Showing metabocard for Phytolaccoside I (HMDB0040810)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 02:23:53 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:44 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0040810 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Phytolaccoside I | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Phytolaccoside I belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a small amount of articles have been published on Phytolaccoside I. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0040810 (Phytolaccoside I)Mrv0541 05061312092D 66 73 0 0 0 0 999 V2000 3.4203 1.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2140 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9291 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6440 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6428 2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 3.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3590 3.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6440 4.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1119 4.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9291 3.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9304 3.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2153 2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5003 3.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7867 2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7867 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5003 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5003 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7854 0.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0704 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 2.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3567 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3568 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3568 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 0.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 0.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 0.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 1.3591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 1.7717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 -0.7033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -1.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -1.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 -2.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 -3.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 -3.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 -3.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9292 -0.7033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6443 -1.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3592 -0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0729 -1.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1078 -1.2849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1740 -0.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3567 0.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8874 -0.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8929 5.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1734 4.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9861 4.7362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 1.3591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 2.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0729 2.5967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3578 -2.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6443 -1.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 -2.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 -3.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -3.5908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -4.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9292 -4.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 -5.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 -4.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7853 -4.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0731 -4.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9361 0.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 12 1 0 0 0 0 2 16 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 5 11 1 0 0 0 0 5 53 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 8 10 1 0 0 0 0 8 50 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 15 20 1 0 0 0 0 16 17 1 0 0 0 0 16 66 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 19 47 1 0 0 0 0 20 21 1 0 0 0 0 20 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 24 47 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 26 30 1 0 0 0 0 27 28 1 0 0 0 0 27 34 1 0 0 0 0 28 29 1 0 0 0 0 28 32 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 35 41 1 0 0 0 0 36 37 1 0 0 0 0 36 57 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 38 59 1 0 0 0 0 39 40 1 0 0 0 0 39 64 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 42 56 1 0 0 0 0 43 44 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 49 50 2 0 0 0 0 50 51 1 0 0 0 0 52 53 2 0 0 0 0 53 54 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 60 63 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 M END 3D MOL for HMDB0040810 (Phytolaccoside I)HMDB0040810 RDKit 3D Phytolaccoside I 140147 0 0 0 0 0 0 0 0999 V2000 10.2147 2.5319 -1.5501 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4749 1.2891 -0.7492 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6375 0.2372 -1.1118 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3753 0.3533 -0.5352 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5897 -0.6885 -1.0259 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5140 -0.2419 -1.7587 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2471 -0.7825 -1.0780 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9997 -0.1415 0.1173 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7419 0.4555 0.1442 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8721 0.0241 1.2930 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6637 0.6789 1.1687 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5637 -0.1903 0.9785 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0343 0.1854 -0.3961 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1733 -0.5873 -0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1157 -0.9240 0.3264 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9751 -2.4783 0.4361 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8340 -0.3874 1.6775 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9383 0.3968 2.3262 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9308 1.0849 1.5062 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1396 0.6000 0.0909 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4241 1.6241 -0.8016 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5576 -0.7663 -0.1077 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4042 -1.8224 0.5915 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8454 -1.6284 0.2761 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3957 -0.5145 -0.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8480 -0.4688 -0.3895 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7319 0.2153 0.5697 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1612 -0.3181 0.2934 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4365 -1.5539 1.1231 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1690 0.7354 0.6139 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0811 0.5976 1.4593 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1071 1.9579 -0.0607 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2941 -0.6375 -1.1686 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4456 0.3091 -2.0288 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9713 -0.0056 -1.8276 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5952 -1.1646 -2.6954 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2845 -2.2681 -2.2144 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5773 -1.0572 -4.0813 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1793 1.2010 -2.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7320 1.1704 -1.7458 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5749 0.7058 -0.2744 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2211 1.8123 0.5323 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4954 0.2255 1.9514 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4854 1.7135 2.0777 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0110 -0.2741 3.3267 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1705 -1.6542 3.2957 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4680 0.2747 2.5215 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5334 1.1338 2.4785 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2817 2.3426 1.6018 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4293 3.1016 1.5799 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8783 1.9652 0.2134 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6039 2.4920 -0.0135 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5049 -2.1241 -0.8390 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5390 -2.8743 -1.9977 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9664 -4.2801 -1.6364 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0711 -4.8293 -0.7506 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4568 -2.3770 -3.0624 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7299 -2.9410 -2.9902 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4932 -0.8821 -3.1492 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3132 -0.4516 -3.7509 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4093 0.2590 0.9567 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9651 -1.0047 1.3815 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8155 0.4140 1.5009 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4847 -0.7819 1.2830 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4959 1.5324 0.7387 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7971 1.6400 1.2263 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2165 2.2624 -2.6162 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3383 3.1039 -1.2186 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1001 3.2100 -1.3931 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5169 0.9444 -1.0166 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9325 1.3468 -0.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4248 0.8361 -1.8729 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3900 -0.7019 -1.7908 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1903 0.2605 -0.8021 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6725 -1.0813 1.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8769 -1.2395 1.0184 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0887 1.2811 -0.4183 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8783 -0.0103 -1.1022 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7623 -1.5067 -1.3207 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6677 -0.0785 -1.6320 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4936 -2.8351 1.3492 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2488 -2.9534 -0.4946 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9105 -2.7481 0.6160 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7968 -1.3032 2.3837 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4862 -0.1988 3.1312 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4037 1.1695 2.9789 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9034 1.0683 2.0741 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6611 2.1898 1.5136 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5306 1.4488 -1.8607 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8937 2.6396 -0.6003 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3749 1.8011 -0.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6145 -0.9991 -1.1879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3012 -1.8618 1.6641 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1505 -2.8477 0.1879 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4934 -2.5099 0.3807 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2573 -1.5372 -0.4424 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5158 -0.1292 1.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8630 1.3074 0.4458 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2865 -2.4592 0.4743 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7127 -1.6800 1.9546 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4768 -1.4783 1.4962 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7484 2.7947 0.4042 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0600 -1.6804 -1.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3495 -0.4549 -1.4667 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6853 0.0441 -3.0832 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6748 1.3466 -1.7930 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1918 -1.6838 -4.5889 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1500 1.2559 -3.2895 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7381 2.0876 -1.8394 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4085 2.2238 -1.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1877 0.4966 -2.4304 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7425 1.4555 1.4416 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4922 2.5717 0.9049 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9082 2.4593 -0.0970 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2321 2.2597 1.5070 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5002 2.0824 1.7194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4918 2.0061 3.1683 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9741 0.1905 3.5515 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7561 -0.0548 4.1019 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4171 -2.1183 3.9467 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6676 1.5396 3.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5158 0.6433 2.2511 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4807 2.9319 2.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6240 3.3607 2.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5370 2.3630 -0.5733 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5619 3.4141 0.3808 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4818 -2.8754 -2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0697 -4.8524 -2.5819 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9578 -4.1868 -1.1380 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2100 -4.3419 -0.8095 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0367 -2.7329 -4.0511 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4505 -2.2659 -3.0182 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3523 -0.5391 -3.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7359 -1.2139 -3.9990 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7825 1.0009 1.4770 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5512 -0.9753 2.2617 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7297 0.6829 2.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4351 -0.6579 1.4996 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9784 2.4956 1.0063 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7353 2.0574 2.1332 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 2 0 30 32 1 0 28 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 35 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 17 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 10 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 7 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 4 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 65 2 1 0 59 6 1 0 51 9 1 0 43 12 1 0 22 15 1 0 41 25 1 0 41 20 1 0 35 26 1 0 1 67 1 0 1 68 1 0 1 69 1 0 2 70 1 0 4 71 1 0 6 72 1 0 7 73 1 0 9 74 1 0 10 75 1 0 12 76 1 0 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 16 81 1 0 16 82 1 0 16 83 1 0 17 84 1 0 18 85 1 0 18 86 1 0 19 87 1 0 19 88 1 0 21 89 1 0 21 90 1 0 21 91 1 0 22 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 26 96 1 0 27 97 1 0 27 98 1 0 29 99 1 0 29100 1 0 29101 1 0 32102 1 0 33103 1 0 33104 1 0 34105 1 0 34106 1 0 38107 1 0 39108 1 0 39109 1 0 40110 1 0 40111 1 0 42112 1 0 42113 1 0 42114 1 0 44115 1 0 44116 1 0 44117 1 0 45118 1 0 45119 1 0 46120 1 0 48121 1 0 48122 1 0 49123 1 0 50124 1 0 51125 1 0 52126 1 0 54127 1 0 55128 1 0 55129 1 0 56130 1 0 57131 1 0 58132 1 0 59133 1 0 60134 1 0 61135 1 0 62136 1 0 63137 1 0 64138 1 0 65139 1 0 66140 1 0 M END 3D SDF for HMDB0040810 (Phytolaccoside I)Mrv0541 05061312092D 66 73 0 0 0 0 999 V2000 3.4203 1.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2140 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9291 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6440 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6428 2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 3.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3590 3.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6440 4.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1119 4.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9291 3.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9304 3.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2153 2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5003 3.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7867 2.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7867 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5003 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5003 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7854 0.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0704 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 2.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3567 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3568 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3568 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 0.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 0.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 0.1216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 1.3591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 1.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 1.7717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 -0.7033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -1.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -1.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 -2.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 -3.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 -3.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 -3.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9292 -0.7033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6443 -1.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3592 -0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0729 -1.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1078 -1.2849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1740 -0.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3567 0.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8874 -0.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8929 5.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1734 4.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9861 4.7362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 1.3591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3578 2.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0729 2.5967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3578 -2.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6443 -1.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 -2.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9304 -3.1783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -3.5908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 -4.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9292 -4.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5018 -5.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5005 -4.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7853 -4.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0731 -4.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9361 0.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 12 1 0 0 0 0 2 16 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 5 11 1 0 0 0 0 5 53 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 8 10 1 0 0 0 0 8 50 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 15 20 1 0 0 0 0 16 17 1 0 0 0 0 16 66 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 19 47 1 0 0 0 0 20 21 1 0 0 0 0 20 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 24 47 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 26 30 1 0 0 0 0 27 28 1 0 0 0 0 27 34 1 0 0 0 0 28 29 1 0 0 0 0 28 32 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 35 41 1 0 0 0 0 36 37 1 0 0 0 0 36 57 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 38 59 1 0 0 0 0 39 40 1 0 0 0 0 39 64 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 42 56 1 0 0 0 0 43 44 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 49 50 2 0 0 0 0 50 51 1 0 0 0 0 52 53 2 0 0 0 0 53 54 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 60 63 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 M END > <DATABASE_ID> HMDB0040810 > <DATABASE_NAME> hmdb > <SMILES> CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(CCC5(CCC43C)C(O)=O)C(O)=O)C2(C)CO)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C47H74O19/c1-21-29(51)32(54)34(56)37(62-21)65-36-33(55)31(53)25(18-48)63-39(36)66-35-30(52)24(50)19-61-38(35)64-28-10-11-43(3)26(44(28,4)20-49)9-12-46(6)27(43)8-7-22-23-17-42(2,40(57)58)13-15-47(23,41(59)60)16-14-45(22,46)5/h7,21,23-39,48-56H,8-20H2,1-6H3,(H,57,58)(H,59,60) > <INCHI_KEY> ZIGYVPCMVRRVNL-UHFFFAOYSA-N > <FORMULA> C47H74O19 > <MOLECULAR_WEIGHT> 943.0791 > <EXACT_MASS> 942.482430186 > <JCHEM_ACCEPTOR_COUNT> 19 > <JCHEM_AVERAGE_POLARIZABILITY> 100.34367820711005 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 11 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 10-[(3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-4,5-dihydroxyoxan-2-yl)oxy]-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2,4a-dicarboxylic acid > <ALOGPS_LOGP> 0.95 > <JCHEM_LOGP> 0.8704928473333342 > <ALOGPS_LOGS> -3.21 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> -2 > <JCHEM_PKA> 4.7865497740455725 > <JCHEM_PKA_STRONGEST_ACIDIC> 4.11617007379208 > <JCHEM_PKA_STRONGEST_BASIC> -3.6121826294395536 > <JCHEM_POLAR_SURFACE_AREA> 312.05 > <JCHEM_REFRACTIVITY> 226.85010000000014 > <JCHEM_ROTATABLE_BOND_COUNT> 10 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 5.88e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 10-[(3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-4,5-dihydroxyoxan-2-yl)oxy]-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydropicene-2,4a-dicarboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0040810 (Phytolaccoside I)HMDB0040810 RDKit 3D Phytolaccoside I 140147 0 0 0 0 0 0 0 0999 V2000 10.2147 2.5319 -1.5501 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4749 1.2891 -0.7492 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6375 0.2372 -1.1118 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3753 0.3533 -0.5352 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5897 -0.6885 -1.0259 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5140 -0.2419 -1.7587 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2471 -0.7825 -1.0780 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9997 -0.1415 0.1173 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7419 0.4555 0.1442 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8721 0.0241 1.2930 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6637 0.6789 1.1687 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5637 -0.1903 0.9785 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0343 0.1854 -0.3961 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1733 -0.5873 -0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1157 -0.9240 0.3264 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9751 -2.4783 0.4361 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8340 -0.3874 1.6775 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9383 0.3968 2.3262 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9308 1.0849 1.5062 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1396 0.6000 0.0909 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4241 1.6241 -0.8016 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5576 -0.7663 -0.1077 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4042 -1.8224 0.5915 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8454 -1.6284 0.2761 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3957 -0.5145 -0.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8480 -0.4688 -0.3895 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7319 0.2153 0.5697 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1612 -0.3181 0.2934 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4365 -1.5539 1.1231 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1690 0.7354 0.6139 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0811 0.5976 1.4593 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1071 1.9579 -0.0607 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2941 -0.6375 -1.1686 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4456 0.3091 -2.0288 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9713 -0.0056 -1.8276 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5952 -1.1646 -2.6954 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2845 -2.2681 -2.2144 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5773 -1.0572 -4.0813 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1793 1.2010 -2.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7320 1.1704 -1.7458 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5749 0.7058 -0.2744 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2211 1.8123 0.5323 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4954 0.2255 1.9514 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4854 1.7135 2.0777 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0110 -0.2741 3.3267 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1705 -1.6542 3.2957 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4680 0.2747 2.5215 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5334 1.1338 2.4785 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2817 2.3426 1.6018 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4293 3.1016 1.5799 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8783 1.9652 0.2134 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6039 2.4920 -0.0135 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5049 -2.1241 -0.8390 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5390 -2.8743 -1.9977 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9664 -4.2801 -1.6364 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0711 -4.8293 -0.7506 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4568 -2.3770 -3.0624 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7299 -2.9410 -2.9902 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4932 -0.8821 -3.1492 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3132 -0.4516 -3.7509 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4093 0.2590 0.9567 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9651 -1.0047 1.3815 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8155 0.4140 1.5009 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4847 -0.7819 1.2830 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4959 1.5324 0.7387 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7971 1.6400 1.2263 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2165 2.2624 -2.6162 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3383 3.1039 -1.2186 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1001 3.2100 -1.3931 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5169 0.9444 -1.0166 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9325 1.3468 -0.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4248 0.8361 -1.8729 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3900 -0.7019 -1.7908 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1903 0.2605 -0.8021 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6725 -1.0813 1.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8769 -1.2395 1.0184 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0887 1.2811 -0.4183 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8783 -0.0103 -1.1022 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7623 -1.5067 -1.3207 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6677 -0.0785 -1.6320 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4936 -2.8351 1.3492 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2488 -2.9534 -0.4946 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9105 -2.7481 0.6160 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7968 -1.3032 2.3837 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4862 -0.1988 3.1312 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4037 1.1695 2.9789 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9034 1.0683 2.0741 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6611 2.1898 1.5136 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5306 1.4488 -1.8607 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8937 2.6396 -0.6003 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3749 1.8011 -0.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6145 -0.9991 -1.1879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3012 -1.8618 1.6641 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1505 -2.8477 0.1879 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4934 -2.5099 0.3807 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2573 -1.5372 -0.4424 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5158 -0.1292 1.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8630 1.3074 0.4458 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2865 -2.4592 0.4743 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7127 -1.6800 1.9546 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4768 -1.4783 1.4962 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7484 2.7947 0.4042 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0600 -1.6804 -1.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3495 -0.4549 -1.4667 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6853 0.0441 -3.0832 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6748 1.3466 -1.7930 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1918 -1.6838 -4.5889 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1500 1.2559 -3.2895 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7381 2.0876 -1.8394 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4085 2.2238 -1.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1877 0.4966 -2.4304 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7425 1.4555 1.4416 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4922 2.5717 0.9049 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9082 2.4593 -0.0970 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2321 2.2597 1.5070 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5002 2.0824 1.7194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4918 2.0061 3.1683 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9741 0.1905 3.5515 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7561 -0.0548 4.1019 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4171 -2.1183 3.9467 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6676 1.5396 3.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5158 0.6433 2.2511 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4807 2.9319 2.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6240 3.3607 2.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5370 2.3630 -0.5733 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5619 3.4141 0.3808 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4818 -2.8754 -2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0697 -4.8524 -2.5819 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9578 -4.1868 -1.1380 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2100 -4.3419 -0.8095 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0367 -2.7329 -4.0511 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4505 -2.2659 -3.0182 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3523 -0.5391 -3.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7359 -1.2139 -3.9990 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7825 1.0009 1.4770 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5512 -0.9753 2.2617 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7297 0.6829 2.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4351 -0.6579 1.4996 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9784 2.4956 1.0063 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7353 2.0574 2.1332 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 2 0 30 32 1 0 28 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 35 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 17 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 10 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 7 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 4 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 65 2 1 0 59 6 1 0 51 9 1 0 43 12 1 0 22 15 1 0 41 25 1 0 41 20 1 0 35 26 1 0 1 67 1 0 1 68 1 0 1 69 1 0 2 70 1 0 4 71 1 0 6 72 1 0 7 73 1 0 9 74 1 0 10 75 1 0 12 76 1 0 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 16 81 1 0 16 82 1 0 16 83 1 0 17 84 1 0 18 85 1 0 18 86 1 0 19 87 1 0 19 88 1 0 21 89 1 0 21 90 1 0 21 91 1 0 22 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 26 96 1 0 27 97 1 0 27 98 1 0 29 99 1 0 29100 1 0 29101 1 0 32102 1 0 33103 1 0 33104 1 0 34105 1 0 34106 1 0 38107 1 0 39108 1 0 39109 1 0 40110 1 0 40111 1 0 42112 1 0 42113 1 0 42114 1 0 44115 1 0 44116 1 0 44117 1 0 45118 1 0 45119 1 0 46120 1 0 48121 1 0 48122 1 0 49123 1 0 50124 1 0 51125 1 0 52126 1 0 54127 1 0 55128 1 0 55129 1 0 56130 1 0 57131 1 0 58132 1 0 59133 1 0 60134 1 0 61135 1 0 62136 1 0 63137 1 0 64138 1 0 65139 1 0 66140 1 0 M END PDB for HMDB0040810 (Phytolaccoside I)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 6.385 2.042 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 5.999 3.307 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 7.334 2.537 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 8.669 3.307 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 8.667 4.847 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 10.001 5.617 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 10.003 7.157 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 8.669 7.927 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 7.676 9.108 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 7.334 7.157 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 7.337 5.617 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 6.002 4.847 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 4.667 5.617 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 3.335 4.847 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 3.335 3.307 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 4.667 2.537 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 4.667 0.997 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 3.333 0.227 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 1.998 0.997 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 2.001 2.537 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 2.001 4.077 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 0.666 3.307 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 -0.666 2.537 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -0.666 0.997 0.000 0.00 0.00 C+0 HETATM 25 O UNK 0 -2.001 0.227 0.000 0.00 0.00 O+0 HETATM 26 C UNK 0 -3.335 0.997 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -4.668 0.227 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -6.002 0.997 0.000 0.00 0.00 C+0 HETATM 29 O UNK 0 -7.337 0.227 0.000 0.00 0.00 O+0 HETATM 30 O UNK 0 -3.335 2.537 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 -4.670 3.307 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -6.002 2.537 0.000 0.00 0.00 C+0 HETATM 33 O UNK 0 -7.337 3.307 0.000 0.00 0.00 O+0 HETATM 34 O UNK 0 -4.668 -1.313 0.000 0.00 0.00 O+0 HETATM 35 C UNK 0 -6.002 -2.083 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -6.002 -3.623 0.000 0.00 0.00 C+0 HETATM 37 O UNK 0 -4.670 -4.393 0.000 0.00 0.00 O+0 HETATM 38 C UNK 0 -4.668 -5.933 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -3.335 -6.703 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 -2.001 -5.933 0.000 0.00 0.00 O+0 HETATM 41 O UNK 0 -7.335 -1.313 0.000 0.00 0.00 O+0 HETATM 42 C UNK 0 -8.669 -2.083 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 -10.004 -1.313 0.000 0.00 0.00 C+0 HETATM 44 O UNK 0 -11.336 -2.083 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 0.201 -2.398 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -0.325 -0.951 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 0.666 0.227 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 1.656 -0.953 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 9.133 10.553 0.000 0.00 0.00 O+0 HETATM 50 C UNK 0 9.657 9.105 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 11.174 8.841 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 10.001 2.537 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 10.001 4.077 0.000 0.00 0.00 C+0 HETATM 54 O UNK 0 11.336 4.847 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -10.001 -4.393 0.000 0.00 0.00 O+0 HETATM 56 C UNK 0 -8.669 -3.623 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 -7.337 -4.393 0.000 0.00 0.00 C+0 HETATM 58 O UNK 0 -7.337 -5.933 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 -6.002 -6.703 0.000 0.00 0.00 O+0 HETATM 60 C UNK 0 -6.002 -8.243 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -7.335 -9.013 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 -4.670 -10.553 0.000 0.00 0.00 O+0 HETATM 63 C UNK 0 -4.668 -9.013 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 -3.333 -8.243 0.000 0.00 0.00 C+0 HETATM 65 O UNK 0 -2.003 -9.013 0.000 0.00 0.00 O+0 HETATM 66 C UNK 0 5.481 1.558 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 12 16 CONECT 3 2 4 CONECT 4 3 5 CONECT 5 4 6 11 53 CONECT 6 5 7 CONECT 7 6 8 CONECT 8 7 9 10 50 CONECT 9 8 CONECT 10 8 11 CONECT 11 5 10 12 CONECT 12 2 11 13 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 20 CONECT 16 2 15 17 66 CONECT 17 16 18 CONECT 18 17 19 CONECT 19 18 20 47 CONECT 20 15 19 21 22 CONECT 21 20 CONECT 22 20 23 CONECT 23 22 24 CONECT 24 23 25 47 CONECT 25 24 26 CONECT 26 25 27 30 CONECT 27 26 28 34 CONECT 28 27 29 32 CONECT 29 28 CONECT 30 26 31 CONECT 31 30 32 CONECT 32 28 31 33 CONECT 33 32 CONECT 34 27 35 CONECT 35 34 36 41 CONECT 36 35 37 57 CONECT 37 36 38 CONECT 38 37 39 59 CONECT 39 38 40 64 CONECT 40 39 CONECT 41 35 42 CONECT 42 41 43 56 CONECT 43 42 44 CONECT 44 43 CONECT 45 46 CONECT 46 45 47 CONECT 47 19 24 46 48 CONECT 48 47 CONECT 49 50 CONECT 50 8 49 51 CONECT 51 50 CONECT 52 53 CONECT 53 5 52 54 CONECT 54 53 CONECT 55 56 CONECT 56 42 55 57 CONECT 57 36 56 58 CONECT 58 57 CONECT 59 38 60 CONECT 60 59 61 63 CONECT 61 60 CONECT 62 63 CONECT 63 60 62 64 CONECT 64 39 63 65 CONECT 65 64 CONECT 66 16 MASTER 0 0 0 0 0 0 0 0 66 0 146 0 END 3D PDB for HMDB0040810 (Phytolaccoside I)COMPND HMDB0040810 HETATM 1 C1 UNL 1 10.215 2.532 -1.550 1.00 0.00 C HETATM 2 C2 UNL 1 10.475 1.289 -0.749 1.00 0.00 C HETATM 3 O1 UNL 1 9.637 0.237 -1.112 1.00 0.00 O HETATM 4 C3 UNL 1 8.375 0.353 -0.535 1.00 0.00 C HETATM 5 O2 UNL 1 7.590 -0.689 -1.026 1.00 0.00 O HETATM 6 C4 UNL 1 6.514 -0.242 -1.759 1.00 0.00 C HETATM 7 C5 UNL 1 5.247 -0.782 -1.078 1.00 0.00 C HETATM 8 O3 UNL 1 5.000 -0.141 0.117 1.00 0.00 O HETATM 9 C6 UNL 1 3.742 0.456 0.144 1.00 0.00 C HETATM 10 C7 UNL 1 2.872 0.024 1.293 1.00 0.00 C HETATM 11 O4 UNL 1 1.664 0.679 1.169 1.00 0.00 O HETATM 12 C8 UNL 1 0.564 -0.190 0.979 1.00 0.00 C HETATM 13 C9 UNL 1 0.034 0.185 -0.396 1.00 0.00 C HETATM 14 C10 UNL 1 -1.173 -0.587 -0.783 1.00 0.00 C HETATM 15 C11 UNL 1 -2.116 -0.924 0.326 1.00 0.00 C HETATM 16 C12 UNL 1 -1.975 -2.478 0.436 1.00 0.00 C HETATM 17 C13 UNL 1 -1.834 -0.387 1.677 1.00 0.00 C HETATM 18 C14 UNL 1 -2.938 0.397 2.326 1.00 0.00 C HETATM 19 C15 UNL 1 -3.931 1.085 1.506 1.00 0.00 C HETATM 20 C16 UNL 1 -4.140 0.600 0.091 1.00 0.00 C HETATM 21 C17 UNL 1 -3.424 1.624 -0.802 1.00 0.00 C HETATM 22 C18 UNL 1 -3.558 -0.766 -0.108 1.00 0.00 C HETATM 23 C19 UNL 1 -4.404 -1.822 0.591 1.00 0.00 C HETATM 24 C20 UNL 1 -5.845 -1.628 0.276 1.00 0.00 C HETATM 25 C21 UNL 1 -6.396 -0.514 -0.101 1.00 0.00 C HETATM 26 C22 UNL 1 -7.848 -0.469 -0.389 1.00 0.00 C HETATM 27 C23 UNL 1 -8.732 0.215 0.570 1.00 0.00 C HETATM 28 C24 UNL 1 -10.161 -0.318 0.293 1.00 0.00 C HETATM 29 C25 UNL 1 -10.436 -1.554 1.123 1.00 0.00 C HETATM 30 C26 UNL 1 -11.169 0.735 0.614 1.00 0.00 C HETATM 31 O5 UNL 1 -12.081 0.598 1.459 1.00 0.00 O HETATM 32 O6 UNL 1 -11.107 1.958 -0.061 1.00 0.00 O HETATM 33 C27 UNL 1 -10.294 -0.638 -1.169 1.00 0.00 C HETATM 34 C28 UNL 1 -9.446 0.309 -2.029 1.00 0.00 C HETATM 35 C29 UNL 1 -7.971 -0.006 -1.828 1.00 0.00 C HETATM 36 C30 UNL 1 -7.595 -1.165 -2.695 1.00 0.00 C HETATM 37 O7 UNL 1 -7.284 -2.268 -2.214 1.00 0.00 O HETATM 38 O8 UNL 1 -7.577 -1.057 -4.081 1.00 0.00 O HETATM 39 C31 UNL 1 -7.179 1.201 -2.165 1.00 0.00 C HETATM 40 C32 UNL 1 -5.732 1.170 -1.746 1.00 0.00 C HETATM 41 C33 UNL 1 -5.575 0.706 -0.274 1.00 0.00 C HETATM 42 C34 UNL 1 -6.221 1.812 0.532 1.00 0.00 C HETATM 43 C35 UNL 1 -0.495 0.225 1.951 1.00 0.00 C HETATM 44 C36 UNL 1 -0.485 1.714 2.078 1.00 0.00 C HETATM 45 C37 UNL 1 0.011 -0.274 3.327 1.00 0.00 C HETATM 46 O9 UNL 1 0.171 -1.654 3.296 1.00 0.00 O HETATM 47 O10 UNL 1 3.468 0.275 2.522 1.00 0.00 O HETATM 48 C38 UNL 1 4.533 1.134 2.478 1.00 0.00 C HETATM 49 C39 UNL 1 4.282 2.343 1.602 1.00 0.00 C HETATM 50 O11 UNL 1 5.429 3.102 1.580 1.00 0.00 O HETATM 51 C40 UNL 1 3.878 1.965 0.213 1.00 0.00 C HETATM 52 O12 UNL 1 2.604 2.492 -0.014 1.00 0.00 O HETATM 53 O13 UNL 1 5.505 -2.124 -0.839 1.00 0.00 O HETATM 54 C41 UNL 1 5.539 -2.874 -1.998 1.00 0.00 C HETATM 55 C42 UNL 1 5.966 -4.280 -1.636 1.00 0.00 C HETATM 56 O14 UNL 1 5.071 -4.829 -0.751 1.00 0.00 O HETATM 57 C43 UNL 1 6.457 -2.377 -3.062 1.00 0.00 C HETATM 58 O15 UNL 1 7.730 -2.941 -2.990 1.00 0.00 O HETATM 59 C44 UNL 1 6.493 -0.882 -3.149 1.00 0.00 C HETATM 60 O16 UNL 1 5.313 -0.452 -3.751 1.00 0.00 O HETATM 61 C45 UNL 1 8.409 0.259 0.957 1.00 0.00 C HETATM 62 O17 UNL 1 7.965 -1.005 1.382 1.00 0.00 O HETATM 63 C46 UNL 1 9.816 0.414 1.501 1.00 0.00 C HETATM 64 O18 UNL 1 10.485 -0.782 1.283 1.00 0.00 O HETATM 65 C47 UNL 1 10.496 1.532 0.739 1.00 0.00 C HETATM 66 O19 UNL 1 11.797 1.640 1.226 1.00 0.00 O HETATM 67 H1 UNL 1 10.217 2.262 -2.616 1.00 0.00 H HETATM 68 H2 UNL 1 9.338 3.104 -1.219 1.00 0.00 H HETATM 69 H3 UNL 1 11.100 3.210 -1.393 1.00 0.00 H HETATM 70 H4 UNL 1 11.517 0.944 -1.017 1.00 0.00 H HETATM 71 H5 UNL 1 7.932 1.347 -0.842 1.00 0.00 H HETATM 72 H6 UNL 1 6.425 0.836 -1.873 1.00 0.00 H HETATM 73 H7 UNL 1 4.390 -0.702 -1.791 1.00 0.00 H HETATM 74 H8 UNL 1 3.190 0.260 -0.802 1.00 0.00 H HETATM 75 H9 UNL 1 2.673 -1.081 1.182 1.00 0.00 H HETATM 76 H10 UNL 1 0.877 -1.239 1.018 1.00 0.00 H HETATM 77 H11 UNL 1 -0.089 1.281 -0.418 1.00 0.00 H HETATM 78 H12 UNL 1 0.878 -0.010 -1.102 1.00 0.00 H HETATM 79 H13 UNL 1 -0.762 -1.507 -1.321 1.00 0.00 H HETATM 80 H14 UNL 1 -1.668 -0.079 -1.632 1.00 0.00 H HETATM 81 H15 UNL 1 -2.494 -2.835 1.349 1.00 0.00 H HETATM 82 H16 UNL 1 -2.249 -2.953 -0.495 1.00 0.00 H HETATM 83 H17 UNL 1 -0.911 -2.748 0.616 1.00 0.00 H HETATM 84 H18 UNL 1 -1.797 -1.303 2.384 1.00 0.00 H HETATM 85 H19 UNL 1 -3.486 -0.199 3.131 1.00 0.00 H HETATM 86 H20 UNL 1 -2.404 1.169 2.979 1.00 0.00 H HETATM 87 H21 UNL 1 -4.903 1.068 2.074 1.00 0.00 H HETATM 88 H22 UNL 1 -3.661 2.190 1.514 1.00 0.00 H HETATM 89 H23 UNL 1 -3.531 1.449 -1.861 1.00 0.00 H HETATM 90 H24 UNL 1 -3.894 2.640 -0.600 1.00 0.00 H HETATM 91 H25 UNL 1 -2.375 1.801 -0.469 1.00 0.00 H HETATM 92 H26 UNL 1 -3.614 -0.999 -1.188 1.00 0.00 H HETATM 93 H27 UNL 1 -4.301 -1.862 1.664 1.00 0.00 H HETATM 94 H28 UNL 1 -4.150 -2.848 0.188 1.00 0.00 H HETATM 95 H29 UNL 1 -6.493 -2.510 0.381 1.00 0.00 H HETATM 96 H30 UNL 1 -8.257 -1.537 -0.442 1.00 0.00 H HETATM 97 H31 UNL 1 -8.516 -0.129 1.578 1.00 0.00 H HETATM 98 H32 UNL 1 -8.863 1.307 0.446 1.00 0.00 H HETATM 99 H33 UNL 1 -10.287 -2.459 0.474 1.00 0.00 H HETATM 100 H34 UNL 1 -9.713 -1.680 1.955 1.00 0.00 H HETATM 101 H35 UNL 1 -11.477 -1.478 1.496 1.00 0.00 H HETATM 102 H36 UNL 1 -10.748 2.795 0.404 1.00 0.00 H HETATM 103 H37 UNL 1 -10.060 -1.680 -1.419 1.00 0.00 H HETATM 104 H38 UNL 1 -11.349 -0.455 -1.467 1.00 0.00 H HETATM 105 H39 UNL 1 -9.685 0.044 -3.083 1.00 0.00 H HETATM 106 H40 UNL 1 -9.675 1.347 -1.793 1.00 0.00 H HETATM 107 H41 UNL 1 -8.192 -1.684 -4.589 1.00 0.00 H HETATM 108 H42 UNL 1 -7.150 1.256 -3.290 1.00 0.00 H HETATM 109 H43 UNL 1 -7.738 2.088 -1.839 1.00 0.00 H HETATM 110 H44 UNL 1 -5.409 2.224 -1.761 1.00 0.00 H HETATM 111 H45 UNL 1 -5.188 0.497 -2.430 1.00 0.00 H HETATM 112 H46 UNL 1 -6.743 1.455 1.442 1.00 0.00 H HETATM 113 H47 UNL 1 -5.492 2.572 0.905 1.00 0.00 H HETATM 114 H48 UNL 1 -6.908 2.459 -0.097 1.00 0.00 H HETATM 115 H49 UNL 1 -1.232 2.260 1.507 1.00 0.00 H HETATM 116 H50 UNL 1 0.500 2.082 1.719 1.00 0.00 H HETATM 117 H51 UNL 1 -0.492 2.006 3.168 1.00 0.00 H HETATM 118 H52 UNL 1 0.974 0.191 3.551 1.00 0.00 H HETATM 119 H53 UNL 1 -0.756 -0.055 4.102 1.00 0.00 H HETATM 120 H54 UNL 1 -0.417 -2.118 3.947 1.00 0.00 H HETATM 121 H55 UNL 1 4.668 1.540 3.519 1.00 0.00 H HETATM 122 H56 UNL 1 5.516 0.643 2.251 1.00 0.00 H HETATM 123 H57 UNL 1 3.481 2.932 2.133 1.00 0.00 H HETATM 124 H58 UNL 1 5.624 3.361 2.526 1.00 0.00 H HETATM 125 H59 UNL 1 4.537 2.363 -0.573 1.00 0.00 H HETATM 126 H60 UNL 1 2.562 3.414 0.381 1.00 0.00 H HETATM 127 H61 UNL 1 4.482 -2.875 -2.396 1.00 0.00 H HETATM 128 H62 UNL 1 6.070 -4.852 -2.582 1.00 0.00 H HETATM 129 H63 UNL 1 6.958 -4.187 -1.138 1.00 0.00 H HETATM 130 H64 UNL 1 4.210 -4.342 -0.809 1.00 0.00 H HETATM 131 H65 UNL 1 6.037 -2.733 -4.051 1.00 0.00 H HETATM 132 H66 UNL 1 8.451 -2.266 -3.018 1.00 0.00 H HETATM 133 H67 UNL 1 7.352 -0.539 -3.763 1.00 0.00 H HETATM 134 H68 UNL 1 4.736 -1.214 -3.999 1.00 0.00 H HETATM 135 H69 UNL 1 7.783 1.001 1.477 1.00 0.00 H HETATM 136 H70 UNL 1 7.551 -0.975 2.262 1.00 0.00 H HETATM 137 H71 UNL 1 9.730 0.683 2.567 1.00 0.00 H HETATM 138 H72 UNL 1 11.435 -0.658 1.500 1.00 0.00 H HETATM 139 H73 UNL 1 9.978 2.496 1.006 1.00 0.00 H HETATM 140 H74 UNL 1 11.735 2.057 2.133 1.00 0.00 H CONECT 1 2 67 68 69 CONECT 2 3 65 70 CONECT 3 4 CONECT 4 5 61 71 CONECT 5 6 CONECT 6 7 59 72 CONECT 7 8 53 73 CONECT 8 9 CONECT 9 10 51 74 CONECT 10 11 47 75 CONECT 11 12 CONECT 12 13 43 76 CONECT 13 14 77 78 CONECT 14 15 79 80 CONECT 15 16 17 22 CONECT 16 81 82 83 CONECT 17 18 43 84 CONECT 18 19 85 86 CONECT 19 20 87 88 CONECT 20 21 22 41 CONECT 21 89 90 91 CONECT 22 23 92 CONECT 23 24 93 94 CONECT 24 25 25 95 CONECT 25 26 41 CONECT 26 27 35 96 CONECT 27 28 97 98 CONECT 28 29 30 33 CONECT 29 99 100 101 CONECT 30 31 31 32 CONECT 32 102 CONECT 33 34 103 104 CONECT 34 35 105 106 CONECT 35 36 39 CONECT 36 37 37 38 CONECT 38 107 CONECT 39 40 108 109 CONECT 40 41 110 111 CONECT 41 42 CONECT 42 112 113 114 CONECT 43 44 45 CONECT 44 115 116 117 CONECT 45 46 118 119 CONECT 46 120 CONECT 47 48 CONECT 48 49 121 122 CONECT 49 50 51 123 CONECT 50 124 CONECT 51 52 125 CONECT 52 126 CONECT 53 54 CONECT 54 55 57 127 CONECT 55 56 128 129 CONECT 56 130 CONECT 57 58 59 131 CONECT 58 132 CONECT 59 60 133 CONECT 60 134 CONECT 61 62 63 135 CONECT 62 136 CONECT 63 64 65 137 CONECT 64 138 CONECT 65 66 139 CONECT 66 140 END SMILES for HMDB0040810 (Phytolaccoside I)CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(CCC5(CCC43C)C(O)=O)C(O)=O)C2(C)CO)C(O)C(O)C1O INCHI for HMDB0040810 (Phytolaccoside I)InChI=1S/C47H74O19/c1-21-29(51)32(54)34(56)37(62-21)65-36-33(55)31(53)25(18-48)63-39(36)66-35-30(52)24(50)19-61-38(35)64-28-10-11-43(3)26(44(28,4)20-49)9-12-46(6)27(43)8-7-22-23-17-42(2,40(57)58)13-15-47(23,41(59)60)16-14-45(22,46)5/h7,21,23-39,48-56H,8-20H2,1-6H3,(H,57,58)(H,59,60) 3D Structure for HMDB0040810 (Phytolaccoside I) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C47H74O19 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 943.0791 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 942.482430186 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 10-[(3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-4,5-dihydroxyoxan-2-yl)oxy]-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2,4a-dicarboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 10-[(3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-4,5-dihydroxyoxan-2-yl)oxy]-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydropicene-2,4a-dicarboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 65608-04-0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(CCC5(CCC43C)C(O)=O)C(O)=O)C2(C)CO)C(O)C(O)C1O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C47H74O19/c1-21-29(51)32(54)34(56)37(62-21)65-36-33(55)31(53)25(18-48)63-39(36)66-35-30(52)24(50)19-61-38(35)64-28-10-11-43(3)26(44(28,4)20-49)9-12-46(6)27(43)8-7-22-23-17-42(2,40(57)58)13-15-47(23,41(59)60)16-14-45(22,46)5/h7,21,23-39,48-56H,8-20H2,1-6H3,(H,57,58)(H,59,60) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | ZIGYVPCMVRRVNL-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB020626 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131752946 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|