Showing metabocard for Tragopogonsaponin G (HMDB0037923)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 23:10:54 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:55:34 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0037923 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Tragopogonsaponin G | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Tragopogonsaponin G belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. Based on a literature review a small amount of articles have been published on Tragopogonsaponin G. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0037923 (Tragopogonsaponin G)Mrv0541 02241215242D 77 85 0 0 0 0 999 V2000 -2.8703 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1290 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0151 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0151 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7275 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3849 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1290 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1290 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8703 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8703 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0151 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7275 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7275 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1593 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 -0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6130 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2717 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2717 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0159 -1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0257 -1.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6130 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2004 -1.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3452 3.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1691 3.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7310 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7310 -2.4742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1614 -2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1614 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -3.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1614 -4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8766 -2.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8766 -1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 2.4730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3007 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3007 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0159 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0159 2.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3007 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 -0.8237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0159 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 2.4730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 3.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8766 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8766 2.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 -2.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8766 -2.0601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7310 -4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 12 1 0 0 0 0 1 30 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 11 1 0 0 0 0 4 19 1 0 0 0 0 6 7 1 0 0 0 0 6 33 1 0 0 0 0 7 8 1 0 0 0 0 7 16 1 0 0 0 0 8 9 2 0 0 0 0 8 19 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 25 1 0 0 0 0 14 15 1 0 0 0 0 14 33 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 24 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 46 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 27 30 1 0 0 0 0 28 35 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 41 1 0 0 0 0 38 39 1 0 0 0 0 38 43 1 0 0 0 0 39 40 1 0 0 0 0 39 44 1 0 0 0 0 40 45 1 0 0 0 0 41 42 1 0 0 0 0 41 77 2 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 50 53 1 0 0 0 0 51 52 1 0 0 0 0 52 55 1 0 0 0 0 53 59 1 0 0 0 0 55 56 1 0 0 0 0 55 57 2 0 0 0 0 56 58 1 0 0 0 0 58 70 1 0 0 0 0 59 60 1 0 0 0 0 59 64 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 61 65 1 0 0 0 0 62 63 1 0 0 0 0 62 69 1 0 0 0 0 63 64 1 0 0 0 0 63 68 1 0 0 0 0 64 67 1 0 0 0 0 65 66 1 0 0 0 0 70 71 2 0 0 0 0 70 75 1 0 0 0 0 71 72 1 0 0 0 0 72 73 2 0 0 0 0 73 74 1 0 0 0 0 73 76 1 0 0 0 0 74 75 2 0 0 0 0 M END 3D MOL for HMDB0037923 (Tragopogonsaponin G)HMDB0037923 RDKit 3D Tragopogonsaponin G 159167 0 0 0 0 0 0 0 0999 V2000 -2.4692 2.4944 2.5256 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7791 2.8479 1.2190 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7949 4.4031 1.2132 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5028 2.3658 0.0140 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6242 1.6387 -0.9714 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9296 0.4476 -0.2727 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0326 -0.3099 0.3441 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9612 -0.5200 1.6043 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1316 -0.8177 -0.2821 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0955 -1.5310 0.4664 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0027 -2.8600 0.0256 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6440 -3.7014 0.8932 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5443 -2.9905 1.8900 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3786 -4.0152 2.3992 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3726 -1.9100 1.2799 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4272 -2.4738 0.5754 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6616 -2.0361 1.0187 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2596 -1.3542 0.0001 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8084 -2.0356 -1.0341 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9186 -2.0153 -2.2869 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6830 -2.6064 -2.0542 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3438 -3.3988 -0.7818 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1154 -4.1907 -1.9097 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7460 -4.1088 0.4124 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5886 -4.7925 0.1387 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6002 -3.0767 1.5119 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3611 -3.6001 2.7489 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4876 -1.0272 0.3743 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6133 0.3201 0.7857 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2155 1.2838 -0.0326 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6262 0.9105 -1.1312 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3095 2.6528 0.4841 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9893 3.6408 -0.3981 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3784 3.3563 -0.7433 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7526 2.7630 -1.9182 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0919 2.4943 -2.1739 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0578 2.8122 -1.2696 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3898 2.5494 -1.5109 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6816 3.4112 -0.0851 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3704 3.6743 0.1658 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2757 -0.3519 -1.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1750 -1.3993 -1.6703 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0654 -0.9782 -1.1111 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9061 -0.3155 -0.0328 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5347 -1.1108 1.2323 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3301 1.0479 0.0305 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9277 2.0169 -0.6042 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1605 1.8336 -1.4016 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0640 0.7194 -0.9127 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3514 1.2997 -0.3662 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0708 2.7577 0.0566 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3519 1.4546 -1.5254 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2778 0.2828 -1.6021 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1474 0.1270 -0.3594 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3704 0.8023 -0.5492 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4460 -0.0486 -0.6976 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9263 -0.0040 -2.0315 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5235 -1.2275 -2.2801 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6238 -1.1105 -3.2730 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2916 -2.1034 -3.6356 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9240 0.1251 -3.8157 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0617 -1.9311 -1.0796 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1675 -2.7055 -1.4686 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5179 -1.0515 0.0354 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8504 -0.6484 -0.0645 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6249 0.1951 0.1641 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4109 0.3846 1.4981 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4613 0.5899 0.8698 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0431 1.8844 1.4307 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7992 -0.4369 1.9662 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9663 0.6520 0.8027 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4184 -0.7365 1.0749 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9260 -0.4159 1.2829 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3800 -0.3602 -0.1592 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7279 -1.7645 -0.6988 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0028 1.1198 0.7304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3552 2.4582 1.1923 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2900 1.7477 2.3515 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7896 2.1040 3.2857 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9854 3.3627 2.9958 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5274 4.6953 2.2467 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7939 4.7558 0.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9774 4.7381 0.5641 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9422 3.2274 -0.5218 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3486 1.7362 0.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2745 1.1893 -1.7433 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8919 2.2890 -1.4795 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8111 -1.5820 1.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3226 -4.3582 0.2974 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9113 -4.2818 1.4778 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9806 -2.6461 2.7928 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8030 -4.6461 2.9241 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7601 -1.2574 2.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5162 -1.3065 1.8547 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7056 -1.4107 -1.3641 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3998 -2.5676 -3.1161 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8196 -0.9598 -2.6588 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4076 -3.1344 -2.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4444 -3.3717 -0.6454 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5566 -5.0628 -1.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5019 -4.8465 0.7649 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5776 -5.7220 0.4822 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6191 -2.5766 1.5545 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0448 -2.8634 3.3320 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9244 -1.0873 -0.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8431 2.6469 1.4893 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2841 3.0447 0.7153 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9033 4.6885 -0.0081 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4175 3.6770 -1.3673 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0636 2.4911 -2.6999 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3696 2.0168 -3.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0854 2.7946 -0.8230 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4181 3.6749 0.6504 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0601 4.1486 1.1060 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2757 0.2705 -2.2813 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8210 -1.9287 -2.4142 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9142 -2.0533 -0.8926 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5796 -0.9499 -2.1133 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4629 -1.4456 1.1918 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6860 -0.5784 2.1540 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0503 -2.1275 1.1726 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5404 3.0276 -0.5884 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6861 2.7833 -1.5345 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7833 1.6275 -2.4574 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3755 0.2000 -1.8808 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3762 3.4878 -0.7043 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7302 3.0288 0.9382 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0529 2.8761 0.4554 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8769 2.4280 -1.4962 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7644 1.4625 -2.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9412 0.4526 -2.4724 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6827 -0.6280 -1.8079 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3861 -0.9567 -0.3391 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0821 -1.0863 -0.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7076 -1.8580 -2.7463 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2645 0.9084 -3.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3287 -2.6841 -0.6761 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5755 -3.0585 -0.6351 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4588 -1.6671 0.9773 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9744 0.2190 0.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2307 1.0722 -0.1923 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2927 -0.4040 2.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0467 1.6357 1.8228 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1320 2.6840 0.7114 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4338 2.1167 2.3353 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7178 -1.4651 1.6268 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8878 -0.2773 2.1773 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3029 -0.1901 2.9253 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6844 1.1970 1.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7667 -1.1128 2.0308 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6189 -1.3551 0.2117 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7725 0.5823 1.7112 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5579 -1.2375 1.8708 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5512 -1.6733 -1.4693 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9554 -2.4816 0.0874 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8869 -2.2028 -1.2732 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0456 0.4373 1.6018 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2060 3.2994 0.7228 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0014 2.5323 2.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 19 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 15 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 37 38 1 0 37 39 1 0 39 40 2 0 6 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 46 47 2 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 58 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 64 66 1 0 66 67 1 0 54 68 1 0 68 69 1 0 68 70 1 0 68 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 46 76 1 0 76 77 1 0 77 2 1 0 76 6 1 0 28 10 1 0 40 34 1 0 74 44 1 0 26 17 1 0 74 49 1 0 71 50 1 0 66 56 1 0 1 78 1 0 1 79 1 0 1 80 1 0 3 81 1 0 3 82 1 0 3 83 1 0 4 84 1 0 4 85 1 0 5 86 1 0 5 87 1 0 10 88 1 0 12 89 1 0 12 90 1 0 13 91 1 0 14 92 1 0 15 93 1 0 17 94 1 0 19 95 1 0 20 96 1 0 20 97 1 0 21 98 1 0 22 99 1 0 23100 1 0 24101 1 0 25102 1 0 26103 1 0 27104 1 0 28105 1 0 32106 1 0 32107 1 0 33108 1 0 33109 1 0 35110 1 0 36111 1 0 38112 1 0 39113 1 0 40114 1 0 41115 1 0 42116 1 0 43117 1 0 43118 1 0 45119 1 0 45120 1 0 45121 1 0 47122 1 0 48123 1 0 48124 1 0 49125 1 0 51126 1 0 51127 1 0 51128 1 0 52129 1 0 52130 1 0 53131 1 0 53132 1 0 54133 1 0 56134 1 0 58135 1 0 61136 1 0 62137 1 0 63138 1 0 64139 1 0 65140 1 0 66141 1 0 67142 1 0 69143 1 0 69144 1 0 69145 1 0 70146 1 0 70147 1 0 70148 1 0 71149 1 0 72150 1 0 72151 1 0 73152 1 0 73153 1 0 75154 1 0 75155 1 0 75156 1 0 76157 1 0 77158 1 0 77159 1 0 M END 3D SDF for HMDB0037923 (Tragopogonsaponin G)Mrv0541 02241215242D 77 85 0 0 0 0 999 V2000 -2.8703 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1290 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0151 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0151 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7275 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3849 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1290 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1290 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8703 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8703 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0151 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7275 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7275 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4167 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1593 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 -0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6130 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2717 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2717 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0159 -1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0257 -1.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6130 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2004 -1.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3452 3.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7564 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1691 3.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7310 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7310 -2.4742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1614 -2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1614 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -3.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1614 -4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8766 -2.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8766 -1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4462 -0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 2.4730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3007 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3007 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0159 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0159 2.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5883 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3007 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 -0.8237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0159 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 2.4730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 2.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 3.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8766 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8766 2.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1628 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 -2.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7338 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8766 -2.0601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7310 -4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 12 1 0 0 0 0 1 30 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 11 1 0 0 0 0 4 19 1 0 0 0 0 6 7 1 0 0 0 0 6 33 1 0 0 0 0 7 8 1 0 0 0 0 7 16 1 0 0 0 0 8 9 2 0 0 0 0 8 19 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 12 25 1 0 0 0 0 14 15 1 0 0 0 0 14 33 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 24 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 46 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 27 30 1 0 0 0 0 28 35 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 41 1 0 0 0 0 38 39 1 0 0 0 0 38 43 1 0 0 0 0 39 40 1 0 0 0 0 39 44 1 0 0 0 0 40 45 1 0 0 0 0 41 42 1 0 0 0 0 41 77 2 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 50 53 1 0 0 0 0 51 52 1 0 0 0 0 52 55 1 0 0 0 0 53 59 1 0 0 0 0 55 56 1 0 0 0 0 55 57 2 0 0 0 0 56 58 1 0 0 0 0 58 70 1 0 0 0 0 59 60 1 0 0 0 0 59 64 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 61 65 1 0 0 0 0 62 63 1 0 0 0 0 62 69 1 0 0 0 0 63 64 1 0 0 0 0 63 68 1 0 0 0 0 64 67 1 0 0 0 0 65 66 1 0 0 0 0 70 71 2 0 0 0 0 70 75 1 0 0 0 0 71 72 1 0 0 0 0 72 73 2 0 0 0 0 73 74 1 0 0 0 0 73 76 1 0 0 0 0 74 75 2 0 0 0 0 M END > <DATABASE_ID> HMDB0037923 > <DATABASE_NAME> hmdb > <SMILES> CC1(C)CCC2(C(O)CC3(C)C(=CCC4C5(C)CCC(OC6OC(C(O)C(O)C6O)C(O)=O)C(C)(C)C5CCC34C)C2C1)C(=O)OC1OCC(O)C(OC2OC(CO)C(O)C(O)C2O)C1OC(=O)CCC1=CC=C(O)C=C1 > <INCHI_IDENTIFIER> InChI=1S/C56H82O21/c1-51(2)20-21-56(50(70)77-49-45(74-36(61)15-10-26-8-11-27(58)12-9-26)43(30(59)25-71-49)75-47-41(66)38(63)37(62)31(24-57)72-47)29(22-51)28-13-14-33-53(5)18-17-35(73-48-42(67)39(64)40(65)44(76-48)46(68)69)52(3,4)32(53)16-19-54(33,6)55(28,7)23-34(56)60/h8-9,11-13,29-35,37-45,47-49,57-60,62-67H,10,14-25H2,1-7H3,(H,68,69) > <INCHI_KEY> GDOFBGFEZUPKAG-UHFFFAOYSA-N > <FORMULA> C56H82O21 > <MOLECULAR_WEIGHT> 1091.2377 > <EXACT_MASS> 1090.534859686 > <JCHEM_ACCEPTOR_COUNT> 19 > <JCHEM_AVERAGE_POLARIZABILITY> 115.5433836821224 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 11 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 3,4,5-trihydroxy-6-[(8-hydroxy-8a-{[(5-hydroxy-3-{[3-(4-hydroxyphenyl)propanoyl]oxy}-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]carbonyl}-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl)oxy]oxane-2-carboxylic acid > <ALOGPS_LOGP> 3.10 > <JCHEM_LOGP> 2.9213610350000003 > <ALOGPS_LOGS> -4.17 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 9 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 9.503684665174013 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.5941200841492082 > <JCHEM_PKA_STRONGEST_BASIC> -3.678621636050602 > <JCHEM_POLAR_SURFACE_AREA> 338.35 > <JCHEM_REFRACTIVITY> 266.7580000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 14 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 7.32e-02 g/l > <JCHEM_TRADITIONAL_IUPAC> 3,4,5-trihydroxy-6-[(8-hydroxy-8a-{[(5-hydroxy-3-{[3-(4-hydroxyphenyl)propanoyl]oxy}-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]carbonyl}-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]oxane-2-carboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0037923 (Tragopogonsaponin G)HMDB0037923 RDKit 3D Tragopogonsaponin G 159167 0 0 0 0 0 0 0 0999 V2000 -2.4692 2.4944 2.5256 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7791 2.8479 1.2190 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7949 4.4031 1.2132 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5028 2.3658 0.0140 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6242 1.6387 -0.9714 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9296 0.4476 -0.2727 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0326 -0.3099 0.3441 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9612 -0.5200 1.6043 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1316 -0.8177 -0.2821 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0955 -1.5310 0.4664 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0027 -2.8600 0.0256 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6440 -3.7014 0.8932 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5443 -2.9905 1.8900 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3786 -4.0152 2.3992 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3726 -1.9100 1.2799 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4272 -2.4738 0.5754 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6616 -2.0361 1.0187 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2596 -1.3542 0.0001 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8084 -2.0356 -1.0341 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9186 -2.0153 -2.2869 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6830 -2.6064 -2.0542 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3438 -3.3988 -0.7818 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1154 -4.1907 -1.9097 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7460 -4.1088 0.4124 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5886 -4.7925 0.1387 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6002 -3.0767 1.5119 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3611 -3.6001 2.7489 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4876 -1.0272 0.3743 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6133 0.3201 0.7857 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2155 1.2838 -0.0326 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6262 0.9105 -1.1312 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3095 2.6528 0.4841 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9893 3.6408 -0.3981 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3784 3.3563 -0.7433 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7526 2.7630 -1.9182 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0919 2.4943 -2.1739 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0578 2.8122 -1.2696 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3898 2.5494 -1.5109 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6816 3.4112 -0.0851 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3704 3.6743 0.1658 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2757 -0.3519 -1.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1750 -1.3993 -1.6703 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0654 -0.9782 -1.1111 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9061 -0.3155 -0.0328 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5347 -1.1108 1.2323 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3301 1.0479 0.0305 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9277 2.0169 -0.6042 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1605 1.8336 -1.4016 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0640 0.7194 -0.9127 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3514 1.2997 -0.3662 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0708 2.7577 0.0566 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3519 1.4546 -1.5254 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2778 0.2828 -1.6021 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1474 0.1270 -0.3594 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3704 0.8023 -0.5492 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4460 -0.0486 -0.6976 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9263 -0.0040 -2.0315 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5235 -1.2275 -2.2801 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6238 -1.1105 -3.2730 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2916 -2.1034 -3.6356 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9240 0.1251 -3.8157 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0617 -1.9311 -1.0796 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1675 -2.7055 -1.4686 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5179 -1.0515 0.0354 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8504 -0.6484 -0.0645 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6249 0.1951 0.1641 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4109 0.3846 1.4981 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4613 0.5899 0.8698 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0431 1.8844 1.4307 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7992 -0.4369 1.9662 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9663 0.6520 0.8027 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4184 -0.7365 1.0749 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9260 -0.4159 1.2829 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3800 -0.3602 -0.1592 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7279 -1.7645 -0.6988 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0028 1.1198 0.7304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3552 2.4582 1.1923 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2900 1.7477 2.3515 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7896 2.1040 3.2857 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9854 3.3627 2.9958 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5274 4.6953 2.2467 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7939 4.7558 0.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9774 4.7381 0.5641 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9422 3.2274 -0.5218 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3486 1.7362 0.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2745 1.1893 -1.7433 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8919 2.2890 -1.4795 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8111 -1.5820 1.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3226 -4.3582 0.2974 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9113 -4.2818 1.4778 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9806 -2.6461 2.7928 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8030 -4.6461 2.9241 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7601 -1.2574 2.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5162 -1.3065 1.8547 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7056 -1.4107 -1.3641 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3998 -2.5676 -3.1161 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8196 -0.9598 -2.6588 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4076 -3.1344 -2.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4444 -3.3717 -0.6454 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5566 -5.0628 -1.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5019 -4.8465 0.7649 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5776 -5.7220 0.4822 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6191 -2.5766 1.5545 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0448 -2.8634 3.3320 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9244 -1.0873 -0.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8431 2.6469 1.4893 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2841 3.0447 0.7153 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9033 4.6885 -0.0081 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4175 3.6770 -1.3673 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0636 2.4911 -2.6999 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3696 2.0168 -3.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0854 2.7946 -0.8230 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4181 3.6749 0.6504 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0601 4.1486 1.1060 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2757 0.2705 -2.2813 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8210 -1.9287 -2.4142 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9142 -2.0533 -0.8926 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5796 -0.9499 -2.1133 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4629 -1.4456 1.1918 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6860 -0.5784 2.1540 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0503 -2.1275 1.1726 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5404 3.0276 -0.5884 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6861 2.7833 -1.5345 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7833 1.6275 -2.4574 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3755 0.2000 -1.8808 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3762 3.4878 -0.7043 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7302 3.0288 0.9382 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0529 2.8761 0.4554 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8769 2.4280 -1.4962 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7644 1.4625 -2.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9412 0.4526 -2.4724 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6827 -0.6280 -1.8079 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3861 -0.9567 -0.3391 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0821 -1.0863 -0.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7076 -1.8580 -2.7463 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2645 0.9084 -3.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3287 -2.6841 -0.6761 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5755 -3.0585 -0.6351 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4588 -1.6671 0.9773 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9744 0.2190 0.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2307 1.0722 -0.1923 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2927 -0.4040 2.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0467 1.6357 1.8228 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1320 2.6840 0.7114 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4338 2.1167 2.3353 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7178 -1.4651 1.6268 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8878 -0.2773 2.1773 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3029 -0.1901 2.9253 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6844 1.1970 1.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7667 -1.1128 2.0308 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6189 -1.3551 0.2117 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7725 0.5823 1.7112 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5579 -1.2375 1.8708 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5512 -1.6733 -1.4693 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9554 -2.4816 0.0874 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8869 -2.2028 -1.2732 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0456 0.4373 1.6018 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2060 3.2994 0.7228 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0014 2.5323 2.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 19 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 15 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 37 38 1 0 37 39 1 0 39 40 2 0 6 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 46 47 2 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 58 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 64 66 1 0 66 67 1 0 54 68 1 0 68 69 1 0 68 70 1 0 68 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 46 76 1 0 76 77 1 0 77 2 1 0 76 6 1 0 28 10 1 0 40 34 1 0 74 44 1 0 26 17 1 0 74 49 1 0 71 50 1 0 66 56 1 0 1 78 1 0 1 79 1 0 1 80 1 0 3 81 1 0 3 82 1 0 3 83 1 0 4 84 1 0 4 85 1 0 5 86 1 0 5 87 1 0 10 88 1 0 12 89 1 0 12 90 1 0 13 91 1 0 14 92 1 0 15 93 1 0 17 94 1 0 19 95 1 0 20 96 1 0 20 97 1 0 21 98 1 0 22 99 1 0 23100 1 0 24101 1 0 25102 1 0 26103 1 0 27104 1 0 28105 1 0 32106 1 0 32107 1 0 33108 1 0 33109 1 0 35110 1 0 36111 1 0 38112 1 0 39113 1 0 40114 1 0 41115 1 0 42116 1 0 43117 1 0 43118 1 0 45119 1 0 45120 1 0 45121 1 0 47122 1 0 48123 1 0 48124 1 0 49125 1 0 51126 1 0 51127 1 0 51128 1 0 52129 1 0 52130 1 0 53131 1 0 53132 1 0 54133 1 0 56134 1 0 58135 1 0 61136 1 0 62137 1 0 63138 1 0 64139 1 0 65140 1 0 66141 1 0 67142 1 0 69143 1 0 69144 1 0 69145 1 0 70146 1 0 70147 1 0 70148 1 0 71149 1 0 72150 1 0 72151 1 0 73152 1 0 73153 1 0 75154 1 0 75155 1 0 75156 1 0 76157 1 0 77158 1 0 77159 1 0 M END PDB for HMDB0037923 (Tragopogonsaponin G)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 -5.358 -1.538 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -3.974 -2.308 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -2.742 -1.538 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -2.742 0.000 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -2.742 1.538 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 0.028 4.616 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 0.028 3.078 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -1.358 2.308 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -2.585 3.078 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -3.974 2.308 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -3.974 0.770 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -5.358 0.000 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -5.358 1.538 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 2.644 4.616 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 2.644 3.078 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 1.412 2.308 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 1.412 0.770 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 0.028 0.000 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -1.358 0.770 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -1.358 -0.770 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 2.644 0.000 0.000 0.00 0.00 O+0 HETATM 22 C UNK 0 2.644 1.538 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 4.031 2.308 0.000 0.00 0.00 O+0 HETATM 24 O UNK 0 1.412 -0.770 0.000 0.00 0.00 O+0 HETATM 25 C UNK 0 -6.744 0.770 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -7.974 0.000 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -7.974 -1.538 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 -9.363 -2.308 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 -7.515 -3.697 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -6.744 -2.308 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -5.974 -3.697 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 0.644 6.773 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 1.412 5.389 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 2.182 6.773 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 -10.698 -3.078 0.000 0.00 0.00 C+0 HETATM 36 O UNK 0 -10.698 -4.618 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 -12.033 -5.389 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -13.368 -4.618 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -13.368 -3.078 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -12.033 -2.308 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -12.033 -6.929 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 -13.368 -7.699 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 -14.703 -5.389 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 -14.703 -2.308 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 -12.033 -0.770 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 5.366 3.078 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 5.366 4.616 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 6.698 5.389 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 8.028 4.616 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 8.028 3.078 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 6.698 2.308 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 6.698 0.770 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 9.363 2.308 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 9.363 5.389 0.000 0.00 0.00 O+0 HETATM 55 C UNK 0 6.698 -0.770 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 8.028 -1.538 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 5.366 -1.538 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 9.363 -0.770 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 10.703 3.078 0.000 0.00 0.00 C+0 HETATM 60 O UNK 0 10.703 4.616 0.000 0.00 0.00 O+0 HETATM 61 C UNK 0 12.038 5.389 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 13.371 4.616 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 13.371 3.078 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 12.038 2.308 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 12.038 6.929 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 10.703 7.699 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 12.038 0.770 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 14.703 2.308 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 14.703 5.389 0.000 0.00 0.00 O+0 HETATM 70 C UNK 0 10.703 -1.538 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 12.038 -0.770 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 13.371 -1.538 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 13.371 -3.078 0.000 0.00 0.00 C+0 HETATM 74 C UNK 0 12.038 -3.846 0.000 0.00 0.00 C+0 HETATM 75 C UNK 0 10.703 -3.078 0.000 0.00 0.00 C+0 HETATM 76 O UNK 0 14.703 -3.846 0.000 0.00 0.00 O+0 HETATM 77 O UNK 0 -10.698 -7.699 0.000 0.00 0.00 O+0 CONECT 1 2 12 30 CONECT 2 1 3 CONECT 3 2 4 CONECT 4 3 5 11 19 CONECT 5 4 CONECT 6 7 33 CONECT 7 6 8 16 CONECT 8 7 9 19 CONECT 9 8 10 CONECT 10 9 11 CONECT 11 4 10 12 CONECT 12 1 11 13 25 CONECT 13 12 CONECT 14 15 33 CONECT 15 14 16 CONECT 16 7 15 17 22 CONECT 17 16 18 24 CONECT 18 17 19 CONECT 19 4 8 18 20 CONECT 20 19 CONECT 21 22 CONECT 22 16 21 23 CONECT 23 22 46 CONECT 24 17 CONECT 25 12 26 CONECT 26 25 27 CONECT 27 26 28 30 CONECT 28 27 35 CONECT 29 30 CONECT 30 1 27 29 31 CONECT 31 30 CONECT 32 33 CONECT 33 6 14 32 34 CONECT 34 33 CONECT 35 28 36 40 CONECT 36 35 37 CONECT 37 36 38 41 CONECT 38 37 39 43 CONECT 39 38 40 44 CONECT 40 35 39 45 CONECT 41 37 42 77 CONECT 42 41 CONECT 43 38 CONECT 44 39 CONECT 45 40 CONECT 46 23 47 51 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 50 54 CONECT 50 49 51 53 CONECT 51 46 50 52 CONECT 52 51 55 CONECT 53 50 59 CONECT 54 49 CONECT 55 52 56 57 CONECT 56 55 58 CONECT 57 55 CONECT 58 56 70 CONECT 59 53 60 64 CONECT 60 59 61 CONECT 61 60 62 65 CONECT 62 61 63 69 CONECT 63 62 64 68 CONECT 64 59 63 67 CONECT 65 61 66 CONECT 66 65 CONECT 67 64 CONECT 68 63 CONECT 69 62 CONECT 70 58 71 75 CONECT 71 70 72 CONECT 72 71 73 CONECT 73 72 74 76 CONECT 74 73 75 CONECT 75 70 74 CONECT 76 73 CONECT 77 41 MASTER 0 0 0 0 0 0 0 0 77 0 170 0 END 3D PDB for HMDB0037923 (Tragopogonsaponin G)COMPND HMDB0037923 HETATM 1 C1 UNL 1 -2.469 2.494 2.526 1.00 0.00 C HETATM 2 C2 UNL 1 -1.779 2.848 1.219 1.00 0.00 C HETATM 3 C3 UNL 1 -1.795 4.403 1.213 1.00 0.00 C HETATM 4 C4 UNL 1 -2.503 2.366 0.014 1.00 0.00 C HETATM 5 C5 UNL 1 -1.624 1.639 -0.971 1.00 0.00 C HETATM 6 C6 UNL 1 -0.930 0.448 -0.273 1.00 0.00 C HETATM 7 C7 UNL 1 -2.033 -0.310 0.344 1.00 0.00 C HETATM 8 O1 UNL 1 -1.961 -0.520 1.604 1.00 0.00 O HETATM 9 O2 UNL 1 -3.132 -0.818 -0.282 1.00 0.00 O HETATM 10 C8 UNL 1 -4.095 -1.531 0.466 1.00 0.00 C HETATM 11 O3 UNL 1 -4.003 -2.860 0.026 1.00 0.00 O HETATM 12 C9 UNL 1 -4.644 -3.701 0.893 1.00 0.00 C HETATM 13 C10 UNL 1 -5.544 -2.991 1.890 1.00 0.00 C HETATM 14 O4 UNL 1 -6.379 -4.015 2.399 1.00 0.00 O HETATM 15 C11 UNL 1 -6.373 -1.910 1.280 1.00 0.00 C HETATM 16 O5 UNL 1 -7.427 -2.474 0.575 1.00 0.00 O HETATM 17 C12 UNL 1 -8.662 -2.036 1.019 1.00 0.00 C HETATM 18 O6 UNL 1 -9.260 -1.354 0.000 1.00 0.00 O HETATM 19 C13 UNL 1 -9.808 -2.036 -1.034 1.00 0.00 C HETATM 20 C14 UNL 1 -8.919 -2.015 -2.287 1.00 0.00 C HETATM 21 O7 UNL 1 -7.683 -2.606 -2.054 1.00 0.00 O HETATM 22 C15 UNL 1 -10.344 -3.399 -0.782 1.00 0.00 C HETATM 23 O8 UNL 1 -10.115 -4.191 -1.910 1.00 0.00 O HETATM 24 C16 UNL 1 -9.746 -4.109 0.412 1.00 0.00 C HETATM 25 O9 UNL 1 -8.589 -4.793 0.139 1.00 0.00 O HETATM 26 C17 UNL 1 -9.600 -3.077 1.512 1.00 0.00 C HETATM 27 O10 UNL 1 -9.361 -3.600 2.749 1.00 0.00 O HETATM 28 C18 UNL 1 -5.488 -1.027 0.374 1.00 0.00 C HETATM 29 O11 UNL 1 -5.613 0.320 0.786 1.00 0.00 O HETATM 30 C19 UNL 1 -6.215 1.284 -0.033 1.00 0.00 C HETATM 31 O12 UNL 1 -6.626 0.910 -1.131 1.00 0.00 O HETATM 32 C20 UNL 1 -6.310 2.653 0.484 1.00 0.00 C HETATM 33 C21 UNL 1 -6.989 3.641 -0.398 1.00 0.00 C HETATM 34 C22 UNL 1 -8.378 3.356 -0.743 1.00 0.00 C HETATM 35 C23 UNL 1 -8.753 2.763 -1.918 1.00 0.00 C HETATM 36 C24 UNL 1 -10.092 2.494 -2.174 1.00 0.00 C HETATM 37 C25 UNL 1 -11.058 2.812 -1.270 1.00 0.00 C HETATM 38 O13 UNL 1 -12.390 2.549 -1.511 1.00 0.00 O HETATM 39 C26 UNL 1 -10.682 3.411 -0.085 1.00 0.00 C HETATM 40 C27 UNL 1 -9.370 3.674 0.166 1.00 0.00 C HETATM 41 C28 UNL 1 -0.276 -0.352 -1.320 1.00 0.00 C HETATM 42 O14 UNL 1 -1.175 -1.399 -1.670 1.00 0.00 O HETATM 43 C29 UNL 1 1.065 -0.978 -1.111 1.00 0.00 C HETATM 44 C30 UNL 1 1.906 -0.315 -0.033 1.00 0.00 C HETATM 45 C31 UNL 1 1.535 -1.111 1.232 1.00 0.00 C HETATM 46 C32 UNL 1 1.330 1.048 0.030 1.00 0.00 C HETATM 47 C33 UNL 1 1.928 2.017 -0.604 1.00 0.00 C HETATM 48 C34 UNL 1 3.160 1.834 -1.402 1.00 0.00 C HETATM 49 C35 UNL 1 4.064 0.719 -0.913 1.00 0.00 C HETATM 50 C36 UNL 1 5.351 1.300 -0.366 1.00 0.00 C HETATM 51 C37 UNL 1 5.071 2.758 0.057 1.00 0.00 C HETATM 52 C38 UNL 1 6.352 1.455 -1.525 1.00 0.00 C HETATM 53 C39 UNL 1 7.278 0.283 -1.602 1.00 0.00 C HETATM 54 C40 UNL 1 8.147 0.127 -0.359 1.00 0.00 C HETATM 55 O15 UNL 1 9.370 0.802 -0.549 1.00 0.00 O HETATM 56 C41 UNL 1 10.446 -0.049 -0.698 1.00 0.00 C HETATM 57 O16 UNL 1 10.926 -0.004 -2.032 1.00 0.00 O HETATM 58 C42 UNL 1 11.524 -1.227 -2.280 1.00 0.00 C HETATM 59 C43 UNL 1 12.624 -1.111 -3.273 1.00 0.00 C HETATM 60 O17 UNL 1 13.292 -2.103 -3.636 1.00 0.00 O HETATM 61 O18 UNL 1 12.924 0.125 -3.816 1.00 0.00 O HETATM 62 C44 UNL 1 12.062 -1.931 -1.080 1.00 0.00 C HETATM 63 O19 UNL 1 13.168 -2.706 -1.469 1.00 0.00 O HETATM 64 C45 UNL 1 12.518 -1.051 0.035 1.00 0.00 C HETATM 65 O20 UNL 1 13.850 -0.648 -0.064 1.00 0.00 O HETATM 66 C46 UNL 1 11.625 0.195 0.164 1.00 0.00 C HETATM 67 O21 UNL 1 11.411 0.385 1.498 1.00 0.00 O HETATM 68 C47 UNL 1 7.461 0.590 0.870 1.00 0.00 C HETATM 69 C48 UNL 1 8.043 1.884 1.431 1.00 0.00 C HETATM 70 C49 UNL 1 7.799 -0.437 1.966 1.00 0.00 C HETATM 71 C50 UNL 1 5.966 0.652 0.803 1.00 0.00 C HETATM 72 C51 UNL 1 5.418 -0.737 1.075 1.00 0.00 C HETATM 73 C52 UNL 1 3.926 -0.416 1.283 1.00 0.00 C HETATM 74 C53 UNL 1 3.380 -0.360 -0.159 1.00 0.00 C HETATM 75 C54 UNL 1 3.728 -1.765 -0.699 1.00 0.00 C HETATM 76 C55 UNL 1 -0.003 1.120 0.730 1.00 0.00 C HETATM 77 C56 UNL 1 -0.355 2.458 1.192 1.00 0.00 C HETATM 78 H1 UNL 1 -3.290 1.748 2.351 1.00 0.00 H HETATM 79 H2 UNL 1 -1.790 2.104 3.286 1.00 0.00 H HETATM 80 H3 UNL 1 -2.985 3.363 2.996 1.00 0.00 H HETATM 81 H4 UNL 1 -1.527 4.695 2.247 1.00 0.00 H HETATM 82 H5 UNL 1 -2.794 4.756 0.936 1.00 0.00 H HETATM 83 H6 UNL 1 -0.977 4.738 0.564 1.00 0.00 H HETATM 84 H7 UNL 1 -2.942 3.227 -0.522 1.00 0.00 H HETATM 85 H8 UNL 1 -3.349 1.736 0.353 1.00 0.00 H HETATM 86 H9 UNL 1 -2.274 1.189 -1.743 1.00 0.00 H HETATM 87 H10 UNL 1 -0.892 2.289 -1.479 1.00 0.00 H HETATM 88 H11 UNL 1 -3.811 -1.582 1.553 1.00 0.00 H HETATM 89 H12 UNL 1 -5.323 -4.358 0.297 1.00 0.00 H HETATM 90 H13 UNL 1 -3.911 -4.282 1.478 1.00 0.00 H HETATM 91 H14 UNL 1 -4.981 -2.646 2.793 1.00 0.00 H HETATM 92 H15 UNL 1 -5.803 -4.646 2.924 1.00 0.00 H HETATM 93 H16 UNL 1 -6.760 -1.257 2.118 1.00 0.00 H HETATM 94 H17 UNL 1 -8.516 -1.307 1.855 1.00 0.00 H HETATM 95 H18 UNL 1 -10.706 -1.411 -1.364 1.00 0.00 H HETATM 96 H19 UNL 1 -9.400 -2.568 -3.116 1.00 0.00 H HETATM 97 H20 UNL 1 -8.820 -0.960 -2.659 1.00 0.00 H HETATM 98 H21 UNL 1 -7.408 -3.134 -2.822 1.00 0.00 H HETATM 99 H22 UNL 1 -11.444 -3.372 -0.645 1.00 0.00 H HETATM 100 H23 UNL 1 -10.557 -5.063 -1.845 1.00 0.00 H HETATM 101 H24 UNL 1 -10.502 -4.846 0.765 1.00 0.00 H HETATM 102 H25 UNL 1 -8.578 -5.722 0.482 1.00 0.00 H HETATM 103 H26 UNL 1 -10.619 -2.577 1.555 1.00 0.00 H HETATM 104 H27 UNL 1 -9.045 -2.863 3.332 1.00 0.00 H HETATM 105 H28 UNL 1 -5.924 -1.087 -0.641 1.00 0.00 H HETATM 106 H29 UNL 1 -6.843 2.647 1.489 1.00 0.00 H HETATM 107 H30 UNL 1 -5.284 3.045 0.715 1.00 0.00 H HETATM 108 H31 UNL 1 -6.903 4.688 -0.008 1.00 0.00 H HETATM 109 H32 UNL 1 -6.418 3.677 -1.367 1.00 0.00 H HETATM 110 H33 UNL 1 -8.064 2.491 -2.700 1.00 0.00 H HETATM 111 H34 UNL 1 -10.370 2.017 -3.127 1.00 0.00 H HETATM 112 H35 UNL 1 -13.085 2.795 -0.823 1.00 0.00 H HETATM 113 H36 UNL 1 -11.418 3.675 0.650 1.00 0.00 H HETATM 114 H37 UNL 1 -9.060 4.149 1.106 1.00 0.00 H HETATM 115 H38 UNL 1 -0.276 0.270 -2.281 1.00 0.00 H HETATM 116 H39 UNL 1 -0.821 -1.929 -2.414 1.00 0.00 H HETATM 117 H40 UNL 1 0.914 -2.053 -0.893 1.00 0.00 H HETATM 118 H41 UNL 1 1.580 -0.950 -2.113 1.00 0.00 H HETATM 119 H42 UNL 1 0.463 -1.446 1.192 1.00 0.00 H HETATM 120 H43 UNL 1 1.686 -0.578 2.154 1.00 0.00 H HETATM 121 H44 UNL 1 2.050 -2.127 1.173 1.00 0.00 H HETATM 122 H45 UNL 1 1.540 3.028 -0.588 1.00 0.00 H HETATM 123 H46 UNL 1 3.686 2.783 -1.534 1.00 0.00 H HETATM 124 H47 UNL 1 2.783 1.627 -2.457 1.00 0.00 H HETATM 125 H48 UNL 1 4.376 0.200 -1.881 1.00 0.00 H HETATM 126 H49 UNL 1 5.376 3.488 -0.704 1.00 0.00 H HETATM 127 H50 UNL 1 5.730 3.029 0.938 1.00 0.00 H HETATM 128 H51 UNL 1 4.053 2.876 0.455 1.00 0.00 H HETATM 129 H52 UNL 1 6.877 2.428 -1.496 1.00 0.00 H HETATM 130 H53 UNL 1 5.764 1.462 -2.470 1.00 0.00 H HETATM 131 H54 UNL 1 7.941 0.453 -2.472 1.00 0.00 H HETATM 132 H55 UNL 1 6.683 -0.628 -1.808 1.00 0.00 H HETATM 133 H56 UNL 1 8.386 -0.957 -0.339 1.00 0.00 H HETATM 134 H57 UNL 1 10.082 -1.086 -0.565 1.00 0.00 H HETATM 135 H58 UNL 1 10.708 -1.858 -2.746 1.00 0.00 H HETATM 136 H59 UNL 1 13.264 0.908 -3.297 1.00 0.00 H HETATM 137 H60 UNL 1 11.329 -2.684 -0.676 1.00 0.00 H HETATM 138 H61 UNL 1 13.575 -3.059 -0.635 1.00 0.00 H HETATM 139 H62 UNL 1 12.459 -1.667 0.977 1.00 0.00 H HETATM 140 H63 UNL 1 13.974 0.219 0.386 1.00 0.00 H HETATM 141 H64 UNL 1 12.231 1.072 -0.192 1.00 0.00 H HETATM 142 H65 UNL 1 11.293 -0.404 2.047 1.00 0.00 H HETATM 143 H66 UNL 1 9.047 1.636 1.823 1.00 0.00 H HETATM 144 H67 UNL 1 8.132 2.684 0.711 1.00 0.00 H HETATM 145 H68 UNL 1 7.434 2.117 2.335 1.00 0.00 H HETATM 146 H69 UNL 1 7.718 -1.465 1.627 1.00 0.00 H HETATM 147 H70 UNL 1 8.888 -0.277 2.177 1.00 0.00 H HETATM 148 H71 UNL 1 7.303 -0.190 2.925 1.00 0.00 H HETATM 149 H72 UNL 1 5.684 1.197 1.763 1.00 0.00 H HETATM 150 H73 UNL 1 5.767 -1.113 2.031 1.00 0.00 H HETATM 151 H74 UNL 1 5.619 -1.355 0.212 1.00 0.00 H HETATM 152 H75 UNL 1 3.773 0.582 1.711 1.00 0.00 H HETATM 153 H76 UNL 1 3.558 -1.238 1.871 1.00 0.00 H HETATM 154 H77 UNL 1 4.551 -1.673 -1.469 1.00 0.00 H HETATM 155 H78 UNL 1 3.955 -2.482 0.087 1.00 0.00 H HETATM 156 H79 UNL 1 2.887 -2.203 -1.273 1.00 0.00 H HETATM 157 H80 UNL 1 0.046 0.437 1.602 1.00 0.00 H HETATM 158 H81 UNL 1 0.206 3.299 0.723 1.00 0.00 H HETATM 159 H82 UNL 1 -0.001 2.532 2.285 1.00 0.00 H CONECT 1 2 78 79 80 CONECT 2 3 4 77 CONECT 3 81 82 83 CONECT 4 5 84 85 CONECT 5 6 86 87 CONECT 6 7 41 76 CONECT 7 8 8 9 CONECT 9 10 CONECT 10 11 28 88 CONECT 11 12 CONECT 12 13 89 90 CONECT 13 14 15 91 CONECT 14 92 CONECT 15 16 28 93 CONECT 16 17 CONECT 17 18 26 94 CONECT 18 19 CONECT 19 20 22 95 CONECT 20 21 96 97 CONECT 21 98 CONECT 22 23 24 99 CONECT 23 100 CONECT 24 25 26 101 CONECT 25 102 CONECT 26 27 103 CONECT 27 104 CONECT 28 29 105 CONECT 29 30 CONECT 30 31 31 32 CONECT 32 33 106 107 CONECT 33 34 108 109 CONECT 34 35 35 40 CONECT 35 36 110 CONECT 36 37 37 111 CONECT 37 38 39 CONECT 38 112 CONECT 39 40 40 113 CONECT 40 114 CONECT 41 42 43 115 CONECT 42 116 CONECT 43 44 117 118 CONECT 44 45 46 74 CONECT 45 119 120 121 CONECT 46 47 47 76 CONECT 47 48 122 CONECT 48 49 123 124 CONECT 49 50 74 125 CONECT 50 51 52 71 CONECT 51 126 127 128 CONECT 52 53 129 130 CONECT 53 54 131 132 CONECT 54 55 68 133 CONECT 55 56 CONECT 56 57 66 134 CONECT 57 58 CONECT 58 59 62 135 CONECT 59 60 60 61 CONECT 61 136 CONECT 62 63 64 137 CONECT 63 138 CONECT 64 65 66 139 CONECT 65 140 CONECT 66 67 141 CONECT 67 142 CONECT 68 69 70 71 CONECT 69 143 144 145 CONECT 70 146 147 148 CONECT 71 72 149 CONECT 72 73 150 151 CONECT 73 74 152 153 CONECT 74 75 CONECT 75 154 155 156 CONECT 76 77 157 CONECT 77 158 159 END SMILES for HMDB0037923 (Tragopogonsaponin G)CC1(C)CCC2(C(O)CC3(C)C(=CCC4C5(C)CCC(OC6OC(C(O)C(O)C6O)C(O)=O)C(C)(C)C5CCC34C)C2C1)C(=O)OC1OCC(O)C(OC2OC(CO)C(O)C(O)C2O)C1OC(=O)CCC1=CC=C(O)C=C1 INCHI for HMDB0037923 (Tragopogonsaponin G)InChI=1S/C56H82O21/c1-51(2)20-21-56(50(70)77-49-45(74-36(61)15-10-26-8-11-27(58)12-9-26)43(30(59)25-71-49)75-47-41(66)38(63)37(62)31(24-57)72-47)29(22-51)28-13-14-33-53(5)18-17-35(73-48-42(67)39(64)40(65)44(76-48)46(68)69)52(3,4)32(53)16-19-54(33,6)55(28,7)23-34(56)60/h8-9,11-13,29-35,37-45,47-49,57-60,62-67H,10,14-25H2,1-7H3,(H,68,69) 3D Structure for HMDB0037923 (Tragopogonsaponin G) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C56H82O21 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1091.2377 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1090.534859686 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 3,4,5-trihydroxy-6-[(8-hydroxy-8a-{[(5-hydroxy-3-{[3-(4-hydroxyphenyl)propanoyl]oxy}-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]carbonyl}-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl)oxy]oxane-2-carboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 3,4,5-trihydroxy-6-[(8-hydroxy-8a-{[(5-hydroxy-3-{[3-(4-hydroxyphenyl)propanoyl]oxy}-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]carbonyl}-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]oxane-2-carboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 134361-69-6 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1(C)CCC2(C(O)CC3(C)C(=CCC4C5(C)CCC(OC6OC(C(O)C(O)C6O)C(O)=O)C(C)(C)C5CCC34C)C2C1)C(=O)OC1OCC(O)C(OC2OC(CO)C(O)C(O)C2O)C1OC(=O)CCC1=CC=C(O)C=C1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C56H82O21/c1-51(2)20-21-56(50(70)77-49-45(74-36(61)15-10-26-8-11-27(58)12-9-26)43(30(59)25-71-49)75-47-41(66)38(63)37(62)31(24-57)72-47)29(22-51)28-13-14-33-53(5)18-17-35(73-48-42(67)39(64)40(65)44(76-48)46(68)69)52(3,4)32(53)16-19-54(33,6)55(28,7)23-34(56)60/h8-9,11-13,29-35,37-45,47-49,57-60,62-67H,10,14-25H2,1-7H3,(H,68,69) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | GDOFBGFEZUPKAG-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Terpene glycosides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpene saponins | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB017080 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | C00040533 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 14827922 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|