Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 02:54:24 UTC

Update Date

2022-03-07 02:56:56 UTC

HMDB ID

HMDB0041239

Secondary Accession Numbers

HMDB41239

Metabolite Identification

Common Name

ent-Epicatechin-(4alpha->6)-ent-epicatechin

Description

ent-Epicatechin-(4alpha->6)-ent-epicatechin belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. ent-Epicatechin-(4alpha->6)-ent-epicatechin has been detected, but not quantified in, fruits. This could make ent-epicatechin-(4alpha->6)-ent-epicatechin a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on ent-Epicatechin-(4alpha->6)-ent-epicatechin.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061312302D          

 42 47  0  0  0  0            999 V2000
    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0374    0.0862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  2  0  0  0  0
  4  2  2  0  0  0  0
 11  1  1  0  0  0  0
 11  5  2  0  0  0  0
 12  2  1  0  0  0  0
 12  6  2  0  0  0  0
 13  7  2  0  0  0  0
 13  8  1  0  0  0  0
 14  9  1  0  0  0  0
 15  3  1  0  0  0  0
 16  4  1  0  0  0  0
 17  5  1  0  0  0  0
 17 15  2  0  0  0  0
 18  6  1  0  0  0  0
 18 16  2  0  0  0  0
 19  7  1  0  0  0  0
 20 10  2  0  0  0  0
 21  9  1  0  0  0  0
 22 10  1  0  0  0  0
 22 14  2  0  0  0  0
 23  8  2  0  0  0  0
 24 19  2  0  0  0  0
 24 23  1  0  0  0  0
 25 20  1  0  0  0  0
 26 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 14  1  0  0  0  0
 27 25  2  0  0  0  0
 28 26  1  0  0  0  0
 29 11  1  0  0  0  0
 29 21  1  0  0  0  0
 30 12  1  0  0  0  0
 30 28  1  0  0  0  0
 31 13  1  0  0  0  0
 32 15  1  0  0  0  0
 33 16  1  0  0  0  0
 34 17  1  0  0  0  0
 35 18  1  0  0  0  0
 36 19  1  0  0  0  0
 37 20  1  0  0  0  0
 38 21  1  0  0  0  0
 39 27  1  0  0  0  0
 40 28  1  0  0  0  0
 41 22  1  0  0  0  0
 41 29  1  0  0  0  0
 42 23  1  0  0  0  0
 42 30  1  0  0  0  0
M  END

HMDB0041239
     RDKit          3D
ent-Epicatechin-(4alpha->6)-ent-epicatechin
 68 73  0  0  0  0  0  0  0  0999 V2000
   -3.6965   -5.1603    1.7825 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2843   -3.8926    1.3918 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2660   -3.2211    2.0414 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8653   -1.9646    1.6454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8217   -1.3235    2.3420 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4898   -1.3624    0.5814 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5014   -2.0066   -0.0789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9099   -3.2925    0.3278 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1474   -1.4354   -1.1454 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8692   -0.1566   -1.5966 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9623    0.7381   -1.1240 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4600    0.6747    0.1619 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4698    1.5168    0.5614 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9708    2.4210   -0.3475 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9834    3.2816    0.0159 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4759    2.4919   -1.6441 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9968    3.4026   -2.5220 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4669    1.6496   -2.0413 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5089    0.3495   -1.2319 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5344    0.0120   -2.1884 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0765   -0.0216    0.1438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6184    0.2000    0.3013 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2109    1.3715    0.9298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1497    2.2969    1.3887 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1283    1.6379    1.1097 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417    0.7039    0.6454 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6748   -0.4529    0.0259 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3273   -0.6859   -0.1368 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1507   -1.8508   -0.7641 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6261   -1.4623   -0.4737 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0543   -1.1325   -0.1091 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4043   -1.7109    1.1135 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2991    0.3579   -0.0854 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7025    0.6248    0.2028 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1842    0.5481    1.5106 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5124    0.7988    1.7746 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3812    1.1255    0.7712 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7131    1.3771    1.0335 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9011    1.2032   -0.5411 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7721    1.5322   -1.5582 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5628    0.9522   -0.8181 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994    0.9574    0.8188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4415   -5.6220    1.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8062   -3.7444    2.8774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3842   -1.7778    3.1085 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7188   -3.7884   -0.2128 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021   -0.2015   -2.7265 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0461   -0.0454    0.8494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8907    1.5065    1.5511 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3808    3.9592   -0.6167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7110    3.5285   -3.4642 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0779    1.7002   -3.0474 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5605    1.4777   -1.2797 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8888   -0.5239   -2.9163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5980    0.6993    0.8385 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8093    3.1235    1.8336 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    2.5589    1.6033 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4744   -2.5572   -1.1170 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5173   -1.5502   -1.5797 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844   -2.4613   -0.0549 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7289   -1.5686   -0.8753 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3691   -1.8183    1.2305 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0519    0.7466   -1.1148 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5523    0.2953    2.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8637    0.7348    2.7870 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3721    1.6200    0.3087 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4412    1.5906   -2.4960 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2347    1.0253   -1.8595 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39 41  2  0
 33 42  1  0
  8  2  1  0
 18 11  1  0
 28 22  1  0
 41 34  1  0
 21  6  1  0
 42 26  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  0
 12 48  1  0
 13 49  1  0
 15 50  1  0
 17 51  1  0
 18 52  1  0
 19 53  1  0
 20 54  1  0
 21 55  1  0
 24 56  1  0
 25 57  1  0
 29 58  1  0
 30 59  1  0
 30 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 35 64  1  0
 36 65  1  0
 38 66  1  0
 40 67  1  0
 41 68  1  0
M  END


  Mrv0541 05061312302D          

 42 47  0  0  0  0            999 V2000
    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    5.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0374    0.0862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  2  0  0  0  0
  4  2  2  0  0  0  0
 11  1  1  0  0  0  0
 11  5  2  0  0  0  0
 12  2  1  0  0  0  0
 12  6  2  0  0  0  0
 13  7  2  0  0  0  0
 13  8  1  0  0  0  0
 14  9  1  0  0  0  0
 15  3  1  0  0  0  0
 16  4  1  0  0  0  0
 17  5  1  0  0  0  0
 17 15  2  0  0  0  0
 18  6  1  0  0  0  0
 18 16  2  0  0  0  0
 19  7  1  0  0  0  0
 20 10  2  0  0  0  0
 21  9  1  0  0  0  0
 22 10  1  0  0  0  0
 22 14  2  0  0  0  0
 23  8  2  0  0  0  0
 24 19  2  0  0  0  0
 24 23  1  0  0  0  0
 25 20  1  0  0  0  0
 26 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 14  1  0  0  0  0
 27 25  2  0  0  0  0
 28 26  1  0  0  0  0
 29 11  1  0  0  0  0
 29 21  1  0  0  0  0
 30 12  1  0  0  0  0
 30 28  1  0  0  0  0
 31 13  1  0  0  0  0
 32 15  1  0  0  0  0
 33 16  1  0  0  0  0
 34 17  1  0  0  0  0
 35 18  1  0  0  0  0
 36 19  1  0  0  0  0
 37 20  1  0  0  0  0
 38 21  1  0  0  0  0
 39 27  1  0  0  0  0
 40 28  1  0  0  0  0
 41 22  1  0  0  0  0
 41 29  1  0  0  0  0
 42 23  1  0  0  0  0
 42 30  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0041239

> <DATABASE_NAME>
hmdb

> <SMILES>
OC1CC2=C(OC1C1=CC(O)=C(O)C=C1)C=C(O)C(C1C(O)C(OC3=CC(O)=CC(O)=C13)C1=CC(O)=C(O)C=C1)=C2O

> <INCHI_IDENTIFIER>
InChI=1S/C30H26O12/c31-13-7-19(36)24-23(8-13)42-30(12-2-4-16(33)18(35)6-12)28(40)26(24)25-20(37)10-22-14(27(25)39)9-21(38)29(41-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26,28-40H,9H2

> <INCHI_KEY>
GMISZFQPFDAPGI-UHFFFAOYSA-N

> <FORMULA>
C30H26O12

> <MOLECULAR_WEIGHT>
578.5202

> <EXACT_MASS>
578.142426296

> <JCHEM_ACCEPTOR_COUNT>
12

> <JCHEM_AVERAGE_POLARIZABILITY>
57.29309694309078

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <ALOGPS_LOGP>
2.31

> <JCHEM_LOGP>
3.1157450136666665

> <ALOGPS_LOGS>
-3.65

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
6

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.131417482712479

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.696085363131802

> <JCHEM_PKA_STRONGEST_BASIC>
-5.176745497915186

> <JCHEM_POLAR_SURFACE_AREA>
220.75999999999996

> <JCHEM_REFRACTIVITY>
146.50800000000004

> <JCHEM_ROTATABLE_BOND_COUNT>
3

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.31e-01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0041239
     RDKit          3D
ent-Epicatechin-(4alpha->6)-ent-epicatechin
 68 73  0  0  0  0  0  0  0  0999 V2000
   -3.6965   -5.1603    1.7825 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2843   -3.8926    1.3918 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2660   -3.2211    2.0414 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8653   -1.9646    1.6454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8217   -1.3235    2.3420 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4898   -1.3624    0.5814 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5014   -2.0066   -0.0789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9099   -3.2925    0.3278 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1474   -1.4354   -1.1454 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8692   -0.1566   -1.5966 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9623    0.7381   -1.1240 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4600    0.6747    0.1619 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4698    1.5168    0.5614 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9708    2.4210   -0.3475 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9834    3.2816    0.0159 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4759    2.4919   -1.6441 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9968    3.4026   -2.5220 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4669    1.6496   -2.0413 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5089    0.3495   -1.2319 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5344    0.0120   -2.1884 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0765   -0.0216    0.1438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6184    0.2000    0.3013 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2109    1.3715    0.9298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1497    2.2969    1.3887 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1283    1.6379    1.1097 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417    0.7039    0.6454 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6748   -0.4529    0.0259 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3273   -0.6859   -0.1368 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1507   -1.8508   -0.7641 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6261   -1.4623   -0.4737 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0543   -1.1325   -0.1091 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4043   -1.7109    1.1135 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2991    0.3579   -0.0854 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7025    0.6248    0.2028 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1842    0.5481    1.5106 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5124    0.7988    1.7746 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3812    1.1255    0.7712 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7131    1.3771    1.0335 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9011    1.2032   -0.5411 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7721    1.5322   -1.5582 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5628    0.9522   -0.8181 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994    0.9574    0.8188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4415   -5.6220    1.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8062   -3.7444    2.8774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3842   -1.7778    3.1085 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7188   -3.7884   -0.2128 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021   -0.2015   -2.7265 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0461   -0.0454    0.8494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8907    1.5065    1.5511 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3808    3.9592   -0.6167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7110    3.5285   -3.4642 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0779    1.7002   -3.0474 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5605    1.4777   -1.2797 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8888   -0.5239   -2.9163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5980    0.6993    0.8385 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8093    3.1235    1.8336 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    2.5589    1.6033 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4744   -2.5572   -1.1170 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5173   -1.5502   -1.5797 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844   -2.4613   -0.0549 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7289   -1.5686   -0.8753 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3691   -1.8183    1.2305 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0519    0.7466   -1.1148 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5523    0.2953    2.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8637    0.7348    2.7870 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3721    1.6200    0.3087 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4412    1.5906   -2.4960 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2347    1.0253   -1.8595 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39 41  2  0
 33 42  1  0
  8  2  1  0
 18 11  1  0
 28 22  1  0
 41 34  1  0
 21  6  1  0
 42 26  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  0
 12 48  1  0
 13 49  1  0
 15 50  1  0
 17 51  1  0
 18 52  1  0
 19 53  1  0
 20 54  1  0
 21 55  1  0
 24 56  1  0
 25 57  1  0
 29 58  1  0
 30 59  1  0
 30 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 35 64  1  0
 36 65  1  0
 38 66  1  0
 40 67  1  0
 41 68  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       9.336   6.930   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      10.669  -4.620   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       9.336   8.470   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      12.003  -5.390   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668   6.930   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       9.336  -6.930   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       4.001  -5.390   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       9.336   2.310   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       8.002   6.160   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       9.336  -5.390   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       2.667  -4.620   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       8.002   9.240   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      12.003  -6.930   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       6.668   8.470   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      10.669  -7.700   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       8.002  -3.080   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0       8.002  -4.620   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0       1.334  -5.390   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       8.002  10.780   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      13.337  -7.700   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       5.335   9.240   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      10.669  -9.240   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       4.001  -0.770   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       3.803   0.161   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      10.669   4.620   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       9.336  -2.310   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       6.668  -5.390   0.000  0.00  0.00           O+0
CONECT    1    3   11                                                       
CONECT    2    4   12                                                       
CONECT    3    1   15                                                       
CONECT    4    2   16                                                       
CONECT    5   11   17                                                       
CONECT    6   12   18                                                       
CONECT    7   13   19                                                       
CONECT    8   13   23                                                       
CONECT    9   14   21                                                       
CONECT   10   20   22                                                       
CONECT   11    1    5   29                                                  
CONECT   12    2    6   30                                                  
CONECT   13    7    8   31                                                  
CONECT   14    9   22   27                                                  
CONECT   15    3   17   32                                                  
CONECT   16    4   18   33                                                  
CONECT   17    5   15   34                                                  
CONECT   18    6   16   35                                                  
CONECT   19    7   24   36                                                  
CONECT   20   10   25   37                                                  
CONECT   21    9   29   38                                                  
CONECT   22   10   14   41                                                  
CONECT   23    8   24   42                                                  
CONECT   24   19   23   26                                                  
CONECT   25   20   26   27                                                  
CONECT   26   24   25   28                                                  
CONECT   27   14   25   39                                                  
CONECT   28   26   30   40                                                  
CONECT   29   11   21   41                                                  
CONECT   30   12   28   42                                                  
CONECT   31   13                                                            
CONECT   32   15                                                            
CONECT   33   16                                                            
CONECT   34   17                                                            
CONECT   35   18                                                            
CONECT   36   19                                                            
CONECT   37   20                                                            
CONECT   38   21                                                            
CONECT   39   27                                                            
CONECT   40   28                                                            
CONECT   41   22   29                                                       
CONECT   42   23   30                                                       
MASTER        0    0    0    0    0    0    0    0   42    0   94    0
END

COMPND    HMDB0041239
HETATM    1  O1  UNL     1      -3.697  -5.160   1.782  1.00  0.00           O  
HETATM    2  C1  UNL     1      -3.284  -3.893   1.392  1.00  0.00           C  
HETATM    3  C2  UNL     1      -2.266  -3.221   2.041  1.00  0.00           C  
HETATM    4  C3  UNL     1      -1.865  -1.965   1.645  1.00  0.00           C  
HETATM    5  O2  UNL     1      -0.822  -1.323   2.342  1.00  0.00           O  
HETATM    6  C4  UNL     1      -2.490  -1.362   0.581  1.00  0.00           C  
HETATM    7  C5  UNL     1      -3.501  -2.007  -0.079  1.00  0.00           C  
HETATM    8  C6  UNL     1      -3.910  -3.293   0.328  1.00  0.00           C  
HETATM    9  O3  UNL     1      -4.147  -1.435  -1.145  1.00  0.00           O  
HETATM   10  C7  UNL     1      -3.869  -0.157  -1.597  1.00  0.00           C  
HETATM   11  C8  UNL     1      -4.962   0.738  -1.124  1.00  0.00           C  
HETATM   12  C9  UNL     1      -5.460   0.675   0.162  1.00  0.00           C  
HETATM   13  C10 UNL     1      -6.470   1.517   0.561  1.00  0.00           C  
HETATM   14  C11 UNL     1      -6.971   2.421  -0.347  1.00  0.00           C  
HETATM   15  O4  UNL     1      -7.983   3.282   0.016  1.00  0.00           O  
HETATM   16  C12 UNL     1      -6.476   2.492  -1.644  1.00  0.00           C  
HETATM   17  O5  UNL     1      -6.997   3.403  -2.522  1.00  0.00           O  
HETATM   18  C13 UNL     1      -5.467   1.650  -2.041  1.00  0.00           C  
HETATM   19  C14 UNL     1      -2.509   0.350  -1.232  1.00  0.00           C  
HETATM   20  O6  UNL     1      -1.534   0.012  -2.188  1.00  0.00           O  
HETATM   21  C15 UNL     1      -2.076  -0.022   0.144  1.00  0.00           C  
HETATM   22  C16 UNL     1      -0.618   0.200   0.301  1.00  0.00           C  
HETATM   23  C17 UNL     1      -0.211   1.372   0.930  1.00  0.00           C  
HETATM   24  O7  UNL     1      -1.150   2.297   1.389  1.00  0.00           O  
HETATM   25  C18 UNL     1       1.128   1.638   1.110  1.00  0.00           C  
HETATM   26  C19 UNL     1       2.042   0.704   0.645  1.00  0.00           C  
HETATM   27  C20 UNL     1       1.675  -0.453   0.026  1.00  0.00           C  
HETATM   28  C21 UNL     1       0.327  -0.686  -0.137  1.00  0.00           C  
HETATM   29  O8  UNL     1      -0.151  -1.851  -0.764  1.00  0.00           O  
HETATM   30  C22 UNL     1       2.626  -1.462  -0.474  1.00  0.00           C  
HETATM   31  C23 UNL     1       4.054  -1.132  -0.109  1.00  0.00           C  
HETATM   32  O9  UNL     1       4.404  -1.711   1.114  1.00  0.00           O  
HETATM   33  C24 UNL     1       4.299   0.358  -0.085  1.00  0.00           C  
HETATM   34  C25 UNL     1       5.702   0.625   0.203  1.00  0.00           C  
HETATM   35  C26 UNL     1       6.184   0.548   1.511  1.00  0.00           C  
HETATM   36  C27 UNL     1       7.512   0.799   1.775  1.00  0.00           C  
HETATM   37  C28 UNL     1       8.381   1.125   0.771  1.00  0.00           C  
HETATM   38  O10 UNL     1       9.713   1.377   1.034  1.00  0.00           O  
HETATM   39  C29 UNL     1       7.901   1.203  -0.541  1.00  0.00           C  
HETATM   40  O11 UNL     1       8.772   1.532  -1.558  1.00  0.00           O  
HETATM   41  C30 UNL     1       6.563   0.952  -0.818  1.00  0.00           C  
HETATM   42  O12 UNL     1       3.399   0.957   0.819  1.00  0.00           O  
HETATM   43  H1  UNL     1      -4.442  -5.622   1.288  1.00  0.00           H  
HETATM   44  H2  UNL     1      -1.806  -3.744   2.877  1.00  0.00           H  
HETATM   45  H3  UNL     1      -0.384  -1.778   3.108  1.00  0.00           H  
HETATM   46  H4  UNL     1      -4.719  -3.788  -0.213  1.00  0.00           H  
HETATM   47  H5  UNL     1      -3.902  -0.202  -2.726  1.00  0.00           H  
HETATM   48  H6  UNL     1      -5.046  -0.045   0.849  1.00  0.00           H  
HETATM   49  H7  UNL     1      -6.891   1.507   1.551  1.00  0.00           H  
HETATM   50  H8  UNL     1      -8.381   3.959  -0.617  1.00  0.00           H  
HETATM   51  H9  UNL     1      -6.711   3.528  -3.464  1.00  0.00           H  
HETATM   52  H10 UNL     1      -5.078   1.700  -3.047  1.00  0.00           H  
HETATM   53  H11 UNL     1      -2.561   1.478  -1.280  1.00  0.00           H  
HETATM   54  H12 UNL     1      -1.889  -0.524  -2.916  1.00  0.00           H  
HETATM   55  H13 UNL     1      -2.598   0.699   0.839  1.00  0.00           H  
HETATM   56  H14 UNL     1      -0.809   3.123   1.834  1.00  0.00           H  
HETATM   57  H15 UNL     1       1.428   2.559   1.603  1.00  0.00           H  
HETATM   58  H16 UNL     1       0.474  -2.557  -1.117  1.00  0.00           H  
HETATM   59  H17 UNL     1       2.517  -1.550  -1.580  1.00  0.00           H  
HETATM   60  H18 UNL     1       2.384  -2.461  -0.055  1.00  0.00           H  
HETATM   61  H19 UNL     1       4.729  -1.569  -0.875  1.00  0.00           H  
HETATM   62  H20 UNL     1       5.369  -1.818   1.231  1.00  0.00           H  
HETATM   63  H21 UNL     1       4.052   0.747  -1.115  1.00  0.00           H  
HETATM   64  H22 UNL     1       5.552   0.295   2.351  1.00  0.00           H  
HETATM   65  H23 UNL     1       7.864   0.735   2.787  1.00  0.00           H  
HETATM   66  H24 UNL     1      10.372   1.620   0.309  1.00  0.00           H  
HETATM   67  H25 UNL     1       8.441   1.591  -2.496  1.00  0.00           H  
HETATM   68  H26 UNL     1       6.235   1.025  -1.859  1.00  0.00           H  
CONECT    1    2   43
CONECT    2    3    3    8
CONECT    3    4   44
CONECT    4    5    6    6
CONECT    5   45
CONECT    6    7   21
CONECT    7    8    8    9
CONECT    8   46
CONECT    9   10
CONECT   10   11   19   47
CONECT   11   12   12   18
CONECT   12   13   48
CONECT   13   14   14   49
CONECT   14   15   16
CONECT   15   50
CONECT   16   17   18   18
CONECT   17   51
CONECT   18   52
CONECT   19   20   21   53
CONECT   20   54
CONECT   21   22   55
CONECT   22   23   23   28
CONECT   23   24   25
CONECT   24   56
CONECT   25   26   26   57
CONECT   26   27   42
CONECT   27   28   28   30
CONECT   28   29
CONECT   29   58
CONECT   30   31   59   60
CONECT   31   32   33   61
CONECT   32   62
CONECT   33   34   42   63
CONECT   34   35   35   41
CONECT   35   36   64
CONECT   36   37   37   65
CONECT   37   38   39
CONECT   38   66
CONECT   39   40   41   41
CONECT   40   67
CONECT   41   68
END

HMDB0041239
     RDKit          3D
ent-Epicatechin-(4alpha->6)-ent-epicatechin
 68 73  0  0  0  0  0  0  0  0999 V2000
   -3.6965   -5.1603    1.7825 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2843   -3.8926    1.3918 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2660   -3.2211    2.0414 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8653   -1.9646    1.6454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8217   -1.3235    2.3420 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4898   -1.3624    0.5814 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5014   -2.0066   -0.0789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9099   -3.2925    0.3278 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1474   -1.4354   -1.1454 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8692   -0.1566   -1.5966 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9623    0.7381   -1.1240 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4600    0.6747    0.1619 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4698    1.5168    0.5614 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9708    2.4210   -0.3475 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9834    3.2816    0.0159 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4759    2.4919   -1.6441 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9968    3.4026   -2.5220 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4669    1.6496   -2.0413 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5089    0.3495   -1.2319 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5344    0.0120   -2.1884 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0765   -0.0216    0.1438 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6184    0.2000    0.3013 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2109    1.3715    0.9298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1497    2.2969    1.3887 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1283    1.6379    1.1097 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417    0.7039    0.6454 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6748   -0.4529    0.0259 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3273   -0.6859   -0.1368 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1507   -1.8508   -0.7641 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6261   -1.4623   -0.4737 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0543   -1.1325   -0.1091 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4043   -1.7109    1.1135 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2991    0.3579   -0.0854 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7025    0.6248    0.2028 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1842    0.5481    1.5106 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5124    0.7988    1.7746 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3812    1.1255    0.7712 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7131    1.3771    1.0335 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9011    1.2032   -0.5411 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7721    1.5322   -1.5582 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5628    0.9522   -0.8181 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994    0.9574    0.8188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4415   -5.6220    1.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8062   -3.7444    2.8774 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3842   -1.7778    3.1085 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7188   -3.7884   -0.2128 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021   -0.2015   -2.7265 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0461   -0.0454    0.8494 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8907    1.5065    1.5511 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3808    3.9592   -0.6167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7110    3.5285   -3.4642 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0779    1.7002   -3.0474 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5605    1.4777   -1.2797 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8888   -0.5239   -2.9163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5980    0.6993    0.8385 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8093    3.1235    1.8336 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    2.5589    1.6033 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4744   -2.5572   -1.1170 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5173   -1.5502   -1.5797 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844   -2.4613   -0.0549 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7289   -1.5686   -0.8753 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3691   -1.8183    1.2305 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0519    0.7466   -1.1148 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5523    0.2953    2.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8637    0.7348    2.7870 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3721    1.6200    0.3087 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4412    1.5906   -2.4960 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2347    1.0253   -1.8595 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 39 41  2  0
 33 42  1  0
  8  2  1  0
 18 11  1  0
 28 22  1  0
 41 34  1  0
 21  6  1  0
 42 26  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 10 47  1  0
 12 48  1  0
 13 49  1  0
 15 50  1  0
 17 51  1  0
 18 52  1  0
 19 53  1  0
 20 54  1  0
 21 55  1  0
 24 56  1  0
 25 57  1  0
 29 58  1  0
 30 59  1  0
 30 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 35 64  1  0
 36 65  1  0
 38 66  1  0
 40 67  1  0
 41 68  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
ent-Epicatechin-(4a->6)-ent-epicatechin	Generator
ent-Epicatechin-(4α->6)-ent-epicatechin	Generator
ent-Epicatechin(4a->6)-ent-epicatechin	HMDB

Chemical Formula

C₃₀H₂₆O₁₂

Average Molecular Weight

578.5202

Monoisotopic Molecular Weight

578.142426296

IUPAC Name

2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

Traditional Name

2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol

CAS Registry Number

Not Available

SMILES

OC1CC2=C(OC1C1=CC(O)=C(O)C=C1)C=C(O)C(C1C(O)C(OC3=CC(O)=CC(O)=C13)C1=CC(O)=C(O)C=C1)=C2O

InChI Identifier

InChI=1S/C30H26O12/c31-13-7-19(36)24-23(8-13)42-30(12-2-4-16(33)18(35)6-12)28(40)26(24)25-20(37)10-22-14(27(25)39)9-21(38)29(41-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26,28-40H,9H2

InChI Key

GMISZFQPFDAPGI-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Biflavonoids and polyflavonoids

Direct Parent

Biflavonoids and polyflavonoids

Alternative Parents

Substituents

B-type proanthocyanidin
Bi- and polyflavonoid skeleton
Proanthocyanidin
Catechin
Flavan-3-ol
Hydroxyflavonoid
3'-hydroxyflavonoid
7-hydroxyflavonoid
5-hydroxyflavonoid
4'-hydroxyflavonoid
3-hydroxyflavonoid
Flavan
Chromane
1-benzopyran
Benzopyran
Catechol
Phenol
1-hydroxy-2-unsubstituted benzenoid
Alkyl aryl ether
1-hydroxy-4-unsubstituted benzenoid
Benzenoid
Monocyclic benzene moiety
Secondary alcohol
Polyol
Organoheterocyclic compound
Oxacycle
Ether
Hydrocarbon derivative
Alcohol
Organic oxygen compound
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0041239)
Cytoplasm (HMDB: HMDB0041239)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0041239)

Source

Exogenous

Food

Food (HMDB: HMDB0041239)

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0041239)

Not Available

Nutrient (HMDB: HMDB0041239)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.13 g/L	ALOGPS
logP	2.31	ALOGPS
logP	3.12	ChemAxon
logS	-3.6	ALOGPS
pKa (Strongest Acidic)	8.7	ChemAxon
pKa (Strongest Basic)	-5.2	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	12	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	220.76 Å²	ChemAxon
Rotatable Bond Count	3	ChemAxon
Refractivity	146.51 m³·mol⁻¹	ChemAxon
Polarizability	57.29 Å³	ChemAxon
Number of Rings	6	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	231.454	31661259
DarkChem	[M-H]-	223.041	31661259
DeepCCS	[M-2H]-	252.461	30932474
DeepCCS	[M+Na]+	227.005	30932474
AllCCS	[M+H]+	237.0	32859911
AllCCS	[M+H-H2O]+	235.4	32859911
AllCCS	[M+NH4]+	238.4	32859911
AllCCS	[M+Na]+	238.9	32859911
AllCCS	[M-H]-	229.8	32859911
AllCCS	[M+Na-2H]-	231.6	32859911
AllCCS	[M+HCOO]-	233.6	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
ent-Epicatechin-(4alpha->6)-ent-epicatechin	OC1CC2=C(OC1C1=CC(O)=C(O)C=C1)C=C(O)C(C1C(O)C(OC3=CC(O)=CC(O)=C13)C1=CC(O)=C(O)C=C1)=C2O	7420.7	Standard polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin	OC1CC2=C(OC1C1=CC(O)=C(O)C=C1)C=C(O)C(C1C(O)C(OC3=CC(O)=CC(O)=C13)C1=CC(O)=C(O)C=C1)=C2O	4955.5	Standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin	OC1CC2=C(OC1C1=CC(O)=C(O)C=C1)C=C(O)C(C1C(O)C(OC3=CC(O)=CC(O)=C13)C1=CC(O)=C(O)C=C1)=C2O	6115.4	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #1	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	5716.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #10	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5677.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #2	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5771.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #3	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5788.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #4	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5725.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #5	C[Si](C)(C)OC1C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C1C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5730.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5785.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #7	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5771.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #8	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5781.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,isomer #9	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	5797.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5609.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #10	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5625.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #11	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5652.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #12	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5695.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5708.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #14	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5687.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #15	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5644.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #16	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5584.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #17	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5646.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #18	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5651.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #19	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5679.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5662.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #20	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5721.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #21	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5725.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #22	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5706.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #23	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5664.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #24	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5606.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #25	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5579.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #26	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5622.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #27	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5635.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #28	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	5660.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #29	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5637.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5670.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5608.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #31	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5669.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #32	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5657.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5663.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #34	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5649.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #35	C[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5558.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #36	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5652.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5722.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5698.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #39	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5610.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #4	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5674.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #40	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5591.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	5687.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #42	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5662.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #43	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5598.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #44	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5656.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #45	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5616.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #5	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)=CC=C1O	5659.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #6	C[Si](C)(C)OC1CC2=C(C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O[Si](C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	5600.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #7	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5573.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #8	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5667.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TMS,isomer #9	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5657.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5516.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #10	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5498.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #100	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5500.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #101	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5568.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #102	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5538.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	5486.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5569.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #105	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5549.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #106	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5520.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #107	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	5471.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #108	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5541.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #109	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5484.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #11	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5557.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #110	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5476.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #111	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5491.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #112	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5556.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #113	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5531.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #114	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5611.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #115	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5523.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #116	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5501.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #117	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5496.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #118	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5473.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5577.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #12	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5543.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	5529.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #13	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5531.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #14	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5564.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #15	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)=CC=C1O	5545.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5612.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5590.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5555.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #19	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5523.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5512.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #20	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5611.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #21	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O	5596.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #22	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5517.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #23	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5616.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #24	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5606.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #25	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5555.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #26	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5586.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #27	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5495.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #28	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5597.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #29	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5583.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #3	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5544.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #30	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5543.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #31	C[Si](C)(C)OC1=C2CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5472.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #32	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5552.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #33	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5541.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #34	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	5509.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #35	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	5496.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5589.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #37	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5490.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #38	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5518.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #39	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5501.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #4	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5554.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #40	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5473.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #41	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5490.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #42	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5498.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #43	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5554.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5530.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #45	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5510.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #46	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5485.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #47	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5513.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #48	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5467.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #49	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5571.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #5	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)=CC=C1O	5533.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #50	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5553.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5533.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #52	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5543.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #53	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O[Si](C)(C)C	5500.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #54	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5610.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #55	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5482.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5612.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #57	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5547.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #58	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5588.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #59	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5528.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #6	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5499.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #60	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5455.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #61	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5587.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #62	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5459.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5558.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #64	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	5523.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #65	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5518.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #66	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5540.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5535.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #68	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5506.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5517.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #7	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5546.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5521.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #71	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5557.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5536.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #73	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5513.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5539.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #75	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5494.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #76	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5572.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #77	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5553.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #78	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5568.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #79	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5524.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #8	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5533.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5614.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5576.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5511.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5557.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5485.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #85	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5484.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #86	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5492.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #87	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5518.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #88	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5525.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #89	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5505.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5563.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #90	C[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5494.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #91	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5512.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #92	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5495.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #93	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	5519.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #94	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5494.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #95	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5540.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #96	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5519.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #97	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5510.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #98	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5517.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,3TMS,isomer #99	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5558.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #1	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5388.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #10	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5371.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #100	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5297.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #101	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5286.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #102	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5379.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #103	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5363.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5434.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	5443.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #106	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5314.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #107	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5466.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #108	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5376.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #109	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5321.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5387.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #110	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5305.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5280.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #112	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5429.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5343.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #114	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5406.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #115	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5323.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #116	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5254.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #117	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)=CC=C1O	5404.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #118	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5323.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5459.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #12	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5400.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #120	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	5411.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #121	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5430.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #122	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5353.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #123	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O[Si](C)(C)C	5304.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #124	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5453.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #125	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5335.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #126	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O[Si](C)(C)C	5282.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #127	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5430.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #128	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O[Si](C)(C)C	5335.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #129	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5472.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #13	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)=CC=C1O	5369.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #130	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O[Si](C)(C)C	5428.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #131	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5394.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #132	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	5305.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #133	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5371.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #134	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5462.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #135	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5521.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #136	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5437.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #137	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5284.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #138	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5441.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #139	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5369.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #14	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5419.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #140	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O[Si](C)(C)C	5402.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #141	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5344.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #142	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5298.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #143	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5283.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #144	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5369.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #145	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5354.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #146	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5330.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #147	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5312.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #148	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5378.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #149	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5374.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5389.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #150	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5414.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #151	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5344.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #152	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5331.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #153	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5326.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #154	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5311.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #155	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5392.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #156	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5338.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #157	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5406.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #158	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5337.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #159	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5322.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5398.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #160	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	5433.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #161	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5371.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #162	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5300.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #163	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5354.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #164	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5279.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #165	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5353.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #166	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5455.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #167	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5376.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #168	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5326.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #169	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O	5360.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5413.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #170	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5306.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #171	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5363.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #172	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)C=C1O	5468.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #173	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5398.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #174	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5332.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #175	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O)C=C1O	5314.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #176	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5384.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #177	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5378.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #178	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5357.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #179	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5333.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O	5396.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #180	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5374.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #181	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5355.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #182	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5398.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #183	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	5392.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #184	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	5451.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #185	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	5375.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #186	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5380.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #187	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5344.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #188	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5325.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #189	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5367.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #19	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5394.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #190	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5348.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #191	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5432.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #192	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5441.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #193	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5373.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #194	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5357.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #195	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5442.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #196	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5399.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #197	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5474.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #198	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5358.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #199	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	5352.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5419.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #20	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5374.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #200	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5467.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5416.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #202	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5380.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #203	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5343.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #204	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	5337.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #205	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5369.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #206	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5338.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #207	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5316.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #208	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)O2	5469.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #209	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C	5430.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #21	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5401.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #210	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	5420.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #22	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5467.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #23	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5369.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #24	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5347.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #25	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5387.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #26	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5397.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #27	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5383.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #28	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5464.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #29	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O[Si](C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	5384.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #3	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5418.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5435.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5417.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5424.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O[Si](C)(C)C)C(O)=C1)O2	5440.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #34	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O[Si](C)(C)C)=C1)O2	5412.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #35	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	5366.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #36	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	5354.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #37	C[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O[Si](C)(C)C)C(O[Si](C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	5356.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #38	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5379.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #39	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5352.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #4	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)=CC=C1O	5390.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5399.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5379.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5416.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #43	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5488.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #44	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5388.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #45	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5363.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #46	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5404.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #47	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5420.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #48	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)=CC=C1O	5404.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #49	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O[Si](C)(C)C	5490.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #5	C[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	5376.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #50	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5523.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5438.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #52	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5397.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #53	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5456.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #54	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O	5441.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #55	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5421.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #56	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5369.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #57	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5434.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #58	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O	5413.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #59	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5360.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #6	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	5405.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #60	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O	5438.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #61	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O	5422.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #62	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5392.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #63	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O[Si](C)(C)C	5376.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #64	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O[Si](C)(C)C)CC2=C1O	5526.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #65	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	5373.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #66	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5362.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #67	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	5364.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #68	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	5429.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5514.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #7	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	5391.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #70	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5437.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #71	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)C=C1O	5518.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5422.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #73	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5495.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5476.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #75	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	5348.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #76	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	5331.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #77	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C)CC4=C3O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	5349.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5416.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #79	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O[Si](C)(C)C)CC4=C3O)C2O)=CC=C1O	5489.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5406.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #80	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)=CC=C1O	5396.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O	5357.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #82	C[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)=CC=C1O	5347.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #83	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5469.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #84	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O[Si](C)(C)C)C=C1O[Si](C)(C)C	5428.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #85	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)C(C1=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5323.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #86	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5282.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #87	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5262.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #88	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C)C(O)=C3CC2O)=CC=C1O	5338.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #89	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C)=C3CC2O)=CC=C1O	5328.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #9	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C)C=C1O	5390.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O[Si](C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C	5427.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #91	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5310.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #92	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5291.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #93	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5353.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #94	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O[Si](C)(C)C	5353.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #95	C[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C)C=C2OC(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C(O)CC2=C1O	5439.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #96	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O[Si](C)(C)C)C2O)C=C1O	5310.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #97	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	5406.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #98	C[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C)C=C1O	5319.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,4TMS,isomer #99	C[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5384.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O)=C2O)OC1C1=CC=C(O)C(O)=C1	5951.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5915.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	5992.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	5996.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	5940.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1C(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C1C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5971.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	5977.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	5978.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	6004.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	6006.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	6144.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	6176.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)=CC=C1O	6200.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C(O)CC2=C1O	6210.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C5)C(O)CC4=C3O)C2O)C=C1O	6220.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C5)C4O)C(O)=C3CC2O)=CC=C1O	6209.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)=CC=C1O	6173.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)=CC=C1O	6167.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O[Si](C)(C)C(C)(C)C	6173.9	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	6185.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	6208.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O[Si](C)(C)C(C)(C)C)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	6185.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C(O)CC2=C1O	6219.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C5)C4O)C(O)=C3CC2O)C=C1O	6225.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C5)C4O)C(O)=C3CC2O)C=C1O	6218.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O[Si](C)(C)C(C)(C)C)C(O)=C3CC2O)C=C1O	6181.0	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O[Si](C)(C)C(C)(C)C)=C3CC2O)C=C1O	6175.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O[Si](C)(C)C(C)(C)C)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	6161.5	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	6167.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O[Si](C)(C)C(C)(C)C)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	6168.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C(C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	6190.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O[Si](C)(C)C(C)(C)C)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	6181.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O[Si](C)(C)C(C)(C)C)CC2=C1O	6179.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC2=C(CC(O)C(C3=CC=C(O)C(O)=C3)O2)C(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	6137.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C(C)(C)C)C=C1O	6186.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	6181.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O[Si](C)(C)C(C)(C)C)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	6168.7	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O[Si](C)(C)C(C)(C)C)C(C1=CC=C(O)C(O)=C1)O2	6172.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	6113.2	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1)C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O)C(O)C(C1=CC=C(O)C(O)=C1)O2	6182.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	6219.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O	6212.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)OC(C1=CC=C(O)C(O)=C1)C(O)C2C1=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C(O)CC2=C1O[Si](C)(C)C(C)(C)C	6159.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C(C)(C)C)CC4=C3O)C2O)C=C1O	6195.8	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1C(C1=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)C(O)CC3=C1O[Si](C)(C)C(C)(C)C)C(O)C(C1=CC=C(O)C(O)=C1)O2	6163.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O	6213.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)=CC=C1O	6206.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	6175.1	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O)C2O)C=C1O[Si](C)(C)C(C)(C)C	6180.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O)CC4=C3O[Si](C)(C)C(C)(C)C)C2O)C=C1O	6180.4	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=CC(O)=C3C(C3=C(O)C=C4OC(C5=CC=C(O)C(O)=C5)C(O[Si](C)(C)C(C)(C)C)CC4=C3O)C2O)=CC=C1O	6191.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1CC2=C(C=C(O)C(C3C4=C(O)C=C(O)C=C4OC(C4=CC=C(O)C(O)=C4)C3O[Si](C)(C)C(C)(C)C)=C2O)OC1C1=CC=C(O)C(O)=C1	6137.3	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=C2CC(O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)OC2=CC(O)=C1C1C2=C(O)C=C(O)C=C2OC(C2=CC=C(O)C(O)=C2)C1O	6129.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)C=C1O	6189.6	Semi standard non polar	33892256
ent-Epicatechin-(4alpha->6)-ent-epicatechin,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC(C2OC3=CC(O)=C(C4C5=C(O)C=C(O)C=C5OC(C5=CC=C(O)C(O)=C5)C4O)C(O)=C3CC2O[Si](C)(C)C(C)(C)C)=CC=C1O	6185.6	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (Non-derivatized) - 70eV, Positive	splash10-03mj-0510690000-ddcfcf385c610cd1911a	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (1 TMS) - 70eV, Positive	splash10-00g0-9310124000-9deb4c99e28326c69e57	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS ("ent-Epicatechin-(4alpha->6)-ent-epicatechin,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 10V, Positive-QTOF	splash10-004i-0110980000-586f08069c095a52ce84	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 20V, Positive-QTOF	splash10-0a4i-0446930000-1e653817d069017a477f	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 40V, Positive-QTOF	splash10-0006-0490110000-5a0848cc1ab75f4d427f	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 10V, Positive-QTOF	splash10-004i-0110980000-586f08069c095a52ce84	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 20V, Positive-QTOF	splash10-0a4i-0446930000-1e653817d069017a477f	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 40V, Positive-QTOF	splash10-0006-0490110000-5a0848cc1ab75f4d427f	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 10V, Negative-QTOF	splash10-004i-0000290000-6566c54261e99b1b7a0f	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 20V, Negative-QTOF	splash10-0kdr-0920440000-0aaffeed991eae619957	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 40V, Negative-QTOF	splash10-004i-0920000000-cc3b058308f32af21f9f	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 10V, Negative-QTOF	splash10-004i-0000290000-6566c54261e99b1b7a0f	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 20V, Negative-QTOF	splash10-0kdr-0920440000-0aaffeed991eae619957	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 40V, Negative-QTOF	splash10-004i-0920000000-cc3b058308f32af21f9f	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 10V, Positive-QTOF	splash10-004i-0000290000-b23210639d3e3e2dd707	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 20V, Positive-QTOF	splash10-004i-0100690000-b87db8d35e2187dea880	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 40V, Positive-QTOF	splash10-00di-0930020000-466b786ed57b8a4d6774	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 10V, Negative-QTOF	splash10-004i-0000090000-51221876ce16ff23d87b	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 20V, Negative-QTOF	splash10-004i-0100790000-2ff88377181e6e6cc9fc	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - ent-Epicatechin-(4alpha->6)-ent-epicatechin 40V, Negative-QTOF	splash10-01rf-0310930000-c8b8d6c461c6a14f16d6	2021-09-23	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB021145

KNApSAcK ID

C00009079

Chemspider ID

10673608

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

13990892

PDB ID

Not Available

ChEBI ID

173295

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for ent-Epicatechin-(4alpha->6)-ent-epicatechin (HMDB0041239)

MOL for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

3D MOL for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

3D SDF for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

3D-SDF for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

PDB for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

3D PDB for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

SMILES for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

INCHI for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

Structure for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

3D Structure for HMDB0041239 (ent-Epicatechin-(4alpha->6)-ent-epicatechin)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra