Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 00:37:04 UTC

Update Date

2022-03-07 02:56:07 UTC

HMDB ID

HMDB0039235

Secondary Accession Numbers

HMDB39235

Metabolite Identification

Common Name

Citrusin F

Description

Citrusin F belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Citrusin F has been detected, but not quantified in, citrus and lemons (Citrus limon). This could make citrusin F a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Citrusin F.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061310572D          

 36 38  0  0  0  0            999 V2000
    5.7158    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    9.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013    7.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013    9.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158    8.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158    6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    7.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  2  0  0  0  0
  5  3  1  0  0  0  0
  9  2  1  0  0  0  0
  9  3  1  0  0  0  0
  9  6  2  0  0  0  0
 10  6  1  0  0  0  0
 11  4  1  0  0  0  0
 11 10  2  0  0  0  0
 12  7  1  0  0  0  0
 13  8  1  0  0  0  0
 14  5  1  0  0  0  0
 15 12  1  0  0  0  0
 16 13  1  0  0  0  0
 17 15  1  0  0  0  0
 18 16  1  0  0  0  0
 19 17  1  0  0  0  0
 20 18  1  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23  7  1  0  0  0  0
 24 10  1  0  0  0  0
 25 14  2  0  0  0  0
 26 15  1  0  0  0  0
 27 16  1  0  0  0  0
 28 17  1  0  0  0  0
 29 18  1  0  0  0  0
 30 19  1  0  0  0  0
 31 20  1  0  0  0  0
 32  1  1  0  0  0  0
 32 14  1  0  0  0  0
 33  8  1  0  0  0  0
 33 21  1  0  0  0  0
 34 11  1  0  0  0  0
 34 22  1  0  0  0  0
 35 12  1  0  0  0  0
 35 21  1  0  0  0  0
 36 13  1  0  0  0  0
 36 22  1  0  0  0  0
M  END

HMDB0039235
     RDKit          3D
Citrusin F
 68 70  0  0  0  0  0  0  0  0999 V2000
    7.1136   -2.7078   -2.3115 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6613   -1.7648   -1.4220 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0440   -1.5956   -0.1613 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0591   -2.3089    0.0436 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5841   -0.6265    0.7890 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8771   -0.5150    2.0803 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4731   -0.1173    2.0605 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4652   -1.0475    2.1434 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1374   -0.7178    2.1096 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7222    0.6218    1.9867 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4076    0.9241    1.9558 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6367    2.0360    1.8631 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1045    2.0040    0.6741 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1037    1.0670    0.6566 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9160    1.1098   -0.6222 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8877    0.1242   -0.5147 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6509    0.1532   -1.6783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6561   -1.0721   -2.2835 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2632   -1.1306   -3.4995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7839   -2.5645   -3.6753 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6873   -2.9087   -2.6948 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3035   -0.1244   -3.7906 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4094   -0.8090   -4.3520 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8105    0.6722   -2.6504 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2017    0.4964   -2.4465 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1152    0.4759   -1.3455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6217   -0.6043   -0.6184 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1169    1.2671    1.7837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0976    0.2908    1.7209 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3225    1.1164    3.0661 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0978    1.1238    4.1994 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2977    2.2341    3.0554 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3961    2.1551    4.2516 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7174    1.5723    1.9029 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4427    2.9324    1.7795 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0576    1.2006    1.9398 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3439   -2.3068   -2.9822 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6477   -3.5689   -1.7718 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9566   -3.1370   -2.8929 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6329   -0.9880    1.0305 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7709    0.3649    0.3024 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4324    0.1385    2.8051 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9140   -1.5319    2.5718 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6862   -2.1207    2.2676 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3623   -1.4795    2.1767 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2465    2.9575    1.8036 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7040    0.0482    0.7651 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2624    0.9568   -1.5125 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3508    2.1259   -0.7162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3248    0.9168   -2.4007 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4480   -1.0520   -4.2810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9413   -3.2778   -3.7153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3306   -2.6523   -4.6596 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3176   -3.6444   -2.1531 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669    0.5676   -4.6186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5254   -0.6485   -5.2995 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7296    1.7762   -2.8892 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4043    0.3173   -1.5098 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1610    1.3886   -0.7085 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8913   -1.1535   -0.2466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5399    2.2850    1.6644 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9622    0.7397    1.9151 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7376    0.1624    2.9395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9717    0.2373    4.6468 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7973    3.2128    2.9616 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0049    2.7422    4.9216 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1898    3.5790    1.7156 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8413    1.9461    1.8744 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 10 34  1  0
 34 35  1  0
 34 36  2  0
 36  7  1  0
 32 12  1  0
 26 17  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  5 40  1  0
  5 41  1  0
  6 42  1  0
  6 43  1  0
  8 44  1  0
  9 45  1  0
 12 46  1  0
 14 47  1  0
 15 48  1  0
 15 49  1  0
 17 50  1  0
 19 51  1  0
 20 52  1  0
 20 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 29 62  1  0
 30 63  1  0
 31 64  1  0
 32 65  1  0
 33 66  1  0
 35 67  1  0
 36 68  1  0
M  END

  Mrv0541 05061310572D          

 36 38  0  0  0  0            999 V2000
    5.7158    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    9.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013    7.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013    9.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158    8.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158    6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    7.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  2  0  0  0  0
  5  3  1  0  0  0  0
  9  2  1  0  0  0  0
  9  3  1  0  0  0  0
  9  6  2  0  0  0  0
 10  6  1  0  0  0  0
 11  4  1  0  0  0  0
 11 10  2  0  0  0  0
 12  7  1  0  0  0  0
 13  8  1  0  0  0  0
 14  5  1  0  0  0  0
 15 12  1  0  0  0  0
 16 13  1  0  0  0  0
 17 15  1  0  0  0  0
 18 16  1  0  0  0  0
 19 17  1  0  0  0  0
 20 18  1  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23  7  1  0  0  0  0
 24 10  1  0  0  0  0
 25 14  2  0  0  0  0
 26 15  1  0  0  0  0
 27 16  1  0  0  0  0
 28 17  1  0  0  0  0
 29 18  1  0  0  0  0
 30 19  1  0  0  0  0
 31 20  1  0  0  0  0
 32  1  1  0  0  0  0
 32 14  1  0  0  0  0
 33  8  1  0  0  0  0
 33 21  1  0  0  0  0
 34 11  1  0  0  0  0
 34 22  1  0  0  0  0
 35 12  1  0  0  0  0
 35 21  1  0  0  0  0
 36 13  1  0  0  0  0
 36 22  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039235

> <DATABASE_NAME>
hmdb

> <SMILES>
COC(=O)CCC1=CC(O)=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C=C1

> <INCHI_IDENTIFIER>
InChI=1S/C22H32O14/c1-32-14(25)5-3-9-2-4-11(10(24)6-9)34-22-20(31)18(29)16(27)13(36-22)8-33-21-19(30)17(28)15(26)12(7-23)35-21/h2,4,6,12-13,15-24,26-31H,3,5,7-8H2,1H3

> <INCHI_KEY>
YLQXQJFWCRRNGA-UHFFFAOYSA-N

> <FORMULA>
C22H32O14

> <MOLECULAR_WEIGHT>
520.4811

> <EXACT_MASS>
520.179205732

> <JCHEM_ACCEPTOR_COUNT>
13

> <JCHEM_AVERAGE_POLARIZABILITY>
50.6648124939572

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
methyl 3-(3-hydroxy-4-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}phenyl)propanoate

> <ALOGPS_LOGP>
-1.34

> <JCHEM_LOGP>
-2.4445775559999996

> <ALOGPS_LOGS>
-1.70

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
11.90742766310343

> <JCHEM_PKA_STRONGEST_ACIDIC>
9.744372979206611

> <JCHEM_PKA_STRONGEST_BASIC>
-2.981083422322401

> <JCHEM_POLAR_SURFACE_AREA>
225.05999999999995

> <JCHEM_REFRACTIVITY>
115.25519999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
10

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.05e+01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
methyl 3-(3-hydroxy-4-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}phenyl)propanoate

