 0.00 0.00 C+0 HETATM 104 C UNK 0 10.670 -5.434 0.000 0.00 0.00 C+0 HETATM 105 O UNK 0 12.027 -6.162 0.000 0.00 0.00 O+0 CONECT 1 2 43 64 CONECT 2 1 3 68 CONECT 3 2 4 66 CONECT 4 3 5 86 CONECT 5 4 6 70 CONECT 6 5 7 88 CONECT 7 6 8 72 CONECT 8 7 9 25 CONECT 9 8 10 22 CONECT 10 9 11 19 CONECT 11 10 CONECT 12 13 78 CONECT 13 12 14 75 CONECT 14 13 CONECT 15 16 30 CONECT 16 15 17 CONECT 17 16 18 28 CONECT 18 17 CONECT 19 10 20 CONECT 20 19 21 97 CONECT 21 20 22 CONECT 22 9 21 23 CONECT 23 22 24 CONECT 24 23 25 102 CONECT 25 8 24 26 CONECT 26 25 CONECT 27 28 CONECT 28 17 27 29 CONECT 29 28 30 CONECT 30 15 29 31 CONECT 31 30 32 34 CONECT 32 31 37 CONECT 33 34 CONECT 34 31 33 35 CONECT 35 34 36 CONECT 36 35 37 61 CONECT 37 32 36 38 CONECT 38 37 39 59 CONECT 39 38 40 55 CONECT 40 39 41 83 CONECT 41 40 42 57 CONECT 42 41 43 81 CONECT 43 1 42 44 CONECT 44 43 45 79 CONECT 45 44 CONECT 46 47 CONECT 47 46 48 52 CONECT 48 47 49 CONECT 49 48 50 56 CONECT 50 49 51 CONECT 51 50 52 CONECT 52 47 51 53 CONECT 53 52 CONECT 54 55 CONECT 55 39 54 56 CONECT 56 49 55 57 CONECT 57 41 56 CONECT 58 59 CONECT 59 38 58 60 CONECT 60 59 61 CONECT 61 36 60 62 CONECT 62 61 CONECT 63 64 CONECT 64 1 63 65 CONECT 65 64 66 CONECT 66 3 65 67 CONECT 67 66 CONECT 68 2 79 CONECT 69 70 CONECT 70 5 69 71 CONECT 71 70 72 CONECT 72 7 71 73 CONECT 73 72 CONECT 74 75 CONECT 75 13 74 76 CONECT 76 75 77 CONECT 77 76 78 CONECT 78 12 77 79 CONECT 79 44 68 78 80 CONECT 80 79 81 CONECT 81 42 80 82 CONECT 82 81 83 CONECT 83 40 82 84 CONECT 84 83 CONECT 85 86 CONECT 86 4 85 87 CONECT 87 86 88 93 CONECT 88 6 87 CONECT 89 90 CONECT 90 89 91 95 CONECT 91 90 92 CONECT 92 91 93 CONECT 93 87 92 94 CONECT 94 93 95 CONECT 95 90 94 96 CONECT 96 95 CONECT 97 20 CONECT 98 99 CONECT 99 98 100 104 CONECT 100 99 101 CONECT 101 100 102 CONECT 102 24 101 103 CONECT 103 102 104 CONECT 104 99 103 105 CONECT 105 104 MASTER 0 0 0 0 0 0 0 0 105 0 240 0 END 3D PDB for HMDB0037671 (Pavetannin D1)COMPND HMDB0037671 HETATM 1 O1 UNL 1 10.951 3.748 -3.681 1.00 0.00 O HETATM 2 C1 UNL 1 10.032 3.301 -2.728 1.00 0.00 C HETATM 3 C2 UNL 1 8.761 2.981 -3.126 1.00 0.00 C HETATM 4 C3 UNL 1 7.790 2.527 -2.216 1.00 0.00 C HETATM 5 O2 UNL 1 6.552 2.220 -2.660 1.00 0.00 O HETATM 6 C4 UNL 1 8.141 2.411 -0.917 1.00 0.00 C HETATM 7 C5 UNL 1 9.468 2.744 -0.515 1.00 0.00 C HETATM 8 C6 UNL 1 10.407 3.183 -1.401 1.00 0.00 C HETATM 9 O3 UNL 1 9.685 2.571 0.841 1.00 0.00 O HETATM 10 C7 UNL 1 9.300 1.340 1.452 1.00 0.00 C HETATM 11 C8 UNL 1 10.453 0.435 1.330 1.00 0.00 C HETATM 12 C9 UNL 1 11.757 0.907 1.533 1.00 0.00 C HETATM 13 C10 UNL 1 12.869 0.116 1.437 1.00 0.00 C HETATM 14 C11 UNL 1 12.743 -1.206 1.130 1.00 0.00 C HETATM 15 O4 UNL 1 13.879 -2.026 1.027 1.00 0.00 O HETATM 16 C12 UNL 1 11.475 -1.704 0.924 1.00 0.00 C HETATM 17 O5 UNL 1 11.349 -3.045 0.613 1.00 0.00 O HETATM 18 C13 UNL 1 10.338 -0.897 1.023 1.00 0.00 C HETATM 19 C14 UNL 1 8.002 0.820 0.858 1.00 0.00 C HETATM 20 O6 UNL 1 7.260 0.365 1.943 1.00 0.00 O HETATM 21 C15 UNL 1 7.312 2.005 0.239 1.00 0.00 C HETATM 22 C16 UNL 1 5.893 2.079 0.170 1.00 0.00 C HETATM 23 C17 UNL 1 5.372 3.394 0.056 1.00 0.00 C HETATM 24 O7 UNL 1 6.256 4.486 -0.007 1.00 0.00 O HETATM 25 C18 UNL 1 4.046 3.667 0.002 1.00 0.00 C HETATM 26 C19 UNL 1 3.123 2.652 0.057 1.00 0.00 C HETATM 27 O8 UNL 1 1.753 2.946 -0.002 1.00 0.00 O HETATM 28 C20 UNL 1 3.593 1.355 0.169 1.00 0.00 C HETATM 29 C21 UNL 1 4.942 1.087 0.223 1.00 0.00 C HETATM 30 O9 UNL 1 5.377 -0.215 0.332 1.00 0.00 O HETATM 31 C22 UNL 1 4.473 -1.264 0.181 1.00 0.00 C HETATM 32 C23 UNL 1 5.050 -2.567 0.592 1.00 0.00 C HETATM 33 C24 UNL 1 4.488 -3.488 1.407 1.00 0.00 C HETATM 34 C25 UNL 1 5.165 -4.682 1.699 1.00 0.00 C HETATM 35 C26 UNL 1 6.405 -4.953 1.176 1.00 0.00 C HETATM 36 O10 UNL 1 7.097 -6.112 1.441 1.00 0.00 O HETATM 37 C27 UNL 1 6.971 -4.017 0.351 1.00 0.00 C HETATM 38 O11 UNL 1 8.235 -4.276 -0.191 1.00 0.00 O HETATM 39 C28 UNL 1 6.308 -2.855 0.069 1.00 0.00 C HETATM 40 C29 UNL 1 3.126 -0.979 0.779 1.00 0.00 C HETATM 41 O12 UNL 1 2.236 -2.060 0.495 1.00 0.00 O HETATM 42 C30 UNL 1 2.577 0.278 0.233 1.00 0.00 C HETATM 43 C31 UNL 1 1.325 0.777 0.858 1.00 0.00 C HETATM 44 C32 UNL 1 1.269 1.300 2.124 1.00 0.00 C HETATM 45 O13 UNL 1 2.392 1.386 2.903 1.00 0.00 O HETATM 46 C33 UNL 1 0.040 1.762 2.624 1.00 0.00 C HETATM 47 C34 UNL 1 -1.113 1.712 1.888 1.00 0.00 C HETATM 48 O14 UNL 1 -2.314 2.202 2.448 1.00 0.00 O HETATM 49 C35 UNL 1 -1.084 1.187 0.607 1.00 0.00 C HETATM 50 C36 UNL 1 0.153 0.730 0.128 1.00 0.00 C HETATM 51 O15 UNL 1 0.213 0.211 -1.132 1.00 0.00 O HETATM 52 C37 UNL 1 -0.914 0.143 -2.021 1.00 0.00 C HETATM 53 C38 UNL 1 -0.305 0.130 -3.371 1.00 0.00 C HETATM 54 C39 UNL 1 0.703 -0.824 -3.551 1.00 0.00 C HETATM 55 C40 UNL 1 1.373 -0.970 -4.746 1.00 0.00 C HETATM 56 C41 UNL 1 1.002 -0.124 -5.774 1.00 0.00 C HETATM 57 O16 UNL 1 1.652 -0.237 -6.998 1.00 0.00 O HETATM 58 C42 UNL 1 0.006 0.831 -5.624 1.00 0.00 C HETATM 59 O17 UNL 1 -0.342 1.666 -6.682 1.00 0.00 O HETATM 60 C43 UNL 1 -0.652 0.957 -4.409 1.00 0.00 C HETATM 61 O18 UNL 1 -1.561 -1.099 -1.868 1.00 0.00 O HETATM 62 C44 UNL 1 -2.748 -1.129 -1.120 1.00 0.00 C HETATM 63 C45 UNL 1 -3.577 -2.214 -1.192 1.00 0.00 C HETATM 64 C46 UNL 1 -4.786 -2.266 -0.446 1.00 0.00 C HETATM 65 O19 UNL 1 -5.512 -3.405 -0.599 1.00 0.00 O HETATM 66 C47 UNL 1 -5.147 -1.239 0.353 1.00 0.00 C HETATM 67 C48 UNL 1 -4.281 -0.124 0.421 1.00 0.00 C HETATM 68 C49 UNL 1 -3.092 -0.066 -0.309 1.00 0.00 C HETATM 69 C50 UNL 1 -2.262 1.142 -0.265 1.00 0.00 C HETATM 70 C51 UNL 1 -1.762 1.328 -1.723 1.00 0.00 C HETATM 71 O20 UNL 1 -2.936 1.364 -2.476 1.00 0.00 O HETATM 72 O21 UNL 1 -4.580 0.964 1.226 1.00 0.00 O HETATM 73 C52 UNL 1 -5.758 1.077 1.984 1.00 0.00 C HETATM 74 C53 UNL 1 -5.619 0.395 3.274 1.00 0.00 C HETATM 75 C54 UNL 1 -6.730 0.286 4.109 1.00 0.00 C HETATM 76 C55 UNL 1 -6.629 -0.347 5.302 1.00 0.00 C HETATM 77 C56 UNL 1 -5.405 -0.895 5.698 1.00 0.00 C HETATM 78 O22 UNL 1 -5.307 -1.537 6.909 1.00 0.00 O HETATM 79 C57 UNL 1 -4.299 -0.803 4.897 1.00 0.00 C HETATM 80 O23 UNL 1 -3.064 -1.333 5.253 1.00 0.00 O HETATM 81 C58 UNL 1 -4.425 -0.152 3.685 1.00 0.00 C HETATM 82 C59 UNL 1 -6.792 0.365 1.090 1.00 0.00 C HETATM 83 O24 UNL 1 -6.566 0.898 -0.173 1.00 0.00 O HETATM 84 C60 UNL 1 -6.359 -1.118 1.130 1.00 0.00 C HETATM 85 C61 UNL 1 -7.510 -1.967 0.919 1.00 0.00 C HETATM 86 C62 UNL 1 -7.911 -2.898 1.890 1.00 0.00 C HETATM 87 O25 UNL 1 -7.210 -3.059 3.052 1.00 0.00 O HETATM 88 C63 UNL 1 -9.025 -3.699 1.733 1.00 0.00 C HETATM 89 C64 UNL 1 -9.798 -3.634 0.631 1.00 0.00 C HETATM 90 O26 UNL 1 -10.919 -4.438 0.473 1.00 0.00 O HETATM 91 C65 UNL 1 -9.433 -2.721 -0.357 1.00 0.00 C HETATM 92 C66 UNL 1 -8.328 -1.917 -0.213 1.00 0.00 C HETATM 93 O27 UNL 1 -8.046 -1.050 -1.224 1.00 0.00 O HETATM 94 C67 UNL 1 -9.003 -0.571 -2.149 1.00 0.00 C HETATM 95 C68 UNL 1 -9.375 0.870 -1.887 1.00 0.00 C HETATM 96 C69 UNL 1 -9.391 1.829 -2.875 1.00 0.00 C HETATM 97 C70 UNL 1 -9.745 3.133 -2.571 1.00 0.00 C HETATM 98 C71 UNL 1 -10.092 3.533 -1.298 1.00 0.00 C HETATM 99 O28 UNL 1 -10.448 4.835 -0.965 1.00 0.00 O HETATM 100 C72 UNL 1 -10.071 2.545 -0.307 1.00 0.00 C HETATM 101 O29 UNL 1 -10.426 2.963 0.981 1.00 0.00 O HETATM 102 C73 UNL 1 -9.720 1.254 -0.611 1.00 0.00 C HETATM 103 C74 UNL 1 -10.294 -1.323 -2.153 1.00 0.00 C HETATM 104 O30 UNL 1 -11.324 -0.605 -1.531 1.00 0.00 O HETATM 105 C75 UNL 1 -10.273 -2.683 -1.568 1.00 0.00 C HETATM 106 H1 UNL 1 10.958 4.760 -3.810 1.00 0.00 H HETATM 107 H2 UNL 1 8.435 3.058 -4.154 1.00 0.00 H HETATM 108 H3 UNL 1 5.765 1.887 -2.253 1.00 0.00 H HETATM 109 H4 UNL 1 11.417 3.441 -1.076 1.00 0.00 H HETATM 110 H5 UNL 1 9.204 1.578 2.533 1.00 0.00 H HETATM 111 H6 UNL 1 11.831 1.956 1.772 1.00 0.00 H HETATM 112 H7 UNL 1 13.854 0.520 1.601 1.00 0.00 H HETATM 113 H8 UNL 1 14.778 -1.614 1.179 1.00 0.00 H HETATM 114 H9 UNL 1 12.128 -3.659 0.534 1.00 0.00 H HETATM 115 H10 UNL 1 9.413 -1.391 0.849 1.00 0.00 H HETATM 116 H11 UNL 1 8.272 0.053 0.124 1.00 0.00 H HETATM 117 H12 UNL 1 7.893 -0.090 2.551 1.00 0.00 H HETATM 118 H13 UNL 1 7.575 2.838 1.031 1.00 0.00 H HETATM 119 H14 UNL 1 5.937 5.425 -0.084 1.00 0.00 H HETATM 120 H15 UNL 1 3.640 4.679 -0.088 1.00 0.00 H HETATM 121 H16 UNL 1 1.407 3.875 -0.078 1.00 0.00 H HETATM 122 H17 UNL 1 4.286 -1.349 -0.934 1.00 0.00 H HETATM 123 H18 UNL 1 3.528 -3.308 1.841 1.00 0.00 H HETATM 124 H19 UNL 1 4.690 -5.398 2.350 1.00 0.00 H HETATM 125 H20 UNL 1 8.011 -6.292 1.047 1.00 0.00 H HETATM 126 H21 UNL 1 8.674 -3.582 -0.812 1.00 0.00 H HETATM 127 H22 UNL 1 6.803 -2.151 -0.588 1.00 0.00 H HETATM 128 H23 UNL 1 3.227 -0.930 1.872 1.00 0.00 H HETATM 129 H24 UNL 1 2.627 -2.520 -0.283 1.00 0.00 H HETATM 130 H25 UNL 1 2.377 0.054 -0.877 1.00 0.00 H HETATM 131 H26 UNL 1 3.317 1.152 2.719 1.00 0.00 H HETATM 132 H27 UNL 1 0.008 2.174 3.635 1.00 0.00 H HETATM 133 H28 UNL 1 -2.338 2.580 3.372 1.00 0.00 H HETATM 134 H29 UNL 1 1.001 -1.492 -2.744 1.00 0.00 H HETATM 135 H30 UNL 1 2.158 -1.717 -4.874 1.00 0.00 H HETATM 136 H31 UNL 1 2.380 -0.912 -7.142 1.00 0.00 H HETATM 137 H32 UNL 1 0.154 1.549 -7.558 1.00 0.00 H HETATM 138 H33 UNL 1 -1.434 1.678 -4.224 1.00 0.00 H HETATM 139 H34 UNL 1 -3.301 -3.044 -1.827 1.00 0.00 H HETATM 140 H35 UNL 1 -6.281 -3.716 -0.137 1.00 0.00 H HETATM 141 H36 UNL 1 -2.893 2.067 -0.099 1.00 0.00 H HETATM 142 H37 UNL 1 -1.164 2.234 -1.812 1.00 0.00 H HETATM 143 H38 UNL 1 -3.180 2.326 -2.594 1.00 0.00 H HETATM 144 H39 UNL 1 -6.077 2.137 2.066 1.00 0.00 H HETATM 145 H40 UNL 1 -7.673 0.715 3.797 1.00 0.00 H HETATM 146 H41 UNL 1 -7.474 -0.443 5.961 1.00 0.00 H HETATM 147 H42 UNL 1 -6.096 -1.618 7.508 1.00 0.00 H HETATM 148 H43 UNL 1 -2.254 -1.257 4.660 1.00 0.00 H HETATM 149 H44 UNL 1 -3.539 -0.095 3.055 1.00 0.00 H HETATM 150 H45 UNL 1 -7.787 0.526 1.483 1.00 0.00 H HETATM 151 H46 UNL 1 -6.455 1.861 -0.185 1.00 0.00 H HETATM 152 H47 UNL 1 -6.046 -1.233 2.212 1.00 0.00 H HETATM 153 H48 UNL 1 -6.415 -2.656 3.433 1.00 0.00 H HETATM 154 H49 UNL 1 -9.300 -4.408 2.520 1.00 0.00 H HETATM 155 H50 UNL 1 -11.143 -5.088 1.210 1.00 0.00 H HETATM 156 H51 UNL 1 -8.570 -0.566 -3.182 1.00 0.00 H HETATM 157 H52 UNL 1 -9.129 1.570 -3.870 1.00 0.00 H HETATM 158 H53 UNL 1 -9.755 3.886 -3.365 1.00 0.00 H HETATM 159 H54 UNL 1 -10.485 5.520 -1.722 1.00 0.00 H HETATM 160 H55 UNL 1 -10.413 2.256 1.714 1.00 0.00 H HETATM 161 H56 UNL 1 -9.724 0.504 0.182 1.00 0.00 H HETATM 162 H57 UNL 1 -10.634 -1.433 -3.228 1.00 0.00 H HETATM 163 H58 UNL 1 -11.760 -1.095 -0.798 1.00 0.00 H HETATM 164 H59 UNL 1 -9.981 -3.461 -2.307 1.00 0.00 H HETATM 165 H60 UNL 1 -11.318 -2.944 -1.275 1.00 0.00 H CONECT 1 2 106 CONECT 2 3 3 8 CONECT 3 4 107 CONECT 4 5 6 6 CONECT 5 108 CONECT 6 7 21 CONECT 7 8 8 9 CONECT 8 109 CONECT 9 10 CONECT 10 11 19 110 CONECT 11 12 12 18 CONECT 12 13 111 CONECT 13 14 14 112 CONECT 14 15 16 CONECT 15 113 CONECT 16 17 18 18 CONECT 17 114 CONECT 18 115 CONECT 19 20 21 116 CONECT 20 117 CONECT 21 22 118 CONECT 22 23 29 29 CONECT 23 24 25 25 CONECT 24 119 CONECT 25 26 120 CONECT 26 27 28 28 CONECT 27 121 CONECT 28 29 42 CONECT 29 30 CONECT 30 31 CONECT 31 32 40 122 CONECT 32 33 33 39 CONECT 33 34 123 CONECT 34 35 35 124 CONECT 35 36 37 CONECT 36 125 CONECT 37 38 39 39 CONECT 38 126 CONECT 39 127 CONECT 40 41 42 128 CONECT 41 129 CONECT 42 43 130 CONECT 43 44 50 50 CONECT 44 45 46 46 CONECT 45 131 CONECT 46 47 132 CONECT 47 48 49 49 CONECT 48 133 CONECT 49 50 69 CONECT 50 51 CONECT 51 52 CONECT 52 53 61 70 CONECT 53 54 54 60 CONECT 54 55 134 CONECT 55 56 56 135 CONECT 56 57 58 CONECT 57 136 CONECT 58 59 60 60 CONECT 59 137 CONECT 60 138 CONECT 61 62 CONECT 62 63 63 68 CONECT 63 64 139 CONECT 64 65 66 66 CONECT 65 140 CONECT 66 67 84 CONECT 67 68 68 72 CONECT 68 69 CONECT 69 70 141 CONECT 70 71 142 CONECT 71 143 CONECT 72 73 CONECT 73 74 82 144 CONECT 74 75 75 81 CONECT 75 76 145 CONECT 76 77 77 146 CONECT 77 78 79 CONECT 78 147 CONECT 79 80 81 81 CONECT 80 148 CONECT 81 149 CONECT 82 83 84 150 CONECT 83 151 CONECT 84 85 152 CONECT 85 86 92 92 CONECT 86 87 88 88 CONECT 87 153 CONECT 88 89 154 CONECT 89 90 91 91 CONECT 90 155 CONECT 91 92 105 CONECT 92 93 CONECT 93 94 CONECT 94 95 103 156 CONECT 95 96 96 102 CONECT 96 97 157 CONECT 97 98 98 158 CONECT 98 99 100 CONECT 99 159 CONECT 100 101 102 102 CONECT 101 160 CONECT 102 161 CONECT 103 104 105 162 CONECT 104 163 CONECT 105 164 165 END SMILES for HMDB0037671 (Pavetannin D1)OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=C5C6C(O)C(OC5=CC(O)=C34)(OC3=C(C4C(O)C(OC5=C(C7C(O)C(OC8=CC(O)=CC(O)=C78)C7=CC=C(O)C(O)=C7)C(O)=CC(O)=C45)C4=CC=C(O)C(O)=C4)C(O)=CC(O)=C63)C3=CC=C(O)C(O)=C3)C3=CC(O)=C(O)C=C3)=C2OC1C1=CC(O)=C(O)C=C1 INCHI for HMDB0037671 (Pavetannin D1)InChI=1S/C75H60O30/c76-28-16-41(88)51-49(17-28)100-67(24-2-7-31(78)37(84)12-24)63(96)59(51)53-43(90)20-44(91)54-61(65(98)68(102-71(53)54)25-3-8-32(79)38(85)13-25)56-45(92)21-46(93)57-62-58-50(104-75(74(62)99,105-73(56)57)27-5-10-34(81)40(87)15-27)22-47(94)55-60(64(97)69(103-72(55)58)26-4-9-33(80)39(86)14-26)52-42(89)19-35(82)29-18-48(95)66(101-70(29)52)23-1-6-30(77)36(83)11-23/h1-17,19-22,48,59-69,74,76-99H,18H2 3D Structure for HMDB0037671 (Pavetannin D1) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C75H60O30 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1441.2609 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1440.31694058 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-16-[2-(3,4-dihydroxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2,8,10,15,17,19-hexaene-6,9,17,19,21-pentol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-16-[2-(3,4-dihydroxyphenyl)-8-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2,8,10,15,17,19-hexaene-6,9,17,19,21-pentol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 88057-90-3 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | OC1CC2=C(O)C=C(O)C(C3C(O)C(OC4=C5C6C(O)C(OC5=CC(O)=C34)(OC3=C(C4C(O)C(OC5=C(C7C(O)C(OC8=CC(O)=CC(O)=C78)C7=CC=C(O)C(O)=C7)C(O)=CC(O)=C45)C4=CC=C(O)C(O)=C4)C(O)=CC(O)=C63)C3=CC=C(O)C(O)=C3)C3=CC(O)=C(O)C=C3)=C2OC1C1=CC(O)=C(O)C=C1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C75H60O30/c76-28-16-41(88)51-49(17-28)100-67(24-2-7-31(78)37(84)12-24)63(96)59(51)53-43(90)20-44(91)54-61(65(98)68(102-71(53)54)25-3-8-32(79)38(85)13-25)56-45(92)21-46(93)57-62-58-50(104-75(74(62)99,105-73(56)57)27-5-10-34(81)40(87)15-27)22-47(94)55-60(64(97)69(103-72(55)58)26-4-9-33(80)39(86)14-26)52-42(89)19-35(82)29-18-48(95)66(101-70(29)52)23-1-6-30(77)36(83)11-23/h1-17,19-22,48,59-69,74,76-99H,18H2 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | ODHOTFAKXJWQIS-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Biflavonoids and polyflavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Biflavonoids and polyflavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB016798 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | C00009310 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 35014455 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 61159 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|