Showing metabocard for Tritriacontyl octacosanoate (HMDB0041479)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 03:10:09 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:57:02 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0041479 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Tritriacontyl octacosanoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Tritriacontyl octacosanoate belongs to the class of organic compounds known as wax monoesters. These are waxes bearing an ester group at exactly one position. Based on a literature review a significant number of articles have been published on Tritriacontyl octacosanoate. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0041479 (Tritriacontyl octacosanoate)Mrv0541 05061312422D 63 62 0 0 0 0 999 V2000 -20.4039 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.1788 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.6895 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4643 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.9750 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.7498 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.2605 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.0354 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.5461 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.3209 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.8316 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.6064 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.1171 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8920 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.4026 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1775 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.6882 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.4630 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.9737 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7485 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2592 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0341 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5448 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3196 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8303 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6051 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1158 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8907 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4013 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6869 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9724 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2579 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5435 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8290 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1762 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1145 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4617 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4001 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7473 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6856 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0328 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9711 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3183 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2566 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6038 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5422 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8894 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8277 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1749 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1132 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4604 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3988 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7460 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3157 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0315 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0302 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3170 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7447 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6025 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4591 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8881 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8881 -12.2565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1736 -11.0190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3 1 1 0 0 0 0 4 2 1 0 0 0 0 5 3 1 0 0 0 0 6 4 1 0 0 0 0 7 5 1 0 0 0 0 8 6 1 0 0 0 0 9 7 1 0 0 0 0 10 8 1 0 0 0 0 11 9 1 0 0 0 0 12 10 1 0 0 0 0 13 11 1 0 0 0 0 14 12 1 0 0 0 0 15 13 1 0 0 0 0 16 14 1 0 0 0 0 17 15 1 0 0 0 0 18 16 1 0 0 0 0 19 17 1 0 0 0 0 20 18 1 0 0 0 0 21 19 1 0 0 0 0 22 20 1 0 0 0 0 23 21 1 0 0 0 0 24 22 1 0 0 0 0 25 23 1 0 0 0 0 26 24 1 0 0 0 0 27 25 1 0 0 0 0 28 26 1 0 0 0 0 29 27 1 0 0 0 0 30 29 1 0 0 0 0 31 30 1 0 0 0 0 32 31 1 0 0 0 0 33 32 1 0 0 0 0 34 33 1 0 0 0 0 35 28 1 0 0 0 0 36 34 1 0 0 0 0 37 35 1 0 0 0 0 38 36 1 0 0 0 0 39 37 1 0 0 0 0 40 38 1 0 0 0 0 41 39 1 0 0 0 0 42 40 1 0 0 0 0 43 41 1 0 0 0 0 44 42 1 0 0 0 0 45 43 1 0 0 0 0 46 44 1 0 0 0 0 47 45 1 0 0 0 0 48 46 1 0 0 0 0 49 47 1 0 0 0 0 50 48 1 0 0 0 0 51 49 1 0 0 0 0 52 50 1 0 0 0 0 53 51 1 0 0 0 0 54 52 1 0 0 0 0 55 53 1 0 0 0 0 56 54 1 0 0 0 0 57 55 1 0 0 0 0 58 56 1 0 0 0 0 59 57 1 0 0 0 0 60 58 1 0 0 0 0 61 59 1 0 0 0 0 62 61 2 0 0 0 0 63 60 1 0 0 0 0 63 61 1 0 0 0 0 M END 3D MOL for HMDB0041479 (Tritriacontyl octacosanoate)HMDB0041479 RDKit 3D Tritriacontyl octacosanoate 185184 0 0 0 0 0 0 0 0999 V2000 -1.9676 -4.6320 -9.4917 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6880 -5.4147 -8.2578 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1960 -4.6260 -7.1008 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0612 -3.5704 -6.5389 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4130 -2.3828 -7.3107 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2715 -1.4627 -7.7202 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8216 -0.3175 -8.5394 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7409 0.5984 -7.8421 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0645 1.5116 -6.7948 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1957 2.2860 -6.1896 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0464 1.5103 -5.2429 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4726 1.3452 -3.8886 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1991 0.7809 -3.5637 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8281 -0.6445 -3.8117 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3671 -0.7544 -3.3425 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1468 -2.1302 -3.5051 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6065 -3.1872 -2.6952 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0774 -4.5199 -2.9485 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5219 -5.6619 -2.1794 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4566 -5.3576 -0.7006 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9599 -5.0773 -0.2330 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8908 -4.7963 1.2423 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2303 -4.4243 1.8560 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7730 -3.1863 1.2219 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1089 -2.7342 1.8251 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5012 -1.4791 1.0835 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7621 -0.8366 1.5111 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7717 -0.4110 2.9654 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6587 0.5095 3.3009 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6190 1.7892 2.4998 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4071 2.5872 2.9337 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1815 3.8612 2.2065 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9764 3.6817 0.7415 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7002 4.8900 0.0327 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5145 4.8589 -1.3377 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6222 3.7025 -1.8782 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2231 5.9853 -2.1615 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8525 6.4937 -2.3567 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1994 5.5854 -2.8524 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6662 4.5138 -1.8914 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3292 5.1953 -0.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8158 4.2104 0.3524 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5308 4.9535 1.4597 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9791 4.0275 2.5308 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8740 2.9538 1.9846 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3487 2.0430 3.1433 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1153 0.9215 2.5664 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6793 -0.1056 3.4422 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8836 -0.9305 4.3547 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7874 -1.7842 3.8484 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5997 -1.0812 3.2622 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8976 -0.2351 4.3554 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8561 0.5953 3.7449 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1088 1.5959 4.4696 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7870 1.4016 5.5912 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2017 0.8201 6.8195 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2131 0.7273 7.9611 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0611 8.3697 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7148 1.8831 9.4996 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9185 1.0678 9.1623 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8389 0.9512 10.3782 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1698 0.2910 11.5492 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7059 -1.1087 11.2028 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6254 -5.2287 -10.4144 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0519 -4.3921 -9.6462 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3983 -3.6947 -9.5821 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8445 -6.1549 -8.4921 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5841 -6.0519 -7.9685 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1708 -4.2557 -7.3739 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0016 -5.3524 -6.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0653 -4.0922 -6.2975 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7329 -3.2857 -5.4882 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0200 -2.5879 -8.2332 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1234 -1.7671 -6.6900 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5549 -2.0173 -8.3166 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7355 -1.0944 -6.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3149 -0.7116 -9.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9364 0.2541 -8.9171 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1919 1.2858 -8.6250 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5911 0.0468 -7.4310 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4923 0.8654 -6.1453 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4019 2.2287 -7.3682 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8519 2.5953 -7.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8577 3.2630 -5.7666 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3896 0.5649 -5.7032 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0223 2.0891 -5.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6383 2.3411 -3.3032 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2690 0.7097 -3.3254 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3063 1.4190 -3.8722 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0876 0.8806 -2.4059 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9709 -1.0255 -4.8074 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4015 -1.3280 -3.1143 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2489 -0.0331 -3.9224 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3258 -0.3836 -2.2875 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2125 -2.3902 -4.5702 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2121 -2.1177 -3.1102 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6469 -3.2173 -3.0506 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5698 -2.9502 -1.6157 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0265 -4.7785 -4.0445 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1714 -4.4059 -2.7810 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0349 -6.6139 -2.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6055 -5.7422 -2.4338 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1481 -4.5164 -0.4915 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8759 -6.2401 -0.1492 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3899 -4.2285 -0.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5709 -5.9800 -0.4341 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4593 -5.6854 1.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1791 -3.9583 1.3928 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0377 -4.2389 2.9292 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9059 -5.2953 1.7902 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9121 -3.3818 0.1316 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0241 -2.3765 1.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8245 -3.5351 1.6300 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9429 -2.5702 2.9031 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6441 -0.7620 1.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6535 -1.8048 0.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0319 -0.0463 0.8092 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5762 -1.6113 1.4255 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7292 -1.3284 3.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7247 0.1462 3.1210 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7404 0.7891 4.3684 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7105 -0.0618 3.2133 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5143 2.3886 2.7467 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6416 1.5447 1.4448 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4881 1.9287 2.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5215 2.8063 4.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0688 4.5278 2.3788 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3270 4.3773 2.6665 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9272 3.2748 0.2816 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2027 2.9533 0.5030 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7195 5.8192 -3.1846 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8287 6.9140 -1.8154 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9298 7.3439 -3.1099 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4430 7.0152 -1.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0124 5.1536 -3.8588 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1190 6.2240 -3.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5088 3.9922 -2.4379 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0462 3.7671 -1.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1503 5.8512 -1.0006 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5653 5.8223 -0.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 3.5434 -0.1488 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9438 3.6597 0.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4151 5.4750 0.9908 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8298 5.7363 1.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1197 3.5921 3.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6027 4.6142 3.2695 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7905 3.3873 1.5451 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3472 2.3278 1.2489 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5062 1.8633 3.7673 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0383 2.7167 3.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6220 0.5405 1.6339 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0549 1.4345 2.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5638 0.3769 3.9849 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2260 -0.8408 2.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5071 -0.3563 5.2596 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6513 -1.6281 4.8790 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3823 -2.3470 4.7488 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1247 -2.6063 3.1793 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8843 -1.9182 2.9686 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7654 -0.5255 2.3519 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6369 0.1663 4.9965 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3918 -1.0633 4.9757 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1338 -0.1342 3.2208 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3379 1.0673 2.8201 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9250 2.3723 4.8287 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3627 2.2838 3.6684 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7833 0.9542 5.3314 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1264 2.4530 5.9147 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1138 -0.2368 6.6691 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6700 1.3582 7.2351 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0303 0.0538 7.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6422 0.3167 8.8194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8636 2.6220 8.8218 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2036 2.6570 7.5606 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1663 1.3240 10.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0090 2.8434 9.9673 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5148 1.6917 8.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7393 0.0803 8.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2222 1.9564 10.6998 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7407 0.3534 10.1281 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3189 0.8901 11.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9045 0.1802 12.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0893 -1.8695 11.9239 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6013 -1.1521 11.2335 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0188 -1.3247 10.1724 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 2 68 1 0 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 5 73 1 0 5 74 1 0 6 75 1 0 6 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 8 80 1 0 9 81 1 0 9 82 1 0 10 83 1 0 10 84 1 0 11 85 1 0 11 86 1 0 12 87 1 0 12 88 1 0 13 89 1 0 13 90 1 0 14 91 1 0 14 92 1 0 15 93 1 0 15 94 1 0 16 95 1 0 16 96 1 0 17 97 1 0 17 98 1 0 18 99 1 0 18100 1 0 19101 1 0 19102 1 0 20103 1 0 20104 1 0 21105 1 0 21106 1 0 22107 1 0 22108 1 0 23109 1 0 23110 1 0 24111 1 0 24112 1 0 25113 1 0 25114 1 0 26115 1 0 26116 1 0 27117 1 0 27118 1 0 28119 1 0 28120 1 0 29121 1 0 29122 1 0 30123 1 0 30124 1 0 31125 1 0 31126 1 0 32127 1 0 32128 1 0 33129 1 0 33130 1 0 37131 1 0 37132 1 0 38133 1 0 38134 1 0 39135 1 0 39136 1 0 40137 1 0 40138 1 0 41139 1 0 41140 1 0 42141 1 0 42142 1 0 43143 1 0 43144 1 0 44145 1 0 44146 1 0 45147 1 0 45148 1 0 46149 1 0 46150 1 0 47151 1 0 47152 1 0 48153 1 0 48154 1 0 49155 1 0 49156 1 0 50157 1 0 50158 1 0 51159 1 0 51160 1 0 52161 1 0 52162 1 0 53163 1 0 53164 1 0 54165 1 0 54166 1 0 55167 1 0 55168 1 0 56169 1 0 56170 1 0 57171 1 0 57172 1 0 58173 1 0 58174 1 0 59175 1 0 59176 1 0 60177 1 0 60178 1 0 61179 1 0 61180 1 0 62181 1 0 62182 1 0 63183 1 0 63184 1 0 63185 1 0 M END 3D SDF for HMDB0041479 (Tritriacontyl octacosanoate)Mrv0541 05061312422D 63 62 0 0 0 0 999 V2000 -20.4039 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.1788 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.6895 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4643 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.9750 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.7498 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.2605 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.0354 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.5461 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.3209 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.8316 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.6064 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.1171 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8920 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.4026 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1775 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.6882 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.4630 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.9737 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7485 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2592 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0341 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5448 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3196 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8303 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6051 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1158 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8907 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4013 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6869 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9724 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2579 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5435 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8290 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1762 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1145 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4617 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4001 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7473 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6856 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0328 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9711 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3183 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2566 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6038 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5422 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8894 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8277 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1749 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1132 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4604 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3988 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7460 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3157 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0315 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0302 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3170 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7447 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6025 -11.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4591 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8881 -11.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8881 -12.2565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1736 -11.0190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3 1 1 0 0 0 0 4 2 1 0 0 0 0 5 3 1 0 0 0 0 6 4 1 0 0 0 0 7 5 1 0 0 0 0 8 6 1 0 0 0 0 9 7 1 0 0 0 0 10 8 1 0 0 0 0 11 9 1 0 0 0 0 12 10 1 0 0 0 0 13 11 1 0 0 0 0 14 12 1 0 0 0 0 15 13 1 0 0 0 0 16 14 1 0 0 0 0 17 15 1 0 0 0 0 18 16 1 0 0 0 0 19 17 1 0 0 0 0 20 18 1 0 0 0 0 21 19 1 0 0 0 0 22 20 1 0 0 0 0 23 21 1 0 0 0 0 24 22 1 0 0 0 0 25 23 1 0 0 0 0 26 24 1 0 0 0 0 27 25 1 0 0 0 0 28 26 1 0 0 0 0 29 27 1 0 0 0 0 30 29 1 0 0 0 0 31 30 1 0 0 0 0 32 31 1 0 0 0 0 33 32 1 0 0 0 0 34 33 1 0 0 0 0 35 28 1 0 0 0 0 36 34 1 0 0 0 0 37 35 1 0 0 0 0 38 36 1 0 0 0 0 39 37 1 0 0 0 0 40 38 1 0 0 0 0 41 39 1 0 0 0 0 42 40 1 0 0 0 0 43 41 1 0 0 0 0 44 42 1 0 0 0 0 45 43 1 0 0 0 0 46 44 1 0 0 0 0 47 45 1 0 0 0 0 48 46 1 0 0 0 0 49 47 1 0 0 0 0 50 48 1 0 0 0 0 51 49 1 0 0 0 0 52 50 1 0 0 0 0 53 51 1 0 0 0 0 54 52 1 0 0 0 0 55 53 1 0 0 0 0 56 54 1 0 0 0 0 57 55 1 0 0 0 0 58 56 1 0 0 0 0 59 57 1 0 0 0 0 60 58 1 0 0 0 0 61 59 1 0 0 0 0 62 61 2 0 0 0 0 63 60 1 0 0 0 0 63 61 1 0 0 0 0 M END > <DATABASE_ID> HMDB0041479 > <DATABASE_NAME> hmdb > <SMILES> CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCC > <INCHI_IDENTIFIER> InChI=1S/C61H122O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-30-31-32-33-34-36-38-40-42-44-46-48-50-52-54-56-58-60-63-61(62)59-57-55-53-51-49-47-45-43-41-39-37-35-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-60H2,1-2H3 > <INCHI_KEY> INEGPTBZICBFNP-UHFFFAOYSA-N > <FORMULA> C61H122O2 > <MOLECULAR_WEIGHT> 887.6202 > <EXACT_MASS> 886.944483148 > <JCHEM_ACCEPTOR_COUNT> 1 > <JCHEM_AVERAGE_POLARIZABILITY> 130.4587550403093 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 0 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> tritriacontyl octacosanoate > <ALOGPS_LOGP> 11.15 > <JCHEM_LOGP> 25.953691113333335 > <ALOGPS_LOGS> -7.90 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA_STRONGEST_BASIC> -7.0327278744240385 > <JCHEM_POLAR_SURFACE_AREA> 26.3 > <JCHEM_REFRACTIVITY> 284.36729999999994 > <JCHEM_ROTATABLE_BOND_COUNT> 59 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.11e-05 g/l > <JCHEM_TRADITIONAL_IUPAC> tritriacontyl octacosanoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0041479 (Tritriacontyl octacosanoate)HMDB0041479 RDKit 3D Tritriacontyl octacosanoate 185184 0 0 0 0 0 0 0 0999 V2000 -1.9676 -4.6320 -9.4917 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6880 -5.4147 -8.2578 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1960 -4.6260 -7.1008 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0612 -3.5704 -6.5389 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4130 -2.3828 -7.3107 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2715 -1.4627 -7.7202 