Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 00:36:49 UTC

Update Date

2022-03-07 02:56:07 UTC

HMDB ID

HMDB0039231

Secondary Accession Numbers

HMDB39231

Metabolite Identification

Common Name

Citrusin B

Description

Citrusin B belongs to the class of organic compounds known as lignan glycosides. These are aromatic polycyclic compounds containing a carbohydrate component glycosidically linked to a lignan moiety. They include 1-aryltetralin lactones. Citrusin B has been detected, but not quantified in, a few different foods, such as citrus, fruits, and lemons (Citrus limon). This could make citrusin b a potential biomarker for the consumption of these foods. Based on a literature review a small amount of articles have been published on Citrusin B.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061310572D          

 40 42  0  0  0  0            999 V2000
    3.5724    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  4  2  0  0  0  0
  7  6  2  0  0  0  0
  8  4  1  0  0  0  0
 14  5  1  0  0  0  0
 14  9  2  0  0  0  0
 14 10  1  0  0  0  0
 15  6  1  0  0  0  0
 15 11  2  0  0  0  0
 16  7  1  0  0  0  0
 17 11  1  0  0  0  0
 17 16  2  0  0  0  0
 18  9  1  0  0  0  0
 19 10  2  0  0  0  0
 20 12  1  0  0  0  0
 21 13  1  0  0  0  0
 22 15  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 18  2  0  0  0  0
 26 19  1  0  0  0  0
 27 25  1  0  0  0  0
 28  8  1  0  0  0  0
 29 12  1  0  0  0  0
 30 13  1  0  0  0  0
 31 22  1  0  0  0  0
 32 23  1  0  0  0  0
 33 24  1  0  0  0  0
 34 25  1  0  0  0  0
 35  1  1  0  0  0  0
 35 17  1  0  0  0  0
 36  2  1  0  0  0  0
 36 18  1  0  0  0  0
 37  3  1  0  0  0  0
 37 19  1  0  0  0  0
 38 20  1  0  0  0  0
 38 26  1  0  0  0  0
 39 16  1  0  0  0  0
 39 27  1  0  0  0  0
 40 21  1  0  0  0  0
 40 27  1  0  0  0  0
M  END

HMDB0039231
     RDKit          3D
Citrusin B
 76 78  0  0  0  0  0  0  0  0999 V2000
    3.5356    3.5429   -0.3046 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7120    2.1456   -0.3621 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6660    1.3539   -0.8023 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4835    1.9601   -1.1707 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3989    1.2377   -1.6182 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8825    1.8210   -2.0140 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6768    3.0231   -2.7182 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8601    2.0814   -0.9216 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5358    3.2846   -0.0622 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4978    3.0940    0.8143 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1848    0.9732   -0.1275 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4695    0.4633   -0.0745 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8323   -0.5041   -1.0075 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9506   -0.9574   -1.9708 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3252   -1.9358   -2.9100 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0859   -1.0295   -0.9850 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0865   -0.6585   -0.0557 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3982   -1.2212   -0.2067 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3037   -1.4499    0.6783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1539   -1.1815    2.0990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3467   -2.4697    2.7672 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6755    0.2997    0.8376 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3986    0.8644    0.8510 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0947    1.8152    1.7956 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0719    2.2067    2.7352 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5689   -0.1294   -1.6756 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7465   -0.7582   -1.3111 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8223   -0.0334   -0.8661 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0353   -0.5600   -0.4799 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4198   -1.8918   -0.4575 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5077   -2.1087   -1.2953 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7021   -1.6583   -0.7987 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6654   -2.8237   -0.5466 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8658   -2.3206   -0.0431 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6025   -0.7760    0.3996 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9164   -0.5945    0.8892 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7943   -1.3635    1.5163 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2397   -0.3173    2.2482 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7276   -2.2663    0.9759 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5494   -2.0089    1.7097 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6778    3.7436    0.3705 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4769    4.0181    0.0545 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3131    3.9974   -1.2866 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3991    3.0565   -1.1155 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4255    1.1729   -2.7646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0849    2.9070   -3.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8232    2.3790   -1.4506 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4453    3.5492    0.5076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3713    4.1386   -0.7566 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8468    2.9076    1.7048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0721   -1.5582   -3.6399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4084   -2.2151   -3.4990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6997   -2.8512   -2.4091 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3700   -1.7830   -1.7103 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6755   -1.4987   -1.2512 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2781   -1.8829    0.3595 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1367   -0.9004    2.3806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9268   -0.5390    2.4869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9422   -3.0137    2.1973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3882    0.7023    1.5395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6443    2.9766    3.4190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9993    2.5828    2.2339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3807    1.3542    3.3977 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2203   -0.7568   -2.0113 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8502   -1.8436   -1.3678 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6287   -2.5876   -0.7959 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1889   -1.0538   -1.6126 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1587   -3.4960    0.1742 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9140   -3.3380   -1.4952 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5214   -3.0749   -0.1200 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2370    0.2339    0.0914 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4602   -0.0422    0.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4424   -1.9321    2.2381 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8360    0.4861    2.2111 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9364   -3.3299    1.0984 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8002   -1.6572    2.5901 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 17 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
  5 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28  3  1  0
 39 30  1  0
 23 12  1  0
  1 41  1  0
  1 42  1  0
  1 43  1  0
  4 44  1  0
  6 45  1  0
  7 46  1  0
  8 47  1  0
  9 48  1  0
  9 49  1  0
 10 50  1  0
 15 51  1  0
 15 52  1  0
 15 53  1  0
 16 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 20 58  1  0
 21 59  1  0
 22 60  1  0
 25 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 27 65  1  0
 30 66  1  0
 32 67  1  0
 33 68  1  0
 33 69  1  0
 34 70  1  0
 35 71  1  0
 36 72  1  0
 37 73  1  0
 38 74  1  0
 39 75  1  0
 40 76  1  0
M  END