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0039235
     RDKit          3D
Citrusin F
 68 70  0  0  0  0  0  0  0  0999 V2000
    7.1136   -2.7078   -2.3115 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6613   -1.7648   -1.4220 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0440   -1.5956   -0.1613 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0591   -2.3089    0.0436 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5841   -0.6265    0.7890 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8771   -0.5150    2.0803 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4731   -0.1173    2.0605 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4652   -1.0475    2.1434 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1374   -0.7178    2.1096 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7222    0.6218    1.9867 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4076    0.9241    1.9558 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6367    2.0360    1.8631 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1045    2.0040    0.6741 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1037    1.0670    0.6566 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9160    1.1098   -0.6222 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8877    0.1242   -0.5147 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6509    0.1532   -1.6783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6561   -1.0721   -2.2835 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2632   -1.1306   -3.4995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7839   -2.5645   -3.6753 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6873   -2.9087   -2.6948 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3035   -0.1244   -3.7906 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4094   -0.8090   -4.3520 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8105    0.6722   -2.6504 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2017    0.4964   -2.4465 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1152    0.4759   -1.3455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6217   -0.6043   -0.6184 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1169    1.2671    1.7837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0976    0.2908    1.7209 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3225    1.1164    3.0661 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0978    1.1238    4.1994 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2977    2.2341    3.0554 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3961    2.1551    4.2516 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7174    1.5723    1.9029 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4427    2.9324    1.7795 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0576    1.2006    1.9398 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3439   -2.3068   -2.9822 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6477   -3.5689   -1.7718 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9566   -3.1370   -2.8929 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6329   -0.9880    1.0305 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7709    0.3649    0.3024 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4324    0.1385    2.8051 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9140   -1.5319    2.5718 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6862   -2.1207    2.2676 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3623   -1.4795    2.1767 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2465    2.9575    1.8036 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7040    0.0482    0.7651 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2624    0.9568   -1.5125 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3508    2.1259   -0.7162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3248    0.9168   -2.4007 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4480   -1.0520   -4.2810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9413   -3.2778   -3.7153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3306   -2.6523   -4.6596 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3176   -3.6444   -2.1531 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669    0.5676   -4.6186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5254   -0.6485   -5.2995 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7296    1.7762   -2.8892 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4043    0.3173   -1.5098 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1610    1.3886   -0.7085 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8913   -1.1535   -0.2466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5399    2.2850    1.6644 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9622    0.7397    1.9151 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7376    0.1624    2.9395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9717    0.2373    4.6468 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7973    3.2128    2.9616 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0049    2.7422    4.9216 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1898    3.5790    1.7156 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8413    1.9461    1.8744 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 10 34  1  0
 34 35  1  0
 34 36  2  0
 36  7  1  0
 32 12  1  0
 26 17  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  5 40  1  0
  5 41  1  0
  6 42  1  0
  6 43  1  0
  8 44  1  0
  9 45  1  0
 12 46  1  0
 14 47  1  0
 15 48  1  0
 15 49  1  0
 17 50  1  0
 19 51  1  0
 20 52  1  0
 20 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 29 62  1  0
 30 63  1  0
 31 64  1  0
 32 65  1  0
 33 66  1  0
 35 67  1  0
 36 68  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      10.669   7.700   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       2.667   7.700   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       5.335   7.700   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       1.334   8.470   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668   8.470   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       4.001  10.010   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -8.002  16.940   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -5.335  10.780   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       4.001   8.470   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       2.667  10.780   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       1.334  10.010   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -8.002  15.400   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -4.001  10.010   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002   7.700   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -9.336  14.630   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -4.001   8.470   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -9.336  13.090   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -2.667   7.700   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -8.002  12.320   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -1.334   8.470   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -6.668  13.090   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      -1.334  10.010   0.000  0.00  0.00           C+0
HETATM   23  O   UNK     0      -9.336  17.710   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       2.667  12.320   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       8.002   6.160   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0     -10.669  15.400   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      -5.335   7.700   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0     -10.669  12.320   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -2.667   6.160   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -8.002  10.780   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000   7.700   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       9.336   8.470   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -5.335  12.320   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       0.000  10.780   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      -6.668  14.630   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      -2.667  10.780   0.000  0.00  0.00           O+0
CONECT    1   32                                                            
CONECT    2    4    9                                                       
CONECT    3    5    9                                                       
CONECT    4    2   11                                                       
CONECT    5    3   14                                                       
CONECT    6    9   10                                                       
CONECT    7   12   23                                                       
CONECT    8   13   33                                                       
CONECT    9    2    3    6                                                  
CONECT   10    6   11   24                                                  
CONECT   11    4   10   34                                                  
CONECT   12    7   15   35                                                  
CONECT   13    8   16   36                                                  
CONECT   14    5   25   32                                                  
CONECT   15   12   17   26                                                  
CONECT   16   13   18   27                                                  
CONECT   17   15   19   28                                                  
CONECT   18   16   20   29                                                  
CONECT   19   17   21   30                                                  
CONECT   20   18   22   31                                                  
CONECT   21   19   33   35                                                  
CONECT   22   20   34   36                                                  
CONECT   23    7                                                            
CONECT   24   10                                                            
CONECT   25   14                                                            
CONECT   26   15                                                            
CONECT   27   16                                                            
CONECT   28   17                                                            
CONECT   29   18                                                            
CONECT   30   19                                                            
CONECT   31   20                                                            
CONECT   32    1   14                                                       
CONECT   33    8   21                                                       
CONECT   34   11   22                                                       
CONECT   35   12   21                                                       
CONECT   36   13   22                                                       
MASTER        0    0    0    0    0    0    0    0   36    0   76    0
END

COMPND    HMDB0039235
HETATM    1  C1  UNL     1       7.114  -2.708  -2.312  1.00  0.00           C  
HETATM    2  O1  UNL     1       7.661  -1.765  -1.422  1.00  0.00           O  
HETATM    3  C2  UNL     1       7.044  -1.596  -0.161  1.00  0.00           C  
HETATM    4  O2  UNL     1       6.059  -2.309   0.044  1.00  0.00           O  
HETATM    5  C3  UNL     1       7.584  -0.627   0.789  1.00  0.00           C  
HETATM    6  C4  UNL     1       6.877  -0.515   2.080  1.00  0.00           C  
HETATM    7  C5  UNL     1       5.473  -0.117   2.061  1.00  0.00           C  
HETATM    8  C6  UNL     1       4.465  -1.047   2.143  1.00  0.00           C  
HETATM    9  C7  UNL     1       3.137  -0.718   2.110  1.00  0.00           C  
HETATM   10  C8  UNL     1       2.722   0.622   1.987  1.00  0.00           C  
HETATM   11  O3  UNL     1       1.408   0.924   1.956  1.00  0.00           O  
HETATM   12  C9  UNL     1       0.637   2.036   1.863  1.00  0.00           C  
HETATM   13  O4  UNL     1      -0.105   2.004   0.674  1.00  0.00           O  
HETATM   14  C10 UNL     1      -1.104   1.067   0.657  1.00  0.00           C  
HETATM   15  C11 UNL     1      -1.916   1.110  -0.622  1.00  0.00           C  
HETATM   16  O5  UNL     1      -2.888   0.124  -0.515  1.00  0.00           O  
HETATM   17  C12 UNL     1      -3.651   0.153  -1.678  1.00  0.00           C  
HETATM   18  O6  UNL     1      -3.656  -1.072  -2.284  1.00  0.00           O  
HETATM   19  C13 UNL     1      -4.263  -1.131  -3.499  1.00  0.00           C  
HETATM   20  C14 UNL     1      -4.784  -2.564  -3.675  1.00  0.00           C  
HETATM   21  O7  UNL     1      -5.687  -2.909  -2.695  1.00  0.00           O  
HETATM   22  C15 UNL     1      -5.303  -0.124  -3.791  1.00  0.00           C  
HETATM   23  O8  UNL     1      -6.409  -0.809  -4.352  1.00  0.00           O  
HETATM   24  C16 UNL     1      -5.811   0.672  -2.650  1.00  0.00           C  
HETATM   25  O9  UNL     1      -7.202   0.496  -2.447  1.00  0.00           O  
HETATM   26  C17 UNL     1      -5.115   0.476  -1.345  1.00  0.00           C  
HETATM   27  O10 UNL     1      -5.622  -0.604  -0.618  1.00  0.00           O  
HETATM   28  C18 UNL     1      -2.117   1.267   1.784  1.00  0.00           C  
HETATM   29  O11 UNL     1      -3.098   0.291   1.721  1.00  0.00           O  
HETATM   30  C19 UNL     1      -1.323   1.116   3.066  1.00  0.00           C  
HETATM   31  O12 UNL     1      -2.098   1.124   4.199  1.00  0.00           O  
HETATM   32  C20 UNL     1      -0.298   2.234   3.055  1.00  0.00           C  
HETATM   33  O13 UNL     1       0.396   2.155   4.252  1.00  0.00           O  
HETATM   34  C21 UNL     1       3.717   1.572   1.903  1.00  0.00           C  
HETATM   35  O14 UNL     1       3.443   2.932   1.780  1.00  0.00           O  
HETATM   36  C22 UNL     1       5.058   1.201   1.940  1.00  0.00           C  
HETATM   37  H1  UNL     1       6.344  -2.307  -2.982  1.00  0.00           H  
HETATM   38  H2  UNL     1       6.648  -3.569  -1.772  1.00  0.00           H  
HETATM   39  H3  UNL     1       7.957  -3.137  -2.893  1.00  0.00           H  
HETATM   40  H4  UNL     1       8.633  -0.988   1.030  1.00  0.00           H  
HETATM   41  H5  UNL     1       7.771   0.365   0.302  1.00  0.00           H  
HETATM   42  H6  UNL     1       7.432   0.139   2.805  1.00  0.00           H  
HETATM   43  H7  UNL     1       6.914  -1.532   2.572  1.00  0.00           H  
HETATM   44  H8  UNL     1       4.686  -2.121   2.268  1.00  0.00           H  
HETATM   45  H9  UNL     1       2.362  -1.479   2.177  1.00  0.00           H  
HETATM   46  H10 UNL     1       1.246   2.957   1.804  1.00  0.00           H  
HETATM   47  H11 UNL     1      -0.704   0.048   0.765  1.00  0.00           H  
HETATM   48  H12 UNL     1      -1.262   0.957  -1.512  1.00  0.00           H  
HETATM   49  H13 UNL     1      -2.351   2.126  -0.716  1.00  0.00           H  
HETATM   50  H14 UNL     1      -3.325   0.917  -2.401  1.00  0.00           H  
HETATM   51  H15 UNL     1      -3.448  -1.052  -4.281  1.00  0.00           H  
HETATM   52  H16 UNL     1      -3.941  -3.278  -3.715  1.00  0.00           H  
HETATM   53  H17 UNL     1      -5.331  -2.652  -4.660  1.00  0.00           H  
HETATM   54  H18 UNL     1      -5.318  -3.644  -2.153  1.00  0.00           H  
HETATM   55  H19 UNL     1      -4.967   0.568  -4.619  1.00  0.00           H  
HETATM   56  H20 UNL     1      -6.525  -0.649  -5.299  1.00  0.00           H  
HETATM   57  H21 UNL     1      -5.730   1.776  -2.889  1.00  0.00           H  
HETATM   58  H22 UNL     1      -7.404   0.317  -1.510  1.00  0.00           H  
HETATM   59  H23 UNL     1      -5.161   1.389  -0.708  1.00  0.00           H  
HETATM   60  H24 UNL     1      -4.891  -1.153  -0.247  1.00  0.00           H  
HETATM   61  H25 UNL     1      -2.540   2.285   1.664  1.00  0.00           H  
HETATM   62  H26 UNL     1      -3.962   0.740   1.915  1.00  0.00           H  
HETATM   63  H27 UNL     1      -0.738   0.162   2.939  1.00  0.00           H  
HETATM   64  H28 UNL     1      -1.972   0.237   4.647  1.00  0.00           H  
HETATM   65  H29 UNL     1      -0.797   3.213   2.962  1.00  0.00           H  
HETATM   66  H30 UNL     1      -0.005   2.742   4.922  1.00  0.00           H  
HETATM   67  H31 UNL     1       4.190   3.579   1.716  1.00  0.00           H  
HETATM   68  H32 UNL     1       5.841   1.946   1.874  1.00  0.00           H  
CONECT    1    2   37   38   39
CONECT    2    3
CONECT    3    4    4    5
CONECT    5    6   40   41
CONECT    6    7   42   43
CONECT    7    8    8   36
CONECT    8    9   44
CONECT    9   10   10   45
CONECT   10   11   34
CONECT   11   12
CONECT   12   13   32   46
CONECT   13   14
CONECT   14   15   28   47
CONECT   15   16   48   49
CONECT   16   17
CONECT   17   18   26   50
CONECT   18   19
CONECT   19   20   22   51
CONECT   20   21   52   53
CONECT   21   54
CONECT   22   23   24   55
CONECT   23   56
CONECT   24   25   26   57
CONECT   25   58
CONECT   26   27   59
CONECT   27   60
CONECT   28   29   30   61
CONECT   29   62
CONECT   30   31   32   63
CONECT   31   64
CONECT   32   33   65
CONECT   33   66
CONECT   34   35   36   36
CONECT   35   67
CONECT   36   68
END

HMDB0039235
     RDKit          3D
Citrusin F
 68 70  0  0  0  0  0  0  0  0999 V2000
    7.1136   -2.7078   -2.3115 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6613   -1.7648   -1.4220 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0440   -1.5956   -0.1613 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0591   -2.3089    0.0436 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5841   -0.6265    0.7890 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8771   -0.5150    2.0803 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4731   -0.1173    2.0605 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4652   -1.0475    2.1434 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1374   -0.7178    2.1096 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7222    0.6218    1.9867 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4076    0.9241    1.9558 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6367    2.0360    1.8631 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1045    2.0040    0.6741 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1037    1.0670    0.6566 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9160    1.1098   -0.6222 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8877    0.1242   -0.5147 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6509    0.1532   -1.6783 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6561   -1.0721   -2.2835 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2632   -1.1306   -3.4995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7839   -2.5645   -3.6753 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6873   -2.9087   -2.6948 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3035   -0.1244   -3.7906 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4094   -0.8090   -4.3520 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8105    0.6722   -2.6504 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2017    0.4964   -2.4465 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1152    0.4759   -1.3455 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6217   -0.6043   -0.6184 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1169    1.2671    1.7837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0976    0.2908    1.7209 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3225    1.1164    3.0661 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0978    1.1238    4.1994 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2977    2.2341    3.0554 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3961    2.1551    4.2516 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7174    1.5723    1.9029 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4427    2.9324    1.7795 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0576    1.2006    1.9398 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3439   -2.3068   -2.9822 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6477   -3.5689   -1.7718 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9566   -3.1370   -2.8929 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6329   -0.9880    1.0305 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7709    0.3649    0.3024 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4324    0.1385    2.8051 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9140   -1.5319    2.5718 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6862   -2.1207    2.2676 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3623   -1.4795    2.1767 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2465    2.9575    1.8036 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7040    0.0482    0.7651 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2624    0.9568   -1.5125 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3508    2.1259   -0.7162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3248    0.9168   -2.4007 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4480   -1.0520   -4.2810 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9413   -3.2778   -3.7153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3306   -2.6523   -4.6596 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3176   -3.6444   -2.1531 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669    0.5676   -4.6186 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5254   -0.6485   -5.2995 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7296    1.7762   -2.8892 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4043    0.3173   -1.5098 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1610    1.3886   -0.7085 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8913   -1.1535   -0.2466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5399    2.2850    1.6644 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9622    0.7397    1.9151 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7376    0.1624    2.9395 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9717    0.2373    4.6468 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7973    3.2128    2.9616 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0049    2.7422    4.9216 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1898    3.5790    1.7156 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8413    1.9461    1.8744 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 10 34  1  0
 34 35  1  0
 34 36  2  0
 36  7  1  0
 32 12  1  0
 26 17  1  0
  1 37  1  0
  1 38  1  0
  1 39  1  0
  5 40  1  0
  5 41  1  0
  6 42  1  0
  6 43  1  0
  8 44  1  0
  9 45  1  0
 12 46  1  0
 14 47  1  0
 15 48  1  0
 15 49  1  0
 17 50  1  0
 19 51  1  0
 20 52  1  0
 20 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 29 62  1  0
 30 63  1  0
 31 64  1  0
 32 65  1  0
 33 66  1  0
 35 67  1  0
 36 68  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Methyl 3-(3-hydroxy-4-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}phenyl)propanoic acid	HMDB

