Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 00:16:18 UTC

Update Date

2022-03-07 02:55:59 UTC

HMDB ID

HMDB0038923

Secondary Accession Numbers

HMDB38923

Metabolite Identification

Common Name

Cinnamoside

Description

Cinnamoside belongs to the class of organic compounds known as terpene glycosides. These are prenol lipids containing a carbohydrate moiety glycosidically bound to a terpene backbone. Based on a literature review a small amount of articles have been published on Cinnamoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02241210502D          

 36 38  0  0  0  0            999 V2000
    2.7787   -1.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0637   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0637    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502   -1.0943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6353   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0797   -1.0943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7933   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5083   -1.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2424   -0.7190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9353   -1.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7053   -0.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9184   -0.0756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502    0.5555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6353    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0797    0.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7933    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5083    0.5555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2479    1.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7787    0.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3080    1.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3048   -0.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2072    2.2053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9222    1.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6357    2.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9222    0.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2072    0.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4923    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4923   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7755   -1.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0797    1.3805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9780   -1.9922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7755   -2.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2237   -1.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8080   -0.9307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8657   -2.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6357   -1.7379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 28  1  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  3 19  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 14  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7 16  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 31  1  0  0  0  0
 11 12  1  0  0  0  0
 11 33  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 30  1  0  0  0  0
 16 17  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 27  1  0  0  0  0
 21 28  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 23 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  2  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 33 35  1  0  0  0  0
 35 36  1  0  0  0  0
M  END

HMDB0038923
     RDKit          3D
Cinnamoside
 74 76  0  0  0  0  0  0  0  0999 V2000
    9.0696    0.1901    1.5645 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9976    0.6459    0.6424 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1909    0.5602   -0.6147 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7830    1.1661    1.1568 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6782    0.7139    0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6665    0.1846   -0.0566 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1458   -1.0435    0.5165 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9700   -2.1967   -0.0778 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3848   -1.0855    2.0092 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7054   -1.2125    0.1590 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1182   -0.0598   -0.6154 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8298   -0.3441   -0.9892 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1202    0.5063   -0.4263 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0057   -0.2196    0.3283 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3226    0.1889    0.1855 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1800   -0.7042    1.0817 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4889   -0.2795    0.9239 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4022   -0.9848    1.6687 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0557   -0.0644    2.5190 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7256    0.7459    1.6138 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4623   -0.2309    0.7521 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7347   -0.4365    1.2419 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5860    0.2594   -0.6819 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2990    1.4421   -0.7488 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5854   -1.4600    0.8303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2218   -1.8277   -0.4414 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8041   -0.0520   -1.2320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1720   -1.3952   -1.3152 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7443    0.3032   -2.2446 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2645    0.8209   -3.4189 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7767    1.2511   -1.5657 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3673    2.4309   -1.1847 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0195    0.2351   -1.8045 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2422    0.9243   -1.2361 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8666    2.3639   -0.9322 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2425    0.9174   -2.2061 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9399   -0.2231    1.0128 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6222   -0.5805    2.2425 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3453    1.0436    2.2114 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5628    1.8520    1.9191 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4113   -1.9146   -1.0480 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8186   -2.4427    0.6047 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3397   -3.1111   -0.1331 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5796   -0.6127    2.5926 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3830   -0.6483    2.2168 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4601   -2.1600    2.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4989   -2.1864   -0.3437 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1347   -1.2672    1.1311 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0951    0.8200    0.0780 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3629    1.2702    0.2338 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4604    1.2143    0.5274 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8349   -0.7060    2.1174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1407   -1.7631    0.7206 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9751   -1.7863    2.2860 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4007    1.4624    2.0914 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9695    1.3175    1.0027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2782   -0.8904    0.5481 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5959    0.4469   -1.1387 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0908   -0.4930   -1.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1532    2.0364    0.0424 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0979   -2.3059    1.3440 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7207   -2.6067   -0.7927 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7293    0.5428   -1.3565 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5156   -1.9344   -1.8174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1723   -0.6348   -2.4608 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6444    0.6155   -4.1577 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0138    1.4809   -2.3088 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2658    2.4635   -1.6409 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5376    0.9036   -2.5361 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2717   -0.7255   -2.2835 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4083    2.4402    0.0818 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7397    3.0448   -0.9651 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1353    2.6699   -1.7088 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7934    1.1150   -3.0882 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 21 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 34  6  1  0
 31 13  1  0
 25 18  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  4 40  1  0
  8 41  1  0
  8 42  1  0
  8 43  1  0
  9 44  1  0
  9 45  1  0
  9 46  1  0
 10 47  1  0
 10 48  1  0
 11 49  1  0
 13 50  1  0
 15 51  1  0
 16 52  1  0
 16 53  1  0
 18 54  1  0
 20 55  1  0
 20 56  1  0
 22 57  1  0
 23 58  1  0
 23 59  1  0
 24 60  1  0
 25 61  1  0
 26 62  1  0
 27 63  1  0
 28 64  1  0
 29 65  1  0
 30 66  1  0
 31 67  1  0
 32 68  1  0
 33 69  1  0
 33 70  1  0
 35 71  1  0
 35 72  1  0
 35 73  1  0
 36 74  1  0
M  END


  Mrv0541 02241210502D          

 36 38  0  0  0  0            999 V2000
    2.7787   -1.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0637   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0637    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502   -1.0943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6353   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0797   -1.0943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7933   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5083   -1.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2424   -0.7190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9353   -1.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7053   -0.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9184   -0.0756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502    0.5555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6353    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0797    0.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7933    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5083    0.5555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2479    1.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7787    0.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3080    1.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3048   -0.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2072    2.2053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9222    1.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6357    2.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9222    0.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2072    0.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4923    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4923   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7755   -1.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0797    1.3805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9780   -1.9922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7755   -2.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2237   -1.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8080   -0.9307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8657   -2.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6357   -1.7379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 28  1  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  3 19  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 14  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7 16  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 31  1  0  0  0  0
 11 12  1  0  0  0  0
 11 33  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 30  1  0  0  0  0
 16 17  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 27  1  0  0  0  0
 21 28  1  0  0  0  0
 22 23  2  0  0  0  0
 23 24  1  0  0  0  0
 23 25  1  0  0  0  0
 25 26  2  0  0  0  0
 26 27  2  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 33 35  1  0  0  0  0
 35 36  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0038923

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(=O)C=C=C1C(C)(C)CC(CC1(C)O)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C24H38O12/c1-12(26)5-6-15-22(2,3)7-13(8-23(15,4)31)35-20-18(29)17(28)16(27)14(36-20)9-33-21-19(30)24(32,10-25)11-34-21/h5,13-14,16-21,25,27-32H,7-11H2,1-4H3

> <INCHI_KEY>
WGFLJEFKPRMWSU-UHFFFAOYSA-N

> <FORMULA>
C24H38O12

> <MOLECULAR_WEIGHT>
518.5513

> <EXACT_MASS>
518.23632668

> <JCHEM_ACCEPTOR_COUNT>
12

> <JCHEM_AVERAGE_POLARIZABILITY>
53.368069119118424

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
7

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
4-(4-{[6-({[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-2-hydroxy-2,6,6-trimethylcyclohexylidene)but-3-en-2-one

> <ALOGPS_LOGP>
-0.83

> <JCHEM_LOGP>
-2.2705442496666692

> <ALOGPS_LOGS>
-2.17

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
12.312091043050103

> <JCHEM_PKA_STRONGEST_ACIDIC>
11.703026199901839

> <JCHEM_PKA_STRONGEST_BASIC>
-3.1423790163389214

> <JCHEM_POLAR_SURFACE_AREA>
195.59999999999997

> <JCHEM_REFRACTIVITY>
122.96729999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.48e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
4-(4-{[6-({[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-2-hydroxy-2,6,6-trimethylcyclohexylidene)but-3-en-2-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0038923
     RDKit          3D
Cinnamoside
 74 76  0  0  0  0  0  0  0  0999 V2000
    9.0696    0.1901    1.5645 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9976    0.6459    0.6424 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1909    0.5602   -0.6147 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7830    1.1661    1.1568 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6782    0.7139    0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6665    0.1846   -0.0566 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1458   -1.0435    0.5165 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9700   -2.1967   -0.0778 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3848   -1.0855    2.0092 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7054   -1.2125    0.1590 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1182   -0.0598   -0.6154 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8298   -0.3441   -0.9892 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1202    0.5063   -0.4263 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0057   -0.2196    0.3283 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3226    0.1889    0.1855 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1800   -0.7042    1.0817 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4889   -0.2795    0.9239 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4022   -0.9848    1.6687 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0557   -0.0644    2.5190 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7256    0.7459    1.6138 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4623   -0.2309    0.7521 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7347   -0.4365    1.2419 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5860    0.2594   -0.6819 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2990    1.4421   -0.7488 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5854   -1.4600    0.8303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2218   -1.8277   -0.4414 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8041   -0.0520   -1.2320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1720   -1.3952   -1.3152 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7443    0.3032   -2.2446 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2645    0.8209   -3.4189 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7767    1.2511   -1.5657 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3673    2.4309   -1.1847 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0195    0.2351   -1.8045 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2422    0.9243   -1.2361 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8666    2.3639   -0.9322 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2425    0.9174   -2.2061 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9399   -0.2231    1.0128 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6222   -0.5805    2.2425 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3453    1.0436    2.2114 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5628    1.8520    1.9191 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4113   -1.9146   -1.0480 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8186   -2.4427    0.6047 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3397   -3.1111   -0.1331 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5796   -0.6127    2.5926 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3830   -0.6483    2.2168 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4601   -2.1600    2.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4989   -2.1864   -0.3437 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1347   -1.2672    1.1311 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0951    0.8200    0.0780 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3629    1.2702    0.2338 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4604    1.2143    0.5274 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8349   -0.7060    2.1174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1407   -1.7631    0.7206 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9751   -1.7863    2.2860 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4007    1.4624    2.0914 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9695    1.3175    1.0027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2782   -0.8904    0.5481 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5959    0.4469   -1.1387 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0908   -0.4930   -1.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1532    2.0364    0.0424 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0979   -2.3059    1.3440 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7207   -2.6067   -0.7927 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7293    0.5428   -1.3565 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5156   -1.9344   -1.8174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1723   -0.6348   -2.4608 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6444    0.6155   -4.1577 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0138    1.4809   -2.3088 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2658    2.4635   -1.6409 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5376    0.9036   -2.5361 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2717   -0.7255   -2.2835 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4083    2.4402    0.0818 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7397    3.0448   -0.9651 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1353    2.6699   -1.7088 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7934    1.1150   -3.0882 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 21 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 34  6  1  0
 31 13  1  0
 25 18  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  4 40  1  0
  8 41  1  0
  8 42  1  0
  8 43  1  0
  9 44  1  0
  9 45  1  0
  9 46  1  0
 10 47  1  0
 10 48  1  0
 11 49  1  0
 13 50  1  0
 15 51  1  0
 16 52  1  0
 16 53  1  0
 18 54  1  0
 20 55  1  0
 20 56  1  0
 22 57  1  0
 23 58  1  0
 23 59  1  0
 24 60  1  0
 25 61  1  0
 26 62  1  0
 27 63  1  0
 28 64  1  0
 29 65  1  0
 30 66  1  0
 31 67  1  0
 32 68  1  0
 33 69  1  0
 33 70  1  0
 35 71  1  0
 35 72  1  0
 35 73  1  0
 36 74  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  C   UNK     0       5.187  -2.043   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       3.852  -1.273   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       3.852   0.267   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0       2.520  -2.043   0.000  0.00  0.00           O+0
HETATM    5  C   UNK     0       1.186  -1.273   0.000  0.00  0.00           C+0
HETATM    6  O   UNK     0      -0.149  -2.043   0.000  0.00  0.00           O+0
HETATM    7  C   UNK     0      -1.481  -1.273   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -2.815  -2.043   0.000  0.00  0.00           C+0
HETATM    9  O   UNK     0      -4.186  -1.342   0.000  0.00  0.00           O+0
HETATM   10  C   UNK     0      -5.479  -2.182   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -6.917  -1.630   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0      -7.314  -0.141   0.000  0.00  0.00           O+0
HETATM   13  O   UNK     0       2.520   1.037   0.000  0.00  0.00           O+0
HETATM   14  C   UNK     0       1.186   0.267   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -0.149   1.037   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -1.481   0.267   0.000  0.00  0.00           C+0
HETATM   17  O   UNK     0      -2.815   1.037   0.000  0.00  0.00           O+0
HETATM   18  C   UNK     0       4.196   2.218   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       5.187   1.037   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       6.175   2.218   0.000  0.00  0.00           C+0
HETATM   21  O   UNK     0       8.036  -1.003   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0       7.853   4.117   0.000  0.00  0.00           O+0
HETATM   23  C   UNK     0       9.188   3.347   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      10.520   4.117   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       9.188   1.807   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       7.853   1.037   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       6.519   0.267   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       6.519  -1.273   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0       7.048  -2.718   0.000  0.00  0.00           C+0
HETATM   30  O   UNK     0      -0.149   2.577   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -5.559  -3.719   0.000  0.00  0.00           O+0
HETATM   32  C   UNK     0      -7.048  -4.117   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      -7.884  -2.826   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0      -8.975  -1.737   0.000  0.00  0.00           O+0
HETATM   35  C   UNK     0      -9.083  -3.796   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0     -10.520  -3.244   0.000  0.00  0.00           O+0
CONECT    1    2   28                                                       
CONECT    2    1    3    4                                                  
CONECT    3    2   19                                                       
CONECT    4    2    5                                                       
CONECT    5    4    6   14                                                  
CONECT    6    5    7                                                       
CONECT    7    6    8   16                                                  
CONECT    8    7    9                                                       
CONECT    9    8   10                                                       
CONECT   10    9   11   31                                                  
CONECT   11   10   12   33                                                  
CONECT   12   11                                                            
CONECT   13   14                                                            
CONECT   14    5   13   15                                                  
CONECT   15   14   16   30                                                  
CONECT   16    7   15   17                                                  
CONECT   17   16                                                            
CONECT   18   19                                                            
CONECT   19    3   18   20   27                                             
CONECT   20   19                                                            
CONECT   21   28                                                            
CONECT   22   23                                                            
CONECT   23   22   24   25                                                  
CONECT   24   23                                                            
CONECT   25   23   26                                                       
CONECT   26   25   27                                                       
CONECT   27   19   26   28                                                  
CONECT   28    1   21   27   29                                             
CONECT   29   28                                                            
CONECT   30   15                                                            
CONECT   31   10   32                                                       
CONECT   32   31   33                                                       
CONECT   33   11   32   34   35                                             
CONECT   34   33                                                            
CONECT   35   33   36                                                       
CONECT   36   35                                                            
MASTER        0    0    0    0    0    0    0    0   36    0   76    0
END

COMPND    HMDB0038923
HETATM    1  C1  UNL     1       9.070   0.190   1.564  1.00  0.00           C  
HETATM    2  C2  UNL     1       7.998   0.646   0.642  1.00  0.00           C  
HETATM    3  O1  UNL     1       8.191   0.560  -0.615  1.00  0.00           O  
HETATM    4  C3  UNL     1       6.783   1.166   1.157  1.00  0.00           C  
HETATM    5  C4  UNL     1       5.678   0.714   0.578  1.00  0.00           C  
HETATM    6  C5  UNL     1       4.667   0.185  -0.057  1.00  0.00           C  
HETATM    7  C6  UNL     1       4.146  -1.044   0.516  1.00  0.00           C  
HETATM    8  C7  UNL     1       4.970  -2.197  -0.078  1.00  0.00           C  
HETATM    9  C8  UNL     1       4.385  -1.085   2.009  1.00  0.00           C  
HETATM   10  C9  UNL     1       2.705  -1.212   0.159  1.00  0.00           C  
HETATM   11  C10 UNL     1       2.118  -0.060  -0.615  1.00  0.00           C  
HETATM   12  O2  UNL     1       0.830  -0.344  -0.989  1.00  0.00           O  
HETATM   13  C11 UNL     1      -0.120   0.506  -0.426  1.00  0.00           C  
HETATM   14  O3  UNL     1      -1.006  -0.220   0.328  1.00  0.00           O  
HETATM   15  C12 UNL     1      -2.323   0.189   0.185  1.00  0.00           C  
HETATM   16  C13 UNL     1      -3.180  -0.704   1.082  1.00  0.00           C  
HETATM   17  O4  UNL     1      -4.489  -0.280   0.924  1.00  0.00           O  
HETATM   18  C14 UNL     1      -5.402  -0.985   1.669  1.00  0.00           C  
HETATM   19  O5  UNL     1      -6.056  -0.064   2.519  1.00  0.00           O  
HETATM   20  C15 UNL     1      -6.726   0.746   1.614  1.00  0.00           C  
HETATM   21  C16 UNL     1      -7.462  -0.231   0.752  1.00  0.00           C  
HETATM   22  O6  UNL     1      -8.735  -0.436   1.242  1.00  0.00           O  
HETATM   23  C17 UNL     1      -7.586   0.259  -0.682  1.00  0.00           C  
HETATM   24  O7  UNL     1      -8.299   1.442  -0.749  1.00  0.00           O  
HETATM   25  C18 UNL     1      -6.585  -1.460   0.830  1.00  0.00           C  
HETATM   26  O8  UNL     1      -6.222  -1.828  -0.441  1.00  0.00           O  
HETATM   27  C19 UNL     1      -2.804  -0.052  -1.232  1.00  0.00           C  
HETATM   28  O9  UNL     1      -3.172  -1.395  -1.315  1.00  0.00           O  
HETATM   29  C20 UNL     1      -1.744   0.303  -2.245  1.00  0.00           C  
HETATM   30  O10 UNL     1      -2.264   0.821  -3.419  1.00  0.00           O  
HETATM   31  C21 UNL     1      -0.777   1.251  -1.566  1.00  0.00           C  
HETATM   32  O11 UNL     1      -1.367   2.431  -1.185  1.00  0.00           O  
HETATM   33  C22 UNL     1       3.019   0.235  -1.805  1.00  0.00           C  
HETATM   34  C23 UNL     1       4.242   0.924  -1.236  1.00  0.00           C  
HETATM   35  C24 UNL     1       3.867   2.364  -0.932  1.00  0.00           C  
HETATM   36  O12 UNL     1       5.242   0.917  -2.206  1.00  0.00           O  
HETATM   37  H1  UNL     1       9.940  -0.223   1.013  1.00  0.00           H  
HETATM   38  H2  UNL     1       8.622  -0.581   2.243  1.00  0.00           H  
HETATM   39  H3  UNL     1       9.345   1.044   2.211  1.00  0.00           H  
HETATM   40  H4  UNL     1       6.563   1.852   1.919  1.00  0.00           H  
HETATM   41  H5  UNL     1       5.411  -1.915  -1.048  1.00  0.00           H  
HETATM   42  H6  UNL     1       5.819  -2.443   0.605  1.00  0.00           H  
HETATM   43  H7  UNL     1       4.340  -3.111  -0.133  1.00  0.00           H  
HETATM   44  H8  UNL     1       3.580  -0.613   2.593  1.00  0.00           H  
HETATM   45  H9  UNL     1       5.383  -0.648   2.217  1.00  0.00           H  
HETATM   46  H10 UNL     1       4.460  -2.160   2.288  1.00  0.00           H  
HETATM   47  H11 UNL     1       2.499  -2.186  -0.344  1.00  0.00           H  
HETATM   48  H12 UNL     1       2.135  -1.267   1.131  1.00  0.00           H  
HETATM   49  H13 UNL     1       2.095   0.820   0.078  1.00  0.00           H  
HETATM   50  H14 UNL     1       0.363   1.270   0.234  1.00  0.00           H  
HETATM   51  H15 UNL     1      -2.460   1.214   0.527  1.00  0.00           H  
HETATM   52  H16 UNL     1      -2.835  -0.706   2.117  1.00  0.00           H  
HETATM   53  H17 UNL     1      -3.141  -1.763   0.721  1.00  0.00           H  
HETATM   54  H18 UNL     1      -4.975  -1.786   2.286  1.00  0.00           H  
HETATM   55  H19 UNL     1      -7.401   1.462   2.091  1.00  0.00           H  
HETATM   56  H20 UNL     1      -5.969   1.317   1.003  1.00  0.00           H  
HETATM   57  H21 UNL     1      -9.278  -0.890   0.548  1.00  0.00           H  
HETATM   58  H22 UNL     1      -6.596   0.447  -1.139  1.00  0.00           H  
HETATM   59  H23 UNL     1      -8.091  -0.493  -1.319  1.00  0.00           H  
HETATM   60  H24 UNL     1      -8.153   2.036   0.042  1.00  0.00           H  
HETATM   61  H25 UNL     1      -7.098  -2.306   1.344  1.00  0.00           H  
HETATM   62  H26 UNL     1      -6.721  -2.607  -0.793  1.00  0.00           H  
HETATM   63  H27 UNL     1      -3.729   0.543  -1.356  1.00  0.00           H  
HETATM   64  H28 UNL     1      -2.516  -1.934  -1.817  1.00  0.00           H  
HETATM   65  H29 UNL     1      -1.172  -0.635  -2.461  1.00  0.00           H  
HETATM   66  H30 UNL     1      -1.644   0.615  -4.158  1.00  0.00           H  
HETATM   67  H31 UNL     1       0.014   1.481  -2.309  1.00  0.00           H  
HETATM   68  H32 UNL     1      -2.266   2.463  -1.641  1.00  0.00           H  
HETATM   69  H33 UNL     1       2.538   0.904  -2.536  1.00  0.00           H  
HETATM   70  H34 UNL     1       3.272  -0.726  -2.284  1.00  0.00           H  
HETATM   71  H35 UNL     1       3.408   2.440   0.082  1.00  0.00           H  
HETATM   72  H36 UNL     1       4.740   3.045  -0.965  1.00  0.00           H  
HETATM   73  H37 UNL     1       3.135   2.670  -1.709  1.00  0.00           H  
HETATM   74  H38 UNL     1       4.793   1.115  -3.088  1.00  0.00           H  
CONECT    1    2   37   38   39
CONECT    2    3    3    4
CONECT    4    5    5   40
CONECT    5    6    6
CONECT    6    7   34
CONECT    7    8    9   10
CONECT    8   41   42   43
CONECT    9   44   45   46
CONECT   10   11   47   48
CONECT   11   12   33   49
CONECT   12   13
CONECT   13   14   31   50
CONECT   14   15
CONECT   15   16   27   51
CONECT   16   17   52   53
CONECT   17   18
CONECT   18   19   25   54
CONECT   19   20
CONECT   20   21   55   56
CONECT   21   22   23   25
CONECT   22   57
CONECT   23   24   58   59
CONECT   24   60
CONECT   25   26   61
CONECT   26   62
CONECT   27   28   29   63
CONECT   28   64
CONECT   29   30   31   65
CONECT   30   66
CONECT   31   32   67
CONECT   32   68
CONECT   33   34   69   70
CONECT   34   35   36
CONECT   35   71   72   73
CONECT   36   74
END

HMDB0038923
     RDKit          3D
Cinnamoside
 74 76  0  0  0  0  0  0  0  0999 V2000
    9.0696    0.1901    1.5645 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9976    0.6459    0.6424 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1909    0.5602   -0.6147 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7830    1.1661    1.1568 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6782    0.7139    0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6665    0.1846   -0.0566 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1458   -1.0435    0.5165 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9700   -2.1967   -0.0778 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3848   -1.0855    2.0092 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7054   -1.2125    0.1590 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1182   -0.0598   -0.6154 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8298   -0.3441   -0.9892 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1202    0.5063   -0.4263 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0057   -0.2196    0.3283 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3226    0.1889    0.1855 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1800   -0.7042    1.0817 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4889   -0.2795    0.9239 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4022   -0.9848    1.6687 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0557   -0.0644    2.5190 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7256    0.7459    1.6138 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4623   -0.2309    0.7521 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7347   -0.4365    1.2419 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5860    0.2594   -0.6819 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2990    1.4421   -0.7488 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5854   -1.4600    0.8303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2218   -1.8277   -0.4414 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8041   -0.0520   -1.2320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1720   -1.3952   -1.3152 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7443    0.3032   -2.2446 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2645    0.8209   -3.4189 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7767    1.2511   -1.5657 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3673    2.4309   -1.1847 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0195    0.2351   -1.8045 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2422    0.9243   -1.2361 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8666    2.3639   -0.9322 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2425    0.9174   -2.2061 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9399   -0.2231    1.0128 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6222   -0.5805    2.2425 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3453    1.0436    2.2114 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5628    1.8520    1.9191 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4113   -1.9146   -1.0480 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8186   -2.4427    0.6047 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3397   -3.1111   -0.1331 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5796   -0.6127    2.5926 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3830   -0.6483    2.2168 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4601   -2.1600    2.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4989   -2.1864   -0.3437 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1347   -1.2672    1.1311 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0951    0.8200    0.0780 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3629    1.2702    0.2338 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4604    1.2143    0.5274 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8349   -0.7060    2.1174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1407   -1.7631    0.7206 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9751   -1.7863    2.2860 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4007    1.4624    2.0914 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9695    1.3175    1.0027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2782   -0.8904    0.5481 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5959    0.4469   -1.1387 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0908   -0.4930   -1.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1532    2.0364    0.0424 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0979   -2.3059    1.3440 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7207   -2.6067   -0.7927 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7293    0.5428   -1.3565 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5156   -1.9344   -1.8174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1723   -0.6348   -2.4608 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6444    0.6155   -4.1577 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0138    1.4809   -2.3088 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2658    2.4635   -1.6409 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5376    0.9036   -2.5361 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2717   -0.7255   -2.2835 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4083    2.4402    0.0818 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7397    3.0448   -0.9651 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1353    2.6699   -1.7088 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7934    1.1150   -3.0882 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 21 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 34  6  1  0
 31 13  1  0
 25 18  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  4 40  1  0
  8 41  1  0
  8 42  1  0
  8 43  1  0
  9 44  1  0
  9 45  1  0
  9 46  1  0
 10 47  1  0
 10 48  1  0
 11 49  1  0
 13 50  1  0
 15 51  1  0
 16 52  1  0
 16 53  1  0
 18 54  1  0
 20 55  1  0
 20 56  1  0
 22 57  1  0
 23 58  1  0
 23 59  1  0
 24 60  1  0
 25 61  1  0
 26 62  1  0
 27 63  1  0
 28 64  1  0
 29 65  1  0
 30 66  1  0
 31 67  1  0
 32 68  1  0
 33 69  1  0
 33 70  1  0
 35 71  1  0
 35 72  1  0
 35 73  1  0
 36 74  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Not Available

Chemical Formula

C₂₄H₃₈O₁₂

Average Molecular Weight

518.5513

Monoisotopic Molecular Weight

518.23632668

IUPAC Name

4-(4-{[6-({[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-2-hydroxy-2,6,6-trimethylcyclohexylidene)but-3-en-2-one

Traditional Name

4-(4-{[6-({[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy}methyl)-3,4,5-trihydroxyoxan-2-yl]oxy}-2-hydroxy-2,6,6-trimethylcyclohexylidene)but-3-en-2-one

CAS Registry Number

108567-70-0

SMILES

CC(=O)C=C=C1C(C)(C)CC(CC1(C)O)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O

InChI Identifier

InChI=1S/C24H38O12/c1-12(26)5-6-15-22(2,3)7-13(8-23(15,4)31)35-20-18(29)17(28)16(27)14(36-20)9-33-21-19(30)24(32,10-25)11-34-21/h5,13-14,16-21,25,27-32H,7-11H2,1-4H3

InChI Key

WGFLJEFKPRMWSU-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as terpene glycosides. These are prenol lipids containing a carbohydrate moiety glycosidically bound to a terpene backbone.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Prenol lipids

Sub Class

Terpene glycosides

Direct Parent

Terpene glycosides

Alternative Parents

Substituents

Terpene glycoside
Sesquiterpenoid
Megastigmane sesquiterpenoid
Disaccharide
Glycosyl compound
O-glycosyl compound
Oxane
Acryloyl-group
Cyclic alcohol
Enone
Tetrahydrofuran
Tertiary alcohol
Ketone
Secondary alcohol
Polyol
Oxacycle
Acetal
Organoheterocyclic compound
Organooxygen compound
Hydrocarbon derivative
Organic oxide
Alcohol
Organic oxygen compound
Primary alcohol
Carbonyl group
Aliphatic heteromonocyclic compound

Molecular Framework

Aliphatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cell membrane (HMDB: HMDB0038923)

Cellular substructure

Route of exposure

Enteral

Ingestion (HMDB: HMDB0038923)

Source

Endogenous

Endogenous (HMDB: HMDB0038923)

Plant

Plant (HMDB: HMDB0038923)

Animal

Animal (HMDB: HMDB0038923)

Exogenous

Food

Food (HMDB: HMDB0038923)

Herb and spice

Spice

Chinese cinnamon (FooDB: FOOD00050)

Herbs and Spices (FooDB: FOOD00866)

Process

Naturally occurring process

Biological process

Chemical reaction

Lipid peroxidation (HMDB: HMDB0038923)

Biochemical process

Fatty acid metabolism (HMDB: HMDB0038923)

Cellular process

Cell signaling (HMDB: HMDB0038923)

Biochemical pathway

Lipid metabolism pathway (HMDB: HMDB0038923)

Role

Biological role

Membrane stabilizer (HMDB: HMDB0038923)

Nutrient

Nutrient (HMDB: HMDB0038923)

Industrial application

Manufacturing industry

Material processing agent

Fluid processing agent

Surfactant

Surfactant (HMDB: HMDB0038923)

Emulsifier (HMDB: HMDB0038923)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	4601 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	3.48 g/L	ALOGPS
logP	-0.83	ALOGPS
logP	-2.3	ChemAxon
logS	-2.2	ALOGPS
pKa (Strongest Acidic)	11.7	ChemAxon
pKa (Strongest Basic)	-3.1	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	12	ChemAxon
Hydrogen Donor Count	7	ChemAxon
Polar Surface Area	195.6 Å²	ChemAxon
Rotatable Bond Count	7	ChemAxon
Refractivity	122.97 m³·mol⁻¹	ChemAxon
Polarizability	53.37 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	218.787	31661259
DarkChem	[M-H]-	209.127	31661259
DeepCCS	[M+H]+	214.975	30932474
DeepCCS	[M-H]-	212.617	30932474
DeepCCS	[M-2H]-	246.121	30932474
DeepCCS	[M+Na]+	221.93	30932474
AllCCS	[M+H]+	220.6	32859911
AllCCS	[M+H-H2O]+	219.1	32859911
AllCCS	[M+NH4]+	221.9	32859911
AllCCS	[M+Na]+	222.3	32859911
AllCCS	[M-H]-	216.7	32859911
AllCCS	[M+Na-2H]-	218.7	32859911
AllCCS	[M+HCOO]-	220.9	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Cinnamoside	CC(=O)C=C=C1C(C)(C)CC(CC1(C)O)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O	4169.7	Standard polar	33892256
Cinnamoside	CC(=O)C=C=C1C(C)(C)CC(CC1(C)O)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O	3558.3	Standard non polar	33892256
Cinnamoside	CC(=O)C=C=C1C(C)(C)CC(CC1(C)O)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O	3792.1	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Cinnamoside,1TMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3791.0	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O	3821.9	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O	3759.9	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O	3804.0	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3775.9	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #6	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3742.6	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #7	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3756.7	Semi standard non polar	33892256
Cinnamoside,1TMS,isomer #8	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3813.9	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3742.4	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #10	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3745.7	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #11	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3696.8	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #12	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3723.8	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #13	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3765.5	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #14	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O	3702.8	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #15	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3688.7	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #16	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3638.5	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #17	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3663.8	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #18	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3710.4	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #19	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3732.0	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3687.7	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #20	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3685.3	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #21	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3707.6	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #22	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3757.2	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #23	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3689.9	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #24	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3698.2	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #25	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3741.4	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #26	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3689.8	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #27	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3690.2	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #28	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3726.0	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3728.2	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3719.7	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3668.2	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #6	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3692.7	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #7	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3742.3	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #8	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O	3720.1	Semi standard non polar	33892256
Cinnamoside,2TMS,isomer #9	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O	3758.2	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3587.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #10	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3542.7	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #11	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3566.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #12	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3600.8	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #13	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3541.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #14	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3572.3	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #15	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3608.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #16	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3582.5	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #17	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3591.8	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #18	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3630.7	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #19	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3577.8	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3637.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #20	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3565.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #21	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3608.5	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #22	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O	3629.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #23	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3624.8	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #24	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3570.3	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #25	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3598.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #26	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3627.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #27	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3670.7	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #28	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3611.5	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #29	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3644.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3630.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #30	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3684.2	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #31	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3631.3	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #32	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3641.5	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #33	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3670.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #34	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3625.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #35	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3606.9	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #36	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3654.5	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #37	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3586.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #38	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3526.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #39	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3558.8	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3579.9	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #40	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3593.6	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #41	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3558.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #42	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3570.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #43	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3604.9	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #44	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3552.3	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #45	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3540.7	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #46	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3587.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #47	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3594.6	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #48	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3607.3	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #49	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3642.7	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3604.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #50	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3593.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #51	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3587.6	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #52	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3621.0	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #53	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3637.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #54	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3626.2	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #55	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3631.2	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #56	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3618.4	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #6	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3636.6	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #7	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3548.1	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #8	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3567.2	Semi standard non polar	33892256
Cinnamoside,3TMS,isomer #9	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3517.8	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C	3478.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #10	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3477.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #11	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3481.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #12	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3507.9	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #13	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3473.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #14	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3475.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #15	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3480.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #16	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3431.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #17	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3404.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #18	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3400.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #19	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3434.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3473.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #20	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3417.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #21	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3428.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #22	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3448.8	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #23	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3415.8	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #24	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3416.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #25	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3422.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #26	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3440.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #27	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3450.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #28	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3481.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #29	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3440.8	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3446.8	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #30	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3445.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #31	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3458.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #32	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3479.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #33	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3471.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #34	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3485.0	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #35	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3469.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #36	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O	3514.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #37	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O	3471.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #38	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O	3485.0	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #39	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3533.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3441.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #40	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3469.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #41	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3480.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #42	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3505.0	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #43	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3466.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #44	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3462.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #45	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3479.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #46	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3510.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #47	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3523.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #48	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3557.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #49	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3508.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #5	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3472.0	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #50	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3505.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #51	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3531.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #52	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3539.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #53	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3508.1	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #54	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3513.7	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #55	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3504.9	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #56	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3428.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #57	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3443.0	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #58	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3472.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #59	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3425.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #6	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3510.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #60	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3427.9	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #61	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3447.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #62	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3463.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #63	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3443.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #64	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3457.1	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #65	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3440.3	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #66	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3504.8	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #67	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3489.2	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #68	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3500.5	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #69	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3490.1	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #7	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3470.9	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #70	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3535.6	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #8	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3478.4	Semi standard non polar	33892256
Cinnamoside,4TMS,isomer #9	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3516.1	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C	3431.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #10	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3391.5	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #11	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3401.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #12	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3409.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #13	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3451.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #14	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3397.5	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #15	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3422.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #16	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3423.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #17	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3391.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #18	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3399.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #19	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3412.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3408.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #20	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3397.6	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #21	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3346.9	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #22	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3356.1	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #23	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3396.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #24	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3343.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #25	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3369.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #26	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3367.2	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #27	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3349.2	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #28	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3359.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #29	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3374.9	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3395.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #30	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3361.2	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #31	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3385.7	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #32	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3395.2	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #33	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3411.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #34	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3396.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #35	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3419.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #36	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O	3419.2	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #37	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O	3435.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #38	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C	3470.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #39	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3417.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #4	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3456.7	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #40	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3435.8	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #41	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3443.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #42	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3409.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #43	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3404.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #44	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3420.4	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #45	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3404.1	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #46	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3444.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #47	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3436.1	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #48	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3456.5	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #49	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3439.6	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C	3379.0	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #50	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3442.7	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #51	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O	3370.5	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #52	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C	3379.6	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #53	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3398.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #54	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3381.7	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #55	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3395.1	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #56	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O)O[Si](C)(C)C	3441.5	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #6	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3389.6	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #7	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3419.9	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #8	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)CC1(C)O[Si](C)(C)C	3378.3	Semi standard non polar	33892256
Cinnamoside,5TMS,isomer #9	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)CC1(C)O[Si](C)(C)C)O[Si](C)(C)C	3393.1	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4001.0	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O	4022.2	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O	3969.1	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O	4009.9	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	3984.9	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #6	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	3960.9	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #7	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	3968.0	Semi standard non polar	33892256
Cinnamoside,1TBDMS,isomer #8	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4015.2	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4144.3	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #10	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	4156.1	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #11	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4125.8	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #12	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4122.4	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #13	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4158.8	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #14	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O	4119.2	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #15	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	4113.0	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #16	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4079.5	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #17	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4076.7	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #18	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4114.9	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #19	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	4145.8	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4104.0	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #20	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4107.0	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #21	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4108.2	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #22	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4142.7	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #23	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4105.3	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #24	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4105.3	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #25	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4144.3	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #26	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4103.7	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #27	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4100.3	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #28	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O)O[Si](C)(C)C(C)(C)C	4117.5	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4142.7	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4131.6	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4085.2	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #6	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C	4101.8	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #7	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4151.6	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #8	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O	4132.7	Semi standard non polar	33892256
Cinnamoside,2TBDMS,isomer #9	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O	4172.6	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #1	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4195.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #10	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C	4165.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #11	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4153.8	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #12	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4219.7	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #13	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4188.1	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #14	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C	4183.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #15	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4185.7	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #16	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4204.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #17	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C	4211.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #18	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4221.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #19	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C	4206.1	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #2	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4248.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #20	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4182.5	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #21	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4193.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #22	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O	4247.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #23	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	4223.5	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #24	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4205.1	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #25	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4188.8	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #26	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4172.6	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #27	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	4271.6	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #28	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4244.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #29	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4235.3	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #3	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4235.8	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #30	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4231.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #31	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4243.1	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #32	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4244.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #33	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4221.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #34	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4239.5	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #35	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4196.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #36	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O)O[Si](C)(C)C(C)(C)C	4194.8	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #37	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O	4200.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #38	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4179.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #39	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4161.8	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #4	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4212.3	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #40	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4152.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #41	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4197.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #42	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4202.5	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #43	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4177.4	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #44	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4194.1	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #45	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4151.0	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #46	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O)O[Si](C)(C)C(C)(C)C	4147.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #47	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O	4212.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #48	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4214.8	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #49	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4197.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #5	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O[Si](C)(C)C(C)(C)C	4208.2	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #50	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4208.6	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #51	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4169.7	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #52	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O)O[Si](C)(C)C(C)(C)C	4166.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #53	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O	4234.1	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #54	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O)O[Si](C)(C)C(C)(C)C	4210.4	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #55	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)CC1(C)O)O[Si](C)(C)C(C)(C)C	4211.4	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #56	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)CC1(C)O)O[Si](C)(C)C(C)(C)C	4204.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #6	C=C(C=C=C1C(C)(C)CC(OC2OC(COC3OCC(CO)(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4190.9	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #7	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4170.3	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #8	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4196.6	Semi standard non polar	33892256
Cinnamoside,3TBDMS,isomer #9	CC(=O)C=C=C1C(C)(C)CC(OC2OC(COC3OCC(O)(CO[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)CC1(C)O[Si](C)(C)C(C)(C)C	4172.2	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Cinnamoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0uki-8462960000-42bacaf64dff0a88f81b	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Cinnamoside GC-MS (2 TMS) - 70eV, Positive	splash10-0002-4421109000-64cf085205c82688b093	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Cinnamoside GC-MS (TBDMS_3_50) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Cinnamoside GC-MS ("Cinnamoside,3TBDMS,#50" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 10V, Negative-QTOF	splash10-066s-1592840000-93769cd90b5e6b749526	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 20V, Negative-QTOF	splash10-0600-0690300000-ebfa921b0ab1757a728e	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 40V, Negative-QTOF	splash10-05fr-2690000000-af9b16e6edd6a7256e85	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 10V, Negative-QTOF	splash10-014i-0010590000-7035e3725e47cfd4293a	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 20V, Negative-QTOF	splash10-0a4i-7728910000-9a42188d9cbadf94903f	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 40V, Negative-QTOF	splash10-0pdi-9623300000-b909e0ffcfe57d2998cb	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 10V, Positive-QTOF	splash10-0pe9-0291660000-f382dcaf5790e693718c	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 20V, Positive-QTOF	splash10-0a6r-0492200000-70e2fd13fab645cc832a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 40V, Positive-QTOF	splash10-0a6r-2590000000-7339c95a75911b1cc1a9	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 10V, Positive-QTOF	splash10-0ldi-0452980000-08e29403d5e995d2b5bb	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 20V, Positive-QTOF	splash10-000i-4911210000-9d5335d413901fa74d30	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cinnamoside 40V, Positive-QTOF	splash10-01q4-5920000000-dd0fc7bcc0eb18cf6596	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular
Membrane

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB018389

KNApSAcK ID

C00054960

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

13909547

PDB ID

Not Available

ChEBI ID

169143

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1872731

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.

Showing metabocard for Cinnamoside (HMDB0038923)

MOL for HMDB0038923 (Cinnamoside)

3D MOL for HMDB0038923 (Cinnamoside)

3D SDF for HMDB0038923 (Cinnamoside)

3D-SDF for HMDB0038923 (Cinnamoside)

PDB for HMDB0038923 (Cinnamoside)

3D PDB for HMDB0038923 (Cinnamoside)

SMILES for HMDB0038923 (Cinnamoside)

INCHI for HMDB0038923 (Cinnamoside)

Structure for HMDB0038923 (Cinnamoside)

3D Structure for HMDB0038923 (Cinnamoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra