Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 00:48:54 UTC

Update Date

2022-03-07 02:56:11 UTC

HMDB ID

HMDB0039384

Secondary Accession Numbers

HMDB39384

Metabolite Identification

Common Name

Piceatannol 3,4'-diglucoside

Description

Piceatannol 3,4'-diglucoside belongs to the class of organic compounds known as stilbene glycosides. Stilbene glycosides are compounds structurally characterized by the presence of a carbohydrate moiety glycosidically linked to the stilbene skeleton. Piceatannol 3,4'-diglucoside has been detected, but not quantified in, green vegetables. This could make piceatannol 3,4'-diglucoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Piceatannol 3,4'-diglucoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061311042D          

 40 43  0  0  0  0            999 V2000
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  4  3  2  0  0  0  0
 11  1  1  0  0  0  0
 11  3  1  0  0  0  0
 11  7  2  0  0  0  0
 12  2  1  0  0  0  0
 12  5  2  0  0  0  0
 12  6  1  0  0  0  0
 13  5  1  0  0  0  0
 13  8  2  0  0  0  0
 14  6  2  0  0  0  0
 14  8  1  0  0  0  0
 15  7  1  0  0  0  0
 16  4  1  0  0  0  0
 16 15  2  0  0  0  0
 17  9  1  0  0  0  0
 18 10  1  0  0  0  0
 19 17  1  0  0  0  0
 20 18  1  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26 24  1  0  0  0  0
 27  9  1  0  0  0  0
 28 10  1  0  0  0  0
 29 13  1  0  0  0  0
 30 15  1  0  0  0  0
 31 19  1  0  0  0  0
 32 20  1  0  0  0  0
 33 21  1  0  0  0  0
 34 22  1  0  0  0  0
 35 23  1  0  0  0  0
 36 24  1  0  0  0  0
 37 14  1  0  0  0  0
 37 25  1  0  0  0  0
 38 16  1  0  0  0  0
 38 26  1  0  0  0  0
 39 17  1  0  0  0  0
 39 25  1  0  0  0  0
 40 18  1  0  0  0  0
 40 26  1  0  0  0  0
M  END

HMDB0039384
     RDKit          3D
Piceatannol 3,4'-diglucoside
 72 75  0  0  0  0  0  0  0  0999 V2000
    7.7283   -3.7702    1.7349 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1799   -3.4881    0.4918 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0368   -2.0096    0.2419 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1986   -1.4814    1.2266 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -0.1147    0.9725 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8659    0.3256    1.6630 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6406    0.7530    1.2201 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3635    0.7485   -0.1253 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1108    1.1948   -0.4921 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7746    1.2114   -1.8626 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1611    1.6280    0.3848 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4138    1.6387    1.7354 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5314    1.9657    2.8005 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7302    1.7891    2.8757 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5910    1.1934    1.9328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3250    0.1833    1.0527 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2330   -0.2475    0.1142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5168    0.3318    0.0008 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3735   -0.1356   -0.9446 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6259    0.2528   -1.2803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5094   -0.8044   -0.8895 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7750   -0.2571   -0.8525 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6939   -1.2112   -0.1362 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9935   -0.7009   -0.0711 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2902    0.0643   -2.2258 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4423    0.8501   -2.1093 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2569    0.7975   -3.0313 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5293    0.5932   -4.4033 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8488    0.3497   -2.7920 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9918    1.2856   -3.3651 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7947    1.3311    0.8680 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0328    1.9783    0.8524 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8716    1.7447    1.7942 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6988    1.1826    2.1162 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2705    0.5703    1.3437 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7065    0.0513    2.5777 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3031    0.1487    0.3218 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5415    0.5947    0.7904 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3815   -1.3605    0.2257 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9924   -1.6473   -1.0195 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6327   -4.1858    1.6612 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1920   -4.0223    0.3512 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8469   -3.9725   -0.2720 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5896   -1.8751   -0.7785 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8457   -0.0045   -0.1256 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0799    0.4119   -0.8951 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4488    0.8992   -2.5491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2032    2.0266    0.0568 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0397    2.4592    3.7043 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2595    2.1541    3.8356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3752   -0.3430    1.1250 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0242   -1.0433   -0.5838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    1.1437   -0.8445 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7107    0.7032   -0.2968 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6923   -2.1929   -0.6114 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3216   -1.3265    0.9198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9159    0.2587    0.1115 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5845   -0.8546   -2.7886 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2719    1.7478   -2.4943 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3351    1.9152   -2.9076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8803   -0.3215   -4.5537 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6849   -0.6213   -3.2721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6652    1.0045   -4.2561 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2676    2.7220    1.4846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1329    2.5487    2.4687 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9761    1.1623    3.1767 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1980    1.6682    1.3753 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5306   -0.9414    2.5237 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1385    0.6430   -0.6598 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0246   -0.0641    1.3150 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0470   -1.7631    0.9917 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9588   -1.4577   -0.9491 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 18 31  1  0
 31 32  1  0
 31 33  2  0
 12 34  2  0
  5 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39  3  1  0
 34  7  1  0
 33 15  1  0
 29 20  1  0
  1 41  1  0
  2 42  1  0
  2 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 16 51  1  0
 17 52  1  0
 20 53  1  0
 22 54  1  0
 23 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 29 62  1  0
 30 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
M  END


  Mrv0541 05061311042D          

 40 43  0  0  0  0            999 V2000
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  4  3  2  0  0  0  0
 11  1  1  0  0  0  0
 11  3  1  0  0  0  0
 11  7  2  0  0  0  0
 12  2  1  0  0  0  0
 12  5  2  0  0  0  0
 12  6  1  0  0  0  0
 13  5  1  0  0  0  0
 13  8  2  0  0  0  0
 14  6  2  0  0  0  0
 14  8  1  0  0  0  0
 15  7  1  0  0  0  0
 16  4  1  0  0  0  0
 16 15  2  0  0  0  0
 17  9  1  0  0  0  0
 18 10  1  0  0  0  0
 19 17  1  0  0  0  0
 20 18  1  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26 24  1  0  0  0  0
 27  9  1  0  0  0  0
 28 10  1  0  0  0  0
 29 13  1  0  0  0  0
 30 15  1  0  0  0  0
 31 19  1  0  0  0  0
 32 20  1  0  0  0  0
 33 21  1  0  0  0  0
 34 22  1  0  0  0  0
 35 23  1  0  0  0  0
 36 24  1  0  0  0  0
 37 14  1  0  0  0  0
 37 25  1  0  0  0  0
 38 16  1  0  0  0  0
 38 26  1  0  0  0  0
 39 17  1  0  0  0  0
 39 25  1  0  0  0  0
 40 18  1  0  0  0  0
 40 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039384

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2=CC(\C=C/C3=CC(O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3)=CC(O)=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C26H32O14/c27-9-17-19(31)21(33)23(35)25(39-17)37-14-6-12(5-13(29)8-14)2-1-11-3-4-16(15(30)7-11)38-26-24(36)22(34)20(32)18(10-28)40-26/h1-8,17-36H,9-10H2/b2-1-

> <INCHI_KEY>
UWGYRKQDXBYOFK-UPHRSURJSA-N

> <FORMULA>
C26H32O14

> <MOLECULAR_WEIGHT>
568.5239

> <EXACT_MASS>
568.179205732

> <JCHEM_ACCEPTOR_COUNT>
14

> <JCHEM_AVERAGE_POLARIZABILITY>
55.64966364561386

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-{3-hydroxy-5-[(Z)-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol

> <ALOGPS_LOGP>
-0.68

> <JCHEM_LOGP>
-1.4373106219999991

> <ALOGPS_LOGS>
-2.64

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.842793329127216

> <JCHEM_PKA_STRONGEST_ACIDIC>
9.169459480116812

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6483953457088125

> <JCHEM_POLAR_SURFACE_AREA>
239.21999999999994

> <JCHEM_REFRACTIVITY>
133.72519999999994

> <JCHEM_ROTATABLE_BOND_COUNT>
8

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.29e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-{3-hydroxy-5-[(Z)-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0039384
     RDKit          3D
Piceatannol 3,4'-diglucoside
 72 75  0  0  0  0  0  0  0  0999 V2000
    7.7283   -3.7702    1.7349 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1799   -3.4881    0.4918 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0368   -2.0096    0.2419 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1986   -1.4814    1.2266 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -0.1147    0.9725 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8659    0.3256    1.6630 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6406    0.7530    1.2201 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3635    0.7485   -0.1253 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1108    1.1948   -0.4921 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7746    1.2114   -1.8626 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1611    1.6280    0.3848 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4138    1.6387    1.7354 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5314    1.9657    2.8005 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7302    1.7891    2.8757 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5910    1.1934    1.9328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3250    0.1833    1.0527 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2330   -0.2475    0.1142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5168    0.3318    0.0008 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3735   -0.1356   -0.9446 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6259    0.2528   -1.2803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5094   -0.8044   -0.8895 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7750   -0.2571   -0.8525 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6939   -1.2112   -0.1362 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9935   -0.7009   -0.0711 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2902    0.0643   -2.2258 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4423    0.8501   -2.1093 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2569    0.7975   -3.0313 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5293    0.5932   -4.4033 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8488    0.3497   -2.7920 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9918    1.2856   -3.3651 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7947    1.3311    0.8680 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0328    1.9783    0.8524 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8716    1.7447    1.7942 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6988    1.1826    2.1162 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2705    0.5703    1.3437 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7065    0.0513    2.5777 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3031    0.1487    0.3218 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5415    0.5947    0.7904 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3815   -1.3605    0.2257 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9924   -1.6473   -1.0195 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6327   -4.1858    1.6612 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1920   -4.0223    0.3512 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8469   -3.9725   -0.2720 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5896   -1.8751   -0.7785 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8457   -0.0045   -0.1256 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0799    0.4119   -0.8951 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4488    0.8992   -2.5491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2032    2.0266    0.0568 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0397    2.4592    3.7043 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2595    2.1541    3.8356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3752   -0.3430    1.1250 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0242   -1.0433   -0.5838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    1.1437   -0.8445 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7107    0.7032   -0.2968 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6923   -2.1929   -0.6114 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3216   -1.3265    0.9198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9159    0.2587    0.1115 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5845   -0.8546   -2.7886 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2719    1.7478   -2.4943 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3351    1.9152   -2.9076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8803   -0.3215   -4.5537 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6849   -0.6213   -3.2721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6652    1.0045   -4.2561 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2676    2.7220    1.4846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1329    2.5487    2.4687 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9761    1.1623    3.1767 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1980    1.6682    1.3753 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5306   -0.9414    2.5237 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1385    0.6430   -0.6598 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0246   -0.0641    1.3150 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0470   -1.7631    0.9917 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9588   -1.4577   -0.9491 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 18 31  1  0
 31 32  1  0
 31 33  2  0
 12 34  2  0
  5 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39  3  1  0
 34  7  1  0
 33 15  1  0
 29 20  1  0
  1 41  1  0
  2 42  1  0
  2 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 16 51  1  0
 17 52  1  0
 20 53  1  0
 22 54  1  0
 23 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 29 62  1  0
 30 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       2.667   6.160   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       1.334  13.090   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       5.335   6.160   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.001   6.930   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       1.334  11.550   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       0.000  10.780   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       0.000   9.240   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       1.334   8.470   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       2.667   9.240   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       0.000  13.860   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       0.000   6.160   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       6.668   6.930   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -1.334  11.550   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      -1.334   8.470   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      -5.335   0.000   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       1.334   6.930   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      -2.667   1.540   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       4.001   8.470   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      -1.334  -0.770   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       2.667  10.780   0.000  0.00  0.00           O+0
CONECT    1    2   11                                                       
CONECT    2    1   12                                                       
CONECT    3    4   11                                                       
CONECT    4    3   16                                                       
CONECT    5   12   13                                                       
CONECT    6   12   14                                                       
CONECT    7   11   15                                                       
CONECT    8   13   14                                                       
CONECT    9   17   27                                                       
CONECT   10   18   28                                                       
CONECT   11    1    3    7                                                  
CONECT   12    2    5    6                                                  
CONECT   13    5    8   29                                                  
CONECT   14    6    8   37                                                  
CONECT   15    7   16   30                                                  
CONECT   16    4   15   38                                                  
CONECT   17    9   19   39                                                  
CONECT   18   10   20   40                                                  
CONECT   19   17   21   31                                                  
CONECT   20   18   22   32                                                  
CONECT   21   19   23   33                                                  
CONECT   22   20   24   34                                                  
CONECT   23   21   25   35                                                  
CONECT   24   22   26   36                                                  
CONECT   25   23   37   39                                                  
CONECT   26   24   38   40                                                  
CONECT   27    9                                                            
CONECT   28   10                                                            
CONECT   29   13                                                            
CONECT   30   15                                                            
CONECT   31   19                                                            
CONECT   32   20                                                            
CONECT   33   21                                                            
CONECT   34   22                                                            
CONECT   35   23                                                            
CONECT   36   24                                                            
CONECT   37   14   25                                                       
CONECT   38   16   26                                                       
CONECT   39   17   25                                                       
CONECT   40   18   26                                                       
MASTER        0    0    0    0    0    0    0    0   40    0   86    0
END

