Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 00:40:55 UTC

Update Date

2022-03-07 02:56:08 UTC

HMDB ID

HMDB0039281

Secondary Accession Numbers

HMDB39281

Metabolite Identification

Common Name

2-O-Galloylsucrose

Description

2-O-Galloylsucrose belongs to the class of organic compounds known as galloyl esters. These are organic compounds that contain an ester derivative of 3,4,5-trihydroxybenzoic acid. 2-O-Galloylsucrose has been detected, but not quantified in, green vegetables. This could make 2-O-galloylsucrose a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on 2-O-Galloylsucrose.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061310582D          

 34 36  0  0  0  0            999 V2000
   -3.1898    3.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4869    5.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3549    6.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6806    1.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3352    4.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9349    4.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9968    3.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2939    5.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5480    6.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1956    2.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5488    4.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0041    6.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6294    2.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8111    6.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0660    5.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8843    3.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1279    4.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5140    5.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2169    3.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9070    5.7565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3450    1.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1421    4.2858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2517    2.9866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8459    5.7820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3558    4.2128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2509    7.5958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1143    1.9072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3631    7.2528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6689    3.6142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5759    4.2858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2930    5.4135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8730    5.6835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4506    3.3593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7689    4.4573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  1  2  0  0  0  0
  6  2  1  0  0  0  0
  7  1  1  0  0  0  0
  8  2  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  1  0  0  0  0
 11  7  2  0  0  0  0
 11  8  1  0  0  0  0
 12  9  1  0  0  0  0
 13 10  1  0  0  0  0
 14 12  1  0  0  0  0
 15 14  1  0  0  0  0
 16 13  1  0  0  0  0
 17  6  1  0  0  0  0
 18 15  1  0  0  0  0
 19  5  1  0  0  0  0
 19 16  1  0  0  0  0
 20  3  1  0  0  0  0
 21  4  1  0  0  0  0
 22  5  1  0  0  0  0
 23  7  1  0  0  0  0
 24  8  1  0  0  0  0
 25 11  1  0  0  0  0
 26 12  1  0  0  0  0
 27 13  1  0  0  0  0
 28 14  1  0  0  0  0
 29 16  1  0  0  0  0
 30 17  2  0  0  0  0
 31  9  1  0  0  0  0
 31 18  1  0  0  0  0
 32 15  1  0  0  0  0
 32 17  1  0  0  0  0
 33 10  1  0  0  0  0
 33 19  1  0  0  0  0
 34 18  1  0  0  0  0
 34 19  1  0  0  0  0
M  END

HMDB0039281
     RDKit          3D
2-O-Galloylsucrose
 60 62  0  0  0  0  0  0  0  0999 V2000
    2.2839    1.0967    1.9776 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4880    0.4801    0.9052 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6339   -0.5494    0.5709 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5420   -0.9583    1.3552 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7718   -0.9325    0.5617 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4614    0.1663    0.9455 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8995    1.0470    0.0136 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8591    1.7243   -0.8271 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0738    0.8855   -1.5791 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5711    2.0619    0.6891 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118    1.9511    0.4730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4476    3.1201   -0.3205 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1835    4.2763    0.4271 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1960    0.6330   -0.1621 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2730    0.6272   -1.0132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8772    0.3706   -0.8986 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9407    0.9540   -2.1555 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4963   -2.0638    1.0054 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9706   -3.2344    0.4449 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6297   -4.4034    1.1299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0039   -4.3819    0.9526 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5244   -3.3540    0.7078 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8692   -4.6333    1.1387 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8451   -2.3813    1.8212 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0958   -2.7204    2.9424 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6083    0.8812    0.0757 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9158    0.2707   -1.1149 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9762    0.6602   -1.8869 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2845    0.0344   -3.0988 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7653    1.7064   -1.4511 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8508    2.1315   -2.2064 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4958    2.3533   -0.2584 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3007    3.4007    0.1598 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4125    1.9198    0.4828 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4316   -0.3574    2.2922 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5823   -1.0949   -0.4921 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4182    2.3796   -1.5498 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2459    2.4567   -0.2242 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5514    0.6583   -2.4190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4205    2.0007    1.4774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5690    2.9948   -0.3284 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0387    3.1705   -1.3413 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4972    4.8460    0.0236 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3332   -0.1179    0.6543 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2228    1.4308   -1.6038 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7489   -0.7307   -0.9356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4960    0.3855   -2.7299 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2004   -3.2227   -0.6232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3376   -4.4271    2.2033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2649   -5.3711    0.7018 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2283   -3.9913    0.0732 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0942   -3.1133   -0.2095 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9760   -4.6549    2.1206 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9147   -2.3964    2.0990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3179   -1.8974    3.3148 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2903   -0.5470   -1.4448 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7460   -0.7306   -3.4645 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4057    2.8946   -1.8632 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0936    3.8676    1.0361 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1959    2.4280    1.4259 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 32 34  2  0
 24  4  1  0
 34 26  1  0
 16  7  1  0
  4 35  1  0
  5 36  1  0
  8 37  1  0
  8 38  1  0
  9 39  1  0
 11 40  1  0
 12 41  1  0
 12 42  1  0
 13 43  1  0
 14 44  1  0
 15 45  1  0
 16 46  1  0
 17 47  1  0
 19 48  1  0
 20 49  1  0
 20 50  1  0
 21 51  1  0
 22 52  1  0
 23 53  1  0
 24 54  1  0
 25 55  1  0
 27 56  1  0
 29 57  1  0
 31 58  1  0
 33 59  1  0
 34 60  1  0
M  END

  Mrv0541 05061310582D          

 34 36  0  0  0  0            999 V2000
   -3.1898    3.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4869    5.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3549    6.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6806    1.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3352    4.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9349    4.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9968    3.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2939    5.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5480    6.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1956    2.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5488    4.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0041    6.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6294    2.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8111    6.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0660    5.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8843    3.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1279    4.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5140    5.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2169    3.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9070    5.7565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3450    1.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1421    4.2858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2517    2.9866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8459    5.7820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3558    4.2128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2509    7.5958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1143    1.9072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3631    7.2528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6689    3.6142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5759    4.2858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2930    5.4135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8730    5.6835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4506    3.3593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7689    4.4573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  1  2  0  0  0  0
  6  2  1  0  0  0  0
  7  1  1  0  0  0  0
  8  2  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  1  0  0  0  0
 11  7  2  0  0  0  0
 11  8  1  0  0  0  0
 12  9  1  0  0  0  0
 13 10  1  0  0  0  0
 14 12  1  0  0  0  0
 15 14  1  0  0  0  0
 16 13  1  0  0  0  0
 17  6  1  0  0  0  0
 18 15  1  0  0  0  0
 19  5  1  0  0  0  0
 19 16  1  0  0  0  0
 20  3  1  0  0  0  0
 21  4  1  0  0  0  0
 22  5  1  0  0  0  0
 23  7  1  0  0  0  0
 24  8  1  0  0  0  0
 25 11  1  0  0  0  0
 26 12  1  0  0  0  0
 27 13  1  0  0  0  0
 28 14  1  0  0  0  0
 29 16  1  0  0  0  0
 30 17  2  0  0  0  0
 31  9  1  0  0  0  0
 31 18  1  0  0  0  0
 32 15  1  0  0  0  0
 32 17  1  0  0  0  0
 33 10  1  0  0  0  0
 33 19  1  0  0  0  0
 34 18  1  0  0  0  0
 34 19  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039281

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C19H26O15/c20-3-9-12(26)14(28)15(32-17(30)6-1-7(23)11(25)8(24)2-6)18(31-9)34-19(5-22)16(29)13(27)10(4-21)33-19/h1-2,9-10,12-16,18,20-29H,3-5H2

> <INCHI_KEY>
LNFBBISCIPAUAE-UHFFFAOYSA-N

> <FORMULA>
C19H26O15

> <MOLECULAR_WEIGHT>
494.4007

> <EXACT_MASS>
494.127170162

> <JCHEM_ACCEPTOR_COUNT>
14

> <JCHEM_AVERAGE_POLARIZABILITY>
45.21852680606399

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-{[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl 3,4,5-trihydroxybenzoate

> <ALOGPS_LOGP>
-1.44

> <JCHEM_LOGP>
-2.94423108

> <ALOGPS_LOGS>
-1.06

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
11.209176668413773

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.101348855623021

> <JCHEM_PKA_STRONGEST_BASIC>
-3.4558264342782907

> <JCHEM_POLAR_SURFACE_AREA>
256.28999999999996

> <JCHEM_REFRACTIVITY>
104.5388

> <JCHEM_ROTATABLE_BOND_COUNT>
8

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
4.32e+01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-{[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl 3,4,5-trihydroxybenzoate

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0039281
     RDKit          3D
2-O-Galloylsucrose
 60 62  0  0  0  0  0  0  0  0999 V2000
    2.2839    1.0967    1.9776 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4880    0.4801    0.9052 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6339   -0.5494    0.5709 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5420   -0.9583    1.3552 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7718   -0.9325    0.5617 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4614    0.1663    0.9455 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8995    1.0470    0.0136 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8591    1.7243   -0.8271 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0738    0.8855   -1.5791 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5711    2.0619    0.6891 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118    1.9511    0.4730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4476    3.1201   -0.3205 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1835    4.2763    0.4271 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1960    0.6330   -0.1621 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2730    0.6272   -1.0132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8772    0.3706   -0.8986 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9407    0.9540   -2.1555 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4963   -2.0638    1.0054 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9706   -3.2344    0.4449 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6297   -4.4034    1.1299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0039   -4.3819    0.9526 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5244   -3.3540    0.7078 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8692   -4.6333    1.1387 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8451   -2.3813    1.8212 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0958   -2.7204    2.9424 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6083    0.8812    0.0757 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9158    0.2707   -1.1149 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9762    0.6602   -1.8869 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2845    0.0344   -3.0988 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7653    1.7064   -1.4511 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8508    2.1315   -2.2064 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4958    2.3533   -0.2584 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3007    3.4007    0.1598 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4125    1.9198    0.4828 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4316   -0.3574    2.2922 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5823   -1.0949   -0.4921 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4182    2.3796   -1.5498 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2459    2.4567   -0.2242 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5514    0.6583   -2.4190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4205    2.0007    1.4774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5690    2.9948   -0.3284 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0387    3.1705   -1.3413 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4972    4.8460    0.0236 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3332   -0.1179    0.6543 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2228    1.4308   -1.6038 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7489   -0.7307   -0.9356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4960    0.3855   -2.7299 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2004   -3.2227   -0.6232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3376   -4.4271    2.2033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2649   -5.3711    0.7018 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2283   -3.9913    0.0732 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0942   -3.1133   -0.2095 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9760   -4.6549    2.1206 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9147   -2.3964    2.0990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3179   -1.8974    3.3148 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2903   -0.5470   -1.4448 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7460   -0.7306   -3.4645 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4057    2.8946   -1.8632 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0936    3.8676    1.0361 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1959    2.4280    1.4259 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 32 34  2  0
 24  4  1  0
 34 26  1  0
 16  7  1  0
  4 35  1  0
  5 36  1  0
  8 37  1  0
  8 38  1  0
  9 39  1  0
 11 40  1  0
 12 41  1  0
 12 42  1  0
 13 43  1  0
 14 44  1  0
 15 45  1  0
 16 46  1  0
 17 47  1  0
 19 48  1  0
 20 49  1  0
 20 50  1  0
 21 51  1  0
 22 52  1  0
 23 53  1  0
 24 54  1  0
 25 55  1  0
 27 56  1  0
 29 57  1  0
 31 58  1  0
 33 59  1  0
 34 60  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -5.954   7.360   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -6.509   9.969   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       2.529  11.890   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       1.270   3.560   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       0.626   8.320   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -5.478   8.824   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -7.461   7.040   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -8.015   9.649   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       1.023  11.570   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       0.365   4.806   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -8.491   8.184   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -0.008  12.714   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -1.175   4.806   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.514  12.394   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -1.990  10.929   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -1.651   6.271   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -3.972   9.145   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -0.959   9.785   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -0.405   7.176   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0       3.560  10.745   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0       0.644   2.153   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0       2.132   8.000   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      -7.937   5.575   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0      -9.046  10.793   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0      -9.997   7.864   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       0.468  14.179   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      -2.080   3.560   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      -2.544  13.539   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -3.115   6.747   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -2.942   8.000   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.547  10.105   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -3.496  10.609   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       0.841   6.271   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      -1.435   8.320   0.000  0.00  0.00           O+0
CONECT    1    6    7                                                       
CONECT    2    6    8                                                       
CONECT    3    9   20                                                       
CONECT    4   10   21                                                       
CONECT    5   19   22                                                       
CONECT    6    1    2   17                                                  
CONECT    7    1   11   23                                                  
CONECT    8    2   11   24                                                  
CONECT    9    3   12   31                                                  
CONECT   10    4   13   33                                                  
CONECT   11    7    8   25                                                  
CONECT   12    9   14   26                                                  
CONECT   13   10   16   27                                                  
CONECT   14   12   15   28                                                  
CONECT   15   14   18   32                                                  
CONECT   16   13   19   29                                                  
CONECT   17    6   30   32                                                  
CONECT   18   15   31   34                                                  
CONECT   19    5   16   33   34                                             
CONECT   20    3                                                            
CONECT   21    4                                                            
CONECT   22    5                                                            
CONECT   23    7                                                            
CONECT   24    8                                                            
CONECT   25   11                                                            
CONECT   26   12                                                            
CONECT   27   13                                                            
CONECT   28   14                                                            
CONECT   29   16                                                            
CONECT   30   17                                                            
CONECT   31    9   18                                                       
CONECT   32   15   17                                                       
CONECT   33   10   19                                                       
CONECT   34   18   19                                                       
MASTER        0    0    0    0    0    0    0    0   34    0   72    0
END

COMPND    HMDB0039281
HETATM    1  O1  UNL     1       2.284   1.097   1.978  1.00  0.00           O  
HETATM    2  C1  UNL     1       2.488   0.480   0.905  1.00  0.00           C  
HETATM    3  O2  UNL     1       1.634  -0.549   0.571  1.00  0.00           O  
HETATM    4  C2  UNL     1       0.542  -0.958   1.355  1.00  0.00           C  
HETATM    5  C3  UNL     1      -0.772  -0.933   0.562  1.00  0.00           C  
HETATM    6  O3  UNL     1      -1.461   0.166   0.946  1.00  0.00           O  
HETATM    7  C4  UNL     1      -1.899   1.047   0.014  1.00  0.00           C  
HETATM    8  C5  UNL     1      -0.859   1.724  -0.827  1.00  0.00           C  
HETATM    9  O4  UNL     1      -0.074   0.886  -1.579  1.00  0.00           O  
HETATM   10  O5  UNL     1      -2.571   2.062   0.689  1.00  0.00           O  
HETATM   11  C6  UNL     1      -3.912   1.951   0.473  1.00  0.00           C  
HETATM   12  C7  UNL     1      -4.448   3.120  -0.320  1.00  0.00           C  
HETATM   13  O6  UNL     1      -4.184   4.276   0.427  1.00  0.00           O  
HETATM   14  C8  UNL     1      -4.196   0.633  -0.162  1.00  0.00           C  
HETATM   15  O7  UNL     1      -5.273   0.627  -1.013  1.00  0.00           O  
HETATM   16  C9  UNL     1      -2.877   0.371  -0.899  1.00  0.00           C  
HETATM   17  O8  UNL     1      -2.941   0.954  -2.155  1.00  0.00           O  
HETATM   18  O9  UNL     1      -1.496  -2.064   1.005  1.00  0.00           O  
HETATM   19  C10 UNL     1      -0.971  -3.234   0.445  1.00  0.00           C  
HETATM   20  C11 UNL     1      -1.630  -4.403   1.130  1.00  0.00           C  
HETATM   21  O10 UNL     1      -3.004  -4.382   0.953  1.00  0.00           O  
HETATM   22  C12 UNL     1       0.524  -3.354   0.708  1.00  0.00           C  
HETATM   23  O11 UNL     1       0.869  -4.633   1.139  1.00  0.00           O  
HETATM   24  C13 UNL     1       0.845  -2.381   1.821  1.00  0.00           C  
HETATM   25  O12 UNL     1       0.096  -2.720   2.942  1.00  0.00           O  
HETATM   26  C14 UNL     1       3.608   0.881   0.076  1.00  0.00           C  
HETATM   27  C15 UNL     1       3.916   0.271  -1.115  1.00  0.00           C  
HETATM   28  C16 UNL     1       4.976   0.660  -1.887  1.00  0.00           C  
HETATM   29  O13 UNL     1       5.284   0.034  -3.099  1.00  0.00           O  
HETATM   30  C17 UNL     1       5.765   1.706  -1.451  1.00  0.00           C  
HETATM   31  O14 UNL     1       6.851   2.131  -2.206  1.00  0.00           O  
HETATM   32  C18 UNL     1       5.496   2.353  -0.258  1.00  0.00           C  
HETATM   33  O15 UNL     1       6.301   3.401   0.160  1.00  0.00           O  
HETATM   34  C19 UNL     1       4.413   1.920   0.483  1.00  0.00           C  
HETATM   35  H1  UNL     1       0.432  -0.357   2.292  1.00  0.00           H  
HETATM   36  H2  UNL     1      -0.582  -1.095  -0.492  1.00  0.00           H  
HETATM   37  H3  UNL     1      -1.418   2.380  -1.550  1.00  0.00           H  
HETATM   38  H4  UNL     1      -0.246   2.457  -0.224  1.00  0.00           H  
HETATM   39  H5  UNL     1      -0.551   0.658  -2.419  1.00  0.00           H  
HETATM   40  H6  UNL     1      -4.421   2.001   1.477  1.00  0.00           H  
HETATM   41  H7  UNL     1      -5.569   2.995  -0.328  1.00  0.00           H  
HETATM   42  H8  UNL     1      -4.039   3.171  -1.341  1.00  0.00           H  
HETATM   43  H9  UNL     1      -3.497   4.846   0.024  1.00  0.00           H  
HETATM   44  H10 UNL     1      -4.333  -0.118   0.654  1.00  0.00           H  
HETATM   45  H11 UNL     1      -5.223   1.431  -1.604  1.00  0.00           H  
HETATM   46  H12 UNL     1      -2.749  -0.731  -0.936  1.00  0.00           H  
HETATM   47  H13 UNL     1      -3.496   0.385  -2.730  1.00  0.00           H  
HETATM   48  H14 UNL     1      -1.200  -3.223  -0.623  1.00  0.00           H  
HETATM   49  H15 UNL     1      -1.338  -4.427   2.203  1.00  0.00           H  
HETATM   50  H16 UNL     1      -1.265  -5.371   0.702  1.00  0.00           H  
HETATM   51  H17 UNL     1      -3.228  -3.991   0.073  1.00  0.00           H  
HETATM   52  H18 UNL     1       1.094  -3.113  -0.209  1.00  0.00           H  
HETATM   53  H19 UNL     1       0.976  -4.655   2.121  1.00  0.00           H  
HETATM   54  H20 UNL     1       1.915  -2.396   2.099  1.00  0.00           H  
HETATM   55  H21 UNL     1      -0.318  -1.897   3.315  1.00  0.00           H  
HETATM   56  H22 UNL     1       3.290  -0.547  -1.445  1.00  0.00           H  
HETATM   57  H23 UNL     1       4.746  -0.731  -3.465  1.00  0.00           H  
HETATM   58  H24 UNL     1       7.406   2.895  -1.863  1.00  0.00           H  
HETATM   59  H25 UNL     1       6.094   3.868   1.036  1.00  0.00           H  
HETATM   60  H26 UNL     1       4.196   2.428   1.426  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   26
CONECT    3    4
CONECT    4    5   24   35
CONECT    5    6   18   36
CONECT    6    7
CONECT    7    8   10   16
CONECT    8    9   37   38
CONECT    9   39
CONECT   10   11
CONECT   11   12   14   40
CONECT   12   13   41   42
CONECT   13   43
CONECT   14   15   16   44
CONECT   15   45
CONECT   16   17   46
CONECT   17   47
CONECT   18   19
CONECT   19   20   22   48
CONECT   20   21   49   50
CONECT   21   51
CONECT   22   23   24   52
CONECT   23   53
CONECT   24   25   54
CONECT   25   55
CONECT   26   27   27   34
CONECT   27   28   56
CONECT   28   29   30   30
CONECT   29   57
CONECT   30   31   32
CONECT   31   58
CONECT   32   33   34   34
CONECT   33   59
CONECT   34   60
END

HMDB0039281
     RDKit          3D
2-O-Galloylsucrose
 60 62  0  0  0  0  0  0  0  0999 V2000
    2.2839    1.0967    1.9776 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4880    0.4801    0.9052 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6339   -0.5494    0.5709 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5420   -0.9583    1.3552 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7718   -0.9325    0.5617 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4614    0.1663    0.9455 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8995    1.0470    0.0136 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8591    1.7243   -0.8271 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0738    0.8855   -1.5791 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5711    2.0619    0.6891 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118    1.9511    0.4730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4476    3.1201   -0.3205 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1835    4.2763    0.4271 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1960    0.6330   -0.1621 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2730    0.6272   -1.0132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8772    0.3706   -0.8986 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9407    0.9540   -2.1555 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4963   -2.0638    1.0054 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9706   -3.2344    0.4449 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6297   -4.4034    1.1299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0039   -4.3819    0.9526 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5244   -3.3540    0.7078 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8692   -4.6333    1.1387 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8451   -2.3813    1.8212 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0958   -2.7204    2.9424 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6083    0.8812    0.0757 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9158    0.2707   -1.1149 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9762    0.6602   -1.8869 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2845    0.0344   -3.0988 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7653    1.7064   -1.4511 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8508    2.1315   -2.2064 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4958    2.3533   -0.2584 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3007    3.4007    0.1598 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4125    1.9198    0.4828 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4316   -0.3574    2.2922 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5823   -1.0949   -0.4921 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4182    2.3796   -1.5498 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2459    2.4567   -0.2242 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5514    0.6583   -2.4190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4205    2.0007    1.4774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5690    2.9948   -0.3284 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0387    3.1705   -1.3413 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4972    4.8460    0.0236 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3332   -0.1179    0.6543 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2228    1.4308   -1.6038 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7489   -0.7307   -0.9356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4960    0.3855   -2.7299 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2004   -3.2227   -0.6232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3376   -4.4271    2.2033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2649   -5.3711    0.7018 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2283   -3.9913    0.0732 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0942   -3.1133   -0.2095 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9760   -4.6549    2.1206 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9147   -2.3964    2.0990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3179   -1.8974    3.3148 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2903   -0.5470   -1.4448 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7460   -0.7306   -3.4645 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4057    2.8946   -1.8632 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0936    3.8676    1.0361 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1959    2.4280    1.4259 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 32 34  2  0
 24  4  1  0
 34 26  1  0
 16  7  1  0
  4 35  1  0
  5 36  1  0
  8 37  1  0
  8 38  1  0
  9 39  1  0
 11 40  1  0
 12 41  1  0
 12 42  1  0
 13 43  1  0
 14 44  1  0
 15 45  1  0
 16 46  1  0
 17 47  1  0
 19 48  1  0
 20 49  1  0
 20 50  1  0
 21 51  1  0
 22 52  1  0
 23 53  1  0
 24 54  1  0
 25 55  1  0
 27 56  1  0
 29 57  1  0
 31 58  1  0
 33 59  1  0
 34 60  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
2-{[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl 3,4,5-trihydroxybenzoic acid	HMDB

Chemical Formula

C₁₉H₂₆O₁₅

Average Molecular Weight

494.4007

Monoisotopic Molecular Weight

494.127170162

IUPAC Name

2-{[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl 3,4,5-trihydroxybenzoate

Traditional Name

2-{[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl 3,4,5-trihydroxybenzoate

CAS Registry Number

115713-46-7

SMILES

OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O

InChI Identifier

InChI=1S/C19H26O15/c20-3-9-12(26)14(28)15(32-17(30)6-1-7(23)11(25)8(24)2-6)18(31-9)34-19(5-22)16(29)13(27)10(4-21)33-19/h1-2,9-10,12-16,18,20-29H,3-5H2

InChI Key

LNFBBISCIPAUAE-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as galloyl esters. These are organic compounds that contain an ester derivative of 3,4,5-trihydroxybenzoic acid.

Kingdom

Organic compounds

Super Class

Benzenoids

Class

Benzene and substituted derivatives

Sub Class

Benzoic acids and derivatives

Direct Parent

Galloyl esters

Alternative Parents

Substituents

Galloyl ester
P-hydroxybenzoic acid alkyl ester
M-hydroxybenzoic acid ester
P-hydroxybenzoic acid ester
O-glycosyl compound
Glycosyl compound
Disaccharide
C-glycosyl compound
Benzoate ester
Benzenetriol
Pyrogallol derivative
Benzoyl
Ketal
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Phenol
Oxane
Tetrahydrofuran
Secondary alcohol
Carboxylic acid ester
Acetal
Oxacycle
Carboxylic acid derivative
Organoheterocyclic compound
Polyol
Monocarboxylic acid or derivatives
Alcohol
Organic oxygen compound
Primary alcohol
Organic oxide
Hydrocarbon derivative
Organooxygen compound
Aromatic heteromonocyclic compound

Molecular Framework

Aromatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0039281)
Cytoplasm (HMDB: HMDB0039281)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0039281)

Source

Exogenous

Exogenous (HMDB: HMDB0039281)

Food

Food (HMDB: HMDB0039281)

Vegetable

Leaf vegetable

Green vegetables (FooDB: FOOD00872)

Endogenous

Plant

Plant (HMDB: HMDB0039281)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0039281)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	43.2 g/L	ALOGPS
logP	-1.4	ALOGPS
logP	-2.9	ChemAxon
logS	-1.1	ALOGPS
pKa (Strongest Acidic)	8.1	ChemAxon
pKa (Strongest Basic)	-3.5	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	14	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	256.29 Å²	ChemAxon
Rotatable Bond Count	8	ChemAxon
Refractivity	104.54 m³·mol⁻¹	ChemAxon
Polarizability	45.22 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	211.901	31661259
DarkChem	[M-H]-	206.852	31661259
DeepCCS	[M+H]+	218.414	30932474
DeepCCS	[M-H]-	216.056	30932474
DeepCCS	[M-2H]-	248.941	30932474
DeepCCS	[M+Na]+	225.184	30932474
AllCCS	[M+H]+	206.7	32859911
AllCCS	[M+H-H2O]+	204.9	32859911
AllCCS	[M+NH4]+	208.3	32859911
AllCCS	[M+Na]+	208.8	32859911
AllCCS	[M-H]-	203.2	32859911
AllCCS	[M+Na-2H]-	203.8	32859911
AllCCS	[M+HCOO]-	204.6	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
2-O-Galloylsucrose	OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4207.6	Standard polar	33892256
2-O-Galloylsucrose	OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4456.5	Standard non polar	33892256
2-O-Galloylsucrose	OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4191.9	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
2-O-Galloylsucrose,1TMS,isomer #1	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4339.1	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #2	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4345.9	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4333.6	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4316.9	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #5	C[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O)C2O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4337.2	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #6	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O)=C1O	4305.8	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #7	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C=C1O	4281.4	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #8	C[Si](C)(C)OC1C(O)C(CO)OC1(CO)OC1OC(CO)C(O)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4385.1	Semi standard non polar	33892256
2-O-Galloylsucrose,1TMS,isomer #9	C[Si](C)(C)OC1C(CO)OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4344.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #1	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4276.1	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #10	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4262.4	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #11	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4274.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #12	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	4222.4	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #13	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O	4184.1	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #14	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	4272.5	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #15	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4292.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4268.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4283.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4207.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4170.6	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4278.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4256.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4247.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #22	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4256.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #23	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4272.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #24	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O	4196.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #25	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C=C1O	4166.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #26	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C	4289.5	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #27	C[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4277.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #28	C[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4293.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #29	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O	4202.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #3	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4267.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #30	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C=C1O	4173.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #31	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O)=C1O	4218.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #32	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O	4238.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #33	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O	4206.1	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #34	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C	4162.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #35	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C=C1O	4176.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #36	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C=C1O	4197.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #37	C[Si](C)(C)OC1C(CO)OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C	4295.1	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #4	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4280.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #5	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4226.5	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #6	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4183.4	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #7	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4294.6	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #8	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4285.4	Semi standard non polar	33892256
2-O-Galloylsucrose,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4276.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4151.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4085.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4039.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4134.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #13	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4133.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #14	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4158.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #15	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4093.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #16	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4046.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #17	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4164.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #18	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4152.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #19	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4080.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #2	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4148.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #20	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4035.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #21	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4155.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #22	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4144.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #23	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4087.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #24	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	4050.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #25	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	4112.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #26	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	4098.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #27	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	4067.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #28	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	4049.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #29	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4151.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #3	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4135.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4134.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4149.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4080.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4035.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4124.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4127.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #36	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4147.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #37	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	4086.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #38	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O	4041.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #39	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	4142.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #4	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4089.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #40	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4151.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #41	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	4067.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #42	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O	4020.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #43	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	4127.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #44	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4141.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #45	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	4079.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #46	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	4043.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #47	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	4090.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #48	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4100.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #49	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	4048.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #5	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4036.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #50	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4048.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #51	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4133.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4139.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4081.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4035.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4120.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4118.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4098.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4053.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4140.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #6	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4136.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4135.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4072.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	4032.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	4057.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	4069.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	4014.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	4027.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4134.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #68	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4148.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #69	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O	4096.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #7	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4121.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #70	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C=C1O	4062.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #71	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C	4157.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #72	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O	4112.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #73	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C=C1O	4072.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #74	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C	4174.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #75	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O	4106.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #76	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O	4085.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #77	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O[Si](C)(C)C	4062.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #78	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	4071.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #79	C[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4140.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4149.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #80	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O	4080.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #81	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C=C1O	4047.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #82	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O	4098.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #83	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C=C1O	4057.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #84	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	4076.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #85	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	4045.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #86	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O	4113.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #87	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O	4097.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #88	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C	4064.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #89	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O	4116.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4161.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #90	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C	4081.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #91	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	4089.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TMS,isomer #92	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C=C1O	4067.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	3967.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #10	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3998.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #100	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3955.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #101	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3910.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #102	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3915.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #103	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3947.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #104	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3889.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #105	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3949.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #106	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3899.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3989.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #108	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3988.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #109	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3941.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #11	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3979.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #110	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3905.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3921.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3936.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #113	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3880.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #114	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3897.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4004.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3950.8	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3915.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #118	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3933.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #119	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3953.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #12	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3932.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #120	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3890.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #121	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3907.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #122	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4019.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #123	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3945.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #124	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3918.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #125	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3940.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #126	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3890.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #127	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3914.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #128	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3959.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #129	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3910.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #13	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3865.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #130	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O	3968.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #131	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C=C1O	3928.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #132	C[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C	4007.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #133	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O	3967.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #134	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O	3969.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #135	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O[Si](C)(C)C	3946.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #136	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3927.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #137	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O	3979.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #138	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O	3978.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #139	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O[Si](C)(C)C	3951.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #14	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3994.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #140	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3933.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #141	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	3973.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #142	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	3939.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #143	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3981.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #144	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O	3952.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #145	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C=C1O	3905.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #146	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	3952.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #147	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	3922.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #148	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	3961.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #149	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	3925.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #15	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3975.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #150	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3953.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #151	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O	3982.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #152	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C	3947.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #153	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3978.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #154	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3990.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #16	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3926.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #17	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3893.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #18	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3940.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #19	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3926.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	3987.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #20	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3876.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #21	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3867.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #22	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3968.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	3999.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3947.8	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3885.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3996.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4002.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3964.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3901.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3942.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4010.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #31	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4018.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3925.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3888.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3928.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #35	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3948.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3871.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #37	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3891.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #38	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4023.8	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #39	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3961.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3870.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #40	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3904.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #41	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4019.8	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #42	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4014.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #43	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3951.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #44	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3924.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #45	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3977.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #46	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3959.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #47	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3922.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #48	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3908.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #49	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4004.8	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4018.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #50	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3929.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #51	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3896.3	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #52	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3954.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #53	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3941.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #54	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3900.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #55	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3888.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #56	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3998.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #57	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3952.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #58	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3967.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #59	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3953.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #6	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4019.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #60	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3933.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #61	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3914.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #62	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3961.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #63	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3910.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	3983.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3937.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3883.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3994.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3999.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3955.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #7	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4014.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3889.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4011.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4017.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3925.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3889.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3928.6	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3947.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3875.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3895.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4017.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #8	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3953.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #80	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3951.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #81	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O	3901.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #82	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3998.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #83	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4018.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #84	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3947.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #85	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3921.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #86	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3953.1	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #87	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3967.8	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #88	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3906.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #89	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3906.2	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #9	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3890.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #90	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3988.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #91	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3924.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #92	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3892.9	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #93	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3931.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #94	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3946.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #95	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3884.4	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #96	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3882.7	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #97	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3983.0	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #98	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3945.5	Semi standard non polar	33892256
2-O-Galloylsucrose,4TMS,isomer #99	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3947.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	3829.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3773.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #100	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3721.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #101	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3732.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #102	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3877.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #103	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3793.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #104	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3781.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #105	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3788.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #106	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3796.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3725.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #108	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3739.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #109	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3894.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3757.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #110	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3832.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3787.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3804.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #113	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3776.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #114	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3794.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3822.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3760.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #117	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3804.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #118	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3794.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #119	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3797.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3778.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #120	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3812.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #121	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3743.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #122	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3746.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #123	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3848.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #124	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3859.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #125	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3798.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #126	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3809.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #127	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3787.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #128	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3795.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #129	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3788.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #13	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3786.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #130	C[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3735.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #131	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O	3836.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #132	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3776.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #133	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3785.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #134	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3764.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #135	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3771.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #136	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3777.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #137	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3717.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #138	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O	3822.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #139	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C	3834.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3713.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #140	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3792.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #141	C[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3769.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #142	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3813.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #143	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3799.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #144	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3799.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #145	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3805.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #146	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3747.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #147	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3760.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #148	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3882.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #149	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3840.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #15	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3731.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #150	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3782.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #151	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3799.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #152	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3772.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #153	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3789.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #154	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3810.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #155	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3757.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #156	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3852.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #157	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3799.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #158	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3818.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #159	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3789.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #16	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	3895.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #160	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3808.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #161	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3821.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #162	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3767.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #163	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3839.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #164	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3858.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #165	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3817.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #166	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3805.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #167	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O	3817.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #168	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O	3825.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #169	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O)=C1O[Si](C)(C)C	3816.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #17	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3800.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #170	C[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3769.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #171	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	3814.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #172	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	3804.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #173	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3868.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #174	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	3828.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #175	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	3815.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #176	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3884.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #177	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3868.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #178	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O	3801.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #179	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C	3792.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #18	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3727.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #180	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3847.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #181	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3860.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #182	C[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C	3864.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #19	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3841.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3749.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #20	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3826.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #21	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3791.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #22	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3779.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #23	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3767.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #24	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3758.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #25	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3711.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #26	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3704.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #27	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3825.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #28	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3769.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #29	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3753.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3694.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #30	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3755.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #31	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3740.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #32	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3690.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #33	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3680.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #34	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3815.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #35	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3815.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #36	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3774.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #37	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3763.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #38	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3752.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #39	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3744.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3820.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #40	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3779.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #41	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3723.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3806.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3755.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3857.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3855.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3787.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3779.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3778.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3787.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3820.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3720.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3733.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3886.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3805.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3796.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3799.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #56	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3810.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3741.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #58	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3756.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #59	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3898.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3765.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3837.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3786.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #62	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3805.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3772.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #64	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3792.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #65	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3820.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #66	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3754.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #67	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3809.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #68	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3794.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #69	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3818.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3708.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #70	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3809.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #71	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3757.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #72	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3743.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #73	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3863.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #74	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3864.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #75	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3823.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #76	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3801.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #77	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3812.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #78	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3790.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #79	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3813.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3831.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #80	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3758.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #81	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3837.1	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #82	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3796.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #83	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3780.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #84	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3785.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #85	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3766.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #86	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3796.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #87	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3734.2	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #88	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3851.4	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #89	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3838.8	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #9	C[Si](C)(C)OCC1OC(CO[Si](C)(C)C)(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3834.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #90	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3814.6	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #91	C[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3800.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #92	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3782.3	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #93	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3728.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #94	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3840.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #95	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	3833.9	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #96	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3781.5	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #97	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3770.0	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #98	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3773.7	Semi standard non polar	33892256
2-O-Galloylsucrose,5TMS,isomer #99	C[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3779.6	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4531.7	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4536.3	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4525.0	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4540.1	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O)C2O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4562.2	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O)=C1O	4501.4	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C=C1O	4511.7	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC1(CO)OC1OC(CO)C(O)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4596.2	Semi standard non polar	33892256
2-O-Galloylsucrose,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(CO)OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4566.6	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4608.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4608.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4614.1	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O)C1O	4578.5	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC(CO)C(O)C1O	4574.6	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O	4623.5	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4626.5	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4616.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4627.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4563.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4562.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4605.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4607.1	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4590.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4633.6	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4643.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)=CC(O)=C1O	4576.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4596.4	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	4647.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4643.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4653.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O	4584.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4613.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4607.3	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O)=C1O	4597.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O	4611.2	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4591.9	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4558.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C=C1O	4599.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C=C1O	4615.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1C(CO)OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	4664.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4621.0	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4576.7	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4568.6	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4643.4	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4626.8	Semi standard non polar	33892256
2-O-Galloylsucrose,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4604.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4698.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4639.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4631.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4689.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4685.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4693.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4643.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4656.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4693.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4683.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4649.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4684.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4665.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4695.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4686.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4654.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4617.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4662.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4647.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4658.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4638.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4705.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4685.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4681.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4691.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4640.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4622.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4688.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4685.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O	4691.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O)C1O	4643.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC(CO)C(O)C1O	4646.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O	4676.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4641.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4680.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O)C1O	4646.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC(CO)C(O)C1O	4653.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O	4677.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4683.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O)C1O	4657.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O)C1O	4619.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O	4643.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4641.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O	4628.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4618.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	4630.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OCC1(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4691.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4695.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4637.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4638.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4682.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4677.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #57	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4646.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #58	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4649.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #59	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4691.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4686.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #60	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4684.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #61	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4651.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #62	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4620.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #63	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4645.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #64	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4645.4	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #65	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4662.6	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #66	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4656.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #67	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4704.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #68	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O	4701.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #69	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)=CC(O)=C1O	4652.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(CO[Si](C)(C)C(C)(C)C)(OC2OC(CO)C(O)C(O)C2OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4676.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #70	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4681.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #71	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	4705.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #72	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)=CC(O)=C1O	4663.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #73	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4690.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #74	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2(CO)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	4717.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #75	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O	4675.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #76	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4674.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #77	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4645.9	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #78	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C=C1O	4679.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #79	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C1OC(=O)C1=CC(O)=C(O)C(O)=C1	4704.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4685.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #80	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O	4657.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #81	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4690.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #82	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O	4668.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #83	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4697.2	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #84	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4682.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #85	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4645.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #86	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O	4669.5	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #87	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4674.7	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #88	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4637.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #89	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O	4688.8	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2(CO)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1O	4697.1	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #90	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C	4651.3	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #91	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)OC2C(OC3(CO)OC(CO)C(O)C3O)OC(CO)C(O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C	4656.0	Semi standard non polar	33892256
2-O-Galloylsucrose,3TBDMS,isomer #92	CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C(=O)OC2C(OC3(CO)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C=C1O	4656.1	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - 2-O-Galloylsucrose GC-MS (Non-derivatized) - 70eV, Positive	splash10-0nor-9502800000-1b299890c242817d7de1	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 2-O-Galloylsucrose GC-MS (2 TMS) - 70eV, Positive	splash10-0fis-6901114000-3e5fca379d304f860570	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 2-O-Galloylsucrose GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 10V, Positive-QTOF	splash10-01q9-0900000000-46dec674dc02fc796de9	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 20V, Positive-QTOF	splash10-03yi-0903000000-0230ab077b985dcbf5e0	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 40V, Positive-QTOF	splash10-03du-9700000000-c40b73493504ed75b1d2	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 10V, Negative-QTOF	splash10-03di-1901100000-fc7a5e12fcb68662e303	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 20V, Negative-QTOF	splash10-03fr-0900000000-2dddffd05d280f01f129	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 40V, Negative-QTOF	splash10-00mn-4900000000-b8250999368a2a8a8e42	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 10V, Negative-QTOF	splash10-01ox-0705900000-23521783077106ad2dd5	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 20V, Negative-QTOF	splash10-001i-2603900000-9ce98969c96afaebb034	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 40V, Negative-QTOF	splash10-004i-5901100000-3c15da46441408e0afd3	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 10V, Positive-QTOF	splash10-0002-0202900000-957ae3c7603c36beea12	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 20V, Positive-QTOF	splash10-003s-1903300000-4d628ed688832a834618	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Galloylsucrose 40V, Positive-QTOF	splash10-0f6w-7902000000-679cad0d9fa8db30aa20	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB018826

KNApSAcK ID

C00056524

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

14055563

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for 2-O-Galloylsucrose (HMDB0039281)

MOL for HMDB0039281 (2-O-Galloylsucrose)

3D MOL for HMDB0039281 (2-O-Galloylsucrose)

3D SDF for HMDB0039281 (2-O-Galloylsucrose)

3D-SDF for HMDB0039281 (2-O-Galloylsucrose)

PDB for HMDB0039281 (2-O-Galloylsucrose)

3D PDB for HMDB0039281 (2-O-Galloylsucrose)

SMILES for HMDB0039281 (2-O-Galloylsucrose)

INCHI for HMDB0039281 (2-O-Galloylsucrose)

Structure for HMDB0039281 (2-O-Galloylsucrose)

3D Structure for HMDB0039281 (2-O-Galloylsucrose)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra