Showing metabocard for Koryoginsenoside Rg2 (HMDB0041327)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 02:59:41 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:58 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0041327 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Koryoginsenoside Rg2 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Koryoginsenoside Rg2 belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Koryoginsenoside Rg2 is an extremely weak basic (essentially neutral) compound (based on its pKa). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0041327 (Koryoginsenoside Rg2)Mrv0541 05061312342D 78 85 0 0 0 0 999 V2000 9.1108 2.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2182 1.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9527 -1.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8921 -1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1295 1.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5670 1.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3626 0.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5613 3.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2676 1.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5424 1.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8496 -0.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7029 0.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0529 1.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0938 2.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4162 0.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0594 0.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5629 -0.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8428 1.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6376 5.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5515 3.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8661 -0.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6051 5.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0557 1.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5562 2.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2492 5.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2671 2.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1528 -0.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3904 4.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1340 -0.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8451 0.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7051 -0.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2718 1.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0755 6.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9804 3.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1550 0.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0020 5.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6870 7.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6961 2.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7873 5.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5583 0.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4724 6.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6984 2.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9611 4.3338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2739 0.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6461 6.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9851 1.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3495 3.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2761 -0.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6645 1.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4207 -0.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1318 0.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5607 0.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2741 0.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3085 2.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8523 5.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1618 2.8983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8638 -1.6412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5539 2.9139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2901 6.9098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9782 4.1416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8706 0.8339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8283 6.1996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5133 8.0173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4094 3.3206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3989 5.6940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5561 1.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0839 7.5117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4140 1.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7464 4.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2761 2.5161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4313 5.8987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0345 5.5977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2694 2.0772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5628 -0.8122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5642 4.0328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9918 -0.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9873 0.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5233 2.9736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13 9 1 0 0 0 0 14 9 2 0 0 0 0 15 12 1 0 0 0 0 16 10 1 0 0 0 0 17 11 1 0 0 0 0 23 10 1 0 0 0 0 24 18 1 0 0 0 0 25 19 1 0 0 0 0 26 20 1 0 0 0 0 27 21 1 0 0 0 0 28 22 1 0 0 0 0 29 11 1 0 0 0 0 30 18 1 0 0 0 0 31 12 1 0 0 0 0 32 23 1 0 0 0 0 32 24 1 0 0 0 0 33 25 1 0 0 0 0 34 26 1 0 0 0 0 35 27 1 0 0 0 0 36 28 1 0 0 0 0 37 33 1 0 0 0 0 38 34 1 0 0 0 0 39 36 1 0 0 0 0 40 35 1 0 0 0 0 41 37 1 0 0 0 0 42 38 1 0 0 0 0 43 39 1 0 0 0 0 44 40 1 0 0 0 0 45 41 1 0 0 0 0 46 42 1 0 0 0 0 47 43 1 0 0 0 0 48 44 1 0 0 0 0 49 1 1 0 0 0 0 49 2 1 0 0 0 0 49 13 1 0 0 0 0 50 3 1 0 0 0 0 50 4 1 0 0 0 0 50 29 1 0 0 0 0 50 31 1 0 0 0 0 51 5 1 0 0 0 0 51 15 1 0 0 0 0 51 29 1 0 0 0 0 51 30 1 0 0 0 0 52 6 1 0 0 0 0 52 17 1 0 0 0 0 52 30 1 0 0 0 0 53 7 1 0 0 0 0 53 16 1 0 0 0 0 53 32 1 0 0 0 0 53 52 1 0 0 0 0 54 8 1 0 0 0 0 54 14 1 0 0 0 0 54 23 1 0 0 0 0 55 19 1 0 0 0 0 56 20 1 0 0 0 0 57 21 1 0 0 0 0 58 24 1 0 0 0 0 59 33 1 0 0 0 0 60 34 1 0 0 0 0 61 35 1 0 0 0 0 62 36 1 0 0 0 0 63 37 1 0 0 0 0 64 38 1 0 0 0 0 65 39 1 0 0 0 0 66 40 1 0 0 0 0 67 41 1 0 0 0 0 68 42 1 0 0 0 0 69 43 1 0 0 0 0 70 49 1 0 0 0 0 71 22 1 0 0 0 0 71 45 1 0 0 0 0 72 25 1 0 0 0 0 72 45 1 0 0 0 0 73 26 1 0 0 0 0 73 46 1 0 0 0 0 74 27 1 0 0 0 0 74 48 1 0 0 0 0 75 28 1 0 0 0 0 75 47 1 0 0 0 0 76 31 1 0 0 0 0 76 48 1 0 0 0 0 77 44 1 0 0 0 0 77 46 1 0 0 0 0 78 47 1 0 0 0 0 78 54 1 0 0 0 0 M END 3D MOL for HMDB0041327 (Koryoginsenoside Rg2)HMDB0041327 RDKit 3D Koryoginsenoside Rg2 170177 0 0 0 0 0 0 0 0999 V2000 5.6757 -6.6933 0.2567 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3847 -6.0258 -1.0807 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5219 -5.0792 -1.3866 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3183 -7.0065 -2.0635 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0650 -5.2668 -1.0110 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1978 -4.2250 0.0691 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0670 -2.9357 -0.1675 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1977 -1.8741 0.9032 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2767 -2.5616 1.8709 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6566 -0.8201 0.3912 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1068 0.2382 -0.0853 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5008 0.3420 -0.2456 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0499 0.3554 -1.4451 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8060 1.6307 -1.8002 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8264 1.8745 -0.8857 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5060 3.0505 -1.2318 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8479 2.8105 -1.4803 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6833 3.2642 -0.4611 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0618 2.7019 -0.7033 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9366 1.2996 -0.6747 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6993 4.7690 -0.3842 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4324 5.1585 0.7350 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2600 5.2223 -0.3296 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9825 5.8547 -1.5485 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2791 4.1110 -0.1654 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2108 3.5590 1.0875 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2150 -0.0457 -2.6313 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9014 0.3339 -3.7863 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8237 0.4812 -2.5797 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7521 1.5744 -3.4664 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3660 0.8890 -1.2317 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4501 2.3014 -1.1599 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0224 -1.7302 1.7685 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2527 -0.6138 2.8192 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8702 -0.5965 3.5252 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0468 -0.4370 2.2844 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3704 0.9082 1.7624 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6436 -1.5869 1.4342 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0271 -1.5096 0.1197 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8556 -0.2136 -0.4233 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4832 -1.8766 0.2803 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0568 -0.7775 1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5748 -0.7332 1.1103 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1847 -2.0439 1.4841 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0048 -0.4607 -0.3215 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9663 0.6592 -0.4939 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0477 0.7822 0.5140 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0120 -0.1921 0.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2877 0.2492 0.1431 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1673 -0.0336 1.1501 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8036 -1.2281 1.1517 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9991 -2.3926 1.7062 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8513 -2.6270 0.9885 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4299 -1.6204 -0.1877 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9376 -2.8922 -0.0726 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4032 -1.5000 -1.2946 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0535 -1.6132 -2.5215 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8693 -0.0815 -1.1956 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9801 0.7913 -1.3429 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9189 1.5669 -2.4667 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0204 1.3400 -3.2836 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1729 1.5706 -2.5792 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4201 1.2740 -3.3849 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4940 -0.0387 -3.8063 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3189 2.9316 -1.9883 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7567 3.9046 -2.8536 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0577 3.3763 -1.2809 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1438 4.6861 -0.8866 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8989 3.0505 -2.1626 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6806 3.5031 -1.7142 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4131 0.8447 1.8879 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3054 0.2081 2.8997 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4132 2.3458 2.2640 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9847 0.4475 1.9045 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4498 0.4969 3.3217 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9646 0.4846 3.2532 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4215 -0.7145 2.4674 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7393 -1.9085 3.2852 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2056 -7.6560 0.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7642 -6.8456 0.8584 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3709 -6.0328 0.8320 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1106 -4.0592 -1.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2401 -5.0327 -0.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0987 -5.4147 -2.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3743 -7.3107 -2.1233 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2847 -6.0152 -0.7603 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9164 -4.7989 -2.0060 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4058 -4.6021 1.0391 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8579 -2.6811 -1.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6219 -1.7771 2.5727 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0233 -3.0590 1.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6453 -3.2312 2.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0118 1.0437 0.7553 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8846 -0.4252 -1.4321 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1123 2.4902 -1.8323 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2866 1.5694 -2.7967 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0605 3.4648 -2.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3761 2.8929 0.5499 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3569 2.9537 -1.7385 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8009 3.0370 0.0581 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1743 0.9822 0.2395 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2305 5.1907 -1.2753 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2524 5.6612 0.4934 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1219 6.0004 0.4662 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7192 5.7616 -2.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2648 4.5516 -0.3732 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5345 4.0289 1.6250 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1440 -1.1731 -2.6787 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6644 -0.2523 -3.9819 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0890 -0.2598 -3.0019 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5917 1.7535 -3.9249 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2867 0.6791 -1.1342 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8498 2.6058 -0.4369 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0803 -2.6286 2.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0544 -0.8757 3.5251 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4898 0.3431 2.3936 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8735 0.2476 4.2134 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8781 -1.5773 4.0063 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7358 1.6257 2.5610 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5615 1.4719 1.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2149 0.9388 1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0743 -2.4709 1.9218 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3598 -2.2236 -0.6437 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0559 -0.2431 -1.4046 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8652 -1.8535 -0.7510 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5862 -2.8804 0.6696 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7969 0.1647 0.5342 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3748 -2.2347 2.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1870 -2.1189 0.9689 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5975 -2.8434 0.9440 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1148 -0.2113 -0.9765 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4285 -1.3651 -0.8093 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4460 1.6490 -0.6836 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4883 0.4860 -1.4854 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5972 1.7508 0.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2070 1.3881 0.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6860 -1.1277 1.8483 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5926 -3.3325 1.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8010 -2.1804 2.7749 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6339 -3.6081 0.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2503 -0.9190 -0.4042 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0186 -3.3187 -0.9855 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5854 -2.2168 -1.2239 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9926 -1.3107 -2.3733 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2143 0.0939 -2.0435 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9905 1.3440 -3.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1945 0.8425 -1.7237 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2920 1.5051 -2.7405 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5118 1.9311 -4.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9939 -0.5679 -3.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1091 2.8522 -1.1867 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5249 3.7865 -3.7880 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9923 2.7574 -0.3513 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4808 4.8333 -0.1475 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0908 3.5702 -3.1460 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9868 3.1920 -2.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2552 0.8165 3.0075 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6494 -0.8136 2.6470 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8996 0.1713 3.9125 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4804 2.8313 1.9043 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5330 2.4835 3.3415 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2680 2.8610 1.7491 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4293 1.3120 1.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7251 1.5356 3.6832 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9109 -0.1868 4.0212 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5796 0.3723 4.3083 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6199 1.4458 2.8858 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0403 -2.8185 2.7237 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0469 -2.2834 3.9677 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5964 -1.7210 4.0040 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 2 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 18 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 13 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 8 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 47 71 1 0 71 72 1 0 71 73 1 0 71 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 31 11 1 0 38 33 1 0 77 42 1 0 25 16 1 0 77 36 1 0 74 43 1 0 58 49 1 0 69 60 1 0 1 79 1 0 1 80 1 0 1 81 1 0 3 82 1 0 3 83 1 0 3 84 1 0 4 85 1 0 5 86 1 0 5 87 1 0 6 88 1 0 7 89 1 0 9 90 1 0 9 91 1 0 9 92 1 0 11 93 1 0 13 94 1 0 14 95 1 0 14 96 1 0 16 97 1 0 18 98 1 0 19 99 1 0 19100 1 0 20101 1 0 21102 1 0 22103 1 0 23104 1 0 24105 1 0 25106 1 0 26107 1 0 27108 1 0 28109 1 0 29110 1 0 30111 1 0 31112 1 0 32113 1 0 33114 1 0 34115 1 0 34116 1 0 35117 1 0 35118 1 0 37119 1 0 37120 1 0 37121 1 0 38122 1 0 39123 1 0 40124 1 0 41125 1 0 41126 1 0 42127 1 0 44128 1 0 44129 1 0 44130 1 0 45131 1 0 45132 1 0 46133 1 0 46134 1 0 47135 1 0 49136 1 0 51137 1 0 52138 1 0 52139 1 0 53140 1 0 54141 1 0 55142 1 0 56143 1 0 57144 1 0 58145 1 0 60146 1 0 62147 1 0 63148 1 0 63149 1 0 64150 1 0 65151 1 0 66152 1 0 67153 1 0 68154 1 0 69155 1 0 70156 1 0 72157 1 0 72158 1 0 72159 1 0 73160 1 0 73161 1 0 73162 1 0 74163 1 0 75164 1 0 75165 1 0 76166 1 0 76167 1 0 78168 1 0 78169 1 0 78170 1 0 M END 3D SDF for HMDB0041327 (Koryoginsenoside Rg2)Mrv0541 05061312342D 78 85 0 0 0 0 999 V2000 9.1108 2.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2182 1.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9527 -1.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8921 -1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1295 1.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5670 1.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3626 0.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5613 3.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2676 1.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5424 1.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8496 -0.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7029 0.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0529 1.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0938 2.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4162 0.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0594 0.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5629 -0.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8428 1.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6376 5.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5515 3.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8661 -0.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6051 5.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0557 1.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5562 2.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2492 5.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2671 2.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1528 -0.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3904 4.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1340 -0.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8451 0.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7051 -0.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2718 1.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0755 6.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9804 3.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1550 0.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0020 5.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6870 7.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6961 2.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7873 5.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5583 0.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4724 6.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6984 2.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9611 4.3338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2739 0.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6461 6.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9851 1.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3495 3.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2761 -0.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6645 1.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4207 -0.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1318 0.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5607 0.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2741 0.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3085 2.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8523 5.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1618 2.8983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8638 -1.6412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5539 2.9139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2901 6.9098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9782 4.1416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8706 0.8339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8283 6.1996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5133 8.0173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4094 3.3206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3989 5.6940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5561 1.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0839 7.5117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4140 1.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7464 4.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2761 2.5161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4313 5.8987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0345 5.5977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2694 2.0772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5628 -0.8122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5642 4.0328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9918 -0.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9873 0.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5233 2.9736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13 9 1 0 0 0 0 14 9 2 0 0 0 0 15 12 1 0 0 0 0 16 10 1 0 0 0 0 17 11 1 0 0 0 0 23 10 1 0 0 0 0 24 18 1 0 0 0 0 25 19 1 0 0 0 0 26 20 1 0 0 0 0 27 21 1 0 0 0 0 28 22 1 0 0 0 0 29 11 1 0 0 0 0 30 18 1 0 0 0 0 31 12 1 0 0 0 0 32 23 1 0 0 0 0 32 24 1 0 0 0 0 33 25 1 0 0 0 0 34 26 1 0 0 0 0 35 27 1 0 0 0 0 36 28 1 0 0 0 0 37 33 1 0 0 0 0 38 34 1 0 0 0 0 39 36 1 0 0 0 0 40 35 1 0 0 0 0 41 37 1 0 0 0 0 42 38 1 0 0 0 0 43 39 1 0 0 0 0 44 40 1 0 0 0 0 45 41 1 0 0 0 0 46 42 1 0 0 0 0 47 43 1 0 0 0 0 48 44 1 0 0 0 0 49 1 1 0 0 0 0 49 2 1 0 0 0 0 49 13 1 0 0 0 0 50 3 1 0 0 0 0 50 4 1 0 0 0 0 50 29 1 0 0 0 0 50 31 1 0 0 0 0 51 5 1 0 0 0 0 51 15 1 0 0 0 0 51 29 1 0 0 0 0 51 30 1 0 0 0 0 52 6 1 0 0 0 0 52 17 1 0 0 0 0 52 30 1 0 0 0 0 53 7 1 0 0 0 0 53 16 1 0 0 0 0 53 32 1 0 0 0 0 53 52 1 0 0 0 0 54 8 1 0 0 0 0 54 14 1 0 0 0 0 54 23 1 0 0 0 0 55 19 1 0 0 0 0 56 20 1 0 0 0 0 57 21 1 0 0 0 0 58 24 1 0 0 0 0 59 33 1 0 0 0 0 60 34 1 0 0 0 0 61 35 1 0 0 0 0 62 36 1 0 0 0 0 63 37 1 0 0 0 0 64 38 1 0 0 0 0 65 39 1 0 0 0 0 66 40 1 0 0 0 0 67 41 1 0 0 0 0 68 42 1 0 0 0 0 69 43 1 0 0 0 0 70 49 1 0 0 0 0 71 22 1 0 0 0 0 71 45 1 0 0 0 0 72 25 1 0 0 0 0 72 45 1 0 0 0 0 73 26 1 0 0 0 0 73 46 1 0 0 0 0 74 27 1 0 0 0 0 74 48 1 0 0 0 0 75 28 1 0 0 0 0 75 47 1 0 0 0 0 76 31 1 0 0 0 0 76 48 1 0 0 0 0 77 44 1 0 0 0 0 77 46 1 0 0 0 0 78 47 1 0 0 0 0 78 54 1 0 0 0 0 M END > <DATABASE_ID> HMDB0041327 > <DATABASE_NAME> hmdb > <SMILES> CC(C)(O)C\C=C\C(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3CCC21C > <INCHI_IDENTIFIER> InChI=1S/C54H92O24/c1-49(2,70)13-9-14-54(8,78-47-43(69)39(65)36(62)28(75-47)22-71-45-41(67)37(63)33(59)25(19-55)72-45)23-10-16-53(7)32(23)24(58)18-30-51(5)15-12-31(50(3,4)29(51)11-17-52(30,53)6)76-48-44(40(66)35(61)27(21-57)74-48)77-46-42(68)38(64)34(60)26(20-56)73-46/h9,14,23-48,55-70H,10-13,15-22H2,1-8H3/b14-9+ > <INCHI_KEY> IJQCDXJUXSOKKW-NTEUORMPSA-N > <FORMULA> C54H92O24 > <MOLECULAR_WEIGHT> 1125.2939 > <EXACT_MASS> 1124.597853872 > <JCHEM_ACCEPTOR_COUNT> 24 > <JCHEM_AVERAGE_POLARIZABILITY> 119.3916973097923 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 16 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-{[(3E)-2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-hydroxy-6-methylhept-3-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol > <ALOGPS_LOGP> -0.61 > <JCHEM_LOGP> -2.822954178000001 > <ALOGPS_LOGS> -2.88 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.184962178610466 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.751421021182779 > <JCHEM_PKA_STRONGEST_BASIC> -3.6486743719488306 > <JCHEM_POLAR_SURFACE_AREA> 397.52000000000015 > <JCHEM_REFRACTIVITY> 268.8378000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.47e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-{[(3E)-2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-hydroxy-6-methylhept-3-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0041327 (Koryoginsenoside Rg2)HMDB0041327 RDKit 3D Koryoginsenoside Rg2 170177 0 0 0 0 0 0 0 0999 V2000 5.6757 -6.6933 0.2567 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3847 -6.0258 -1.0807 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5219 -5.0792 -1.3866 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3183 -7.0065 -2.0635 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0650 -5.2668 -1.0110 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1978 -4.2250 0.0691 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0670 -2.9357 -0.1675 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1977 -1.8741 0.9032 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2767 -2.5616 1.8709 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6566 -0.8201 0.3912 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1068 0.2382 -0.0853 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5008 0.3420 -0.2456 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0499 0.3554 -1.4451 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8060 1.6307 -1.8002 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8264 1.8745 -0.8857 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5060 3.0505 -1.2318 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8479 2.8105 -1.4803 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6833 3.2642 -0.4611 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0618 2.7019 -0.7033 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9366 1.2996 -0.6747 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6993 4.7690 -0.3842 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4324 5.1585 0.7350 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2600 5.2223 -0.3296 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9825 5.8547 -1.5485 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2791 4.1110 -0.1654 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2108 3.5590 1.0875 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2150 -0.0457 -2.6313 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9014 0.3339 -3.7863 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8237 0.4812 -2.5797 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7521 1.5744 -3.4664 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3660 0.8890 -1.2317 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4501 2.3014 -1.1599 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0224 -1.7302 1.7685 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2527 -0.6138 2.8192 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8702 -0.5965 3.5252 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0468 -0.4370 2.2844 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3704 0.9082 1.7624 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6436 -1.5869 1.4342 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0271 -1.5096 0.1197 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8556 -0.2136 -0.4233 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4832 -1.8766 0.2803 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0568 -0.7775 1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5748 -0.7332 1.1103 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1847 -2.0439 1.4841 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0048 -0.4607 -0.3215 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9663 0.6592 -0.4939 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0477 0.7822 0.5140 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0120 -0.1921 0.3830 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2877 0.2492 0.1431 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1673 -0.0336 1.1501 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8036 -1.2281 1.1517 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9991 -2.3926 1.7062 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8513 -2.6270 0.9885 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4299 -1.6204 -0.1877 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9376 -2.8922 -0.0726 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4032 -1.5000 -1.2946 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0535 -1.6132 -2.5215 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8693 -0.0815 -1.1956 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9801 0.7913 -1.3429 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9189 1.5669 -2.4667 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0204 1.3400 -3.2836 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1729 1.5706 -2.5792 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4201 1.2740 -3.3849 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4940 -0.0387 -3.8063 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3189 2.9316 -1.9883 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7567 3.9046 -2.8536 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0577 3.3763 -1.2809 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1438 4.6861 -0.8866 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8989 3.0505 -2.1626 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6806 3.5031 -1.7142 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4131 0.8447 1.8879 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3054 0.2081 2.8997 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4132 2.3458 2.2640 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9847 0.4475 1.9045 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4498 0.4969 3.3217 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9646 0.4846 3.2532 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4215 -0.7145 2.4674 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7393 -1.9085 3.2852 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2056 -7.6560 0.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7642 -6.8456 0.8584 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3709 -6.0328 0.8320 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1106 -4.0592 -1.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2401 -5.0327 -0.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0987 -5.4147 -2.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3743 -7.3107 -2.1233 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2847 -6.0152 -0.7603 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9164 -4.7989 -2.0060 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4058 -4.6021 1.0391 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8579 -2.6811 -1.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6219 -1.7771 2.5727 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0233 -3.0590 1.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6453 -3.2312 2.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0118 1.0437 0.7553 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8846 -0.4252 -1.4321 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1123 2.4902 -1.8323 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2866 1.5694 -2.7967 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0605 3.4648 -2.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3761 2.8929 0.5499 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3569 2.9537 -1.7385 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8009 3.0370 0.0581 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1743 0.9822 0.2395 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2305 5.1907 -1.2753 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2524 5.6612 0.4934 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1219 6.0004 0.4662 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7192 5.7616 -2.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2648 4.5516 -0.3732 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5345 4.0289 1.6250 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1440 -1.1731 -2.6787 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6644 -0.2523 -3.9819 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0890 -0.2598 -3.0019 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5917 1.7535 -3.9249 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2867 0.6791 -1.1342 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8498 2.6058 -0.4369 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0803 -2.6286 2.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0544 -0.8757 3.5251 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4898 0.3431 2.3936 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8735 0.2476 4.2134 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8781 -1.5773 4.0063 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7358 1.6257 2.5610 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5615 1.4719 1.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2149 0.9388 1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0743 -2.4709 1.9218 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3598 -2.2236 -0.6437 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0559 -0.2431 -1.4046 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8652 -1.8535 -0.7510 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5862 -2.8804 0.6696 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7969 0.1647 0.5342 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3748 -2.2347 2.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1870 -2.1189 0.9689 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5975 -2.8434 0.9440 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1148 -0.2113 -0.9765 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4285 -1.3651 -0.8093 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4460 1.6490 -0.6836 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4883 0.4860 -1.4854 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5972 1.7508 0.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2070 1.3881 0.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6860 -1.1277 1.8483 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5926 -3.3325 1.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8010 -2.1804 2.7749 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6339 -3.6081 0.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2503 -0.9190 -0.4042 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0186 -3.3187 -0.9855 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5854 -2.2168 -1.2239 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9926 -1.3107 -2.3733 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2143 0.0939 -2.0435 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9905 1.3440 -3.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1945 0.8425 -1.7237 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2920 1.5051 -2.7405 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5118 1.9311 -4.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9939 -0.5679 -3.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1091 2.8522 -1.1867 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5249 3.7865 -3.7880 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9923 2.7574 -0.3513 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4808 4.8333 -0.1475 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0908 3.5702 -3.1460 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9868 3.1920 -2.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2552 0.8165 3.0075 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6494 -0.8136 2.6470 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8996 0.1713 3.9125 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4804 2.8313 1.9043 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5330 2.4835 3.3415 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2680 2.8610 1.7491 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4293 1.3120 1.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7251 1.5356 3.6832 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9109 -0.1868 4.0212 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5796 0.3723 4.3083 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6199 1.4458 2.8858 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0403 -2.8185 2.7237 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0469 -2.2834 3.9677 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5964 -1.7210 4.0040 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 2 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 18 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 13 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 8 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 47 71 1 0 71 72 1 0 71 73 1 0 71 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 31 11 1 0 38 33 1 0 77 42 1 0 25 16 1 0 77 36 1 0 74 43 1 0 58 49 1 0 69 60 1 0 1 79 1 0 1 80 1 0 1 81 1 0 3 82 1 0 3 83 1 0 3 84 1 0 4 85 1 0 5 86 1 0 5 87 1 0 6 88 1 0 7 89 1 0 9 90 1 0 9 91 1 0 9 92 1 0 11 93 1 0 13 94 1 0 14 95 1 0 14 96 1 0 16 97 1 0 18 98 1 0 19 99 1 0 19100 1 0 20101 1 0 21102 1 0 22103 1 0 23104 1 0 24105 1 0 25106 1 0 26107 1 0 27108 1 0 28109 1 0 29110 1 0 30111 1 0 31112 1 0 32113 1 0 33114 1 0 34115 1 0 34116 1 0 35117 1 0 35118 1 0 37119 1 0 37120 1 0 37121 1 0 38122 1 0 39123 1 0 40124 1 0 41125 1 0 41126 1 0 42127 1 0 44128 1 0 44129 1 0 44130 1 0 45131 1 0 45132 1 0 46133 1 0 46134 1 0 47135 1 0 49136 1 0 51137 1 0 52138 1 0 52139 1 0 53140 1 0 54141 1 0 55142 1 0 56143 1 0 57144 1 0 58145 1 0 60146 1 0 62147 1 0 63148 1 0 63149 1 0 64150 1 0 65151 1 0 66152 1 0 67153 1 0 68154 1 0 69155 1 0 70156 1 0 72157 1 0 72158 1 0 72159 1 0 73160 1 0 73161 1 0 73162 1 0 74163 1 0 75164 1 0 75165 1 0 76166 1 0 76167 1 0 78168 1 0 78169 1 0 78170 1 0 M END PDB for HMDB0041327 (Koryoginsenoside Rg2)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 17.007 4.805 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 19.074 2.521 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 7.378 -2.679 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 5.399 -2.684 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 7.708 2.352 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 10.392 2.367 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 11.877 0.062 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 14.114 6.545 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 15.433 3.101 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 14.079 2.370 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 9.053 -1.494 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 5.045 0.805 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 16.899 2.630 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 15.108 4.607 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 6.377 1.578 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 13.178 1.121 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 10.384 -0.721 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 9.040 3.126 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 3.057 9.887 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.029 6.184 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -1.617 -1.523 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 8.596 9.505 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 13.171 3.613 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 10.372 3.899 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 4.199 10.921 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 2.365 5.417 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -0.285 -0.750 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 10.062 9.034 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 7.717 -0.728 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 9.044 1.586 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 5.050 -0.735 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 11.707 3.133 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 3.874 12.426 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 3.697 6.191 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 -0.289 0.790 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 11.204 10.067 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 5.016 13.460 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 5.033 5.425 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 12.670 9.595 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 1.042 1.564 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 6.482 12.988 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 5.037 3.885 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 12.994 8.090 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 2.378 0.797 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 6.806 11.483 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 3.706 3.111 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 11.852 7.056 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 2.382 -0.743 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 18.040 3.663 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 6.385 -1.502 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 7.713 0.812 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 10.380 0.819 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 11.712 1.593 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 13.643 5.079 0.000 0.00 0.00 C+0 HETATM 55 O UNK 0 1.591 10.359 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -0.302 5.410 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 -1.612 -3.064 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 10.367 5.439 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 2.408 12.898 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 3.693 7.731 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 -1.625 1.557 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 10.879 11.573 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 4.691 14.966 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 6.364 6.198 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 13.811 10.629 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 1.038 3.104 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 7.623 14.022 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 6.373 3.118 0.000 0.00 0.00 O+0 HETATM 69 O UNK 0 14.460 7.618 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 19.182 4.697 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 8.272 11.011 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 5.664 10.449 0.000 0.00 0.00 O+0 HETATM 73 O UNK 0 2.370 3.877 0.000 0.00 0.00 O+0 HETATM 74 O UNK 0 1.051 -1.516 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 10.387 7.528 0.000 0.00 0.00 O+0 HETATM 76 O UNK 0 3.718 -1.509 0.000 0.00 0.00 O+0 HETATM 77 O UNK 0 3.710 1.571 0.000 0.00 0.00 O+0 HETATM 78 O UNK 0 12.177 5.551 0.000 0.00 0.00 O+0 CONECT 1 49 CONECT 2 49 CONECT 3 50 CONECT 4 50 CONECT 5 51 CONECT 6 52 CONECT 7 53 CONECT 8 54 CONECT 9 13 14 CONECT 10 16 23 CONECT 11 17 29 CONECT 12 15 31 CONECT 13 9 49 CONECT 14 9 54 CONECT 15 12 51 CONECT 16 10 53 CONECT 17 11 52 CONECT 18 24 30 CONECT 19 25 55 CONECT 20 26 56 CONECT 21 27 57 CONECT 22 28 71 CONECT 23 10 32 54 CONECT 24 18 32 58 CONECT 25 19 33 72 CONECT 26 20 34 73 CONECT 27 21 35 74 CONECT 28 22 36 75 CONECT 29 11 50 51 CONECT 30 18 51 52 CONECT 31 12 50 76 CONECT 32 23 24 53 CONECT 33 25 37 59 CONECT 34 26 38 60 CONECT 35 27 40 61 CONECT 36 28 39 62 CONECT 37 33 41 63 CONECT 38 34 42 64 CONECT 39 36 43 65 CONECT 40 35 44 66 CONECT 41 37 45 67 CONECT 42 38 46 68 CONECT 43 39 47 69 CONECT 44 40 48 77 CONECT 45 41 71 72 CONECT 46 42 73 77 CONECT 47 43 75 78 CONECT 48 44 74 76 CONECT 49 1 2 13 70 CONECT 50 3 4 29 31 CONECT 51 5 15 29 30 CONECT 52 6 17 30 53 CONECT 53 7 16 32 52 CONECT 54 8 14 23 78 CONECT 55 19 CONECT 56 20 CONECT 57 21 CONECT 58 24 CONECT 59 33 CONECT 60 34 CONECT 61 35 CONECT 62 36 CONECT 63 37 CONECT 64 38 CONECT 65 39 CONECT 66 40 CONECT 67 41 CONECT 68 42 CONECT 69 43 CONECT 70 49 CONECT 71 22 45 CONECT 72 25 45 CONECT 73 26 46 CONECT 74 27 48 CONECT 75 28 47 CONECT 76 31 48 CONECT 77 44 46 CONECT 78 47 54 MASTER 0 0 0 0 0 0 0 0 78 0 170 0 END 3D PDB for HMDB0041327 (Koryoginsenoside Rg2)COMPND HMDB0041327 HETATM 1 C1 UNL 1 5.676 -6.693 0.257 1.00 0.00 C HETATM 2 C2 UNL 1 5.385 -6.026 -1.081 1.00 0.00 C HETATM 3 C3 UNL 1 6.522 -5.079 -1.387 1.00 0.00 C HETATM 4 O1 UNL 1 5.318 -7.007 -2.063 1.00 0.00 O HETATM 5 C4 UNL 1 4.065 -5.267 -1.011 1.00 0.00 C HETATM 6 C5 UNL 1 4.198 -4.225 0.069 1.00 0.00 C HETATM 7 C6 UNL 1 4.067 -2.936 -0.167 1.00 0.00 C HETATM 8 C7 UNL 1 4.198 -1.874 0.903 1.00 0.00 C HETATM 9 C8 UNL 1 5.277 -2.562 1.871 1.00 0.00 C HETATM 10 O2 UNL 1 4.657 -0.820 0.391 1.00 0.00 O HETATM 11 C9 UNL 1 5.107 0.238 -0.085 1.00 0.00 C HETATM 12 O3 UNL 1 6.501 0.342 -0.246 1.00 0.00 O HETATM 13 C10 UNL 1 7.050 0.355 -1.445 1.00 0.00 C HETATM 14 C11 UNL 1 7.806 1.631 -1.800 1.00 0.00 C HETATM 15 O4 UNL 1 8.826 1.875 -0.886 1.00 0.00 O HETATM 16 C12 UNL 1 9.506 3.051 -1.232 1.00 0.00 C HETATM 17 O5 UNL 1 10.848 2.810 -1.480 1.00 0.00 O HETATM 18 C13 UNL 1 11.683 3.264 -0.461 1.00 0.00 C HETATM 19 C14 UNL 1 13.062 2.702 -0.703 1.00 0.00 C HETATM 20 O6 UNL 1 12.937 1.300 -0.675 1.00 0.00 O HETATM 21 C15 UNL 1 11.699 4.769 -0.384 1.00 0.00 C HETATM 22 O7 UNL 1 12.432 5.159 0.735 1.00 0.00 O HETATM 23 C16 UNL 1 10.260 5.222 -0.330 1.00 0.00 C HETATM 24 O8 UNL 1 9.983 5.855 -1.548 1.00 0.00 O HETATM 25 C17 UNL 1 9.279 4.111 -0.165 1.00 0.00 C HETATM 26 O9 UNL 1 9.211 3.559 1.088 1.00 0.00 O HETATM 27 C18 UNL 1 6.215 -0.046 -2.631 1.00 0.00 C HETATM 28 O10 UNL 1 6.901 0.334 -3.786 1.00 0.00 O HETATM 29 C19 UNL 1 4.824 0.481 -2.580 1.00 0.00 C HETATM 30 O11 UNL 1 4.752 1.574 -3.466 1.00 0.00 O HETATM 31 C20 UNL 1 4.366 0.889 -1.232 1.00 0.00 C HETATM 32 O12 UNL 1 4.450 2.301 -1.160 1.00 0.00 O HETATM 33 C21 UNL 1 3.022 -1.730 1.769 1.00 0.00 C HETATM 34 C22 UNL 1 3.253 -0.614 2.819 1.00 0.00 C HETATM 35 C23 UNL 1 1.870 -0.596 3.525 1.00 0.00 C HETATM 36 C24 UNL 1 1.047 -0.437 2.284 1.00 0.00 C HETATM 37 C25 UNL 1 1.370 0.908 1.762 1.00 0.00 C HETATM 38 C26 UNL 1 1.644 -1.587 1.434 1.00 0.00 C HETATM 39 C27 UNL 1 1.027 -1.510 0.120 1.00 0.00 C HETATM 40 O13 UNL 1 0.856 -0.214 -0.423 1.00 0.00 O HETATM 41 C28 UNL 1 -0.483 -1.877 0.280 1.00 0.00 C HETATM 42 C29 UNL 1 -1.057 -0.778 1.108 1.00 0.00 C HETATM 43 C30 UNL 1 -2.575 -0.733 1.110 1.00 0.00 C HETATM 44 C31 UNL 1 -3.185 -2.044 1.484 1.00 0.00 C HETATM 45 C32 UNL 1 -3.005 -0.461 -0.322 1.00 0.00 C HETATM 46 C33 UNL 1 -3.966 0.659 -0.494 1.00 0.00 C HETATM 47 C34 UNL 1 -5.048 0.782 0.514 1.00 0.00 C HETATM 48 O14 UNL 1 -6.012 -0.192 0.383 1.00 0.00 O HETATM 49 C35 UNL 1 -7.288 0.249 0.143 1.00 0.00 C HETATM 50 O15 UNL 1 -8.167 -0.034 1.150 1.00 0.00 O HETATM 51 C36 UNL 1 -8.804 -1.228 1.152 1.00 0.00 C HETATM 52 C37 UNL 1 -7.999 -2.393 1.706 1.00 0.00 C HETATM 53 O16 UNL 1 -6.851 -2.627 0.988 1.00 0.00 O HETATM 54 C38 UNL 1 -9.430 -1.620 -0.188 1.00 0.00 C HETATM 55 O17 UNL 1 -9.938 -2.892 -0.073 1.00 0.00 O HETATM 56 C39 UNL 1 -8.403 -1.500 -1.295 1.00 0.00 C HETATM 57 O18 UNL 1 -9.054 -1.613 -2.521 1.00 0.00 O HETATM 58 C40 UNL 1 -7.869 -0.081 -1.196 1.00 0.00 C HETATM 59 O19 UNL 1 -8.980 0.791 -1.343 1.00 0.00 O HETATM 60 C41 UNL 1 -8.919 1.567 -2.467 1.00 0.00 C HETATM 61 O20 UNL 1 -10.020 1.340 -3.284 1.00 0.00 O HETATM 62 C42 UNL 1 -11.173 1.571 -2.579 1.00 0.00 C HETATM 63 C43 UNL 1 -12.420 1.274 -3.385 1.00 0.00 C HETATM 64 O21 UNL 1 -12.494 -0.039 -3.806 1.00 0.00 O HETATM 65 C44 UNL 1 -11.319 2.932 -1.988 1.00 0.00 C HETATM 66 O22 UNL 1 -11.757 3.905 -2.854 1.00 0.00 O HETATM 67 C45 UNL 1 -10.058 3.376 -1.281 1.00 0.00 C HETATM 68 O23 UNL 1 -10.144 4.686 -0.887 1.00 0.00 O HETATM 69 C46 UNL 1 -8.899 3.051 -2.163 1.00 0.00 C HETATM 70 O24 UNL 1 -7.681 3.503 -1.714 1.00 0.00 O HETATM 71 C47 UNL 1 -4.413 0.845 1.888 1.00 0.00 C HETATM 72 C48 UNL 1 -5.305 0.208 2.900 1.00 0.00 C HETATM 73 C49 UNL 1 -4.413 2.346 2.264 1.00 0.00 C HETATM 74 C50 UNL 1 -2.985 0.448 1.905 1.00 0.00 C HETATM 75 C51 UNL 1 -2.450 0.497 3.322 1.00 0.00 C HETATM 76 C52 UNL 1 -0.965 0.485 3.253 1.00 0.00 C HETATM 77 C53 UNL 1 -0.421 -0.715 2.467 1.00 0.00 C HETATM 78 C54 UNL 1 -0.739 -1.908 3.285 1.00 0.00 C HETATM 79 H1 UNL 1 6.206 -7.656 0.135 1.00 0.00 H HETATM 80 H2 UNL 1 4.764 -6.846 0.858 1.00 0.00 H HETATM 81 H3 UNL 1 6.371 -6.033 0.832 1.00 0.00 H HETATM 82 H4 UNL 1 6.111 -4.059 -1.527 1.00 0.00 H HETATM 83 H5 UNL 1 7.240 -5.033 -0.545 1.00 0.00 H HETATM 84 H6 UNL 1 7.099 -5.415 -2.281 1.00 0.00 H HETATM 85 H7 UNL 1 4.374 -7.311 -2.123 1.00 0.00 H HETATM 86 H8 UNL 1 3.285 -6.015 -0.760 1.00 0.00 H HETATM 87 H9 UNL 1 3.916 -4.799 -2.006 1.00 0.00 H HETATM 88 H10 UNL 1 4.406 -4.602 1.039 1.00 0.00 H HETATM 89 H11 UNL 1 3.858 -2.681 -1.189 1.00 0.00 H HETATM 90 H12 UNL 1 5.622 -1.777 2.573 1.00 0.00 H HETATM 91 H13 UNL 1 6.023 -3.059 1.280 1.00 0.00 H HETATM 92 H14 UNL 1 4.645 -3.231 2.479 1.00 0.00 H HETATM 93 H15 UNL 1 5.012 1.044 0.755 1.00 0.00 H HETATM 94 H16 UNL 1 7.885 -0.425 -1.432 1.00 0.00 H HETATM 95 H17 UNL 1 7.112 2.490 -1.832 1.00 0.00 H HETATM 96 H18 UNL 1 8.287 1.569 -2.797 1.00 0.00 H HETATM 97 H19 UNL 1 9.060 3.465 -2.161 1.00 0.00 H HETATM 98 H20 UNL 1 11.376 2.893 0.550 1.00 0.00 H HETATM 99 H21 UNL 1 13.357 2.954 -1.739 1.00 0.00 H HETATM 100 H22 UNL 1 13.801 3.037 0.058 1.00 0.00 H HETATM 101 H23 UNL 1 13.174 0.982 0.239 1.00 0.00 H HETATM 102 H24 UNL 1 12.230 5.191 -1.275 1.00 0.00 H HETATM 103 H25 UNL 1 13.252 5.661 0.493 1.00 0.00 H HETATM 104 H26 UNL 1 10.122 6.000 0.466 1.00 0.00 H HETATM 105 H27 UNL 1 10.719 5.762 -2.193 1.00 0.00 H HETATM 106 H28 UNL 1 8.265 4.552 -0.373 1.00 0.00 H HETATM 107 H29 UNL 1 8.534 4.029 1.625 1.00 0.00 H HETATM 108 H30 UNL 1 6.144 -1.173 -2.679 1.00 0.00 H HETATM 109 H31 UNL 1 7.664 -0.252 -3.982 1.00 0.00 H HETATM 110 H32 UNL 1 4.089 -0.260 -3.002 1.00 0.00 H HETATM 111 H33 UNL 1 5.592 1.754 -3.925 1.00 0.00 H HETATM 112 H34 UNL 1 3.287 0.679 -1.134 1.00 0.00 H HETATM 113 H35 UNL 1 3.850 2.606 -0.437 1.00 0.00 H HETATM 114 H36 UNL 1 3.080 -2.629 2.515 1.00 0.00 H HETATM 115 H37 UNL 1 4.054 -0.876 3.525 1.00 0.00 H HETATM 116 H38 UNL 1 3.490 0.343 2.394 1.00 0.00 H HETATM 117 H39 UNL 1 1.873 0.248 4.213 1.00 0.00 H HETATM 118 H40 UNL 1 1.878 -1.577 4.006 1.00 0.00 H HETATM 119 H41 UNL 1 1.736 1.626 2.561 1.00 0.00 H HETATM 120 H42 UNL 1 0.561 1.472 1.263 1.00 0.00 H HETATM 121 H43 UNL 1 2.215 0.939 1.009 1.00 0.00 H HETATM 122 H44 UNL 1 1.074 -2.471 1.922 1.00 0.00 H HETATM 123 H45 UNL 1 1.360 -2.224 -0.644 1.00 0.00 H HETATM 124 H46 UNL 1 1.056 -0.243 -1.405 1.00 0.00 H HETATM 125 H47 UNL 1 -0.865 -1.853 -0.751 1.00 0.00 H HETATM 126 H48 UNL 1 -0.586 -2.880 0.670 1.00 0.00 H HETATM 127 H49 UNL 1 -0.797 0.165 0.534 1.00 0.00 H HETATM 128 H50 UNL 1 -3.375 -2.235 2.526 1.00 0.00 H HETATM 129 H51 UNL 1 -4.187 -2.119 0.969 1.00 0.00 H HETATM 130 H52 UNL 1 -2.597 -2.843 0.944 1.00 0.00 H HETATM 131 H53 UNL 1 -2.115 -0.211 -0.976 1.00 0.00 H HETATM 132 H54 UNL 1 -3.429 -1.365 -0.809 1.00 0.00 H HETATM 133 H55 UNL 1 -3.446 1.649 -0.684 1.00 0.00 H HETATM 134 H56 UNL 1 -4.488 0.486 -1.485 1.00 0.00 H HETATM 135 H57 UNL 1 -5.597 1.751 0.303 1.00 0.00 H HETATM 136 H58 UNL 1 -7.207 1.388 0.133 1.00 0.00 H HETATM 137 H59 UNL 1 -9.686 -1.128 1.848 1.00 0.00 H HETATM 138 H60 UNL 1 -8.593 -3.333 1.689 1.00 0.00 H HETATM 139 H61 UNL 1 -7.801 -2.180 2.775 1.00 0.00 H HETATM 140 H62 UNL 1 -6.634 -3.608 0.888 1.00 0.00 H HETATM 141 H63 UNL 1 -10.250 -0.919 -0.404 1.00 0.00 H HETATM 142 H64 UNL 1 -10.019 -3.319 -0.985 1.00 0.00 H HETATM 143 H65 UNL 1 -7.585 -2.217 -1.224 1.00 0.00 H HETATM 144 H66 UNL 1 -9.993 -1.311 -2.373 1.00 0.00 H HETATM 145 H67 UNL 1 -7.214 0.094 -2.044 1.00 0.00 H HETATM 146 H68 UNL 1 -7.990 1.344 -3.066 1.00 0.00 H HETATM 147 H69 UNL 1 -11.195 0.843 -1.724 1.00 0.00 H HETATM 148 H70 UNL 1 -13.292 1.505 -2.740 1.00 0.00 H HETATM 149 H71 UNL 1 -12.512 1.931 -4.275 1.00 0.00 H HETATM 150 H72 UNL 1 -12.994 -0.568 -3.131 1.00 0.00 H HETATM 151 H73 UNL 1 -12.109 2.852 -1.187 1.00 0.00 H HETATM 152 H74 UNL 1 -11.525 3.786 -3.788 1.00 0.00 H HETATM 153 H75 UNL 1 -9.992 2.757 -0.351 1.00 0.00 H HETATM 154 H76 UNL 1 -9.481 4.833 -0.148 1.00 0.00 H HETATM 155 H77 UNL 1 -9.091 3.570 -3.146 1.00 0.00 H HETATM 156 H78 UNL 1 -6.987 3.192 -2.326 1.00 0.00 H HETATM 157 H79 UNL 1 -6.255 0.817 3.008 1.00 0.00 H HETATM 158 H80 UNL 1 -5.649 -0.814 2.647 1.00 0.00 H HETATM 159 H81 UNL 1 -4.900 0.171 3.912 1.00 0.00 H HETATM 160 H82 UNL 1 -3.480 2.831 1.904 1.00 0.00 H HETATM 161 H83 UNL 1 -4.533 2.484 3.341 1.00 0.00 H HETATM 162 H84 UNL 1 -5.268 2.861 1.749 1.00 0.00 H HETATM 163 H85 UNL 1 -2.429 1.312 1.406 1.00 0.00 H HETATM 164 H86 UNL 1 -2.725 1.536 3.683 1.00 0.00 H HETATM 165 H87 UNL 1 -2.911 -0.187 4.021 1.00 0.00 H HETATM 166 H88 UNL 1 -0.580 0.372 4.308 1.00 0.00 H HETATM 167 H89 UNL 1 -0.620 1.446 2.886 1.00 0.00 H HETATM 168 H90 UNL 1 -1.040 -2.818 2.724 1.00 0.00 H HETATM 169 H91 UNL 1 0.047 -2.283 3.968 1.00 0.00 H HETATM 170 H92 UNL 1 -1.596 -1.721 4.004 1.00 0.00 H CONECT 1 2 79 80 81 CONECT 2 3 4 5 CONECT 3 82 83 84 CONECT 4 85 CONECT 5 6 86 87 CONECT 6 7 7 88 CONECT 7 8 89 CONECT 8 9 10 33 CONECT 9 90 91 92 CONECT 10 11 CONECT 11 12 31 93 CONECT 12 13 CONECT 13 14 27 94 CONECT 14 15 95 96 CONECT 15 16 CONECT 16 17 25 97 CONECT 17 18 CONECT 18 19 21 98 CONECT 19 20 99 100 CONECT 20 101 CONECT 21 22 23 102 CONECT 22 103 CONECT 23 24 25 104 CONECT 24 105 CONECT 25 26 106 CONECT 26 107 CONECT 27 28 29 108 CONECT 28 109 CONECT 29 30 31 110 CONECT 30 111 CONECT 31 32 112 CONECT 32 113 CONECT 33 34 38 114 CONECT 34 35 115 116 CONECT 35 36 117 118 CONECT 36 37 38 77 CONECT 37 119 120 121 CONECT 38 39 122 CONECT 39 40 41 123 CONECT 40 124 CONECT 41 42 125 126 CONECT 42 43 77 127 CONECT 43 44 45 74 CONECT 44 128 129 130 CONECT 45 46 131 132 CONECT 46 47 133 134 CONECT 47 48 71 135 CONECT 48 49 CONECT 49 50 58 136 CONECT 50 51 CONECT 51 52 54 137 CONECT 52 53 138 139 CONECT 53 140 CONECT 54 55 56 141 CONECT 55 142 CONECT 56 57 58 143 CONECT 57 144 CONECT 58 59 145 CONECT 59 60 CONECT 60 61 69 146 CONECT 61 62 CONECT 62 63 65 147 CONECT 63 64 148 149 CONECT 64 150 CONECT 65 66 67 151 CONECT 66 152 CONECT 67 68 69 153 CONECT 68 154 CONECT 69 70 155 CONECT 70 156 CONECT 71 72 73 74 CONECT 72 157 158 159 CONECT 73 160 161 162 CONECT 74 75 163 CONECT 75 76 164 165 CONECT 76 77 166 167 CONECT 77 78 CONECT 78 168 169 170 END SMILES for HMDB0041327 (Koryoginsenoside Rg2)CC(C)(O)C\C=C\C(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3CCC21C INCHI for HMDB0041327 (Koryoginsenoside Rg2)InChI=1S/C54H92O24/c1-49(2,70)13-9-14-54(8,78-47-43(69)39(65)36(62)28(75-47)22-71-45-41(67)37(63)33(59)25(19-55)72-45)23-10-16-53(7)32(23)24(58)18-30-51(5)15-12-31(50(3,4)29(51)11-17-52(30,53)6)76-48-44(40(66)35(61)27(21-57)74-48)77-46-42(68)38(64)34(60)26(20-56)73-46/h9,14,23-48,55-70H,10-13,15-22H2,1-8H3/b14-9+ 3D Structure for HMDB0041327 (Koryoginsenoside Rg2) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C54H92O24 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1125.2939 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1124.597853872 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-{[(3E)-2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-hydroxy-6-methylhept-3-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-{[(3E)-2-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-16-hydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl)-6-hydroxy-6-methylhept-3-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 171746-13-7 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(C)(O)C\C=C\C(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3CCC21C | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C54H92O24/c1-49(2,70)13-9-14-54(8,78-47-43(69)39(65)36(62)28(75-47)22-71-45-41(67)37(63)33(59)25(19-55)72-45)23-10-16-53(7)32(23)24(58)18-30-51(5)15-12-31(50(3,4)29(51)11-17-52(30,53)6)76-48-44(40(66)35(61)27(21-57)74-48)77-46-42(68)38(64)34(60)26(20-56)73-46/h9,14,23-48,55-70H,10-13,15-22H2,1-8H3/b14-9+ | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | IJQCDXJUXSOKKW-NTEUORMPSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpenoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB021248 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131753106 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|