Chemical Formula

C₂₂H₃₂O₁₄

Average Molecular Weight

520.4811

Monoisotopic Molecular Weight

520.179205732

IUPAC Name

methyl 3-(3-hydroxy-4-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}phenyl)propanoate

Traditional Name

methyl 3-(3-hydroxy-4-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}phenyl)propanoate

CAS Registry Number

134860-04-1

SMILES

COC(=O)CCC1=CC(O)=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C=C1

InChI Identifier

InChI=1S/C22H32O14/c1-32-14(25)5-3-9-2-4-11(10(24)6-9)34-22-20(31)18(29)16(27)13(36-22)8-33-21-19(30)17(28)15(26)12(7-23)35-21/h2,4,6,12-13,15-24,26-31H,3,5,7-8H2,1H3

InChI Key

YLQXQJFWCRRNGA-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose.

Kingdom

Organic compounds

Super Class

Organic oxygen compounds

Class

Organooxygen compounds

Sub Class

Carbohydrates and carbohydrate conjugates

Direct Parent

Phenolic glycosides

Alternative Parents

Substituents

Phenolic glycoside
Disaccharide
O-glycosyl compound
Phenoxy compound
Phenol ether
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Fatty acid ester
Phenol
Monocyclic benzene moiety
Fatty acyl
Benzenoid
Oxane
Methyl ester
Carboxylic acid ester
Secondary alcohol
Acetal
Carboxylic acid derivative
Oxacycle
Organoheterocyclic compound
Monocarboxylic acid or derivatives
Polyol
Hydrocarbon derivative
Organic oxide
Carbonyl group
Primary alcohol
Alcohol
Aromatic heteromonocyclic compound

Molecular Framework

Aromatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0039235)
Cytoplasm (HMDB: HMDB0039235)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0039235)

Source

Exogenous

Exogenous (HMDB: HMDB0039235)

Food

Food (HMDB: HMDB0039235)

Fruit

Citrus

Lemon (FooDB: FOOD00054)
Citrus (FooDB: FOOD00859)

Endogenous

Plant

Plant (HMDB: HMDB0039235)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0039235)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	257500 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	10.5 g/L	ALOGPS
logP	-1.3	ALOGPS
logP	-2.4	ChemAxon
logS	-1.7	ALOGPS
pKa (Strongest Acidic)	9.74	ChemAxon
pKa (Strongest Basic)	-3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	13	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	225.06 Å²	ChemAxon
Rotatable Bond Count	10	ChemAxon
Refractivity	115.26 m³·mol⁻¹	ChemAxon
Polarizability	50.66 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	220.447	31661259
DarkChem	[M-H]-	212.729	31661259
DeepCCS	[M+H]+	217.164	30932474
DeepCCS	[M-H]-	214.806	30932474
DeepCCS	[M-2H]-	247.692	30932474
DeepCCS	[M+Na]+	223.257	30932474
AllCCS	[M+H]+	216.3	32859911
AllCCS	[M+H-H2O]+	214.8	32859911
AllCCS	[M+NH4]+	217.7	32859911
AllCCS	[M+Na]+	218.1	32859911
AllCCS	[M-H]-	210.8	32859911
AllCCS	[M+Na-2H]-	212.3	32859911
AllCCS	[M+HCOO]-	214.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Citrusin F	COC(=O)CCC1=CC(O)=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C=C1	4493.6	Standard polar	33892256
Citrusin F	COC(=O)CCC1=CC(O)=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C=C1	4283.2	Standard non polar	33892256
Citrusin F	COC(=O)CCC1=CC(O)=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C=C1	4468.8	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Citrusin F,1TMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4268.4	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O)C(O)=C1	4267.2	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O)=C1	4249.7	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4205.6	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4241.3	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4264.9	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4233.9	Semi standard non polar	33892256
Citrusin F,1TMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4274.6	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4168.4	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #10	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4192.0	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #11	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4189.0	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #12	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4143.4	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #13	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4202.2	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #14	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4164.8	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #15	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4166.3	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #16	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4193.8	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #17	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4146.4	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #18	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4202.1	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #19	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4178.5	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4175.9	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #20	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4147.9	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #21	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4094.8	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #22	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4157.7	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #23	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4191.2	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #24	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4148.9	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #25	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4202.5	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #26	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	4189.8	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #27	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4211.6	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #28	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4212.4	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4119.9	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4169.1	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	4193.5	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	4151.6	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4213.9	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O)=C1	4194.3	Semi standard non polar	33892256
Citrusin F,2TMS,isomer #9	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4141.6	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4085.9	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #10	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	4040.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #11	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4118.4	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #12	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4069.4	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #13	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	4029.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #14	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3965.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #15	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4045.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #16	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	4085.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #17	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	4026.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #18	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4110.3	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #19	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	4087.6	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4015.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #20	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4127.2	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #21	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4111.7	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #22	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4069.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #23	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4099.2	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #24	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4099.1	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #25	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4026.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #26	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4119.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #27	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4080.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #28	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4024.9	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #29	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	3957.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4083.3	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #30	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4047.2	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #31	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4097.7	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #32	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4032.9	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #33	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4121.9	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #34	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	4062.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #35	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4112.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #36	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4092.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #37	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4103.9	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #38	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4067.9	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #39	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4001.1	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	4079.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #40	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4083.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #41	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4074.7	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #42	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4010.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #43	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4093.6	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #44	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	4076.7	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #45	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4125.2	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #46	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4103.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #47	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4081.4	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #48	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	4012.3	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #49	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4101.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	4023.6	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #50	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	4007.6	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #51	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4055.8	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #52	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4032.0	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #53	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	4062.7	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #54	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4114.3	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #55	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4094.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #56	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4173.2	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4104.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4059.7	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4060.5	Semi standard non polar	33892256
Citrusin F,3TMS,isomer #9	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	4097.1	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	3975.1	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #10	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3999.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #11	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3948.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #12	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4030.1	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #13	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3977.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #14	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4028.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #15	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4006.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #16	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	3994.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #17	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3969.3	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #18	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3907.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #19	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3996.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	4016.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #20	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3984.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #21	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3927.6	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #22	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4008.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #23	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3990.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #24	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4044.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #25	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4018.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #26	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3979.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #27	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3916.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #28	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4007.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #29	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3917.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	4004.2	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #30	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3977.6	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #31	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3944.2	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #32	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3979.6	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #33	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4034.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #34	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4003.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #35	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4083.3	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #36	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O)=C1	4070.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #37	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	3967.1	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #38	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	3909.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #39	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	3999.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3948.3	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #40	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	4034.2	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #41	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	3965.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #42	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4057.6	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #43	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3965.4	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #44	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4035.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #45	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3998.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #46	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	3976.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #47	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	3914.4	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #48	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4009.4	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #49	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3894.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	4032.1	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #50	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	3963.6	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #51	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3920.6	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #52	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3966.3	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #53	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4039.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #54	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4000.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #55	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4060.1	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #56	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	3992.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #57	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	3921.4	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #58	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	4027.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #59	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3925.2	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	3985.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #60	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	3996.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #61	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3956.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #62	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3934.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #63	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4013.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #64	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3969.3	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #65	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4073.0	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #66	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3933.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #67	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	4007.5	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #68	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3965.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #69	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3990.7	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3938.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #70	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	4065.9	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3885.8	Semi standard non polar	33892256
Citrusin F,4TMS,isomer #9	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3961.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)=C1	3994.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #10	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3944.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #11	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3908.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #12	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3869.7	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #13	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3940.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #14	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3854.7	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #15	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3893.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #16	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3870.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #17	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3908.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #18	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3957.1	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #19	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3937.1	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3898.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #20	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3977.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #21	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3903.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #22	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3853.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #23	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3930.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #24	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3857.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #25	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3898.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #26	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3877.0	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #27	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3867.7	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #28	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3919.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #29	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3892.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3867.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #30	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3979.3	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #31	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3860.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #32	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3907.0	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #33	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3884.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #34	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3907.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #35	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3962.7	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #36	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)=C1	3954.9	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #37	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)=C1	3914.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #38	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)=C1	3984.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #39	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3859.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3928.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #40	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	3900.1	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #41	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3882.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #42	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3905.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #43	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	3957.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #44	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3923.0	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #45	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3950.3	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #46	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3857.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #47	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	3902.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #48	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3883.1	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #49	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3877.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C1	3960.0	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #50	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3939.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #51	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C1	3849.7	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #52	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C1	3906.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #53	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3877.5	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #54	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3900.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #55	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3911.8	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #56	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C1	3906.2	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3912.3	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3983.7	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C1	3919.6	Semi standard non polar	33892256
Citrusin F,5TMS,isomer #9	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C1	3968.5	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4485.4	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O)C(O)=C1	4482.9	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O)=C1	4506.1	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4470.0	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4494.7	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4513.4	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4485.7	Semi standard non polar	33892256
Citrusin F,1TBDMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4524.2	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4587.3	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #10	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4561.7	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #11	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4572.3	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #12	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4545.7	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #13	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4583.5	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #14	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4566.1	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #15	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4562.6	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #16	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4595.7	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #17	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4578.3	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #18	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4601.8	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #19	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4577.3	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4593.2	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #20	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4549.1	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #21	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4531.9	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #22	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4549.4	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #23	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4560.6	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #24	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4541.3	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #25	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4573.4	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #26	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4599.0	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #27	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4616.5	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #28	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4617.0	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4544.3	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4561.6	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4600.0	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4575.5	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4614.7	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O)=C1	4576.7	Semi standard non polar	33892256
Citrusin F,2TBDMS,isomer #9	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4541.9	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #1	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4625.8	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #10	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4653.8	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #11	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4694.3	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #12	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4635.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #13	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4635.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #14	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4625.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #15	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4640.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #16	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4640.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #17	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4614.4	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #18	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4662.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #19	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4680.9	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #2	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4586.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #20	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4717.5	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #21	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4707.8	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #22	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O)=C1	4632.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #23	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4646.9	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #24	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4649.3	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #25	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4624.4	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #26	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4660.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #27	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4638.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #28	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4622.3	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #29	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4611.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #3	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4603.4	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #30	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4624.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #31	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4636.5	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #32	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4612.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #33	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4647.3	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #34	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4635.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #35	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4682.9	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #36	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4659.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #37	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)=C1	4665.5	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #38	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4663.1	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #39	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4650.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #4	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4629.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #40	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4667.1	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #41	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4652.5	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #42	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4643.8	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #43	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4658.9	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #44	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4690.0	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #45	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4722.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #46	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4715.6	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #47	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C1	4671.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #48	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4660.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #49	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4674.9	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #5	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4596.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #50	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4656.6	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #51	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4684.7	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #52	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4675.8	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #53	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C1	4654.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #54	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4684.5	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #55	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4680.4	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #56	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)=C1	4758.4	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #6	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1	4645.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #7	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4624.6	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #8	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4617.2	Semi standard non polar	33892256
Citrusin F,3TBDMS,isomer #9	COC(=O)CCC1=CC=C(OC2OC(COC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C1	4679.9	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin F GC-MS (Non-derivatized) - 70eV, Positive	splash10-0udi-4732940000-d28e69a39148ad62ac49	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Citrusin F GC-MS (2 TMS) - 70eV, Positive	splash10-0002-2233009000-a4cd674bd7471f7d9bbe	2017-10-06	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 10V, Positive-QTOF	splash10-0f6t-0901340000-ae652261580b4b8246ed	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 20V, Positive-QTOF	splash10-0002-0901000000-b30b7c95c7055b6c37d3	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 40V, Positive-QTOF	splash10-000b-1900000000-810b6de1f0170f3ffc95	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 10V, Negative-QTOF	splash10-014j-2923160000-8621ba436fa7d3e969df	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 20V, Negative-QTOF	splash10-01ot-2900010000-d8b967363108e1803962	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 40V, Negative-QTOF	splash10-01ot-3900000000-8dc3ac8d04c6b3decad1	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 10V, Positive-QTOF	splash10-000i-0900100000-17622fcd23f466d5d95d	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 20V, Positive-QTOF	splash10-00g1-0900110000-2d4fff3d2165d7a0b589	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 40V, Positive-QTOF	splash10-0a4j-3910000000-5eab3d95719e3e65efce	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 10V, Negative-QTOF	splash10-014r-0100790000-8c61c03b9e10282d7436	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 20V, Negative-QTOF	splash10-01p9-2301910000-58a8fe3d86483e990b00	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Citrusin F 40V, Negative-QTOF	splash10-000i-1900100000-c4021b3d5f1850ef00bb	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB018768

KNApSAcK ID

C00054076

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131752582

PDB ID

Not Available

ChEBI ID

169466

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1875331

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Citrusin F (HMDB0039235)

MOL for HMDB0039235 (Citrusin F)

3D MOL for HMDB0039235 (Citrusin F)

3D SDF for HMDB0039235 (Citrusin F)

3D-SDF for HMDB0039235 (Citrusin F)

PDB for HMDB0039235 (Citrusin F)

3D PDB for HMDB0039235 (Citrusin F)

SMILES for HMDB0039235 (Citrusin F)

INCHI for HMDB0039235 (Citrusin F)

Structure for HMDB0039235 (Citrusin F)

3D Structure for HMDB0039235 (Citrusin F)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra