Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 02:02:21 UTC

Update Date

2022-03-07 02:56:36 UTC

HMDB ID

HMDB0040490

Secondary Accession Numbers

HMDB40490

Metabolite Identification

Common Name

Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]

Description

Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review very few articles have been published on Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside].

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061311532D          

 43 47  0  0  0  0            999 V2000
    5.7158    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0  0  0  0
  9  2  1  0  0  0  0
  9  4  2  0  0  0  0
 10  5  2  0  0  0  0
 10  6  1  0  0  0  0
 11  3  1  0  0  0  0
 12  5  1  0  0  0  0
 13  7  1  0  0  0  0
 14  4  1  0  0  0  0
 14 11  2  0  0  0  0
 15  6  2  0  0  0  0
 16  8  1  0  0  0  0
 17 12  2  0  0  0  0
 17 15  1  0  0  0  0
 18 13  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 19  1  0  0  0  0
 22 18  1  0  0  0  0
 23 21  1  0  0  0  0
 24  9  1  0  0  0  0
 25 20  1  0  0  0  0
 25 24  2  0  0  0  0
 26 22  1  0  0  0  0
 27 23  1  0  0  0  0
 28 10  1  0  0  0  0
 29 11  1  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34 20  2  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38  1  1  0  0  0  0
 38 14  1  0  0  0  0
 39  7  1  0  0  0  0
 39 26  1  0  0  0  0
 40  8  1  0  0  0  0
 40 26  1  0  0  0  0
 41 15  1  0  0  0  0
 41 24  1  0  0  0  0
 42 16  1  0  0  0  0
 42 27  1  0  0  0  0
 43 25  1  0  0  0  0
 43 27  1  0  0  0  0
M  END

HMDB0040490
     RDKit          3D
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]
 73 77  0  0  0  0  0  0  0  0999 V2000
   -4.8628    4.8042    1.5186 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4372    3.6008    1.1841 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0106    2.4422    0.9088 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3155    1.5988    1.7686 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8583    0.3610    1.4683 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2067   -0.4828    2.4868 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4561   -0.1584    3.7667 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9406   -0.8277    4.7646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2492   -0.4264    6.0466 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7000   -1.1411    7.1229 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0316   -0.7099    8.3821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8707   -2.2198    6.9372 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5715   -2.6084    5.6498 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2592   -3.6881    5.3836 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1137   -1.9016    4.5592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8209   -2.2810    3.2682 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0707   -3.2602    3.0778 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4019   -1.5236    2.2288 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0692   -1.9312    0.9505 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0754   -1.4358    0.2441 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2769   -0.8026   -0.9110 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6540   -0.8033   -1.9234 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1123    0.0059   -3.0937 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0192    0.0671   -4.1294 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1976    0.7246   -3.7692 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2574   -0.1569   -3.7744 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4452    0.4727   -3.3586 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8287    1.5569   -4.3293 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0159    1.1486   -4.9716 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7368    1.8157   -5.3386 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9366    3.0377   -5.9938 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4198    1.9235   -4.6313 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3718    3.0958   -3.8942 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7258   -2.2866   -2.3605 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5635   -2.8025   -2.5728 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4287   -2.9904   -1.2423 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8166   -2.9165   -1.5233 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2070   -2.3818    0.1186 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4053   -1.7372    0.5131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0931   -0.1221    0.2106 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7735    0.6366   -0.7199 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2240    1.8756   -0.4040 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9056    2.6330   -1.3319 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7464    5.1447    0.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1284    5.6598    1.3780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2209    4.9771    2.5803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1110    1.9535    2.7889 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9030    0.4224    6.1858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7245   -1.1071    9.2375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4678   -2.7465    7.7854 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6744   -4.2345    6.1236 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4468   -0.6081    0.9379 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6519   -0.5166   -1.6452 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8240   -0.4870   -3.3979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1738    1.0019   -2.6948 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1204    1.0893   -2.7019 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2275   -0.3070   -3.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3841    0.8173   -2.2999 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0096    2.4799   -3.7576 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7569    1.6112   -4.4841 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7305    0.9937   -6.0795 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7313    3.4687   -5.5832 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6003    2.0178   -5.3884 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2655    2.8481   -2.9352 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2400   -2.3706   -3.3334 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4625   -3.6025   -3.1368 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2241   -4.1038   -1.2598 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0518   -1.9540   -1.3785 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1041   -3.2252    0.8127 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2201   -0.8008    0.7803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7977   -1.1063   -0.1160 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9538    0.2385   -1.7374 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0145    2.2410   -2.2843 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 22 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
  5 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 42  3  1  0
 18  6  2  0
 38 20  1  0
 15  8  1  0
 32 25  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  9 48  1  0
 11 49  1  0
 12 50  1  0
 14 51  1  0
 20 52  1  0
 22 53  1  0
 23 54  1  0
 23 55  1  0
 25 56  1  0
 27 57  1  0
 27 58  1  0
 28 59  1  0
 29 60  1  0
 30 61  1  0
 31 62  1  0
 32 63  1  0
 33 64  1  0
 34 65  1  0
 35 66  1  0
 36 67  1  0
 37 68  1  0
 38 69  1  0
 39 70  1  0
 40 71  1  0
 41 72  1  0
 43 73  1  0
M  END

  Mrv0541 05061311532D          

 43 47  0  0  0  0            999 V2000
    5.7158    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -6.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0  0  0  0
  9  2  1  0  0  0  0
  9  4  2  0  0  0  0
 10  5  2  0  0  0  0
 10  6  1  0  0  0  0
 11  3  1  0  0  0  0
 12  5  1  0  0  0  0
 13  7  1  0  0  0  0
 14  4  1  0  0  0  0
 14 11  2  0  0  0  0
 15  6  2  0  0  0  0
 16  8  1  0  0  0  0
 17 12  2  0  0  0  0
 17 15  1  0  0  0  0
 18 13  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 19  1  0  0  0  0
 22 18  1  0  0  0  0
 23 21  1  0  0  0  0
 24  9  1  0  0  0  0
 25 20  1  0  0  0  0
 25 24  2  0  0  0  0
 26 22  1  0  0  0  0
 27 23  1  0  0  0  0
 28 10  1  0  0  0  0
 29 11  1  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34 20  2  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38  1  1  0  0  0  0
 38 14  1  0  0  0  0
 39  7  1  0  0  0  0
 39 26  1  0  0  0  0
 40  8  1  0  0  0  0
 40 26  1  0  0  0  0
 41 15  1  0  0  0  0
 41 24  1  0  0  0  0
 42 16  1  0  0  0  0
 42 27  1  0  0  0  0
 43 25  1  0  0  0  0
 43 27  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0040490

> <DATABASE_NAME>
hmdb

> <SMILES>
COC1=C(O)C=CC(=C1)C1=C(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)C(=O)C2=C(O)C=C(O)C=C2O1

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c1-38-14-4-9(2-3-11(14)29)24-25(20(34)17-12(30)5-10(28)6-15(17)41-24)43-27-23(37)21(35)19(33)16(42-27)8-40-26-22(36)18(32)13(31)7-39-26/h2-6,13,16,18-19,21-23,26-33,35-37H,7-8H2,1H3

> <INCHI_KEY>
HIRWMGZVIYIRJM-UHFFFAOYSA-N

> <FORMULA>
C27H30O16

> <MOLECULAR_WEIGHT>
610.5175

> <EXACT_MASS>
610.153384912

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
58.09327952598733

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.16

> <JCHEM_LOGP>
-1.1394419436666652

> <ALOGPS_LOGS>
-2.32

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.762787243827194

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.436132197022758

> <JCHEM_PKA_STRONGEST_BASIC>
-3.648686042866199

> <JCHEM_POLAR_SURFACE_AREA>
254.51999999999992

> <JCHEM_REFRACTIVITY>
140.2086

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.93e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0040490
     RDKit          3D
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]
 73 77  0  0  0  0  0  0  0  0999 V2000
   -4.8628    4.8042    1.5186 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4372    3.6008    1.1841 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0106    2.4422    0.9088 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3155    1.5988    1.7686 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8583    0.3610    1.4683 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2067   -0.4828    2.4868 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4561   -0.1584    3.7667 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9406   -0.8277    4.7646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2492   -0.4264    6.0466 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7000   -1.1411    7.1229 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0316   -0.7099    8.3821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8707   -2.2198    6.9372 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5715   -2.6084    5.6498 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2592   -3.6881    5.3836 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1137   -1.9016    4.5592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8209   -2.2810    3.2682 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0707   -3.2602    3.0778 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4019   -1.5236    2.2288 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0692   -1.9312    0.9505 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0754   -1.4358    0.2441 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2769   -0.8026   -0.9110 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6540   -0.8033   -1.9234 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1123    0.0059   -3.0937 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0192    0.0671   -4.1294 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1976    0.7246   -3.7692 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2574   -0.1569   -3.7744 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4452    0.4727   -3.3586 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8287    1.5569   -4.3293 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0159    1.1486   -4.9716 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7368    1.8157   -5.3386 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9366    3.0377   -5.9938 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4198    1.9235   -4.6313 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3718    3.0958   -3.8942 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7258   -2.2866   -2.3605 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5635   -2.8025   -2.5728 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4287   -2.9904   -1.2423 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8166   -2.9165   -1.5233 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2070   -2.3818    0.1186 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4053   -1.7372    0.5131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0931   -0.1221    0.2106 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7735    0.6366   -0.7199 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2240    1.8756   -0.4040 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9056    2.6330   -1.3319 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7464    5.1447    0.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1284    5.6598    1.3780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2209    4.9771    2.5803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1110    1.9535    2.7889 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9030    0.4224    6.1858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7245   -1.1071    9.2375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4678   -2.7465    7.7854 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6744   -4.2345    6.1236 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4468   -0.6081    0.9379 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6519   -0.5166   -1.6452 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8240   -0.4870   -3.3979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1738    1.0019   -2.6948 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1204    1.0893   -2.7019 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2275   -0.3070   -3.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3841    0.8173   -2.2999 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0096    2.4799   -3.7576 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7569    1.6112   -4.4841 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7305    0.9937   -6.0795 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7313    3.4687   -5.5832 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6003    2.0178   -5.3884 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2655    2.8481   -2.9352 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2400   -2.3706   -3.3334 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4625   -3.6025   -3.1368 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2241   -4.1038   -1.2598 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0518   -1.9540   -1.3785 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1041   -3.2252    0.8127 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2201   -0.8008    0.7803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7977   -1.1063   -0.1160 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9538    0.2385   -1.7374 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0145    2.2410   -2.2843 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 22 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
  5 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 42  3  1  0
 18  6  2  0
 38 20  1  0
 15  8  1  0
 32 25  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  9 48  1  0
 11 49  1  0
 12 50  1  0
 14 51  1  0
 20 52  1  0
 22 53  1  0
 23 54  1  0
 23 55  1  0
 25 56  1  0
 27 57  1  0
 27 58  1  0
 28 59  1  0
 29 60  1  0
 30 61  1  0
 31 62  1  0
 32 63  1  0
 33 64  1  0
 34 65  1  0
 35 66  1  0
 36 67  1  0
 37 68  1  0
 38 69  1  0
 39 70  1  0
 40 71  1  0
 41 72  1  0
 43 73  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      10.669   0.000   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -1.334 -10.010   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       2.667  -7.700   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -1.334 -11.550   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.001  -6.930   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       0.000 -12.320   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       5.335  -7.700   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       6.668  -6.930   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       1.334 -11.550   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       1.334 -10.010   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -2.667 -12.320   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       0.000 -13.860   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       5.335  -9.240   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       8.002  -7.700   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       2.667 -12.320   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       8.002  -4.620   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       0.000  -9.240   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       2.667  -9.240   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       4.001  -5.390   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
CONECT    1   38                                                            
CONECT    2    3    9                                                       
CONECT    3    2   11                                                       
CONECT    4    9   14                                                       
CONECT    5   10   12                                                       
CONECT    6   10   15                                                       
CONECT    7   13   39                                                       
CONECT    8   16   40                                                       
CONECT    9    2    4   24                                                  
CONECT   10    5    6   28                                                  
CONECT   11    3   14   29                                                  
CONECT   12    5   17   30                                                  
CONECT   13    7   18   31                                                  
CONECT   14    4   11   38                                                  
CONECT   15    6   17   41                                                  
CONECT   16    8   19   42                                                  
CONECT   17   12   15   20                                                  
CONECT   18   13   22   32                                                  
CONECT   19   16   21   33                                                  
CONECT   20   17   25   34                                                  
CONECT   21   19   23   35                                                  
CONECT   22   18   26   36                                                  
CONECT   23   21   27   37                                                  
CONECT   24    9   25   41                                                  
CONECT   25   20   24   43                                                  
CONECT   26   22   39   40                                                  
CONECT   27   23   42   43                                                  
CONECT   28   10                                                            
CONECT   29   11                                                            
CONECT   30   12                                                            
CONECT   31   13                                                            
CONECT   32   18                                                            
CONECT   33   19                                                            
CONECT   34   20                                                            
CONECT   35   21                                                            
CONECT   36   22                                                            
CONECT   37   23                                                            
CONECT   38    1   14                                                       
CONECT   39    7   26                                                       
CONECT   40    8   26                                                       
CONECT   41   15   24                                                       
CONECT   42   16   27                                                       
CONECT   43   25   27                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0040490
HETATM    1  C1  UNL     1      -4.863   4.804   1.519  1.00  0.00           C  
HETATM    2  O1  UNL     1      -4.437   3.601   1.184  1.00  0.00           O  
HETATM    3  C2  UNL     1      -4.011   2.442   0.909  1.00  0.00           C  
HETATM    4  C3  UNL     1      -3.316   1.599   1.769  1.00  0.00           C  
HETATM    5  C4  UNL     1      -2.858   0.361   1.468  1.00  0.00           C  
HETATM    6  C5  UNL     1      -2.207  -0.483   2.487  1.00  0.00           C  
HETATM    7  O2  UNL     1      -2.456  -0.158   3.767  1.00  0.00           O  
HETATM    8  C6  UNL     1      -1.941  -0.828   4.765  1.00  0.00           C  
HETATM    9  C7  UNL     1      -2.249  -0.426   6.047  1.00  0.00           C  
HETATM   10  C8  UNL     1      -1.700  -1.141   7.123  1.00  0.00           C  
HETATM   11  O3  UNL     1      -2.032  -0.710   8.382  1.00  0.00           O  
HETATM   12  C9  UNL     1      -0.871  -2.220   6.937  1.00  0.00           C  
HETATM   13  C10 UNL     1      -0.571  -2.608   5.650  1.00  0.00           C  
HETATM   14  O4  UNL     1       0.259  -3.688   5.384  1.00  0.00           O  
HETATM   15  C11 UNL     1      -1.114  -1.902   4.559  1.00  0.00           C  
HETATM   16  C12 UNL     1      -0.821  -2.281   3.268  1.00  0.00           C  
HETATM   17  O5  UNL     1      -0.071  -3.260   3.078  1.00  0.00           O  
HETATM   18  C13 UNL     1      -1.402  -1.524   2.229  1.00  0.00           C  
HETATM   19  O6  UNL     1      -1.069  -1.931   0.951  1.00  0.00           O  
HETATM   20  C14 UNL     1       0.075  -1.436   0.244  1.00  0.00           C  
HETATM   21  O7  UNL     1      -0.277  -0.803  -0.911  1.00  0.00           O  
HETATM   22  C15 UNL     1       0.654  -0.803  -1.923  1.00  0.00           C  
HETATM   23  C16 UNL     1       0.112   0.006  -3.094  1.00  0.00           C  
HETATM   24  O8  UNL     1       1.019   0.067  -4.129  1.00  0.00           O  
HETATM   25  C17 UNL     1       2.198   0.725  -3.769  1.00  0.00           C  
HETATM   26  O9  UNL     1       3.257  -0.157  -3.774  1.00  0.00           O  
HETATM   27  C18 UNL     1       4.445   0.473  -3.359  1.00  0.00           C  
HETATM   28  C19 UNL     1       4.829   1.557  -4.329  1.00  0.00           C  
HETATM   29  O10 UNL     1       6.016   1.149  -4.972  1.00  0.00           O  
HETATM   30  C20 UNL     1       3.737   1.816  -5.339  1.00  0.00           C  
HETATM   31  O11 UNL     1       3.937   3.038  -5.994  1.00  0.00           O  
HETATM   32  C21 UNL     1       2.420   1.924  -4.631  1.00  0.00           C  
HETATM   33  O12 UNL     1       2.372   3.096  -3.894  1.00  0.00           O  
HETATM   34  C22 UNL     1       0.726  -2.287  -2.361  1.00  0.00           C  
HETATM   35  O13 UNL     1      -0.564  -2.802  -2.573  1.00  0.00           O  
HETATM   36  C23 UNL     1       1.429  -2.990  -1.242  1.00  0.00           C  
HETATM   37  O14 UNL     1       2.817  -2.917  -1.523  1.00  0.00           O  
HETATM   38  C24 UNL     1       1.207  -2.382   0.119  1.00  0.00           C  
HETATM   39  O15 UNL     1       2.405  -1.737   0.513  1.00  0.00           O  
HETATM   40  C25 UNL     1      -3.093  -0.122   0.211  1.00  0.00           C  
HETATM   41  C26 UNL     1      -3.774   0.637  -0.720  1.00  0.00           C  
HETATM   42  C27 UNL     1      -4.224   1.876  -0.404  1.00  0.00           C  
HETATM   43  O16 UNL     1      -4.906   2.633  -1.332  1.00  0.00           O  
HETATM   44  H1  UNL     1      -5.746   5.145   0.883  1.00  0.00           H  
HETATM   45  H2  UNL     1      -4.128   5.660   1.378  1.00  0.00           H  
HETATM   46  H3  UNL     1      -5.221   4.977   2.580  1.00  0.00           H  
HETATM   47  H4  UNL     1      -3.111   1.954   2.789  1.00  0.00           H  
HETATM   48  H5  UNL     1      -2.903   0.422   6.186  1.00  0.00           H  
HETATM   49  H6  UNL     1      -1.724  -1.107   9.238  1.00  0.00           H  
HETATM   50  H7  UNL     1      -0.468  -2.747   7.785  1.00  0.00           H  
HETATM   51  H8  UNL     1       0.674  -4.235   6.124  1.00  0.00           H  
HETATM   52  H9  UNL     1       0.447  -0.608   0.938  1.00  0.00           H  
HETATM   53  H10 UNL     1       1.652  -0.517  -1.645  1.00  0.00           H  
HETATM   54  H11 UNL     1      -0.824  -0.487  -3.398  1.00  0.00           H  
HETATM   55  H12 UNL     1      -0.174   1.002  -2.695  1.00  0.00           H  
HETATM   56  H13 UNL     1       2.120   1.089  -2.702  1.00  0.00           H  
HETATM   57  H14 UNL     1       5.228  -0.307  -3.369  1.00  0.00           H  
HETATM   58  H15 UNL     1       4.384   0.817  -2.300  1.00  0.00           H  
HETATM   59  H16 UNL     1       5.010   2.480  -3.758  1.00  0.00           H  
HETATM   60  H17 UNL     1       6.757   1.611  -4.484  1.00  0.00           H  
HETATM   61  H18 UNL     1       3.730   0.994  -6.079  1.00  0.00           H  
HETATM   62  H19 UNL     1       4.731   3.469  -5.583  1.00  0.00           H  
HETATM   63  H20 UNL     1       1.600   2.018  -5.388  1.00  0.00           H  
HETATM   64  H21 UNL     1       2.266   2.848  -2.935  1.00  0.00           H  
HETATM   65  H22 UNL     1       1.240  -2.371  -3.333  1.00  0.00           H  
HETATM   66  H23 UNL     1      -0.463  -3.602  -3.137  1.00  0.00           H  
HETATM   67  H24 UNL     1       1.224  -4.104  -1.260  1.00  0.00           H  
HETATM   68  H25 UNL     1       3.052  -1.954  -1.379  1.00  0.00           H  
HETATM   69  H26 UNL     1       1.104  -3.225   0.813  1.00  0.00           H  
HETATM   70  H27 UNL     1       2.220  -0.801   0.780  1.00  0.00           H  
HETATM   71  H28 UNL     1      -2.798  -1.106  -0.116  1.00  0.00           H  
HETATM   72  H29 UNL     1      -3.954   0.239  -1.737  1.00  0.00           H  
HETATM   73  H30 UNL     1      -5.014   2.241  -2.284  1.00  0.00           H  
CONECT    1    2   44   45   46
CONECT    2    3
CONECT    3    4    4   42
CONECT    4    5   47
CONECT    5    6   40   40
CONECT    6    7   18   18
CONECT    7    8
CONECT    8    9    9   15
CONECT    9   10   48
CONECT   10   11   12   12
CONECT   11   49
CONECT   12   13   50
CONECT   13   14   15   15
CONECT   14   51
CONECT   15   16
CONECT   16   17   17   18
CONECT   18   19
CONECT   19   20
CONECT   20   21   38   52
CONECT   21   22
CONECT   22   23   34   53
CONECT   23   24   54   55
CONECT   24   25
CONECT   25   26   32   56
CONECT   26   27
CONECT   27   28   57   58
CONECT   28   29   30   59
CONECT   29   60
CONECT   30   31   32   61
CONECT   31   62
CONECT   32   33   63
CONECT   33   64
CONECT   34   35   36   65
CONECT   35   66
CONECT   36   37   38   67
CONECT   37   68
CONECT   38   39   69
CONECT   39   70
CONECT   40   41   71
CONECT   41   42   42   72
CONECT   42   43
CONECT   43   73
END

HMDB0040490
     RDKit          3D
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]
 73 77  0  0  0  0  0  0  0  0999 V2000
   -4.8628    4.8042    1.5186 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4372    3.6008    1.1841 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0106    2.4422    0.9088 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3155    1.5988    1.7686 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8583    0.3610    1.4683 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2067   -0.4828    2.4868 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4561   -0.1584    3.7667 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9406   -0.8277    4.7646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2492   -0.4264    6.0466 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7000   -1.1411    7.1229 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0316   -0.7099    8.3821 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8707   -2.2198    6.9372 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5715   -2.6084    5.6498 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2592   -3.6881    5.3836 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1137   -1.9016    4.5592 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8209   -2.2810    3.2682 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0707   -3.2602    3.0778 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4019   -1.5236    2.2288 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0692   -1.9312    0.9505 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0754   -1.4358    0.2441 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2769   -0.8026   -0.9110 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6540   -0.8033   -1.9234 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1123    0.0059   -3.0937 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0192    0.0671   -4.1294 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1976    0.7246   -3.7692 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2574   -0.1569   -3.7744 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4452    0.4727   -3.3586 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8287    1.5569   -4.3293 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0159    1.1486   -4.9716 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7368    1.8157   -5.3386 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9366    3.0377   -5.9938 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4198    1.9235   -4.6313 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3718    3.0958   -3.8942 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7258   -2.2866   -2.3605 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5635   -2.8025   -2.5728 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4287   -2.9904   -1.2423 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8166   -2.9165   -1.5233 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2070   -2.3818    0.1186 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4053   -1.7372    0.5131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0931   -0.1221    0.2106 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7735    0.6366   -0.7199 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2240    1.8756   -0.4040 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9056    2.6330   -1.3319 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7464    5.1447    0.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1284    5.6598    1.3780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2209    4.9771    2.5803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1110    1.9535    2.7889 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9030    0.4224    6.1858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7245   -1.1071    9.2375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4678   -2.7465    7.7854 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6744   -4.2345    6.1236 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4468   -0.6081    0.9379 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6519   -0.5166   -1.6452 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8240   -0.4870   -3.3979 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1738    1.0019   -2.6948 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1204    1.0893   -2.7019 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2275   -0.3070   -3.3690 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3841    0.8173   -2.2999 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0096    2.4799   -3.7576 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7569    1.6112   -4.4841 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7305    0.9937   -6.0795 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7313    3.4687   -5.5832 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6003    2.0178   -5.3884 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2655    2.8481   -2.9352 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2400   -2.3706   -3.3334 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4625   -3.6025   -3.1368 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2241   -4.1038   -1.2598 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0518   -1.9540   -1.3785 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1041   -3.2252    0.8127 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2201   -0.8008    0.7803 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7977   -1.1063   -0.1160 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9538    0.2385   -1.7374 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0145    2.2410   -2.2843 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 22 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
  5 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 42  3  1  0
 18  6  2  0
 38 20  1  0
 15  8  1  0
 32 25  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  9 48  1  0
 11 49  1  0
 12 50  1  0
 14 51  1  0
 20 52  1  0
 22 53  1  0
 23 54  1  0
 23 55  1  0
 25 56  1  0
 27 57  1  0
 27 58  1  0
 28 59  1  0
 29 60  1  0
 30 61  1  0
 31 62  1  0
 32 63  1  0
 33 64  1  0
 34 65  1  0
 35 66  1  0
 36 67  1  0
 37 68  1  0
 38 69  1  0
 39 70  1  0
 40 71  1  0
 41 72  1  0
 43 73  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
2,2,5,5-Tetramethyl-4-phenyl-1-imidazolidinol 3-oxide	HMDB
AmbsicL14/009	HMDB
Isorhamnetin 3-xylosyl-(1->6)-glucoside	HMDB

Chemical Formula

C₂₇H₃₀O₁₆

Average Molecular Weight

610.5175

Monoisotopic Molecular Weight

610.153384912

IUPAC Name

5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]-4H-chromen-4-one

Traditional Name

5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]chromen-4-one

CAS Registry Number

142905-19-9

SMILES

COC1=C(O)C=CC(=C1)C1=C(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)C(=O)C2=C(O)C=C(O)C=C2O1

InChI Identifier

InChI=1S/C27H30O16/c1-38-14-4-9(2-3-11(14)29)24-25(20(34)17-12(30)5-10(28)6-15(17)41-24)43-27-23(37)21(35)19(33)16(42-27)8-40-26-22(36)18(32)13(31)7-39-26/h2-6,13,16,18-19,21-23,26-33,35-37H,7-8H2,1H3

InChI Key

HIRWMGZVIYIRJM-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Prenol lipids

Sub Class

Triterpenoids

Direct Parent

Triterpenoids

Alternative Parents

Substituents

Triterpenoid
3-hydroxysteroid
12-hydroxysteroid
Hydroxysteroid
Steroid
Fatty acyl glycoside
Fatty acyl glycoside of mono- or disaccharide
Alkyl glycoside
Disaccharide
Glycosyl compound
O-glycosyl compound
Fatty acyl
Oxane
Cyclic alcohol
Secondary alcohol
Organoheterocyclic compound
Acetal
Oxacycle
Polyol
Organooxygen compound
Alcohol
Organic oxygen compound
Hydrocarbon derivative
Primary alcohol
Aliphatic heteropolycyclic compound

Molecular Framework

Aliphatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0040490)
Cytoplasm (HMDB: HMDB0040490)

Source

Exogenous

Exogenous (HMDB: HMDB0040490)

Food

Food (HMDB: HMDB0040490)

Endogenous

Plant

Plant (HMDB: HMDB0040490)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0040490)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	2.93 g/L	ALOGPS
logP	-0.16	ALOGPS
logP	-1.1	ChemAxon
logS	-2.3	ALOGPS
pKa (Strongest Acidic)	6.44	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	254.52 Å²	ChemAxon
Rotatable Bond Count	7	ChemAxon
Refractivity	140.21 m³·mol⁻¹	ChemAxon
Polarizability	58.09 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	227.533	30932474
DeepCCS	[M-H]-	225.137	30932474
DeepCCS	[M-2H]-	258.254	30932474
DeepCCS	[M+Na]+	233.445	30932474
AllCCS	[M+H]+	232.4	32859911
AllCCS	[M+H-H2O]+	231.1	32859911
AllCCS	[M+NH4]+	233.5	32859911
AllCCS	[M+Na]+	233.8	32859911
AllCCS	[M-H]-	228.4	32859911
AllCCS	[M+Na-2H]-	230.6	32859911
AllCCS	[M+HCOO]-	233.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]	COC1=C(O)C=CC(=C1)C1=C(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)C(=O)C2=C(O)C=C(O)C=C2O1	5769.5	Standard polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]	COC1=C(O)C=CC(=C1)C1=C(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)C(=O)C2=C(O)C=C(O)C=C2O1	5084.1	Standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside]	COC1=C(O)C=CC(=C1)C1=C(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)C(=O)C2=C(O)C=C(O)C=C2O1	5617.8	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #1	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5500.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #2	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5516.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #3	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5476.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #4	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5495.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #5	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5491.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #6	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5488.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #7	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5514.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #8	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5509.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TMS,isomer #9	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5535.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #1	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5395.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #10	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5372.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #11	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5368.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #12	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5376.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #13	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5363.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #14	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5345.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #15	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5384.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #16	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5328.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #17	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5310.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #18	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5346.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #19	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5315.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #2	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5381.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #20	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5291.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #21	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5332.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #22	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5365.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #23	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5346.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #24	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5344.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #25	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5324.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #26	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5362.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #27	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5381.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #28	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5359.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #29	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5370.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #3	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5387.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #30	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5390.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #31	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5356.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #32	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5337.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #33	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5386.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #34	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5400.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #35	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5378.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #36	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5371.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #4	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5340.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #5	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5368.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #6	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5374.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #7	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5362.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #8	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5392.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TMS,isomer #9	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5392.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #1	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5225.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #10	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5209.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #11	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5225.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #12	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5186.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #13	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5242.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #14	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5223.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #15	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5244.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #16	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5242.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #17	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5208.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #18	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5259.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #19	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5201.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #2	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5261.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #20	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5186.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #21	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5149.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #22	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5203.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #23	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5228.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #24	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5195.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #25	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5245.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #26	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5228.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #27	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5258.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #28	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5247.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #29	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5202.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #3	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5191.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #30	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5206.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #31	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5221.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #32	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5232.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #33	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5195.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #34	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5250.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #35	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5170.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #36	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5188.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #37	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5196.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #38	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5159.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #39	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5216.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #4	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5243.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #40	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5285.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #41	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5201.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #42	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5167.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #43	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5217.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #44	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5233.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #45	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5206.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #46	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5250.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #47	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5206.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #48	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5247.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #49	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5225.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #5	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5259.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #50	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5110.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #51	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5181.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #52	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5167.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #53	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5132.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #54	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5187.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #55	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5146.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #56	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5117.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #57	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5086.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #58	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5141.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #59	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5177.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #6	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5220.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #60	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5153.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #61	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5198.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #62	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5154.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #63	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5197.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #64	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5172.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #65	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5165.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #66	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5212.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #67	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5175.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #68	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5231.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #69	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5169.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #7	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5277.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #70	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5131.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #71	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5193.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #72	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5191.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #73	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5225.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #74	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5209.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #75	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5200.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #76	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5210.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #77	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5246.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #78	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5182.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #79	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5219.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #8	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5226.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #80	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5286.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #81	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5163.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #82	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5232.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #83	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5201.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #84	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5220.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],3TMS,isomer #9	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5150.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #1	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5079.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #10	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5084.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #100	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5056.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #101	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5037.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #102	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5022.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #103	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	4987.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #104	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5056.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #105	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	4987.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #106	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5031.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #107	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5009.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #108	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5074.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #109	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5109.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #11	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5155.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #110	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5097.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #111	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5110.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #112	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5013.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #113	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4971.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #114	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5054.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #115	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5075.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #116	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5105.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #117	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5097.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #118	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5044.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #119	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5078.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #12	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5082.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #120	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5066.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #121	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5145.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #122	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5045.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #123	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5083.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #124	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5156.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #125	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5131.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #126	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5067.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #13	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5046.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #14	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5005.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #15	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5083.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #16	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5107.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #17	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5070.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #18	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5144.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #19	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5122.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #2	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	4982.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #20	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5153.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #21	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5142.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #22	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5059.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #23	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5085.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #24	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5090.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #25	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5053.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #26	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5123.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #27	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5047.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #28	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5007.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #29	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	4968.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #3	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5063.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #30	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5043.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #31	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5067.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #32	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5032.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #33	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5106.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #34	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5087.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #35	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5126.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #36	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5109.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #37	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5149.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #38	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5099.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #39	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5067.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #4	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5078.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #40	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5127.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #41	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5128.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #42	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5101.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #43	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5158.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #44	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5121.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #45	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5154.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #46	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5137.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #47	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5086.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #48	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5055.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #49	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5117.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #5	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5031.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #50	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5062.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #51	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5101.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #52	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5081.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #53	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5107.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #54	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5138.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #55	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5126.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #56	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C	5170.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #57	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4992.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #58	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5019.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #59	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5037.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #6	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5118.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #60	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4995.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #61	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5074.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #62	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5111.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #63	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5054.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #64	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5010.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #65	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5091.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #66	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5083.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #67	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5043.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #68	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5121.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #69	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5090.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #7	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5092.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #70	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5129.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #71	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5109.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #72	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5088.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #73	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5026.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #74	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	4985.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #75	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5063.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #76	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5058.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #77	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5023.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #78	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5094.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #79	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5068.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #8	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5116.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #80	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5108.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #81	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O)C=C3O2)=CC=C1O	5086.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #82	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5138.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #83	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5113.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #84	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5163.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #85	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5085.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #86	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5122.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #87	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5105.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #88	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5121.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #89	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5142.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #9	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C	5123.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #90	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5137.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #91	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C)C(O)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5160.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #92	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4993.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #93	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4947.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #94	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4928.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #95	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	4983.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #96	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5053.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #97	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5015.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #98	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5089.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],4TMS,isomer #99	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C)C4O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C)C=C3O2)=CC=C1O	5016.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #1	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5701.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #2	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5765.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #3	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5729.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #4	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5744.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #5	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5737.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #6	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5737.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #7	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5757.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #8	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5703.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],1TBDMS,isomer #9	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5724.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #1	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5761.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #10	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5754.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #11	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5756.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #12	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5765.5	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #13	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5765.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #14	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5763.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #15	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5779.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #16	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5713.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #17	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5695.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #18	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5721.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #19	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5704.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #2	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5742.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #20	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5707.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #21	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5718.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #22	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5720.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #23	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5697.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #24	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5712.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #25	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5712.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #26	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5730.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #27	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5750.0	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #28	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5731.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #29	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5758.7	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #3	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5771.3	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #30	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5775.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #31	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5754.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #32	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5736.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #33	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O	5765.9	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #34	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5766.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #35	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3O2)=CC=C1O	5744.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #36	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5746.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #4	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5717.4	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #5	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5725.8	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #6	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5745.2	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #7	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5749.1	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #8	COC1=CC(C2=C(OC3OC(COC4OCC(O)C(O)C4O)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(O)C=C3O2)=CC=C1O[Si](C)(C)C(C)(C)C	5768.6	Semi standard non polar	33892256
Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside],2TBDMS,isomer #9	COC1=CC(C2=C(OC3OC(COC4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)C(O)C(O)C3O)C(=O)C3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3O2)=CC=C1O	5771.3	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (Non-derivatized) - 70eV, Positive	splash10-000y-3330290000-123f94ab117ced90e037	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (1 TMS) - 70eV, Positive	splash10-02t9-3330029000-7d86018fdd964e832bc3	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] GC-MS (TMS_2_15) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 10V, Positive-QTOF	splash10-02tc-0119153000-5722c20b00155b238ec6	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 20V, Positive-QTOF	splash10-014i-0139210000-a9615d6cb08dc7a50ca6	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 40V, Positive-QTOF	splash10-0gb9-1749000000-22662daa4f2f59fca4e8	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 10V, Negative-QTOF	splash10-0aor-2848349000-e2d73a231204659d9731	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 20V, Negative-QTOF	splash10-015a-2968120000-0f6a11aeaeef9582d954	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 40V, Negative-QTOF	splash10-00ke-4495000000-9fbff713238650e9ab54	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 10V, Positive-QTOF	splash10-014i-0009002000-18620334237b7ca128e2	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 20V, Positive-QTOF	splash10-04i0-0009009000-db394e3e2a8e8161e97b	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 40V, Positive-QTOF	splash10-014i-0009000000-235a2c69093cac80b556	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 10V, Negative-QTOF	splash10-0a4i-0000009000-2daf4735711b3104561a	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 20V, Negative-QTOF	splash10-0a4i-0005009000-aa8bac0f09e7d99a78eb	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] 40V, Negative-QTOF	splash10-03di-0019001000-d3fde091fdee6b2347c3	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB020250

KNApSAcK ID

C00005541

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

74977613

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside] (HMDB0040490)

MOL for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

3D MOL for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

3D SDF for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

3D-SDF for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

PDB for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

3D PDB for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

SMILES for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

INCHI for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

Structure for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

3D Structure for HMDB0040490 (Isorhamnetin 3-O-[b-D-xylopyranosyl-(1->6)-b-D-glucopyranoside])

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra