Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 01:23:34 UTC

Update Date

2022-03-07 02:56:22 UTC

HMDB ID

HMDB0039855

Secondary Accession Numbers

HMDB39855

Metabolite Identification

Common Name

Vitexin 4'-O-alpha-L-Rhamnopyranoside

Description

Vitexin 4'-rhamnoside belongs to the class of organic compounds known as flavonoid o-glycosides. Flavonoid O-glycosides are compounds containing a carbohydrate moiety which is O-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone. Vitexin 4'-rhamnoside has been detected, but not quantified in, herbs and spices. This could make vitexin 4'-rhamnoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Vitexin 4'-rhamnoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061311262D          

 41 45  0  0  0  0            999 V2000
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5737   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5737   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  9  1  1  0  0  0  0
 10  2  2  0  0  0  0
 10  3  1  0  0  0  0
 11  4  2  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 13  6  1  0  0  0  0
 14  7  1  0  0  0  0
 15  7  2  0  0  0  0
 15 10  1  0  0  0  0
 16  8  1  0  0  0  0
 17 12  1  0  0  0  0
 17 14  1  0  0  0  0
 18 13  2  0  0  0  0
 19  9  1  0  0  0  0
 20 16  1  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23 22  1  0  0  0  0
 24 21  1  0  0  0  0
 25 17  2  0  0  0  0
 25 18  1  0  0  0  0
 26 18  1  0  0  0  0
 26 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28  8  1  0  0  0  0
 29 12  1  0  0  0  0
 30 13  1  0  0  0  0
 31 14  2  0  0  0  0
 32 19  1  0  0  0  0
 33 20  1  0  0  0  0
 34 21  1  0  0  0  0
 35 22  1  0  0  0  0
 36 23  1  0  0  0  0
 37 24  1  0  0  0  0
 38  9  1  0  0  0  0
 38 27  1  0  0  0  0
 39 11  1  0  0  0  0
 39 27  1  0  0  0  0
 40 15  1  0  0  0  0
 40 25  1  0  0  0  0
 41 16  1  0  0  0  0
 41 26  1  0  0  0  0
M  END

HMDB0259859
     RDKit          3D
Vitexin rhamnoside
 71 75  0  0  0  0  0  0  0  0999 V2000
    7.4731   -1.3449    2.0599 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6139   -0.7297    0.9628 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2579   -0.9752    1.1364 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6476   -1.3941   -0.0564 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2767   -1.5214    0.1462 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2760   -0.6510   -0.2091 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9860   -1.0675    0.1044 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1157   -0.2546   -0.2014 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0463    0.9629   -0.8166 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1151    1.8476   -1.0462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583    2.9846   -1.7808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0032    3.8776   -2.0225 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8125    4.9089   -2.7012 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2345    3.5728   -1.4859 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3183    4.3983   -1.6300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2421    5.5437   -2.3425 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5183    4.0171   -1.0161 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6386    2.8590   -0.2926 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8443    2.5151    0.3015 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5344    2.0133   -0.1471 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6882    0.7806    0.7128 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4297    0.6150    1.3075 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2754   -0.5971    1.9223 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9702   -0.6170    3.2841 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8488   -1.8966    3.8484 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5815   -1.7909    1.0831 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334   -2.7010    0.9558 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1216   -1.4587   -0.2702 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2077   -1.2263   -1.2643 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0810   -0.3341   -0.1698 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3677   -0.8491    0.2511 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3520    2.3893   -0.7396 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3026    1.5895   -0.5587 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3290    1.3303   -1.1093 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4454    0.5571   -0.8218 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2774   -2.6343   -0.5855 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5443   -3.0536   -1.6887 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6786   -2.3428   -0.9959 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5492   -3.4045   -0.7406 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1588   -1.0772   -0.3701 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5575   -1.2428   -0.1967 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8617   -1.6888    2.9112 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2081   -0.5954    2.4871 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320   -2.1463    1.6473 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7460    0.3754    1.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8408   -0.5537   -0.7657 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7818   -2.0015    0.5779 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1037   -0.5892    0.0666 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    3.2372   -2.2153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6293    6.0587   -2.8494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3646    4.6944   -1.1475 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0860    1.7402    0.8368 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4150    0.9600    1.5009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1783   -0.6516    2.1877 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9996   -0.2433    3.2419 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4091    0.0700    3.9960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9338   -2.1130    4.1336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4038   -2.4033    1.5823 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5494   -3.0655    0.0318 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7327   -2.3553   -0.6404 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6741   -0.8051   -2.0320 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3060    0.0136   -1.2226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4720   -0.5406    1.2074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5570    2.2786   -1.5881 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4443    0.8997   -1.0667 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2002   -3.4670    0.1577 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0666   -3.9190   -1.5399 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6817   -2.1927   -2.0965 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6325   -3.9740   -1.5416 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0812   -0.1996   -1.0637 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0010   -0.4214    0.0650 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 20 32  2  0
 32 33  1  0
  9 34  1  0
 34 35  2  0
  4 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40  2  1  0
 35  6  1  0
 33 10  1  0
 32 14  1  0
 30 21  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  2 45  1  0
  4 46  1  0
  7 47  1  0
  8 48  1  0
 11 49  1  0
 16 50  1  0
 17 51  1  0
 19 52  1  0
 21 53  1  0
 23 54  1  0
 24 55  1  0
 24 56  1  0
 25 57  1  0
 26 58  1  0
 27 59  1  0
 28 60  1  0
 29 61  1  0
 30 62  1  0
 31 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
M  END

  Mrv0541 05061311262D          

 41 45  0  0  0  0            999 V2000
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8592   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5737   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5737   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  9  1  1  0  0  0  0
 10  2  2  0  0  0  0
 10  3  1  0  0  0  0
 11  4  2  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 13  6  1  0  0  0  0
 14  7  1  0  0  0  0
 15  7  2  0  0  0  0
 15 10  1  0  0  0  0
 16  8  1  0  0  0  0
 17 12  1  0  0  0  0
 17 14  1  0  0  0  0
 18 13  2  0  0  0  0
 19  9  1  0  0  0  0
 20 16  1  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23 22  1  0  0  0  0
 24 21  1  0  0  0  0
 25 17  2  0  0  0  0
 25 18  1  0  0  0  0
 26 18  1  0  0  0  0
 26 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28  8  1  0  0  0  0
 29 12  1  0  0  0  0
 30 13  1  0  0  0  0
 31 14  2  0  0  0  0
 32 19  1  0  0  0  0
 33 20  1  0  0  0  0
 34 21  1  0  0  0  0
 35 22  1  0  0  0  0
 36 23  1  0  0  0  0
 37 24  1  0  0  0  0
 38  9  1  0  0  0  0
 38 27  1  0  0  0  0
 39 11  1  0  0  0  0
 39 27  1  0  0  0  0
 40 15  1  0  0  0  0
 40 25  1  0  0  0  0
 41 16  1  0  0  0  0
 41 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039855

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1OC(OC2=CC=C(C=C2)C2=CC(=O)C3=C(O2)C(C2OC(CO)C(O)C(O)C2O)=C(O)C=C3O)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O14/c1-9-19(32)21(34)24(37)27(38-9)39-11-4-2-10(3-5-11)15-7-14(31)17-12(29)6-13(30)18(25(17)40-15)26-23(36)22(35)20(33)16(8-28)41-26/h2-7,9,16,19-24,26-30,32-37H,8H2,1H3

> <INCHI_KEY>
ZIIBNXKQZAUBRD-UHFFFAOYSA-N

> <FORMULA>
C27H30O14

> <MOLECULAR_WEIGHT>
578.5187

> <EXACT_MASS>
578.163555668

> <JCHEM_ACCEPTOR_COUNT>
14

> <JCHEM_AVERAGE_POLARIZABILITY>
55.8557141120235

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-{4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.31

> <JCHEM_LOGP>
-1.2717898980000002

> <ALOGPS_LOGS>
-2.49

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
9.263868722815818

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.20013514101749

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6122003585840687

> <JCHEM_POLAR_SURFACE_AREA>
236.05999999999992

> <JCHEM_REFRACTIVITY>
136.63289999999995

> <JCHEM_ROTATABLE_BOND_COUNT>
5

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.89e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-{4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0259859
     RDKit          3D
Vitexin rhamnoside
 71 75  0  0  0  0  0  0  0  0999 V2000
    7.4731   -1.3449    2.0599 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6139   -0.7297    0.9628 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2579   -0.9752    1.1364 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6476   -1.3941   -0.0564 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2767   -1.5214    0.1462 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2760   -0.6510   -0.2091 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9860   -1.0675    0.1044 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1157   -0.2546   -0.2014 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0463    0.9629   -0.8166 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1151    1.8476   -1.0462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583    2.9846   -1.7808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0032    3.8776   -2.0225 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8125    4.9089   -2.7012 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2345    3.5728   -1.4859 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3183    4.3983   -1.6300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2421    5.5437   -2.3425 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5183    4.0171   -1.0161 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6386    2.8590   -0.2926 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8443    2.5151    0.3015 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5344    2.0133   -0.1471 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6882    0.7806    0.7128 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4297    0.6150    1.3075 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2754   -0.5971    1.9223 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9702   -0.6170    3.2841 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8488   -1.8966    3.8484 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5815   -1.7909    1.0831 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334   -2.7010    0.9558 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1216   -1.4587   -0.2702 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2077   -1.2263   -1.2643 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0810   -0.3341   -0.1698 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3677   -0.8491    0.2511 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3520    2.3893   -0.7396 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3026    1.5895   -0.5587 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3290    1.3303   -1.1093 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4454    0.5571   -0.8218 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2774   -2.6343   -0.5855 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5443   -3.0536   -1.6887 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6786   -2.3428   -0.9959 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5492   -3.4045   -0.7406 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1588   -1.0772   -0.3701 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5575   -1.2428   -0.1967 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8617   -1.6888    2.9112 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2081   -0.5954    2.4871 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320   -2.1463    1.6473 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7460    0.3754    1.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8408   -0.5537   -0.7657 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7818   -2.0015    0.5779 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1037   -0.5892    0.0666 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    3.2372   -2.2153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6293    6.0587   -2.8494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3646    4.6944   -1.1475 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0860    1.7402    0.8368 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4150    0.9600    1.5009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1783   -0.6516    2.1877 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9996   -0.2433    3.2419 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4091    0.0700    3.9960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9338   -2.1130    4.1336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4038   -2.4033    1.5823 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5494   -3.0655    0.0318 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7327   -2.3553   -0.6404 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6741   -0.8051   -2.0320 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3060    0.0136   -1.2226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4720   -0.5406    1.2074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5570    2.2786   -1.5881 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4443    0.8997   -1.0667 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2002   -3.4670    0.1577 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0666   -3.9190   -1.5399 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6817   -2.1927   -2.0965 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6325   -3.9740   -1.5416 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0812   -0.1996   -1.0637 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0010   -0.4214    0.0650 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 20 32  2  0
 32 33  1  0
  9 34  1  0
 34 35  2  0
  4 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40  2  1  0
 35  6  1  0
 33 10  1  0
 32 14  1  0
 30 21  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  2 45  1  0
  4 46  1  0
  7 47  1  0
  8 48  1  0
 11 49  1  0
 16 50  1  0
 17 51  1  0
 19 52  1  0
 21 53  1  0
 23 54  1  0
 24 55  1  0
 24 56  1  0
 25 57  1  0
 26 58  1  0
 27 59  1  0
 28 60  1  0
 29 61  1  0
 30 62  1  0
 31 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      10.669  -7.700   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       9.336  -2.310   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      10.669   0.000   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      10.669  -3.080   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      12.003  -0.770   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       1.334  -5.390   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      12.003  -6.930   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       9.336  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      12.003  -2.310   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.667  -4.620   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      13.337  -7.700   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       4.001  -5.390   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      14.671  -6.930   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      14.671  -5.390   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      13.337  -4.620   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0       1.334  -6.930   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       4.001   3.850   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       1.334  -0.770   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      13.337  -9.240   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       4.001  -6.930   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      16.004  -7.700   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       6.668  -5.390   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       6.668  -2.310   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      16.004  -4.620   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      12.003  -5.390   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      13.337  -3.080   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       6.668  -0.770   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       2.667  -3.080   0.000  0.00  0.00           O+0
CONECT    1    9                                                            
CONECT    2    4   10                                                       
CONECT    3    5   10                                                       
CONECT    4    2   11                                                       
CONECT    5    3   11                                                       
CONECT    6   12   13                                                       
CONECT    7   14   15                                                       
CONECT    8   16   28                                                       
CONECT    9    1   19   38                                                  
CONECT   10    2    3   15                                                  
CONECT   11    4    5   39                                                  
CONECT   12    6   17   29                                                  
CONECT   13    6   18   30                                                  
CONECT   14    7   17   31                                                  
CONECT   15    7   10   40                                                  
CONECT   16    8   20   41                                                  
CONECT   17   12   14   25                                                  
CONECT   18   13   25   26                                                  
CONECT   19    9   21   32                                                  
CONECT   20   16   22   33                                                  
CONECT   21   19   24   34                                                  
CONECT   22   20   23   35                                                  
CONECT   23   22   26   36                                                  
CONECT   24   21   27   37                                                  
CONECT   25   17   18   40                                                  
CONECT   26   18   23   41                                                  
CONECT   27   24   38   39                                                  
CONECT   28    8                                                            
CONECT   29   12                                                            
CONECT   30   13                                                            
CONECT   31   14                                                            
CONECT   32   19                                                            
CONECT   33   20                                                            
CONECT   34   21                                                            
CONECT   35   22                                                            
CONECT   36   23                                                            
CONECT   37   24                                                            
CONECT   38    9   27                                                       
CONECT   39   11   27                                                       
CONECT   40   15   25                                                       
CONECT   41   16   26                                                       
MASTER        0    0    0    0    0    0    0    0   41    0   90    0
END

COMPND    HMDB0259859
HETATM    1  C1  UNL     1       7.473  -1.345   2.060  1.00  0.00           C  
HETATM    2  C2  UNL     1       6.614  -0.730   0.963  1.00  0.00           C  
HETATM    3  O1  UNL     1       5.258  -0.975   1.136  1.00  0.00           O  
HETATM    4  C3  UNL     1       4.648  -1.394  -0.056  1.00  0.00           C  
HETATM    5  O2  UNL     1       3.277  -1.521   0.146  1.00  0.00           O  
HETATM    6  C4  UNL     1       2.276  -0.651  -0.209  1.00  0.00           C  
HETATM    7  C5  UNL     1       0.986  -1.068   0.104  1.00  0.00           C  
HETATM    8  C6  UNL     1      -0.116  -0.255  -0.201  1.00  0.00           C  
HETATM    9  C7  UNL     1       0.046   0.963  -0.817  1.00  0.00           C  
HETATM   10  C8  UNL     1      -1.115   1.848  -1.046  1.00  0.00           C  
HETATM   11  C9  UNL     1      -0.958   2.985  -1.781  1.00  0.00           C  
HETATM   12  C10 UNL     1      -2.003   3.878  -2.022  1.00  0.00           C  
HETATM   13  O3  UNL     1      -1.813   4.909  -2.701  1.00  0.00           O  
HETATM   14  C11 UNL     1      -3.234   3.573  -1.486  1.00  0.00           C  
HETATM   15  C12 UNL     1      -4.318   4.398  -1.630  1.00  0.00           C  
HETATM   16  O4  UNL     1      -4.242   5.544  -2.342  1.00  0.00           O  
HETATM   17  C13 UNL     1      -5.518   4.017  -1.016  1.00  0.00           C  
HETATM   18  C14 UNL     1      -5.639   2.859  -0.293  1.00  0.00           C  
HETATM   19  O5  UNL     1      -6.844   2.515   0.302  1.00  0.00           O  
HETATM   20  C15 UNL     1      -4.534   2.013  -0.147  1.00  0.00           C  
HETATM   21  C16 UNL     1      -4.688   0.781   0.713  1.00  0.00           C  
HETATM   22  O6  UNL     1      -3.430   0.615   1.308  1.00  0.00           O  
HETATM   23  C17 UNL     1      -3.275  -0.597   1.922  1.00  0.00           C  
HETATM   24  C18 UNL     1      -3.970  -0.617   3.284  1.00  0.00           C  
HETATM   25  O7  UNL     1      -3.849  -1.897   3.848  1.00  0.00           O  
HETATM   26  C19 UNL     1      -3.581  -1.791   1.083  1.00  0.00           C  
HETATM   27  O8  UNL     1      -2.533  -2.701   0.956  1.00  0.00           O  
HETATM   28  C20 UNL     1      -4.122  -1.459  -0.270  1.00  0.00           C  
HETATM   29  O9  UNL     1      -3.208  -1.226  -1.264  1.00  0.00           O  
HETATM   30  C21 UNL     1      -5.081  -0.334  -0.170  1.00  0.00           C  
HETATM   31  O10 UNL     1      -6.368  -0.849   0.251  1.00  0.00           O  
HETATM   32  C22 UNL     1      -3.352   2.389  -0.740  1.00  0.00           C  
HETATM   33  O11 UNL     1      -2.303   1.589  -0.559  1.00  0.00           O  
HETATM   34  C23 UNL     1       1.329   1.330  -1.109  1.00  0.00           C  
HETATM   35  C24 UNL     1       2.445   0.557  -0.822  1.00  0.00           C  
HETATM   36  C25 UNL     1       5.277  -2.634  -0.586  1.00  0.00           C  
HETATM   37  O12 UNL     1       4.544  -3.054  -1.689  1.00  0.00           O  
HETATM   38  C26 UNL     1       6.679  -2.343  -0.996  1.00  0.00           C  
HETATM   39  O13 UNL     1       7.549  -3.405  -0.741  1.00  0.00           O  
HETATM   40  C27 UNL     1       7.159  -1.077  -0.370  1.00  0.00           C  
HETATM   41  O14 UNL     1       8.557  -1.243  -0.197  1.00  0.00           O  
HETATM   42  H1  UNL     1       6.862  -1.689   2.911  1.00  0.00           H  
HETATM   43  H2  UNL     1       8.208  -0.595   2.487  1.00  0.00           H  
HETATM   44  H3  UNL     1       8.132  -2.146   1.647  1.00  0.00           H  
HETATM   45  H4  UNL     1       6.746   0.375   1.079  1.00  0.00           H  
HETATM   46  H5  UNL     1       4.841  -0.554  -0.766  1.00  0.00           H  
HETATM   47  H6  UNL     1       0.782  -2.002   0.578  1.00  0.00           H  
HETATM   48  H7  UNL     1      -1.104  -0.589   0.067  1.00  0.00           H  
HETATM   49  H8  UNL     1       0.000   3.237  -2.215  1.00  0.00           H  
HETATM   50  H9  UNL     1      -3.629   6.059  -2.849  1.00  0.00           H  
HETATM   51  H10 UNL     1      -6.365   4.694  -1.148  1.00  0.00           H  
HETATM   52  H11 UNL     1      -7.086   1.740   0.837  1.00  0.00           H  
HETATM   53  H12 UNL     1      -5.415   0.960   1.501  1.00  0.00           H  
HETATM   54  H13 UNL     1      -2.178  -0.652   2.188  1.00  0.00           H  
HETATM   55  H14 UNL     1      -5.000  -0.243   3.242  1.00  0.00           H  
HETATM   56  H15 UNL     1      -3.409   0.070   3.996  1.00  0.00           H  
HETATM   57  H16 UNL     1      -2.934  -2.113   4.134  1.00  0.00           H  
HETATM   58  H17 UNL     1      -4.404  -2.403   1.582  1.00  0.00           H  
HETATM   59  H18 UNL     1      -2.549  -3.065   0.032  1.00  0.00           H  
HETATM   60  H19 UNL     1      -4.733  -2.355  -0.640  1.00  0.00           H  
HETATM   61  H20 UNL     1      -3.674  -0.805  -2.032  1.00  0.00           H  
HETATM   62  H21 UNL     1      -5.306   0.014  -1.223  1.00  0.00           H  
HETATM   63  H22 UNL     1      -6.472  -0.541   1.207  1.00  0.00           H  
HETATM   64  H23 UNL     1       1.557   2.279  -1.588  1.00  0.00           H  
HETATM   65  H24 UNL     1       3.444   0.900  -1.067  1.00  0.00           H  
HETATM   66  H25 UNL     1       5.200  -3.467   0.158  1.00  0.00           H  
HETATM   67  H26 UNL     1       4.067  -3.919  -1.540  1.00  0.00           H  
HETATM   68  H27 UNL     1       6.682  -2.193  -2.096  1.00  0.00           H  
HETATM   69  H28 UNL     1       7.632  -3.974  -1.542  1.00  0.00           H  
HETATM   70  H29 UNL     1       7.081  -0.200  -1.064  1.00  0.00           H  
HETATM   71  H30 UNL     1       9.001  -0.421   0.065  1.00  0.00           H  
CONECT    1    2   42   43   44
CONECT    2    3   40   45
CONECT    3    4
CONECT    4    5   36   46
CONECT    5    6
CONECT    6    7    7   35
CONECT    7    8   47
CONECT    8    9    9   48
CONECT    9   10   34
CONECT   10   11   11   33
CONECT   11   12   49
CONECT   12   13   13   14
CONECT   14   15   15   32
CONECT   15   16   17
CONECT   16   50
CONECT   17   18   18   51
CONECT   18   19   20
CONECT   19   52
CONECT   20   21   32   32
CONECT   21   22   30   53
CONECT   22   23
CONECT   23   24   26   54
CONECT   24   25   55   56
CONECT   25   57
CONECT   26   27   28   58
CONECT   27   59
CONECT   28   29   30   60
CONECT   29   61
CONECT   30   31   62
CONECT   31   63
CONECT   32   33
CONECT   34   35   35   64
CONECT   35   65
CONECT   36   37   38   66
CONECT   37   67
CONECT   38   39   40   68
CONECT   39   69
CONECT   40   41   70
CONECT   41   71
END

HMDB0259859
     RDKit          3D
Vitexin rhamnoside
 71 75  0  0  0  0  0  0  0  0999 V2000
    7.4731   -1.3449    2.0599 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6139   -0.7297    0.9628 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2579   -0.9752    1.1364 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6476   -1.3941   -0.0564 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2767   -1.5214    0.1462 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2760   -0.6510   -0.2091 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9860   -1.0675    0.1044 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1157   -0.2546   -0.2014 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0463    0.9629   -0.8166 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1151    1.8476   -1.0462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583    2.9846   -1.7808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0032    3.8776   -2.0225 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8125    4.9089   -2.7012 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2345    3.5728   -1.4859 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3183    4.3983   -1.6300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2421    5.5437   -2.3425 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5183    4.0171   -1.0161 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6386    2.8590   -0.2926 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8443    2.5151    0.3015 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5344    2.0133   -0.1471 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6882    0.7806    0.7128 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4297    0.6150    1.3075 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2754   -0.5971    1.9223 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9702   -0.6170    3.2841 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8488   -1.8966    3.8484 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5815   -1.7909    1.0831 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5334   -2.7010    0.9558 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1216   -1.4587   -0.2702 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2077   -1.2263   -1.2643 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0810   -0.3341   -0.1698 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3677   -0.8491    0.2511 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3520    2.3893   -0.7396 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3026    1.5895   -0.5587 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3290    1.3303   -1.1093 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4454    0.5571   -0.8218 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2774   -2.6343   -0.5855 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5443   -3.0536   -1.6887 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6786   -2.3428   -0.9959 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5492   -3.4045   -0.7406 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1588   -1.0772   -0.3701 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5575   -1.2428   -0.1967 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8617   -1.6888    2.9112 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2081   -0.5954    2.4871 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320   -2.1463    1.6473 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7460    0.3754    1.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8408   -0.5537   -0.7657 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7818   -2.0015    0.5779 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1037   -0.5892    0.0666 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    3.2372   -2.2153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6293    6.0587   -2.8494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3646    4.6944   -1.1475 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0860    1.7402    0.8368 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4150    0.9600    1.5009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1783   -0.6516    2.1877 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9996   -0.2433    3.2419 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4091    0.0700    3.9960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9338   -2.1130    4.1336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4038   -2.4033    1.5823 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5494   -3.0655    0.0318 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7327   -2.3553   -0.6404 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6741   -0.8051   -2.0320 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3060    0.0136   -1.2226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4720   -0.5406    1.2074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5570    2.2786   -1.5881 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4443    0.8997   -1.0667 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2002   -3.4670    0.1577 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0666   -3.9190   -1.5399 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6817   -2.1927   -2.0965 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6325   -3.9740   -1.5416 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0812   -0.1996   -1.0637 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0010   -0.4214    0.0650 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 20 32  2  0
 32 33  1  0
  9 34  1  0
 34 35  2  0
  4 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 40  2  1  0
 35  6  1  0
 33 10  1  0
 32 14  1  0
 30 21  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  2 45  1  0
  4 46  1  0
  7 47  1  0
  8 48  1  0
 11 49  1  0
 16 50  1  0
 17 51  1  0
 19 52  1  0
 21 53  1  0
 23 54  1  0
 24 55  1  0
 24 56  1  0
 25 57  1  0
 26 58  1  0
 27 59  1  0
 28 60  1  0
 29 61  1  0
 30 62  1  0
 31 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Vitexin rhamnoside	HMDB
8-Glycosyl-apigenin-rhamnoside	MeSH
Vitexin-2''-O-rhamnoside	MeSH
Vitexin 4'-O-a-L-rhamnopyranoside	Generator
Vitexin 4'-O-α-L-rhamnopyranoside	Generator

Chemical Formula

C₂₇H₃₀O₁₄

Average Molecular Weight

578.5187

Monoisotopic Molecular Weight

578.163555668

IUPAC Name

5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-{4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}-4H-chromen-4-one

Traditional Name

5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-{4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}chromen-4-one

CAS Registry Number

32426-34-9

SMILES

CC1OC(OC2=CC=C(C=C2)C2=CC(=O)C3=C(O2)C(C2OC(CO)C(O)C(O)C2O)=C(O)C=C3O)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O14/c1-9-19(32)21(34)24(37)27(38-9)39-11-4-2-10(3-5-11)15-7-14(31)17-12(29)6-13(30)18(25(17)40-15)26-23(36)22(35)20(33)16(8-28)41-26/h2-7,9,16,19-24,26-30,32-37H,8H2,1H3

InChI Key

ZIIBNXKQZAUBRD-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid o-glycosides. Flavonoid O-glycosides are compounds containing a carbohydrate moiety which is O-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid O-glycosides

Alternative Parents

Substituents

Flavonoid o-glycoside
Flavonoid-4p-o-glycoside
Flavonoid c-glycoside
Flavonoid-8-c-glycoside
5-hydroxyflavonoid
7-hydroxyflavonoid
Hydroxyflavonoid
Flavone
Phenolic glycoside
O-glycosyl compound
Glycosyl compound
C-glycosyl compound
Chromone
1-benzopyran
Benzopyran
Phenoxy compound
Phenol ether
Pyranone
1-hydroxy-2-unsubstituted benzenoid
Monocyclic benzene moiety
Pyran
Oxane
Monosaccharide
Benzenoid
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Ether
Dialkyl ether
Organoheterocyclic compound
Oxacycle
Acetal
Polyol
Primary alcohol
Organic oxide
Organic oxygen compound
Hydrocarbon derivative
Alcohol
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0039855)
Cytoplasm (HMDB: HMDB0039855)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0039855)

Source

Exogenous

Exogenous (HMDB: HMDB0039855)

Food

Food (HMDB: HMDB0039855)

Herb and spice

Herbs and Spices (FooDB: FOOD00866)

Endogenous

Plant

Plant (HMDB: HMDB0039855)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0039855)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.89 g/L	ALOGPS
logP	-0.31	ALOGPS
logP	-1.3	ChemAxon
logS	-2.5	ALOGPS
pKa (Strongest Acidic)	6.2	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	14	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	236.06 Å²	ChemAxon
Rotatable Bond Count	5	ChemAxon
Refractivity	136.63 m³·mol⁻¹	ChemAxon
Polarizability	55.86 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	229.334	31661259
DarkChem	[M-H]-	221.149	31661259
DeepCCS	[M+H]+	237.511	30932474
DeepCCS	[M-H]-	235.245	30932474
DeepCCS	[M-2H]-	268.487	30932474
DeepCCS	[M+Na]+	243.424	30932474
AllCCS	[M+H]+	232.3	32859911
AllCCS	[M+H-H2O]+	230.8	32859911
AllCCS	[M+NH4]+	233.7	32859911
AllCCS	[M+Na]+	234.1	32859911
AllCCS	[M-H]-	229.8	32859911
AllCCS	[M+Na-2H]-	232.2	32859911
AllCCS	[M+HCOO]-	234.9	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Vitexin 4'-O-alpha-L-Rhamnopyranoside	CC1OC(OC2=CC=C(C=C2)C2=CC(=O)C3=C(O2)C(C2OC(CO)C(O)C(O)C2O)=C(O)C=C3O)C(O)C(O)C1O	5650.5	Standard polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside	CC1OC(OC2=CC=C(C=C2)C2=CC(=O)C3=C(O2)C(C2OC(CO)C(O)C(O)C2O)=C(O)C=C3O)C(O)C(O)C1O	5019.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside	CC1OC(OC2=CC=C(C=C2)C2=CC(=O)C3=C(O2)C(C2OC(CO)C(O)C(O)C2O)=C(O)C=C3O)C(O)C(O)C1O	5571.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5373.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4872.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5416.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4791.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5421.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4805.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5402.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4807.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5404.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4862.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5410.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4861.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5410.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4795.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5410.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4786.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5403.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4770.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5322.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4898.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5317.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4811.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5335.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4724.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5309.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4748.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5311.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4754.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5293.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4747.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5308.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4734.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5326.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4827.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5306.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4823.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5329.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4748.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5310.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4770.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5306.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4895.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5290.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4761.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5310.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4749.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5331.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4831.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5318.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4831.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5314.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4774.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5301.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4765.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5312.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4753.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5314.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4857.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5333.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4813.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5315.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4801.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5313.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4828.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5335.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4793.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5354.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4815.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5336.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4804.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5355.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4796.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5347.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4738.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5340.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4737.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5339.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4708.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5311.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4836.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5302.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4848.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5312.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4835.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5305.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4824.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5306.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4814.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5328.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4816.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5161.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4907.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5158.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4864.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5183.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4852.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5139.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4843.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5174.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4834.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5175.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4763.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5169.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4804.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5195.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4796.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5163.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4788.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5184.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4780.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5155.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4776.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5188.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4852.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5177.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4806.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5140.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4796.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5169.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4789.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5182.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4813.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5147.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4804.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5169.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4796.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5191.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4778.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5195.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4788.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5161.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4753.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5175.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4822.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5170.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4854.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5199.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4739.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5186.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4773.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5203.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4771.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5160.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4762.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5197.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4754.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5182.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4736.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5170.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4771.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #37	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5193.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #37	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4770.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #38	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5149.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #38	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4761.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #39	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5188.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #39	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4752.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5174.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4868.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #40	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5222.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #40	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4694.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #41	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5208.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #41	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4700.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #42	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5173.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #42	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4691.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #43	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5199.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #43	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4684.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #44	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5194.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #44	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4731.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #45	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5161.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #45	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4722.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #46	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5185.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #46	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4716.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #47	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5203.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #47	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4703.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #48	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5210.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #48	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4716.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #49	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5174.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #49	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4682.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5198.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4855.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #50	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5155.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #50	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4824.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #51	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5194.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #51	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4762.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #52	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5188.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #52	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4778.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #53	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5142.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #53	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4766.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #54	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5185.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #54	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4760.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #55	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5177.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #56	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5172.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #56	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4777.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #57	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5127.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #57	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4764.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #58	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5168.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #58	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4758.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #59	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5207.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #59	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4721.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5160.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4846.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #60	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5172.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #60	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4711.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #61	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5198.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #61	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4704.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #62	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5192.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #62	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4711.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #63	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5201.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #63	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4722.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #64	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5163.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #64	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4689.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #65	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5175.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #65	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4840.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #66	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5210.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #66	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4790.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #67	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5167.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #67	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4780.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #68	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5203.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #68	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4772.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #69	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5193.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #69	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4788.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5193.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4837.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #70	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5150.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #70	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4779.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #71	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5188.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #71	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4771.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #72	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5210.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #72	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4723.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #73	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5218.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #73	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4735.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #74	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5179.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #74	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4701.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #75	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5203.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #75	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4821.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #76	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	5161.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #76	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4811.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #77	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5210.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #77	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4802.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #78	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5214.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #78	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4747.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #79	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5221.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #79	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4757.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5177.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4847.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #80	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5187.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #80	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4722.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #81	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5234.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #81	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4749.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #82	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5242.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #82	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4757.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #83	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5210.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #83	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4723.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #84	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5245.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #84	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4694.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5148.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4850.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4994.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	4844.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4967.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4781.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #100	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5019.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #100	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4708.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #101	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4989.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #101	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4670.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #102	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5005.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #103	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4948.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #104	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4999.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #105	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4987.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #105	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4686.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #106	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5004.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #106	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4703.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #107	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4971.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #107	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4664.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #108	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5014.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #108	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4654.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #109	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5039.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #109	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4674.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5020.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4777.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #110	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5006.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #110	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4636.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #111	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5029.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #111	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4642.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #112	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5009.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #112	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4787.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #113	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4951.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #113	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4771.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #114	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5018.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #114	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4765.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #115	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5030.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #115	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4723.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #116	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5050.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #116	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4739.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #117	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5019.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #117	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4700.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #118	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5010.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #118	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4716.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #119	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5030.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #119	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4732.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4989.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4778.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #120	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4996.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #120	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4692.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #121	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5053.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #121	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4672.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #122	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5039.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #122	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4744.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #123	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5050.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #123	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4757.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #124	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5018.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #124	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4717.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #125	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5064.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #125	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4684.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #126	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5084.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #126	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4690.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4996.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4796.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4943.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4776.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4996.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4774.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5019.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4815.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4957.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4798.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5010.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4794.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5021.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4775.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4978.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4838.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5036.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4788.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5010.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4747.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4983.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4758.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4993.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4812.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5012.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4793.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4951.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4776.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5007.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4772.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4972.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4980.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4791.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4927.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4771.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4984.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4858.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4980.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4768.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5005.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4810.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4945.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4791.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4998.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4788.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5005.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4769.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5021.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4783.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4996.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4741.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #37	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5021.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #37	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4737.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #38	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5017.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #38	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4719.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #39	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4956.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #39	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4703.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5001.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4849.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #40	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5002.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #40	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4701.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #41	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5028.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #41	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4776.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #42	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4967.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #42	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4759.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #43	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5012.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #43	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4757.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #44	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5011.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #44	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4724.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #45	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5034.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #45	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4741.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #46	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5006.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #46	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4701.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #47	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5011.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #47	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4739.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #48	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4950.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #48	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4723.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #49	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4995.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #49	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4721.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4938.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4830.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #50	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4981.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #50	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4724.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #51	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5007.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #51	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4741.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #52	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4974.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #52	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4702.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #53	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5004.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #53	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4744.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #54	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5027.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #54	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4761.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #55	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5000.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #55	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4720.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #56	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5042.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #56	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4715.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #57	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5002.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #57	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4734.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #58	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4991.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #58	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4778.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #59	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5006.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #59	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4768.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5007.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO[Si](C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4827.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #60	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4952.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #60	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4751.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #61	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5020.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #61	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4746.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #62	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5035.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #62	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4701.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #63	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5019.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #63	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4693.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #64	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4971.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #64	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4676.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #65	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5023.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #65	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4673.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #66	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5017.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #66	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4741.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #67	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4961.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #67	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4725.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #68	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5015.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #68	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4722.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #69	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5022.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #69	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4701.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5000.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	4763.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #70	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5038.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #70	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4715.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #71	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5009.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #71	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4678.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #72	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5011.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #73	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5002.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #73	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4689.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #74	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4949.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #74	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4671.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #75	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5001.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #75	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4669.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #76	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5001.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #76	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4736.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #77	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4945.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #77	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4719.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #78	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4996.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #78	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4716.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #79	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5007.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #79	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4695.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5006.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4817.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #80	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5023.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #80	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4711.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #81	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4992.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #81	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4673.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #82	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5041.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #82	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4661.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #83	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4986.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #83	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4644.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #84	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5030.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #84	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4642.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #85	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5005.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #85	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4627.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #86	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5029.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #86	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4649.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #87	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4997.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #87	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4612.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #88	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5009.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #88	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4678.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #89	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5034.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #89	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4698.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5027.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4798.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #90	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4998.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #90	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4660.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #91	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5042.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #91	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4647.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #92	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	4992.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #93	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4976.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #93	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4764.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #94	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4931.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #94	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4744.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #95	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4995.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #95	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4739.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #96	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	5023.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #96	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C)C(O)C1O	4720.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #97	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4971.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #97	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C)C1O	4703.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #98	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	5023.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #98	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C	4699.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #99	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5004.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,4TMS,isomer #99	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4693.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5569.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5125.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5634.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5038.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5642.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5054.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5627.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5056.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5588.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5108.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5600.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5107.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5629.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5037.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5633.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5025.7	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5629.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,1TBDMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5009.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5692.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #1	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5358.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5684.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #10	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5273.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5696.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #11	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5189.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5698.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #12	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5216.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5680.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #13	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5219.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5671.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #14	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5209.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5688.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #15	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5197.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5719.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #16	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5286.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5696.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #17	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5281.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5703.7	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #18	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5212.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5688.8	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #19	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5232.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5674.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #2	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5354.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5685.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #20	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5223.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5703.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #21	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5211.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5717.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #22	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5295.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5697.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #23	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5292.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5697.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #24	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5238.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5693.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #25	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5228.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5705.9	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #26	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5215.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5697.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #27	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5327.2	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5702.3	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #28	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5273.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5700.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #29	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5260.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5679.0	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #3	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5287.5	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5720.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #30	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5250.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5723.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #31	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5277.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5722.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #32	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5265.4	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5741.4	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #33	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5255.3	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5719.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #34	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5198.9	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5731.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #35	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5194.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5727.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #36	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5170.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5696.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #4	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)=C4O3)C=C2)C(O)C(O)C1O	5295.8	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5684.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #5	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)=C4O3)C=C2)C(O)C(O)C1O	5307.6	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5684.1	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #6	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5296.1	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5682.2	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #7	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5282.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5688.6	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #8	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O)C=C(O)C(C5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5274.0	Standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5702.5	Semi standard non polar	33892256
Vitexin 4'-O-alpha-L-Rhamnopyranoside,2TBDMS,isomer #9	CC1OC(OC2=CC=C(C3=CC(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(C5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)=C4O3)C=C2)C(O)C(O)C1O	5278.9	Standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-02g9-4500980000-71d172911ffebb1ec4b0	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (1 TMS) - 70eV, Positive	splash10-0019-4700987000-9992b8b3db63c70d8bf6	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS ("Vitexin 4'-O-alpha-L-Rhamnopyranoside,3TMS,#55" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_3_55) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_4_27) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_4_72) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_4_92) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_4_102) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_4_103) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside GC-MS (TMS_4_104) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Positive-QTOF	splash10-02cr-0100970000-7e5380744f0a1ea89d8a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Positive-QTOF	splash10-0159-0201900000-f31ce4791cd551777a80	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Positive-QTOF	splash10-05mk-3596800000-9c667f31d93fe36321fa	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Positive-QTOF	splash10-02cr-0100970000-7e5380744f0a1ea89d8a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Positive-QTOF	splash10-0159-0201900000-f31ce4791cd551777a80	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Positive-QTOF	splash10-05mk-3596800000-9c667f31d93fe36321fa	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Positive-QTOF	splash10-02cr-0100970000-7e5380744f0a1ea89d8a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Positive-QTOF	splash10-0159-0201900000-f31ce4791cd551777a80	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Positive-QTOF	splash10-05mk-3596800000-9c667f31d93fe36321fa	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Negative-QTOF	splash10-004i-1101690000-9640ac2a8e7855a629c5	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Negative-QTOF	splash10-01qc-4204930000-98be6dc62d3b042cf47d	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Negative-QTOF	splash10-01po-6129600000-1b0a01ab70e89e5a93e4	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Negative-QTOF	splash10-004i-1101690000-9640ac2a8e7855a629c5	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Negative-QTOF	splash10-01qc-4204930000-98be6dc62d3b042cf47d	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Negative-QTOF	splash10-01po-6129600000-1b0a01ab70e89e5a93e4	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Negative-QTOF	splash10-004i-1101690000-9640ac2a8e7855a629c5	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Negative-QTOF	splash10-01qc-4204930000-98be6dc62d3b042cf47d	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Negative-QTOF	splash10-01po-6129600000-1b0a01ab70e89e5a93e4	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Positive-QTOF	splash10-004i-0000090000-ed76a1e0332f66700602	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Positive-QTOF	splash10-004i-0000090000-ed76a1e0332f66700602	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Positive-QTOF	splash10-014i-0039050000-8d73aa734ff3b172033a	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 10V, Negative-QTOF	splash10-004i-0000090000-205d908166a11e471cd9	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 20V, Negative-QTOF	splash10-004i-0000090000-6ecc991f16d1ad27701f	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vitexin 4'-O-alpha-L-Rhamnopyranoside 40V, Negative-QTOF	splash10-0bt9-0019020000-383967b4ee9a1a77c775	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB019513

KNApSAcK ID

C00014038

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

13589027

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Vitexin 4'-O-alpha-L-Rhamnopyranoside (HMDB0039855)

MOL for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

3D MOL for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

3D SDF for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

3D-SDF for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

PDB for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

3D PDB for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

SMILES for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

INCHI for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

Structure for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

3D Structure for HMDB0039855 (Vitexin 4'-O-alpha-L-Rhamnopyranoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra