Showing metabocard for 3-O-beta-D-Galactopyranosylcinnamtannin B1 (HMDB0039864)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 01:24:10 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:22 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0039864 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 3-O-beta-D-Galactopyranosylcinnamtannin B1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 3-O-beta-D-Galactopyranosylcinnamtannin B1 belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. 3-O-beta-D-Galactopyranosylcinnamtannin B1 is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, 3-O-beta-D-galactopyranosylcinnamtannin B1 has been detected, but not quantified in, cocoa and cocoa products. This could make 3-O-beta-D-galactopyranosylcinnamtannin B1 a potential biomarker for the consumption of these foods. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)Mrv0541 02241211062D 74 84 0 0 0 0 999 V2000 -0.4306 -3.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1828 -4.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9670 -3.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1375 -3.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5241 -2.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2586 -2.7463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2147 -3.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8281 -3.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6135 -3.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7855 -4.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1719 -4.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3866 -4.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9216 -2.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0922 -1.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4787 -1.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6961 -1.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5710 -4.5731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0110 -4.9115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2050 -0.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6313 -1.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1691 -0.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3947 -0.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1788 0.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9766 0.2235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0042 -0.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5777 -0.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3797 -0.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6068 -1.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0331 -1.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2326 -1.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1939 0.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4208 0.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8473 1.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0481 1.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4087 -1.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8597 -1.9567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0743 3.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7923 2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3205 1.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1321 1.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4141 2.6582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8859 3.2868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5433 3.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8253 4.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2957 5.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5241 5.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8005 4.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2696 3.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6617 1.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4732 1.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7552 2.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2271 2.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0481 5.6762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0220 2.1451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5351 -3.3405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6493 -0.6238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9918 -0.1864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0743 2.2070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3797 0.4738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5682 2.3129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 4.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2614 -2.5551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3439 -5.6762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0922 2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5049 2.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 2.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7429 2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 3.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5049 3.6802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0922 1.5358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7429 1.5358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5682 2.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7429 4.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 5.1109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 1 7 1 0 0 0 0 2 3 1 0 0 0 0 2 18 1 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 4 13 1 0 0 0 0 5 6 1 0 0 0 0 5 16 1 0 0 0 0 7 8 2 0 0 0 0 7 12 1 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 10 17 1 0 0 0 0 11 12 2 0 0 0 0 11 63 1 0 0 0 0 13 14 2 0 0 0 0 13 55 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 56 1 0 0 0 0 16 21 1 0 0 0 0 19 20 1 0 0 0 0 19 24 1 0 0 0 0 19 25 1 0 0 0 0 20 21 1 0 0 0 0 20 36 1 0 0 0 0 21 22 1 0 0 0 0 22 23 2 0 0 0 0 22 31 1 0 0 0 0 23 24 1 0 0 0 0 23 34 1 0 0 0 0 25 26 2 0 0 0 0 25 30 1 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 28 29 1 0 0 0 0 28 35 1 0 0 0 0 29 30 2 0 0 0 0 29 62 1 0 0 0 0 31 32 2 0 0 0 0 31 57 1 0 0 0 0 32 33 1 0 0 0 0 33 34 2 0 0 0 0 33 58 1 0 0 0 0 34 39 1 0 0 0 0 37 38 1 0 0 0 0 37 42 1 0 0 0 0 37 43 1 0 0 0 0 37 58 1 0 0 0 0 38 39 1 0 0 0 0 38 54 1 0 0 0 0 39 40 1 0 0 0 0 40 41 2 0 0 0 0 40 49 1 0 0 0 0 41 42 1 0 0 0 0 41 52 1 0 0 0 0 43 44 2 0 0 0 0 43 48 1 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 46 53 1 0 0 0 0 47 48 2 0 0 0 0 47 61 1 0 0 0 0 49 50 2 0 0 0 0 49 59 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 51 60 1 0 0 0 0 54 64 1 0 0 0 0 64 65 1 0 0 0 0 64 69 1 0 0 0 0 65 66 1 0 0 0 0 65 70 1 0 0 0 0 66 67 1 0 0 0 0 66 71 1 0 0 0 0 67 68 1 0 0 0 0 67 72 1 0 0 0 0 68 69 1 0 0 0 0 68 73 1 0 0 0 0 73 74 1 0 0 0 0 M END 3D MOL for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)HMDB0039864 RDKit 3D 3-O-beta-D-Galactopyranosylcinnamtannin B1 120130 0 0 0 0 0 0 0 0999 V2000 -5.9665 0.2652 -1.4286 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1050 1.4630 -0.7172 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9280 2.3729 -0.9783 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7630 1.7557 -0.6104 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8108 1.3139 0.6956 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6760 0.5220 0.9954 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9838 -0.7817 1.2779 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2415 -1.6235 0.2432 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4976 -3.0408 0.5777 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2441 -4.0457 -0.3774 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7663 -3.7938 -1.5737 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5092 -5.3917 -0.0597 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0095 -5.7375 1.1625 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2559 -7.0938 1.4266 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2545 -4.7616 2.0883 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9990 -3.4428 1.7900 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2909 -2.5149 2.8275 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5934 -1.2651 2.6323 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9479 -0.3294 3.7107 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9882 0.6000 4.1269 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2556 1.5040 5.1304 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4991 1.5032 5.7492 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7587 2.4340 6.7732 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4317 0.5977 5.3420 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6885 0.5615 5.9359 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1586 -0.3079 4.3348 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2186 -1.6335 2.7456 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3332 -1.3264 1.7455 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9956 -1.0344 1.9454 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8354 -0.7275 0.8977 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1751 -0.4314 1.0768 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3499 -0.7044 -0.4034 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0277 -0.9969 -0.5903 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8085 -1.3039 0.4472 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5412 -0.9928 -1.8777 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1389 -0.1832 -2.8711 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4640 -0.6043 -4.1467 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8627 -0.7234 -4.1547 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5722 -1.0996 -5.2652 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9156 -1.3798 -6.4392 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6269 -1.7700 -7.5945 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5468 -1.2708 -6.4598 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1922 -1.5402 -7.6217 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1766 -0.8854 -5.3197 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5967 -0.5128 -2.8522 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2161 0.3429 -3.8029 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2293 -0.3601 -1.5286 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5595 -1.0075 -1.4170 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6599 -2.3609 -1.4931 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5589 -3.1468 -1.6664 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9136 -2.9370 -1.3893 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0475 -2.1845 -1.2141 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2938 -2.7919 -1.1125 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9343 -0.8106 -1.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6990 -0.2103 -1.2378 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6074 1.1556 -1.1600 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6972 2.0327 -0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8449 2.4219 0.4605 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6686 2.7517 1.1366 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6677 3.1351 2.4627 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8591 3.2055 3.1747 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8568 3.5957 4.5250 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0238 2.8831 2.5198 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2288 2.9479 3.2208 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9982 2.5006 1.1871 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9026 1.3680 -1.5398 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0058 2.1815 -1.6059 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1603 0.0056 -0.9453 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9143 2.4741 1.6276 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0075 2.3355 2.4608 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9595 3.7510 0.8019 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0449 4.8705 1.5958 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0709 3.6923 -0.2450 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7946 4.7064 -1.1704 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7908 -0.2772 -1.3969 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3911 1.3492 0.3240 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0239 1.9415 -1.2018 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8680 2.5493 -2.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6599 0.6240 0.8733 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0712 -0.9162 1.1666 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5334 -1.3468 -0.7848 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4390 -3.4906 -2.3633 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3057 -6.1626 -0.8155 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5330 -7.6756 1.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6567 -5.0775 3.0568 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0215 0.5917 3.6346 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5153 2.2321 5.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0246 3.0951 7.0400 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3889 -0.0948 5.6545 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9212 -0.9988 4.0503 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4001 -1.0410 2.9347 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6156 -0.4206 1.9649 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0615 0.8921 -2.6662 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4112 -0.5044 -3.2269 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6567 -1.1809 -5.2334 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6329 -1.8384 -7.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3116 -1.8208 -8.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2385 -0.8260 -5.3967 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6721 -1.5799 -3.2258 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0809 1.2756 -3.5096 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4234 0.7646 -1.3908 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6331 -4.1617 -1.7252 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9589 -4.0312 -1.4537 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3925 -3.7948 -1.1644 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4914 2.9508 -1.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7116 2.7167 0.6319 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7713 3.3949 3.0071 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0158 3.8275 5.0047 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1196 2.7232 2.7993 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9114 2.2605 0.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6207 1.1702 -2.6219 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8130 1.6218 -1.5997 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0157 -0.4361 -1.5123 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3440 0.0146 0.1367 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9707 2.5970 2.2443 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0987 3.2237 2.9337 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0150 3.8164 0.1994 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4974 5.5876 1.1903 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0591 3.8658 0.1849 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1870 4.3996 -2.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 10 12 1 0 12 13 2 0 13 14 1 0 13 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 22 24 1 0 24 25 1 0 24 26 2 0 18 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 30 32 2 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 40 42 1 0 42 43 1 0 42 44 2 0 36 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 49 51 1 0 51 52 2 0 52 53 1 0 52 54 1 0 54 55 2 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 2 0 59 60 1 0 60 61 2 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 2 0 57 66 1 0 66 67 1 0 66 68 1 0 5 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 73 3 1 0 18 7 1 0 26 19 1 0 34 28 1 0 44 37 1 0 55 48 1 0 65 58 1 0 34 8 1 0 68 54 1 0 16 9 1 0 47 32 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 0 5 79 1 0 7 80 1 0 8 81 1 0 11 82 1 0 12 83 1 0 14 84 1 0 15 85 1 0 20 86 1 0 21 87 1 0 23 88 1 0 25 89 1 0 26 90 1 0 29 91 1 0 31 92 1 0 36 93 1 0 38 94 1 0 39 95 1 0 41 96 1 0 43 97 1 0 44 98 1 0 45 99 1 0 46100 1 0 47101 1 0 50102 1 0 51103 1 0 53104 1 0 57105 1 0 59106 1 0 60107 1 0 62108 1 0 64109 1 0 65110 1 0 66111 1 0 67112 1 0 68113 1 0 68114 1 0 69115 1 0 70116 1 0 71117 1 0 72118 1 0 73119 1 0 74120 1 0 M END 3D SDF for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)Mrv0541 02241211062D 74 84 0 0 0 0 999 V2000 -0.4306 -3.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1828 -4.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9670 -3.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1375 -3.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5241 -2.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2586 -2.7463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2147 -3.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8281 -3.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6135 -3.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7855 -4.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1719 -4.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3866 -4.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9216 -2.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0922 -1.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4787 -1.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6961 -1.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5710 -4.5731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0110 -4.9115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2050 -0.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6313 -1.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1691 -0.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3947 -0.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1788 0.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9766 0.2235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0042 -0.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5777 -0.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3797 -0.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6068 -1.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0331 -1.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2326 -1.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1939 0.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4208 0.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8473 1.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0481 1.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4087 -1.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8597 -1.9567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0743 3.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7923 2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3205 1.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1321 1.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4141 2.6582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8859 3.2868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5433 3.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8253 4.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2957 5.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5241 5.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8005 4.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2696 3.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6617 1.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4732 1.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7552 2.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2271 2.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0481 5.6762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0220 2.1451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5351 -3.3405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6493 -0.6238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9918 -0.1864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0743 2.2070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3797 0.4738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5682 2.3129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 4.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2614 -2.5551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3439 -5.6762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0922 2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5049 2.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 2.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7429 2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 3.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5049 3.6802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0922 1.5358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7429 1.5358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5682 2.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7429 4.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 5.1109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 1 7 1 0 0 0 0 2 3 1 0 0 0 0 2 18 1 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 4 13 1 0 0 0 0 5 6 1 0 0 0 0 5 16 1 0 0 0 0 7 8 2 0 0 0 0 7 12 1 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 10 17 1 0 0 0 0 11 12 2 0 0 0 0 11 63 1 0 0 0 0 13 14 2 0 0 0 0 13 55 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 56 1 0 0 0 0 16 21 1 0 0 0 0 19 20 1 0 0 0 0 19 24 1 0 0 0 0 19 25 1 0 0 0 0 20 21 1 0 0 0 0 20 36 1 0 0 0 0 21 22 1 0 0 0 0 22 23 2 0 0 0 0 22 31 1 0 0 0 0 23 24 1 0 0 0 0 23 34 1 0 0 0 0 25 26 2 0 0 0 0 25 30 1 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 28 29 1 0 0 0 0 28 35 1 0 0 0 0 29 30 2 0 0 0 0 29 62 1 0 0 0 0 31 32 2 0 0 0 0 31 57 1 0 0 0 0 32 33 1 0 0 0 0 33 34 2 0 0 0 0 33 58 1 0 0 0 0 34 39 1 0 0 0 0 37 38 1 0 0 0 0 37 42 1 0 0 0 0 37 43 1 0 0 0 0 37 58 1 0 0 0 0 38 39 1 0 0 0 0 38 54 1 0 0 0 0 39 40 1 0 0 0 0 40 41 2 0 0 0 0 40 49 1 0 0 0 0 41 42 1 0 0 0 0 41 52 1 0 0 0 0 43 44 2 0 0 0 0 43 48 1 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 46 53 1 0 0 0 0 47 48 2 0 0 0 0 47 61 1 0 0 0 0 49 50 2 0 0 0 0 49 59 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 51 60 1 0 0 0 0 54 64 1 0 0 0 0 64 65 1 0 0 0 0 64 69 1 0 0 0 0 65 66 1 0 0 0 0 65 70 1 0 0 0 0 66 67 1 0 0 0 0 66 71 1 0 0 0 0 67 68 1 0 0 0 0 67 72 1 0 0 0 0 68 69 1 0 0 0 0 68 73 1 0 0 0 0 73 74 1 0 0 0 0 M END > <DATABASE_ID> HMDB0039864 > <DATABASE_NAME> hmdb > <SMILES> OCC1OC(OC2C3C4=C(OC2(OC2=C3C3=C(C(C(O)C(O3)C3=CC=C(O)C(O)=C3)C3=C(O)C=C(O)C5=C3OC(C(O)C5)C3=CC=C(O)C(O)=C3)C(O)=C2)C2=CC=C(O)C(O)=C2)C=C(O)C=C4O)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C51H46O23/c52-15-34-41(65)43(67)44(68)50(69-34)72-49-40-35-28(61)10-19(53)11-32(35)73-51(49,18-3-6-23(56)27(60)9-18)74-33-14-30(63)37-39(42(66)46(71-48(37)38(33)40)17-2-5-22(55)26(59)8-17)36-29(62)13-24(57)20-12-31(64)45(70-47(20)36)16-1-4-21(54)25(58)7-16/h1-11,13-14,31,34,39-46,49-50,52-68H,12,15H2 > <INCHI_KEY> XIFRPUIQXADIQI-UHFFFAOYSA-N > <FORMULA> C51H46O23 > <MOLECULAR_WEIGHT> 1026.8971 > <EXACT_MASS> 1026.242987778 > <JCHEM_ACCEPTOR_COUNT> 23 > <JCHEM_AVERAGE_POLARIZABILITY> 99.21964598150706 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 17 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-21-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19-tetrol > <ALOGPS_LOGP> 3.22 > <JCHEM_LOGP> 3.140334449333333 > <ALOGPS_LOGS> -3.21 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 11 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 9.014325486138283 > <JCHEM_PKA_STRONGEST_ACIDIC> 8.597666519734386 > <JCHEM_PKA_STRONGEST_BASIC> -5.217717773419602 > <JCHEM_POLAR_SURFACE_AREA> 399.2900000000001 > <JCHEM_REFRACTIVITY> 249.1179000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 7 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 6.37e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-21-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19-tetrol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)HMDB0039864 RDKit 3D 3-O-beta-D-Galactopyranosylcinnamtannin B1 120130 0 0 0 0 0 0 0 0999 V2000 -5.9665 0.2652 -1.4286 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1050 1.4630 -0.7172 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9280 2.3729 -0.9783 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7630 1.7557 -0.6104 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8108 1.3139 0.6956 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6760 0.5220 0.9954 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9838 -0.7817 1.2779 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2415 -1.6235 0.2432 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4976 -3.0408 0.5777 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2441 -4.0457 -0.3774 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7663 -3.7938 -1.5737 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5092 -5.3917 -0.0597 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0095 -5.7375 1.1625 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2559 -7.0938 1.4266 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2545 -4.7616 2.0883 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9990 -3.4428 1.7900 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2909 -2.5149 2.8275 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5934 -1.2651 2.6323 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9479 -0.3294 3.7107 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9882 0.6000 4.1269 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2556 1.5040 5.1304 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4991 1.5032 5.7492 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7587 2.4340 6.7732 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4317 0.5977 5.3420 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6885 0.5615 5.9359 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1586 -0.3079 4.3348 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2186 -1.6335 2.7456 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3332 -1.3264 1.7455 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9956 -1.0344 1.9454 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8354 -0.7275 0.8977 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1751 -0.4314 1.0768 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3499 -0.7044 -0.4034 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0277 -0.9969 -0.5903 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8085 -1.3039 0.4472 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5412 -0.9928 -1.8777 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1389 -0.1832 -2.8711 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4640 -0.6043 -4.1467 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8627 -0.7234 -4.1547 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5722 -1.0996 -5.2652 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9156 -1.3798 -6.4392 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6269 -1.7700 -7.5945 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5468 -1.2708 -6.4598 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1922 -1.5402 -7.6217 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1766 -0.8854 -5.3197 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5967 -0.5128 -2.8522 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2161 0.3429 -3.8029 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2293 -0.3601 -1.5286 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5595 -1.0075 -1.4170 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6599 -2.3609 -1.4931 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5589 -3.1468 -1.6664 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9136 -2.9370 -1.3893 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0475 -2.1845 -1.2141 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2938 -2.7919 -1.1125 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9343 -0.8106 -1.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6990 -0.2103 -1.2378 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6074 1.1556 -1.1600 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6972 2.0327 -0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8449 2.4219 0.4605 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6686 2.7517 1.1366 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6677 3.1351 2.4627 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8591 3.2055 3.1747 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8568 3.5957 4.5250 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0238 2.8831 2.5198 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2288 2.9479 3.2208 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9982 2.5006 1.1871 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9026 1.3680 -1.5398 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0058 2.1815 -1.6059 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1603 0.0056 -0.9453 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9143 2.4741 1.6276 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0075 2.3355 2.4608 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9595 3.7510 0.8019 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0449 4.8705 1.5958 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0709 3.6923 -0.2450 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7946 4.7064 -1.1704 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7908 -0.2772 -1.3969 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3911 1.3492 0.3240 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0239 1.9415 -1.2018 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8680 2.5493 -2.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6599 0.6240 0.8733 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0712 -0.9162 1.1666 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5334 -1.3468 -0.7848 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4390 -3.4906 -2.3633 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3057 -6.1626 -0.8155 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5330 -7.6756 1.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6567 -5.0775 3.0568 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0215 0.5917 3.6346 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5153 2.2321 5.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0246 3.0951 7.0400 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3889 -0.0948 5.6545 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9212 -0.9988 4.0503 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4001 -1.0410 2.9347 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6156 -0.4206 1.9649 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0615 0.8921 -2.6662 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4112 -0.5044 -3.2269 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6567 -1.1809 -5.2334 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6329 -1.8384 -7.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3116 -1.8208 -8.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2385 -0.8260 -5.3967 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6721 -1.5799 -3.2258 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0809 1.2756 -3.5096 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4234 0.7646 -1.3908 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6331 -4.1617 -1.7252 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9589 -4.0312 -1.4537 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3925 -3.7948 -1.1644 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4914 2.9508 -1.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7116 2.7167 0.6319 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7713 3.3949 3.0071 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0158 3.8275 5.0047 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1196 2.7232 2.7993 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9114 2.2605 0.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6207 1.1702 -2.6219 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8130 1.6218 -1.5997 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0157 -0.4361 -1.5123 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3440 0.0146 0.1367 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9707 2.5970 2.2443 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0987 3.2237 2.9337 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0150 3.8164 0.1994 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4974 5.5876 1.1903 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0591 3.8658 0.1849 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1870 4.3996 -2.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 10 12 1 0 12 13 2 0 13 14 1 0 13 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 22 24 1 0 24 25 1 0 24 26 2 0 18 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 30 32 2 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 40 42 1 0 42 43 1 0 42 44 2 0 36 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 49 51 1 0 51 52 2 0 52 53 1 0 52 54 1 0 54 55 2 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 2 0 59 60 1 0 60 61 2 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 2 0 57 66 1 0 66 67 1 0 66 68 1 0 5 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 73 3 1 0 18 7 1 0 26 19 1 0 34 28 1 0 44 37 1 0 55 48 1 0 65 58 1 0 34 8 1 0 68 54 1 0 16 9 1 0 47 32 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 0 5 79 1 0 7 80 1 0 8 81 1 0 11 82 1 0 12 83 1 0 14 84 1 0 15 85 1 0 20 86 1 0 21 87 1 0 23 88 1 0 25 89 1 0 26 90 1 0 29 91 1 0 31 92 1 0 36 93 1 0 38 94 1 0 39 95 1 0 41 96 1 0 43 97 1 0 44 98 1 0 45 99 1 0 46100 1 0 47101 1 0 50102 1 0 51103 1 0 53104 1 0 57105 1 0 59106 1 0 60107 1 0 62108 1 0 64109 1 0 65110 1 0 66111 1 0 67112 1 0 68113 1 0 68114 1 0 69115 1 0 70116 1 0 71117 1 0 72118 1 0 73119 1 0 74120 1 0 M END PDB for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 -0.804 -6.631 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 0.341 -7.661 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 1.805 -7.186 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 2.123 -5.681 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 0.978 -4.651 0.000 0.00 0.00 C+0 HETATM 6 O UNK 0 -0.483 -5.126 0.000 0.00 0.00 O+0 HETATM 7 C UNK 0 -2.267 -7.104 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -3.412 -6.074 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -4.879 -6.551 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -5.200 -8.059 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -4.054 -9.088 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -2.588 -8.613 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 3.587 -5.206 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 3.905 -3.701 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 2.760 -2.672 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 1.299 -3.147 0.000 0.00 0.00 C+0 HETATM 17 O UNK 0 -6.666 -8.536 0.000 0.00 0.00 O+0 HETATM 18 O UNK 0 0.021 -9.168 0.000 0.00 0.00 O+0 HETATM 19 C UNK 0 -2.249 -1.062 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -1.178 -2.171 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 0.316 -1.799 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 0.737 -0.320 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 -0.334 0.790 0.000 0.00 0.00 C+0 HETATM 24 O UNK 0 -1.823 0.417 0.000 0.00 0.00 O+0 HETATM 25 C UNK 0 -3.741 -1.432 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -4.812 -0.320 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -6.309 -0.697 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -6.733 -2.171 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -5.662 -3.288 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -4.168 -2.913 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 2.229 0.050 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 2.652 1.529 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 1.582 2.638 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 0.090 2.266 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 -8.230 -2.554 0.000 0.00 0.00 O+0 HETATM 36 O UNK 0 -1.605 -3.653 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 -2.005 5.871 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -1.479 4.423 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -2.465 3.242 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -3.980 3.514 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -4.506 4.962 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 -3.520 6.135 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 -1.014 7.047 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -1.541 8.498 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 -0.552 9.676 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 0.978 9.412 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 1.494 7.964 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 0.503 6.785 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -4.969 2.333 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -6.483 2.602 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -7.010 4.050 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -6.024 5.226 0.000 0.00 0.00 C+0 HETATM 53 O UNK 0 1.956 10.596 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 0.041 4.004 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 4.732 -6.236 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 3.079 -1.164 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 3.718 -0.348 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 2.005 4.120 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 -4.442 0.884 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 -8.527 4.317 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 3.009 7.691 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 -6.088 -4.770 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 -4.375 -10.596 0.000 0.00 0.00 O+0 HETATM 64 C UNK 0 3.905 5.537 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 4.676 4.202 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 6.216 4.202 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 6.987 5.537 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 6.216 6.870 0.000 0.00 0.00 C+0 HETATM 69 O UNK 0 4.676 6.870 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 3.905 2.867 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 6.987 2.867 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 8.527 5.537 0.000 0.00 0.00 O+0 HETATM 73 C UNK 0 6.987 8.205 0.000 0.00 0.00 C+0 HETATM 74 O UNK 0 6.216 9.540 0.000 0.00 0.00 O+0 CONECT 1 2 6 7 CONECT 2 1 3 18 CONECT 3 2 4 CONECT 4 3 5 13 CONECT 5 4 6 16 CONECT 6 1 5 CONECT 7 1 8 12 CONECT 8 7 9 CONECT 9 8 10 CONECT 10 9 11 17 CONECT 11 10 12 63 CONECT 12 7 11 CONECT 13 4 14 55 CONECT 14 13 15 CONECT 15 14 16 56 CONECT 16 5 15 21 CONECT 17 10 CONECT 18 2 CONECT 19 20 24 25 CONECT 20 19 21 36 CONECT 21 16 20 22 CONECT 22 21 23 31 CONECT 23 22 24 34 CONECT 24 19 23 CONECT 25 19 26 30 CONECT 26 25 27 CONECT 27 26 28 CONECT 28 27 29 35 CONECT 29 28 30 62 CONECT 30 25 29 CONECT 31 22 32 57 CONECT 32 31 33 CONECT 33 32 34 58 CONECT 34 23 33 39 CONECT 35 28 CONECT 36 20 CONECT 37 38 42 43 58 CONECT 38 37 39 54 CONECT 39 34 38 40 CONECT 40 39 41 49 CONECT 41 40 42 52 CONECT 42 37 41 CONECT 43 37 44 48 CONECT 44 43 45 CONECT 45 44 46 CONECT 46 45 47 53 CONECT 47 46 48 61 CONECT 48 43 47 CONECT 49 40 50 59 CONECT 50 49 51 CONECT 51 50 52 60 CONECT 52 41 51 CONECT 53 46 CONECT 54 38 64 CONECT 55 13 CONECT 56 15 CONECT 57 31 CONECT 58 33 37 CONECT 59 49 CONECT 60 51 CONECT 61 47 CONECT 62 29 CONECT 63 11 CONECT 64 54 65 69 CONECT 65 64 66 70 CONECT 66 65 67 71 CONECT 67 66 68 72 CONECT 68 67 69 73 CONECT 69 64 68 CONECT 70 65 CONECT 71 66 CONECT 72 67 CONECT 73 68 74 CONECT 74 73 MASTER 0 0 0 0 0 0 0 0 74 0 168 0 END 3D PDB for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)COMPND HMDB0039864 HETATM 1 O1 UNL 1 -5.966 0.265 -1.429 1.00 0.00 O HETATM 2 C1 UNL 1 -6.105 1.463 -0.717 1.00 0.00 C HETATM 3 C2 UNL 1 -4.928 2.373 -0.978 1.00 0.00 C HETATM 4 O2 UNL 1 -3.763 1.756 -0.610 1.00 0.00 O HETATM 5 C3 UNL 1 -3.811 1.314 0.696 1.00 0.00 C HETATM 6 O3 UNL 1 -2.676 0.522 0.995 1.00 0.00 O HETATM 7 C4 UNL 1 -2.984 -0.782 1.278 1.00 0.00 C HETATM 8 C5 UNL 1 -2.242 -1.623 0.243 1.00 0.00 C HETATM 9 C6 UNL 1 -2.498 -3.041 0.578 1.00 0.00 C HETATM 10 C7 UNL 1 -2.244 -4.046 -0.377 1.00 0.00 C HETATM 11 O4 UNL 1 -1.766 -3.794 -1.574 1.00 0.00 O HETATM 12 C8 UNL 1 -2.509 -5.392 -0.060 1.00 0.00 C HETATM 13 C9 UNL 1 -3.009 -5.737 1.163 1.00 0.00 C HETATM 14 O5 UNL 1 -3.256 -7.094 1.427 1.00 0.00 O HETATM 15 C10 UNL 1 -3.254 -4.762 2.088 1.00 0.00 C HETATM 16 C11 UNL 1 -2.999 -3.443 1.790 1.00 0.00 C HETATM 17 O6 UNL 1 -3.291 -2.515 2.827 1.00 0.00 O HETATM 18 C12 UNL 1 -2.593 -1.265 2.632 1.00 0.00 C HETATM 19 C13 UNL 1 -2.948 -0.329 3.711 1.00 0.00 C HETATM 20 C14 UNL 1 -1.988 0.600 4.127 1.00 0.00 C HETATM 21 C15 UNL 1 -2.256 1.504 5.130 1.00 0.00 C HETATM 22 C16 UNL 1 -3.499 1.503 5.749 1.00 0.00 C HETATM 23 O7 UNL 1 -3.759 2.434 6.773 1.00 0.00 O HETATM 24 C17 UNL 1 -4.432 0.598 5.342 1.00 0.00 C HETATM 25 O8 UNL 1 -5.689 0.561 5.936 1.00 0.00 O HETATM 26 C18 UNL 1 -4.159 -0.308 4.335 1.00 0.00 C HETATM 27 O9 UNL 1 -1.219 -1.634 2.746 1.00 0.00 O HETATM 28 C19 UNL 1 -0.333 -1.326 1.745 1.00 0.00 C HETATM 29 C20 UNL 1 0.996 -1.034 1.945 1.00 0.00 C HETATM 30 C21 UNL 1 1.835 -0.727 0.898 1.00 0.00 C HETATM 31 O10 UNL 1 3.175 -0.431 1.077 1.00 0.00 O HETATM 32 C22 UNL 1 1.350 -0.704 -0.403 1.00 0.00 C HETATM 33 C23 UNL 1 0.028 -0.997 -0.590 1.00 0.00 C HETATM 34 C24 UNL 1 -0.809 -1.304 0.447 1.00 0.00 C HETATM 35 O11 UNL 1 -0.541 -0.993 -1.878 1.00 0.00 O HETATM 36 C25 UNL 1 0.139 -0.183 -2.871 1.00 0.00 C HETATM 37 C26 UNL 1 -0.464 -0.604 -4.147 1.00 0.00 C HETATM 38 C27 UNL 1 -1.863 -0.723 -4.155 1.00 0.00 C HETATM 39 C28 UNL 1 -2.572 -1.100 -5.265 1.00 0.00 C HETATM 40 C29 UNL 1 -1.916 -1.380 -6.439 1.00 0.00 C HETATM 41 O12 UNL 1 -2.627 -1.770 -7.595 1.00 0.00 O HETATM 42 C30 UNL 1 -0.547 -1.271 -6.460 1.00 0.00 C HETATM 43 O13 UNL 1 0.192 -1.540 -7.622 1.00 0.00 O HETATM 44 C31 UNL 1 0.177 -0.885 -5.320 1.00 0.00 C HETATM 45 C32 UNL 1 1.597 -0.513 -2.852 1.00 0.00 C HETATM 46 O14 UNL 1 2.216 0.343 -3.803 1.00 0.00 O HETATM 47 C33 UNL 1 2.229 -0.360 -1.529 1.00 0.00 C HETATM 48 C34 UNL 1 3.559 -1.008 -1.417 1.00 0.00 C HETATM 49 C35 UNL 1 3.660 -2.361 -1.493 1.00 0.00 C HETATM 50 O15 UNL 1 2.559 -3.147 -1.666 1.00 0.00 O HETATM 51 C36 UNL 1 4.914 -2.937 -1.389 1.00 0.00 C HETATM 52 C37 UNL 1 6.047 -2.184 -1.214 1.00 0.00 C HETATM 53 O16 UNL 1 7.294 -2.792 -1.113 1.00 0.00 O HETATM 54 C38 UNL 1 5.934 -0.811 -1.139 1.00 0.00 C HETATM 55 C39 UNL 1 4.699 -0.210 -1.238 1.00 0.00 C HETATM 56 O17 UNL 1 4.607 1.156 -1.160 1.00 0.00 O HETATM 57 C40 UNL 1 5.697 2.033 -0.936 1.00 0.00 C HETATM 58 C41 UNL 1 5.845 2.422 0.461 1.00 0.00 C HETATM 59 C42 UNL 1 4.669 2.752 1.137 1.00 0.00 C HETATM 60 C43 UNL 1 4.668 3.135 2.463 1.00 0.00 C HETATM 61 C44 UNL 1 5.859 3.205 3.175 1.00 0.00 C HETATM 62 O18 UNL 1 5.857 3.596 4.525 1.00 0.00 O HETATM 63 C45 UNL 1 7.024 2.883 2.520 1.00 0.00 C HETATM 64 O19 UNL 1 8.229 2.948 3.221 1.00 0.00 O HETATM 65 C46 UNL 1 6.998 2.501 1.187 1.00 0.00 C HETATM 66 C47 UNL 1 6.903 1.368 -1.540 1.00 0.00 C HETATM 67 O20 UNL 1 8.006 2.181 -1.606 1.00 0.00 O HETATM 68 C48 UNL 1 7.160 0.006 -0.945 1.00 0.00 C HETATM 69 C49 UNL 1 -3.914 2.474 1.628 1.00 0.00 C HETATM 70 O21 UNL 1 -5.008 2.336 2.461 1.00 0.00 O HETATM 71 C50 UNL 1 -3.960 3.751 0.802 1.00 0.00 C HETATM 72 O22 UNL 1 -4.045 4.871 1.596 1.00 0.00 O HETATM 73 C51 UNL 1 -5.071 3.692 -0.245 1.00 0.00 C HETATM 74 O23 UNL 1 -4.795 4.706 -1.170 1.00 0.00 O HETATM 75 H1 UNL 1 -6.791 -0.277 -1.397 1.00 0.00 H HETATM 76 H2 UNL 1 -6.391 1.349 0.324 1.00 0.00 H HETATM 77 H3 UNL 1 -7.024 1.942 -1.202 1.00 0.00 H HETATM 78 H4 UNL 1 -4.868 2.549 -2.088 1.00 0.00 H HETATM 79 H5 UNL 1 -4.660 0.624 0.873 1.00 0.00 H HETATM 80 H6 UNL 1 -4.071 -0.916 1.167 1.00 0.00 H HETATM 81 H7 UNL 1 -2.533 -1.347 -0.785 1.00 0.00 H HETATM 82 H8 UNL 1 -1.439 -3.491 -2.363 1.00 0.00 H HETATM 83 H9 UNL 1 -2.306 -6.163 -0.815 1.00 0.00 H HETATM 84 H10 UNL 1 -2.533 -7.676 1.832 1.00 0.00 H HETATM 85 H11 UNL 1 -3.657 -5.077 3.057 1.00 0.00 H HETATM 86 H12 UNL 1 -1.022 0.592 3.635 1.00 0.00 H HETATM 87 H13 UNL 1 -1.515 2.232 5.466 1.00 0.00 H HETATM 88 H14 UNL 1 -3.025 3.095 7.040 1.00 0.00 H HETATM 89 H15 UNL 1 -6.389 -0.095 5.655 1.00 0.00 H HETATM 90 H16 UNL 1 -4.921 -0.999 4.050 1.00 0.00 H HETATM 91 H17 UNL 1 1.400 -1.041 2.935 1.00 0.00 H HETATM 92 H18 UNL 1 3.616 -0.421 1.965 1.00 0.00 H HETATM 93 H19 UNL 1 -0.062 0.892 -2.666 1.00 0.00 H HETATM 94 H20 UNL 1 -2.411 -0.504 -3.227 1.00 0.00 H HETATM 95 H21 UNL 1 -3.657 -1.181 -5.233 1.00 0.00 H HETATM 96 H22 UNL 1 -3.633 -1.838 -7.539 1.00 0.00 H HETATM 97 H23 UNL 1 -0.312 -1.821 -8.456 1.00 0.00 H HETATM 98 H24 UNL 1 1.239 -0.826 -5.397 1.00 0.00 H HETATM 99 H25 UNL 1 1.672 -1.580 -3.226 1.00 0.00 H HETATM 100 H26 UNL 1 2.081 1.276 -3.510 1.00 0.00 H HETATM 101 H27 UNL 1 2.423 0.765 -1.391 1.00 0.00 H HETATM 102 H28 UNL 1 2.633 -4.162 -1.725 1.00 0.00 H HETATM 103 H29 UNL 1 4.959 -4.031 -1.454 1.00 0.00 H HETATM 104 H30 UNL 1 7.393 -3.795 -1.164 1.00 0.00 H HETATM 105 H31 UNL 1 5.491 2.951 -1.530 1.00 0.00 H HETATM 106 H32 UNL 1 3.712 2.717 0.632 1.00 0.00 H HETATM 107 H33 UNL 1 3.771 3.395 3.007 1.00 0.00 H HETATM 108 H34 UNL 1 5.016 3.827 5.005 1.00 0.00 H HETATM 109 H35 UNL 1 9.120 2.723 2.799 1.00 0.00 H HETATM 110 H36 UNL 1 7.911 2.260 0.711 1.00 0.00 H HETATM 111 H37 UNL 1 6.621 1.170 -2.622 1.00 0.00 H HETATM 112 H38 UNL 1 8.813 1.622 -1.600 1.00 0.00 H HETATM 113 H39 UNL 1 8.016 -0.436 -1.512 1.00 0.00 H HETATM 114 H40 UNL 1 7.344 0.015 0.137 1.00 0.00 H HETATM 115 H41 UNL 1 -2.971 2.597 2.244 1.00 0.00 H HETATM 116 H42 UNL 1 -5.099 3.224 2.934 1.00 0.00 H HETATM 117 H43 UNL 1 -3.015 3.816 0.199 1.00 0.00 H HETATM 118 H44 UNL 1 -3.497 5.588 1.190 1.00 0.00 H HETATM 119 H45 UNL 1 -6.059 3.866 0.185 1.00 0.00 H HETATM 120 H46 UNL 1 -5.187 4.400 -2.047 1.00 0.00 H CONECT 1 2 75 CONECT 2 3 76 77 CONECT 3 4 73 78 CONECT 4 5 CONECT 5 6 69 79 CONECT 6 7 CONECT 7 8 18 80 CONECT 8 9 34 81 CONECT 9 10 10 16 CONECT 10 11 12 CONECT 11 82 CONECT 12 13 13 83 CONECT 13 14 15 CONECT 14 84 CONECT 15 16 16 85 CONECT 16 17 CONECT 17 18 CONECT 18 19 27 CONECT 19 20 20 26 CONECT 20 21 86 CONECT 21 22 22 87 CONECT 22 23 24 CONECT 23 88 CONECT 24 25 26 26 CONECT 25 89 CONECT 26 90 CONECT 27 28 CONECT 28 29 29 34 CONECT 29 30 91 CONECT 30 31 32 32 CONECT 31 92 CONECT 32 33 47 CONECT 33 34 34 35 CONECT 35 36 CONECT 36 37 45 93 CONECT 37 38 38 44 CONECT 38 39 94 CONECT 39 40 40 95 CONECT 40 41 42 CONECT 41 96 CONECT 42 43 44 44 CONECT 43 97 CONECT 44 98 CONECT 45 46 47 99 CONECT 46 100 CONECT 47 48 101 CONECT 48 49 49 55 CONECT 49 50 51 CONECT 50 102 CONECT 51 52 52 103 CONECT 52 53 54 CONECT 53 104 CONECT 54 55 55 68 CONECT 55 56 CONECT 56 57 CONECT 57 58 66 105 CONECT 58 59 59 65 CONECT 59 60 106 CONECT 60 61 61 107 CONECT 61 62 63 CONECT 62 108 CONECT 63 64 65 65 CONECT 64 109 CONECT 65 110 CONECT 66 67 68 111 CONECT 67 112 CONECT 68 113 114 CONECT 69 70 71 115 CONECT 70 116 CONECT 71 72 73 117 CONECT 72 118 CONECT 73 74 119 CONECT 74 120 END SMILES for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)OCC1OC(OC2C3C4=C(OC2(OC2=C3C3=C(C(C(O)C(O3)C3=CC=C(O)C(O)=C3)C3=C(O)C=C(O)C5=C3OC(C(O)C5)C3=CC=C(O)C(O)=C3)C(O)=C2)C2=CC=C(O)C(O)=C2)C=C(O)C=C4O)C(O)C(O)C1O INCHI for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1)InChI=1S/C51H46O23/c52-15-34-41(65)43(67)44(68)50(69-34)72-49-40-35-28(61)10-19(53)11-32(35)73-51(49,18-3-6-23(56)27(60)9-18)74-33-14-30(63)37-39(42(66)46(71-48(37)38(33)40)17-2-5-22(55)26(59)8-17)36-29(62)13-24(57)20-12-31(64)45(70-47(20)36)16-1-4-21(54)25(58)7-16/h1-11,13-14,31,34,39-46,49-50,52-68H,12,15H2 3D Structure for HMDB0039864 (3-O-beta-D-Galactopyranosylcinnamtannin B1) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C51H46O23 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1026.8971 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1026.242987778 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-21-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19-tetrol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 5,13-bis(3,4-dihydroxyphenyl)-7-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-8-yl]-21-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19-tetrol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | OCC1OC(OC2C3C4=C(OC2(OC2=C3C3=C(C(C(O)C(O3)C3=CC=C(O)C(O)=C3)C3=C(O)C=C(O)C5=C3OC(C(O)C5)C3=CC=C(O)C(O)=C3)C(O)=C2)C2=CC=C(O)C(O)=C2)C=C(O)C=C4O)C(O)C(O)C1O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C51H46O23/c52-15-34-41(65)43(67)44(68)50(69-34)72-49-40-35-28(61)10-19(53)11-32(35)73-51(49,18-3-6-23(56)27(60)9-18)74-33-14-30(63)37-39(42(66)46(71-48(37)38(33)40)17-2-5-22(55)26(59)8-17)36-29(62)13-24(57)20-12-31(64)45(70-47(20)36)16-1-4-21(54)25(58)7-16/h1-11,13-14,31,34,39-46,49-50,52-68H,12,15H2 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | XIFRPUIQXADIQI-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Biflavonoids and polyflavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Biflavonoids and polyflavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | 185 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB019523 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 74029703 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|