Hmdb loader

Showing metabocard for Ginsenoside Rh1 (HMDB0039554)

Jump To Section:
IdentificationTaxonomyOntologyPhysical propertiesSpectraBiological propertiesConcentrationsLinksReferencesXML
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-12 01:03:04 UTC
Update Date2022-03-07 02:56:15 UTC
HMDB IDHMDB0039554
Secondary Accession Numbers
  • HMDB39554
Metabolite Identification
Common NameGinsenoside Rh1
DescriptionGinsenoside Rh1 belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a significant number of articles have been published on Ginsenoside Rh1.
Structure
Thumb
MOL3D MOLSDF3D SDFPDB3D PDBSMILESInChI

MOL for HMDB0039554 (Ginsenoside Rh1)


  Mrv0541 05061311142D          

 45 49  0  0  0  0            999 V2000
    2.1086    4.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8955    3.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4785    2.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2653    1.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4679    2.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -0.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0096   -0.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4950    0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0096    1.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258    0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108    1.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108    2.0329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042    0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042   -0.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5187    0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -1.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042   -1.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9178   -1.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9178   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9178    0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7281    4.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5256    4.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7387    5.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6328   -0.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3464   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3464   -1.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0615   -1.6796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1622   -2.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6328   -1.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1020   -2.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0615    1.6217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042   -2.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -2.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -2.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -1.6796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -3.7421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9396   -3.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6546   -4.1547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9396   -2.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6546   -2.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3120   -0.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -4.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -5.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 23  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4  9  1  0  0  0  0
  4 32  1  0  0  0  0
  6  7  1  0  0  0  0
  6 10  1  0  0  0  0
  6 15  1  0  0  0  0
  6 43  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 14 20  1  0  0  0  0
 15 16  1  0  0  0  0
 15 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 18 33  1  0  0  0  0
 19 20  1  0  0  0  0
 19 30  1  0  0  0  0
 20 21  1  0  0  0  0
 20 25  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 30  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 34 37  1  0  0  0  0
 35 36  1  0  0  0  0
 35 41  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 38 44  1  0  0  0  0
 39 40  1  0  0  0  0
 39 41  1  0  0  0  0
 41 42  1  0  0  0  0
 44 45  1  0  0  0  0
M  END
Download

3D MOL for HMDB0039554 (Ginsenoside Rh1)

HMDB0039554
     RDKit          3D
Ginsenoside Rh1
107111  0  0  0  0  0  0  0  0999 V2000
    8.9969    1.6876    0.1303 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0480    0.7147    0.7380 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7624    0.7874    2.1954 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4737   -0.2035   -0.0204 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5166   -1.2284    0.4402 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1985   -1.1137   -0.2916 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5853    0.2355   -0.0731 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2720    0.5124    1.3465 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5810    1.1982   -0.4442 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4548    0.5048   -1.0515 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9273    1.9007   -0.7242 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4227    1.7254   -0.4664 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1148    0.5382   -1.3537 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2745    1.1185   -2.7453 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2817   -0.3428   -0.9684 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1955   -1.5652   -1.8046 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1247   -1.4030   -3.1621 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0213   -2.3260   -1.2282 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2656   -1.5821   -1.1272 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0361   -2.2712   -0.0249 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1250   -2.6293    1.1384 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3656   -3.6699   -0.5902 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3426   -4.3277    0.3589 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6564   -3.6531    0.0092 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7101   -4.2220    0.7182 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5975   -2.1509    0.0903 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1869   -1.6637   -1.2059 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6099   -1.7671    1.1689 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2716   -1.5960    0.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1731   -0.1198    0.5438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1512    0.6099   -0.1112 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8189    1.5356    0.6683 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1931    1.3837    0.7001 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6570    2.0998    1.8152 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1755    2.1251    1.7261 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6515    0.8223    1.7409 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1170    3.5176    1.7851 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0396    3.6451    2.6661 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6768    3.8088    0.3852 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2772    5.1401    0.2744 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5334    2.8969    0.0172 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5818    2.7038   -1.3647 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8185    0.4353    0.1486 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2289   -0.1026   -1.1065 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0899    0.4760   -2.2507 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9781    1.2170    0.0603 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5973    1.9946   -0.8772 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0469    2.6182    0.7285 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5973    1.3659    2.6814 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7850   -0.2363    2.6284 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8345    1.3281    2.4169 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7098   -0.2331   -1.0978 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8900   -2.2656    0.2437 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3642   -1.1647    1.5109 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5679   -1.9288    0.1494 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3145   -1.3396   -1.3662 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5909    1.5408    1.6066 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1698    0.5077    1.5238 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7952   -0.1484    2.0568 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5956    1.2664   -1.4460 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9747    0.5113   -2.0482 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1188    2.6245   -1.5369 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4045    2.3291    0.1787 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3012    1.5806    0.5928 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9295    2.6454   -0.8575 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9557    0.5119   -3.5711 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3530    1.3283   -2.9026 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8179    2.1535   -2.7489 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1166   -0.6381    0.0898 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0898   -2.1903   -1.6175 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5649   -2.1348   -3.5709 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4159   -2.6451   -0.2150 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8992   -3.2280   -1.8690 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8288   -1.8611   -2.0803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8268   -2.6964    2.0346 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5793   -1.8674    1.4395 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2857   -3.6559    1.0923 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8369   -3.5017   -1.5675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4408   -4.2531   -0.7226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4224   -5.3865    0.1241 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1430   -4.1293    1.4102 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8351   -3.9938   -1.0579 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5670   -4.2063    0.2125 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9990   -2.3826   -1.5550 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7033   -0.6996   -1.1592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4240   -1.7635   -2.0033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1785   -1.0325    1.8791 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9530   -2.6610    1.7473 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5229   -1.3349    0.7288 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2761   -1.9004    1.5954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2721    0.2930    1.6117 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4580    1.5358    1.7228 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3118    1.5549    2.7333 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5474    2.6145    2.6531 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4372    2.6676    0.8094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2700    0.3562    2.5232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9044    4.2408    2.1035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5771    4.5033    2.4774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5109    3.5832   -0.3145 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0997    5.3750   -0.6688 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5725    3.2891    0.3671 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4152    2.1662   -1.5411 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9688    1.5369    0.0084 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1565    0.3387    1.0331 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0530    1.5616   -2.2957 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8885   -0.0549   -3.2087 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1441    0.2083   -2.0447 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 34 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 30 43  1  0
 43 44  1  0
 44 45  1  0
 15 10  1  0
 44 19  1  0
 44 13  1  0
 29 20  1  0
 41 32  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  3 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  5 53  1  0
  5 54  1  0
  6 55  1  0
  6 56  1  0
  8 57  1  0
  8 58  1  0
  8 59  1  0
  9 60  1  0
 10 61  1  0
 11 62  1  0
 11 63  1  0
 12 64  1  0
 12 65  1  0
 14 66  1  0
 14 67  1  0
 14 68  1  0
 15 69  1  0
 16 70  1  0
 17 71  1  0
 18 72  1  0
 18 73  1  0
 19 74  1  0
 21 75  1  0
 21 76  1  0
 21 77  1  0
 22 78  1  0
 22 79  1  0
 23 80  1  0
 23 81  1  0
 24 82  1  0
 25 83  1  0
 27 84  1  0
 27 85  1  0
 27 86  1  0
 28 87  1  0
 28 88  1  0
 28 89  1  0
 29 90  1  0
 30 91  1  0
 32 92  1  0
 34 93  1  0
 35 94  1  0
 35 95  1  0
 36 96  1  0
 37 97  1  0
 38 98  1  0
 39 99  1  0
 40100  1  0
 41101  1  0
 42102  1  0
 43103  1  0
 43104  1  0
 45105  1  0
 45106  1  0
 45107  1  0
M  END
Download

3D SDF for HMDB0039554 (Ginsenoside Rh1)


  Mrv0541 05061311142D          

 45 49  0  0  0  0            999 V2000
    2.1086    4.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8955    3.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4785    2.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2653    1.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4679    2.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -0.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0096   -0.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4950    0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0096    1.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258    0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108    1.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108    2.0329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042    0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042   -0.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5187    0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -1.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042   -1.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9178   -1.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9178   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9178    0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7281    4.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5256    4.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7387    5.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6328   -0.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3464   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3464   -1.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0615   -1.6796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1622   -2.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6328   -1.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1020   -2.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0615    1.6217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2042   -2.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -2.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -2.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -1.6796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -3.7421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9396   -3.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6546   -4.1547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9396   -2.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6546   -2.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3120   -0.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2258   -4.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -5.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 23  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4  9  1  0  0  0  0
  4 32  1  0  0  0  0
  6  7  1  0  0  0  0
  6 10  1  0  0  0  0
  6 15  1  0  0  0  0
  6 43  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 14 20  1  0  0  0  0
 15 16  1  0  0  0  0
 15 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 18 33  1  0  0  0  0
 19 20  1  0  0  0  0
 19 30  1  0  0  0  0
 20 21  1  0  0  0  0
 20 25  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 30  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 34 37  1  0  0  0  0
 35 36  1  0  0  0  0
 35 41  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 38 44  1  0  0  0  0
 39 40  1  0  0  0  0
 39 41  1  0  0  0  0
 41 42  1  0  0  0  0
 44 45  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039554

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(CC21C)OC1OC(CO)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C36H62O9/c1-19(2)10-9-13-36(8,43)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(39)32(3,4)30(33)22(17-35(24,34)7)44-31-29(42)28(41)27(40)23(18-37)45-31/h10,20-31,37-43H,9,11-18H2,1-8H3

> <INCHI_KEY>
RAQNTCRNSXYLAH-UHFFFAOYSA-N

> <FORMULA>
C36H62O9

> <MOLECULAR_WEIGHT>
638.8721

> <EXACT_MASS>
638.439383582

> <JCHEM_ACCEPTOR_COUNT>
9

> <JCHEM_AVERAGE_POLARIZABILITY>
73.41780319622906

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
7

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-{[5,16-dihydroxy-14-(2-hydroxy-6-methylhept-5-en-2-yl)-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-8-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

> <ALOGPS_LOGP>
2.68

> <JCHEM_LOGP>
2.4523373623333296

> <ALOGPS_LOGS>
-3.93

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
13.170860990607942

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.207106820940874

> <JCHEM_PKA_STRONGEST_BASIC>
-2.838900957340167

> <JCHEM_POLAR_SURFACE_AREA>
160.07

> <JCHEM_REFRACTIVITY>
171.24170000000007

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
7.43e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-{[5,16-dihydroxy-14-(2-hydroxy-6-methylhept-5-en-2-yl)-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-8-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol

> <JCHEM_VEBER_RULE>
0

$$$$
Download

3D-SDF for HMDB0039554 (Ginsenoside Rh1)

HMDB0039554
     RDKit          3D
Ginsenoside Rh1
107111  0  0  0  0  0  0  0  0999 V2000
    8.9969    1.6876    0.1303 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0480    0.7147    0.7380 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7624    0.7874    2.1954 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4737   -0.2035   -0.0204 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5166   -1.2284    0.4402 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1985   -1.1137   -0.2916 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5853    0.2355   -0.0731 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2720    0.5124    1.3465 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5810    1.1982   -0.4442 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4548    0.5048   -1.0515 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9273    1.9007   -0.7242 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4227    1.7254   -0.4664 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1148    0.5382   -1.3537 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2745    1.1185   -2.7453 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2817   -0.3428   -0.9684 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1955   -1.5652   -1.8046 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1247   -1.4030   -3.1621 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0213   -2.3260   -1.2282 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2656   -1.5821   -1.1272 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0361   -2.2712   -0.0249 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1250   -2.6293    1.1384 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3656   -3.6699   -0.5902 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3426   -4.3277    0.3589 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6564   -3.6531    0.0092 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7101   -4.2220    0.7182 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5975   -2.1509    0.0903 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1869   -1.6637   -1.2059 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6099   -1.7671    1.1689 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2716   -1.5960    0.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1731   -0.1198    0.5438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1512    0.6099   -0.1112 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8189    1.5356    0.6683 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1931    1.3837    0.7001 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6570    2.0998    1.8152 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1755    2.1251    1.7261 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6515    0.8223    1.7409 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1170    3.5176    1.7851 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0396    3.6451    2.6661 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6768    3.8088    0.3852 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2772    5.1401    0.2744 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5334    2.8969    0.0172 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5818    2.7038   -1.3647 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8185    0.4353    0.1486 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2289   -0.1026   -1.1065 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0899    0.4760   -2.2507 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9781    1.2170    0.0603 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5973    1.9946   -0.8772 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0469    2.6182    0.7285 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5973    1.3659    2.6814 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7850   -0.2363    2.6284 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8345    1.3281    2.4169 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7098   -0.2331   -1.0978 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8900   -2.2656    0.2437 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3642   -1.1647    1.5109 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5679   -1.9288    0.1494 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3145   -1.3396   -1.3662 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5909    1.5408    1.6066 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1698    0.5077    1.5238 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7952   -0.1484    2.0568 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5956    1.2664   -1.4460 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9747    0.5113   -2.0482 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1188    2.6245   -1.5369 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4045    2.3291    0.1787 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3012    1.5806    0.5928 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9295    2.6454   -0.8575 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9557    0.5119   -3.5711 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3530    1.3283   -2.9026 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8179    2.1535   -2.7489 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1166   -0.6381    0.0898 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0898   -2.1903   -1.6175 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5649   -2.1348   -3.5709 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4159   -2.6451   -0.2150 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8992   -3.2280   -1.8690 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8288   -1.8611   -2.0803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8268   -2.6964    2.0346 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5793   -1.8674    1.4395 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2857   -3.6559    1.0923 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8369   -3.5017   -1.5675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4408   -4.2531   -0.7226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4224   -5.3865    0.1241 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1430   -4.1293    1.4102 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8351   -3.9938   -1.0579 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5670   -4.2063    0.2125 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9990   -2.3826   -1.5550 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7033   -0.6996   -1.1592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4240   -1.7635   -2.0033 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1785   -1.0325    1.8791 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9530   -2.6610    1.7473 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5229   -1.3349    0.7288 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2761   -1.9004    1.5954 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2721    0.2930    1.6117 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4580    1.5358    1.7228 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3118    1.5549    2.7333 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5474    2.6145    2.6531 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4372    2.6676    0.8094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2700    0.3562    2.5232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9044    4.2408    2.1035 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5771    4.5033    2.4774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5109    3.5832   -0.3145 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0997    5.3750   -0.6688 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5725    3.2891    0.3671 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4152    2.1662   -1.5411 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9688    1.5369    0.0084 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1565    0.3387    1.0331 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0530    1.5616   -2.2957 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8885   -0.0549   -3.2087 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1441    0.2083   -2.0447 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 34 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 30 43  1  0
 43 44  1  0
 44 45  1  0
 15 10  1  0
 44 19  1  0
 44 13  1  0
 29 20  1  0
 41 32  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  3 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  5 53  1  0
  5 54  1  0
  6 55  1  0
  6 56  1  0
  8 57  1  0
  8 58  1  0
  8 59  1  0
  9 60  1  0
 10 61  1  0
 11 62  1  0
 11 63  1  0
 12 64  1  0
 12 65  1  0
 14 66  1  0
 14 67  1  0
 14 68  1  0
 15 69  1  0
 16 70  1  0
 17 71  1  0
 18 72  1  0
 18 73  1  0
 19 74  1  0
 21 75  1  0
 21 76  1  0
 21 77  1  0
 22 78  1  0
 22 79  1  0
 23 80  1  0
 23 81  1  0
 24 82  1  0
 25 83  1  0
 27 84  1  0
 27 85  1  0
 27 86  1  0
 28 87  1  0
 28 88  1  0
 28 89  1  0
 29 90  1  0
 30 91  1  0
 32 92  1  0
 34 93  1  0
 35 94  1  0
 35 95  1  0
 36 96  1  0
 37 97  1  0
 38 98  1  0
 39 99  1  0
 40100  1  0
 41101  1  0
 42102  1  0
 43103  1  0
 43104  1  0
 45105  1  0
 45106  1  0
 45107  1  0
M  END
Download

PDB for HMDB0039554 (Ginsenoside Rh1)

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       3.936   7.488   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       3.538   6.002   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       4.627   4.914   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       4.229   3.425   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       2.740   3.823   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       2.288  -0.055   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       3.751  -0.530   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       4.657   0.715   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       3.751   1.960   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       2.288   1.485   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.953   2.255   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0       0.953   3.795   0.000  0.00  0.00           O+0
HETATM   13  C   UNK     0      -0.381   1.485   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -0.381  -0.055   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       0.953  -0.825   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       0.968   0.715   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       0.953  -2.365   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -0.381  -3.135   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -1.713  -2.365   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -1.713  -0.825   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -1.713   0.715   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       1.359   8.179   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       2.848   8.579   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       3.246  10.065   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      -3.048  -0.055   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -4.380  -0.825   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      -4.380  -2.365   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      -5.715  -3.135   0.000  0.00  0.00           O+0
HETATM   29  C   UNK     0      -4.036  -4.316   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      -3.048  -3.135   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      -2.057  -4.316   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0       5.715   3.027   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -0.381  -4.675   0.000  0.00  0.00           O+0
HETATM   34  C   UNK     0       0.953  -5.445   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0       2.288  -4.675   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0       2.288  -3.135   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       0.953  -6.985   0.000  0.00  0.00           O+0
HETATM   38  C   UNK     0       2.288  -7.755   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0       3.621  -6.985   0.000  0.00  0.00           C+0
HETATM   40  O   UNK     0       4.955  -7.755   0.000  0.00  0.00           O+0
HETATM   41  C   UNK     0       3.621  -5.445   0.000  0.00  0.00           C+0
HETATM   42  O   UNK     0       4.955  -4.675   0.000  0.00  0.00           O+0
HETATM   43  C   UNK     0       2.449  -1.587   0.000  0.00  0.00           C+0
HETATM   44  C   UNK     0       2.288  -9.295   0.000  0.00  0.00           C+0
HETATM   45  O   UNK     0       0.953 -10.065   0.000  0.00  0.00           O+0
CONECT    1    2   23                                                       
CONECT    2    1    3                                                       
CONECT    3    2    4                                                       
CONECT    4    3    5    9   32                                             
CONECT    5    4                                                            
CONECT    6    7   10   15   43                                             
CONECT    7    6    8                                                       
CONECT    8    7    9                                                       
CONECT    9    4    8   10                                                  
CONECT   10    6    9   11                                                  
CONECT   11   10   12   13                                                  
CONECT   12   11                                                            
CONECT   13   11   14                                                       
CONECT   14   13   15   20                                                  
CONECT   15    6   14   16   17                                             
CONECT   16   15                                                            
CONECT   17   15   18                                                       
CONECT   18   17   19   33                                                  
CONECT   19   18   20   30                                                  
CONECT   20   14   19   21   25                                             
CONECT   21   20                                                            
CONECT   22   23                                                            
CONECT   23    1   22   24                                                  
CONECT   24   23                                                            
CONECT   25   20   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   28   30                                                  
CONECT   28   27                                                            
CONECT   29   30                                                            
CONECT   30   19   27   29   31                                             
CONECT   31   30                                                            
CONECT   32    4                                                            
CONECT   33   18   34                                                       
CONECT   34   33   35   37                                                  
CONECT   35   34   36   41                                                  
CONECT   36   35                                                            
CONECT   37   34   38                                                       
CONECT   38   37   39   44                                                  
CONECT   39   38   40   41                                                  
CONECT   40   39                                                            
CONECT   41   35   39   42                                                  
CONECT   42   41                                                            
CONECT   43    6                                                            
CONECT   44   38   45                                                       
CONECT   45   44                                                            
MASTER        0    0    0    0    0    0    0    0   45    0   98    0
END
Download

3D PDB for HMDB0039554 (Ginsenoside Rh1)

COMPND    HMDB0039554
HETATM    1  C1  UNL     1       8.997   1.688   0.130  1.00  0.00           C  
HETATM    2  C2  UNL     1       8.048   0.715   0.738  1.00  0.00           C  
HETATM    3  C3  UNL     1       7.762   0.787   2.195  1.00  0.00           C  
HETATM    4  C4  UNL     1       7.474  -0.204  -0.020  1.00  0.00           C  
HETATM    5  C5  UNL     1       6.517  -1.228   0.440  1.00  0.00           C  
HETATM    6  C6  UNL     1       5.198  -1.114  -0.292  1.00  0.00           C  
HETATM    7  C7  UNL     1       4.585   0.236  -0.073  1.00  0.00           C  
HETATM    8  C8  UNL     1       4.272   0.512   1.347  1.00  0.00           C  
HETATM    9  O1  UNL     1       5.581   1.198  -0.444  1.00  0.00           O  
HETATM   10  C9  UNL     1       3.455   0.505  -1.052  1.00  0.00           C  
HETATM   11  C10 UNL     1       2.927   1.901  -0.724  1.00  0.00           C  
HETATM   12  C11 UNL     1       1.423   1.725  -0.466  1.00  0.00           C  
HETATM   13  C12 UNL     1       1.115   0.538  -1.354  1.00  0.00           C  
HETATM   14  C13 UNL     1       1.275   1.119  -2.745  1.00  0.00           C  
HETATM   15  C14 UNL     1       2.282  -0.343  -0.968  1.00  0.00           C  
HETATM   16  C15 UNL     1       2.195  -1.565  -1.805  1.00  0.00           C  
HETATM   17  O2  UNL     1       2.125  -1.403  -3.162  1.00  0.00           O  
HETATM   18  C16 UNL     1       1.021  -2.326  -1.228  1.00  0.00           C  
HETATM   19  C17 UNL     1      -0.266  -1.582  -1.127  1.00  0.00           C  
HETATM   20  C18 UNL     1      -1.036  -2.271  -0.025  1.00  0.00           C  
HETATM   21  C19 UNL     1      -0.125  -2.629   1.138  1.00  0.00           C  
HETATM   22  C20 UNL     1      -1.366  -3.670  -0.590  1.00  0.00           C  
HETATM   23  C21 UNL     1      -2.343  -4.328   0.359  1.00  0.00           C  
HETATM   24  C22 UNL     1      -3.656  -3.653   0.009  1.00  0.00           C  
HETATM   25  O3  UNL     1      -4.710  -4.222   0.718  1.00  0.00           O  
HETATM   26  C23 UNL     1      -3.598  -2.151   0.090  1.00  0.00           C  
HETATM   27  C24 UNL     1      -4.187  -1.664  -1.206  1.00  0.00           C  
HETATM   28  C25 UNL     1      -4.610  -1.767   1.169  1.00  0.00           C  
HETATM   29  C26 UNL     1      -2.272  -1.596   0.479  1.00  0.00           C  
HETATM   30  C27 UNL     1      -2.173  -0.120   0.544  1.00  0.00           C  
HETATM   31  O4  UNL     1      -3.151   0.610  -0.111  1.00  0.00           O  
HETATM   32  C28 UNL     1      -3.819   1.536   0.668  1.00  0.00           C  
HETATM   33  O5  UNL     1      -5.193   1.384   0.700  1.00  0.00           O  
HETATM   34  C29 UNL     1      -5.657   2.100   1.815  1.00  0.00           C  
HETATM   35  C30 UNL     1      -7.176   2.125   1.726  1.00  0.00           C  
HETATM   36  O6  UNL     1      -7.652   0.822   1.741  1.00  0.00           O  
HETATM   37  C31 UNL     1      -5.117   3.518   1.785  1.00  0.00           C  
HETATM   38  O7  UNL     1      -4.040   3.645   2.666  1.00  0.00           O  
HETATM   39  C32 UNL     1      -4.677   3.809   0.385  1.00  0.00           C  
HETATM   40  O8  UNL     1      -4.277   5.140   0.274  1.00  0.00           O  
HETATM   41  C33 UNL     1      -3.533   2.897   0.017  1.00  0.00           C  
HETATM   42  O9  UNL     1      -3.582   2.704  -1.365  1.00  0.00           O  
HETATM   43  C34 UNL     1      -0.818   0.435   0.149  1.00  0.00           C  
HETATM   44  C35 UNL     1      -0.229  -0.103  -1.106  1.00  0.00           C  
HETATM   45  C36 UNL     1      -1.090   0.476  -2.251  1.00  0.00           C  
HETATM   46  H1  UNL     1       9.978   1.217   0.060  1.00  0.00           H  
HETATM   47  H2  UNL     1       8.597   1.995  -0.877  1.00  0.00           H  
HETATM   48  H3  UNL     1       9.047   2.618   0.729  1.00  0.00           H  
HETATM   49  H4  UNL     1       8.597   1.366   2.681  1.00  0.00           H  
HETATM   50  H5  UNL     1       7.785  -0.236   2.628  1.00  0.00           H  
HETATM   51  H6  UNL     1       6.835   1.328   2.417  1.00  0.00           H  
HETATM   52  H7  UNL     1       7.710  -0.233  -1.098  1.00  0.00           H  
HETATM   53  H8  UNL     1       6.890  -2.266   0.244  1.00  0.00           H  
HETATM   54  H9  UNL     1       6.364  -1.165   1.511  1.00  0.00           H  
HETATM   55  H10 UNL     1       4.568  -1.929   0.149  1.00  0.00           H  
HETATM   56  H11 UNL     1       5.315  -1.340  -1.366  1.00  0.00           H  
HETATM   57  H12 UNL     1       4.591   1.541   1.607  1.00  0.00           H  
HETATM   58  H13 UNL     1       3.170   0.508   1.524  1.00  0.00           H  
HETATM   59  H14 UNL     1       4.795  -0.148   2.057  1.00  0.00           H  
HETATM   60  H15 UNL     1       5.596   1.266  -1.446  1.00  0.00           H  
HETATM   61  H16 UNL     1       3.975   0.511  -2.048  1.00  0.00           H  
HETATM   62  H17 UNL     1       3.119   2.624  -1.537  1.00  0.00           H  
HETATM   63  H18 UNL     1       3.405   2.329   0.179  1.00  0.00           H  
HETATM   64  H19 UNL     1       1.301   1.581   0.593  1.00  0.00           H  
HETATM   65  H20 UNL     1       0.930   2.645  -0.858  1.00  0.00           H  
HETATM   66  H21 UNL     1       0.956   0.512  -3.571  1.00  0.00           H  
HETATM   67  H22 UNL     1       2.353   1.328  -2.903  1.00  0.00           H  
HETATM   68  H23 UNL     1       0.818   2.153  -2.749  1.00  0.00           H  
HETATM   69  H24 UNL     1       2.117  -0.638   0.090  1.00  0.00           H  
HETATM   70  H25 UNL     1       3.090  -2.190  -1.617  1.00  0.00           H  
HETATM   71  H26 UNL     1       1.565  -2.135  -3.571  1.00  0.00           H  
HETATM   72  H27 UNL     1       1.416  -2.645  -0.215  1.00  0.00           H  
HETATM   73  H28 UNL     1       0.899  -3.228  -1.869  1.00  0.00           H  
HETATM   74  H29 UNL     1      -0.829  -1.861  -2.080  1.00  0.00           H  
HETATM   75  H30 UNL     1      -0.827  -2.696   2.035  1.00  0.00           H  
HETATM   76  H31 UNL     1       0.579  -1.867   1.440  1.00  0.00           H  
HETATM   77  H32 UNL     1       0.286  -3.656   1.092  1.00  0.00           H  
HETATM   78  H33 UNL     1      -1.837  -3.502  -1.568  1.00  0.00           H  
HETATM   79  H34 UNL     1      -0.441  -4.253  -0.723  1.00  0.00           H  
HETATM   80  H35 UNL     1      -2.422  -5.387   0.124  1.00  0.00           H  
HETATM   81  H36 UNL     1      -2.143  -4.129   1.410  1.00  0.00           H  
HETATM   82  H37 UNL     1      -3.835  -3.994  -1.058  1.00  0.00           H  
HETATM   83  H38 UNL     1      -5.567  -4.206   0.212  1.00  0.00           H  
HETATM   84  H39 UNL     1      -4.999  -2.383  -1.555  1.00  0.00           H  
HETATM   85  H40 UNL     1      -4.703  -0.700  -1.159  1.00  0.00           H  
HETATM   86  H41 UNL     1      -3.424  -1.763  -2.003  1.00  0.00           H  
HETATM   87  H42 UNL     1      -4.179  -1.033   1.879  1.00  0.00           H  
HETATM   88  H43 UNL     1      -4.953  -2.661   1.747  1.00  0.00           H  
HETATM   89  H44 UNL     1      -5.523  -1.335   0.729  1.00  0.00           H  
HETATM   90  H45 UNL     1      -2.276  -1.900   1.595  1.00  0.00           H  
HETATM   91  H46 UNL     1      -2.272   0.293   1.612  1.00  0.00           H  
HETATM   92  H47 UNL     1      -3.458   1.536   1.723  1.00  0.00           H  
HETATM   93  H48 UNL     1      -5.312   1.555   2.733  1.00  0.00           H  
HETATM   94  H49 UNL     1      -7.547   2.614   2.653  1.00  0.00           H  
HETATM   95  H50 UNL     1      -7.437   2.668   0.809  1.00  0.00           H  
HETATM   96  H51 UNL     1      -7.270   0.356   2.523  1.00  0.00           H  
HETATM   97  H52 UNL     1      -5.904   4.241   2.104  1.00  0.00           H  
HETATM   98  H53 UNL     1      -3.577   4.503   2.477  1.00  0.00           H  
HETATM   99  H54 UNL     1      -5.511   3.583  -0.314  1.00  0.00           H  
HETATM  100  H55 UNL     1      -4.100   5.375  -0.669  1.00  0.00           H  
HETATM  101  H56 UNL     1      -2.572   3.289   0.367  1.00  0.00           H  
HETATM  102  H57 UNL     1      -4.415   2.166  -1.541  1.00  0.00           H  
HETATM  103  H58 UNL     1      -0.969   1.537   0.008  1.00  0.00           H  
HETATM  104  H59 UNL     1      -0.156   0.339   1.033  1.00  0.00           H  
HETATM  105  H60 UNL     1      -1.053   1.562  -2.296  1.00  0.00           H  
HETATM  106  H61 UNL     1      -0.889  -0.055  -3.209  1.00  0.00           H  
HETATM  107  H62 UNL     1      -2.144   0.208  -2.045  1.00  0.00           H  
CONECT    1    2   46   47   48
CONECT    2    3    4    4
CONECT    3   49   50   51
CONECT    4    5   52
CONECT    5    6   53   54
CONECT    6    7   55   56
CONECT    7    8    9   10
CONECT    8   57   58   59
CONECT    9   60
CONECT   10   11   15   61
CONECT   11   12   62   63
CONECT   12   13   64   65
CONECT   13   14   15   44
CONECT   14   66   67   68
CONECT   15   16   69
CONECT   16   17   18   70
CONECT   17   71
CONECT   18   19   72   73
CONECT   19   20   44   74
CONECT   20   21   22   29
CONECT   21   75   76   77
CONECT   22   23   78   79
CONECT   23   24   80   81
CONECT   24   25   26   82
CONECT   25   83
CONECT   26   27   28   29
CONECT   27   84   85   86
CONECT   28   87   88   89
CONECT   29   30   90
CONECT   30   31   43   91
CONECT   31   32
CONECT   32   33   41   92
CONECT   33   34
CONECT   34   35   37   93
CONECT   35   36   94   95
CONECT   36   96
CONECT   37   38   39   97
CONECT   38   98
CONECT   39   40   41   99
CONECT   40  100
CONECT   41   42  101
CONECT   42  102
CONECT   43   44  103  104
CONECT   44   45
CONECT   45  105  106  107
END
Download

SMILES for HMDB0039554 (Ginsenoside Rh1)

CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(CC21C)OC1OC(CO)C(O)C(O)C1O
Download

INCHI for HMDB0039554 (Ginsenoside Rh1)

InChI=1S/C36H62O9/c1-19(2)10-9-13-36(8,43)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(39)32(3,4)30(33)22(17-35(24,34)7)44-31-29(42)28(41)27(40)23(18-37)45-31/h10,20-31,37-43H,9,11-18H2,1-8H3
Download
View in JSmolView Stereo Labels
Synonyms
ValueSource
Ginsenoside g-RH(1)MeSH
Ginsenoside RH(1)MeSH
Sanchinoside b2HMDB
Ginsenoside RH1MeSH
Chemical FormulaC36H62O9
Average Molecular Weight638.8721
Monoisotopic Molecular Weight638.439383582
IUPAC Name2-{[5,16-dihydroxy-14-(2-hydroxy-6-methylhept-5-en-2-yl)-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-8-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
Traditional Name2-{[5,16-dihydroxy-14-(2-hydroxy-6-methylhept-5-en-2-yl)-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-8-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
CAS Registry Number63223-86-9
SMILES
CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(CC21C)OC1OC(CO)C(O)C(O)C1O
InChI Identifier
InChI=1S/C36H62O9/c1-19(2)10-9-13-36(8,43)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(39)32(3,4)30(33)22(17-35(24,34)7)44-31-29(42)28(41)27(40)23(18-37)45-31/h10,20-31,37-43H,9,11-18H2,1-8H3
InChI KeyRAQNTCRNSXYLAH-UHFFFAOYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units.
KingdomOrganic compounds
Super ClassLipids and lipid-like molecules
ClassPrenol lipids
Sub ClassTriterpenoids
Direct ParentTriterpenoids
Alternative Parents
Substituents
  • Triterpenoid
  • 20-hydroxysteroid
  • 3-hydroxysteroid
  • 12-hydroxysteroid
  • Hydroxysteroid
  • Steroid
  • Hexose monosaccharide
  • Glycosyl compound
  • O-glycosyl compound
  • Monosaccharide
  • Oxane
  • Cyclic alcohol
  • Tertiary alcohol
  • Secondary alcohol
  • Acetal
  • Organoheterocyclic compound
  • Oxacycle
  • Polyol
  • Primary alcohol
  • Hydrocarbon derivative
  • Organic oxygen compound
  • Alcohol
  • Organooxygen compound
  • Aliphatic heteropolycyclic compound
Molecular FrameworkAliphatic heteropolycyclic compounds
External DescriptorsNot Available
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
Process
Naturally occurring process
Role
Biological roleIndustrial application
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility0.074 g/LALOGPS
logP2.68ALOGPS
logP2.45ChemAxon
logS-3.9ALOGPS
pKa (Strongest Acidic)12.21ChemAxon
pKa (Strongest Basic)-2.8ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count9ChemAxon
Hydrogen Donor Count7ChemAxon
Polar Surface Area160.07 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity171.24 m³·mol⁻¹ChemAxon
Polarizability73.42 ųChemAxon
Number of Rings5ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+245.02131661259
DarkChem[M-H]-234.11831661259
DeepCCS[M-2H]-278.50230932474
DeepCCS[M+Na]+253.61530932474
AllCCS[M+H]+246.332859911
AllCCS[M+H-H2O]+245.632859911
AllCCS[M+NH4]+247.032859911
AllCCS[M+Na]+247.232859911
AllCCS[M-H]-228.432859911
AllCCS[M+Na-2H]-233.132859911
AllCCS[M+HCOO]-238.332859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Ginsenoside Rh1CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(CC21C)OC1OC(CO)C(O)C(O)C1O3242.2Standard polar33892256
Ginsenoside Rh1CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(CC21C)OC1OC(CO)C(O)C(O)C1O4239.8Standard non polar33892256
Ginsenoside Rh1CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(CC21C)OC1OC(CO)C(O)C(O)C1O4942.3Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Ginsenoside Rh1,1TMS,isomer #1CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C4987.0Semi standard non polar33892256
Ginsenoside Rh1,1TMS,isomer #2CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C4958.0Semi standard non polar33892256
Ginsenoside Rh1,1TMS,isomer #3CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5046.8Semi standard non polar33892256
Ginsenoside Rh1,1TMS,isomer #4CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C5045.7Semi standard non polar33892256
Ginsenoside Rh1,1TMS,isomer #5CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C5044.0Semi standard non polar33892256
Ginsenoside Rh1,1TMS,isomer #6CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C5037.1Semi standard non polar33892256
Ginsenoside Rh1,1TMS,isomer #7CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C5028.3Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #1CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C4844.1Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #10CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C4806.5Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #11CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C4806.5Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #12CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C4956.0Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #13CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C4954.0Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #14CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C4928.0Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #15CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C4920.1Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #16CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)CC12C4963.5Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #17CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)CC12C4949.2Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #18CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)CC12C4950.1Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #19CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CC12C4950.1Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #2CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C4887.9Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #20CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CC12C4937.7Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #21CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CC12C4949.8Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #3CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C4885.2Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #4CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C4883.9Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #5CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C4861.6Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #6CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C4852.9Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #7CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C4832.8Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #8CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C4846.8Semi standard non polar33892256
Ginsenoside Rh1,2TMS,isomer #9CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C4841.3Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #1CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C4701.7Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #10CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)CC12C4771.4Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #11CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)CC12C4748.8Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #12CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)CC12C4751.1Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #13CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CC12C4748.3Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #14CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CC12C4736.6Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #15CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CC12C4748.9Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #16CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C4696.5Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #17CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C4676.2Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #18CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C4639.6Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #19CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C4647.1Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #2CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C4714.4Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #20CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)CC12C4716.7Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #21CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)CC12C4687.8Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #22CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)CC12C4699.3Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #23CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CC12C4688.8Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #24CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CC12C4678.9Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #25CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CC12C4686.4Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #26CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)CC12C4834.8Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #27CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)CC12C4810.7Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #28CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)CC12C4810.0Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #29CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CC12C4804.7Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #3CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C4697.5Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #30CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CC12C4795.2Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #31CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CC12C4803.6Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #32CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)CC12C4859.2Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #33CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)CC12C4836.5Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #34CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CC12C4850.4Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #35CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)CC12C4854.9Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #4CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C4672.0Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #5CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C4670.6Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #6CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C)C(O)C(O)C3O)CC12C4756.6Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #7CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)CC12C4744.9Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #8CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)CC12C4720.7Semi standard non polar33892256
Ginsenoside Rh1,3TMS,isomer #9CC(C)=CCCC(C)(O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)CC12C4713.8Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #1CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5202.3Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #2CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5182.0Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #3CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5261.9Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #4CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)CC12C5238.9Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #5CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CC12C5282.8Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #6CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CC12C5265.9Semi standard non polar33892256
Ginsenoside Rh1,1TBDMS,isomer #7CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CC12C5263.2Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #1CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5268.7Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #10CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CC12C5259.1Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #11CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CC12C5264.4Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #12CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)CC12C5362.8Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #13CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CC12C5400.6Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #14CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CC12C5377.5Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #15CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CC12C5376.1Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #16CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CC12C5391.9Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #17CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CC12C5378.4Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #18CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CC12C5385.4Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #19CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)CC12C5414.8Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #2CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5323.5Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #20CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)CC12C5404.5Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #21CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)CC12C5412.5Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #3CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)CC12C5305.4Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #4CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CC12C5329.9Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #5CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)CC12C5304.7Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #6CC(C)=CCCC(C)(O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)CC12C5308.9Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #7CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C5269.6Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #8CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)CC12C5254.2Semi standard non polar33892256
Ginsenoside Rh1,2TBDMS,isomer #9CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)CC12C5293.5Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (Non-derivatized) - 70eV, Positivesplash10-05fr-4400339000-9f7882207f453de6c5e92017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_1) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_2) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_3) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_4) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_5) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_6) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_1_7) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_1) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_2) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_3) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_4) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_5) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_6) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_7) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_8) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_9) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_10) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_11) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_12) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_13) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_14) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_15) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_16) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh1 GC-MS (TMS_2_17) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Positive-QTOFsplash10-0pi0-0000709000-c47fc9449dc5d24bb18f2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Positive-QTOFsplash10-0a4i-0001901000-29b5141f8974ae0c05e82015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Positive-QTOFsplash10-0a6r-3102900000-641c8872caa71243d94d2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Positive-QTOFsplash10-0pi0-0000709000-c47fc9449dc5d24bb18f2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Positive-QTOFsplash10-0a4i-0001901000-29b5141f8974ae0c05e82015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Positive-QTOFsplash10-0a6r-3102900000-641c8872caa71243d94d2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Positive-QTOFsplash10-0pi0-0000709000-c47fc9449dc5d24bb18f2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Positive-QTOFsplash10-0a4i-0001901000-29b5141f8974ae0c05e82015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Positive-QTOFsplash10-0a6r-3102900000-641c8872caa71243d94d2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Negative-QTOFsplash10-052r-0100619000-f72a014cb35ad56ac6172015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Negative-QTOFsplash10-0a6r-1100902000-92a0a5324aba767e96572015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Negative-QTOFsplash10-0a6r-3001900000-dd99c1cc5d6ff96a3e9e2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Negative-QTOFsplash10-052r-0100619000-f72a014cb35ad56ac6172015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Negative-QTOFsplash10-0a6r-1100902000-92a0a5324aba767e96572015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Negative-QTOFsplash10-0a6r-3001900000-dd99c1cc5d6ff96a3e9e2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Negative-QTOFsplash10-052r-0100619000-f72a014cb35ad56ac6172015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Negative-QTOFsplash10-0a6r-1100902000-92a0a5324aba767e96572015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Negative-QTOFsplash10-0a6r-3001900000-dd99c1cc5d6ff96a3e9e2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Positive-QTOFsplash10-0uki-0100129000-b5490daa8c14916851a52021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Positive-QTOFsplash10-08g0-6901565000-3a261521134434abde8a2021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Positive-QTOFsplash10-014i-9100100000-b1c954b7e0aab81b881e2021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 10V, Negative-QTOFsplash10-000i-0000009000-8158b86d9eb78664e1f92021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 20V, Negative-QTOFsplash10-000i-3000169000-5b0ac89fd82fafff02272021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh1 40V, Negative-QTOFsplash10-052f-9000031000-81240722da45f7ca003c2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Extracellular
  • Membrane
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB019175
KNApSAcK IDC00030402
Chemspider ID21686433
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound12855917
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDrw1700481
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
  2. Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
  3. Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
  4. Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
  5. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
  6. Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.