Showing metabocard for 28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide] (HMDB0040859)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 02:27:47 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:46 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0040859 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide] | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide] belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. Based on a literature review a small amount of articles have been published on 28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide]. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])Mrv0541 02241210142D 78 86 0 0 0 0 999 V2000 -0.7135 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6791 -2.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6791 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0916 -2.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0522 -1.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7149 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4285 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1435 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1435 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8584 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8584 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1435 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4202 -1.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4202 -2.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9592 -3.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4285 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8978 -3.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7135 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7135 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4285 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1435 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1435 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 -2.0623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2869 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0005 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0005 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2869 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3276 1.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8584 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3877 1.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1440 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8590 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1440 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -2.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4291 -2.8873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4291 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1440 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8590 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1440 0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4291 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 2.0623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1440 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 20 1 0 0 0 0 1 23 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 6 1 0 0 0 0 4 17 1 0 0 0 0 6 7 1 0 0 0 0 6 23 1 0 0 0 0 7 8 1 0 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 9 17 1 0 0 0 0 10 11 1 0 0 0 0 10 14 1 0 0 0 0 11 38 1 0 0 0 0 12 13 1 0 0 0 0 12 38 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 14 32 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 26 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 28 48 1 0 0 0 0 29 30 1 0 0 0 0 29 55 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 34 40 1 0 0 0 0 35 36 1 0 0 0 0 35 46 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 41 45 1 0 0 0 0 42 43 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 2 0 0 0 0 50 52 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 57 63 1 0 0 0 0 58 59 1 0 0 0 0 58 69 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 60 71 1 0 0 0 0 61 62 1 0 0 0 0 61 76 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 64 68 1 0 0 0 0 65 66 1 0 0 0 0 65 78 2 0 0 0 0 67 68 1 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 76 77 1 0 0 0 0 M END 3D MOL for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])HMDB0040859 RDKit 3D 28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide] 162170 0 0 0 0 0 0 0 0999 V2000 -12.6660 -1.1428 3.0299 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3482 -1.1528 1.5460 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3949 -0.2557 1.1878 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0848 -0.6642 1.1817 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3908 0.3164 0.4450 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4822 1.0093 1.2059 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1604 1.0484 0.4961 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0802 1.1553 1.3709 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0487 0.2392 1.0504 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8407 1.0612 0.7353 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9001 2.2293 1.5519 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5134 0.4435 1.0326 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0609 -0.4645 0.0844 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8513 -0.0238 -0.5007 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2164 -0.9787 -0.0247 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5208 -0.8544 -0.7724 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4250 -0.6730 -2.2318 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3478 -2.0862 -2.8454 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2482 0.0816 -2.7577 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5507 1.5101 -3.1479 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6078 2.0285 -2.1600 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9095 1.3803 -2.5706 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1538 1.9861 -3.9870 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7040 -0.0761 -2.8131 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8607 -0.9763 -2.6601 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0474 -0.4390 -1.9866 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1333 0.7815 -1.6174 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3296 1.3123 -0.9376 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6217 0.6633 -1.1919 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6610 1.5857 -0.5841 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6169 2.8715 -1.4241 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0204 0.9816 -0.7859 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4008 1.9342 0.8352 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9737 2.1498 1.2082 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0012 1.2071 0.5405 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2191 -0.1370 1.1207 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1929 -0.7840 1.5139 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4161 -0.7847 1.2901 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4908 -2.0773 1.8619 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2169 -2.1708 3.0099 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5376 -1.8561 2.9704 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1848 -2.3234 4.2608 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0093 -3.7077 4.3515 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3085 -2.4739 1.8404 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3707 -1.6232 1.5302 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4847 -2.6546 0.5946 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1215 -3.6363 -0.1993 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0678 -3.0413 0.8482 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9900 -4.3523 1.3057 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5754 1.6111 0.7181 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8491 2.3002 -0.3656 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0783 1.8128 -1.7799 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8119 2.9996 -2.4600 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0242 -0.0714 -1.9626 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0448 0.9457 -2.3964 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6431 -1.4454 -2.2820 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5714 -0.2071 2.2555 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4149 -1.2794 2.1657 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3300 -2.2559 3.2551 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5352 -2.1355 4.2159 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1624 -3.3562 3.2225 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8595 -0.7700 2.1459 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2298 -0.2564 3.3895 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0981 2.2364 -0.2923 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2542 2.3915 -1.0513 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0541 3.4543 -2.0389 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9448 3.8144 -2.8607 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8451 4.1264 -2.1130 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3926 2.8370 -0.1284 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5468 2.1812 -0.5499 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9871 2.4630 1.2585 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9345 2.6593 2.2288 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7770 -1.9897 0.6097 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8296 -1.8584 -0.4051 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0207 -2.5709 -0.0273 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8222 -3.8714 -0.4899 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1107 -2.5492 1.0108 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2589 -3.1220 0.4694 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1976 -1.9908 3.5634 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3536 -0.1519 3.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7558 -1.2246 3.2116 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3104 -0.8143 1.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6760 -0.5765 2.2342 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4338 0.6112 2.2506 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0385 0.2441 -0.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4279 -0.3204 0.1519 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9638 1.4029 -0.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0071 1.9466 2.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7810 1.2980 1.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6695 0.9702 -0.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1894 -2.0046 -0.0372 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4114 -0.7268 1.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0258 -1.8534 -0.5563 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2301 -0.1557 -0.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4841 -2.1779 -3.5559 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2264 -2.3217 -3.4751 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2102 -2.8546 -2.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0282 -0.3865 -3.7552 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8474 1.6345 -4.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3155 2.1956 -2.9875 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6594 3.1406 -2.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2132 1.7641 -1.1992 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2334 1.9985 -4.2277 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6013 2.8989 -4.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7527 1.2670 -4.7720 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4236 -0.2056 -3.9249 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2499 -1.4287 -3.6226 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6020 -1.9047 -2.0556 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8624 -1.1325 -1.8111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4874 2.4059 -1.1551 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7035 -0.3796 -0.9078 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8711 0.6715 -2.3065 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0845 2.7450 -2.3692 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6193 3.2390 -1.6498 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0879 3.6570 -0.8328 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7578 1.8255 -0.8893 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2958 0.5192 0.2059 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0943 0.2647 -1.6120 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8429 1.1407 1.4715 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9580 2.8661 1.0751 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8751 2.0994 2.3135 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6705 3.1853 0.9205 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4430 -2.3854 2.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6569 -0.7329 2.9807 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6911 -1.8943 5.1491 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2826 -2.1490 4.2593 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5225 -4.0864 3.5697 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7629 -3.4534 2.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7086 -1.1323 2.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4898 -1.7223 0.0057 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7926 -3.1777 -0.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5010 -2.8962 -0.0983 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4388 -4.9286 0.6288 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9790 0.7322 1.0611 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5639 2.3013 1.6169 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1039 3.4040 -0.2504 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7732 2.3022 -0.0871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1698 3.7432 -1.7009 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0983 3.6159 -3.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7080 2.6756 -3.0035 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0833 1.8319 -1.7579 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9838 1.1687 -3.4854 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0597 0.4531 -2.2962 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8155 -1.5541 -3.3705 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6817 -1.3671 -1.8389 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1210 -2.2705 -1.8060 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2944 -1.8477 1.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2053 -4.1041 3.8716 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4939 -1.6599 1.9598 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8779 -0.8252 4.0988 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5114 1.4572 -1.5966 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3961 4.1509 -3.0250 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5928 3.9250 -0.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7529 2.3522 -1.4835 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0840 3.0632 1.5202 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5964 3.3252 1.8774 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3196 -2.7033 1.3349 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2739 -1.7834 -1.2638 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3006 -1.8852 -0.8521 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6419 -4.4139 -0.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7781 -3.1981 1.8572 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8171 -2.3714 0.1103 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 35 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 19 54 1 0 54 55 1 0 54 56 1 0 12 57 1 0 57 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 58 62 1 0 62 63 1 0 7 64 1 0 64 65 1 0 65 66 1 0 66 67 2 0 66 68 1 0 65 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 4 73 1 0 73 74 1 0 73 75 1 0 75 76 1 0 75 77 1 0 77 78 1 0 77 2 1 0 71 6 1 0 62 9 1 0 54 14 1 0 24 17 1 0 52 27 1 0 52 22 1 0 35 28 1 0 48 39 1 0 1 79 1 0 1 80 1 0 1 81 1 0 2 82 1 0 4 83 1 0 6 84 1 0 7 85 1 0 9 86 1 0 10 87 1 0 11 88 1 0 12 89 1 0 14 90 1 0 15 91 1 0 15 92 1 0 16 93 1 0 16 94 1 0 18 95 1 0 18 96 1 0 18 97 1 0 19 98 1 0 20 99 1 0 20100 1 0 21101 1 0 21102 1 0 23103 1 0 23104 1 0 23105 1 0 24106 1 0 25107 1 0 25108 1 0 26109 1 0 28110 1 0 29111 1 0 29112 1 0 31113 1 0 31114 1 0 31115 1 0 32116 1 0 32117 1 0 32118 1 0 33119 1 0 33120 1 0 34121 1 0 34122 1 0 39123 1 0 41124 1 0 42125 1 0 42126 1 0 43127 1 0 44128 1 0 45129 1 0 46130 1 0 47131 1 0 48132 1 0 49133 1 0 50134 1 0 50135 1 0 51136 1 0 51137 1 0 53138 1 0 53139 1 0 53140 1 0 55141 1 0 55142 1 0 55143 1 0 56144 1 0 56145 1 0 56146 1 0 58147 1 0 61148 1 0 62149 1 0 63150 1 0 65151 1 0 68152 1 0 69153 1 0 70154 1 0 71155 1 0 72156 1 0 73157 1 0 74158 1 0 75159 1 0 76160 1 0 77161 1 0 78162 1 0 M END 3D SDF for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])Mrv0541 02241210142D 78 86 0 0 0 0 999 V2000 -0.7135 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6791 -2.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6791 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0916 -2.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0522 -1.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7149 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4285 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1435 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1435 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8584 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8584 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1435 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4202 -1.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4202 -2.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9592 -3.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4285 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8978 -3.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7135 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7135 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4285 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1435 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1435 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 -2.0623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5719 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2869 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0005 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0005 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2869 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3276 1.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8584 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3877 1.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1440 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8590 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1440 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -2.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4291 -2.8873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4291 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1440 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8590 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1440 0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4291 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 2.0623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0006 2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7155 3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 4.1247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2870 3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5721 2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8571 3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1440 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 20 1 0 0 0 0 1 23 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 6 1 0 0 0 0 4 17 1 0 0 0 0 6 7 1 0 0 0 0 6 23 1 0 0 0 0 7 8 1 0 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 9 17 1 0 0 0 0 10 11 1 0 0 0 0 10 14 1 0 0 0 0 11 38 1 0 0 0 0 12 13 1 0 0 0 0 12 38 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 14 32 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 26 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 28 48 1 0 0 0 0 29 30 1 0 0 0 0 29 55 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 34 40 1 0 0 0 0 35 36 1 0 0 0 0 35 46 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 41 45 1 0 0 0 0 42 43 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 2 0 0 0 0 50 52 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 57 63 1 0 0 0 0 58 59 1 0 0 0 0 58 69 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 60 71 1 0 0 0 0 61 62 1 0 0 0 0 61 76 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 64 68 1 0 0 0 0 65 66 1 0 0 0 0 65 78 2 0 0 0 0 67 68 1 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 76 77 1 0 0 0 0 M END > <DATABASE_ID> HMDB0040859 > <DATABASE_NAME> hmdb > <SMILES> CC1OC(OC2C(O)C(O)C(OC2OC2C(O)C(OC3CCC4(C)C(CCC5(C)C4CC=C4C6CC(C)(C)CCC6(CCC54C)C(=O)OC4OC(CO)C(O)C(O)C4O)C3(C)C)OC(C2O)C(O)=O)C(O)=O)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C54H84O24/c1-21-28(56)30(58)34(62)44(71-21)77-41-33(61)32(60)39(42(66)67)76-47(41)74-38-36(64)40(43(68)69)75-46(37(38)65)73-27-12-13-51(6)25(50(27,4)5)11-14-53(8)26(51)10-9-22-23-19-49(2,3)15-17-54(23,18-16-52(22,53)7)48(70)78-45-35(63)31(59)29(57)24(20-55)72-45/h9,21,23-41,44-47,55-65H,10-20H2,1-8H3,(H,66,67)(H,68,69) > <INCHI_KEY> IMPZGAYJJGGWNV-UHFFFAOYSA-N > <FORMULA> C54H84O24 > <MOLECULAR_WEIGHT> 1117.2304 > <EXACT_MASS> 1116.535253616 > <JCHEM_ACCEPTOR_COUNT> 23 > <JCHEM_AVERAGE_POLARIZABILITY> 116.28358219742296 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 6-[(2-{[4,4,6a,6b,11,11,14b-heptamethyl-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-6-carboxy-3,5-dihydroxyoxan-4-yl)oxy]-3,4-dihydroxy-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxane-2-carboxylic acid > <ALOGPS_LOGP> 1.72 > <JCHEM_LOGP> 0.7017174456666672 > <ALOGPS_LOGS> -3.60 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 9 > <JCHEM_PHYSIOLOGICAL_CHARGE> -2 > <JCHEM_PKA> 3.5268405181565017 > <JCHEM_PKA_STRONGEST_ACIDIC> 2.8166349918043445 > <JCHEM_PKA_STRONGEST_BASIC> -3.7388484754389006 > <JCHEM_POLAR_SURFACE_AREA> 388.0400000000001 > <JCHEM_REFRACTIVITY> 261.4867000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 12 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 2.81e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 6-[(2-{[4,4,6a,6b,11,11,14b-heptamethyl-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-6-carboxy-3,5-dihydroxyoxan-4-yl)oxy]-3,4-dihydroxy-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxane-2-carboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])HMDB0040859 RDKit 3D 28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide] 162170 0 0 0 0 0 0 0 0999 V2000 -12.6660 -1.1428 3.0299 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3482 -1.1528 1.5460 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3949 -0.2557 1.1878 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0848 -0.6642 1.1817 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3908 0.3164 0.4450 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4822 1.0093 1.2059 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1604 1.0484 0.4961 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0802 1.1553 1.3709 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0487 0.2392 1.0504 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8407 1.0612 0.7353 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9001 2.2293 1.5519 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5134 0.4435 1.0326 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0609 -0.4645 0.0844 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8513 -0.0238 -0.5007 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2164 -0.9787 -0.0247 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5208 -0.8544 -0.7724 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4250 -0.6730 -2.2318 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3478 -2.0862 -2.8454 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2482 0.0816 -2.7577 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5507 1.5101 -3.1479 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6078 2.0285 -2.1600 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9095 1.3803 -2.5706 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1538 1.9861 -3.9870 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7040 -0.0761 -2.8131 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8607 -0.9763 -2.6601 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0474 -0.4390 -1.9866 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1333 0.7815 -1.6174 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3296 1.3123 -0.9376 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6217 0.6633 -1.1919 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6610 1.5857 -0.5841 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6169 2.8715 -1.4241 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0204 0.9816 -0.7859 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4008 1.9342 0.8352 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9737 2.1498 1.2082 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0012 1.2071 0.5405 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2191 -0.1370 1.1207 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1929 -0.7840 1.5139 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4161 -0.7847 1.2901 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4908 -2.0773 1.8619 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2169 -2.1708 3.0099 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5376 -1.8561 2.9704 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1848 -2.3234 4.2608 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0093 -3.7077 4.3515 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3085 -2.4739 1.8404 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3707 -1.6232 1.5302 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4847 -2.6546 0.5946 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1215 -3.6363 -0.1993 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0678 -3.0413 0.8482 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9900 -4.3523 1.3057 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5754 1.6111 0.7181 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8491 2.3002 -0.3656 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0783 1.8128 -1.7799 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8119 2.9996 -2.4600 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0242 -0.0714 -1.9626 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0448 0.9457 -2.3964 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6431 -1.4454 -2.2820 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5714 -0.2071 2.2555 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4149 -1.2794 2.1657 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3300 -2.2559 3.2551 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5352 -2.1355 4.2159 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1624 -3.3562 3.2225 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8595 -0.7700 2.1459 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2298 -0.2564 3.3895 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0981 2.2364 -0.2923 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2542 2.3915 -1.0513 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0541 3.4543 -2.0389 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9448 3.8144 -2.8607 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8451 4.1264 -2.1130 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3926 2.8370 -0.1284 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5468 2.1812 -0.5499 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9871 2.4630 1.2585 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9345 2.6593 2.2288 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7770 -1.9897 0.6097 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8296 -1.8584 -0.4051 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0207 -2.5709 -0.0273 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8222 -3.8714 -0.4899 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1107 -2.5492 1.0108 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2589 -3.1220 0.4694 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1976 -1.9908 3.5634 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3536 -0.1519 3.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7558 -1.2246 3.2116 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3104 -0.8143 1.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6760 -0.5765 2.2342 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4338 0.6112 2.2506 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0385 0.2441 -0.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4279 -0.3204 0.1519 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9638 1.4029 -0.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0071 1.9466 2.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7810 1.2980 1.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6695 0.9702 -0.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1894 -2.0046 -0.0372 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4114 -0.7268 1.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0258 -1.8534 -0.5563 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2301 -0.1557 -0.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4841 -2.1779 -3.5559 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2264 -2.3217 -3.4751 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2102 -2.8546 -2.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0282 -0.3865 -3.7552 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8474 1.6345 -4.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3155 2.1956 -2.9875 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6594 3.1406 -2.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2132 1.7641 -1.1992 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2334 1.9985 -4.2277 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6013 2.8989 -4.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7527 1.2670 -4.7720 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4236 -0.2056 -3.9249 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2499 -1.4287 -3.6226 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6020 -1.9047 -2.0556 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8624 -1.1325 -1.8111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4874 2.4059 -1.1551 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7035 -0.3796 -0.9078 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8711 0.6715 -2.3065 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0845 2.7450 -2.3692 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6193 3.2390 -1.6498 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0879 3.6570 -0.8328 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7578 1.8255 -0.8893 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2958 0.5192 0.2059 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0943 0.2647 -1.6120 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8429 1.1407 1.4715 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9580 2.8661 1.0751 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8751 2.0994 2.3135 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6705 3.1853 0.9205 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4430 -2.3854 2.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6569 -0.7329 2.9807 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6911 -1.8943 5.1491 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2826 -2.1490 4.2593 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5225 -4.0864 3.5697 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7629 -3.4534 2.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7086 -1.1323 2.3085 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4898 -1.7223 0.0057 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7926 -3.1777 -0.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5010 -2.8962 -0.0983 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4388 -4.9286 0.6288 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9790 0.7322 1.0611 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5639 2.3013 1.6169 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1039 3.4040 -0.2504 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7732 2.3022 -0.0871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1698 3.7432 -1.7009 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0983 3.6159 -3.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7080 2.6756 -3.0035 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0833 1.8319 -1.7579 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9838 1.1687 -3.4854 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0597 0.4531 -2.2962 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8155 -1.5541 -3.3705 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6817 -1.3671 -1.8389 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1210 -2.2705 -1.8060 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2944 -1.8477 1.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2053 -4.1041 3.8716 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4939 -1.6599 1.9598 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8779 -0.8252 4.0988 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5114 1.4572 -1.5966 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3961 4.1509 -3.0250 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5928 3.9250 -0.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7529 2.3522 -1.4835 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0840 3.0632 1.5202 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5964 3.3252 1.8774 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3196 -2.7033 1.3349 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2739 -1.7834 -1.2638 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3006 -1.8852 -0.8521 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6419 -4.4139 -0.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7781 -3.1981 1.8572 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8171 -2.3714 0.1103 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 35 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 19 54 1 0 54 55 1 0 54 56 1 0 12 57 1 0 57 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 58 62 1 0 62 63 1 0 7 64 1 0 64 65 1 0 65 66 1 0 66 67 2 0 66 68 1 0 65 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 4 73 1 0 73 74 1 0 73 75 1 0 75 76 1 0 75 77 1 0 77 78 1 0 77 2 1 0 71 6 1 0 62 9 1 0 54 14 1 0 24 17 1 0 52 27 1 0 52 22 1 0 35 28 1 0 48 39 1 0 1 79 1 0 1 80 1 0 1 81 1 0 2 82 1 0 4 83 1 0 6 84 1 0 7 85 1 0 9 86 1 0 10 87 1 0 11 88 1 0 12 89 1 0 14 90 1 0 15 91 1 0 15 92 1 0 16 93 1 0 16 94 1 0 18 95 1 0 18 96 1 0 18 97 1 0 19 98 1 0 20 99 1 0 20100 1 0 21101 1 0 21102 1 0 23103 1 0 23104 1 0 23105 1 0 24106 1 0 25107 1 0 25108 1 0 26109 1 0 28110 1 0 29111 1 0 29112 1 0 31113 1 0 31114 1 0 31115 1 0 32116 1 0 32117 1 0 32118 1 0 33119 1 0 33120 1 0 34121 1 0 34122 1 0 39123 1 0 41124 1 0 42125 1 0 42126 1 0 43127 1 0 44128 1 0 45129 1 0 46130 1 0 47131 1 0 48132 1 0 49133 1 0 50134 1 0 50135 1 0 51136 1 0 51137 1 0 53138 1 0 53139 1 0 53140 1 0 55141 1 0 55142 1 0 55143 1 0 56144 1 0 56145 1 0 56146 1 0 58147 1 0 61148 1 0 62149 1 0 63150 1 0 65151 1 0 68152 1 0 69153 1 0 70154 1 0 71155 1 0 72156 1 0 73157 1 0 74158 1 0 75159 1 0 76160 1 0 77161 1 0 78162 1 0 M END PDB for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 -1.332 -5.390 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 0.000 -6.159 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 1.268 -5.428 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 1.268 -3.850 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 2.038 -5.184 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 0.097 -2.931 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 0.000 -1.540 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 1.334 -0.770 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 2.667 -1.540 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 4.001 -0.770 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 4.001 0.770 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 6.668 0.770 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 6.668 -0.770 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 5.336 -1.540 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 5.336 -3.080 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 4.001 -3.850 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 2.651 -3.051 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 2.651 -4.620 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -3.657 -7.340 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -2.667 -6.159 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -1.676 -7.340 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -1.332 -2.310 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 -1.332 -3.850 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -2.667 -3.080 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -4.001 -3.850 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -4.001 -5.390 0.000 0.00 0.00 C+0 HETATM 27 O UNK 0 -5.333 -6.159 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 -6.668 -5.390 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -6.668 -3.850 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 -5.333 -3.080 0.000 0.00 0.00 O+0 HETATM 31 O UNK 0 6.668 -3.850 0.000 0.00 0.00 O+0 HETATM 32 C UNK 0 6.668 -2.310 0.000 0.00 0.00 C+0 HETATM 33 O UNK 0 8.002 -1.540 0.000 0.00 0.00 O+0 HETATM 34 C UNK 0 9.334 -2.310 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 9.334 -3.850 0.000 0.00 0.00 C+0 HETATM 36 O UNK 0 8.002 -4.620 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 4.345 2.720 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 5.336 1.540 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 6.324 2.720 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 10.669 -1.540 0.000 0.00 0.00 O+0 HETATM 41 C UNK 0 12.003 -2.310 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 13.335 -1.540 0.000 0.00 0.00 C+0 HETATM 43 O UNK 0 14.670 -2.310 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 13.335 -4.620 0.000 0.00 0.00 O+0 HETATM 45 C UNK 0 12.003 -3.850 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 10.669 -4.620 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 10.669 -6.159 0.000 0.00 0.00 O+0 HETATM 48 O UNK 0 -8.002 -6.159 0.000 0.00 0.00 O+0 HETATM 49 C UNK 0 -9.334 -5.390 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -10.669 -6.159 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 -10.669 -7.699 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 -12.001 -5.390 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 -10.669 -3.080 0.000 0.00 0.00 O+0 HETATM 54 C UNK 0 -9.334 -3.850 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -8.002 -3.080 0.000 0.00 0.00 C+0 HETATM 56 O UNK 0 -8.002 -1.540 0.000 0.00 0.00 O+0 HETATM 57 C UNK 0 -9.334 -0.770 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -9.334 0.770 0.000 0.00 0.00 C+0 HETATM 59 O UNK 0 -8.002 1.540 0.000 0.00 0.00 O+0 HETATM 60 C UNK 0 -8.002 3.080 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -6.668 3.850 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 -5.333 3.080 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 -10.669 -1.540 0.000 0.00 0.00 O+0 HETATM 64 C UNK 0 -12.001 -0.770 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 -13.335 -1.540 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 -14.670 -0.770 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 -13.335 1.540 0.000 0.00 0.00 O+0 HETATM 68 C UNK 0 -12.001 0.770 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 -10.669 1.540 0.000 0.00 0.00 C+0 HETATM 70 O UNK 0 -10.669 3.080 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 -9.334 3.850 0.000 0.00 0.00 O+0 HETATM 72 C UNK 0 -9.334 5.390 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -10.669 6.159 0.000 0.00 0.00 C+0 HETATM 74 O UNK 0 -8.002 7.699 0.000 0.00 0.00 O+0 HETATM 75 C UNK 0 -8.002 6.159 0.000 0.00 0.00 C+0 HETATM 76 C UNK 0 -6.668 5.390 0.000 0.00 0.00 C+0 HETATM 77 O UNK 0 -5.333 6.159 0.000 0.00 0.00 O+0 HETATM 78 O UNK 0 -13.335 -3.080 0.000 0.00 0.00 O+0 CONECT 1 2 20 23 CONECT 2 1 3 CONECT 3 2 4 CONECT 4 3 5 6 17 CONECT 5 4 CONECT 6 4 7 23 CONECT 7 6 8 CONECT 8 7 9 CONECT 9 8 10 17 CONECT 10 9 11 14 CONECT 11 10 38 CONECT 12 13 38 CONECT 13 12 14 CONECT 14 10 13 15 32 CONECT 15 14 16 CONECT 16 15 17 CONECT 17 4 9 16 18 CONECT 18 17 CONECT 19 20 CONECT 20 1 19 21 26 CONECT 21 20 CONECT 22 23 CONECT 23 1 6 22 24 CONECT 24 23 25 CONECT 25 24 26 CONECT 26 20 25 27 CONECT 27 26 28 CONECT 28 27 29 48 CONECT 29 28 30 55 CONECT 30 29 CONECT 31 32 CONECT 32 14 31 33 CONECT 33 32 34 CONECT 34 33 35 40 CONECT 35 34 36 46 CONECT 36 35 CONECT 37 38 CONECT 38 11 12 37 39 CONECT 39 38 CONECT 40 34 41 CONECT 41 40 42 45 CONECT 42 41 43 CONECT 43 42 CONECT 44 45 CONECT 45 41 44 46 CONECT 46 35 45 47 CONECT 47 46 CONECT 48 28 49 CONECT 49 48 50 54 CONECT 50 49 51 52 CONECT 51 50 CONECT 52 50 CONECT 53 54 CONECT 54 49 53 55 CONECT 55 29 54 56 CONECT 56 55 57 CONECT 57 56 58 63 CONECT 58 57 59 69 CONECT 59 58 60 CONECT 60 59 61 71 CONECT 61 60 62 76 CONECT 62 61 CONECT 63 57 64 CONECT 64 63 65 68 CONECT 65 64 66 78 CONECT 66 65 CONECT 67 68 CONECT 68 64 67 69 CONECT 69 58 68 70 CONECT 70 69 CONECT 71 60 72 CONECT 72 71 73 75 CONECT 73 72 CONECT 74 75 CONECT 75 72 74 76 CONECT 76 61 75 77 CONECT 77 76 CONECT 78 65 MASTER 0 0 0 0 0 0 0 0 78 0 172 0 END 3D PDB for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])COMPND HMDB0040859 HETATM 1 C1 UNL 1 -12.666 -1.143 3.030 1.00 0.00 C HETATM 2 C2 UNL 1 -12.348 -1.153 1.546 1.00 0.00 C HETATM 3 O1 UNL 1 -11.395 -0.256 1.188 1.00 0.00 O HETATM 4 C3 UNL 1 -10.085 -0.664 1.182 1.00 0.00 C HETATM 5 O2 UNL 1 -9.391 0.316 0.445 1.00 0.00 O HETATM 6 C4 UNL 1 -8.482 1.009 1.206 1.00 0.00 C HETATM 7 C5 UNL 1 -7.160 1.048 0.496 1.00 0.00 C HETATM 8 O3 UNL 1 -6.080 1.155 1.371 1.00 0.00 O HETATM 9 C6 UNL 1 -5.049 0.239 1.050 1.00 0.00 C HETATM 10 C7 UNL 1 -3.841 1.061 0.735 1.00 0.00 C HETATM 11 O4 UNL 1 -3.900 2.229 1.552 1.00 0.00 O HETATM 12 C8 UNL 1 -2.513 0.444 1.033 1.00 0.00 C HETATM 13 O5 UNL 1 -2.061 -0.464 0.084 1.00 0.00 O HETATM 14 C9 UNL 1 -0.851 -0.024 -0.501 1.00 0.00 C HETATM 15 C10 UNL 1 0.216 -0.979 -0.025 1.00 0.00 C HETATM 16 C11 UNL 1 1.521 -0.854 -0.772 1.00 0.00 C HETATM 17 C12 UNL 1 1.425 -0.673 -2.232 1.00 0.00 C HETATM 18 C13 UNL 1 1.348 -2.086 -2.845 1.00 0.00 C HETATM 19 C14 UNL 1 0.248 0.082 -2.758 1.00 0.00 C HETATM 20 C15 UNL 1 0.551 1.510 -3.148 1.00 0.00 C HETATM 21 C16 UNL 1 1.608 2.028 -2.160 1.00 0.00 C HETATM 22 C17 UNL 1 2.910 1.380 -2.571 1.00 0.00 C HETATM 23 C18 UNL 1 3.154 1.986 -3.987 1.00 0.00 C HETATM 24 C19 UNL 1 2.704 -0.076 -2.813 1.00 0.00 C HETATM 25 C20 UNL 1 3.861 -0.976 -2.660 1.00 0.00 C HETATM 26 C21 UNL 1 5.047 -0.439 -1.987 1.00 0.00 C HETATM 27 C22 UNL 1 5.133 0.781 -1.617 1.00 0.00 C HETATM 28 C23 UNL 1 6.330 1.312 -0.938 1.00 0.00 C HETATM 29 C24 UNL 1 7.622 0.663 -1.192 1.00 0.00 C HETATM 30 C25 UNL 1 8.661 1.586 -0.584 1.00 0.00 C HETATM 31 C26 UNL 1 8.617 2.871 -1.424 1.00 0.00 C HETATM 32 C27 UNL 1 10.020 0.982 -0.786 1.00 0.00 C HETATM 33 C28 UNL 1 8.401 1.934 0.835 1.00 0.00 C HETATM 34 C29 UNL 1 6.974 2.150 1.208 1.00 0.00 C HETATM 35 C30 UNL 1 6.001 1.207 0.540 1.00 0.00 C HETATM 36 C31 UNL 1 6.219 -0.137 1.121 1.00 0.00 C HETATM 37 O6 UNL 1 5.193 -0.784 1.514 1.00 0.00 O HETATM 38 O7 UNL 1 7.416 -0.785 1.290 1.00 0.00 O HETATM 39 C32 UNL 1 7.491 -2.077 1.862 1.00 0.00 C HETATM 40 O8 UNL 1 8.217 -2.171 3.010 1.00 0.00 O HETATM 41 C33 UNL 1 9.538 -1.856 2.970 1.00 0.00 C HETATM 42 C34 UNL 1 10.185 -2.323 4.261 1.00 0.00 C HETATM 43 O9 UNL 1 10.009 -3.708 4.351 1.00 0.00 O HETATM 44 C35 UNL 1 10.309 -2.474 1.840 1.00 0.00 C HETATM 45 O10 UNL 1 11.371 -1.623 1.530 1.00 0.00 O HETATM 46 C36 UNL 1 9.485 -2.655 0.595 1.00 0.00 C HETATM 47 O11 UNL 1 10.122 -3.636 -0.199 1.00 0.00 O HETATM 48 C37 UNL 1 8.068 -3.041 0.848 1.00 0.00 C HETATM 49 O12 UNL 1 7.990 -4.352 1.306 1.00 0.00 O HETATM 50 C38 UNL 1 4.575 1.611 0.718 1.00 0.00 C HETATM 51 C39 UNL 1 3.849 2.300 -0.366 1.00 0.00 C HETATM 52 C40 UNL 1 4.078 1.813 -1.780 1.00 0.00 C HETATM 53 C41 UNL 1 4.812 3.000 -2.460 1.00 0.00 C HETATM 54 C42 UNL 1 -1.024 -0.071 -1.963 1.00 0.00 C HETATM 55 C43 UNL 1 -2.045 0.946 -2.396 1.00 0.00 C HETATM 56 C44 UNL 1 -1.643 -1.445 -2.282 1.00 0.00 C HETATM 57 O13 UNL 1 -2.571 -0.207 2.256 1.00 0.00 O HETATM 58 C45 UNL 1 -3.415 -1.279 2.166 1.00 0.00 C HETATM 59 C46 UNL 1 -3.330 -2.256 3.255 1.00 0.00 C HETATM 60 O14 UNL 1 -2.535 -2.135 4.216 1.00 0.00 O HETATM 61 O15 UNL 1 -4.162 -3.356 3.223 1.00 0.00 O HETATM 62 C47 UNL 1 -4.860 -0.770 2.146 1.00 0.00 C HETATM 63 O16 UNL 1 -5.230 -0.256 3.389 1.00 0.00 O HETATM 64 O17 UNL 1 -7.098 2.236 -0.292 1.00 0.00 O HETATM 65 C48 UNL 1 -8.254 2.391 -1.051 1.00 0.00 C HETATM 66 C49 UNL 1 -8.054 3.454 -2.039 1.00 0.00 C HETATM 67 O18 UNL 1 -8.945 3.814 -2.861 1.00 0.00 O HETATM 68 O19 UNL 1 -6.845 4.126 -2.113 1.00 0.00 O HETATM 69 C50 UNL 1 -9.393 2.837 -0.128 1.00 0.00 C HETATM 70 O20 UNL 1 -10.547 2.181 -0.550 1.00 0.00 O HETATM 71 C51 UNL 1 -8.987 2.463 1.258 1.00 0.00 C HETATM 72 O21 UNL 1 -9.935 2.659 2.229 1.00 0.00 O HETATM 73 C52 UNL 1 -9.777 -1.990 0.610 1.00 0.00 C HETATM 74 O22 UNL 1 -8.830 -1.858 -0.405 1.00 0.00 O HETATM 75 C53 UNL 1 -11.021 -2.571 -0.027 1.00 0.00 C HETATM 76 O23 UNL 1 -10.822 -3.871 -0.490 1.00 0.00 O HETATM 77 C54 UNL 1 -12.111 -2.549 1.011 1.00 0.00 C HETATM 78 O24 UNL 1 -13.259 -3.122 0.469 1.00 0.00 O HETATM 79 H1 UNL 1 -12.198 -1.991 3.563 1.00 0.00 H HETATM 80 H2 UNL 1 -12.354 -0.152 3.439 1.00 0.00 H HETATM 81 H3 UNL 1 -13.756 -1.225 3.212 1.00 0.00 H HETATM 82 H4 UNL 1 -13.310 -0.814 1.046 1.00 0.00 H HETATM 83 H5 UNL 1 -9.676 -0.577 2.234 1.00 0.00 H HETATM 84 H6 UNL 1 -8.434 0.611 2.251 1.00 0.00 H HETATM 85 H7 UNL 1 -7.038 0.244 -0.257 1.00 0.00 H HETATM 86 H8 UNL 1 -5.428 -0.320 0.152 1.00 0.00 H HETATM 87 H9 UNL 1 -3.964 1.403 -0.323 1.00 0.00 H HETATM 88 H10 UNL 1 -4.007 1.947 2.496 1.00 0.00 H HETATM 89 H11 UNL 1 -1.781 1.298 1.137 1.00 0.00 H HETATM 90 H12 UNL 1 -0.670 0.970 -0.070 1.00 0.00 H HETATM 91 H13 UNL 1 -0.189 -2.005 -0.037 1.00 0.00 H HETATM 92 H14 UNL 1 0.411 -0.727 1.036 1.00 0.00 H HETATM 93 H15 UNL 1 2.026 -1.853 -0.556 1.00 0.00 H HETATM 94 H16 UNL 1 2.230 -0.156 -0.261 1.00 0.00 H HETATM 95 H17 UNL 1 0.484 -2.178 -3.556 1.00 0.00 H HETATM 96 H18 UNL 1 2.226 -2.322 -3.475 1.00 0.00 H HETATM 97 H19 UNL 1 1.210 -2.855 -2.087 1.00 0.00 H HETATM 98 H20 UNL 1 -0.028 -0.386 -3.755 1.00 0.00 H HETATM 99 H21 UNL 1 0.847 1.634 -4.192 1.00 0.00 H HETATM 100 H22 UNL 1 -0.316 2.196 -2.988 1.00 0.00 H HETATM 101 H23 UNL 1 1.659 3.141 -2.253 1.00 0.00 H HETATM 102 H24 UNL 1 1.213 1.764 -1.199 1.00 0.00 H HETATM 103 H25 UNL 1 4.233 1.999 -4.228 1.00 0.00 H HETATM 104 H26 UNL 1 2.601 2.899 -4.158 1.00 0.00 H HETATM 105 H27 UNL 1 2.753 1.267 -4.772 1.00 0.00 H HETATM 106 H28 UNL 1 2.424 -0.206 -3.925 1.00 0.00 H HETATM 107 H29 UNL 1 4.250 -1.429 -3.623 1.00 0.00 H HETATM 108 H30 UNL 1 3.602 -1.905 -2.056 1.00 0.00 H HETATM 109 H31 UNL 1 5.862 -1.132 -1.811 1.00 0.00 H HETATM 110 H32 UNL 1 6.487 2.406 -1.155 1.00 0.00 H HETATM 111 H33 UNL 1 7.704 -0.380 -0.908 1.00 0.00 H HETATM 112 H34 UNL 1 7.871 0.672 -2.306 1.00 0.00 H HETATM 113 H35 UNL 1 8.084 2.745 -2.369 1.00 0.00 H HETATM 114 H36 UNL 1 9.619 3.239 -1.650 1.00 0.00 H HETATM 115 H37 UNL 1 8.088 3.657 -0.833 1.00 0.00 H HETATM 116 H38 UNL 1 10.758 1.826 -0.889 1.00 0.00 H HETATM 117 H39 UNL 1 10.296 0.519 0.206 1.00 0.00 H HETATM 118 H40 UNL 1 10.094 0.265 -1.612 1.00 0.00 H HETATM 119 H41 UNL 1 8.843 1.141 1.471 1.00 0.00 H HETATM 120 H42 UNL 1 8.958 2.866 1.075 1.00 0.00 H HETATM 121 H43 UNL 1 6.875 2.099 2.313 1.00 0.00 H HETATM 122 H44 UNL 1 6.671 3.185 0.921 1.00 0.00 H HETATM 123 H45 UNL 1 6.443 -2.385 2.114 1.00 0.00 H HETATM 124 H46 UNL 1 9.657 -0.733 2.981 1.00 0.00 H HETATM 125 H47 UNL 1 9.691 -1.894 5.149 1.00 0.00 H HETATM 126 H48 UNL 1 11.283 -2.149 4.259 1.00 0.00 H HETATM 127 H49 UNL 1 9.523 -4.086 3.570 1.00 0.00 H HETATM 128 H50 UNL 1 10.763 -3.453 2.096 1.00 0.00 H HETATM 129 H51 UNL 1 11.709 -1.132 2.308 1.00 0.00 H HETATM 130 H52 UNL 1 9.490 -1.722 0.006 1.00 0.00 H HETATM 131 H53 UNL 1 10.793 -3.178 -0.758 1.00 0.00 H HETATM 132 H54 UNL 1 7.501 -2.896 -0.098 1.00 0.00 H HETATM 133 H55 UNL 1 8.439 -4.929 0.629 1.00 0.00 H HETATM 134 H56 UNL 1 3.979 0.732 1.061 1.00 0.00 H HETATM 135 H57 UNL 1 4.564 2.301 1.617 1.00 0.00 H HETATM 136 H58 UNL 1 4.104 3.404 -0.250 1.00 0.00 H HETATM 137 H59 UNL 1 2.773 2.302 -0.087 1.00 0.00 H HETATM 138 H60 UNL 1 5.170 3.743 -1.701 1.00 0.00 H HETATM 139 H61 UNL 1 4.098 3.616 -3.059 1.00 0.00 H HETATM 140 H62 UNL 1 5.708 2.676 -3.003 1.00 0.00 H HETATM 141 H63 UNL 1 -2.083 1.832 -1.758 1.00 0.00 H HETATM 142 H64 UNL 1 -1.984 1.169 -3.485 1.00 0.00 H HETATM 143 H65 UNL 1 -3.060 0.453 -2.296 1.00 0.00 H HETATM 144 H66 UNL 1 -1.816 -1.554 -3.370 1.00 0.00 H HETATM 145 H67 UNL 1 -2.682 -1.367 -1.839 1.00 0.00 H HETATM 146 H68 UNL 1 -1.121 -2.271 -1.806 1.00 0.00 H HETATM 147 H69 UNL 1 -3.294 -1.848 1.197 1.00 0.00 H HETATM 148 H70 UNL 1 -4.205 -4.104 3.872 1.00 0.00 H HETATM 149 H71 UNL 1 -5.494 -1.660 1.960 1.00 0.00 H HETATM 150 H72 UNL 1 -4.878 -0.825 4.099 1.00 0.00 H HETATM 151 H73 UNL 1 -8.511 1.457 -1.597 1.00 0.00 H HETATM 152 H74 UNL 1 -6.396 4.151 -3.025 1.00 0.00 H HETATM 153 H75 UNL 1 -9.593 3.925 -0.255 1.00 0.00 H HETATM 154 H76 UNL 1 -10.753 2.352 -1.484 1.00 0.00 H HETATM 155 H77 UNL 1 -8.084 3.063 1.520 1.00 0.00 H HETATM 156 H78 UNL 1 -10.596 3.325 1.877 1.00 0.00 H HETATM 157 H79 UNL 1 -9.320 -2.703 1.335 1.00 0.00 H HETATM 158 H80 UNL 1 -9.274 -1.783 -1.264 1.00 0.00 H HETATM 159 H81 UNL 1 -11.301 -1.885 -0.852 1.00 0.00 H HETATM 160 H82 UNL 1 -11.642 -4.414 -0.253 1.00 0.00 H HETATM 161 H83 UNL 1 -11.778 -3.198 1.857 1.00 0.00 H HETATM 162 H84 UNL 1 -13.817 -2.371 0.110 1.00 0.00 H CONECT 1 2 79 80 81 CONECT 2 3 77 82 CONECT 3 4 CONECT 4 5 73 83 CONECT 5 6 CONECT 6 7 71 84 CONECT 7 8 64 85 CONECT 8 9 CONECT 9 10 62 86 CONECT 10 11 12 87 CONECT 11 88 CONECT 12 13 57 89 CONECT 13 14 CONECT 14 15 54 90 CONECT 15 16 91 92 CONECT 16 17 93 94 CONECT 17 18 19 24 CONECT 18 95 96 97 CONECT 19 20 54 98 CONECT 20 21 99 100 CONECT 21 22 101 102 CONECT 22 23 24 52 CONECT 23 103 104 105 CONECT 24 25 106 CONECT 25 26 107 108 CONECT 26 27 27 109 CONECT 27 28 52 CONECT 28 29 35 110 CONECT 29 30 111 112 CONECT 30 31 32 33 CONECT 31 113 114 115 CONECT 32 116 117 118 CONECT 33 34 119 120 CONECT 34 35 121 122 CONECT 35 36 50 CONECT 36 37 37 38 CONECT 38 39 CONECT 39 40 48 123 CONECT 40 41 CONECT 41 42 44 124 CONECT 42 43 125 126 CONECT 43 127 CONECT 44 45 46 128 CONECT 45 129 CONECT 46 47 48 130 CONECT 47 131 CONECT 48 49 132 CONECT 49 133 CONECT 50 51 134 135 CONECT 51 52 136 137 CONECT 52 53 CONECT 53 138 139 140 CONECT 54 55 56 CONECT 55 141 142 143 CONECT 56 144 145 146 CONECT 57 58 CONECT 58 59 62 147 CONECT 59 60 60 61 CONECT 61 148 CONECT 62 63 149 CONECT 63 150 CONECT 64 65 CONECT 65 66 69 151 CONECT 66 67 67 68 CONECT 68 152 CONECT 69 70 71 153 CONECT 70 154 CONECT 71 72 155 CONECT 72 156 CONECT 73 74 75 157 CONECT 74 158 CONECT 75 76 77 159 CONECT 76 160 CONECT 77 78 161 CONECT 78 162 END SMILES for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])CC1OC(OC2C(O)C(O)C(OC2OC2C(O)C(OC3CCC4(C)C(CCC5(C)C4CC=C4C6CC(C)(C)CCC6(CCC54C)C(=O)OC4OC(CO)C(O)C(O)C4O)C3(C)C)OC(C2O)C(O)=O)C(O)=O)C(O)C(O)C1O INCHI for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])InChI=1S/C54H84O24/c1-21-28(56)30(58)34(62)44(71-21)77-41-33(61)32(60)39(42(66)67)76-47(41)74-38-36(64)40(43(68)69)75-46(37(38)65)73-27-12-13-51(6)25(50(27,4)5)11-14-53(8)26(51)10-9-22-23-19-49(2,3)15-17-54(23,18-16-52(22,53)7)48(70)78-45-35(63)31(59)29(57)24(20-55)72-45/h9,21,23-41,44-47,55-65H,10-20H2,1-8H3,(H,66,67)(H,68,69) Structure for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide])3D Structure for HMDB0040859 (28-Glucosyloleanolic acid 3-[rhamnosyl-(1->2)-galactosyl-(1->3)-glucuronide]) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C54H84O24 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1117.2304 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1116.535253616 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 6-[(2-{[4,4,6a,6b,11,11,14b-heptamethyl-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-6-carboxy-3,5-dihydroxyoxan-4-yl)oxy]-3,4-dihydroxy-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxane-2-carboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 6-[(2-{[4,4,6a,6b,11,11,14b-heptamethyl-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-6-carboxy-3,5-dihydroxyoxan-4-yl)oxy]-3,4-dihydroxy-5-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxane-2-carboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OC2C(O)C(O)C(OC2OC2C(O)C(OC3CCC4(C)C(CCC5(C)C4CC=C4C6CC(C)(C)CCC6(CCC54C)C(=O)OC4OC(CO)C(O)C(O)C4O)C3(C)C)OC(C2O)C(O)=O)C(O)=O)C(O)C(O)C1O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C54H84O24/c1-21-28(56)30(58)34(62)44(71-21)77-41-33(61)32(60)39(42(66)67)76-47(41)74-38-36(64)40(43(68)69)75-46(37(38)65)73-27-12-13-51(6)25(50(27,4)5)11-14-53(8)26(51)10-9-22-23-19-49(2,3)15-17-54(23,18-16-52(22,53)7)48(70)78-45-35(63)31(59)29(57)24(20-55)72-45/h9,21,23-41,44-47,55-65H,10-20H2,1-8H3,(H,66,67)(H,68,69) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | IMPZGAYJJGGWNV-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Terpene glycosides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpene saponins | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB020687 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131752956 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|