  Mrv0541 05061310572D          

 40 42  0  0  0  0            999 V2000
    3.5724    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  4  2  0  0  0  0
  7  6  2  0  0  0  0
  8  4  1  0  0  0  0
 14  5  1  0  0  0  0
 14  9  2  0  0  0  0
 14 10  1  0  0  0  0
 15  6  1  0  0  0  0
 15 11  2  0  0  0  0
 16  7  1  0  0  0  0
 17 11  1  0  0  0  0
 17 16  2  0  0  0  0
 18  9  1  0  0  0  0
 19 10  2  0  0  0  0
 20 12  1  0  0  0  0
 21 13  1  0  0  0  0
 22 15  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 18  2  0  0  0  0
 26 19  1  0  0  0  0
 27 25  1  0  0  0  0
 28  8  1  0  0  0  0
 29 12  1  0  0  0  0
 30 13  1  0  0  0  0
 31 22  1  0  0  0  0
 32 23  1  0  0  0  0
 33 24  1  0  0  0  0
 34 25  1  0  0  0  0
 35  1  1  0  0  0  0
 35 17  1  0  0  0  0
 36  2  1  0  0  0  0
 36 18  1  0  0  0  0
 37  3  1  0  0  0  0
 37 19  1  0  0  0  0
 38 20  1  0  0  0  0
 38 26  1  0  0  0  0
 39 16  1  0  0  0  0
 39 27  1  0  0  0  0
 40 21  1  0  0  0  0
 40 27  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039231

> <DATABASE_NAME>
hmdb

> <SMILES>
COC1=CC(\C=C/CO)=CC(OC)=C1OC(CO)C(O)C1=CC(OC)=C(OC2OC(CO)C(O)C(O)C2O)C=C1

> <INCHI_IDENTIFIER>
InChI=1S/C27H36O13/c1-35-17-11-15(6-7-16(17)39-27-25(34)24(33)23(32)21(13-30)40-27)22(31)20(12-29)38-26-18(36-2)9-14(5-4-8-28)10-19(26)37-3/h4-7,9-11,20-25,27-34H,8,12-13H2,1-3H3/b5-4-

> <INCHI_KEY>
XMGKCJUCYBLMBY-PLNGDYQASA-N

> <FORMULA>
C27H36O13

> <MOLECULAR_WEIGHT>
568.5669

> <EXACT_MASS>
568.215591238

> <JCHEM_ACCEPTOR_COUNT>
13

> <JCHEM_AVERAGE_POLARIZABILITY>
57.76784205369434

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
7

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-[4-(1,3-dihydroxy-2-{4-[(1Z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}propyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol

> <ALOGPS_LOGP>
0.24

> <JCHEM_LOGP>
-0.922703522333333

> <ALOGPS_LOGS>
-3.05

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
12.979978463650248

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.167474409136984

> <JCHEM_PKA_STRONGEST_BASIC>
-2.5264907609046254

> <JCHEM_POLAR_SURFACE_AREA>
196.98999999999995

> <JCHEM_REFRACTIVITY>
139.70819999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
13

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
5.06e-01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-[4-(1,3-dihydroxy-2-{4-[(1Z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}propyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0039231
     RDKit          3D
Citrusin B
 76 78  0  0  0  0  0  0  0  0999 V2000
    3.5356    3.5429   -0.3046 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7120    2.1456   -0.3621 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6660    1.3539   -0.8023 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4835    1.9601   -1.1707 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3989    1.2377   -1.6182 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8825    1.8210   -2.0140 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6768    3.0231   -2.7182 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8601    2.0814   -0.9216 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5358    3.2846   -0.0622 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4978    3.0940    0.8143 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1848    0.9732   -0.1275 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4695    0.4633   -0.0745 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8323   -0.5041   -1.0075 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9506   -0.9574   -1.9708 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3252   -1.9358   -2.9100 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0859   -1.0295   -0.9850 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0865   -0.6585   -0.0557 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3982   -1.2212   -0.2067 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3037   -1.4499    0.6783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1539   -1.1815    2.0990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3467   -2.4697    2.7672 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6755    0.2997    0.8376 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3986    0.8644    0.8510 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0947    1.8152    1.7956 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0719    2.2067    2.7352 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5689   -0.1294   -1.6756 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7465   -0.7582   -1.3111 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8223   -0.0334   -0.8661 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0353   -0.5600   -0.4799 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4198   -1.8918   -0.4575 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5077   -2.1087   -1.2953 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7021   -1.6583   -0.7987 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6654   -2.8237   -0.5466 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8658   -2.3206   -0.0431 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6025   -0.7760    0.3996 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9164   -0.5945    0.8892 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7943   -1.3635    1.5163 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2397   -0.3173    2.2482 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7276   -2.2663    0.9759 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5494   -2.0089    1.7097 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6778    3.7436    0.3705 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4769    4.0181    0.0545 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3131    3.9974   -1.2866 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3991    3.0565   -1.1155 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4255    1.1729   -2.7646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0849    2.9070   -3.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8232    2.3790   -1.4506 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4453    3.5492    0.5076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3713    4.1386   -0.7566 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8468    2.9076    1.7048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0721   -1.5582   -3.6399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4084   -2.2151   -3.4990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6997   -2.8512   -2.4091 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3700   -1.7830   -1.7103 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6755   -1.4987   -1.2512 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2781   -1.8829    0.3595 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1367   -0.9004    2.3806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9268   -0.5390    2.4869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9422   -3.0137    2.1973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3882    0.7023    1.5395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6443    2.9766    3.4190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9993    2.5828    2.2339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3807    1.3542    3.3977 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2203   -0.7568   -2.0113 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8502   -1.8436   -1.3678 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6287   -2.5876   -0.7959 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1889   -1.0538   -1.6126 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1587   -3.4960    0.1742 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9140   -3.3380   -1.4952 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5214   -3.0749   -0.1200 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2370    0.2339    0.0914 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4602   -0.0422    0.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4424   -1.9321    2.2381 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8360    0.4861    2.2111 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9364   -3.3299    1.0984 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8002   -1.6572    2.5901 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 17 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
  5 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28  3  1  0
 39 30  1  0
 23 12  1  0
  1 41  1  0
  1 42  1  0
  1 43  1  0
  4 44  1  0
  6 45  1  0
  7 46  1  0
  8 47  1  0
  9 48  1  0
  9 49  1  0
 10 50  1  0
 15 51  1  0
 15 52  1  0
 15 53  1  0
 16 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 20 58  1  0
 21 59  1  0
 22 60  1  0
 25 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 27 65  1  0
 30 66  1  0
 32 67  1  0
 33 68  1  0
 33 69  1  0
 34 70  1  0
 35 71  1  0
 36 72  1  0
 37 73  1  0
 38 74  1  0
 39 75  1  0
 40 76  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       6.668   8.470   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -2.667  -4.620   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -2.667  -3.080   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       2.667   6.160   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -1.334  -5.390   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       1.334  13.090   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.001   6.930   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       5.335   6.160   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       1.334  11.550   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       0.000  10.780   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       0.000   9.240   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       1.334   8.470   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       2.667   9.240   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      -1.334  -6.930   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       1.334   3.850   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       0.000  13.860   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -1.334  11.550   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -1.334   8.470   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       1.334   6.930   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       6.668   6.930   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       2.667  -3.080   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       4.001   8.470   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       2.667  10.780   0.000  0.00  0.00           O+0
CONECT    1   35                                                            
CONECT    2   36                                                            
CONECT    3   37                                                            
CONECT    4    5    8                                                       
CONECT    5    4   14                                                       
CONECT    6    7   15                                                       
CONECT    7    6   16                                                       
CONECT    8    4   28                                                       
CONECT    9   14   18                                                       
CONECT   10   14   19                                                       
CONECT   11   15   17                                                       
CONECT   12   20   29                                                       
CONECT   13   21   30                                                       
CONECT   14    5    9   10                                                  
CONECT   15    6   11   22                                                  
CONECT   16    7   17   39                                                  
CONECT   17   11   16   35                                                  
CONECT   18    9   26   36                                                  
CONECT   19   10   26   37                                                  
CONECT   20   12   22   38                                                  
CONECT   21   13   23   40                                                  
CONECT   22   15   20   31                                                  
CONECT   23   21   24   32                                                  
CONECT   24   23   25   33                                                  
CONECT   25   24   27   34                                                  
CONECT   26   18   19   38                                                  
CONECT   27   25   39   40                                                  
CONECT   28    8                                                            
CONECT   29   12                                                            
CONECT   30   13                                                            
CONECT   31   22                                                            
CONECT   32   23                                                            
CONECT   33   24                                                            
CONECT   34   25                                                            
CONECT   35    1   17                                                       
CONECT   36    2   18                                                       
CONECT   37    3   19                                                       
CONECT   38   20   26                                                       
CONECT   39   16   27                                                       
CONECT   40   21   27                                                       
MASTER        0    0    0    0    0    0    0    0   40    0   84    0
END

COMPND    HMDB0039231
HETATM    1  C1  UNL     1       3.536   3.543  -0.305  1.00  0.00           C  
HETATM    2  O1  UNL     1       3.712   2.146  -0.362  1.00  0.00           O  
HETATM    3  C2  UNL     1       2.666   1.354  -0.802  1.00  0.00           C  
HETATM    4  C3  UNL     1       1.483   1.960  -1.171  1.00  0.00           C  
HETATM    5  C4  UNL     1       0.399   1.238  -1.618  1.00  0.00           C  
HETATM    6  C5  UNL     1      -0.882   1.821  -2.014  1.00  0.00           C  
HETATM    7  O2  UNL     1      -0.677   3.023  -2.718  1.00  0.00           O  
HETATM    8  C6  UNL     1      -1.860   2.081  -0.922  1.00  0.00           C  
HETATM    9  C7  UNL     1      -1.536   3.285  -0.062  1.00  0.00           C  
HETATM   10  O3  UNL     1      -0.498   3.094   0.814  1.00  0.00           O  
HETATM   11  O4  UNL     1      -2.185   0.973  -0.127  1.00  0.00           O  
HETATM   12  C8  UNL     1      -3.469   0.463  -0.075  1.00  0.00           C  
HETATM   13  C9  UNL     1      -3.832  -0.504  -1.008  1.00  0.00           C  
HETATM   14  O5  UNL     1      -2.951  -0.957  -1.971  1.00  0.00           O  
HETATM   15  C10 UNL     1      -3.325  -1.936  -2.910  1.00  0.00           C  
HETATM   16  C11 UNL     1      -5.086  -1.030  -0.985  1.00  0.00           C  
HETATM   17  C12 UNL     1      -6.087  -0.658  -0.056  1.00  0.00           C  
HETATM   18  C13 UNL     1      -7.398  -1.221  -0.207  1.00  0.00           C  
HETATM   19  C14 UNL     1      -8.304  -1.450   0.678  1.00  0.00           C  
HETATM   20  C15 UNL     1      -8.154  -1.181   2.099  1.00  0.00           C  
HETATM   21  O6  UNL     1      -8.347  -2.470   2.767  1.00  0.00           O  
HETATM   22  C16 UNL     1      -5.676   0.300   0.838  1.00  0.00           C  
HETATM   23  C17 UNL     1      -4.399   0.864   0.851  1.00  0.00           C  
HETATM   24  O7  UNL     1      -4.095   1.815   1.796  1.00  0.00           O  
HETATM   25  C18 UNL     1      -5.072   2.207   2.735  1.00  0.00           C  
HETATM   26  C19 UNL     1       0.569  -0.129  -1.676  1.00  0.00           C  
HETATM   27  C20 UNL     1       1.747  -0.758  -1.311  1.00  0.00           C  
HETATM   28  C21 UNL     1       2.822  -0.033  -0.866  1.00  0.00           C  
HETATM   29  O8  UNL     1       4.035  -0.560  -0.480  1.00  0.00           O  
HETATM   30  C22 UNL     1       4.420  -1.892  -0.458  1.00  0.00           C  
HETATM   31  O9  UNL     1       5.508  -2.109  -1.295  1.00  0.00           O  
HETATM   32  C23 UNL     1       6.702  -1.658  -0.799  1.00  0.00           C  
HETATM   33  C24 UNL     1       7.665  -2.824  -0.547  1.00  0.00           C  
HETATM   34  O10 UNL     1       8.866  -2.321  -0.043  1.00  0.00           O  
HETATM   35  C25 UNL     1       6.602  -0.776   0.400  1.00  0.00           C  
HETATM   36  O11 UNL     1       7.916  -0.595   0.889  1.00  0.00           O  
HETATM   37  C26 UNL     1       5.794  -1.364   1.516  1.00  0.00           C  
HETATM   38  O12 UNL     1       5.240  -0.317   2.248  1.00  0.00           O  
HETATM   39  C27 UNL     1       4.728  -2.266   0.976  1.00  0.00           C  
HETATM   40  O13 UNL     1       3.549  -2.009   1.710  1.00  0.00           O  
HETATM   41  H1  UNL     1       2.678   3.744   0.370  1.00  0.00           H  
HETATM   42  H2  UNL     1       4.477   4.018   0.055  1.00  0.00           H  
HETATM   43  H3  UNL     1       3.313   3.997  -1.287  1.00  0.00           H  
HETATM   44  H4  UNL     1       1.399   3.057  -1.115  1.00  0.00           H  
HETATM   45  H5  UNL     1      -1.426   1.173  -2.765  1.00  0.00           H  
HETATM   46  H6  UNL     1       0.085   2.907  -3.351  1.00  0.00           H  
HETATM   47  H7  UNL     1      -2.823   2.379  -1.451  1.00  0.00           H  
HETATM   48  H8  UNL     1      -2.445   3.549   0.508  1.00  0.00           H  
HETATM   49  H9  UNL     1      -1.371   4.139  -0.757  1.00  0.00           H  
HETATM   50  H10 UNL     1      -0.847   2.908   1.705  1.00  0.00           H  
HETATM   51  H11 UNL     1      -4.072  -1.558  -3.640  1.00  0.00           H  
HETATM   52  H12 UNL     1      -2.408  -2.215  -3.499  1.00  0.00           H  
HETATM   53  H13 UNL     1      -3.700  -2.851  -2.409  1.00  0.00           H  
HETATM   54  H14 UNL     1      -5.370  -1.783  -1.710  1.00  0.00           H  
HETATM   55  H15 UNL     1      -7.676  -1.499  -1.251  1.00  0.00           H  
HETATM   56  H16 UNL     1      -9.278  -1.883   0.359  1.00  0.00           H  
HETATM   57  H17 UNL     1      -7.137  -0.900   2.381  1.00  0.00           H  
HETATM   58  H18 UNL     1      -8.927  -0.539   2.487  1.00  0.00           H  
HETATM   59  H19 UNL     1      -8.942  -3.014   2.197  1.00  0.00           H  
HETATM   60  H20 UNL     1      -6.388   0.702   1.540  1.00  0.00           H  
HETATM   61  H21 UNL     1      -4.644   2.977   3.419  1.00  0.00           H  
HETATM   62  H22 UNL     1      -5.999   2.583   2.234  1.00  0.00           H  
HETATM   63  H23 UNL     1      -5.381   1.354   3.398  1.00  0.00           H  
HETATM   64  H24 UNL     1      -0.220  -0.757  -2.011  1.00  0.00           H  
HETATM   65  H25 UNL     1       1.850  -1.844  -1.368  1.00  0.00           H  
HETATM   66  H26 UNL     1       3.629  -2.588  -0.796  1.00  0.00           H  
HETATM   67  H27 UNL     1       7.189  -1.054  -1.613  1.00  0.00           H  
HETATM   68  H28 UNL     1       7.159  -3.496   0.174  1.00  0.00           H  
HETATM   69  H29 UNL     1       7.914  -3.338  -1.495  1.00  0.00           H  
HETATM   70  H30 UNL     1       9.521  -3.075  -0.120  1.00  0.00           H  
HETATM   71  H31 UNL     1       6.237   0.234   0.091  1.00  0.00           H  
HETATM   72  H32 UNL     1       8.460  -0.042   0.283  1.00  0.00           H  
HETATM   73  H33 UNL     1       6.442  -1.932   2.238  1.00  0.00           H  
HETATM   74  H34 UNL     1       5.836   0.486   2.211  1.00  0.00           H  
HETATM   75  H35 UNL     1       4.936  -3.330   1.098  1.00  0.00           H  
HETATM   76  H36 UNL     1       3.800  -1.657   2.590  1.00  0.00           H  
CONECT    1    2   41   42   43
CONECT    2    3
CONECT    3    4    4   28
CONECT    4    5   44
CONECT    5    6   26   26
CONECT    6    7    8   45
CONECT    7   46
CONECT    8    9   11   47
CONECT    9   10   48   49
CONECT   10   50
CONECT   11   12
CONECT   12   13   13   23
CONECT   13   14   16
CONECT   14   15
CONECT   15   51   52   53
CONECT   16   17   17   54
CONECT   17   18   22
CONECT   18   19   19   55
CONECT   19   20   56
CONECT   20   21   57   58
CONECT   21   59
CONECT   22   23   23   60
CONECT   23   24
CONECT   24   25
CONECT   25   61   62   63
CONECT   26   27   64
CONECT   27   28   28   65
CONECT   28   29
CONECT   29   30
CONECT   30   31   39   66
CONECT   31   32
CONECT   32   33   35   67
CONECT   33   34   68   69
CONECT   34   70
CONECT   35   36   37   71
CONECT   36   72
CONECT   37   38   39   73
CONECT   38   74
CONECT   39   40   75
CONECT   40   76
END

HMDB0039231
     RDKit          3D
Citrusin B
 76 78  0  0  0  0  0  0  0  0999 V2000
    3.5356    3.5429   -0.3046 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7120    2.1456   -0.3621 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6660    1.3539   -0.8023 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4835    1.9601   -1.1707 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3989    1.2377   -1.6182 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8825    1.8210   -2.0140 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6768    3.0231   -2.7182 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8601    2.0814   -0.9216 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5358    3.2846   -0.0622 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4978    3.0940    0.8143 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1848    0.9732   -0.1275 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4695    0.4633   -0.0745 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8323   -0.5041   -1.0075 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9506   -0.9574   -1.9708 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3252   -1.9358   -2.9100 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0859   -1.0295   -0.9850 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0865   -0.6585   -0.0557 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3982   -1.2212   -0.2067 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3037   -1.4499    0.6783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1539   -1.1815    2.0990 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3467   -2.4697    2.7672 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6755    0.2997    0.8376 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3986    0.8644    0.8510 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0947    1.8152    1.7956 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0719    2.2067    2.7352 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5689   -0.1294   -1.6756 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7465   -0.7582   -1.3111 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8223   -0.0334   -0.8661 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0353   -0.5600   -0.4799 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4198   -1.8918   -0.4575 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5077   -2.1087   -1.2953 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7021   -1.6583   -0.7987 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6654   -2.8237   -0.5466 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8658   -2.3206   -0.0431 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6025   -0.7760    0.3996 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9164   -0.5945    0.8892 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7943   -1.3635    1.5163 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2397   -0.3173    2.2482 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7276   -2.2663    0.9759 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5494   -2.0089    1.7097 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6778    3.7436    0.3705 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4769    4.0181    0.0545 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3131    3.9974   -1.2866 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3991    3.0565   -1.1155 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4255    1.1729   -2.7646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0849    2.9070   -3.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8232    2.3790   -1.4506 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4453    3.5492    0.5076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3713    4.1386   -0.7566 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8468    2.9076    1.7048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0721   -1.5582   -3.6399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4084   -2.2151   -3.4990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6997   -2.8512   -2.4091 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3700   -1.7830   -1.7103 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6755   -1.4987   -1.2512 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2781   -1.8829    0.3595 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1367   -0.9004    2.3806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9268   -0.5390    2.4869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9422   -3.0137    2.1973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3882    0.7023    1.5395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6443    2.9766    3.4190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9993    2.5828    2.2339 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3807    1.3542    3.3977 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2203   -0.7568   -2.0113 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8502   -1.8436   -1.3678 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6287   -2.5876   -0.7959 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1889   -1.0538   -1.6126 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1587   -3.4960    0.1742 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9140   -3.3380   -1.4952 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5214   -3.0749   -0.1200 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2370    0.2339    0.0914 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4602   -0.0422    0.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4424   -1.9321    2.2381 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8360    0.4861    2.2111 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9364   -3.3299    1.0984 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8002   -1.6572    2.5901 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 17 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
  5 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28  3  1  0
 39 30  1  0
 23 12  1  0
  1 41  1  0
  1 42  1  0
  1 43  1  0
  4 44  1  0
  6 45  1  0
  7 46  1  0
  8 47  1  0
  9 48  1  0
  9 49  1  0
 10 50  1  0
 15 51  1  0
 15 52  1  0
 15 53  1  0
 16 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 20 58  1  0
 21 59  1  0
 22 60  1  0
 25 61  1  0
 25 62  1  0
 25 63  1  0
 26 64  1  0
 27 65  1  0
 30 66  1  0
 32 67  1  0
 33 68  1  0
 33 69  1  0
 34 70  1  0
 35 71  1  0
 36 72  1  0
 37 73  1  0
 38 74  1  0
 39 75  1  0
 40 76  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Not Available

Chemical Formula

C₂₇H₃₆O₁₃

Average Molecular Weight

568.5669

Monoisotopic Molecular Weight

568.215591238

IUPAC Name

2-[4-(1,3-dihydroxy-2-{4-[(1Z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}propyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol

Traditional Name

2-[4-(1,3-dihydroxy-2-{4-[(1Z)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenoxy}propyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol

CAS Registry Number

105279-10-5

SMILES

COC1=CC(\C=C/CO)=CC(OC)=C1OC(CO)C(O)C1=CC(OC)=C(OC2OC(CO)C(O)C(O)C2O)C=C1

InChI Identifier

InChI=1S/C27H36O13/c1-35-17-11-15(6-7-16(17)39-27-25(34)24(33)23(32)21(13-30)40-27)22(31)20(12-29)38-26-18(36-2)9-14(5-4-8-28)10-19(26)37-3/h4-7,9-11,20-25,27-34H,8,12-13H2,1-3H3/b5-4-

InChI Key

XMGKCJUCYBLMBY-PLNGDYQASA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as lignan glycosides. These are aromatic polycyclic compounds containing a carbohydrate component glycosidically linked to a lignan moiety. They include 1-aryltetralin lactones.

Kingdom

Organic compounds

Super Class

Lignans, neolignans and related compounds

Class

Lignan glycosides

Sub Class

Not Available

Direct Parent

Lignan glycosides

Alternative Parents

Substituents

Lignan glycoside
Phenolic glycoside
Hexose monosaccharide
O-glycosyl compound
Glycosyl compound
Cinnamyl alcohol
M-dimethoxybenzene
Dimethoxybenzene
Phenoxy compound
Phenol ether
Anisole
Styrene
Methoxybenzene
Alkyl aryl ether
Oxane
Monosaccharide
Monocyclic benzene moiety
Benzenoid
Secondary alcohol
Acetal
Oxacycle
Organoheterocyclic compound
Ether
Polyol
Organic oxygen compound
Alcohol
Hydrocarbon derivative
Aromatic alcohol
Primary alcohol
Organooxygen compound
Aromatic heteromonocyclic compound

Molecular Framework

Aromatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0039231)
Cytoplasm (HMDB: HMDB0039231)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0039231)

Source

Exogenous

Exogenous (HMDB: HMDB0039231)

Food

Food (HMDB: HMDB0039231)

Fruit

Citrus

Lemon (FooDB: FOOD00054)
Citrus (FooDB: FOOD00859)

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0039231)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0039231)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	105 - 106 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	12140 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.51 g/L	ALOGPS
logP	0.24	ALOGPS
logP	-0.92	ChemAxon
logS	-3	ALOGPS
pKa (Strongest Acidic)	12.17	ChemAxon
pKa (Strongest Basic)	-2.5	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	13	ChemAxon
Hydrogen Donor Count	7	ChemAxon
Polar Surface Area	196.99 Å²	ChemAxon
Rotatable Bond Count	13	ChemAxon
Refractivity	139.71 m³·mol⁻¹	ChemAxon
Polarizability	57.77 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	228.526	31661259
DarkChem	[M-H]-	221.18	31661259
DeepCCS	[M+H]+	219.974	30932474
DeepCCS	[M-H]-	217.578	30932474
DeepCCS	[M-2H]-	250.461	30932474
DeepCCS	[M+Na]+	225.886	30932474
AllCCS	[M+H]+	231.6	32859911
AllCCS	[M+H-H2O]+	230.3	32859911
AllCCS	[M+NH4]+	232.7	32859911
AllCCS	[M+Na]+	233.1	32859911
AllCCS	[M-H]-	221.6	32859911
AllCCS	[M+Na-2H]-	223.9	32859911
AllCCS	[M+HCOO]-	226.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Citrusin B	COC1=CC(\C=C/CO)=CC(OC)=C1OC(CO)C(O)C1=CC(OC)=C(OC2OC(CO)C(O)C(O)C2O)C=C1	4720.6	Standard polar	33892256
Citrusin B	COC1=CC(\C=C/CO)=CC(OC)=C1OC(CO)C(O)C1=CC(OC)=C(OC2OC(CO)C(O)C(O)C2O)C=C1	4795.5	Standard non polar	33892256
Citrusin B	COC1=CC(\C=C/CO)=CC(OC)=C1OC(CO)C(O)C1=CC(OC)=C(OC2OC(CO)C(O)C(O)C2O)C=C1	4827.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Citrusin B,1TMS,isomer #1	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4709.4	Semi standard non polar	33892256
Citrusin B,1TMS,isomer #2	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4708.2	Semi standard non polar	33892256
Citrusin B,1TMS,isomer #3	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4698.6	Semi standard non polar	33892256
Citrusin B,1TMS,isomer #4	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4681.1	Semi standard non polar	33892256
Citrusin B,1TMS,isomer #5	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4673.4	Semi standard non polar	33892256
Citrusin B,1TMS,isomer #6	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4633.3	Semi standard non polar	33892256
Citrusin B,1TMS,isomer #7	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4676.9	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #1	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4554.1	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #10	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4504.4	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #11	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4554.2	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #12	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4535.3	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #13	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4543.1	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #14	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4487.7	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #15	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4546.5	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #16	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4542.8	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #17	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4495.8	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #18	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4556.1	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #19	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4507.7	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #2	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4569.4	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #20	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4521.5	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #21	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4534.0	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #3	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4543.6	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #4	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4551.3	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #5	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4514.6	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #6	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4555.0	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #7	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4562.2	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #8	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4556.0	Semi standard non polar	33892256
Citrusin B,2TMS,isomer #9	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4549.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #1	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4403.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #10	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4424.3	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #11	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4379.2	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #12	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4440.0	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #13	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4385.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #14	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4414.4	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #15	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4411.3	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #16	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4407.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #17	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4416.9	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #18	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4368.0	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #19	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4417.7	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #2	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4384.2	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #20	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4438.6	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #21	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4389.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #22	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4449.9	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #23	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4389.2	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #24	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4415.9	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #25	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4416.8	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #26	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4423.5	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #27	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4371.7	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #28	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4434.3	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #29	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4382.3	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #3	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4409.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #30	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4408.9	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #31	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4407.5	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #32	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4413.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #33	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4470.1	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #34	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4436.9	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #35	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4435.4	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #4	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4359.2	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #5	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4409.6	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #6	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4403.6	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #7	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4416.3	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #8	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4375.8	Semi standard non polar	33892256
Citrusin B,3TMS,isomer #9	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4420.1	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #1	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4258.2	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #10	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4255.1	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #11	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4312.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #12	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4274.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #13	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4322.9	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #14	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4271.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #15	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4297.1	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #16	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4287.1	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #17	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4297.2	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #18	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4350.5	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #19	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4317.9	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #2	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4268.9	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #20	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4311.5	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #21	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4313.9	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #22	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4262.8	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #23	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4325.5	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #24	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4264.9	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #25	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4298.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #26	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4283.7	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #27	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4329.4	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #28	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4376.8	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #29	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4349.1	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #3	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4233.2	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #30	COC1=CC(C(O)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4341.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #31	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4291.4	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #32	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4349.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #33	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4314.2	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #34	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4312.0	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #35	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4388.3	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #4	COC1=CC(C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4270.0	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #5	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4278.4	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #6	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4239.2	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #7	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4291.0	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #8	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4239.7	Semi standard non polar	33892256
Citrusin B,4TMS,isomer #9	COC1=CC(C(O[Si](C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4269.1	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #1	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4933.5	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #2	COC1=CC(C(O)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4928.7	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #3	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	4915.8	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #4	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4880.5	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #5	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4916.9	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #6	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4891.6	Semi standard non polar	33892256
Citrusin B,1TBDMS,isomer #7	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4912.8	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #1	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	5008.9	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #10	COC1=CC(C(O)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4980.8	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #11	COC1=CC(C(O)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4990.5	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #12	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4975.3	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #13	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4977.1	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #14	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4949.5	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #15	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4967.4	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #16	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4977.3	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #17	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4967.1	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #18	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4980.7	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #19	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4962.1	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #2	COC1=CC(C(O)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	5029.0	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #20	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4966.8	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #21	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4987.7	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #3	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4976.6	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #4	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5000.2	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #5	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4986.9	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #6	COC1=CC(C(O)C(CO)OC2=C(OC)C=C(/C=C\CO[Si](C)(C)C(C)(C)C)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4993.8	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #7	COC1=CC(C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O)C(O)C1O	5021.0	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #8	COC1=CC(C(O)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4994.9	Semi standard non polar	33892256
Citrusin B,2TBDMS,isomer #9	COC1=CC(C(O)C(CO[Si](C)(C)C(C)(C)C)OC2=C(OC)C=C(/C=C\CO)C=C2OC)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5001.2	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (Non-derivatized) - 70eV, Positive	splash10-0w29-5923170000-bd8846a4e8f35d82429b	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (1 TMS) - 70eV, Positive	splash10-0il0-7923006000-5eb509c4d71e456d02c8	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS ("Citrusin B,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_15) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin B GC-MS (TMS_2_16) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 10V, Positive-QTOF	splash10-1009-0216390000-91ad21d6b5d2cd580ce8	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 20V, Positive-QTOF	splash10-000i-0619220000-956d922e3fc1ba6ed3fc	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 40V, Positive-QTOF	splash10-0ikc-1954000000-27cda94f5b35da8a2696	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 10V, Negative-QTOF	splash10-066r-1312390000-43b6d39594330705b8a9	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 20V, Negative-QTOF	splash10-0a4i-0985230000-f3c76b37777c33d6663b	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 40V, Negative-QTOF	splash10-052f-1950000000-092e480e46e44966ab7e	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 10V, Negative-QTOF	splash10-014i-0000090000-fe4439cce3e5065cff64	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 20V, Negative-QTOF	splash10-00fr-1215190000-b2843ae3c18ed0325819	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 40V, Negative-QTOF	splash10-0006-1921030000-d70a3cef7f0841c5ed24	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 10V, Positive-QTOF	splash10-0lec-0105090000-1b976a7628b2ca3c35f2	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 20V, Positive-QTOF	splash10-0pwi-0109060000-45ebbac86cc21a3cbd90	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin B 40V, Positive-QTOF	splash10-001i-1922110000-6c051d29441ef071f1c1	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB018764

KNApSAcK ID

C00040918

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131752580

PDB ID

Not Available

ChEBI ID

176070

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1875291

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Citrusin B (HMDB0039231)

MOL for HMDB0039231 (Citrusin B)

3D MOL for HMDB0039231 (Citrusin B)

3D SDF for HMDB0039231 (Citrusin B)

3D-SDF for HMDB0039231 (Citrusin B)

PDB for HMDB0039231 (Citrusin B)

3D PDB for HMDB0039231 (Citrusin B)

SMILES for HMDB0039231 (Citrusin B)

INCHI for HMDB0039231 (Citrusin B)

Structure for HMDB0039231 (Citrusin B)

3D Structure for HMDB0039231 (Citrusin B)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra