Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 23:11:54 UTC

Update Date

2022-03-07 02:55:34 UTC

HMDB ID

HMDB0037933

Secondary Accession Numbers

HMDB37933

Metabolite Identification

Common Name

Calendoflavobioside

Description

Calendoflavobioside belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Calendoflavobioside has been detected, but not quantified in, a few different foods, such as corns (Zea mays), potatos (Solanum tuberosum), and soy beans (Glycine max). This could make calendoflavobioside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Calendoflavobioside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061310052D          

 43 47  0  0  0  0            999 V2000
    5.7158   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0  0  0  0
  8  1  1  0  0  0  0
  9  2  1  0  0  0  0
  9  4  2  0  0  0  0
 10  5  2  0  0  0  0
 10  6  1  0  0  0  0
 11  3  1  0  0  0  0
 12  4  1  0  0  0  0
 12 11  2  0  0  0  0
 13  5  1  0  0  0  0
 14  6  2  0  0  0  0
 15  7  1  0  0  0  0
 16 13  2  0  0  0  0
 16 14  1  0  0  0  0
 17  8  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 20  1  0  0  0  0
 23  9  1  0  0  0  0
 24 19  1  0  0  0  0
 24 23  2  0  0  0  0
 25 21  1  0  0  0  0
 26 22  1  0  0  0  0
 27 25  1  0  0  0  0
 28  7  1  0  0  0  0
 29 10  1  0  0  0  0
 30 11  1  0  0  0  0
 31 12  1  0  0  0  0
 32 13  1  0  0  0  0
 33 17  1  0  0  0  0
 34 18  1  0  0  0  0
 35 19  2  0  0  0  0
 36 20  1  0  0  0  0
 37 21  1  0  0  0  0
 38 22  1  0  0  0  0
 39  8  1  0  0  0  0
 39 26  1  0  0  0  0
 40 14  1  0  0  0  0
 40 23  1  0  0  0  0
 41 15  1  0  0  0  0
 41 27  1  0  0  0  0
 42 24  1  0  0  0  0
 42 27  1  0  0  0  0
 43 25  1  0  0  0  0
 43 26  1  0  0  0  0
M  END

HMDB0037933
     RDKit          3D
Calendoflavobioside
 73 77  0  0  0  0  0  0  0  0999 V2000
    3.0612    2.6666    0.8310 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1864    1.9094    2.1593 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1730    0.9875    2.1869 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6146   -0.1576    1.4757 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5274   -0.9178    1.0585 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4392   -1.0580   -0.2959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1871   -0.6874   -0.9785 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2848    0.6030   -0.6320 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6106    0.9576   -0.9261 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6405    0.8231   -0.0955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5313    0.3027    1.2468 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3642    0.2304    1.9332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3518   -0.3550    3.2122 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4797   -0.8593    3.8023 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3905   -1.4234    5.0693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6660   -0.7849    3.1075 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8060   -1.2962    3.7098 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6828   -0.2126    1.8526 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8961    1.1802   -0.4811 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1286    1.6610   -1.6544 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4462    1.9924   -1.9438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7082    2.5099   -3.2006 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0313    2.8392   -3.4821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6969    2.6823   -4.1121 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614    2.3470   -3.8206 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4012    2.5363   -4.7538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1053    1.8298   -2.5619 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8323    1.4815   -2.2127 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8403    1.5928   -2.9529 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5603   -0.5463   -2.3674 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8504   -1.7612   -2.9290 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3144   -2.6781   -3.1083 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3037   -2.1232   -3.9382 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9340   -2.5140   -2.1915 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0178   -3.8025   -2.6695 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7266   -2.5223   -0.7111 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8495   -3.0239   -0.0979 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4877   -0.8774    2.4439 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7920   -0.9684    3.6741 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7106   -0.0300    2.6878 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7458   -0.6009    1.9087 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5500    1.4028    2.3753 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1961    2.1385    3.3977 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5053    3.6639    1.0016 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6467    2.1723    0.0299 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9862    2.7687    0.5736 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9408    2.6812    2.9474 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2293    0.1781    0.6059 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3058   -0.4931   -0.7366 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5980   -1.4342   -0.9190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4532    0.6450    1.5424 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3869   -0.3848    3.7106 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5215   -1.4675    5.5558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6692   -1.2335    3.1856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6356   -0.1696    1.3296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2276    1.8475   -1.2086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4093    3.7733   -3.2879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8990    3.0812   -5.0810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4509    2.4113   -4.8479 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2627   -1.5516   -3.9445 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0646   -3.5713   -3.6817 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7861   -3.0203   -2.1812 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2045   -2.5057   -3.6942 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8930   -1.9669   -2.4197 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2121   -4.4206   -1.9260 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7949   -3.0729   -0.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5609   -3.6589    0.6078 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7914   -1.8870    2.1826 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4218   -1.0228    4.4378 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0215   -0.2064    3.7391 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2294   -1.2996    2.4168 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1600    1.6404    1.4531 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4796    3.0305    3.0689 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
  7 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
  4 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 42 43  1  0
 42  2  1  0
 36  6  1  0
 28  9  1  0
 18 11  1  0
 27 20  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  2 47  1  0
  4 48  1  0
  6 49  1  0
  7 50  1  0
 12 51  1  0
 13 52  1  0
 15 53  1  0
 17 54  1  0
 18 55  1  0
 21 56  1  0
 23 57  1  0
 24 58  1  0
 26 59  1  0
 31 60  1  0
 32 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
 42 72  1  0
 43 73  1  0
M  END

  Mrv0541 05061310052D          

 43 47  0  0  0  0            999 V2000
    5.7158   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0  0  0  0
  8  1  1  0  0  0  0
  9  2  1  0  0  0  0
  9  4  2  0  0  0  0
 10  5  2  0  0  0  0
 10  6  1  0  0  0  0
 11  3  1  0  0  0  0
 12  4  1  0  0  0  0
 12 11  2  0  0  0  0
 13  5  1  0  0  0  0
 14  6  2  0  0  0  0
 15  7  1  0  0  0  0
 16 13  2  0  0  0  0
 16 14  1  0  0  0  0
 17  8  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 20  1  0  0  0  0
 23  9  1  0  0  0  0
 24 19  1  0  0  0  0
 24 23  2  0  0  0  0
 25 21  1  0  0  0  0
 26 22  1  0  0  0  0
 27 25  1  0  0  0  0
 28  7  1  0  0  0  0
 29 10  1  0  0  0  0
 30 11  1  0  0  0  0
 31 12  1  0  0  0  0
 32 13  1  0  0  0  0
 33 17  1  0  0  0  0
 34 18  1  0  0  0  0
 35 19  2  0  0  0  0
 36 20  1  0  0  0  0
 37 21  1  0  0  0  0
 38 22  1  0  0  0  0
 39  8  1  0  0  0  0
 39 26  1  0  0  0  0
 40 14  1  0  0  0  0
 40 23  1  0  0  0  0
 41 15  1  0  0  0  0
 41 27  1  0  0  0  0
 42 24  1  0  0  0  0
 42 27  1  0  0  0  0
 43 25  1  0  0  0  0
 43 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037933

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c1-8-17(33)20(36)22(38)26(39-8)43-25-21(37)18(34)15(7-28)41-27(25)42-24-19(35)16-13(32)5-10(29)6-14(16)40-23(24)9-2-3-11(30)12(31)4-9/h2-6,8,15,17-18,20-22,25-34,36-38H,7H2,1H3

> <INCHI_KEY>
FYBMGZSDYDNBFX-UHFFFAOYSA-N

> <FORMULA>
C27H30O16

> <MOLECULAR_WEIGHT>
610.5175

> <EXACT_MASS>
610.153384912

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
57.817623793900545

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one

> <ALOGPS_LOGP>
0.15

> <JCHEM_LOGP>
-0.8687609749999999

> <ALOGPS_LOGS>
-2.11

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.451120914145177

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.43396050247307

> <JCHEM_PKA_STRONGEST_BASIC>
-3.648692248957399

> <JCHEM_POLAR_SURFACE_AREA>
265.52

> <JCHEM_REFRACTIVITY>
140.14509999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
4.78e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037933
     RDKit          3D
Calendoflavobioside
 73 77  0  0  0  0  0  0  0  0999 V2000
    3.0612    2.6666    0.8310 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1864    1.9094    2.1593 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1730    0.9875    2.1869 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6146   -0.1576    1.4757 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5274   -0.9178    1.0585 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4392   -1.0580   -0.2959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1871   -0.6874   -0.9785 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2848    0.6030   -0.6320 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6106    0.9576   -0.9261 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6405    0.8231   -0.0955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5313    0.3027    1.2468 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3642    0.2304    1.9332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3518   -0.3550    3.2122 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4797   -0.8593    3.8023 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3905   -1.4234    5.0693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6660   -0.7849    3.1075 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8060   -1.2962    3.7098 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6828   -0.2126    1.8526 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8961    1.1802   -0.4811 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1286    1.6610   -1.6544 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4462    1.9924   -1.9438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7082    2.5099   -3.2006 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0313    2.8392   -3.4821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6969    2.6823   -4.1121 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614    2.3470   -3.8206 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4012    2.5363   -4.7538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1053    1.8298   -2.5619 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8323    1.4815   -2.2127 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8403    1.5928   -2.9529 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5603   -0.5463   -2.3674 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8504   -1.7612   -2.9290 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3144   -2.6781   -3.1083 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3037   -2.1232   -3.9382 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9340   -2.5140   -2.1915 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0178   -3.8025   -2.6695 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7266   -2.5223   -0.7111 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8495   -3.0239   -0.0979 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4877   -0.8774    2.4439 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7920   -0.9684    3.6741 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7106   -0.0300    2.6878 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7458   -0.6009    1.9087 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5500    1.4028    2.3753 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1961    2.1385    3.3977 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5053    3.6639    1.0016 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6467    2.1723    0.0299 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9862    2.7687    0.5736 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9408    2.6812    2.9474 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2293    0.1781    0.6059 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3058   -0.4931   -0.7366 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5980   -1.4342   -0.9190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4532    0.6450    1.5424 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3869   -0.3848    3.7106 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5215   -1.4675    5.5558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6692   -1.2335    3.1856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6356   -0.1696    1.3296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2276    1.8475   -1.2086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4093    3.7733   -3.2879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8990    3.0812   -5.0810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4509    2.4113   -4.8479 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2627   -1.5516   -3.9445 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0646   -3.5713   -3.6817 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7861   -3.0203   -2.1812 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2045   -2.5057   -3.6942 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8930   -1.9669   -2.4197 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2121   -4.4206   -1.9260 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7949   -3.0729   -0.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5609   -3.6589    0.6078 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7914   -1.8870    2.1826 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4218   -1.0228    4.4378 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0215   -0.2064    3.7391 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2294   -1.2996    2.4168 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1600    1.6404    1.4531 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4796    3.0305    3.0689 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
  7 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
  4 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 42 43  1  0
 42  2  1  0
 36  6  1  0
 28  9  1  0
 18 11  1  0
 27 20  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  2 47  1  0
  4 48  1  0
  6 49  1  0
  7 50  1  0
 12 51  1  0
 13 52  1  0
 15 53  1  0
 17 54  1  0
 18 55  1  0
 21 56  1  0
 23 57  1  0
 24 58  1  0
 26 59  1  0
 31 60  1  0
 32 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
 42 72  1  0
 43 73  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      10.669  -9.240   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       2.667  -7.700   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      10.669  -7.700   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       4.001  -6.930   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      12.003  -6.930   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       5.335  -7.700   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      12.003  -5.390   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       6.668  -6.930   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      10.669  -4.620   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       9.336  -5.390   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0       1.334  -6.930   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      13.337  -7.700   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       5.335  -9.240   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      13.337  -4.620   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       8.002  -7.700   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      10.669  -3.080   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       9.336  -6.930   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       4.001  -5.390   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       8.002  -4.620   0.000  0.00  0.00           O+0
CONECT    1    8                                                            
CONECT    2    3    9                                                       
CONECT    3    2   11                                                       
CONECT    4    9   12                                                       
CONECT    5   10   13                                                       
CONECT    6   10   14                                                       
CONECT    7   15   28                                                       
CONECT    8    1   17   39                                                  
CONECT    9    2    4   23                                                  
CONECT   10    5    6   29                                                  
CONECT   11    3   12   30                                                  
CONECT   12    4   11   31                                                  
CONECT   13    5   16   32                                                  
CONECT   14    6   16   40                                                  
CONECT   15    7   18   41                                                  
CONECT   16   13   14   19                                                  
CONECT   17    8   20   33                                                  
CONECT   18   15   21   34                                                  
CONECT   19   16   24   35                                                  
CONECT   20   17   22   36                                                  
CONECT   21   18   25   37                                                  
CONECT   22   20   26   38                                                  
CONECT   23    9   24   40                                                  
CONECT   24   19   23   42                                                  
CONECT   25   21   27   43                                                  
CONECT   26   22   39   43                                                  
CONECT   27   25   41   42                                                  
CONECT   28    7                                                            
CONECT   29   10                                                            
CONECT   30   11                                                            
CONECT   31   12                                                            
CONECT   32   13                                                            
CONECT   33   17                                                            
CONECT   34   18                                                            
CONECT   35   19                                                            
CONECT   36   20                                                            
CONECT   37   21                                                            
CONECT   38   22                                                            
CONECT   39    8   26                                                       
CONECT   40   14   23                                                       
CONECT   41   15   27                                                       
CONECT   42   24   27                                                       
CONECT   43   25   26                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0037933
HETATM    1  C1  UNL     1       3.061   2.667   0.831  1.00  0.00           C  
HETATM    2  C2  UNL     1       3.186   1.909   2.159  1.00  0.00           C  
HETATM    3  O1  UNL     1       2.173   0.987   2.187  1.00  0.00           O  
HETATM    4  C3  UNL     1       2.615  -0.158   1.476  1.00  0.00           C  
HETATM    5  O2  UNL     1       1.527  -0.918   1.058  1.00  0.00           O  
HETATM    6  C4  UNL     1       1.439  -1.058  -0.296  1.00  0.00           C  
HETATM    7  C5  UNL     1       0.187  -0.687  -0.979  1.00  0.00           C  
HETATM    8  O3  UNL     1      -0.285   0.603  -0.632  1.00  0.00           O  
HETATM    9  C6  UNL     1      -1.611   0.958  -0.926  1.00  0.00           C  
HETATM   10  C7  UNL     1      -2.641   0.823  -0.096  1.00  0.00           C  
HETATM   11  C8  UNL     1      -2.531   0.303   1.247  1.00  0.00           C  
HETATM   12  C9  UNL     1      -1.364   0.230   1.933  1.00  0.00           C  
HETATM   13  C10 UNL     1      -1.352  -0.355   3.212  1.00  0.00           C  
HETATM   14  C11 UNL     1      -2.480  -0.859   3.802  1.00  0.00           C  
HETATM   15  O4  UNL     1      -2.391  -1.423   5.069  1.00  0.00           O  
HETATM   16  C12 UNL     1      -3.666  -0.785   3.107  1.00  0.00           C  
HETATM   17  O5  UNL     1      -4.806  -1.296   3.710  1.00  0.00           O  
HETATM   18  C13 UNL     1      -3.683  -0.213   1.853  1.00  0.00           C  
HETATM   19  O6  UNL     1      -3.896   1.180  -0.481  1.00  0.00           O  
HETATM   20  C14 UNL     1      -4.129   1.661  -1.654  1.00  0.00           C  
HETATM   21  C15 UNL     1      -5.446   1.992  -1.944  1.00  0.00           C  
HETATM   22  C16 UNL     1      -5.708   2.510  -3.201  1.00  0.00           C  
HETATM   23  O7  UNL     1      -7.031   2.839  -3.482  1.00  0.00           O  
HETATM   24  C17 UNL     1      -4.697   2.682  -4.112  1.00  0.00           C  
HETATM   25  C18 UNL     1      -3.361   2.347  -3.821  1.00  0.00           C  
HETATM   26  O8  UNL     1      -2.401   2.536  -4.754  1.00  0.00           O  
HETATM   27  C19 UNL     1      -3.105   1.830  -2.562  1.00  0.00           C  
HETATM   28  C20 UNL     1      -1.832   1.481  -2.213  1.00  0.00           C  
HETATM   29  O9  UNL     1      -0.840   1.593  -2.953  1.00  0.00           O  
HETATM   30  O10 UNL     1       0.560  -0.546  -2.367  1.00  0.00           O  
HETATM   31  C21 UNL     1       0.850  -1.761  -2.929  1.00  0.00           C  
HETATM   32  C22 UNL     1      -0.314  -2.678  -3.108  1.00  0.00           C  
HETATM   33  O11 UNL     1      -1.304  -2.123  -3.938  1.00  0.00           O  
HETATM   34  C23 UNL     1       1.934  -2.514  -2.192  1.00  0.00           C  
HETATM   35  O12 UNL     1       2.018  -3.802  -2.669  1.00  0.00           O  
HETATM   36  C24 UNL     1       1.727  -2.522  -0.711  1.00  0.00           C  
HETATM   37  O13 UNL     1       2.850  -3.024  -0.098  1.00  0.00           O  
HETATM   38  C25 UNL     1       3.488  -0.877   2.444  1.00  0.00           C  
HETATM   39  O14 UNL     1       2.792  -0.968   3.674  1.00  0.00           O  
HETATM   40  C26 UNL     1       4.711  -0.030   2.688  1.00  0.00           C  
HETATM   41  O15 UNL     1       5.746  -0.601   1.909  1.00  0.00           O  
HETATM   42  C27 UNL     1       4.550   1.403   2.375  1.00  0.00           C  
HETATM   43  O16 UNL     1       5.196   2.138   3.398  1.00  0.00           O  
HETATM   44  H1  UNL     1       3.505   3.664   1.002  1.00  0.00           H  
HETATM   45  H2  UNL     1       3.647   2.172   0.030  1.00  0.00           H  
HETATM   46  H3  UNL     1       1.986   2.769   0.574  1.00  0.00           H  
HETATM   47  H4  UNL     1       2.941   2.681   2.947  1.00  0.00           H  
HETATM   48  H5  UNL     1       3.229   0.178   0.606  1.00  0.00           H  
HETATM   49  H6  UNL     1       2.306  -0.493  -0.737  1.00  0.00           H  
HETATM   50  H7  UNL     1      -0.598  -1.434  -0.919  1.00  0.00           H  
HETATM   51  H8  UNL     1      -0.453   0.645   1.542  1.00  0.00           H  
HETATM   52  H9  UNL     1      -0.387  -0.385   3.711  1.00  0.00           H  
HETATM   53  H10 UNL     1      -1.522  -1.467   5.556  1.00  0.00           H  
HETATM   54  H11 UNL     1      -5.669  -1.234   3.186  1.00  0.00           H  
HETATM   55  H12 UNL     1      -4.636  -0.170   1.330  1.00  0.00           H  
HETATM   56  H13 UNL     1      -6.228   1.847  -1.209  1.00  0.00           H  
HETATM   57  H14 UNL     1      -7.409   3.773  -3.288  1.00  0.00           H  
HETATM   58  H15 UNL     1      -4.899   3.081  -5.081  1.00  0.00           H  
HETATM   59  H16 UNL     1      -1.451   2.411  -4.848  1.00  0.00           H  
HETATM   60  H17 UNL     1       1.263  -1.552  -3.945  1.00  0.00           H  
HETATM   61  H18 UNL     1       0.065  -3.571  -3.682  1.00  0.00           H  
HETATM   62  H19 UNL     1      -0.786  -3.020  -2.181  1.00  0.00           H  
HETATM   63  H20 UNL     1      -2.204  -2.506  -3.694  1.00  0.00           H  
HETATM   64  H21 UNL     1       2.893  -1.967  -2.420  1.00  0.00           H  
HETATM   65  H22 UNL     1       2.212  -4.421  -1.926  1.00  0.00           H  
HETATM   66  H23 UNL     1       0.795  -3.073  -0.476  1.00  0.00           H  
HETATM   67  H24 UNL     1       2.561  -3.659   0.608  1.00  0.00           H  
HETATM   68  H25 UNL     1       3.791  -1.887   2.183  1.00  0.00           H  
HETATM   69  H26 UNL     1       3.422  -1.023   4.438  1.00  0.00           H  
HETATM   70  H27 UNL     1       5.021  -0.206   3.739  1.00  0.00           H  
HETATM   71  H28 UNL     1       6.229  -1.300   2.417  1.00  0.00           H  
HETATM   72  H29 UNL     1       5.160   1.640   1.453  1.00  0.00           H  
HETATM   73  H30 UNL     1       5.480   3.031   3.069  1.00  0.00           H  
CONECT    1    2   44   45   46
CONECT    2    3   42   47
CONECT    3    4
CONECT    4    5   38   48
CONECT    5    6
CONECT    6    7   36   49
CONECT    7    8   30   50
CONECT    8    9
CONECT    9   10   10   28
CONECT   10   11   19
CONECT   11   12   12   18
CONECT   12   13   51
CONECT   13   14   14   52
CONECT   14   15   16
CONECT   15   53
CONECT   16   17   18   18
CONECT   17   54
CONECT   18   55
CONECT   19   20
CONECT   20   21   21   27
CONECT   21   22   56
CONECT   22   23   24   24
CONECT   23   57
CONECT   24   25   58
CONECT   25   26   27   27
CONECT   26   59
CONECT   27   28
CONECT   28   29   29
CONECT   30   31
CONECT   31   32   34   60
CONECT   32   33   61   62
CONECT   33   63
CONECT   34   35   36   64
CONECT   35   65
CONECT   36   37   66
CONECT   37   67
CONECT   38   39   40   68
CONECT   39   69
CONECT   40   41   42   70
CONECT   41   71
CONECT   42   43   72
CONECT   43   73
END

HMDB0037933
     RDKit          3D
Calendoflavobioside
 73 77  0  0  0  0  0  0  0  0999 V2000
    3.0612    2.6666    0.8310 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1864    1.9094    2.1593 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1730    0.9875    2.1869 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6146   -0.1576    1.4757 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5274   -0.9178    1.0585 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4392   -1.0580   -0.2959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1871   -0.6874   -0.9785 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2848    0.6030   -0.6320 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6106    0.9576   -0.9261 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6405    0.8231   -0.0955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5313    0.3027    1.2468 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3642    0.2304    1.9332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3518   -0.3550    3.2122 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4797   -0.8593    3.8023 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3905   -1.4234    5.0693 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6660   -0.7849    3.1075 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8060   -1.2962    3.7098 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6828   -0.2126    1.8526 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8961    1.1802   -0.4811 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1286    1.6610   -1.6544 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4462    1.9924   -1.9438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7082    2.5099   -3.2006 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0313    2.8392   -3.4821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6969    2.6823   -4.1121 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3614    2.3470   -3.8206 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4012    2.5363   -4.7538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1053    1.8298   -2.5619 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8323    1.4815   -2.2127 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8403    1.5928   -2.9529 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5603   -0.5463   -2.3674 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8504   -1.7612   -2.9290 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3144   -2.6781   -3.1083 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3037   -2.1232   -3.9382 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9340   -2.5140   -2.1915 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0178   -3.8025   -2.6695 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7266   -2.5223   -0.7111 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8495   -3.0239   -0.0979 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4877   -0.8774    2.4439 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7920   -0.9684    3.6741 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7106   -0.0300    2.6878 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7458   -0.6009    1.9087 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5500    1.4028    2.3753 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1961    2.1385    3.3977 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5053    3.6639    1.0016 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6467    2.1723    0.0299 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9862    2.7687    0.5736 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9408    2.6812    2.9474 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2293    0.1781    0.6059 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3058   -0.4931   -0.7366 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5980   -1.4342   -0.9190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4532    0.6450    1.5424 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3869   -0.3848    3.7106 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5215   -1.4675    5.5558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6692   -1.2335    3.1856 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6356   -0.1696    1.3296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2276    1.8475   -1.2086 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4093    3.7733   -3.2879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8990    3.0812   -5.0810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4509    2.4113   -4.8479 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2627   -1.5516   -3.9445 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0646   -3.5713   -3.6817 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7861   -3.0203   -2.1812 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2045   -2.5057   -3.6942 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8930   -1.9669   -2.4197 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2121   -4.4206   -1.9260 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7949   -3.0729   -0.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5609   -3.6589    0.6078 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7914   -1.8870    2.1826 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4218   -1.0228    4.4378 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0215   -0.2064    3.7391 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2294   -1.2996    2.4168 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1600    1.6404    1.4531 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4796    3.0305    3.0689 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
  7 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
  4 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40 42  1  0
 42 43  1  0
 42  2  1  0
 36  6  1  0
 28  9  1  0
 18 11  1  0
 27 20  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  2 47  1  0
  4 48  1  0
  6 49  1  0
  7 50  1  0
 12 51  1  0
 13 52  1  0
 15 53  1  0
 17 54  1  0
 18 55  1  0
 21 56  1  0
 23 57  1  0
 24 58  1  0
 26 59  1  0
 31 60  1  0
 32 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
 42 72  1  0
 43 73  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Q-Rha-gal	HMDB
Quercetin 3-neohesperidoside	HMDB

Chemical Formula

C₂₇H₃₀O₁₆

Average Molecular Weight

610.5175

Monoisotopic Molecular Weight

610.153384912

IUPAC Name

3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one

Traditional Name

3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one

CAS Registry Number

32453-36-4

SMILES

CC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O16/c1-8-17(33)20(36)22(38)26(39-8)43-25-21(37)18(34)15(7-28)41-27(25)42-24-19(35)16-13(32)5-10(29)6-14(16)40-23(24)9-2-3-11(30)12(31)4-9/h2-6,8,15,17-18,20-22,25-34,36-38H,7H2,1H3

InChI Key

FYBMGZSDYDNBFX-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-3-O-glycosides

Alternative Parents

Substituents

Flavonoid-3-o-glycoside
Hydroxyflavonoid
Flavone
3'-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
O-glycosyl compound
Glycosyl compound
Disaccharide
Chromone
1-benzopyran
Benzopyran
Catechol
1-hydroxy-2-unsubstituted benzenoid
Phenol
1-hydroxy-4-unsubstituted benzenoid
Pyranone
Monocyclic benzene moiety
Benzenoid
Pyran
Oxane
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Organoheterocyclic compound
Oxacycle
Acetal
Polyol
Organic oxide
Organic oxygen compound
Alcohol
Hydrocarbon derivative
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	28700 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	4.78 g/L	ALOGPS
logP	0.15	ALOGPS
logP	-0.87	ChemAxon
logS	-2.1	ALOGPS
pKa (Strongest Acidic)	6.43	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	265.52 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	140.15 m³·mol⁻¹	ChemAxon
Polarizability	57.82 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	229.696	30932474
DeepCCS	[M-H]-	227.757	30932474
DeepCCS	[M-2H]-	260.997	30932474
DeepCCS	[M+Na]+	235.564	30932474
AllCCS	[M+H]+	231.8	32859911
AllCCS	[M+H-H2O]+	230.5	32859911
AllCCS	[M+NH4]+	232.9	32859911
AllCCS	[M+Na]+	233.2	32859911
AllCCS	[M-H]-	228.2	32859911
AllCCS	[M+Na-2H]-	230.3	32859911
AllCCS	[M+HCOO]-	232.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Calendoflavobioside	CC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O	5911.5	Standard polar	33892256
Calendoflavobioside	CC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O	5270.9	Standard non polar	33892256
Calendoflavobioside	CC1OC(OC2C(O)C(O)C(CO)OC2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O	5617.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Calendoflavobioside,1TMS,isomer #1	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5532.1	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #10	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5523.2	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #2	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5523.0	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #3	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5497.9	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #4	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5566.7	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #5	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5549.4	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #6	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5558.2	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #7	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5567.6	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #8	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5518.2	Semi standard non polar	33892256
Calendoflavobioside,1TMS,isomer #9	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5514.3	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #1	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5433.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #10	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5426.8	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #11	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5411.8	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #12	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5451.3	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #13	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5438.3	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #14	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5448.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #15	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5416.7	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #16	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5407.0	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #17	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5424.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #18	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5431.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #19	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5414.1	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #2	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5417.0	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #20	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5445.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #21	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5435.1	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #22	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5416.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #23	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5408.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #24	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5420.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #25	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5449.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #26	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5435.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #27	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5435.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #28	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5448.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #29	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5427.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #3	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5458.0	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #30	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5453.8	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #31	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5434.2	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #32	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5418.1	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #33	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5429.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #34	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5409.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #35	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5441.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #36	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5423.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #37	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5405.2	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #38	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5381.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #39	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5414.9	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #4	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5441.7	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #40	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5421.8	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #41	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5400.2	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #42	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5431.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #43	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5424.3	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #44	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5418.2	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #45	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5438.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #5	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5436.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #6	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5449.6	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #7	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5436.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #8	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5417.5	Semi standard non polar	33892256
Calendoflavobioside,2TMS,isomer #9	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5432.9	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #1	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5286.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #10	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5225.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #100	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5313.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #101	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5279.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #102	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5252.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #103	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5208.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #104	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5272.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #105	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5227.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #106	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5177.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #107	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5247.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #108	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5270.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #109	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5278.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #11	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5257.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #110	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5277.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #111	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5274.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #112	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5238.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #113	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5298.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #114	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5228.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #115	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5233.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #116	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5229.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #117	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5253.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #118	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5258.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #119	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5255.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #12	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5270.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #120	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5296.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #13	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5232.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #14	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5194.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #15	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5252.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #16	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5300.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #17	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5331.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #18	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5340.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #19	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5317.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #2	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5282.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #20	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5286.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #21	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5334.2	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #22	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5313.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #23	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5310.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #24	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5276.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #25	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5247.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #26	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5303.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #27	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5391.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #28	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5317.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #29	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5294.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #3	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5252.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #30	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5327.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #31	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5301.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #32	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5283.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #33	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5317.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #34	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5287.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #35	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5295.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #36	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5292.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #37	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5290.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #38	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5291.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #39	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5258.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #4	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5280.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #40	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5318.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #41	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5255.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #42	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5225.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #43	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5282.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #44	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5268.2	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #45	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5232.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #46	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5301.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #47	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5230.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #48	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5199.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #49	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5256.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #5	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5291.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #50	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5303.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #51	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5366.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #52	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5312.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #53	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5286.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #54	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5334.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #55	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5351.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #56	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5273.2	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #57	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5247.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #58	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5303.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #59	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5357.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #6	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5257.2	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #60	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5337.9	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #61	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5366.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #62	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5284.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #63	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5288.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #64	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5288.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #65	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5291.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #66	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5302.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #67	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5272.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #68	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5271.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #69	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5242.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #7	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5220.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #70	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5291.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #71	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5283.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #72	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5248.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #73	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5248.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #74	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5217.4	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #75	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5269.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #76	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5310.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #77	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5322.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #78	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5296.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #79	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5339.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #8	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5276.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #80	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5289.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #81	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5264.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #82	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5312.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #83	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5304.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #84	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5307.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #85	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5310.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #86	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5314.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #87	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5274.9	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #88	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5290.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #89	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5247.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #9	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5259.7	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #90	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5304.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #91	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5252.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #92	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5266.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #93	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5219.5	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #94	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5281.6	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #95	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5296.1	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #96	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5259.3	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #97	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5315.8	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #98	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5309.0	Semi standard non polar	33892256
Calendoflavobioside,3TMS,isomer #99	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5313.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #1	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5146.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #10	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5133.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #100	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5149.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #101	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5107.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #102	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5172.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #103	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5070.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #104	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5090.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #105	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5087.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #106	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5072.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #107	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5154.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #108	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5089.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #109	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5040.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #11	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5103.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #110	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5113.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #111	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5125.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #112	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5051.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #113	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	4998.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #114	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5076.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #115	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5135.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #116	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5093.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #117	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5159.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #118	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5049.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #119	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5067.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #12	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5057.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #120	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5066.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #121	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5196.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #122	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5134.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #123	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5094.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #124	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5162.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #125	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5218.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #126	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5188.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #127	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5239.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #128	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5139.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #129	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5161.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #13	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5125.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #130	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5155.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #131	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5184.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #132	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5154.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #133	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5208.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #134	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5095.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #135	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5117.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #136	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5113.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #137	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5193.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #138	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5214.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #139	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5212.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #14	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5110.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #140	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5146.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #141	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5173.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #142	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5136.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #143	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5143.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #144	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5103.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #145	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5166.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #146	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5131.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #147	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5142.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #148	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5089.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #149	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5161.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #15	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5097.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #150	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5106.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #151	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5053.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #152	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5129.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #153	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5102.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #154	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5124.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #155	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5123.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #156	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5111.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #157	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5126.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #158	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5067.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #159	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5144.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #16	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5067.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #160	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5085.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #161	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5028.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #162	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5110.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #163	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5085.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #164	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5106.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #165	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5105.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #166	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5159.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #167	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5124.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #168	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5185.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #169	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5165.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #17	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5017.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #170	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5187.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #171	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5182.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #172	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5128.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #173	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5151.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #174	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5148.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #175	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5183.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #176	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5141.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #177	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5162.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #178	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5105.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #179	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5178.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #18	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5091.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #180	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5096.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #181	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5035.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #182	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5119.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #183	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5099.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #184	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5118.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #185	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5110.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #186	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5073.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #187	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5010.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #188	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5095.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #189	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5082.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #19	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5178.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #190	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5097.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #191	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5090.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #192	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5125.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #193	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5139.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #194	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5135.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #195	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5168.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #196	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5121.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #197	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5063.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #198	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5142.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #199	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5064.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #2	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5106.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #20	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5121.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #200	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5081.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #201	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5075.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #202	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5044.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #203	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5059.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #204	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5053.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #205	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5129.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #206	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5108.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #207	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5126.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #208	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5123.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #209	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5094.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #21	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5077.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #210	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5108.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #22	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5142.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #23	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5097.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #24	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5057.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #25	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5121.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #26	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5063.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #27	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5085.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #28	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5079.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #29	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5060.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #3	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5152.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #30	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5124.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #31	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5117.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #32	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5085.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #33	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5033.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #34	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5106.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #35	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5092.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #36	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5077.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #37	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5046.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #38	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4989.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #39	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5069.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #4	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5142.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #40	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5170.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #41	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5105.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #42	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5061.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #43	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5128.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #44	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5082.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #45	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5039.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #46	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5107.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #47	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5044.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #48	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5064.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #49	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5059.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #5	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5119.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #50	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5173.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #51	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5163.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #52	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5135.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #53	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5090.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #54	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5159.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #55	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5254.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #56	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5191.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #57	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5159.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #58	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5211.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #59	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5169.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #6	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5075.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #60	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5136.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #61	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5191.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #62	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5142.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #63	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5161.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #64	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5153.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #65	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5228.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #66	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5156.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #67	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5123.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #68	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5178.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #69	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5130.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #7	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5137.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #70	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5098.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #71	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5155.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #72	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5099.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #73	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5120.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #74	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5114.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #75	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5237.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #76	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5210.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #77	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5257.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #78	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5165.2	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #79	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5189.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #8	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5083.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #80	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5185.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #81	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5127.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #82	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5149.9	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #83	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5139.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #84	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5146.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #85	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5154.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #86	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5114.1	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #87	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5177.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #88	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5119.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #89	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5082.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #9	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5139.0	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #90	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5142.3	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #91	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5095.6	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #92	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5168.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #93	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5109.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #94	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5063.8	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #95	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5133.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #96	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5141.4	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #97	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5072.7	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #98	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5025.5	Semi standard non polar	33892256
Calendoflavobioside,4TMS,isomer #99	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5098.2	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #1	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5754.6	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #10	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5756.5	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #2	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5748.9	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #3	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5697.2	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #4	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5741.8	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #5	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5722.4	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #6	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5727.6	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #7	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5741.0	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #8	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5741.8	Semi standard non polar	33892256
Calendoflavobioside,1TBDMS,isomer #9	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5739.1	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #1	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5788.4	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #10	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5788.1	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #11	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5757.9	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #12	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5809.9	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #13	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5786.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #14	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5807.5	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #15	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5760.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #16	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5755.7	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #17	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5795.3	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #18	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5788.7	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #19	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5760.8	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #2	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5760.0	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #20	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5809.3	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #21	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5783.8	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #22	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5766.9	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #23	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5756.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #24	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5791.0	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #25	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5805.3	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #26	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5778.1	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #27	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5786.4	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #28	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5782.9	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #29	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5773.3	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #3	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5813.6	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #30	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5819.5	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #31	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5782.3	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #32	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5754.7	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #33	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5763.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #34	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5751.6	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #35	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5798.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #36	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O	5771.8	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #37	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5724.6	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #38	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5713.6	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #39	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5766.4	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #4	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5787.9	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #40	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5752.9	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #41	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5745.1	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #42	CC1OC(OC2C(OC3=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5794.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #43	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5760.8	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #44	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5771.6	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #45	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5786.8	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #5	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5805.1	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #6	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5806.2	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #7	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5768.8	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #8	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5762.5	Semi standard non polar	33892256
Calendoflavobioside,2TBDMS,isomer #9	CC1OC(OC2C(OC3=C(C4=CC=C(O)C(O)=C4)OC4=CC(O)=CC(O)=C4C3=O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5802.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (1 TMS) - 70eV, Positive	splash10-00xr-9402007000-07c0430b8a07ad607696	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0kfy-8411090000-e0c7acf063fce22fd50d	2017-11-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Calendoflavobioside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 10V, Positive-QTOF	splash10-0udj-0329722000-1a04866d8d444e4bbe22	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 20V, Positive-QTOF	splash10-0udi-0239400000-4d279ed513c6c3ac5b1d	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 40V, Positive-QTOF	splash10-0udr-1936100000-3573e9809d4831109633	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 10V, Negative-QTOF	splash10-0r01-2519635000-08f6e4e3e4a2ad4e54f1	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 20V, Negative-QTOF	splash10-0w2a-2829310000-0deb4d201dc78bc35683	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 40V, Negative-QTOF	splash10-0udi-5925000000-046844795b55dd89bef0	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 10V, Negative-QTOF	splash10-0a4i-0000009000-46fcfcc5d755a35fcf8f	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 20V, Negative-QTOF	splash10-0pb9-0005009000-a5c1c8ec4d0bab88976a	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 40V, Negative-QTOF	splash10-0udi-0019001000-b9d00ee4f120c75adebc	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 10V, Positive-QTOF	splash10-0udi-0009002000-7a6fa616aa3e23b89d44	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 20V, Positive-QTOF	splash10-0ik9-0009009000-0f587058245221a67239	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Calendoflavobioside 40V, Positive-QTOF	splash10-0udi-0009000000-58b2754f892c40f07699	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB017096

KNApSAcK ID

C00005412

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

14034827

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1864331

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Calendoflavobioside (HMDB0037933)

MOL for HMDB0037933 (Calendoflavobioside)

3D MOL for HMDB0037933 (Calendoflavobioside)

3D SDF for HMDB0037933 (Calendoflavobioside)

3D-SDF for HMDB0037933 (Calendoflavobioside)

PDB for HMDB0037933 (Calendoflavobioside)

3D PDB for HMDB0037933 (Calendoflavobioside)

SMILES for HMDB0037933 (Calendoflavobioside)

INCHI for HMDB0037933 (Calendoflavobioside)

Structure for HMDB0037933 (Calendoflavobioside)

3D Structure for HMDB0037933 (Calendoflavobioside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra