Showing metabocard for Hoduloside X (HMDB0040662)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 02:13:50 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:41 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0040662 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Hoduloside X | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Hoduloside X belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Hoduloside X is an extremely weak basic (essentially neutral) compound (based on its pKa). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0040662 (Hoduloside X)Mrv0541 05061312012D 76 83 0 0 0 0 999 V2000 1.5866 -2.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1514 4.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1299 3.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7720 -2.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8326 -2.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0166 0.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4378 0.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4147 2.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2612 2.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4454 1.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7309 0.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7312 -1.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5877 -0.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5160 3.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4542 2.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3021 -0.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4456 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9447 -0.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8379 -3.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0160 -6.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4442 -0.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2463 -0.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3011 -2.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1599 0.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4295 0.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7298 -0.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5053 -3.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7304 -6.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0167 -1.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7311 -0.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5878 -1.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9445 0.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3011 -3.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7299 -1.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2590 -3.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4449 -6.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9263 -3.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1593 -6.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0157 -4.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8400 -2.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1592 -5.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4444 -1.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7301 -3.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0864 -2.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4447 -5.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1588 -1.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7301 -2.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3230 3.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3023 -1.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0166 -0.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4455 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1994 1.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1601 -0.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9242 -4.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3014 -6.2721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2545 0.3289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0153 -0.0845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5867 -4.2097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0155 -1.7345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3453 -4.5217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4450 -7.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6801 -3.5517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8738 -6.6843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0158 -5.0345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5074 -1.9107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8736 -5.0342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4946 2.8864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9840 1.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1587 -0.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0000 -1.2398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0156 -2.5596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4190 -2.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7303 -5.4469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8733 -1.7342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4446 -4.2094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4445 -2.5594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11 10 1 0 0 0 0 14 9 2 0 0 0 0 15 9 1 0 0 0 0 16 13 1 0 0 0 0 17 12 1 0 0 0 0 23 1 1 0 0 0 0 24 10 1 0 0 0 0 25 18 1 0 0 0 0 26 21 1 0 0 0 0 27 19 1 0 0 0 0 28 20 1 0 0 0 0 29 12 1 0 0 0 0 30 11 1 0 0 0 0 31 13 1 0 0 0 0 32 24 1 0 0 0 0 32 25 1 0 0 0 0 33 23 1 0 0 0 0 34 26 1 0 0 0 0 35 27 1 0 0 0 0 36 28 1 0 0 0 0 37 35 1 0 0 0 0 38 36 1 0 0 0 0 39 33 1 0 0 0 0 40 37 1 0 0 0 0 41 38 1 0 0 0 0 42 34 1 0 0 0 0 43 39 1 0 0 0 0 44 40 1 0 0 0 0 45 41 1 0 0 0 0 46 42 1 0 0 0 0 47 43 1 0 0 0 0 48 2 1 0 0 0 0 48 3 1 0 0 0 0 48 14 1 0 0 0 0 49 4 1 0 0 0 0 49 5 1 0 0 0 0 49 29 1 0 0 0 0 49 31 1 0 0 0 0 50 6 1 0 0 0 0 50 16 1 0 0 0 0 50 29 1 0 0 0 0 50 30 1 0 0 0 0 51 7 1 0 0 0 0 51 17 1 0 0 0 0 51 30 1 0 0 0 0 52 8 1 0 0 0 0 52 15 1 0 0 0 0 52 32 1 0 0 0 0 53 18 1 0 0 0 0 53 22 1 0 0 0 0 53 24 1 0 0 0 0 53 51 1 0 0 0 0 54 19 1 0 0 0 0 55 20 1 0 0 0 0 56 25 2 0 0 0 0 57 26 1 0 0 0 0 58 33 1 0 0 0 0 59 34 1 0 0 0 0 60 35 1 0 0 0 0 61 36 1 0 0 0 0 62 37 1 0 0 0 0 63 38 1 0 0 0 0 64 39 1 0 0 0 0 65 40 1 0 0 0 0 66 41 1 0 0 0 0 67 48 1 0 0 0 0 68 52 1 0 0 0 0 69 21 1 0 0 0 0 69 46 1 0 0 0 0 70 22 1 0 0 0 0 70 44 1 0 0 0 0 71 23 1 0 0 0 0 71 47 1 0 0 0 0 72 27 1 0 0 0 0 72 44 1 0 0 0 0 73 28 1 0 0 0 0 73 45 1 0 0 0 0 74 31 1 0 0 0 0 74 46 1 0 0 0 0 75 43 1 0 0 0 0 75 45 1 0 0 0 0 76 42 1 0 0 0 0 76 47 1 0 0 0 0 M END 3D MOL for HMDB0040662 (Hoduloside X)HMDB0040662 RDKit 3D Hoduloside X 164171 0 0 0 0 0 0 0 0999 V2000 4.5091 3.4047 1.7962 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7155 1.9001 1.7603 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0454 1.4864 0.4971 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4739 0.1726 0.5307 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4115 -0.4539 -0.6961 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7491 -1.6681 -0.6653 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5823 -1.8242 -1.5748 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3398 -1.6575 -1.0536 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4191 -0.9241 -1.7391 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3744 -1.8794 -2.2489 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7188 -2.2631 -1.3094 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0529 -1.2132 -0.2753 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3370 -1.7069 0.9636 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5814 0.0706 -0.8442 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2883 1.2825 -0.3720 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7431 1.2015 -0.7706 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3467 -0.1737 -0.7092 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6298 -0.6052 -2.1331 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5183 -1.1375 0.0886 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7413 -0.9620 1.5630 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5320 0.2318 2.0017 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8286 0.3023 1.3172 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5524 1.6186 1.3875 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4644 1.6825 2.6025 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6871 1.5325 3.8845 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4305 0.6537 2.4946 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2362 2.9661 2.7116 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4044 4.1771 2.8127 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4890 4.9720 3.8678 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7028 6.2099 4.0714 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3912 7.3632 3.3705 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2612 6.0862 3.6219 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6594 6.5363 5.4311 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2994 1.6837 0.1357 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3213 2.3008 -0.0763 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5955 0.8526 -0.8733 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7594 -0.1651 -0.1055 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4564 -1.4743 -0.1805 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6943 -2.0521 -1.3862 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4060 -3.2290 -1.1793 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7232 -3.1114 -1.6327 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4391 -4.2714 -1.5680 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6067 -4.7998 -0.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3582 -5.9909 -0.1762 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8869 -5.3369 -2.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1689 -6.6036 -1.9713 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4250 -5.1626 -2.7736 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8541 -6.4287 -2.8903 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7216 -4.4468 -1.6424 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4400 -4.1656 -2.0823 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9181 0.2291 -0.9702 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6146 0.5994 0.2758 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0427 1.4869 -1.8729 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7124 -3.1614 -2.0856 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6790 -3.1387 -3.0549 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0265 -2.9957 -2.3939 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6700 -4.2499 -2.4923 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8089 -2.7329 -0.9253 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5276 -3.9126 -0.2374 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9355 0.2339 0.9984 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7544 0.8910 0.1078 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8006 0.0915 -0.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0302 0.5218 0.1564 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5927 1.5684 -0.5237 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9950 1.2167 -1.0385 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8382 0.8968 0.0015 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7382 2.1151 -1.6221 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5140 3.0493 -2.3152 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3350 1.0409 -2.6112 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3687 1.6144 -3.4456 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7698 -0.1057 -1.8204 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3982 -1.3174 -2.1487 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0115 1.0066 2.3070 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9457 2.0367 2.2425 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6906 1.4789 2.8062 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9476 2.5868 3.6460 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2188 3.6580 2.8446 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6422 3.6439 1.1522 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4153 3.9642 1.5600 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7232 1.4416 2.0461 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9161 -0.4220 1.2914 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4062 -1.8643 0.3794 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7011 -1.2171 -2.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9318 -0.5538 -2.6707 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1110 -1.4236 -3.1317 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9245 -2.7582 -2.6624 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3386 -3.1812 -0.7633 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5761 -2.6468 -1.8785 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0710 -0.9719 1.6222 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5239 -2.4041 0.7265 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0342 -2.4711 1.4307 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8459 0.0429 -1.9514 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8233 2.1546 -0.9314 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1144 1.5349 0.6878 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2792 1.9621 -0.1802 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7902 1.6084 -1.8262 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5909 -1.6760 -2.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9855 -0.1169 -2.8929 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6452 -0.2209 -2.4704 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8993 -2.1532 -0.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8208 -0.8548 2.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2471 -1.8590 2.0270 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7096 0.0202 3.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9727 1.1838 2.0565 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5203 -0.4023 1.8881 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8539 2.4760 1.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2109 2.0980 4.7285 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6932 0.4871 4.2694 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6977 2.0088 3.8476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6074 0.3622 3.4284 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0672 3.0631 1.9712 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7991 2.8712 3.6919 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6906 4.4844 2.0508 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1992 4.7006 4.6666 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9886 7.4585 2.3506 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2344 8.3235 3.8749 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4793 7.1545 3.3306 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7733 7.0478 3.9361 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8152 5.2129 4.1431 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2520 6.0271 2.5339 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5502 7.5108 5.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3351 0.3507 -1.5553 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9701 1.4905 -1.5481 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4983 -1.2775 0.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0639 -2.2319 0.5393 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5284 -3.3305 -0.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4691 -4.0457 -1.9189 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6439 -4.9751 0.3537 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1778 -4.0939 0.4869 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4473 -6.3930 0.7008 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4107 -5.2496 -3.4565 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0587 -6.8906 -2.3107 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2530 -4.6639 -3.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3202 -6.5447 -3.7124 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5801 -5.2206 -0.8279 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4288 -3.8616 -3.0252 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3770 1.4151 0.0829 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8695 1.1559 0.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1634 -0.1741 0.8018 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9771 1.3587 -2.4937 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2099 1.5469 -2.5759 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2155 2.3954 -1.2681 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6067 -4.1150 -3.6012 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5150 -2.3560 -3.8268 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6494 -2.2179 -2.8775 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4862 -4.1541 -3.0749 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7619 -2.3535 -0.5323 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1088 -4.6104 -0.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2832 -0.8031 1.1520 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6515 -0.9197 0.1418 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7533 2.4067 0.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8590 0.4115 -1.7835 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4343 2.0776 -1.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0886 -0.0519 -0.0813 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8817 2.6505 -1.1942 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0580 3.6007 -1.7072 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1939 0.7603 -3.2417 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5355 2.5729 -3.5043 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7169 -0.2213 -2.1284 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6682 -1.2362 -3.1117 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4196 0.3025 3.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7569 2.6901 1.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2581 0.7127 3.5014 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8954 2.7582 3.7611 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 23 34 1 0 34 35 2 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 14 51 1 0 51 52 1 0 51 53 1 0 7 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 4 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 60 73 1 0 73 74 1 0 73 75 1 0 75 76 1 0 75 2 1 0 58 6 1 0 71 62 1 0 51 9 1 0 19 12 1 0 37 22 1 0 49 40 1 0 37 17 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 0 4 81 1 0 6 82 1 0 7 83 1 0 9 84 1 0 10 85 1 0 10 86 1 0 11 87 1 0 11 88 1 0 13 89 1 0 13 90 1 0 13 91 1 0 14 92 1 0 15 93 1 0 15 94 1 0 16 95 1 0 16 96 1 0 18 97 1 0 18 98 1 0 18 99 1 0 19100 1 0 20101 1 0 20102 1 0 21103 1 0 21104 1 0 22105 1 0 23106 1 0 25107 1 0 25108 1 0 25109 1 0 26110 1 0 27111 1 0 27112 1 0 28113 1 0 29114 1 0 31115 1 0 31116 1 0 31117 1 0 32118 1 0 32119 1 0 32120 1 0 33121 1 0 36122 1 0 36123 1 0 38124 1 0 38125 1 0 40126 1 0 42127 1 0 43128 1 0 43129 1 0 44130 1 0 45131 1 0 46132 1 0 47133 1 0 48134 1 0 49135 1 0 50136 1 0 52137 1 0 52138 1 0 52139 1 0 53140 1 0 53141 1 0 53142 1 0 55143 1 0 55144 1 0 56145 1 0 57146 1 0 58147 1 0 59148 1 0 60149 1 0 62150 1 0 64151 1 0 65152 1 0 65153 1 0 66154 1 0 67155 1 0 68156 1 0 69157 1 0 70158 1 0 71159 1 0 72160 1 0 73161 1 0 74162 1 0 75163 1 0 76164 1 0 M END 3D SDF for HMDB0040662 (Hoduloside X)Mrv0541 05061312012D 76 83 0 0 0 0 999 V2000 1.5866 -2.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1514 4.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1299 3.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7720 -2.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8326 -2.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0166 0.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4378 0.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4147 2.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2612 2.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4454 1.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7309 0.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7312 -1.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5877 -0.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5160 3.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4542 2.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3021 -0.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4456 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9447 -0.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8379 -3.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0160 -6.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4442 -0.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2463 -0.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3011 -2.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1599 0.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4295 0.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7298 -0.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5053 -3.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7304 -6.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0167 -1.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7311 -0.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5878 -1.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9445 0.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3011 -3.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7299 -1.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2590 -3.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4449 -6.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9263 -3.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1593 -6.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0157 -4.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8400 -2.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1592 -5.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4444 -1.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7301 -3.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0864 -2.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4447 -5.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1588 -1.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7301 -2.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3230 3.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3023 -1.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0166 -0.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4455 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1994 1.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1601 -0.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9242 -4.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3014 -6.2721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2545 0.3289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0153 -0.0845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5867 -4.2097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0155 -1.7345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3453 -4.5217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4450 -7.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6801 -3.5517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8738 -6.6843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0158 -5.0345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5074 -1.9107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8736 -5.0342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4946 2.8864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9840 1.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1587 -0.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0000 -1.2398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0156 -2.5596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4190 -2.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7303 -5.4469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8733 -1.7342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4446 -4.2094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4445 -2.5594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11 10 1 0 0 0 0 14 9 2 0 0 0 0 15 9 1 0 0 0 0 16 13 1 0 0 0 0 17 12 1 0 0 0 0 23 1 1 0 0 0 0 24 10 1 0 0 0 0 25 18 1 0 0 0 0 26 21 1 0 0 0 0 27 19 1 0 0 0 0 28 20 1 0 0 0 0 29 12 1 0 0 0 0 30 11 1 0 0 0 0 31 13 1 0 0 0 0 32 24 1 0 0 0 0 32 25 1 0 0 0 0 33 23 1 0 0 0 0 34 26 1 0 0 0 0 35 27 1 0 0 0 0 36 28 1 0 0 0 0 37 35 1 0 0 0 0 38 36 1 0 0 0 0 39 33 1 0 0 0 0 40 37 1 0 0 0 0 41 38 1 0 0 0 0 42 34 1 0 0 0 0 43 39 1 0 0 0 0 44 40 1 0 0 0 0 45 41 1 0 0 0 0 46 42 1 0 0 0 0 47 43 1 0 0 0 0 48 2 1 0 0 0 0 48 3 1 0 0 0 0 48 14 1 0 0 0 0 49 4 1 0 0 0 0 49 5 1 0 0 0 0 49 29 1 0 0 0 0 49 31 1 0 0 0 0 50 6 1 0 0 0 0 50 16 1 0 0 0 0 50 29 1 0 0 0 0 50 30 1 0 0 0 0 51 7 1 0 0 0 0 51 17 1 0 0 0 0 51 30 1 0 0 0 0 52 8 1 0 0 0 0 52 15 1 0 0 0 0 52 32 1 0 0 0 0 53 18 1 0 0 0 0 53 22 1 0 0 0 0 53 24 1 0 0 0 0 53 51 1 0 0 0 0 54 19 1 0 0 0 0 55 20 1 0 0 0 0 56 25 2 0 0 0 0 57 26 1 0 0 0 0 58 33 1 0 0 0 0 59 34 1 0 0 0 0 60 35 1 0 0 0 0 61 36 1 0 0 0 0 62 37 1 0 0 0 0 63 38 1 0 0 0 0 64 39 1 0 0 0 0 65 40 1 0 0 0 0 66 41 1 0 0 0 0 67 48 1 0 0 0 0 68 52 1 0 0 0 0 69 21 1 0 0 0 0 69 46 1 0 0 0 0 70 22 1 0 0 0 0 70 44 1 0 0 0 0 71 23 1 0 0 0 0 71 47 1 0 0 0 0 72 27 1 0 0 0 0 72 44 1 0 0 0 0 73 28 1 0 0 0 0 73 45 1 0 0 0 0 74 31 1 0 0 0 0 74 46 1 0 0 0 0 75 43 1 0 0 0 0 75 45 1 0 0 0 0 76 42 1 0 0 0 0 76 47 1 0 0 0 0 M END > <DATABASE_ID> HMDB0040662 > <DATABASE_NAME> hmdb > <SMILES> CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CCC3C(C(=O)CC43COC3OC(CO)C(O)C(O)C3O)C(C)(O)C\C=C\C(C)(C)O)C2(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C53H88O23/c1-23-33(58)39(64)43(75-45-41(66)38(63)36(61)28(20-55)73-45)47(71-23)76-42-34(59)26(57)21-69-46(42)74-31-13-16-50(6)29(49(31,4)5)12-17-51(7)30(50)11-10-24-32(52(8,68)15-9-14-48(2,3)67)25(56)18-53(24,51)22-70-44-40(65)37(62)35(60)27(19-54)72-44/h9,14,23-24,26-47,54-55,57-68H,10-13,15-22H2,1-8H3/b14-9+ > <INCHI_KEY> MCLHEEFYPPASJO-NTEUORMPSA-N > <FORMULA> C53H88O23 > <MOLECULAR_WEIGHT> 1093.252 > <EXACT_MASS> 1092.571639122 > <JCHEM_ACCEPTOR_COUNT> 23 > <JCHEM_AVERAGE_POLARIZABILITY> 115.42921528430409 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 14 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 5-({3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-4,5-dihydroxyoxan-2-yl}oxy)-14-[(4E)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-2,6,6,10-tetramethyl-11-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-13-one > <ALOGPS_LOGP> 0.09 > <JCHEM_LOGP> -1.9630124423333344 > <ALOGPS_LOGS> -2.88 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.301229665272693 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.843200590230804 > <JCHEM_PKA_STRONGEST_BASIC> -3.6483773010692735 > <JCHEM_POLAR_SURFACE_AREA> 374.13000000000017 > <JCHEM_REFRACTIVITY> 262.1041000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 15 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.43e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 5-({3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-4,5-dihydroxyoxan-2-yl}oxy)-14-[(4E)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-2,6,6,10-tetramethyl-11-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-13-one > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0040662 (Hoduloside X)HMDB0040662 RDKit 3D Hoduloside X 164171 0 0 0 0 0 0 0 0999 V2000 4.5091 3.4047 1.7962 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7155 1.9001 1.7603 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0454 1.4864 0.4971 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4739 0.1726 0.5307 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4115 -0.4539 -0.6961 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7491 -1.6681 -0.6653 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5823 -1.8242 -1.5748 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3398 -1.6575 -1.0536 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4191 -0.9241 -1.7391 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3744 -1.8794 -2.2489 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7188 -2.2631 -1.3094 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0529 -1.2132 -0.2753 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3370 -1.7069 0.9636 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5814 0.0706 -0.8442 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2883 1.2825 -0.3720 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7431 1.2015 -0.7706 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3467 -0.1737 -0.7092 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6298 -0.6052 -2.1331 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5183 -1.1375 0.0886 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7413 -0.9620 1.5630 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5320 0.2318 2.0017 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8286 0.3023 1.3172 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5524 1.6186 1.3875 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4644 1.6825 2.6025 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6871 1.5325 3.8845 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4305 0.6537 2.4946 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2362 2.9661 2.7116 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4044 4.1771 2.8127 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4890 4.9720 3.8678 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7028 6.2099 4.0714 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3912 7.3632 3.3705 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2612 6.0862 3.6219 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6594 6.5363 5.4311 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2994 1.6837 0.1357 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3213 2.3008 -0.0763 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5955 0.8526 -0.8733 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7594 -0.1651 -0.1055 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4564 -1.4743 -0.1805 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6943 -2.0521 -1.3862 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4060 -3.2290 -1.1793 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7232 -3.1114 -1.6327 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4391 -4.2714 -1.5680 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6067 -4.7998 -0.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3582 -5.9909 -0.1762 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8869 -5.3369 -2.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1689 -6.6036 -1.9713 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4250 -5.1626 -2.7736 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8541 -6.4287 -2.8903 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7216 -4.4468 -1.6424 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4400 -4.1656 -2.0823 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9181 0.2291 -0.9702 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6146 0.5994 0.2758 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0427 1.4869 -1.8729 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7124 -3.1614 -2.0856 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6790 -3.1387 -3.0549 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0265 -2.9957 -2.3939 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6700 -4.2499 -2.4923 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8089 -2.7329 -0.9253 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5276 -3.9126 -0.2374 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9355 0.2339 0.9984 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7544 0.8910 0.1078 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8006 0.0915 -0.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0302 0.5218 0.1564 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5927 1.5684 -0.5237 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9950 1.2167 -1.0385 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8382 0.8968 0.0015 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7382 2.1151 -1.6221 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5140 3.0493 -2.3152 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3350 1.0409 -2.6112 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3687 1.6144 -3.4456 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7698 -0.1057 -1.8204 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3982 -1.3174 -2.1487 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0115 1.0066 2.3070 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9457 2.0367 2.2425 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6906 1.4789 2.8062 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9476 2.5868 3.6460 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2188 3.6580 2.8446 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6422 3.6439 1.1522 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4153 3.9642 1.5600 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7232 1.4416 2.0461 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9161 -0.4220 1.2914 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4062 -1.8643 0.3794 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7011 -1.2171 -2.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9318 -0.5538 -2.6707 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1110 -1.4236 -3.1317 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9245 -2.7582 -2.6624 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3386 -3.1812 -0.7633 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5761 -2.6468 -1.8785 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0710 -0.9719 1.6222 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5239 -2.4041 0.7265 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0342 -2.4711 1.4307 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8459 0.0429 -1.9514 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8233 2.1546 -0.9314 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1144 1.5349 0.6878 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2792 1.9621 -0.1802 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7902 1.6084 -1.8262 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5909 -1.6760 -2.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9855 -0.1169 -2.8929 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6452 -0.2209 -2.4704 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8993 -2.1532 -0.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8208 -0.8548 2.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2471 -1.8590 2.0270 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7096 0.0202 3.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9727 1.1838 2.0565 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5203 -0.4023 1.8881 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8539 2.4760 1.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2109 2.0980 4.7285 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6932 0.4871 4.2694 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6977 2.0088 3.8476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6074 0.3622 3.4284 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0672 3.0631 1.9712 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7991 2.8712 3.6919 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6906 4.4844 2.0508 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1992 4.7006 4.6666 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9886 7.4585 2.3506 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2344 8.3235 3.8749 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4793 7.1545 3.3306 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7733 7.0478 3.9361 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8152 5.2129 4.1431 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2520 6.0271 2.5339 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5502 7.5108 5.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3351 0.3507 -1.5553 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9701 1.4905 -1.5481 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4983 -1.2775 0.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0639 -2.2319 0.5393 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5284 -3.3305 -0.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4691 -4.0457 -1.9189 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6439 -4.9751 0.3537 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1778 -4.0939 0.4869 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4473 -6.3930 0.7008 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4107 -5.2496 -3.4565 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0587 -6.8906 -2.3107 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2530 -4.6639 -3.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3202 -6.5447 -3.7124 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5801 -5.2206 -0.8279 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4288 -3.8616 -3.0252 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3770 1.4151 0.0829 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8695 1.1559 0.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1634 -0.1741 0.8018 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9771 1.3587 -2.4937 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2099 1.5469 -2.5759 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2155 2.3954 -1.2681 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6067 -4.1150 -3.6012 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5150 -2.3560 -3.8268 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6494 -2.2179 -2.8775 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4862 -4.1541 -3.0749 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7619 -2.3535 -0.5323 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1088 -4.6104 -0.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2832 -0.8031 1.1520 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6515 -0.9197 0.1418 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7533 2.4067 0.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8590 0.4115 -1.7835 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4343 2.0776 -1.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0886 -0.0519 -0.0813 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8817 2.6505 -1.1942 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0580 3.6007 -1.7072 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1939 0.7603 -3.2417 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5355 2.5729 -3.5043 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7169 -0.2213 -2.1284 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6682 -1.2362 -3.1117 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4196 0.3025 3.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7569 2.6901 1.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2581 0.7127 3.5014 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8954 2.7582 3.7611 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 23 34 1 0 34 35 2 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 14 51 1 0 51 52 1 0 51 53 1 0 7 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 4 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 60 73 1 0 73 74 1 0 73 75 1 0 75 76 1 0 75 2 1 0 58 6 1 0 71 62 1 0 51 9 1 0 19 12 1 0 37 22 1 0 49 40 1 0 37 17 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 0 4 81 1 0 6 82 1 0 7 83 1 0 9 84 1 0 10 85 1 0 10 86 1 0 11 87 1 0 11 88 1 0 13 89 1 0 13 90 1 0 13 91 1 0 14 92 1 0 15 93 1 0 15 94 1 0 16 95 1 0 16 96 1 0 18 97 1 0 18 98 1 0 18 99 1 0 19100 1 0 20101 1 0 20102 1 0 21103 1 0 21104 1 0 22105 1 0 23106 1 0 25107 1 0 25108 1 0 25109 1 0 26110 1 0 27111 1 0 27112 1 0 28113 1 0 29114 1 0 31115 1 0 31116 1 0 31117 1 0 32118 1 0 32119 1 0 32120 1 0 33121 1 0 36122 1 0 36123 1 0 38124 1 0 38125 1 0 40126 1 0 42127 1 0 43128 1 0 43129 1 0 44130 1 0 45131 1 0 46132 1 0 47133 1 0 48134 1 0 49135 1 0 50136 1 0 52137 1 0 52138 1 0 52139 1 0 53140 1 0 53141 1 0 53142 1 0 55143 1 0 55144 1 0 56145 1 0 57146 1 0 58147 1 0 59148 1 0 60149 1 0 62150 1 0 64151 1 0 65152 1 0 65153 1 0 66154 1 0 67155 1 0 68156 1 0 69157 1 0 70158 1 0 71159 1 0 72160 1 0 73161 1 0 74162 1 0 75163 1 0 76164 1 0 M END PDB for HMDB0040662 (Hoduloside X)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 2.962 -4.778 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 24.549 8.401 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 26.376 7.215 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 12.641 -4.417 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 14.621 -4.417 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 14.964 0.613 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 17.617 0.616 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 19.441 3.800 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 22.888 5.109 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 17.631 2.153 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 16.298 1.383 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 16.298 -3.237 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 12.297 -0.927 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 23.363 6.574 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 21.381 4.789 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 13.631 -0.157 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 17.632 -2.467 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 20.430 -0.632 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 18.364 -7.188 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 5.630 -12.478 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 8.296 -0.158 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 19.126 -1.688 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 4.295 -5.548 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 18.965 1.384 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 21.335 0.614 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 6.962 -0.928 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 19.610 -6.283 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 6.963 -11.708 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 14.965 -2.467 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 16.298 -0.157 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 12.297 -2.467 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 20.430 1.860 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 4.295 -7.088 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 6.962 -2.468 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 21.017 -6.909 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 8.297 -12.478 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 22.262 -6.004 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 9.631 -11.708 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 5.629 -7.858 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 22.101 -4.472 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 9.631 -10.167 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 8.296 -3.238 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 6.963 -7.088 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 20.695 -3.846 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 8.297 -9.398 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 9.630 -2.467 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 6.963 -5.548 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 24.870 6.894 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 13.631 -3.237 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 14.964 -0.927 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 17.632 -0.927 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 20.906 3.324 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 18.966 -0.156 0.000 0.00 0.00 C+0 HETATM 54 O UNK 0 18.525 -8.719 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 4.296 -11.708 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 22.875 0.614 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 5.629 -0.158 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 2.962 -7.858 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 5.629 -3.238 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 21.178 -8.441 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 8.297 -14.018 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 23.670 -6.630 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 10.964 -12.477 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 5.629 -9.398 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 23.347 -3.567 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 10.964 -9.397 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 25.190 5.388 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 22.370 2.849 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 9.630 -0.927 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 20.533 -2.314 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 5.629 -4.778 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 19.449 -4.751 0.000 0.00 0.00 O+0 HETATM 73 O UNK 0 6.963 -10.168 0.000 0.00 0.00 O+0 HETATM 74 O UNK 0 10.963 -3.237 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 8.297 -7.858 0.000 0.00 0.00 O+0 HETATM 76 O UNK 0 8.296 -4.778 0.000 0.00 0.00 O+0 CONECT 1 23 CONECT 2 48 CONECT 3 48 CONECT 4 49 CONECT 5 49 CONECT 6 50 CONECT 7 51 CONECT 8 52 CONECT 9 14 15 CONECT 10 11 24 CONECT 11 10 30 CONECT 12 17 29 CONECT 13 16 31 CONECT 14 9 48 CONECT 15 9 52 CONECT 16 13 50 CONECT 17 12 51 CONECT 18 25 53 CONECT 19 27 54 CONECT 20 28 55 CONECT 21 26 69 CONECT 22 53 70 CONECT 23 1 33 71 CONECT 24 10 32 53 CONECT 25 18 32 56 CONECT 26 21 34 57 CONECT 27 19 35 72 CONECT 28 20 36 73 CONECT 29 12 49 50 CONECT 30 11 50 51 CONECT 31 13 49 74 CONECT 32 24 25 52 CONECT 33 23 39 58 CONECT 34 26 42 59 CONECT 35 27 37 60 CONECT 36 28 38 61 CONECT 37 35 40 62 CONECT 38 36 41 63 CONECT 39 33 43 64 CONECT 40 37 44 65 CONECT 41 38 45 66 CONECT 42 34 46 76 CONECT 43 39 47 75 CONECT 44 40 70 72 CONECT 45 41 73 75 CONECT 46 42 69 74 CONECT 47 43 71 76 CONECT 48 2 3 14 67 CONECT 49 4 5 29 31 CONECT 50 6 16 29 30 CONECT 51 7 17 30 53 CONECT 52 8 15 32 68 CONECT 53 18 22 24 51 CONECT 54 19 CONECT 55 20 CONECT 56 25 CONECT 57 26 CONECT 58 33 CONECT 59 34 CONECT 60 35 CONECT 61 36 CONECT 62 37 CONECT 63 38 CONECT 64 39 CONECT 65 40 CONECT 66 41 CONECT 67 48 CONECT 68 52 CONECT 69 21 46 CONECT 70 22 44 CONECT 71 23 47 CONECT 72 27 44 CONECT 73 28 45 CONECT 74 31 46 CONECT 75 43 45 CONECT 76 42 47 MASTER 0 0 0 0 0 0 0 0 76 0 166 0 END 3D PDB for HMDB0040662 (Hoduloside X)COMPND HMDB0040662 HETATM 1 C1 UNL 1 4.509 3.405 1.796 1.00 0.00 C HETATM 2 C2 UNL 1 4.716 1.900 1.760 1.00 0.00 C HETATM 3 O1 UNL 1 5.045 1.486 0.497 1.00 0.00 O HETATM 4 C3 UNL 1 5.474 0.173 0.531 1.00 0.00 C HETATM 5 O2 UNL 1 5.411 -0.454 -0.696 1.00 0.00 O HETATM 6 C4 UNL 1 4.749 -1.668 -0.665 1.00 0.00 C HETATM 7 C5 UNL 1 3.582 -1.824 -1.575 1.00 0.00 C HETATM 8 O3 UNL 1 2.340 -1.658 -1.054 1.00 0.00 O HETATM 9 C6 UNL 1 1.419 -0.924 -1.739 1.00 0.00 C HETATM 10 C7 UNL 1 0.374 -1.879 -2.249 1.00 0.00 C HETATM 11 C8 UNL 1 -0.719 -2.263 -1.309 1.00 0.00 C HETATM 12 C9 UNL 1 -1.053 -1.213 -0.275 1.00 0.00 C HETATM 13 C10 UNL 1 -0.337 -1.707 0.964 1.00 0.00 C HETATM 14 C11 UNL 1 -0.581 0.071 -0.844 1.00 0.00 C HETATM 15 C12 UNL 1 -1.288 1.283 -0.372 1.00 0.00 C HETATM 16 C13 UNL 1 -2.743 1.201 -0.771 1.00 0.00 C HETATM 17 C14 UNL 1 -3.347 -0.174 -0.709 1.00 0.00 C HETATM 18 C15 UNL 1 -3.630 -0.605 -2.133 1.00 0.00 C HETATM 19 C16 UNL 1 -2.518 -1.137 0.089 1.00 0.00 C HETATM 20 C17 UNL 1 -2.741 -0.962 1.563 1.00 0.00 C HETATM 21 C18 UNL 1 -3.532 0.232 2.002 1.00 0.00 C HETATM 22 C19 UNL 1 -4.829 0.302 1.317 1.00 0.00 C HETATM 23 C20 UNL 1 -5.552 1.619 1.388 1.00 0.00 C HETATM 24 C21 UNL 1 -6.464 1.683 2.603 1.00 0.00 C HETATM 25 C22 UNL 1 -5.687 1.533 3.885 1.00 0.00 C HETATM 26 O4 UNL 1 -7.431 0.654 2.495 1.00 0.00 O HETATM 27 C23 UNL 1 -7.236 2.966 2.712 1.00 0.00 C HETATM 28 C24 UNL 1 -6.404 4.177 2.813 1.00 0.00 C HETATM 29 C25 UNL 1 -6.489 4.972 3.868 1.00 0.00 C HETATM 30 C26 UNL 1 -5.703 6.210 4.071 1.00 0.00 C HETATM 31 C27 UNL 1 -6.391 7.363 3.371 1.00 0.00 C HETATM 32 C28 UNL 1 -4.261 6.086 3.622 1.00 0.00 C HETATM 33 O5 UNL 1 -5.659 6.536 5.431 1.00 0.00 O HETATM 34 C29 UNL 1 -6.299 1.684 0.136 1.00 0.00 C HETATM 35 O6 UNL 1 -7.321 2.301 -0.076 1.00 0.00 O HETATM 36 C30 UNL 1 -5.596 0.853 -0.873 1.00 0.00 C HETATM 37 C31 UNL 1 -4.759 -0.165 -0.106 1.00 0.00 C HETATM 38 C32 UNL 1 -5.456 -1.474 -0.180 1.00 0.00 C HETATM 39 O7 UNL 1 -5.694 -2.052 -1.386 1.00 0.00 O HETATM 40 C33 UNL 1 -6.406 -3.229 -1.179 1.00 0.00 C HETATM 41 O8 UNL 1 -7.723 -3.111 -1.633 1.00 0.00 O HETATM 42 C34 UNL 1 -8.439 -4.271 -1.568 1.00 0.00 C HETATM 43 C35 UNL 1 -8.607 -4.800 -0.147 1.00 0.00 C HETATM 44 O9 UNL 1 -9.358 -5.991 -0.176 1.00 0.00 O HETATM 45 C36 UNL 1 -7.887 -5.337 -2.481 1.00 0.00 C HETATM 46 O10 UNL 1 -8.169 -6.604 -1.971 1.00 0.00 O HETATM 47 C37 UNL 1 -6.425 -5.163 -2.774 1.00 0.00 C HETATM 48 O11 UNL 1 -5.854 -6.429 -2.890 1.00 0.00 O HETATM 49 C38 UNL 1 -5.722 -4.447 -1.642 1.00 0.00 C HETATM 50 O12 UNL 1 -4.440 -4.166 -2.082 1.00 0.00 O HETATM 51 C39 UNL 1 0.918 0.229 -0.970 1.00 0.00 C HETATM 52 C40 UNL 1 1.615 0.599 0.276 1.00 0.00 C HETATM 53 C41 UNL 1 1.043 1.487 -1.873 1.00 0.00 C HETATM 54 O13 UNL 1 3.712 -3.161 -2.086 1.00 0.00 O HETATM 55 C42 UNL 1 4.679 -3.139 -3.055 1.00 0.00 C HETATM 56 C43 UNL 1 6.027 -2.996 -2.394 1.00 0.00 C HETATM 57 O14 UNL 1 6.670 -4.250 -2.492 1.00 0.00 O HETATM 58 C44 UNL 1 5.809 -2.733 -0.925 1.00 0.00 C HETATM 59 O15 UNL 1 5.528 -3.913 -0.237 1.00 0.00 O HETATM 60 C45 UNL 1 6.936 0.234 0.998 1.00 0.00 C HETATM 61 O16 UNL 1 7.754 0.891 0.108 1.00 0.00 O HETATM 62 C46 UNL 1 8.801 0.092 -0.345 1.00 0.00 C HETATM 63 O17 UNL 1 10.030 0.522 0.156 1.00 0.00 O HETATM 64 C47 UNL 1 10.593 1.568 -0.524 1.00 0.00 C HETATM 65 C48 UNL 1 11.995 1.217 -1.038 1.00 0.00 C HETATM 66 O18 UNL 1 12.838 0.897 0.002 1.00 0.00 O HETATM 67 C49 UNL 1 9.738 2.115 -1.622 1.00 0.00 C HETATM 68 O19 UNL 1 10.514 3.049 -2.315 1.00 0.00 O HETATM 69 C50 UNL 1 9.335 1.041 -2.611 1.00 0.00 C HETATM 70 O20 UNL 1 8.369 1.614 -3.446 1.00 0.00 O HETATM 71 C51 UNL 1 8.770 -0.106 -1.820 1.00 0.00 C HETATM 72 O21 UNL 1 9.398 -1.317 -2.149 1.00 0.00 O HETATM 73 C52 UNL 1 7.012 1.007 2.307 1.00 0.00 C HETATM 74 O22 UNL 1 7.946 2.037 2.242 1.00 0.00 O HETATM 75 C53 UNL 1 5.691 1.479 2.806 1.00 0.00 C HETATM 76 O23 UNL 1 5.948 2.587 3.646 1.00 0.00 O HETATM 77 H1 UNL 1 4.219 3.658 2.845 1.00 0.00 H HETATM 78 H2 UNL 1 3.642 3.644 1.152 1.00 0.00 H HETATM 79 H3 UNL 1 5.415 3.964 1.560 1.00 0.00 H HETATM 80 H4 UNL 1 3.723 1.442 2.046 1.00 0.00 H HETATM 81 H5 UNL 1 4.916 -0.422 1.291 1.00 0.00 H HETATM 82 H6 UNL 1 4.406 -1.864 0.379 1.00 0.00 H HETATM 83 H7 UNL 1 3.701 -1.217 -2.484 1.00 0.00 H HETATM 84 H8 UNL 1 1.932 -0.554 -2.671 1.00 0.00 H HETATM 85 H9 UNL 1 -0.111 -1.424 -3.132 1.00 0.00 H HETATM 86 H10 UNL 1 0.925 -2.758 -2.662 1.00 0.00 H HETATM 87 H11 UNL 1 -0.339 -3.181 -0.763 1.00 0.00 H HETATM 88 H12 UNL 1 -1.576 -2.647 -1.878 1.00 0.00 H HETATM 89 H13 UNL 1 0.071 -0.972 1.622 1.00 0.00 H HETATM 90 H14 UNL 1 0.524 -2.404 0.726 1.00 0.00 H HETATM 91 H15 UNL 1 -1.034 -2.471 1.431 1.00 0.00 H HETATM 92 H16 UNL 1 -0.846 0.043 -1.951 1.00 0.00 H HETATM 93 H17 UNL 1 -0.823 2.155 -0.931 1.00 0.00 H HETATM 94 H18 UNL 1 -1.114 1.535 0.688 1.00 0.00 H HETATM 95 H19 UNL 1 -3.279 1.962 -0.180 1.00 0.00 H HETATM 96 H20 UNL 1 -2.790 1.608 -1.826 1.00 0.00 H HETATM 97 H21 UNL 1 -3.591 -1.676 -2.285 1.00 0.00 H HETATM 98 H22 UNL 1 -2.986 -0.117 -2.893 1.00 0.00 H HETATM 99 H23 UNL 1 -4.645 -0.221 -2.470 1.00 0.00 H HETATM 100 H24 UNL 1 -2.899 -2.153 -0.175 1.00 0.00 H HETATM 101 H25 UNL 1 -1.821 -0.855 2.177 1.00 0.00 H HETATM 102 H26 UNL 1 -3.247 -1.859 2.027 1.00 0.00 H HETATM 103 H27 UNL 1 -3.710 0.020 3.112 1.00 0.00 H HETATM 104 H28 UNL 1 -2.973 1.184 2.056 1.00 0.00 H HETATM 105 H29 UNL 1 -5.520 -0.402 1.888 1.00 0.00 H HETATM 106 H30 UNL 1 -4.854 2.476 1.535 1.00 0.00 H HETATM 107 H31 UNL 1 -6.211 2.098 4.729 1.00 0.00 H HETATM 108 H32 UNL 1 -5.693 0.487 4.269 1.00 0.00 H HETATM 109 H33 UNL 1 -4.698 2.009 3.848 1.00 0.00 H HETATM 110 H34 UNL 1 -7.607 0.362 3.428 1.00 0.00 H HETATM 111 H35 UNL 1 -8.067 3.063 1.971 1.00 0.00 H HETATM 112 H36 UNL 1 -7.799 2.871 3.692 1.00 0.00 H HETATM 113 H37 UNL 1 -5.691 4.484 2.051 1.00 0.00 H HETATM 114 H38 UNL 1 -7.199 4.701 4.667 1.00 0.00 H HETATM 115 H39 UNL 1 -5.989 7.459 2.351 1.00 0.00 H HETATM 116 H40 UNL 1 -6.234 8.323 3.875 1.00 0.00 H HETATM 117 H41 UNL 1 -7.479 7.155 3.331 1.00 0.00 H HETATM 118 H42 UNL 1 -3.773 7.048 3.936 1.00 0.00 H HETATM 119 H43 UNL 1 -3.815 5.213 4.143 1.00 0.00 H HETATM 120 H44 UNL 1 -4.252 6.027 2.534 1.00 0.00 H HETATM 121 H45 UNL 1 -5.550 7.511 5.573 1.00 0.00 H HETATM 122 H46 UNL 1 -6.335 0.351 -1.555 1.00 0.00 H HETATM 123 H47 UNL 1 -4.970 1.491 -1.548 1.00 0.00 H HETATM 124 H48 UNL 1 -6.498 -1.277 0.245 1.00 0.00 H HETATM 125 H49 UNL 1 -5.064 -2.232 0.539 1.00 0.00 H HETATM 126 H50 UNL 1 -6.528 -3.331 -0.058 1.00 0.00 H HETATM 127 H51 UNL 1 -9.469 -4.046 -1.919 1.00 0.00 H HETATM 128 H52 UNL 1 -7.644 -4.975 0.354 1.00 0.00 H HETATM 129 H53 UNL 1 -9.178 -4.094 0.487 1.00 0.00 H HETATM 130 H54 UNL 1 -9.447 -6.393 0.701 1.00 0.00 H HETATM 131 H55 UNL 1 -8.411 -5.250 -3.456 1.00 0.00 H HETATM 132 H56 UNL 1 -9.059 -6.891 -2.311 1.00 0.00 H HETATM 133 H57 UNL 1 -6.253 -4.664 -3.762 1.00 0.00 H HETATM 134 H58 UNL 1 -5.320 -6.545 -3.712 1.00 0.00 H HETATM 135 H59 UNL 1 -5.580 -5.221 -0.828 1.00 0.00 H HETATM 136 H60 UNL 1 -4.429 -3.862 -3.025 1.00 0.00 H HETATM 137 H61 UNL 1 2.377 1.415 0.083 1.00 0.00 H HETATM 138 H62 UNL 1 0.869 1.156 0.922 1.00 0.00 H HETATM 139 H63 UNL 1 2.163 -0.174 0.802 1.00 0.00 H HETATM 140 H64 UNL 1 1.977 1.359 -2.494 1.00 0.00 H HETATM 141 H65 UNL 1 0.210 1.547 -2.576 1.00 0.00 H HETATM 142 H66 UNL 1 1.215 2.395 -1.268 1.00 0.00 H HETATM 143 H67 UNL 1 4.607 -4.115 -3.601 1.00 0.00 H HETATM 144 H68 UNL 1 4.515 -2.356 -3.827 1.00 0.00 H HETATM 145 H69 UNL 1 6.649 -2.218 -2.878 1.00 0.00 H HETATM 146 H70 UNL 1 7.486 -4.154 -3.075 1.00 0.00 H HETATM 147 H71 UNL 1 6.762 -2.354 -0.532 1.00 0.00 H HETATM 148 H72 UNL 1 6.109 -4.610 -0.639 1.00 0.00 H HETATM 149 H73 UNL 1 7.283 -0.803 1.152 1.00 0.00 H HETATM 150 H74 UNL 1 8.651 -0.920 0.142 1.00 0.00 H HETATM 151 H75 UNL 1 10.753 2.407 0.211 1.00 0.00 H HETATM 152 H76 UNL 1 11.859 0.411 -1.783 1.00 0.00 H HETATM 153 H77 UNL 1 12.434 2.078 -1.578 1.00 0.00 H HETATM 154 H78 UNL 1 13.089 -0.052 -0.081 1.00 0.00 H HETATM 155 H79 UNL 1 8.882 2.651 -1.194 1.00 0.00 H HETATM 156 H80 UNL 1 11.058 3.601 -1.707 1.00 0.00 H HETATM 157 H81 UNL 1 10.194 0.760 -3.242 1.00 0.00 H HETATM 158 H82 UNL 1 8.536 2.573 -3.504 1.00 0.00 H HETATM 159 H83 UNL 1 7.717 -0.221 -2.128 1.00 0.00 H HETATM 160 H84 UNL 1 9.668 -1.236 -3.112 1.00 0.00 H HETATM 161 H85 UNL 1 7.420 0.302 3.090 1.00 0.00 H HETATM 162 H86 UNL 1 7.757 2.690 1.512 1.00 0.00 H HETATM 163 H87 UNL 1 5.258 0.713 3.501 1.00 0.00 H HETATM 164 H88 UNL 1 6.895 2.758 3.761 1.00 0.00 H CONECT 1 2 77 78 79 CONECT 2 3 75 80 CONECT 3 4 CONECT 4 5 60 81 CONECT 5 6 CONECT 6 7 58 82 CONECT 7 8 54 83 CONECT 8 9 CONECT 9 10 51 84 CONECT 10 11 85 86 CONECT 11 12 87 88 CONECT 12 13 14 19 CONECT 13 89 90 91 CONECT 14 15 51 92 CONECT 15 16 93 94 CONECT 16 17 95 96 CONECT 17 18 19 37 CONECT 18 97 98 99 CONECT 19 20 100 CONECT 20 21 101 102 CONECT 21 22 103 104 CONECT 22 23 37 105 CONECT 23 24 34 106 CONECT 24 25 26 27 CONECT 25 107 108 109 CONECT 26 110 CONECT 27 28 111 112 CONECT 28 29 29 113 CONECT 29 30 114 CONECT 30 31 32 33 CONECT 31 115 116 117 CONECT 32 118 119 120 CONECT 33 121 CONECT 34 35 35 36 CONECT 36 37 122 123 CONECT 37 38 CONECT 38 39 124 125 CONECT 39 40 CONECT 40 41 49 126 CONECT 41 42 CONECT 42 43 45 127 CONECT 43 44 128 129 CONECT 44 130 CONECT 45 46 47 131 CONECT 46 132 CONECT 47 48 49 133 CONECT 48 134 CONECT 49 50 135 CONECT 50 136 CONECT 51 52 53 CONECT 52 137 138 139 CONECT 53 140 141 142 CONECT 54 55 CONECT 55 56 143 144 CONECT 56 57 58 145 CONECT 57 146 CONECT 58 59 147 CONECT 59 148 CONECT 60 61 73 149 CONECT 61 62 CONECT 62 63 71 150 CONECT 63 64 CONECT 64 65 67 151 CONECT 65 66 152 153 CONECT 66 154 CONECT 67 68 69 155 CONECT 68 156 CONECT 69 70 71 157 CONECT 70 158 CONECT 71 72 159 CONECT 72 160 CONECT 73 74 75 161 CONECT 74 162 CONECT 75 76 163 CONECT 76 164 END SMILES for HMDB0040662 (Hoduloside X)CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CCC3C(C(=O)CC43COC3OC(CO)C(O)C(O)C3O)C(C)(O)C\C=C\C(C)(C)O)C2(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O INCHI for HMDB0040662 (Hoduloside X)InChI=1S/C53H88O23/c1-23-33(58)39(64)43(75-45-41(66)38(63)36(61)28(20-55)73-45)47(71-23)76-42-34(59)26(57)21-69-46(42)74-31-13-16-50(6)29(49(31,4)5)12-17-51(7)30(50)11-10-24-32(52(8,68)15-9-14-48(2,3)67)25(56)18-53(24,51)22-70-44-40(65)37(62)35(60)27(19-54)72-44/h9,14,23-24,26-47,54-55,57-68H,10-13,15-22H2,1-8H3/b14-9+ 3D Structure for HMDB0040662 (Hoduloside X) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C53H88O23 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1093.252 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1092.571639122 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 5-({3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-4,5-dihydroxyoxan-2-yl}oxy)-14-[(4E)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-2,6,6,10-tetramethyl-11-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-13-one | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 5-({3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-4,5-dihydroxyoxan-2-yl}oxy)-14-[(4E)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-2,6,6,10-tetramethyl-11-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-13-one | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 154971-14-9 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CCC3C(C(=O)CC43COC3OC(CO)C(O)C(O)C3O)C(C)(O)C\C=C\C(C)(C)O)C2(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C53H88O23/c1-23-33(58)39(64)43(75-45-41(66)38(63)36(61)28(20-55)73-45)47(71-23)76-42-34(59)26(57)21-69-46(42)74-31-13-16-50(6)29(49(31,4)5)12-17-51(7)30(50)11-10-24-32(52(8,68)15-9-14-48(2,3)67)25(56)18-53(24,51)22-70-44-40(65)37(62)35(60)27(19-54)72-44/h9,14,23-24,26-47,54-55,57-68H,10-13,15-22H2,1-8H3/b14-9+ | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | MCLHEEFYPPASJO-NTEUORMPSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB020457 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131752896 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|