Showing metabocard for Notoginsenoside L (HMDB0039942)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 01:29:12 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:24 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0039942 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Notoginsenoside L | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Notoginsenoside L belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Notoginsenoside L is an extremely weak basic (essentially neutral) compound (based on its pKa). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0039942 (Notoginsenoside L)Mrv0541 05061311312D 75 82 0 0 0 0 999 V2000 9.5571 5.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8726 4.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9020 -1.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8414 -1.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0506 1.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4736 1.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2963 0.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0020 2.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2633 3.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5079 4.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4632 1.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7922 -0.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6327 0.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4587 3.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3416 0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9872 0.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5011 -0.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7595 1.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5165 5.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9231 -0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1711 2.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4861 5.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3126 4.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9695 1.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4685 2.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8801 3.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1223 5.8140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2141 -0.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2740 4.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0723 -0.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7704 0.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6436 -0.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1884 1.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6000 2.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9402 6.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2250 0.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8797 5.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5459 7.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6676 5.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4840 0.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6109 2.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3339 6.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8498 4.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2038 0.3808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5160 6.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9020 1.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2440 3.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2147 -0.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3634 -0.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0615 0.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4902 0.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1993 0.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2141 2.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7286 5.4986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9122 -1.7098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4576 2.9121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8692 4.1024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3090 3.2963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1522 6.8632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9448 0.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6976 6.2005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3638 7.9834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2734 5.7113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4731 1.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3308 1.6464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9395 7.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6377 4.1020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1821 2.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3039 5.8850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9102 5.5694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5057 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4562 4.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9346 -0.8471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9129 0.8027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4263 2.9819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10 9 1 0 0 0 0 14 9 1 0 0 0 0 15 13 1 0 0 0 0 16 11 1 0 0 0 0 17 12 1 0 0 0 0 23 1 1 0 0 0 0 23 2 1 0 0 0 0 23 10 2 0 0 0 0 24 11 1 0 0 0 0 25 18 1 0 0 0 0 26 21 1 0 0 0 0 27 19 1 0 0 0 0 28 20 1 0 0 0 0 29 22 1 0 0 0 0 30 12 1 0 0 0 0 31 18 1 0 0 0 0 32 13 1 0 0 0 0 33 24 1 0 0 0 0 33 25 1 0 0 0 0 34 26 1 0 0 0 0 35 27 1 0 0 0 0 36 28 1 0 0 0 0 37 29 1 0 0 0 0 38 35 1 0 0 0 0 39 37 1 0 0 0 0 40 36 1 0 0 0 0 41 34 1 0 0 0 0 42 38 1 0 0 0 0 43 39 1 0 0 0 0 44 40 1 0 0 0 0 45 42 1 0 0 0 0 46 41 1 0 0 0 0 47 43 1 0 0 0 0 48 44 1 0 0 0 0 49 3 1 0 0 0 0 49 4 1 0 0 0 0 49 30 1 0 0 0 0 49 32 1 0 0 0 0 50 5 1 0 0 0 0 50 15 1 0 0 0 0 50 30 1 0 0 0 0 50 31 1 0 0 0 0 51 6 1 0 0 0 0 51 17 1 0 0 0 0 51 31 1 0 0 0 0 52 7 1 0 0 0 0 52 16 1 0 0 0 0 52 33 1 0 0 0 0 52 51 1 0 0 0 0 53 8 1 0 0 0 0 53 14 1 0 0 0 0 53 24 1 0 0 0 0 54 19 1 0 0 0 0 55 20 1 0 0 0 0 56 25 1 0 0 0 0 57 26 1 0 0 0 0 58 34 1 0 0 0 0 59 35 1 0 0 0 0 60 36 1 0 0 0 0 61 37 1 0 0 0 0 62 38 1 0 0 0 0 63 39 1 0 0 0 0 64 40 1 0 0 0 0 65 41 1 0 0 0 0 66 42 1 0 0 0 0 67 43 1 0 0 0 0 68 21 1 0 0 0 0 68 46 1 0 0 0 0 69 22 1 0 0 0 0 69 45 1 0 0 0 0 70 27 1 0 0 0 0 70 45 1 0 0 0 0 71 28 1 0 0 0 0 71 48 1 0 0 0 0 72 29 1 0 0 0 0 72 47 1 0 0 0 0 73 32 1 0 0 0 0 73 48 1 0 0 0 0 74 44 1 0 0 0 0 74 46 1 0 0 0 0 75 47 1 0 0 0 0 75 53 1 0 0 0 0 M END 3D MOL for HMDB0039942 (Notoginsenoside L)HMDB0039942 RDKit 3D Notoginsenoside L 165172 0 0 0 0 0 0 0 0999 V2000 7.9448 -1.4164 1.1206 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6215 -2.7815 1.5819 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8174 -3.7647 1.6264 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4607 -3.2395 1.9479 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1589 -2.5763 2.0188 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0304 -1.1477 1.7128 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5413 -0.6832 1.9121 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4043 -1.0323 3.4448 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4823 0.6478 1.8903 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0664 1.4394 0.9793 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9764 2.3217 1.6845 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8516 2.9112 0.8166 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1347 2.1187 0.7839 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0538 2.6735 -0.1157 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2413 1.9419 -0.1183 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3527 1.3221 -1.3499 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6350 2.1251 -2.4081 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8745 1.5740 -3.1094 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1547 2.4036 -4.1922 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7622 3.5843 -2.1492 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5417 4.2577 -2.1644 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5570 3.9006 -0.9030 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8955 4.0918 -1.2010 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4437 2.7925 0.1210 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5242 3.3569 1.3719 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3459 3.0790 -0.5715 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8844 2.1121 -1.4315 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8685 3.2233 -0.6711 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4946 2.6818 -1.9253 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0967 2.4112 0.3628 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0420 1.7535 -0.2074 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6066 -1.4685 1.1546 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8139 -1.4702 -0.3432 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4722 -1.5496 -1.0185 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6151 -2.0717 0.1037 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0429 -3.5024 0.3411 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1251 -1.1963 1.2609 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4301 -1.6549 2.4725 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5729 -0.7193 3.5479 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0576 -1.7226 2.2778 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5837 -2.3962 1.0781 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0716 -2.1548 1.0207 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5513 -2.3194 2.4496 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8095 -3.1045 0.1410 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2839 -2.9973 0.3526 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8540 -1.6098 0.3634 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9106 -1.4618 -0.5605 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1508 -1.6023 -0.0805 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6326 -2.8248 -0.6394 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6827 -2.8358 -1.9996 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4435 -3.2114 -2.7317 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7527 -3.1486 -4.1116 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3072 -1.5576 -2.5611 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3600 -0.5969 -2.8646 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1682 -1.0335 -1.4426 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0888 -0.1077 -1.7728 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2125 -0.5908 -0.3338 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8081 0.6869 -0.6078 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3463 1.6518 0.2161 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3235 2.0764 1.0848 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6111 3.3004 1.6535 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5428 4.4294 0.6495 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1959 4.7873 0.5230 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1411 3.9945 -0.6473 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8478 5.0104 -1.2863 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0346 2.7869 -0.4342 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0494 3.2249 0.4513 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9069 -0.5008 0.4749 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0907 0.4201 -0.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2346 0.4092 1.6822 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4451 -0.7757 0.5460 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7490 -0.4892 -0.7783 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2230 -0.6344 -0.6451 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8384 -1.9890 -0.1783 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1058 -2.9804 -1.3098 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7151 -0.6131 1.8285 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5620 -1.2234 0.0732 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0847 -1.3316 0.9985 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5157 -3.4708 0.8371 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2937 -3.5955 2.6150 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4290 -4.7911 1.4976 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4544 -4.3177 2.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6204 -2.8762 2.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5433 -3.1738 1.2306 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3813 -0.8111 0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5424 -0.5526 2.4978 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9040 -1.9757 3.5880 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4338 -1.1507 3.8865 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9751 -0.2105 3.9994 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6489 0.9828 0.1795 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1299 3.9119 1.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8767 1.1189 0.3168 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5549 1.9052 1.7673 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1907 1.1229 0.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8148 2.0090 -3.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7522 1.5486 -2.4609 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6166 0.5601 -3.5196 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6436 2.0658 -4.9764 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3479 4.0159 -3.0136 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1067 3.9922 -3.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1665 4.8656 -0.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3038 4.6813 -0.5248 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3333 2.1017 0.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4610 4.3500 1.3589 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7767 4.0525 -0.9600 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2257 1.7171 -2.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4997 4.2732 -0.6583 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8842 3.1845 -2.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7631 3.1568 1.1470 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4680 2.3298 -0.7635 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7557 -2.5818 1.4368 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3986 -2.3772 -0.6790 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3526 -0.6078 -0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1247 -0.5331 -1.3315 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5099 -2.2420 -1.8825 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3122 -4.2217 -0.1047 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9999 -3.7280 -0.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1675 -3.7896 1.3840 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8794 -0.1501 1.0988 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7505 -2.6266 2.9004 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1926 0.1317 3.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4181 -2.3238 3.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4204 -0.6615 2.3884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4407 -3.4907 1.1828 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1663 -3.2906 2.8800 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2265 -1.4379 3.0770 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6253 -2.3667 2.5804 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6543 -2.9526 -0.9445 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5014 -4.1335 0.3863 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7667 -3.5671 -0.4654 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5149 -3.6087 1.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4686 -1.6420 1.3279 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1940 -1.8336 1.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4469 -3.6338 -2.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5846 -2.5398 -2.5875 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1977 -4.2757 -2.5421 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0722 -2.6330 -4.6202 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9513 -1.7549 -3.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8295 0.0749 -3.4475 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7216 -1.9312 -1.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9512 -0.2909 -1.3397 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9377 -0.5397 0.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0667 1.1301 0.9079 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5493 3.3253 2.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7998 3.4905 2.4048 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1221 5.2695 1.0422 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8754 5.0397 1.4210 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3246 3.6776 -1.3284 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8397 4.8929 -1.1518 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5593 2.4877 -1.3379 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4104 2.4636 0.9854 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6966 0.0183 -1.6624 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6324 1.4247 -0.4867 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1706 0.6263 -0.8114 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7254 1.3350 1.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2901 0.7121 2.2148 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9072 -0.1315 2.3812 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9478 -0.0691 1.2457 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0449 -1.1366 -1.5951 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8577 0.6087 -1.0261 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8767 0.1942 -0.0363 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8586 -0.4770 -1.6976 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6764 -2.5207 -2.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1476 -3.2964 -1.8245 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5168 -3.9401 -0.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 12 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 7 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 64 66 1 0 66 67 1 0 46 68 1 0 68 69 1 0 68 70 1 0 68 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 30 10 1 0 37 32 1 0 74 41 1 0 24 15 1 0 74 35 1 0 71 42 1 0 57 48 1 0 66 59 1 0 1 76 1 0 1 77 1 0 1 78 1 0 3 79 1 0 3 80 1 0 3 81 1 0 4 82 1 0 5 83 1 0 5 84 1 0 6 85 1 0 6 86 1 0 8 87 1 0 8 88 1 0 8 89 1 0 10 90 1 0 12 91 1 0 13 92 1 0 13 93 1 0 15 94 1 0 17 95 1 0 18 96 1 0 18 97 1 0 19 98 1 0 20 99 1 0 21100 1 0 22101 1 0 23102 1 0 24103 1 0 25104 1 0 26105 1 0 27106 1 0 28107 1 0 29108 1 0 30109 1 0 31110 1 0 32111 1 0 33112 1 0 33113 1 0 34114 1 0 34115 1 0 36116 1 0 36117 1 0 36118 1 0 37119 1 0 38120 1 0 39121 1 0 40122 1 0 40123 1 0 41124 1 0 43125 1 0 43126 1 0 43127 1 0 44128 1 0 44129 1 0 45130 1 0 45131 1 0 46132 1 0 48133 1 0 50134 1 0 51135 1 0 51136 1 0 52137 1 0 53138 1 0 54139 1 0 55140 1 0 56141 1 0 57142 1 0 59143 1 0 61144 1 0 61145 1 0 62146 1 0 63147 1 0 64148 1 0 65149 1 0 66150 1 0 67151 1 0 69152 1 0 69153 1 0 69154 1 0 70155 1 0 70156 1 0 70157 1 0 71158 1 0 72159 1 0 72160 1 0 73161 1 0 73162 1 0 75163 1 0 75164 1 0 75165 1 0 M END 3D SDF for HMDB0039942 (Notoginsenoside L)Mrv0541 05061311312D 75 82 0 0 0 0 999 V2000 9.5571 5.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8726 4.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9020 -1.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8414 -1.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0506 1.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4736 1.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2963 0.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0020 2.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2633 3.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5079 4.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4632 1.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7922 -0.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6327 0.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4587 3.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3416 0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9872 0.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5011 -0.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7595 1.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5165 5.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9231 -0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1711 2.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4861 5.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3126 4.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9695 1.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4685 2.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8801 3.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1223 5.8140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2141 -0.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2740 4.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0723 -0.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7704 0.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6436 -0.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1884 1.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6000 2.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9402 6.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2250 0.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8797 5.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5459 7.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6676 5.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4840 0.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6109 2.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3339 6.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8498 4.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2038 0.3808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5160 6.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9020 1.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2440 3.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2147 -0.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3634 -0.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0615 0.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4902 0.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1993 0.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2141 2.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7286 5.4986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9122 -1.7098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4576 2.9121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8692 4.1024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3090 3.2963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1522 6.8632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9448 0.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6976 6.2005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3638 7.9834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2734 5.7113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4731 1.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3308 1.6464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9395 7.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6377 4.1020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1821 2.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3039 5.8850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9102 5.5694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5057 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4562 4.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9346 -0.8471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9129 0.8027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4263 2.9819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10 9 1 0 0 0 0 14 9 1 0 0 0 0 15 13 1 0 0 0 0 16 11 1 0 0 0 0 17 12 1 0 0 0 0 23 1 1 0 0 0 0 23 2 1 0 0 0 0 23 10 2 0 0 0 0 24 11 1 0 0 0 0 25 18 1 0 0 0 0 26 21 1 0 0 0 0 27 19 1 0 0 0 0 28 20 1 0 0 0 0 29 22 1 0 0 0 0 30 12 1 0 0 0 0 31 18 1 0 0 0 0 32 13 1 0 0 0 0 33 24 1 0 0 0 0 33 25 1 0 0 0 0 34 26 1 0 0 0 0 35 27 1 0 0 0 0 36 28 1 0 0 0 0 37 29 1 0 0 0 0 38 35 1 0 0 0 0 39 37 1 0 0 0 0 40 36 1 0 0 0 0 41 34 1 0 0 0 0 42 38 1 0 0 0 0 43 39 1 0 0 0 0 44 40 1 0 0 0 0 45 42 1 0 0 0 0 46 41 1 0 0 0 0 47 43 1 0 0 0 0 48 44 1 0 0 0 0 49 3 1 0 0 0 0 49 4 1 0 0 0 0 49 30 1 0 0 0 0 49 32 1 0 0 0 0 50 5 1 0 0 0 0 50 15 1 0 0 0 0 50 30 1 0 0 0 0 50 31 1 0 0 0 0 51 6 1 0 0 0 0 51 17 1 0 0 0 0 51 31 1 0 0 0 0 52 7 1 0 0 0 0 52 16 1 0 0 0 0 52 33 1 0 0 0 0 52 51 1 0 0 0 0 53 8 1 0 0 0 0 53 14 1 0 0 0 0 53 24 1 0 0 0 0 54 19 1 0 0 0 0 55 20 1 0 0 0 0 56 25 1 0 0 0 0 57 26 1 0 0 0 0 58 34 1 0 0 0 0 59 35 1 0 0 0 0 60 36 1 0 0 0 0 61 37 1 0 0 0 0 62 38 1 0 0 0 0 63 39 1 0 0 0 0 64 40 1 0 0 0 0 65 41 1 0 0 0 0 66 42 1 0 0 0 0 67 43 1 0 0 0 0 68 21 1 0 0 0 0 68 46 1 0 0 0 0 69 22 1 0 0 0 0 69 45 1 0 0 0 0 70 27 1 0 0 0 0 70 45 1 0 0 0 0 71 28 1 0 0 0 0 71 48 1 0 0 0 0 72 29 1 0 0 0 0 72 47 1 0 0 0 0 73 32 1 0 0 0 0 73 48 1 0 0 0 0 74 44 1 0 0 0 0 74 46 1 0 0 0 0 75 47 1 0 0 0 0 75 53 1 0 0 0 0 M END > <DATABASE_ID> HMDB0039942 > <DATABASE_NAME> hmdb > <SMILES> CC(C)=CCCC(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)C(C)(C)C3CCC21C > <INCHI_IDENTIFIER> InChI=1S/C53H90O22/c1-23(2)10-9-14-53(8,75-47-43(67)39(63)37(61)29(72-47)22-69-45-42(66)38(62)35(59)27(19-54)70-45)24-11-16-52(7)33(24)25(56)18-31-50(5)15-13-32(49(3,4)30(50)12-17-51(31,52)6)73-48-44(40(64)36(60)28(20-55)71-48)74-46-41(65)34(58)26(57)21-68-46/h10,24-48,54-67H,9,11-22H2,1-8H3 > <INCHI_KEY> MGEVFIHLEFXNMC-UHFFFAOYSA-N > <FORMULA> C53H90O22 > <MOLECULAR_WEIGHT> 1079.2685 > <EXACT_MASS> 1078.592374564 > <JCHEM_ACCEPTOR_COUNT> 22 > <JCHEM_AVERAGE_POLARIZABILITY> 115.79877289492757 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 14 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-{[2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol > <ALOGPS_LOGP> -0.03 > <JCHEM_LOGP> -0.9210698356666672 > <ALOGPS_LOGS> -3.15 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.186236912370648 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.75272564862408 > <JCHEM_PKA_STRONGEST_BASIC> -3.648674370961553 > <JCHEM_POLAR_SURFACE_AREA> 357.0600000000001 > <JCHEM_REFRACTIVITY> 260.92660000000006 > <JCHEM_ROTATABLE_BOND_COUNT> 15 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 7.62e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-{[2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0039942 (Notoginsenoside L)HMDB0039942 RDKit 3D Notoginsenoside L 165172 0 0 0 0 0 0 0 0999 V2000 7.9448 -1.4164 1.1206 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6215 -2.7815 1.5819 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8174 -3.7647 1.6264 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4607 -3.2395 1.9479 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1589 -2.5763 2.0188 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0304 -1.1477 1.7128 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5413 -0.6832 1.9121 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4043 -1.0323 3.4448 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4823 0.6478 1.8903 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0664 1.4394 0.9793 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9764 2.3217 1.6845 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8516 2.9112 0.8166 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1347 2.1187 0.7839 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0538 2.6735 -0.1157 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2413 1.9419 -0.1183 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3527 1.3221 -1.3499 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6350 2.1251 -2.4081 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8745 1.5740 -3.1094 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1547 2.4036 -4.1922 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7622 3.5843 -2.1492 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5417 4.2577 -2.1644 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5570 3.9006 -0.9030 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8955 4.0918 -1.2010 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4437 2.7925 0.1210 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5242 3.3569 1.3719 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3459 3.0790 -0.5715 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8844 2.1121 -1.4315 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8685 3.2233 -0.6711 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4946 2.6818 -1.9253 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0967 2.4112 0.3628 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0420 1.7535 -0.2074 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6066 -1.4685 1.1546 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8139 -1.4702 -0.3432 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4722 -1.5496 -1.0185 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6151 -2.0717 0.1037 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0429 -3.5024 0.3411 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1251 -1.1963 1.2609 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4301 -1.6549 2.4725 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5729 -0.7193 3.5479 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0576 -1.7226 2.2778 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5837 -2.3962 1.0781 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0716 -2.1548 1.0207 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5513 -2.3194 2.4496 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8095 -3.1045 0.1410 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2839 -2.9973 0.3526 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8540 -1.6098 0.3634 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9106 -1.4618 -0.5605 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1508 -1.6023 -0.0805 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6326 -2.8248 -0.6394 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6827 -2.8358 -1.9996 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4435 -3.2114 -2.7317 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7527 -3.1486 -4.1116 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3072 -1.5576 -2.5611 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3600 -0.5969 -2.8646 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1682 -1.0335 -1.4426 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0888 -0.1077 -1.7728 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2125 -0.5908 -0.3338 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8081 0.6869 -0.6078 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3463 1.6518 0.2161 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3235 2.0764 1.0848 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6111 3.3004 1.6535 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5428 4.4294 0.6495 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1959 4.7873 0.5230 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1411 3.9945 -0.6473 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8478 5.0104 -1.2863 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0346 2.7869 -0.4342 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0494 3.2249 0.4513 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9069 -0.5008 0.4749 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0907 0.4201 -0.7300 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2346 0.4092 1.6822 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4451 -0.7757 0.5460 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7490 -0.4892 -0.7783 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2230 -0.6344 -0.6451 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8384 -1.9890 -0.1783 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1058 -2.9804 -1.3098 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7151 -0.6131 1.8285 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5620 -1.2234 0.0732 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0847 -1.3316 0.9985 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5157 -3.4708 0.8371 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2937 -3.5955 2.6150 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4290 -4.7911 1.4976 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4544 -4.3177 2.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6204 -2.8762 2.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5433 -3.1738 1.2306 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3813 -0.8111 0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5424 -0.5526 2.4978 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9040 -1.9757 3.5880 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4338 -1.1507 3.8865 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9751 -0.2105 3.9994 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6489 0.9828 0.1795 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1299 3.9119 1.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8767 1.1189 0.3168 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5549 1.9052 1.7673 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1907 1.1229 0.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8148 2.0090 -3.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7522 1.5486 -2.4609 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6166 0.5601 -3.5196 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6436 2.0658 -4.9764 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3479 4.0159 -3.0136 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1067 3.9922 -3.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1665 4.8656 -0.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3038 4.6813 -0.5248 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3333 2.1017 0.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4610 4.3500 1.3589 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7767 4.0525 -0.9600 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2257 1.7171 -2.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4997 4.2732 -0.6583 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8842 3.1845 -2.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7631 3.1568 1.1470 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4680 2.3298 -0.7635 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7557 -2.5818 1.4368 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3986 -2.3772 -0.6790 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3526 -0.6078 -0.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1247 -0.5331 -1.3315 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5099 -2.2420 -1.8825 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3122 -4.2217 -0.1047 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9999 -3.7280 -0.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1675 -3.7896 1.3840 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8794 -0.1501 1.0988 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7505 -2.6266 2.9004 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1926 0.1317 3.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4181 -2.3238 3.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4204 -0.6615 2.3884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4407 -3.4907 1.1828 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1663 -3.2906 2.8800 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2265 -1.4379 3.0770 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6253 -2.3667 2.5804 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6543 -2.9526 -0.9445 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5014 -4.1335 0.3863 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7667 -3.5671 -0.4654 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5149 -3.6087 1.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4686 -1.6420 1.3279 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1940 -1.8336 1.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4469 -3.6338 -2.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5846 -2.5398 -2.5875 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1977 -4.2757 -2.5421 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0722 -2.6330 -4.6202 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9513 -1.7549 -3.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8295 0.0749 -3.4475 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7216 -1.9312 -1.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9512 -0.2909 -1.3397 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9377 -0.5397 0.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0667 1.1301 0.9079 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5493 3.3253 2.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7998 3.4905 2.4048 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1221 5.2695 1.0422 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8754 5.0397 1.4210 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3246 3.6776 -1.3284 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8397 4.8929 -1.1518 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5593 2.4877 -1.3379 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4104 2.4636 0.9854 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6966 0.0183 -1.6624 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6324 1.4247 -0.4867 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1706 0.6263 -0.8114 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7254 1.3350 1.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2901 0.7121 2.2148 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9072 -0.1315 2.3812 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9478 -0.0691 1.2457 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0449 -1.1366 -1.5951 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8577 0.6087 -1.0261 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8767 0.1942 -0.0363 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8586 -0.4770 -1.6976 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6764 -2.5207 -2.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1476 -3.2964 -1.8245 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5168 -3.9401 -0.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 12 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 7 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 64 66 1 0 66 67 1 0 46 68 1 0 68 69 1 0 68 70 1 0 68 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 30 10 1 0 37 32 1 0 74 41 1 0 24 15 1 0 74 35 1 0 71 42 1 0 57 48 1 0 66 59 1 0 1 76 1 0 1 77 1 0 1 78 1 0 3 79 1 0 3 80 1 0 3 81 1 0 4 82 1 0 5 83 1 0 5 84 1 0 6 85 1 0 6 86 1 0 8 87 1 0 8 88 1 0 8 89 1 0 10 90 1 0 12 91 1 0 13 92 1 0 13 93 1 0 15 94 1 0 17 95 1 0 18 96 1 0 18 97 1 0 19 98 1 0 20 99 1 0 21100 1 0 22101 1 0 23102 1 0 24103 1 0 25104 1 0 26105 1 0 27106 1 0 28107 1 0 29108 1 0 30109 1 0 31110 1 0 32111 1 0 33112 1 0 33113 1 0 34114 1 0 34115 1 0 36116 1 0 36117 1 0 36118 1 0 37119 1 0 38120 1 0 39121 1 0 40122 1 0 40123 1 0 41124 1 0 43125 1 0 43126 1 0 43127 1 0 44128 1 0 44129 1 0 45130 1 0 45131 1 0 46132 1 0 48133 1 0 50134 1 0 51135 1 0 51136 1 0 52137 1 0 53138 1 0 54139 1 0 55140 1 0 56141 1 0 57142 1 0 59143 1 0 61144 1 0 61145 1 0 62146 1 0 63147 1 0 64148 1 0 65149 1 0 66150 1 0 67151 1 0 69152 1 0 69153 1 0 69154 1 0 70155 1 0 70156 1 0 70157 1 0 71158 1 0 72159 1 0 72160 1 0 73161 1 0 73162 1 0 75163 1 0 75164 1 0 75165 1 0 M END PDB for HMDB0039942 (Notoginsenoside L)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 17.840 10.202 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 18.429 7.601 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 7.284 -2.713 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 5.304 -2.739 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 7.561 2.321 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 10.217 2.319 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 11.753 0.074 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 14.937 4.653 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 15.425 6.921 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 15.881 8.391 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 13.931 2.405 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 8.945 -1.511 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 4.914 0.746 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 13.923 6.580 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 6.238 1.533 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 13.043 1.147 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 10.269 -0.724 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 8.884 3.109 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 2.831 9.807 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -1.723 -1.652 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 2.186 5.330 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 8.374 9.483 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 17.384 8.731 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 13.010 3.639 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 10.208 3.896 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 3.510 6.118 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 3.962 10.853 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -0.400 -0.864 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 9.845 9.027 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 7.602 -0.759 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 8.905 1.569 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 4.935 -0.794 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 11.552 3.144 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 4.853 5.366 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 3.622 12.355 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -0.420 0.676 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 10.975 10.072 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 4.752 13.400 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 12.446 9.616 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 0.903 1.463 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 4.874 3.826 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 6.223 12.944 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 12.786 8.114 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 2.247 0.711 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 6.563 11.442 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 3.550 3.038 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 11.655 7.068 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 2.267 -0.829 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 6.278 -1.546 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 7.581 0.781 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 10.248 0.816 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 11.572 1.604 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 13.466 5.110 0.000 0.00 0.00 C+0 HETATM 54 O UNK 0 1.360 10.264 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -1.703 -3.192 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 10.188 5.436 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 3.489 7.658 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 6.177 6.153 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 2.151 12.811 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 -1.764 1.428 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 10.636 11.574 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 4.412 14.902 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 13.577 10.661 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 0.883 3.003 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 6.217 3.073 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 7.354 13.989 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 14.257 7.657 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 2.207 3.790 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 8.034 10.985 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 5.432 10.396 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 0.944 -1.617 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 10.185 7.525 0.000 0.00 0.00 O+0 HETATM 73 O UNK 0 3.611 -1.581 0.000 0.00 0.00 O+0 HETATM 74 O UNK 0 3.571 1.498 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 11.996 5.566 0.000 0.00 0.00 O+0 CONECT 1 23 CONECT 2 23 CONECT 3 49 CONECT 4 49 CONECT 5 50 CONECT 6 51 CONECT 7 52 CONECT 8 53 CONECT 9 10 14 CONECT 10 9 23 CONECT 11 16 24 CONECT 12 17 30 CONECT 13 15 32 CONECT 14 9 53 CONECT 15 13 50 CONECT 16 11 52 CONECT 17 12 51 CONECT 18 25 31 CONECT 19 27 54 CONECT 20 28 55 CONECT 21 26 68 CONECT 22 29 69 CONECT 23 1 2 10 CONECT 24 11 33 53 CONECT 25 18 33 56 CONECT 26 21 34 57 CONECT 27 19 35 70 CONECT 28 20 36 71 CONECT 29 22 37 72 CONECT 30 12 49 50 CONECT 31 18 50 51 CONECT 32 13 49 73 CONECT 33 24 25 52 CONECT 34 26 41 58 CONECT 35 27 38 59 CONECT 36 28 40 60 CONECT 37 29 39 61 CONECT 38 35 42 62 CONECT 39 37 43 63 CONECT 40 36 44 64 CONECT 41 34 46 65 CONECT 42 38 45 66 CONECT 43 39 47 67 CONECT 44 40 48 74 CONECT 45 42 69 70 CONECT 46 41 68 74 CONECT 47 43 72 75 CONECT 48 44 71 73 CONECT 49 3 4 30 32 CONECT 50 5 15 30 31 CONECT 51 6 17 31 52 CONECT 52 7 16 33 51 CONECT 53 8 14 24 75 CONECT 54 19 CONECT 55 20 CONECT 56 25 CONECT 57 26 CONECT 58 34 CONECT 59 35 CONECT 60 36 CONECT 61 37 CONECT 62 38 CONECT 63 39 CONECT 64 40 CONECT 65 41 CONECT 66 42 CONECT 67 43 CONECT 68 21 46 CONECT 69 22 45 CONECT 70 27 45 CONECT 71 28 48 CONECT 72 29 47 CONECT 73 32 48 CONECT 74 44 46 CONECT 75 47 53 MASTER 0 0 0 0 0 0 0 0 75 0 164 0 END 3D PDB for HMDB0039942 (Notoginsenoside L)COMPND HMDB0039942 HETATM 1 C1 UNL 1 7.945 -1.416 1.121 1.00 0.00 C HETATM 2 C2 UNL 1 7.622 -2.781 1.582 1.00 0.00 C HETATM 3 C3 UNL 1 8.817 -3.765 1.626 1.00 0.00 C HETATM 4 C4 UNL 1 6.461 -3.239 1.948 1.00 0.00 C HETATM 5 C5 UNL 1 5.159 -2.576 2.019 1.00 0.00 C HETATM 6 C6 UNL 1 5.030 -1.148 1.713 1.00 0.00 C HETATM 7 C7 UNL 1 3.541 -0.683 1.912 1.00 0.00 C HETATM 8 C8 UNL 1 3.404 -1.032 3.445 1.00 0.00 C HETATM 9 O1 UNL 1 3.482 0.648 1.890 1.00 0.00 O HETATM 10 C9 UNL 1 4.066 1.439 0.979 1.00 0.00 C HETATM 11 O2 UNL 1 4.976 2.322 1.685 1.00 0.00 O HETATM 12 C10 UNL 1 5.852 2.911 0.817 1.00 0.00 C HETATM 13 C11 UNL 1 7.135 2.119 0.784 1.00 0.00 C HETATM 14 O3 UNL 1 8.054 2.673 -0.116 1.00 0.00 O HETATM 15 C12 UNL 1 9.241 1.942 -0.118 1.00 0.00 C HETATM 16 O4 UNL 1 9.353 1.322 -1.350 1.00 0.00 O HETATM 17 C13 UNL 1 9.635 2.125 -2.408 1.00 0.00 C HETATM 18 C14 UNL 1 10.875 1.574 -3.109 1.00 0.00 C HETATM 19 O5 UNL 1 11.155 2.404 -4.192 1.00 0.00 O HETATM 20 C15 UNL 1 9.762 3.584 -2.149 1.00 0.00 C HETATM 21 O6 UNL 1 8.542 4.258 -2.164 1.00 0.00 O HETATM 22 C16 UNL 1 10.557 3.901 -0.903 1.00 0.00 C HETATM 23 O7 UNL 1 11.896 4.092 -1.201 1.00 0.00 O HETATM 24 C17 UNL 1 10.444 2.792 0.121 1.00 0.00 C HETATM 25 O8 UNL 1 10.524 3.357 1.372 1.00 0.00 O HETATM 26 C18 UNL 1 5.346 3.079 -0.572 1.00 0.00 C HETATM 27 O9 UNL 1 5.884 2.112 -1.431 1.00 0.00 O HETATM 28 C19 UNL 1 3.869 3.223 -0.671 1.00 0.00 C HETATM 29 O10 UNL 1 3.495 2.682 -1.925 1.00 0.00 O HETATM 30 C20 UNL 1 3.097 2.411 0.363 1.00 0.00 C HETATM 31 O11 UNL 1 2.042 1.754 -0.207 1.00 0.00 O HETATM 32 C21 UNL 1 2.607 -1.468 1.155 1.00 0.00 C HETATM 33 C22 UNL 1 2.814 -1.470 -0.343 1.00 0.00 C HETATM 34 C23 UNL 1 1.472 -1.550 -1.018 1.00 0.00 C HETATM 35 C24 UNL 1 0.615 -2.072 0.104 1.00 0.00 C HETATM 36 C25 UNL 1 1.043 -3.502 0.341 1.00 0.00 C HETATM 37 C26 UNL 1 1.125 -1.196 1.261 1.00 0.00 C HETATM 38 C27 UNL 1 0.430 -1.655 2.472 1.00 0.00 C HETATM 39 O12 UNL 1 0.573 -0.719 3.548 1.00 0.00 O HETATM 40 C28 UNL 1 -1.058 -1.723 2.278 1.00 0.00 C HETATM 41 C29 UNL 1 -1.584 -2.396 1.078 1.00 0.00 C HETATM 42 C30 UNL 1 -3.072 -2.155 1.021 1.00 0.00 C HETATM 43 C31 UNL 1 -3.551 -2.319 2.450 1.00 0.00 C HETATM 44 C32 UNL 1 -3.809 -3.105 0.141 1.00 0.00 C HETATM 45 C33 UNL 1 -5.284 -2.997 0.353 1.00 0.00 C HETATM 46 C34 UNL 1 -5.854 -1.610 0.363 1.00 0.00 C HETATM 47 O13 UNL 1 -6.911 -1.462 -0.560 1.00 0.00 O HETATM 48 C35 UNL 1 -8.151 -1.602 -0.081 1.00 0.00 C HETATM 49 O14 UNL 1 -8.633 -2.825 -0.639 1.00 0.00 O HETATM 50 C36 UNL 1 -8.683 -2.836 -2.000 1.00 0.00 C HETATM 51 C37 UNL 1 -7.443 -3.211 -2.732 1.00 0.00 C HETATM 52 O15 UNL 1 -7.753 -3.149 -4.112 1.00 0.00 O HETATM 53 C38 UNL 1 -9.307 -1.558 -2.561 1.00 0.00 C HETATM 54 O16 UNL 1 -8.360 -0.597 -2.865 1.00 0.00 O HETATM 55 C39 UNL 1 -10.168 -1.033 -1.443 1.00 0.00 C HETATM 56 O17 UNL 1 -11.089 -0.108 -1.773 1.00 0.00 O HETATM 57 C40 UNL 1 -9.213 -0.591 -0.334 1.00 0.00 C HETATM 58 O18 UNL 1 -8.808 0.687 -0.608 1.00 0.00 O HETATM 59 C41 UNL 1 -9.346 1.652 0.216 1.00 0.00 C HETATM 60 O19 UNL 1 -8.324 2.076 1.085 1.00 0.00 O HETATM 61 C42 UNL 1 -8.611 3.300 1.653 1.00 0.00 C HETATM 62 C43 UNL 1 -8.543 4.429 0.650 1.00 0.00 C HETATM 63 O20 UNL 1 -7.196 4.787 0.523 1.00 0.00 O HETATM 64 C44 UNL 1 -9.141 3.995 -0.647 1.00 0.00 C HETATM 65 O21 UNL 1 -9.848 5.010 -1.286 1.00 0.00 O HETATM 66 C45 UNL 1 -10.035 2.787 -0.434 1.00 0.00 C HETATM 67 O22 UNL 1 -11.049 3.225 0.451 1.00 0.00 O HETATM 68 C46 UNL 1 -4.907 -0.501 0.475 1.00 0.00 C HETATM 69 C47 UNL 1 -5.091 0.420 -0.730 1.00 0.00 C HETATM 70 C48 UNL 1 -5.235 0.409 1.682 1.00 0.00 C HETATM 71 C49 UNL 1 -3.445 -0.776 0.546 1.00 0.00 C HETATM 72 C50 UNL 1 -2.749 -0.489 -0.778 1.00 0.00 C HETATM 73 C51 UNL 1 -1.223 -0.634 -0.645 1.00 0.00 C HETATM 74 C52 UNL 1 -0.838 -1.989 -0.178 1.00 0.00 C HETATM 75 C53 UNL 1 -1.106 -2.980 -1.310 1.00 0.00 C HETATM 76 H1 UNL 1 7.715 -0.613 1.828 1.00 0.00 H HETATM 77 H2 UNL 1 7.562 -1.223 0.073 1.00 0.00 H HETATM 78 H3 UNL 1 9.085 -1.332 0.999 1.00 0.00 H HETATM 79 H4 UNL 1 9.516 -3.471 0.837 1.00 0.00 H HETATM 80 H5 UNL 1 9.294 -3.596 2.615 1.00 0.00 H HETATM 81 H6 UNL 1 8.429 -4.791 1.498 1.00 0.00 H HETATM 82 H7 UNL 1 6.454 -4.318 2.263 1.00 0.00 H HETATM 83 H8 UNL 1 4.620 -2.876 2.975 1.00 0.00 H HETATM 84 H9 UNL 1 4.543 -3.174 1.231 1.00 0.00 H HETATM 85 H10 UNL 1 5.381 -0.811 0.745 1.00 0.00 H HETATM 86 H11 UNL 1 5.542 -0.553 2.498 1.00 0.00 H HETATM 87 H12 UNL 1 2.904 -1.976 3.588 1.00 0.00 H HETATM 88 H13 UNL 1 4.434 -1.151 3.886 1.00 0.00 H HETATM 89 H14 UNL 1 2.975 -0.210 3.999 1.00 0.00 H HETATM 90 H15 UNL 1 4.649 0.983 0.180 1.00 0.00 H HETATM 91 H16 UNL 1 6.130 3.912 1.255 1.00 0.00 H HETATM 92 H17 UNL 1 6.877 1.119 0.317 1.00 0.00 H HETATM 93 H18 UNL 1 7.555 1.905 1.767 1.00 0.00 H HETATM 94 H19 UNL 1 9.191 1.123 0.639 1.00 0.00 H HETATM 95 H20 UNL 1 8.815 2.009 -3.180 1.00 0.00 H HETATM 96 H21 UNL 1 11.752 1.549 -2.461 1.00 0.00 H HETATM 97 H22 UNL 1 10.617 0.560 -3.520 1.00 0.00 H HETATM 98 H23 UNL 1 10.644 2.066 -4.976 1.00 0.00 H HETATM 99 H24 UNL 1 10.348 4.016 -3.014 1.00 0.00 H HETATM 100 H25 UNL 1 8.107 3.992 -3.036 1.00 0.00 H HETATM 101 H26 UNL 1 10.167 4.866 -0.503 1.00 0.00 H HETATM 102 H27 UNL 1 12.304 4.681 -0.525 1.00 0.00 H HETATM 103 H28 UNL 1 11.333 2.102 0.036 1.00 0.00 H HETATM 104 H29 UNL 1 10.461 4.350 1.359 1.00 0.00 H HETATM 105 H30 UNL 1 5.777 4.053 -0.960 1.00 0.00 H HETATM 106 H31 UNL 1 5.226 1.717 -2.041 1.00 0.00 H HETATM 107 H32 UNL 1 3.500 4.273 -0.658 1.00 0.00 H HETATM 108 H33 UNL 1 3.884 3.184 -2.680 1.00 0.00 H HETATM 109 H34 UNL 1 2.763 3.157 1.147 1.00 0.00 H HETATM 110 H35 UNL 1 1.468 2.330 -0.764 1.00 0.00 H HETATM 111 H36 UNL 1 2.756 -2.582 1.437 1.00 0.00 H HETATM 112 H37 UNL 1 3.399 -2.377 -0.679 1.00 0.00 H HETATM 113 H38 UNL 1 3.353 -0.608 -0.745 1.00 0.00 H HETATM 114 H39 UNL 1 1.125 -0.533 -1.332 1.00 0.00 H HETATM 115 H40 UNL 1 1.510 -2.242 -1.882 1.00 0.00 H HETATM 116 H41 UNL 1 0.312 -4.222 -0.105 1.00 0.00 H HETATM 117 H42 UNL 1 2.000 -3.728 -0.170 1.00 0.00 H HETATM 118 H43 UNL 1 1.168 -3.790 1.384 1.00 0.00 H HETATM 119 H44 UNL 1 0.879 -0.150 1.099 1.00 0.00 H HETATM 120 H45 UNL 1 0.750 -2.627 2.900 1.00 0.00 H HETATM 121 H46 UNL 1 0.193 0.132 3.282 1.00 0.00 H HETATM 122 H47 UNL 1 -1.418 -2.324 3.174 1.00 0.00 H HETATM 123 H48 UNL 1 -1.420 -0.662 2.388 1.00 0.00 H HETATM 124 H49 UNL 1 -1.441 -3.491 1.183 1.00 0.00 H HETATM 125 H50 UNL 1 -3.166 -3.291 2.880 1.00 0.00 H HETATM 126 H51 UNL 1 -3.226 -1.438 3.077 1.00 0.00 H HETATM 127 H52 UNL 1 -4.625 -2.367 2.580 1.00 0.00 H HETATM 128 H53 UNL 1 -3.654 -2.953 -0.944 1.00 0.00 H HETATM 129 H54 UNL 1 -3.501 -4.133 0.386 1.00 0.00 H HETATM 130 H55 UNL 1 -5.767 -3.567 -0.465 1.00 0.00 H HETATM 131 H56 UNL 1 -5.515 -3.609 1.257 1.00 0.00 H HETATM 132 H57 UNL 1 -6.469 -1.642 1.328 1.00 0.00 H HETATM 133 H58 UNL 1 -8.194 -1.834 1.024 1.00 0.00 H HETATM 134 H59 UNL 1 -9.447 -3.634 -2.263 1.00 0.00 H HETATM 135 H60 UNL 1 -6.585 -2.540 -2.587 1.00 0.00 H HETATM 136 H61 UNL 1 -7.198 -4.276 -2.542 1.00 0.00 H HETATM 137 H62 UNL 1 -7.072 -2.633 -4.620 1.00 0.00 H HETATM 138 H63 UNL 1 -9.951 -1.755 -3.428 1.00 0.00 H HETATM 139 H64 UNL 1 -8.830 0.075 -3.448 1.00 0.00 H HETATM 140 H65 UNL 1 -10.722 -1.931 -1.025 1.00 0.00 H HETATM 141 H66 UNL 1 -11.951 -0.291 -1.340 1.00 0.00 H HETATM 142 H67 UNL 1 -9.938 -0.540 0.562 1.00 0.00 H HETATM 143 H68 UNL 1 -10.067 1.130 0.908 1.00 0.00 H HETATM 144 H69 UNL 1 -9.549 3.325 2.233 1.00 0.00 H HETATM 145 H70 UNL 1 -7.800 3.491 2.405 1.00 0.00 H HETATM 146 H71 UNL 1 -9.122 5.269 1.042 1.00 0.00 H HETATM 147 H72 UNL 1 -6.875 5.040 1.421 1.00 0.00 H HETATM 148 H73 UNL 1 -8.325 3.678 -1.328 1.00 0.00 H HETATM 149 H74 UNL 1 -10.840 4.893 -1.152 1.00 0.00 H HETATM 150 H75 UNL 1 -10.559 2.488 -1.338 1.00 0.00 H HETATM 151 H76 UNL 1 -11.410 2.464 0.985 1.00 0.00 H HETATM 152 H77 UNL 1 -4.697 0.018 -1.662 1.00 0.00 H HETATM 153 H78 UNL 1 -4.632 1.425 -0.487 1.00 0.00 H HETATM 154 H79 UNL 1 -6.171 0.626 -0.811 1.00 0.00 H HETATM 155 H80 UNL 1 -5.725 1.335 1.398 1.00 0.00 H HETATM 156 H81 UNL 1 -4.290 0.712 2.215 1.00 0.00 H HETATM 157 H82 UNL 1 -5.907 -0.131 2.381 1.00 0.00 H HETATM 158 H83 UNL 1 -2.948 -0.069 1.246 1.00 0.00 H HETATM 159 H84 UNL 1 -3.045 -1.137 -1.595 1.00 0.00 H HETATM 160 H85 UNL 1 -2.858 0.609 -1.026 1.00 0.00 H HETATM 161 H86 UNL 1 -0.877 0.194 -0.036 1.00 0.00 H HETATM 162 H87 UNL 1 -0.859 -0.477 -1.698 1.00 0.00 H HETATM 163 H88 UNL 1 -1.676 -2.521 -2.148 1.00 0.00 H HETATM 164 H89 UNL 1 -0.148 -3.296 -1.824 1.00 0.00 H HETATM 165 H90 UNL 1 -1.517 -3.940 -0.949 1.00 0.00 H CONECT 1 2 76 77 78 CONECT 2 3 4 4 CONECT 3 79 80 81 CONECT 4 5 82 CONECT 5 6 83 84 CONECT 6 7 85 86 CONECT 7 8 9 32 CONECT 8 87 88 89 CONECT 9 10 CONECT 10 11 30 90 CONECT 11 12 CONECT 12 13 26 91 CONECT 13 14 92 93 CONECT 14 15 CONECT 15 16 24 94 CONECT 16 17 CONECT 17 18 20 95 CONECT 18 19 96 97 CONECT 19 98 CONECT 20 21 22 99 CONECT 21 100 CONECT 22 23 24 101 CONECT 23 102 CONECT 24 25 103 CONECT 25 104 CONECT 26 27 28 105 CONECT 27 106 CONECT 28 29 30 107 CONECT 29 108 CONECT 30 31 109 CONECT 31 110 CONECT 32 33 37 111 CONECT 33 34 112 113 CONECT 34 35 114 115 CONECT 35 36 37 74 CONECT 36 116 117 118 CONECT 37 38 119 CONECT 38 39 40 120 CONECT 39 121 CONECT 40 41 122 123 CONECT 41 42 74 124 CONECT 42 43 44 71 CONECT 43 125 126 127 CONECT 44 45 128 129 CONECT 45 46 130 131 CONECT 46 47 68 132 CONECT 47 48 CONECT 48 49 57 133 CONECT 49 50 CONECT 50 51 53 134 CONECT 51 52 135 136 CONECT 52 137 CONECT 53 54 55 138 CONECT 54 139 CONECT 55 56 57 140 CONECT 56 141 CONECT 57 58 142 CONECT 58 59 CONECT 59 60 66 143 CONECT 60 61 CONECT 61 62 144 145 CONECT 62 63 64 146 CONECT 63 147 CONECT 64 65 66 148 CONECT 65 149 CONECT 66 67 150 CONECT 67 151 CONECT 68 69 70 71 CONECT 69 152 153 154 CONECT 70 155 156 157 CONECT 71 72 158 CONECT 72 73 159 160 CONECT 73 74 161 162 CONECT 74 75 CONECT 75 163 164 165 END SMILES for HMDB0039942 (Notoginsenoside L)CC(C)=CCCC(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)C(C)(C)C3CCC21C INCHI for HMDB0039942 (Notoginsenoside L)InChI=1S/C53H90O22/c1-23(2)10-9-14-53(8,75-47-43(67)39(63)37(61)29(72-47)22-69-45-42(66)38(62)35(59)27(19-54)70-45)24-11-16-52(7)33(24)25(56)18-31-50(5)15-13-32(49(3,4)30(50)12-17-51(31,52)6)73-48-44(40(64)36(60)28(20-55)71-48)74-46-41(65)34(58)26(57)21-68-46/h10,24-48,54-67H,9,11-22H2,1-8H3 3D Structure for HMDB0039942 (Notoginsenoside L) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C53H90O22 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1079.2685 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1078.592374564 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-{[2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-{[2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 394246-58-3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(C)=CCCC(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OCC(O)C(O)C4O)C(C)(C)C3CCC21C | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C53H90O22/c1-23(2)10-9-14-53(8,75-47-43(67)39(63)37(61)29(72-47)22-69-45-42(66)38(62)35(59)27(19-54)70-45)24-11-16-52(7)33(24)25(56)18-31-50(5)15-13-32(49(3,4)30(50)12-17-51(31,52)6)73-48-44(40(64)36(60)28(20-55)71-48)74-46-41(65)34(58)26(57)21-68-46/h10,24-48,54-67H,9,11-22H2,1-8H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | MGEVFIHLEFXNMC-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB019604 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | C00030850 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 85352630 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|