COMPND    HMDB0039384
HETATM    1  O1  UNL     1       7.728  -3.770   1.735  1.00  0.00           O  
HETATM    2  C1  UNL     1       7.180  -3.488   0.492  1.00  0.00           C  
HETATM    3  C2  UNL     1       7.037  -2.010   0.242  1.00  0.00           C  
HETATM    4  O2  UNL     1       6.199  -1.481   1.227  1.00  0.00           O  
HETATM    5  C3  UNL     1       5.967  -0.115   0.972  1.00  0.00           C  
HETATM    6  O3  UNL     1       4.866   0.326   1.663  1.00  0.00           O  
HETATM    7  C4  UNL     1       3.641   0.753   1.220  1.00  0.00           C  
HETATM    8  C5  UNL     1       3.364   0.749  -0.125  1.00  0.00           C  
HETATM    9  C6  UNL     1       2.111   1.195  -0.492  1.00  0.00           C  
HETATM   10  O4  UNL     1       1.775   1.211  -1.863  1.00  0.00           O  
HETATM   11  C7  UNL     1       1.161   1.628   0.385  1.00  0.00           C  
HETATM   12  C8  UNL     1       1.414   1.639   1.735  1.00  0.00           C  
HETATM   13  C9  UNL     1       0.531   1.966   2.801  1.00  0.00           C  
HETATM   14  C10 UNL     1      -0.730   1.789   2.876  1.00  0.00           C  
HETATM   15  C11 UNL     1      -1.591   1.193   1.933  1.00  0.00           C  
HETATM   16  C12 UNL     1      -1.325   0.183   1.053  1.00  0.00           C  
HETATM   17  C13 UNL     1      -2.233  -0.248   0.114  1.00  0.00           C  
HETATM   18  C14 UNL     1      -3.517   0.332   0.001  1.00  0.00           C  
HETATM   19  O5  UNL     1      -4.373  -0.136  -0.945  1.00  0.00           O  
HETATM   20  C15 UNL     1      -5.626   0.253  -1.280  1.00  0.00           C  
HETATM   21  O6  UNL     1      -6.509  -0.804  -0.889  1.00  0.00           O  
HETATM   22  C16 UNL     1      -7.775  -0.257  -0.853  1.00  0.00           C  
HETATM   23  C17 UNL     1      -8.694  -1.211  -0.136  1.00  0.00           C  
HETATM   24  O7  UNL     1      -9.994  -0.701  -0.071  1.00  0.00           O  
HETATM   25  C18 UNL     1      -8.290   0.064  -2.226  1.00  0.00           C  
HETATM   26  O8  UNL     1      -9.442   0.850  -2.109  1.00  0.00           O  
HETATM   27  C19 UNL     1      -7.257   0.798  -3.031  1.00  0.00           C  
HETATM   28  O9  UNL     1      -7.529   0.593  -4.403  1.00  0.00           O  
HETATM   29  C20 UNL     1      -5.849   0.350  -2.792  1.00  0.00           C  
HETATM   30  O10 UNL     1      -4.992   1.286  -3.365  1.00  0.00           O  
HETATM   31  C21 UNL     1      -3.795   1.331   0.868  1.00  0.00           C  
HETATM   32  O11 UNL     1      -5.033   1.978   0.852  1.00  0.00           O  
HETATM   33  C22 UNL     1      -2.872   1.745   1.794  1.00  0.00           C  
HETATM   34  C23 UNL     1       2.699   1.183   2.116  1.00  0.00           C  
HETATM   35  C24 UNL     1       7.271   0.570   1.344  1.00  0.00           C  
HETATM   36  O12 UNL     1       7.707   0.051   2.578  1.00  0.00           O  
HETATM   37  C25 UNL     1       8.303   0.149   0.322  1.00  0.00           C  
HETATM   38  O13 UNL     1       9.542   0.595   0.790  1.00  0.00           O  
HETATM   39  C26 UNL     1       8.381  -1.361   0.226  1.00  0.00           C  
HETATM   40  O14 UNL     1       8.992  -1.647  -1.019  1.00  0.00           O  
HETATM   41  H1  UNL     1       8.633  -4.186   1.661  1.00  0.00           H  
HETATM   42  H2  UNL     1       6.192  -4.022   0.351  1.00  0.00           H  
HETATM   43  H3  UNL     1       7.847  -3.973  -0.272  1.00  0.00           H  
HETATM   44  H4  UNL     1       6.590  -1.875  -0.779  1.00  0.00           H  
HETATM   45  H5  UNL     1       5.846  -0.004  -0.126  1.00  0.00           H  
HETATM   46  H6  UNL     1       4.080   0.412  -0.895  1.00  0.00           H  
HETATM   47  H7  UNL     1       2.449   0.899  -2.549  1.00  0.00           H  
HETATM   48  H8  UNL     1       0.203   2.027   0.057  1.00  0.00           H  
HETATM   49  H9  UNL     1       1.040   2.459   3.704  1.00  0.00           H  
HETATM   50  H10 UNL     1      -1.259   2.154   3.836  1.00  0.00           H  
HETATM   51  H11 UNL     1      -0.375  -0.343   1.125  1.00  0.00           H  
HETATM   52  H12 UNL     1      -2.024  -1.043  -0.584  1.00  0.00           H  
HETATM   53  H13 UNL     1      -6.071   1.144  -0.844  1.00  0.00           H  
HETATM   54  H14 UNL     1      -7.711   0.703  -0.297  1.00  0.00           H  
HETATM   55  H15 UNL     1      -8.692  -2.193  -0.611  1.00  0.00           H  
HETATM   56  H16 UNL     1      -8.322  -1.327   0.920  1.00  0.00           H  
HETATM   57  H17 UNL     1      -9.916   0.259   0.111  1.00  0.00           H  
HETATM   58  H18 UNL     1      -8.584  -0.855  -2.789  1.00  0.00           H  
HETATM   59  H19 UNL     1      -9.272   1.748  -2.494  1.00  0.00           H  
HETATM   60  H20 UNL     1      -7.335   1.915  -2.908  1.00  0.00           H  
HETATM   61  H21 UNL     1      -7.880  -0.322  -4.554  1.00  0.00           H  
HETATM   62  H22 UNL     1      -5.685  -0.621  -3.272  1.00  0.00           H  
HETATM   63  H23 UNL     1      -4.665   1.004  -4.256  1.00  0.00           H  
HETATM   64  H24 UNL     1      -5.268   2.722   1.485  1.00  0.00           H  
HETATM   65  H25 UNL     1      -3.133   2.549   2.469  1.00  0.00           H  
HETATM   66  H26 UNL     1       2.976   1.162   3.177  1.00  0.00           H  
HETATM   67  H27 UNL     1       7.198   1.668   1.375  1.00  0.00           H  
HETATM   68  H28 UNL     1       7.531  -0.941   2.524  1.00  0.00           H  
HETATM   69  H29 UNL     1       8.138   0.643  -0.660  1.00  0.00           H  
HETATM   70  H30 UNL     1      10.025  -0.064   1.315  1.00  0.00           H  
HETATM   71  H31 UNL     1       9.047  -1.763   0.992  1.00  0.00           H  
HETATM   72  H32 UNL     1       9.959  -1.458  -0.949  1.00  0.00           H  
CONECT    1    2   41
CONECT    2    3   42   43
CONECT    3    4   39   44
CONECT    4    5
CONECT    5    6   35   45
CONECT    6    7
CONECT    7    8    8   34
CONECT    8    9   46
CONECT    9   10   11   11
CONECT   10   47
CONECT   11   12   48
CONECT   12   13   34   34
CONECT   13   14   14   49
CONECT   14   15   50
CONECT   15   16   16   33
CONECT   16   17   51
CONECT   17   18   18   52
CONECT   18   19   31
CONECT   19   20
CONECT   20   21   29   53
CONECT   21   22
CONECT   22   23   25   54
CONECT   23   24   55   56
CONECT   24   57
CONECT   25   26   27   58
CONECT   26   59
CONECT   27   28   29   60
CONECT   28   61
CONECT   29   30   62
CONECT   30   63
CONECT   31   32   33   33
CONECT   32   64
CONECT   33   65
CONECT   34   66
CONECT   35   36   37   67
CONECT   36   68
CONECT   37   38   39   69
CONECT   38   70
CONECT   39   40   71
CONECT   40   72
END

HMDB0039384
     RDKit          3D
Piceatannol 3,4'-diglucoside
 72 75  0  0  0  0  0  0  0  0999 V2000
    7.7283   -3.7702    1.7349 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1799   -3.4881    0.4918 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0368   -2.0096    0.2419 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1986   -1.4814    1.2266 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -0.1147    0.9725 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8659    0.3256    1.6630 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6406    0.7530    1.2201 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3635    0.7485   -0.1253 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1108    1.1948   -0.4921 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7746    1.2114   -1.8626 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1611    1.6280    0.3848 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4138    1.6387    1.7354 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5314    1.9657    2.8005 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7302    1.7891    2.8757 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5910    1.1934    1.9328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3250    0.1833    1.0527 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2330   -0.2475    0.1142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5168    0.3318    0.0008 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3735   -0.1356   -0.9446 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6259    0.2528   -1.2803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5094   -0.8044   -0.8895 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7750   -0.2571   -0.8525 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6939   -1.2112   -0.1362 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9935   -0.7009   -0.0711 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2902    0.0643   -2.2258 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4423    0.8501   -2.1093 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2569    0.7975   -3.0313 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5293    0.5932   -4.4033 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8488    0.3497   -2.7920 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9918    1.2856   -3.3651 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7947    1.3311    0.8680 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0328    1.9783    0.8524 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8716    1.7447    1.7942 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6988    1.1826    2.1162 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2705    0.5703    1.3437 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7065    0.0513    2.5777 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3031    0.1487    0.3218 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5415    0.5947    0.7904 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3815   -1.3605    0.2257 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9924   -1.6473   -1.0195 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6327   -4.1858    1.6612 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1920   -4.0223    0.3512 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8469   -3.9725   -0.2720 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5896   -1.8751   -0.7785 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8457   -0.0045   -0.1256 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0799    0.4119   -0.8951 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4488    0.8992   -2.5491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2032    2.0266    0.0568 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0397    2.4592    3.7043 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2595    2.1541    3.8356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3752   -0.3430    1.1250 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0242   -1.0433   -0.5838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    1.1437   -0.8445 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7107    0.7032   -0.2968 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6923   -2.1929   -0.6114 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3216   -1.3265    0.9198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9159    0.2587    0.1115 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5845   -0.8546   -2.7886 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2719    1.7478   -2.4943 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3351    1.9152   -2.9076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8803   -0.3215   -4.5537 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6849   -0.6213   -3.2721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6652    1.0045   -4.2561 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2676    2.7220    1.4846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1329    2.5487    2.4687 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9761    1.1623    3.1767 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1980    1.6682    1.3753 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5306   -0.9414    2.5237 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1385    0.6430   -0.6598 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0246   -0.0641    1.3150 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0470   -1.7631    0.9917 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9588   -1.4577   -0.9491 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 18 31  1  0
 31 32  1  0
 31 33  2  0
 12 34  2  0
  5 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39  3  1  0
 34  7  1  0
 33 15  1  0
 29 20  1  0
  1 41  1  0
  2 42  1  0
  2 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 16 51  1  0
 17 52  1  0
 20 53  1  0
 22 54  1  0
 23 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 28 61  1  0
 29 62  1  0
 30 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Not Available

Chemical Formula

C₂₆H₃₂O₁₄

Average Molecular Weight

568.5239

Monoisotopic Molecular Weight

568.179205732

IUPAC Name

2-{3-hydroxy-5-[(Z)-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol

Traditional Name

2-{3-hydroxy-5-[(Z)-2-(3-hydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol

CAS Registry Number

282736-93-0

SMILES

OCC1OC(OC2=CC(\C=C/C3=CC(O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3)=CC(O)=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C26H32O14/c27-9-17-19(31)21(33)23(35)25(39-17)37-14-6-12(5-13(29)8-14)2-1-11-3-4-16(15(30)7-11)38-26-24(36)22(34)20(32)18(10-28)40-26/h1-8,17-36H,9-10H2/b2-1-

InChI Key

UWGYRKQDXBYOFK-UPHRSURJSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as stilbene glycosides. Stilbene glycosides are compounds structurally characterized by the presence of a carbohydrate moiety glycosidically linked to the stilbene skeleton.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Stilbenes

Sub Class

Stilbene glycosides

Direct Parent

Stilbene glycosides

Alternative Parents

Substituents

Stilbene glycoside
Phenolic glycoside
Glycosyl compound
O-glycosyl compound
Phenoxy compound
Styrene
Phenol ether
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Phenol
Monocyclic benzene moiety
Monosaccharide
Benzenoid
Oxane
Secondary alcohol
Acetal
Oxacycle
Organoheterocyclic compound
Polyol
Alcohol
Hydrocarbon derivative
Organooxygen compound
Primary alcohol
Organic oxygen compound
Aromatic heteromonocyclic compound

Molecular Framework

Aromatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0039384)
Cytoplasm (HMDB: HMDB0039384)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0039384)

Source

Exogenous

Food

Food (HMDB: HMDB0039384)

Vegetable

Leaf vegetable

Green vegetables (FooDB: FOOD00872)

Endogenous

Plant

Plant (HMDB: HMDB0039384)

Not Available

Nutrient (HMDB: HMDB0039384)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.29 g/L	ALOGPS
logP	-0.68	ALOGPS
logP	-1.4	ChemAxon
logS	-2.6	ALOGPS
pKa (Strongest Acidic)	9.17	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	14	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	239.22 Å²	ChemAxon
Rotatable Bond Count	8	ChemAxon
Refractivity	133.73 m³·mol⁻¹	ChemAxon
Polarizability	55.65 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	227.662	30932474
DeepCCS	[M-H]-	225.266	30932474
DeepCCS	[M-2H]-	258.179	30932474
DeepCCS	[M+Na]+	233.574	30932474
AllCCS	[M+H]+	227.1	32859911
AllCCS	[M+H-H2O]+	225.8	32859911
AllCCS	[M+NH4]+	228.3	32859911
AllCCS	[M+Na]+	228.7	32859911
AllCCS	[M-H]-	218.9	32859911
AllCCS	[M+Na-2H]-	221.0	32859911
AllCCS	[M+HCOO]-	223.5	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Piceatannol 3,4'-diglucoside	OCC1OC(OC2=CC(\C=C/C3=CC(O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3)=CC(O)=C2)C(O)C(O)C1O	6211.8	Standard polar	33892256
Piceatannol 3,4'-diglucoside	OCC1OC(OC2=CC(\C=C/C3=CC(O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3)=CC(O)=C2)C(O)C(O)C1O	5453.9	Standard non polar	33892256
Piceatannol 3,4'-diglucoside	OCC1OC(OC2=CC(\C=C/C3=CC(O)=C(OC4OC(CO)C(O)C(O)C4O)C=C3)=CC(O)=C2)C(O)C(O)C1O	5315.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Piceatannol 3,4'-diglucoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5246.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C1O	5257.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #2	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5282.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O	5249.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C1O	5261.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #5	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C1O	5232.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #6	C[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)OC(CO)C(O)C1O	5269.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #7	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5303.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #8	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O	5264.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TMS,isomer #9	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C1O	5237.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5160.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #10	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5186.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #11	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5168.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #12	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5150.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #13	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5191.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5166.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #15	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5171.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #16	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5138.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5185.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5164.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O	5138.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5135.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O	5123.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5168.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5172.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5128.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5158.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #25	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5169.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #26	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C1O	5147.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #27	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C1O	5126.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #28	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C1O	5173.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #29	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C1O	5165.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5137.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #30	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C1O[Si](C)(C)C	5143.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #31	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5124.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #32	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C1O	5113.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #33	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C1O	5086.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #34	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O	5138.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #35	C[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)OC(CO)C(O)C1O[Si](C)(C)C	5178.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #36	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5174.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #37	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C1O	5162.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #38	C[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)OC(CO)C(O)C1O	5139.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #39	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)OC(CO)C(O)C1O	5193.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5110.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #40	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	5161.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #41	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	5138.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #42	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5185.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O	5169.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #44	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O[Si](C)(C)C	5183.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C1O[Si](C)(C)C	5152.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	5158.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	5164.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5179.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	5139.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	5153.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5069.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5044.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #100	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5120.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #101	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5095.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #102	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	5049.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #103	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	5027.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #104	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5057.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #105	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C1O	5089.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #106	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O	5058.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #107	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C1O	5035.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #108	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C1O	5061.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #109	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C1O	5066.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	5089.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #110	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)OC(CO)C(O)C1O	5110.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #111	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	5092.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #112	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	5055.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #113	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5114.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #114	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O	5104.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #115	C[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)OC(CO)C(O)C1O	5079.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #116	C[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)OC(CO)C(O)C1O	5114.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #117	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1	5078.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #118	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1	5102.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #119	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1	5111.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	5069.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #120	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5131.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5102.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O	5055.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O	5072.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5048.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	5071.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	5082.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5106.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5078.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	5059.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	5081.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	5084.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	5051.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5070.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	5018.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	5043.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	5095.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5117.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	5069.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5035.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	5094.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5128.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	5086.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	5102.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5111.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5116.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5078.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5088.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #38	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5097.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #39	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5053.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5086.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #40	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5105.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #41	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	5092.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #42	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	5063.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #43	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5120.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #44	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5094.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #45	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5123.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5082.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #47	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5096.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #48	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5061.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #49	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5105.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	5086.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5127.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5063.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #52	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5070.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #53	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5023.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #54	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5080.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	5104.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5113.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5079.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #58	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5125.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5117.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5121.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5074.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5101.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #62	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5085.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #63	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5111.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #64	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5114.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5073.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5048.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5100.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5106.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5057.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	5068.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5092.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O	5062.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5085.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5095.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5046.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5080.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5099.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5069.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5019.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5057.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	5087.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5117.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	5068.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	5102.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5098.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5103.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5065.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #86	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5069.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #87	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5088.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #88	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	5088.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #89	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	5059.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5075.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #90	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5104.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #91	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C1O	5062.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #92	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C1O	5082.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #93	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C1O	5096.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #94	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C1O	5074.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #95	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C1O	5104.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #96	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C1O	5055.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #97	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C1O	5035.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #98	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C1O	5103.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,3TMS,isomer #99	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O	5081.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4957.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4970.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #100	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	5000.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #101	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	4948.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #102	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5014.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #103	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1	4967.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #104	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1	4988.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #105	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1	4997.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #106	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5032.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4955.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #108	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4968.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #109	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4921.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	4997.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #110	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4979.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4973.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #112	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4989.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #113	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4942.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #114	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5002.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4996.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4940.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4977.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #118	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4960.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #119	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4981.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4943.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #120	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4988.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #121	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4984.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #122	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4999.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #123	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4951.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5011.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #125	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4958.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #126	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4899.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #127	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4940.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #128	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4921.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #129	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4942.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	4972.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #130	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4945.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #131	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5012.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #132	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4957.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #133	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4995.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #134	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4976.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #135	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5001.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #136	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5009.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #137	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4998.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #138	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5013.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #139	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4975.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4953.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #140	C[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5017.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #141	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4938.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #142	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4957.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #143	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4986.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #144	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4932.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #145	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	4968.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #146	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4967.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #147	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4947.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #148	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4905.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #149	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	4934.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4920.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #150	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	5001.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #151	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4941.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #152	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	4983.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #153	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4974.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #154	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4989.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #155	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4955.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #156	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4977.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #157	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4965.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #158	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4905.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #159	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	4947.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	4947.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #160	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4986.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #161	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4926.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #162	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	4967.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #163	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4969.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #164	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4984.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #165	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4948.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #166	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4992.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #167	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4932.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #168	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C	4975.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #169	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4935.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4904.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #170	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4950.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #171	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4914.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #172	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4989.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #173	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5003.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #174	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4968.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #175	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5010.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #176	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	4992.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #177	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	4946.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #178	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	4908.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #179	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	4955.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	4927.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #180	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	4964.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #181	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	4932.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #182	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	4976.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #183	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1	4956.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #184	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1	4974.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #185	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1	4987.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #186	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C1O	4984.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #187	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O	4945.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #188	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C1O[Si](C)(C)C	4924.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #189	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O	4966.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4975.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #190	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C1O	4944.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #191	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C1O	4999.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #192	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O[Si](C)(C)C)C1O	4973.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #193	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C1O[Si](C)(C)C	4952.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #194	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C1O	4950.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #195	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)OC(CO)C(O)C1O	5000.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #196	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	4973.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #197	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	4935.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #198	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	4984.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #199	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1	4908.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4922.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5003.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #200	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1	4930.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #201	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1	4939.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #202	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C1O	4970.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #203	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C1O[Si](C)(C)C	4947.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #204	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C1O	4956.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #205	C[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)OC(CO)C(O)C1O[Si](C)(C)C	4976.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #206	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=C1	4957.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #207	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=C1	4978.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #208	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1	4988.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #209	C[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)OC(CO)C(O)C1O	5003.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4943.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #210	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=C1	5007.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	4977.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O	5013.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O	4953.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O[Si](C)(C)C	4983.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4988.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5001.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4965.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O	4936.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4974.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	4974.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	4957.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	4981.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4927.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4952.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	4956.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	4925.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	4947.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4893.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C)C1O	4921.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4952.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	4975.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5003.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4947.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C)C(O)C1O	4973.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4982.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4933.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4958.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4983.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4968.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O	4946.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4981.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	4964.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	4946.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	4967.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4905.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4940.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	4965.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	4986.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4927.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4960.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5005.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4931.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4949.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4979.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4983.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4997.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4960.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O	4972.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	4990.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4929.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4963.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	4958.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O)C(O)C(O)C1O	4957.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4901.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4934.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4938.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4952.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4915.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O	5014.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O	4959.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C	4990.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4991.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5005.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4928.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4970.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5011.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5023.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C)=C3)=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4989.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5024.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4967.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4927.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O	4981.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5000.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4945.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)=C3)=CC(O[Si](C)(C)C)=C2)C(O)C(O)C1O	4948.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C)=C3)C=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4984.5	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #91	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	4958.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #92	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	4981.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #93	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	4992.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #94	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	4946.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #95	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	5004.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #96	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	4985.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #97	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=C1	4941.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #98	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=C1	4907.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,4TMS,isomer #99	C[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(O[Si](C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=C1	4946.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5471.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C1O	5504.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5500.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O	5475.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C1O	5511.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C1O	5489.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)OC(CO)C(O)C1O	5516.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5529.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O	5516.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C1O	5500.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=CC(O[Si](C)(C)C(C)(C)C)=C2)C(O)C(O)C1O	5570.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O[Si](C)(C)C(C)(C)C)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5618.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5584.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5575.0	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O	5601.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5562.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5586.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5561.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC(O)=CC(OC3OC(CO)C(O)C(O)C3O)=C2)=CC=C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5593.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(OC4OC(CO)C(O)C(O)C4O)=CC(O[Si](C)(C)C(C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5575.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O	5539.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5520.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)C=C2O)C(O)C(O)C1O	5530.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)C=C2O)C(O)C(O)C1O	5557.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5574.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5548.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5552.6	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5599.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C1O	5558.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)C=C2O)C(O)C1O	5546.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3)C=C2O)C(O)C1O	5576.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5577.9	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5539.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5553.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5564.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3)=C2)C(O)C1O	5528.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3)=C2)C1O	5513.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O	5545.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O)C4O)=C3)C=C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5593.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O)=C1	5596.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3)=C2)C(O)C1O	5566.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=C(/C=C\C3=CC(O)=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3)C=C2O)OC(CO)C(O)C1O	5550.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3)=C2)OC(CO)C(O)C1O	5586.2	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)=C3)=C2)C(O)C(O)C1O	5512.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=C1	5591.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=C1	5584.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC(/C=C\C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(O)=C2)=CC(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=C1	5609.8	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	5586.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5604.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	5569.7	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)=C3)=C2)C(O)C(O)C1O	5548.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)=C3)=C2)C(O)C(O)C1O	5559.3	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5585.4	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5564.1	Semi standard non polar	33892256
Piceatannol 3,4'-diglucoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=CC(/C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C(O)=C3)=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5548.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0zfr-2400690000-1634534f000d30e9c462	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (1 TMS) - 70eV, Positive	splash10-00di-6820139000-4f44692f9fd736c02a81	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS ("Piceatannol 3,4'-diglucoside,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Piceatannol 3,4'-diglucoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 10V, Positive-QTOF	splash10-052r-0198770000-72acfb5d968e0c7fc3fc	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 20V, Positive-QTOF	splash10-052o-0293100000-79c0a64657e64f699e8c	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 40V, Positive-QTOF	splash10-0006-1391100000-2b2540ff45422b378b3e	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 10V, Negative-QTOF	splash10-066r-1223790000-87bb3d000e2df7a53e82	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 20V, Negative-QTOF	splash10-0a4r-1249830000-68cb568da830f8c317c5	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 40V, Negative-QTOF	splash10-0006-2291100000-995a6abe523061bf1610	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 10V, Negative-QTOF	splash10-066r-0110690000-5bece74431a9faa7165b	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 20V, Negative-QTOF	splash10-0a4r-1155900000-871ee6d19bbd0c7e6961	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 40V, Negative-QTOF	splash10-0006-1090100000-57f546f1f20787307093	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 10V, Positive-QTOF	splash10-0a4s-0369850000-6ee9380aabdbc8cba806	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 20V, Positive-QTOF	splash10-052b-0232930000-bcf4a5516c4fed6358a2	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Piceatannol 3,4'-diglucoside 40V, Positive-QTOF	splash10-05r1-7472910000-b915056ab73a1bc06c1a	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB018954

KNApSAcK ID

C00057323

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131752625

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Piceatannol 3,4'-diglucoside (HMDB0039384)

MOL for HMDB0039384 (Piceatannol 3,4'-diglucoside)

3D MOL for HMDB0039384 (Piceatannol 3,4'-diglucoside)

3D SDF for HMDB0039384 (Piceatannol 3,4'-diglucoside)

3D-SDF for HMDB0039384 (Piceatannol 3,4'-diglucoside)

PDB for HMDB0039384 (Piceatannol 3,4'-diglucoside)

3D PDB for HMDB0039384 (Piceatannol 3,4'-diglucoside)

SMILES for HMDB0039384 (Piceatannol 3,4'-diglucoside)

INCHI for HMDB0039384 (Piceatannol 3,4'-diglucoside)

Structure for HMDB0039384 (Piceatannol 3,4'-diglucoside)

3D Structure for HMDB0039384 (Piceatannol 3,4'-diglucoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra