Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-12 02:15:11 UTC |
---|
Update Date | 2022-03-07 02:56:41 UTC |
---|
HMDB ID | HMDB0040680 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Melitric acid B |
---|
Description | Melitric acid B, also known as melitrate b, belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Melitric acid B has been detected, but not quantified in, several different foods, such as teas (Camellia sinensis), green tea, black tea, red tea, and herbal tea. This could make melitric acid b a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Melitric acid B. |
---|
Structure | OC(=O)C(CC1=CC(O)=C(O)C=C1)OC(=O)\C=C\C1=CC2=C(O\C(=C/C3=CC(O)=C(O)C=C3)C(=O)O2)C=C1 InChI=1S/C27H20O11/c28-17-5-1-15(9-19(17)30)12-23(26(33)34)37-25(32)8-4-14-3-7-21-22(11-14)38-27(35)24(36-21)13-16-2-6-18(29)20(31)10-16/h1-11,13,23,28-31H,12H2,(H,33,34)/b8-4+,24-13- |
---|
Synonyms | Value | Source |
---|
Melitrate b | Generator | 3-(3,4-Dihydroxyphenyl)-2-{[(2E)-3-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-3-oxo-2,3-dihydro-1,4-benzodioxin-6-yl]prop-2-enoyl]oxy}propanoate | HMDB |
|
---|
Chemical Formula | C27H20O11 |
---|
Average Molecular Weight | 520.4411 |
---|
Monoisotopic Molecular Weight | 520.100561482 |
---|
IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-{[(2E)-3-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-3-oxo-2,3-dihydro-1,4-benzodioxin-6-yl]prop-2-enoyl]oxy}propanoic acid |
---|
Traditional Name | 3-(3,4-dihydroxyphenyl)-2-{[(2E)-3-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-3-oxo-1,4-benzodioxin-6-yl]prop-2-enoyl]oxy}propanoic acid |
---|
CAS Registry Number | 153765-46-9 |
---|
SMILES | OC(=O)C(CC1=CC(O)=C(O)C=C1)OC(=O)\C=C\C1=CC2=C(O\C(=C/C3=CC(O)=C(O)C=C3)C(=O)O2)C=C1 |
---|
InChI Identifier | InChI=1S/C27H20O11/c28-17-5-1-15(9-19(17)30)12-23(26(33)34)37-25(32)8-4-14-3-7-21-22(11-14)38-27(35)24(36-21)13-16-2-6-18(29)20(31)10-16/h1-11,13,23,28-31H,12H2,(H,33,34)/b8-4+,24-13- |
---|
InChI Key | QKDZPQYDQYXJCV-YIZZYABDSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. |
---|
Kingdom | Organic compounds |
---|
Super Class | Phenylpropanoids and polyketides |
---|
Class | Cinnamic acids and derivatives |
---|
Sub Class | Hydroxycinnamic acids and derivatives |
---|
Direct Parent | Coumaric acids and derivatives |
---|
Alternative Parents | |
---|
Substituents | - Coumaric acid or derivatives
- 3-phenylpropanoic-acid
- Benzo-1,4-dioxane
- Benzodioxane
- Tricarboxylic acid or derivatives
- Catechol
- Styrene
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Fatty acid ester
- Phenol
- Monocyclic benzene moiety
- Fatty acyl
- Benzenoid
- Para-dioxin
- Alpha,beta-unsaturated carboxylic ester
- Enoate ester
- Carboxylic acid ester
- Lactone
- Carboxylic acid derivative
- Oxacycle
- Carboxylic acid
- Organoheterocyclic compound
- Carbonyl group
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Aromatic heteropolycyclic compound
|
---|
Molecular Framework | Aromatic heteropolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | 133 - 135 °C | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | 125.7 mg/L @ 25 °C (est) | The Good Scents Company Information System | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Melitric acid B,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 5045.1 | Semi standard non polar | 33892256 | Melitric acid B,1TMS,isomer #2 | C[Si](C)(C)OC1=CC(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O)=C4)C(=O)OC3=C2)C(=O)O)=CC=C1O | 5092.9 | Semi standard non polar | 33892256 | Melitric acid B,1TMS,isomer #3 | C[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O)=C4)C(=O)OC3=C2)C(=O)O)C=C1O | 5105.0 | Semi standard non polar | 33892256 | Melitric acid B,1TMS,isomer #4 | C[Si](C)(C)OC1=CC(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O)=C4)C(=O)O)C=C3OC2=O)=CC=C1O | 5099.0 | Semi standard non polar | 33892256 | Melitric acid B,1TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O)=C4)C(=O)O)C=C3OC2=O)C=C1O | 5097.0 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 4899.2 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #10 | C[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O)=C4)C(=O)O)C=C3OC2=O)C=C1O[Si](C)(C)C | 4933.1 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 4880.2 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(=O)OC2=C1 | 4886.5 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #4 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4880.7 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O[Si](C)(C)C)=C4)C(=O)O)C=C3OC2=O)C=C1O | 4957.0 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #6 | C[Si](C)(C)OC1=CC(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O[Si](C)(C)C)=C4)C(=O)O)C=C3OC2=O)=CC=C1O | 4949.7 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O)=C4)C(=O)OC3=C2)C(=O)O)C=C1O[Si](C)(C)C | 4941.2 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #8 | C[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C)C(O)=C4)C(=O)O)C=C3OC2=O)C=C1O | 4974.3 | Semi standard non polar | 33892256 | Melitric acid B,2TMS,isomer #9 | C[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(=O)OC3=C2)C(=O)O)C=C1O | 4972.4 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 4771.7 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #10 | C[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(=O)OC3=C2)C(=O)O)C=C1O | 4860.1 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(=O)OC2=C1 | 4821.2 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4815.0 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(=O)OC2=C1 | 4809.8 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #5 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4799.7 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #6 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4772.3 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(=O)O)C=C3OC2=O)C=C1O | 4856.9 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #8 | C[Si](C)(C)OC1=CC(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(=O)OC3=C2)C(=O)O)=CC=C1O | 4842.1 | Semi standard non polar | 33892256 | Melitric acid B,3TMS,isomer #9 | C[Si](C)(C)OC1=CC(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(=O)O)C=C3OC2=O)=CC=C1O | 4832.0 | Semi standard non polar | 33892256 | Melitric acid B,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(=O)OC2=C1 | 4751.2 | Semi standard non polar | 33892256 | Melitric acid B,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4728.7 | Semi standard non polar | 33892256 | Melitric acid B,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4756.0 | Semi standard non polar | 33892256 | Melitric acid B,4TMS,isomer #4 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4739.2 | Semi standard non polar | 33892256 | Melitric acid B,4TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(=O)O)C=C3OC2=O)C=C1O[Si](C)(C)C | 4764.6 | Semi standard non polar | 33892256 | Melitric acid B,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(=O)OC2=C1 | 4697.4 | Semi standard non polar | 33892256 | Melitric acid B,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 5373.6 | Semi standard non polar | 33892256 | Melitric acid B,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O)=C4)C(=O)OC3=C2)C(=O)O)=CC=C1O | 5392.1 | Semi standard non polar | 33892256 | Melitric acid B,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O)=C4)C(=O)OC3=C2)C(=O)O)C=C1O | 5416.4 | Semi standard non polar | 33892256 | Melitric acid B,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O)=C4)C(=O)O)C=C3OC2=O)=CC=C1O | 5397.0 | Semi standard non polar | 33892256 | Melitric acid B,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O)=C4)C(=O)O)C=C3OC2=O)C=C1O | 5399.8 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 5522.0 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O)=C4)C(=O)O)C=C3OC2=O)C=C1O[Si](C)(C)C(C)(C)C | 5509.4 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 5498.7 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(=O)OC2=C1 | 5500.3 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C(=O)OC2=C1 | 5498.3 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)O)C=C3OC2=O)C=C1O | 5577.9 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)O)C=C3OC2=O)=CC=C1O | 5577.0 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O)=C4)C(=O)OC3=C2)C(=O)O)C=C1O[Si](C)(C)C(C)(C)C | 5524.5 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)C(=O)O)C=C3OC2=O)C=C1O | 5599.6 | Semi standard non polar | 33892256 | Melitric acid B,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)OC3=C2)C(=O)O)C=C1O | 5608.8 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O)=C3)C(=O)OC2=C1 | 5576.8 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)OC3=C2)C(=O)O)C=C1O | 5701.3 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(=O)OC2=C1 | 5715.5 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C(=O)OC2=C1 | 5718.4 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(=O)OC2=C1 | 5662.5 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C(=O)OC2=C1 | 5665.2 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)C(CC1=CC=C(O)C(O)=C1)OC(=O)/C=C/C1=CC=C2O/C(=C\C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)C(=O)OC2=C1 | 5562.8 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)O)C=C3OC2=O)C=C1O | 5705.2 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC(CC(OC(=O)/C=C/C2=CC=C3O/C(=C\C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)OC3=C2)C(=O)O)=CC=C1O | 5658.1 | Semi standard non polar | 33892256 | Melitric acid B,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC(/C=C2\OC3=CC=C(/C=C/C(=O)OC(CC4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)C(=O)O)C=C3OC2=O)=CC=C1O | 5685.2 | Semi standard non polar | 33892256 |
|
---|