Showing metabocard for Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside (HMDB0041155)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 02:48:35 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:54 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0041155 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside belongs to the class of organic compounds known as anthocyanidin 3-o-6-p-coumaroyl glycosides. These are anthocyanidin 3-O-glycosides where the carbohydrate moiety is esterified at the C6 position with a p-coumaric acid. P-coumaric acid is an organic derivative of cinnamic acid, that carries a hydroxyl group at the 4-position of the benzene ring. Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside has been detected, but not quantified in, brassicas. This could make cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside a potential biomarker for the consumption of these foods. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)Mrv0541 05061312252D 76 83 0 0 0 0 999 V2000 2.1434 6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 10.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 5.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 7.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 9.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 9.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 8.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 11.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 9.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 8.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 7.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 8.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -1.6500 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 9.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5 1 1 0 0 0 0 6 2 2 0 0 0 0 7 4 2 0 0 0 0 8 3 2 0 0 0 0 17 1 2 0 0 0 0 17 2 1 0 0 0 0 17 3 1 0 0 0 0 18 4 1 0 0 0 0 18 9 2 0 0 0 0 19 10 2 0 0 0 0 19 11 1 0 0 0 0 20 5 2 0 0 0 0 20 6 1 0 0 0 0 21 12 2 0 0 0 0 22 7 1 0 0 0 0 23 9 1 0 0 0 0 23 22 2 0 0 0 0 24 10 1 0 0 0 0 24 21 1 0 0 0 0 25 11 2 0 0 0 0 25 21 1 0 0 0 0 26 12 1 0 0 0 0 27 13 1 0 0 0 0 28 14 1 0 0 0 0 29 15 1 0 0 0 0 30 16 1 0 0 0 0 31 8 1 0 0 0 0 32 27 1 0 0 0 0 33 28 1 0 0 0 0 34 29 1 0 0 0 0 35 30 1 0 0 0 0 36 32 1 0 0 0 0 37 33 1 0 0 0 0 38 34 1 0 0 0 0 39 35 1 0 0 0 0 40 36 1 0 0 0 0 41 37 1 0 0 0 0 42 38 1 0 0 0 0 43 18 1 0 0 0 0 43 26 2 0 0 0 0 44 39 1 0 0 0 0 45 40 1 0 0 0 0 46 41 1 0 0 0 0 47 42 1 0 0 0 0 48 44 1 0 0 0 0 49 13 1 0 0 0 0 50 14 1 0 0 0 0 51 15 1 0 0 0 0 52 19 1 0 0 0 0 53 22 1 0 0 0 0 54 23 1 0 0 0 0 55 31 2 0 0 0 0 56 32 1 0 0 0 0 57 33 1 0 0 0 0 58 34 1 0 0 0 0 59 35 1 0 0 0 0 60 36 1 0 0 0 0 61 37 1 0 0 0 0 62 38 1 0 0 0 0 63 39 1 0 0 0 0 64 40 1 0 0 0 0 65 41 1 0 0 0 0 66 42 1 0 0 0 0 67 16 1 0 0 0 0 67 31 1 0 0 0 0 68 20 1 0 0 0 0 68 45 1 0 0 0 0 69 24 2 0 0 0 0 69 43 1 0 0 0 0 70 25 1 0 0 0 0 70 46 1 0 0 0 0 71 26 1 0 0 0 0 71 48 1 0 0 0 0 72 27 1 0 0 0 0 72 45 1 0 0 0 0 73 28 1 0 0 0 0 73 46 1 0 0 0 0 74 29 1 0 0 0 0 74 47 1 0 0 0 0 75 30 1 0 0 0 0 75 48 1 0 0 0 0 76 44 1 0 0 0 0 76 47 1 0 0 0 0 M CHG 1 69 1 M END 3D MOL for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)HMDB0041155 RDKit 3D Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside 133140 0 0 0 0 0 0 0 0999 V2000 1.9393 -0.2519 -2.2062 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2234 0.6030 -1.2917 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6461 0.8435 -1.0092 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5986 0.2299 -1.6593 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0192 0.3751 -1.4794 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8922 -0.3490 -2.2969 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2530 -0.2455 -2.1550 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8078 0.5921 -1.1817 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1489 0.6529 -1.0885 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9055 1.3841 -0.1842 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9038 0.5910 0.4211 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2594 1.1952 1.6136 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5265 0.5869 2.1909 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2821 -0.7524 2.4185 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3012 2.6833 1.5597 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2475 3.2652 2.2934 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3745 3.2859 0.1986 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6988 3.5092 -0.1909 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6800 2.5102 -0.8767 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7361 3.2883 -1.5423 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9722 1.3141 -0.3664 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5794 1.1826 -0.5414 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1979 1.2199 -0.6592 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1631 1.0796 -0.7967 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7815 -0.1325 -0.1890 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0790 -0.1993 -0.5604 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9152 -1.1642 -0.1132 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7498 -1.4667 -1.2668 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6726 -0.6089 -1.7816 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7543 0.6599 -1.2153 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6737 1.5410 -1.7270 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7684 2.8179 -1.1819 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9114 3.0959 -0.1433 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8668 4.3597 0.4612 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5679 4.7932 0.6906 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5987 6.1064 1.1043 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2116 6.7335 1.0680 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3202 8.0347 1.5076 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1811 6.2189 2.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3261 5.7111 3.4610 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5427 5.5558 2.5304 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9549 5.4117 3.8550 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6123 4.2661 1.7930 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2631 3.1753 2.5457 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6933 3.6746 -1.7216 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5074 3.2766 -2.7788 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4504 4.1862 -3.3088 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3844 2.0097 -3.2888 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4519 1.0937 -2.7721 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3527 -0.0970 -3.2766 O 0 0 0 0 0 3 0 0 0 0 0 0 -5.4900 -0.9773 -2.8239 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4363 -2.3095 -3.4505 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2644 -2.5224 -4.5424 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3013 -3.7214 -5.1983 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4910 -4.7629 -4.7668 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5298 -5.9935 -5.4408 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6587 -4.5951 -3.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8331 -5.6003 -3.2219 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6649 -3.3432 -3.0608 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3294 -2.3870 0.4079 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9583 -2.8347 1.6032 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4240 -4.1104 1.4090 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7725 -5.0153 2.2798 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9011 -6.2814 1.7361 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0751 -7.2764 2.5410 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4938 -7.3294 3.8711 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3437 -6.7493 1.7386 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4361 -7.8370 0.8694 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2843 -5.6857 1.2678 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5869 -5.9001 1.7228 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9031 -4.2858 1.6792 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0955 -4.0330 3.0278 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8522 -2.4517 0.6031 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6119 -2.2049 1.9739 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0557 -1.4140 -0.1855 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1954 -1.3746 0.4036 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9309 1.5459 -0.2431 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2364 -0.4790 -2.4304 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4572 -0.9974 -3.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9463 -0.7896 -2.7747 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3077 1.8924 0.5905 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4514 0.9045 2.3516 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4149 0.7517 1.5643 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7049 1.0898 3.1612 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2070 -1.2412 1.5548 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2456 2.9896 2.1006 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5169 3.5559 3.1810 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9011 4.2986 0.2602 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9476 2.7569 -0.7994 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3979 2.0724 -1.6110 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5524 4.1294 -1.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3006 1.9750 0.3988 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9115 1.7604 0.1070 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4760 1.1951 -1.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6181 2.0280 -0.3483 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8620 0.1243 0.9691 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6303 -0.6749 0.6525 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1205 0.9624 -0.3980 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3843 5.1664 -0.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2396 6.7577 0.4476 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4945 6.1190 1.6456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9264 6.7846 -0.0121 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0160 8.1802 2.4429 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3028 7.3124 2.7105 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4009 6.2489 4.2912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2409 6.3066 2.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9398 5.2883 3.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6944 4.1364 1.4874 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0599 2.7346 2.9499 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8009 4.6739 -1.3236 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0999 4.7624 -4.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0286 1.7239 -4.1072 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9102 -1.7257 -4.9012 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9638 -3.8607 -6.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1533 -6.0984 -6.2334 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7815 -6.5066 -3.6199 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9994 -3.2782 -2.2297 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5271 -3.2340 -0.3433 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2330 -4.5267 0.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4915 -6.3119 0.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1843 -8.2823 2.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0051 -6.9827 2.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5054 -8.2476 4.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6502 -7.0961 2.7391 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9381 -7.6633 0.0074 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3406 -5.6771 0.1447 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6167 -6.8538 2.0346 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5096 -3.5950 1.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7723 -3.3146 3.1725 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3931 -3.4343 0.3757 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1386 -2.9398 2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0292 -1.8216 -1.1994 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1490 -1.4454 1.3904 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 8 21 1 0 21 22 2 0 2 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 32 45 1 0 45 46 2 0 46 47 1 0 46 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 2 0 55 56 1 0 55 57 1 0 57 58 1 0 57 59 2 0 27 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 60 73 1 0 73 74 1 0 73 75 1 0 75 76 1 0 22 5 1 0 75 25 1 0 19 10 1 0 51 29 1 0 59 52 1 0 71 62 1 0 49 31 1 0 43 34 1 0 3 77 1 0 4 78 1 0 6 79 1 0 7 80 1 0 10 81 1 0 12 82 1 0 13 83 1 0 13 84 1 0 14 85 1 0 15 86 1 0 16 87 1 0 17 88 1 0 18 89 1 0 19 90 1 0 20 91 1 0 21 92 1 0 22 93 1 0 24 94 1 0 24 95 1 0 25 96 1 0 27 97 1 0 30 98 1 0 34 99 1 0 36100 1 0 37101 1 0 37102 1 0 38103 1 0 39104 1 0 40105 1 0 41106 1 0 42107 1 0 43108 1 0 44109 1 0 45110 1 0 47111 1 0 48112 1 0 53113 1 0 54114 1 0 56115 1 0 58116 1 0 59117 1 0 60118 1 0 62119 1 0 64120 1 0 65121 1 0 65122 1 0 66123 1 0 67124 1 0 68125 1 0 69126 1 0 70127 1 0 71128 1 0 72129 1 0 73130 1 0 74131 1 0 75132 1 0 76133 1 0 M CHG 1 50 1 M END 3D SDF for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)Mrv0541 05061312252D 76 83 0 0 0 0 999 V2000 2.1434 6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 10.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 5.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 7.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 9.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 9.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 8.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 11.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 9.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 8.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 7.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 8.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -1.6500 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 9.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5 1 1 0 0 0 0 6 2 2 0 0 0 0 7 4 2 0 0 0 0 8 3 2 0 0 0 0 17 1 2 0 0 0 0 17 2 1 0 0 0 0 17 3 1 0 0 0 0 18 4 1 0 0 0 0 18 9 2 0 0 0 0 19 10 2 0 0 0 0 19 11 1 0 0 0 0 20 5 2 0 0 0 0 20 6 1 0 0 0 0 21 12 2 0 0 0 0 22 7 1 0 0 0 0 23 9 1 0 0 0 0 23 22 2 0 0 0 0 24 10 1 0 0 0 0 24 21 1 0 0 0 0 25 11 2 0 0 0 0 25 21 1 0 0 0 0 26 12 1 0 0 0 0 27 13 1 0 0 0 0 28 14 1 0 0 0 0 29 15 1 0 0 0 0 30 16 1 0 0 0 0 31 8 1 0 0 0 0 32 27 1 0 0 0 0 33 28 1 0 0 0 0 34 29 1 0 0 0 0 35 30 1 0 0 0 0 36 32 1 0 0 0 0 37 33 1 0 0 0 0 38 34 1 0 0 0 0 39 35 1 0 0 0 0 40 36 1 0 0 0 0 41 37 1 0 0 0 0 42 38 1 0 0 0 0 43 18 1 0 0 0 0 43 26 2 0 0 0 0 44 39 1 0 0 0 0 45 40 1 0 0 0 0 46 41 1 0 0 0 0 47 42 1 0 0 0 0 48 44 1 0 0 0 0 49 13 1 0 0 0 0 50 14 1 0 0 0 0 51 15 1 0 0 0 0 52 19 1 0 0 0 0 53 22 1 0 0 0 0 54 23 1 0 0 0 0 55 31 2 0 0 0 0 56 32 1 0 0 0 0 57 33 1 0 0 0 0 58 34 1 0 0 0 0 59 35 1 0 0 0 0 60 36 1 0 0 0 0 61 37 1 0 0 0 0 62 38 1 0 0 0 0 63 39 1 0 0 0 0 64 40 1 0 0 0 0 65 41 1 0 0 0 0 66 42 1 0 0 0 0 67 16 1 0 0 0 0 67 31 1 0 0 0 0 68 20 1 0 0 0 0 68 45 1 0 0 0 0 69 24 2 0 0 0 0 69 43 1 0 0 0 0 70 25 1 0 0 0 0 70 46 1 0 0 0 0 71 26 1 0 0 0 0 71 48 1 0 0 0 0 72 27 1 0 0 0 0 72 45 1 0 0 0 0 73 28 1 0 0 0 0 73 46 1 0 0 0 0 74 29 1 0 0 0 0 74 47 1 0 0 0 0 75 30 1 0 0 0 0 75 48 1 0 0 0 0 76 44 1 0 0 0 0 76 47 1 0 0 0 0 M CHG 1 69 1 M END > <DATABASE_ID> HMDB0041155 > <DATABASE_NAME> hmdb > <SMILES> OCC1OC(OC2C(O)C(O)C(COC(=O)\C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C=C3)OC2OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C48H56O28/c49-13-27-32(56)36(60)40(64)45(72-27)68-20-5-1-17(2-6-20)3-8-31(55)67-16-30-35(59)39(63)44(76-47-42(66)38(62)34(58)29(15-51)74-47)48(75-30)71-26-12-21-24(69-43(26)18-4-7-22(53)23(54)9-18)10-19(52)11-25(21)70-46-41(65)37(61)33(57)28(14-50)73-46/h1-12,27-30,32-42,44-51,56-66H,13-16H2,(H2-,52,53,54)/p+1/b8-3+ > <INCHI_KEY> JSIMVXMJRFINRS-FPYGCLRLSA-O > <FORMULA> C48H57O28 > <MOLECULAR_WEIGHT> 1081.9494 > <EXACT_MASS> 1081.30363624 > <JCHEM_ACCEPTOR_COUNT> 26 > <JCHEM_AVERAGE_POLARIZABILITY> 104.91217675266753 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 17 > <JCHEM_FORMAL_CHARGE> 1 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 3-[(4,5-dihydroxy-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-6-({[(2E)-3-(4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoyl]oxy}methyl)oxan-2-yl)oxy]-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium > <ALOGPS_LOGP> 0.21 > <JCHEM_LOGP> -3.6426000000000007 > <ALOGPS_LOGS> -3.03 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 7.991501240338166 > <JCHEM_PKA_STRONGEST_ACIDIC> 6.648189894584478 > <JCHEM_PKA_STRONGEST_BASIC> -3.6789468869085615 > <JCHEM_POLAR_SURFACE_AREA> 457.1900000000002 > <JCHEM_REFRACTIVITY> 254.50820000000016 > <JCHEM_ROTATABLE_BOND_COUNT> 17 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.04e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 3-[(4,5-dihydroxy-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-6-({[(2E)-3-(4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoyl]oxy}methyl)oxan-2-yl)oxy]-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)HMDB0041155 RDKit 3D Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside 133140 0 0 0 0 0 0 0 0999 V2000 1.9393 -0.2519 -2.2062 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2234 0.6030 -1.2917 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6461 0.8435 -1.0092 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5986 0.2299 -1.6593 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0192 0.3751 -1.4794 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8922 -0.3490 -2.2969 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2530 -0.2455 -2.1550 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8078 0.5921 -1.1817 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1489 0.6529 -1.0885 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9055 1.3841 -0.1842 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9038 0.5910 0.4211 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2594 1.1952 1.6136 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5265 0.5869 2.1909 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2821 -0.7524 2.4185 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3012 2.6833 1.5597 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2475 3.2652 2.2934 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3745 3.2859 0.1986 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6988 3.5092 -0.1909 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6800 2.5102 -0.8767 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7361 3.2883 -1.5423 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9722 1.3141 -0.3664 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5794 1.1826 -0.5414 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1979 1.2199 -0.6592 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1631 1.0796 -0.7967 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7815 -0.1325 -0.1890 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0790 -0.1993 -0.5604 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9152 -1.1642 -0.1132 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7498 -1.4667 -1.2668 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6726 -0.6089 -1.7816 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7543 0.6599 -1.2153 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6737 1.5410 -1.7270 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7684 2.8179 -1.1819 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9114 3.0959 -0.1433 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8668 4.3597 0.4612 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5679 4.7932 0.6906 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5987 6.1064 1.1043 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2116 6.7335 1.0680 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3202 8.0347 1.5076 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1811 6.2189 2.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3261 5.7111 3.4610 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5427 5.5558 2.5304 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9549 5.4117 3.8550 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6123 4.2661 1.7930 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2631 3.1753 2.5457 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6933 3.6746 -1.7216 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5074 3.2766 -2.7788 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4504 4.1862 -3.3088 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3844 2.0097 -3.2888 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4519 1.0937 -2.7721 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3527 -0.0970 -3.2766 O 0 0 0 0 0 3 0 0 0 0 0 0 -5.4900 -0.9773 -2.8239 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4363 -2.3095 -3.4505 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2644 -2.5224 -4.5424 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3013 -3.7214 -5.1983 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4910 -4.7629 -4.7668 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5298 -5.9935 -5.4408 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6587 -4.5951 -3.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8331 -5.6003 -3.2219 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6649 -3.3432 -3.0608 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3294 -2.3870 0.4079 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9583 -2.8347 1.6032 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4240 -4.1104 1.4090 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7725 -5.0153 2.2798 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9011 -6.2814 1.7361 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0751 -7.2764 2.5410 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4938 -7.3294 3.8711 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3437 -6.7493 1.7386 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4361 -7.8370 0.8694 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2843 -5.6857 1.2678 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5869 -5.9001 1.7228 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9031 -4.2858 1.6792 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0955 -4.0330 3.0278 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8522 -2.4517 0.6031 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6119 -2.2049 1.9739 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0557 -1.4140 -0.1855 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1954 -1.3746 0.4036 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9309 1.5459 -0.2431 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2364 -0.4790 -2.4304 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4572 -0.9974 -3.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9463 -0.7896 -2.7747 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3077 1.8924 0.5905 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4514 0.9045 2.3516 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4149 0.7517 1.5643 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7049 1.0898 3.1612 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2070 -1.2412 1.5548 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2456 2.9896 2.1006 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5169 3.5559 3.1810 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9011 4.2986 0.2602 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9476 2.7569 -0.7994 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3979 2.0724 -1.6110 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5524 4.1294 -1.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3006 1.9750 0.3988 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9115 1.7604 0.1070 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4760 1.1951 -1.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6181 2.0280 -0.3483 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8620 0.1243 0.9691 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6303 -0.6749 0.6525 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1205 0.9624 -0.3980 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3843 5.1664 -0.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2396 6.7577 0.4476 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4945 6.1190 1.6456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9264 6.7846 -0.0121 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0160 8.1802 2.4429 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3028 7.3124 2.7105 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4009 6.2489 4.2912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2409 6.3066 2.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9398 5.2883 3.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6944 4.1364 1.4874 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0599 2.7346 2.9499 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8009 4.6739 -1.3236 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0999 4.7624 -4.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0286 1.7239 -4.1072 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9102 -1.7257 -4.9012 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9638 -3.8607 -6.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1533 -6.0984 -6.2334 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7815 -6.5066 -3.6199 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9994 -3.2782 -2.2297 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5271 -3.2340 -0.3433 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2330 -4.5267 0.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4915 -6.3119 0.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1843 -8.2823 2.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0051 -6.9827 2.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5054 -8.2476 4.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6502 -7.0961 2.7391 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9381 -7.6633 0.0074 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3406 -5.6771 0.1447 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6167 -6.8538 2.0346 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5096 -3.5950 1.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7723 -3.3146 3.1725 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3931 -3.4343 0.3757 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1386 -2.9398 2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0292 -1.8216 -1.1994 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1490 -1.4454 1.3904 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 8 21 1 0 21 22 2 0 2 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 32 45 1 0 45 46 2 0 46 47 1 0 46 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 2 0 55 56 1 0 55 57 1 0 57 58 1 0 57 59 2 0 27 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 60 73 1 0 73 74 1 0 73 75 1 0 75 76 1 0 22 5 1 0 75 25 1 0 19 10 1 0 51 29 1 0 59 52 1 0 71 62 1 0 49 31 1 0 43 34 1 0 3 77 1 0 4 78 1 0 6 79 1 0 7 80 1 0 10 81 1 0 12 82 1 0 13 83 1 0 13 84 1 0 14 85 1 0 15 86 1 0 16 87 1 0 17 88 1 0 18 89 1 0 19 90 1 0 20 91 1 0 21 92 1 0 22 93 1 0 24 94 1 0 24 95 1 0 25 96 1 0 27 97 1 0 30 98 1 0 34 99 1 0 36100 1 0 37101 1 0 37102 1 0 38103 1 0 39104 1 0 40105 1 0 41106 1 0 42107 1 0 43108 1 0 44109 1 0 45110 1 0 47111 1 0 48112 1 0 53113 1 0 54114 1 0 56115 1 0 58116 1 0 59117 1 0 60118 1 0 62119 1 0 64120 1 0 65121 1 0 65122 1 0 66123 1 0 67124 1 0 68125 1 0 69126 1 0 70127 1 0 71128 1 0 72129 1 0 73130 1 0 74131 1 0 75132 1 0 76133 1 0 M CHG 1 50 1 M END PDB for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 4.001 11.550 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 1.334 11.550 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 2.667 9.240 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 8.002 -4.620 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 4.001 13.090 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 1.334 13.090 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 9.336 -5.390 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 4.001 8.470 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 9.336 -2.310 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 2.667 -3.080 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 1.334 -0.770 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 5.335 0.000 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 0.000 20.020 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 0.000 6.160 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 13.337 6.160 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 5.335 4.620 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 2.667 10.780 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 8.002 -3.080 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 1.334 -2.310 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 2.667 13.860 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 4.001 -0.770 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 10.669 -4.620 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 10.669 -3.080 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 4.001 -2.310 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 2.667 0.000 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 6.668 -0.770 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 0.000 18.480 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 0.000 4.620 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 13.337 4.620 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 6.668 3.850 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 4.001 6.930 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -1.334 17.710 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -1.334 3.850 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 14.671 3.850 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 8.002 4.620 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -1.334 16.170 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -1.334 2.310 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 14.671 2.310 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 9.336 3.850 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 0.000 15.400 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 0.000 1.540 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 13.337 1.540 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 6.668 -2.310 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 9.336 2.310 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 1.334 16.170 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 1.334 2.310 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 12.003 2.310 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 8.002 1.540 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 -1.334 20.790 0.000 0.00 0.00 O+0 HETATM 50 O UNK 0 -1.334 6.930 0.000 0.00 0.00 O+0 HETATM 51 O UNK 0 12.003 6.930 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 0.000 -3.080 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 12.003 -5.390 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 12.003 -2.310 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 2.667 6.160 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -2.667 18.480 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 -2.667 4.620 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 16.004 4.620 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 8.002 6.160 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 -2.667 15.400 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 -2.667 1.540 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 16.004 1.540 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 10.669 4.620 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 0.000 13.860 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 0.000 0.000 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 13.337 0.000 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 5.335 6.160 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 2.667 15.400 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 5.335 -3.080 0.000 0.00 0.00 O+1 HETATM 70 O UNK 0 2.667 1.540 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 8.002 0.000 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 1.334 17.710 0.000 0.00 0.00 O+0 HETATM 73 O UNK 0 1.334 3.850 0.000 0.00 0.00 O+0 HETATM 74 O UNK 0 12.003 3.850 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 6.668 2.310 0.000 0.00 0.00 O+0 HETATM 76 O UNK 0 10.669 1.540 0.000 0.00 0.00 O+0 CONECT 1 5 17 CONECT 2 6 17 CONECT 3 8 17 CONECT 4 7 18 CONECT 5 1 20 CONECT 6 2 20 CONECT 7 4 22 CONECT 8 3 31 CONECT 9 18 23 CONECT 10 19 24 CONECT 11 19 25 CONECT 12 21 26 CONECT 13 27 49 CONECT 14 28 50 CONECT 15 29 51 CONECT 16 30 67 CONECT 17 1 2 3 CONECT 18 4 9 43 CONECT 19 10 11 52 CONECT 20 5 6 68 CONECT 21 12 24 25 CONECT 22 7 23 53 CONECT 23 9 22 54 CONECT 24 10 21 69 CONECT 25 11 21 70 CONECT 26 12 43 71 CONECT 27 13 32 72 CONECT 28 14 33 73 CONECT 29 15 34 74 CONECT 30 16 35 75 CONECT 31 8 55 67 CONECT 32 27 36 56 CONECT 33 28 37 57 CONECT 34 29 38 58 CONECT 35 30 39 59 CONECT 36 32 40 60 CONECT 37 33 41 61 CONECT 38 34 42 62 CONECT 39 35 44 63 CONECT 40 36 45 64 CONECT 41 37 46 65 CONECT 42 38 47 66 CONECT 43 18 26 69 CONECT 44 39 48 76 CONECT 45 40 68 72 CONECT 46 41 70 73 CONECT 47 42 74 76 CONECT 48 44 71 75 CONECT 49 13 CONECT 50 14 CONECT 51 15 CONECT 52 19 CONECT 53 22 CONECT 54 23 CONECT 55 31 CONECT 56 32 CONECT 57 33 CONECT 58 34 CONECT 59 35 CONECT 60 36 CONECT 61 37 CONECT 62 38 CONECT 63 39 CONECT 64 40 CONECT 65 41 CONECT 66 42 CONECT 67 16 31 CONECT 68 20 45 CONECT 69 24 43 CONECT 70 25 46 CONECT 71 26 48 CONECT 72 27 45 CONECT 73 28 46 CONECT 74 29 47 CONECT 75 30 48 CONECT 76 44 47 MASTER 0 0 0 0 0 0 0 0 76 0 166 0 END 3D PDB for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)COMPND HMDB0041155 HETATM 1 O1 UNL 1 1.939 -0.252 -2.206 1.00 0.00 O HETATM 2 C1 UNL 1 2.223 0.603 -1.292 1.00 0.00 C HETATM 3 C2 UNL 1 3.646 0.844 -1.009 1.00 0.00 C HETATM 4 C3 UNL 1 4.599 0.230 -1.659 1.00 0.00 C HETATM 5 C4 UNL 1 6.019 0.375 -1.479 1.00 0.00 C HETATM 6 C5 UNL 1 6.892 -0.349 -2.297 1.00 0.00 C HETATM 7 C6 UNL 1 8.253 -0.245 -2.155 1.00 0.00 C HETATM 8 C7 UNL 1 8.808 0.592 -1.182 1.00 0.00 C HETATM 9 O2 UNL 1 10.149 0.653 -1.088 1.00 0.00 O HETATM 10 C8 UNL 1 10.905 1.384 -0.184 1.00 0.00 C HETATM 11 O3 UNL 1 11.904 0.591 0.421 1.00 0.00 O HETATM 12 C9 UNL 1 12.259 1.195 1.614 1.00 0.00 C HETATM 13 C10 UNL 1 13.527 0.587 2.191 1.00 0.00 C HETATM 14 O4 UNL 1 13.282 -0.752 2.418 1.00 0.00 O HETATM 15 C11 UNL 1 12.301 2.683 1.560 1.00 0.00 C HETATM 16 O5 UNL 1 11.248 3.265 2.293 1.00 0.00 O HETATM 17 C12 UNL 1 12.374 3.286 0.199 1.00 0.00 C HETATM 18 O6 UNL 1 13.699 3.509 -0.191 1.00 0.00 O HETATM 19 C13 UNL 1 11.680 2.510 -0.877 1.00 0.00 C HETATM 20 O7 UNL 1 10.736 3.288 -1.542 1.00 0.00 O HETATM 21 C14 UNL 1 7.972 1.314 -0.366 1.00 0.00 C HETATM 22 C15 UNL 1 6.579 1.183 -0.541 1.00 0.00 C HETATM 23 O8 UNL 1 1.198 1.220 -0.659 1.00 0.00 O HETATM 24 C16 UNL 1 -0.163 1.080 -0.797 1.00 0.00 C HETATM 25 C17 UNL 1 -0.781 -0.133 -0.189 1.00 0.00 C HETATM 26 O9 UNL 1 -2.079 -0.199 -0.560 1.00 0.00 O HETATM 27 C18 UNL 1 -2.915 -1.164 -0.113 1.00 0.00 C HETATM 28 O10 UNL 1 -3.750 -1.467 -1.267 1.00 0.00 O HETATM 29 C19 UNL 1 -4.673 -0.609 -1.782 1.00 0.00 C HETATM 30 C20 UNL 1 -4.754 0.660 -1.215 1.00 0.00 C HETATM 31 C21 UNL 1 -5.674 1.541 -1.727 1.00 0.00 C HETATM 32 C22 UNL 1 -5.768 2.818 -1.182 1.00 0.00 C HETATM 33 O11 UNL 1 -4.911 3.096 -0.143 1.00 0.00 O HETATM 34 C23 UNL 1 -4.867 4.360 0.461 1.00 0.00 C HETATM 35 O12 UNL 1 -3.568 4.793 0.691 1.00 0.00 O HETATM 36 C24 UNL 1 -3.599 6.106 1.104 1.00 0.00 C HETATM 37 C25 UNL 1 -2.212 6.734 1.068 1.00 0.00 C HETATM 38 O13 UNL 1 -2.320 8.035 1.508 1.00 0.00 O HETATM 39 C26 UNL 1 -4.181 6.219 2.495 1.00 0.00 C HETATM 40 O14 UNL 1 -3.326 5.711 3.461 1.00 0.00 O HETATM 41 C27 UNL 1 -5.543 5.556 2.530 1.00 0.00 C HETATM 42 O15 UNL 1 -5.955 5.412 3.855 1.00 0.00 O HETATM 43 C28 UNL 1 -5.612 4.266 1.793 1.00 0.00 C HETATM 44 O16 UNL 1 -5.263 3.175 2.546 1.00 0.00 O HETATM 45 C29 UNL 1 -6.693 3.675 -1.722 1.00 0.00 C HETATM 46 C30 UNL 1 -7.507 3.277 -2.779 1.00 0.00 C HETATM 47 O17 UNL 1 -8.450 4.186 -3.309 1.00 0.00 O HETATM 48 C31 UNL 1 -7.384 2.010 -3.289 1.00 0.00 C HETATM 49 C32 UNL 1 -6.452 1.094 -2.772 1.00 0.00 C HETATM 50 O18 UNL 1 -6.353 -0.097 -3.277 1.00 0.00 O1+ HETATM 51 C33 UNL 1 -5.490 -0.977 -2.824 1.00 0.00 C HETATM 52 C34 UNL 1 -5.436 -2.309 -3.451 1.00 0.00 C HETATM 53 C35 UNL 1 -6.264 -2.522 -4.542 1.00 0.00 C HETATM 54 C36 UNL 1 -6.301 -3.721 -5.198 1.00 0.00 C HETATM 55 C37 UNL 1 -5.491 -4.763 -4.767 1.00 0.00 C HETATM 56 O19 UNL 1 -5.530 -5.993 -5.441 1.00 0.00 O HETATM 57 C38 UNL 1 -4.659 -4.595 -3.692 1.00 0.00 C HETATM 58 O20 UNL 1 -3.833 -5.600 -3.222 1.00 0.00 O HETATM 59 C39 UNL 1 -4.665 -3.343 -3.061 1.00 0.00 C HETATM 60 C40 UNL 1 -2.329 -2.387 0.408 1.00 0.00 C HETATM 61 O21 UNL 1 -2.958 -2.835 1.603 1.00 0.00 O HETATM 62 C41 UNL 1 -3.424 -4.110 1.409 1.00 0.00 C HETATM 63 O22 UNL 1 -2.773 -5.015 2.280 1.00 0.00 O HETATM 64 C42 UNL 1 -2.901 -6.281 1.736 1.00 0.00 C HETATM 65 C43 UNL 1 -2.075 -7.276 2.541 1.00 0.00 C HETATM 66 O23 UNL 1 -2.494 -7.329 3.871 1.00 0.00 O HETATM 67 C44 UNL 1 -4.344 -6.749 1.739 1.00 0.00 C HETATM 68 O24 UNL 1 -4.436 -7.837 0.869 1.00 0.00 O HETATM 69 C45 UNL 1 -5.284 -5.686 1.268 1.00 0.00 C HETATM 70 O25 UNL 1 -6.587 -5.900 1.723 1.00 0.00 O HETATM 71 C46 UNL 1 -4.903 -4.286 1.679 1.00 0.00 C HETATM 72 O26 UNL 1 -5.095 -4.033 3.028 1.00 0.00 O HETATM 73 C47 UNL 1 -0.852 -2.452 0.603 1.00 0.00 C HETATM 74 O27 UNL 1 -0.612 -2.205 1.974 1.00 0.00 O HETATM 75 C48 UNL 1 -0.056 -1.414 -0.185 1.00 0.00 C HETATM 76 O28 UNL 1 1.195 -1.375 0.404 1.00 0.00 O HETATM 77 H1 UNL 1 3.931 1.546 -0.243 1.00 0.00 H HETATM 78 H2 UNL 1 4.236 -0.479 -2.430 1.00 0.00 H HETATM 79 H3 UNL 1 6.457 -0.997 -3.051 1.00 0.00 H HETATM 80 H4 UNL 1 8.946 -0.790 -2.775 1.00 0.00 H HETATM 81 H5 UNL 1 10.308 1.892 0.590 1.00 0.00 H HETATM 82 H6 UNL 1 11.451 0.904 2.352 1.00 0.00 H HETATM 83 H7 UNL 1 14.415 0.752 1.564 1.00 0.00 H HETATM 84 H8 UNL 1 13.705 1.090 3.161 1.00 0.00 H HETATM 85 H9 UNL 1 13.207 -1.241 1.555 1.00 0.00 H HETATM 86 H10 UNL 1 13.246 2.990 2.101 1.00 0.00 H HETATM 87 H11 UNL 1 11.517 3.556 3.181 1.00 0.00 H HETATM 88 H12 UNL 1 11.901 4.299 0.260 1.00 0.00 H HETATM 89 H13 UNL 1 13.948 2.757 -0.799 1.00 0.00 H HETATM 90 H14 UNL 1 12.398 2.072 -1.611 1.00 0.00 H HETATM 91 H15 UNL 1 10.552 4.129 -1.039 1.00 0.00 H HETATM 92 H16 UNL 1 8.301 1.975 0.399 1.00 0.00 H HETATM 93 H17 UNL 1 5.912 1.760 0.107 1.00 0.00 H HETATM 94 H18 UNL 1 -0.476 1.195 -1.888 1.00 0.00 H HETATM 95 H19 UNL 1 -0.618 2.028 -0.348 1.00 0.00 H HETATM 96 H20 UNL 1 -0.862 0.124 0.969 1.00 0.00 H HETATM 97 H21 UNL 1 -3.630 -0.675 0.652 1.00 0.00 H HETATM 98 H22 UNL 1 -4.120 0.962 -0.398 1.00 0.00 H HETATM 99 H23 UNL 1 -5.384 5.166 -0.089 1.00 0.00 H HETATM 100 H24 UNL 1 -4.240 6.758 0.448 1.00 0.00 H HETATM 101 H25 UNL 1 -1.495 6.119 1.646 1.00 0.00 H HETATM 102 H26 UNL 1 -1.926 6.785 -0.012 1.00 0.00 H HETATM 103 H27 UNL 1 -2.016 8.180 2.443 1.00 0.00 H HETATM 104 H28 UNL 1 -4.303 7.312 2.711 1.00 0.00 H HETATM 105 H29 UNL 1 -3.401 6.249 4.291 1.00 0.00 H HETATM 106 H30 UNL 1 -6.241 6.307 2.061 1.00 0.00 H HETATM 107 H31 UNL 1 -6.940 5.288 3.891 1.00 0.00 H HETATM 108 H32 UNL 1 -6.694 4.136 1.487 1.00 0.00 H HETATM 109 H33 UNL 1 -6.060 2.735 2.950 1.00 0.00 H HETATM 110 H34 UNL 1 -6.801 4.674 -1.324 1.00 0.00 H HETATM 111 H35 UNL 1 -8.100 4.762 -4.070 1.00 0.00 H HETATM 112 H36 UNL 1 -8.029 1.724 -4.107 1.00 0.00 H HETATM 113 H37 UNL 1 -6.910 -1.726 -4.901 1.00 0.00 H HETATM 114 H38 UNL 1 -6.964 -3.861 -6.059 1.00 0.00 H HETATM 115 H39 UNL 1 -6.153 -6.098 -6.233 1.00 0.00 H HETATM 116 H40 UNL 1 -3.781 -6.507 -3.620 1.00 0.00 H HETATM 117 H41 UNL 1 -3.999 -3.278 -2.230 1.00 0.00 H HETATM 118 H42 UNL 1 -2.527 -3.234 -0.343 1.00 0.00 H HETATM 119 H43 UNL 1 -3.233 -4.527 0.395 1.00 0.00 H HETATM 120 H44 UNL 1 -2.491 -6.312 0.711 1.00 0.00 H HETATM 121 H45 UNL 1 -2.184 -8.282 2.113 1.00 0.00 H HETATM 122 H46 UNL 1 -1.005 -6.983 2.452 1.00 0.00 H HETATM 123 H47 UNL 1 -2.505 -8.248 4.224 1.00 0.00 H HETATM 124 H48 UNL 1 -4.650 -7.096 2.739 1.00 0.00 H HETATM 125 H49 UNL 1 -3.938 -7.663 0.007 1.00 0.00 H HETATM 126 H50 UNL 1 -5.341 -5.677 0.145 1.00 0.00 H HETATM 127 H51 UNL 1 -6.617 -6.854 2.035 1.00 0.00 H HETATM 128 H52 UNL 1 -5.510 -3.595 1.049 1.00 0.00 H HETATM 129 H53 UNL 1 -5.772 -3.315 3.172 1.00 0.00 H HETATM 130 H54 UNL 1 -0.393 -3.434 0.376 1.00 0.00 H HETATM 131 H55 UNL 1 -0.139 -2.940 2.396 1.00 0.00 H HETATM 132 H56 UNL 1 0.029 -1.822 -1.199 1.00 0.00 H HETATM 133 H57 UNL 1 1.149 -1.445 1.390 1.00 0.00 H CONECT 1 2 2 CONECT 2 3 23 CONECT 3 4 4 77 CONECT 4 5 78 CONECT 5 6 6 22 CONECT 6 7 79 CONECT 7 8 8 80 CONECT 8 9 21 CONECT 9 10 CONECT 10 11 19 81 CONECT 11 12 CONECT 12 13 15 82 CONECT 13 14 83 84 CONECT 14 85 CONECT 15 16 17 86 CONECT 16 87 CONECT 17 18 19 88 CONECT 18 89 CONECT 19 20 90 CONECT 20 91 CONECT 21 22 22 92 CONECT 22 93 CONECT 23 24 CONECT 24 25 94 95 CONECT 25 26 75 96 CONECT 26 27 CONECT 27 28 60 97 CONECT 28 29 CONECT 29 30 30 51 CONECT 30 31 98 CONECT 31 32 32 49 CONECT 32 33 45 CONECT 33 34 CONECT 34 35 43 99 CONECT 35 36 CONECT 36 37 39 100 CONECT 37 38 101 102 CONECT 38 103 CONECT 39 40 41 104 CONECT 40 105 CONECT 41 42 43 106 CONECT 42 107 CONECT 43 44 108 CONECT 44 109 CONECT 45 46 46 110 CONECT 46 47 48 CONECT 47 111 CONECT 48 49 49 112 CONECT 49 50 CONECT 50 51 51 CONECT 51 52 CONECT 52 53 53 59 CONECT 53 54 113 CONECT 54 55 55 114 CONECT 55 56 57 CONECT 56 115 CONECT 57 58 59 59 CONECT 58 116 CONECT 59 117 CONECT 60 61 73 118 CONECT 61 62 CONECT 62 63 71 119 CONECT 63 64 CONECT 64 65 67 120 CONECT 65 66 121 122 CONECT 66 123 CONECT 67 68 69 124 CONECT 68 125 CONECT 69 70 71 126 CONECT 70 127 CONECT 71 72 128 CONECT 72 129 CONECT 73 74 75 130 CONECT 74 131 CONECT 75 76 132 CONECT 76 133 END SMILES for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)OCC1OC(OC2C(O)C(O)C(COC(=O)\C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C=C3)OC2OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O INCHI for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside)InChI=1S/C48H56O28/c49-13-27-32(56)36(60)40(64)45(72-27)68-20-5-1-17(2-6-20)3-8-31(55)67-16-30-35(59)39(63)44(76-47-42(66)38(62)34(58)29(15-51)74-47)48(75-30)71-26-12-21-24(69-43(26)18-4-7-22(53)23(54)9-18)10-19(52)11-25(21)70-46-41(65)37(61)33(57)28(14-50)73-46/h1-12,27-30,32-42,44-51,56-66H,13-16H2,(H2-,52,53,54)/p+1/b8-3+ 3D Structure for HMDB0041155 (Cyanidin 3-[6-(4-glucosylcoumaryl)sophoroside] 5-glucoside) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C48H57O28 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1081.9494 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1081.30363624 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 3-[(4,5-dihydroxy-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-6-({[(2E)-3-(4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoyl]oxy}methyl)oxan-2-yl)oxy]-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 3-[(4,5-dihydroxy-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-6-({[(2E)-3-(4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoyl]oxy}methyl)oxan-2-yl)oxy]-2-(3,4-dihydroxyphenyl)-7-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 107480-92-2 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | OCC1OC(OC2C(O)C(O)C(COC(=O)\C=C\C3=CC=C(OC4OC(CO)C(O)C(O)C4O)C=C3)OC2OC2=C([O+]=C3C=C(O)C=C(OC4OC(CO)C(O)C(O)C4O)C3=C2)C2=CC(O)=C(O)C=C2)C(O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C48H56O28/c49-13-27-32(56)36(60)40(64)45(72-27)68-20-5-1-17(2-6-20)3-8-31(55)67-16-30-35(59)39(63)44(76-47-42(66)38(62)34(58)29(15-51)74-47)48(75-30)71-26-12-21-24(69-43(26)18-4-7-22(53)23(54)9-18)10-19(52)11-25(21)70-46-41(65)37(61)33(57)28(14-50)73-46/h1-12,27-30,32-42,44-51,56-66H,13-16H2,(H2-,52,53,54)/p+1/b8-3+ | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | JSIMVXMJRFINRS-FPYGCLRLSA-O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as anthocyanidin 3-o-6-p-coumaroyl glycosides. These are anthocyanidin 3-O-glycosides where the carbohydrate moiety is esterified at the C6 position with a p-coumaric acid. P-coumaric acid is an organic derivative of cinnamic acid, that carries a hydroxyl group at the 4-position of the benzene ring. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Flavonoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Flavonoid glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Anthocyanidin 3-O-6-p-coumaroyl glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB021044 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131753045 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|