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8216 -0.3175 -8.5394 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7409 0.5984 -7.8421 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0645 1.5116 -6.7948 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1957 2.2860 -6.1896 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0464 1.5103 -5.2429 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4726 1.3452 -3.8886 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1991 0.7809 -3.5637 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8281 -0.6445 -3.8117 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3671 -0.7544 -3.3425 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1468 -2.1302 -3.5051 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6065 -3.1872 -2.6952 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0774 -4.5199 -2.9485 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5219 -5.6619 -2.1794 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4566 -5.3576 -0.7006 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9599 -5.0773 -0.2330 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8908 -4.7963 1.2423 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2303 -4.4243 1.8560 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7730 -3.1863 1.2219 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1089 -2.7342 1.8251 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5012 -1.4791 1.0835 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7621 -0.8366 1.5111 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7717 -0.4110 2.9654 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6587 0.5095 3.3009 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6190 1.7892 2.4998 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4071 2.5872 2.9337 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1815 3.8612 2.2065 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9764 3.6817 0.7415 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7002 4.8900 0.0327 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5145 4.8589 -1.3377 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6222 3.7025 -1.8782 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2231 5.9853 -2.1615 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8525 6.4937 -2.3567 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1994 5.5854 -2.8524 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6662 4.5138 -1.8914 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3292 5.1953 -0.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8158 4.2104 0.3524 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5308 4.9535 1.4597 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9791 4.0275 2.5308 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8740 2.9538 1.9846 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3487 2.0430 3.1433 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1153 0.9215 2.5664 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6793 -0.1056 3.4422 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8836 -0.9305 4.3547 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7874 -1.7842 3.8484 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5997 -1.0812 3.2622 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8976 -0.2351 4.3554 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8561 0.5953 3.7449 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1088 1.5959 4.4696 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7870 1.4016 5.5912 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2017 0.8201 6.8195 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2131 0.7273 7.9611 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0611 8.3697 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7148 1.8831 9.4996 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9185 1.0678 9.1623 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8389 0.9512 10.3782 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1698 0.2910 11.5492 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7059 -1.1087 11.2028 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6254 -5.2287 -10.4144 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0519 -4.3921 -9.6462 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3983 -3.6947 -9.5821 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8445 -6.1549 -8.4921 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5841 -6.0519 -7.9685 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1708 -4.2557 -7.3739 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0016 -5.3524 -6.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0653 -4.0922 -6.2975 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7329 -3.2857 -5.4882 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0200 -2.5879 -8.2332 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1234 -1.7671 -6.6900 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5549 -2.0173 -8.3166 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7355 -1.0944 -6.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3149 -0.7116 -9.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9364 0.2541 -8.9171 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1919 1.2858 -8.6250 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5911 0.0468 -7.4310 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4923 0.8654 -6.1453 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4019 2.2287 -7.3682 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8519 2.5953 -7.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8577 3.2630 -5.7666 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3896 0.5649 -5.7032 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0223 2.0891 -5.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6383 2.3411 -3.3032 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2690 0.7097 -3.3254 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3063 1.4190 -3.8722 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0876 0.8806 -2.4059 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9709 -1.0255 -4.8074 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4015 -1.3280 -3.1143 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2489 -0.0331 -3.9224 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3258 -0.3836 -2.2875 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2125 -2.3902 -4.5702 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2121 -2.1177 -3.1102 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6469 -3.2173 -3.0506 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5698 -2.9502 -1.6157 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0265 -4.7785 -4.0445 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1714 -4.4059 -2.7810 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0349 -6.6139 -2.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6055 -5.7422 -2.4338 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1481 -4.5164 -0.4915 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8759 -6.2401 -0.1492 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3899 -4.2285 -0.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5709 -5.9800 -0.4341 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4593 -5.6854 1.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1791 -3.9583 1.3928 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0377 -4.2389 2.9292 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9059 -5.2953 1.7902 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9121 -3.3818 0.1316 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0241 -2.3765 1.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8245 -3.5351 1.6300 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9429 -2.5702 2.9031 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6441 -0.7620 1.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6535 -1.8048 0.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0319 -0.0463 0.8092 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5762 -1.6113 1.4255 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7292 -1.3284 3.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7247 0.1462 3.1210 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7404 0.7891 4.3684 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7105 -0.0618 3.2133 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5143 2.3886 2.7467 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6416 1.5447 1.4448 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4881 1.9287 2.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5215 2.8063 4.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0688 4.5278 2.3788 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3270 4.3773 2.6665 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9272 3.2748 0.2816 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2027 2.9533 0.5030 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7195 5.8192 -3.1846 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8287 6.9140 -1.8154 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9298 7.3439 -3.1099 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4430 7.0152 -1.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0124 5.1536 -3.8588 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1190 6.2240 -3.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5088 3.9922 -2.4379 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0462 3.7671 -1.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1503 5.8512 -1.0006 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5653 5.8223 -0.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 3.5434 -0.1488 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9438 3.6597 0.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4151 5.4750 0.9908 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8298 5.7363 1.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1197 3.5921 3.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6027 4.6142 3.2695 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7905 3.3873 1.5451 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3472 2.3278 1.2489 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5062 1.8633 3.7673 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0383 2.7167 3.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6220 0.5405 1.6339 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0549 1.4345 2.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5638 0.3769 3.9849 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2260 -0.8408 2.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5071 -0.3563 5.2596 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6513 -1.6281 4.8790 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3823 -2.3470 4.7488 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1247 -2.6063 3.1793 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8843 -1.9182 2.9686 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7654 -0.5255 2.3519 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6369 0.1663 4.9965 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3918 -1.0633 4.9757 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1338 -0.1342 3.2208 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3379 1.0673 2.8201 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9250 2.3723 4.8287 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3627 2.2838 3.6684 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7833 0.9542 5.3314 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1264 2.4530 5.9147 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1138 -0.2368 6.6691 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6700 1.3582 7.2351 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0303 0.0538 7.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6422 0.3167 8.8194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8636 2.6220 8.8218 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2036 2.6570 7.5606 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1663 1.3240 10.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0090 2.8434 9.9673 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5148 1.6917 8.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7393 0.0803 8.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2222 1.9564 10.6998 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7407 0.3534 10.1281 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3189 0.8901 11.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9045 0.1802 12.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0893 -1.8695 11.9239 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6013 -1.1521 11.2335 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0188 -1.3247 10.1724 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 2 68 1 0 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 5 73 1 0 5 74 1 0 6 75 1 0 6 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 8 80 1 0 9 81 1 0 9 82 1 0 10 83 1 0 10 84 1 0 11 85 1 0 11 86 1 0 12 87 1 0 12 88 1 0 13 89 1 0 13 90 1 0 14 91 1 0 14 92 1 0 15 93 1 0 15 94 1 0 16 95 1 0 16 96 1 0 17 97 1 0 17 98 1 0 18 99 1 0 18100 1 0 19101 1 0 19102 1 0 20103 1 0 20104 1 0 21105 1 0 21106 1 0 22107 1 0 22108 1 0 23109 1 0 23110 1 0 24111 1 0 24112 1 0 25113 1 0 25114 1 0 26115 1 0 26116 1 0 27117 1 0 27118 1 0 28119 1 0 28120 1 0 29121 1 0 29122 1 0 30123 1 0 30124 1 0 31125 1 0 31126 1 0 32127 1 0 32128 1 0 33129 1 0 33130 1 0 37131 1 0 37132 1 0 38133 1 0 38134 1 0 39135 1 0 39136 1 0 40137 1 0 40138 1 0 41139 1 0 41140 1 0 42141 1 0 42142 1 0 43143 1 0 43144 1 0 44145 1 0 44146 1 0 45147 1 0 45148 1 0 46149 1 0 46150 1 0 47151 1 0 47152 1 0 48153 1 0 48154 1 0 49155 1 0 49156 1 0 50157 1 0 50158 1 0 51159 1 0 51160 1 0 52161 1 0 52162 1 0 53163 1 0 53164 1 0 54165 1 0 54166 1 0 55167 1 0 55168 1 0 56169 1 0 56170 1 0 57171 1 0 57172 1 0 58173 1 0 58174 1 0 59175 1 0 59176 1 0 60177 1 0 60178 1 0 61179 1 0 61180 1 0 62181 1 0 62182 1 0 63183 1 0 63184 1 0 63185 1 0 M END PDB for HMDB0041479 (Tritriacontyl octacosanoate)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 -38.087 -21.339 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 43.267 -20.569 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -36.754 -20.569 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 41.933 -21.339 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -35.420 -21.339 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 40.600 -20.569 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -34.086 -20.569 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 39.266 -21.339 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -32.753 -21.339 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 37.932 -20.569 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -31.419 -20.569 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 36.599 -21.339 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -30.085 -21.339 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 35.265 -20.569 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 -28.752 -20.569 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 33.931 -21.339 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -27.418 -21.339 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 32.598 -20.569 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -26.084 -20.569 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 31.264 -21.339 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -24.751 -21.339 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 29.930 -20.569 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 -23.417 -20.569 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 28.597 -21.339 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -22.083 -21.339 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 27.263 -20.569 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -20.749 -20.569 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 25.929 -21.339 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -19.416 -21.339 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -18.082 -20.569 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -16.748 -21.339 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -15.415 -20.569 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -14.081 -21.339 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -12.747 -20.569 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 24.596 -20.569 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -11.414 -21.339 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 23.262 -21.339 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -10.080 -20.569 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 21.928 -20.569 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -8.746 -21.339 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 20.595 -21.339 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -7.413 -20.569 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 19.261 -20.569 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -6.079 -21.339 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 17.927 -21.339 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 -4.745 -20.569 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 16.594 -20.569 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -3.412 -21.339 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 15.260 -21.339 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -2.078 -20.569 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 13.926 -20.569 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -0.744 -21.339 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 12.593 -21.339 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 0.589 -20.569 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 11.259 -20.569 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 1.923 -21.339 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 9.925 -21.339 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 3.257 -20.569 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 8.591 -20.569 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 4.590 -21.339 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 7.258 -21.339 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 7.258 -22.879 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 5.924 -20.569 0.000 0.00 0.00 O+0 CONECT 1 3 CONECT 2 4 CONECT 3 1 5 CONECT 4 2 6 CONECT 5 3 7 CONECT 6 4 8 CONECT 7 5 9 CONECT 8 6 10 CONECT 9 7 11 CONECT 10 8 12 CONECT 11 9 13 CONECT 12 10 14 CONECT 13 11 15 CONECT 14 12 16 CONECT 15 13 17 CONECT 16 14 18 CONECT 17 15 19 CONECT 18 16 20 CONECT 19 17 21 CONECT 20 18 22 CONECT 21 19 23 CONECT 22 20 24 CONECT 23 21 25 CONECT 24 22 26 CONECT 25 23 27 CONECT 26 24 28 CONECT 27 25 29 CONECT 28 26 35 CONECT 29 27 30 CONECT 30 29 31 CONECT 31 30 32 CONECT 32 31 33 CONECT 33 32 34 CONECT 34 33 36 CONECT 35 28 37 CONECT 36 34 38 CONECT 37 35 39 CONECT 38 36 40 CONECT 39 37 41 CONECT 40 38 42 CONECT 41 39 43 CONECT 42 40 44 CONECT 43 41 45 CONECT 44 42 46 CONECT 45 43 47 CONECT 46 44 48 CONECT 47 45 49 CONECT 48 46 50 CONECT 49 47 51 CONECT 50 48 52 CONECT 51 49 53 CONECT 52 50 54 CONECT 53 51 55 CONECT 54 52 56 CONECT 55 53 57 CONECT 56 54 58 CONECT 57 55 59 CONECT 58 56 60 CONECT 59 57 61 CONECT 60 58 63 CONECT 61 59 62 63 CONECT 62 61 CONECT 63 60 61 MASTER 0 0 0 0 0 0 0 0 63 0 124 0 END 3D PDB for HMDB0041479 (Tritriacontyl octacosanoate)COMPND HMDB0041479 HETATM 1 C1 UNL 1 -1.968 -4.632 -9.492 1.00 0.00 C HETATM 2 C2 UNL 1 -1.688 -5.415 -8.258 1.00 0.00 C HETATM 3 C3 UNL 1 -1.196 -4.626 -7.101 1.00 0.00 C HETATM 4 C4 UNL 1 -2.061 -3.570 -6.539 1.00 0.00 C HETATM 5 C5 UNL 1 -2.413 -2.383 -7.311 1.00 0.00 C HETATM 6 C6 UNL 1 -1.272 -1.463 -7.720 1.00 0.00 C HETATM 7 C7 UNL 1 -1.822 -0.318 -8.539 1.00 0.00 C HETATM 8 C8 UNL 1 -2.741 0.598 -7.842 1.00 0.00 C HETATM 9 C9 UNL 1 -2.064 1.512 -6.795 1.00 0.00 C HETATM 10 C10 UNL 1 -3.196 2.286 -6.190 1.00 0.00 C HETATM 11 C11 UNL 1 -4.046 1.510 -5.243 1.00 0.00 C HETATM 12 C12 UNL 1 -3.473 1.345 -3.889 1.00 0.00 C HETATM 13 C13 UNL 1 -2.199 0.781 -3.564 1.00 0.00 C HETATM 14 C14 UNL 1 -1.828 -0.644 -3.812 1.00 0.00 C HETATM 15 C15 UNL 1 -0.367 -0.754 -3.342 1.00 0.00 C HETATM 16 C16 UNL 1 0.147 -2.130 -3.505 1.00 0.00 C HETATM 17 C17 UNL 1 -0.607 -3.187 -2.695 1.00 0.00 C HETATM 18 C18 UNL 1 0.077 -4.520 -2.948 1.00 0.00 C HETATM 19 C19 UNL 1 -0.522 -5.662 -2.179 1.00 0.00 C HETATM 20 C20 UNL 1 -0.457 -5.358 -0.701 1.00 0.00 C HETATM 21 C21 UNL 1 0.960 -5.077 -0.233 1.00 0.00 C HETATM 22 C22 UNL 1 0.891 -4.796 1.242 1.00 0.00 C HETATM 23 C23 UNL 1 2.230 -4.424 1.856 1.00 0.00 C HETATM 24 C24 UNL 1 2.773 -3.186 1.222 1.00 0.00 C HETATM 25 C25 UNL 1 4.109 -2.734 1.825 1.00 0.00 C HETATM 26 C26 UNL 1 4.501 -1.479 1.084 1.00 0.00 C HETATM 27 C27 UNL 1 5.762 -0.837 1.511 1.00 0.00 C HETATM 28 C28 UNL 1 5.772 -0.411 2.965 1.00 0.00 C HETATM 29 C29 UNL 1 4.659 0.509 3.301 1.00 0.00 C HETATM 30 C30 UNL 1 4.619 1.789 2.500 1.00 0.00 C HETATM 31 C31 UNL 1 3.407 2.587 2.934 1.00 0.00 C HETATM 32 C32 UNL 1 3.182 3.861 2.206 1.00 0.00 C HETATM 33 C33 UNL 1 2.976 3.682 0.742 1.00 0.00 C HETATM 34 O1 UNL 1 2.700 4.890 0.033 1.00 0.00 O HETATM 35 C34 UNL 1 2.515 4.859 -1.338 1.00 0.00 C HETATM 36 O2 UNL 1 2.622 3.703 -1.878 1.00 0.00 O HETATM 37 C35 UNL 1 2.223 5.985 -2.162 1.00 0.00 C HETATM 38 C36 UNL 1 0.853 6.494 -2.357 1.00 0.00 C HETATM 39 C37 UNL 1 -0.199 5.585 -2.852 1.00 0.00 C HETATM 40 C38 UNL 1 -0.666 4.514 -1.891 1.00 0.00 C HETATM 41 C39 UNL 1 -1.329 5.195 -0.692 1.00 0.00 C HETATM 42 C40 UNL 1 -1.816 4.210 0.352 1.00 0.00 C HETATM 43 C41 UNL 1 -2.531 4.954 1.460 1.00 0.00 C HETATM 44 C42 UNL 1 -2.979 4.027 2.531 1.00 0.00 C HETATM 45 C43 UNL 1 -3.874 2.954 1.985 1.00 0.00 C HETATM 46 C44 UNL 1 -4.349 2.043 3.143 1.00 0.00 C HETATM 47 C45 UNL 1 -5.115 0.922 2.566 1.00 0.00 C HETATM 48 C46 UNL 1 -5.679 -0.106 3.442 1.00 0.00 C HETATM 49 C47 UNL 1 -4.884 -0.931 4.355 1.00 0.00 C HETATM 50 C48 UNL 1 -3.787 -1.784 3.848 1.00 0.00 C HETATM 51 C49 UNL 1 -2.600 -1.081 3.262 1.00 0.00 C HETATM 52 C50 UNL 1 -1.898 -0.235 4.355 1.00 0.00 C HETATM 53 C51 UNL 1 -0.856 0.595 3.745 1.00 0.00 C HETATM 54 C52 UNL 1 -0.109 1.596 4.470 1.00 0.00 C HETATM 55 C53 UNL 1 0.787 1.402 5.591 1.00 0.00 C HETATM 56 C54 UNL 1 0.202 0.820 6.819 1.00 0.00 C HETATM 57 C55 UNL 1 1.213 0.727 7.961 1.00 0.00 C HETATM 58 C56 UNL 1 1.732 2.061 8.370 1.00 0.00 C HETATM 59 C57 UNL 1 2.715 1.883 9.500 1.00 0.00 C HETATM 60 C58 UNL 1 3.918 1.068 9.162 1.00 0.00 C HETATM 61 C59 UNL 1 4.839 0.951 10.378 1.00 0.00 C HETATM 62 C60 UNL 1 4.170 0.291 11.549 1.00 0.00 C HETATM 63 C61 UNL 1 3.706 -1.109 11.203 1.00 0.00 C HETATM 64 H1 UNL 1 -1.625 -5.229 -10.414 1.00 0.00 H HETATM 65 H2 UNL 1 -3.052 -4.392 -9.646 1.00 0.00 H HETATM 66 H3 UNL 1 -1.398 -3.695 -9.582 1.00 0.00 H HETATM 67 H4 UNL 1 -0.845 -6.155 -8.492 1.00 0.00 H HETATM 68 H5 UNL 1 -2.584 -6.052 -7.968 1.00 0.00 H HETATM 69 H6 UNL 1 -0.171 -4.256 -7.374 1.00 0.00 H HETATM 70 H7 UNL 1 -1.002 -5.352 -6.235 1.00 0.00 H HETATM 71 H8 UNL 1 -3.065 -4.092 -6.297 1.00 0.00 H HETATM 72 H9 UNL 1 -1.733 -3.286 -5.488 1.00 0.00 H HETATM 73 H10 UNL 1 -3.020 -2.588 -8.233 1.00 0.00 H HETATM 74 H11 UNL 1 -3.123 -1.767 -6.690 1.00 0.00 H HETATM 75 H12 UNL 1 -0.555 -2.017 -8.317 1.00 0.00 H HETATM 76 H13 UNL 1 -0.735 -1.094 -6.824 1.00 0.00 H HETATM 77 H14 UNL 1 -2.315 -0.712 -9.452 1.00 0.00 H HETATM 78 H15 UNL 1 -0.936 0.254 -8.917 1.00 0.00 H HETATM 79 H16 UNL 1 -3.192 1.286 -8.625 1.00 0.00 H HETATM 80 H17 UNL 1 -3.591 0.047 -7.431 1.00 0.00 H HETATM 81 H18 UNL 1 -1.492 0.865 -6.145 1.00 0.00 H HETATM 82 H19 UNL 1 -1.402 2.229 -7.368 1.00 0.00 H HETATM 83 H20 UNL 1 -3.852 2.595 -7.059 1.00 0.00 H HETATM 84 H21 UNL 1 -2.858 3.263 -5.767 1.00 0.00 H HETATM 85 H22 UNL 1 -4.390 0.565 -5.703 1.00 0.00 H HETATM 86 H23 UNL 1 -5.022 2.089 -5.093 1.00 0.00 H HETATM 87 H24 UNL 1 -3.638 2.341 -3.303 1.00 0.00 H HETATM 88 H25 UNL 1 -4.269 0.710 -3.325 1.00 0.00 H HETATM 89 H26 UNL 1 -1.306 1.419 -3.872 1.00 0.00 H HETATM 90 H27 UNL 1 -2.088 0.881 -2.406 1.00 0.00 H HETATM 91 H28 UNL 1 -1.971 -1.026 -4.807 1.00 0.00 H HETATM 92 H29 UNL 1 -2.401 -1.328 -3.114 1.00 0.00 H HETATM 93 H30 UNL 1 0.249 -0.033 -3.922 1.00 0.00 H HETATM 94 H31 UNL 1 -0.326 -0.384 -2.288 1.00 0.00 H HETATM 95 H32 UNL 1 0.212 -2.390 -4.570 1.00 0.00 H HETATM 96 H33 UNL 1 1.212 -2.118 -3.110 1.00 0.00 H HETATM 97 H34 UNL 1 -1.647 -3.217 -3.051 1.00 0.00 H HETATM 98 H35 UNL 1 -0.570 -2.950 -1.616 1.00 0.00 H HETATM 99 H36 UNL 1 -0.027 -4.779 -4.045 1.00 0.00 H HETATM 100 H37 UNL 1 1.171 -4.406 -2.781 1.00 0.00 H HETATM 101 H38 UNL 1 -0.035 -6.614 -2.419 1.00 0.00 H HETATM 102 H39 UNL 1 -1.606 -5.742 -2.434 1.00 0.00 H HETATM 103 H40 UNL 1 -1.148 -4.516 -0.491 1.00 0.00 H HETATM 104 H41 UNL 1 -0.876 -6.240 -0.149 1.00 0.00 H HETATM 105 H42 UNL 1 1.390 -4.228 -0.795 1.00 0.00 H HETATM 106 H43 UNL 1 1.571 -5.980 -0.434 1.00 0.00 H HETATM 107 H44 UNL 1 0.459 -5.685 1.738 1.00 0.00 H HETATM 108 H45 UNL 1 0.179 -3.958 1.393 1.00 0.00 H HETATM 109 H46 UNL 1 2.038 -4.239 2.929 1.00 0.00 H HETATM 110 H47 UNL 1 2.906 -5.295 1.790 1.00 0.00 H HETATM 111 H48 UNL 1 2.912 -3.382 0.132 1.00 0.00 H HETATM 112 H49 UNL 1 2.024 -2.377 1.312 1.00 0.00 H HETATM 113 H50 UNL 1 4.824 -3.535 1.630 1.00 0.00 H HETATM 114 H51 UNL 1 3.943 -2.570 2.903 1.00 0.00 H HETATM 115 H52 UNL 1 3.644 -0.762 1.022 1.00 0.00 H HETATM 116 H53 UNL 1 4.654 -1.805 0.012 1.00 0.00 H HETATM 117 H54 UNL 1 6.032 -0.046 0.809 1.00 0.00 H HETATM 118 H55 UNL 1 6.576 -1.611 1.425 1.00 0.00 H HETATM 119 H56 UNL 1 5.729 -1.328 3.567 1.00 0.00 H HETATM 120 H57 UNL 1 6.725 0.146 3.121 1.00 0.00 H HETATM 121 H58 UNL 1 4.740 0.789 4.368 1.00 0.00 H HETATM 122 H59 UNL 1 3.711 -0.062 3.213 1.00 0.00 H HETATM 123 H60 UNL 1 5.514 2.389 2.747 1.00 0.00 H HETATM 124 H61 UNL 1 4.642 1.545 1.445 1.00 0.00 H HETATM 125 H62 UNL 1 2.488 1.929 2.879 1.00 0.00 H HETATM 126 H63 UNL 1 3.522 2.806 4.013 1.00 0.00 H HETATM 127 H64 UNL 1 4.069 4.528 2.379 1.00 0.00 H HETATM 128 H65 UNL 1 2.327 4.377 2.666 1.00 0.00 H HETATM 129 H66 UNL 1 3.927 3.275 0.282 1.00 0.00 H HETATM 130 H67 UNL 1 2.203 2.953 0.503 1.00 0.00 H HETATM 131 H68 UNL 1 2.719 5.819 -3.185 1.00 0.00 H HETATM 132 H69 UNL 1 2.829 6.914 -1.815 1.00 0.00 H HETATM 133 H70 UNL 1 0.930 7.344 -3.110 1.00 0.00 H HETATM 134 H71 UNL 1 0.443 7.015 -1.452 1.00 0.00 H HETATM 135 H72 UNL 1 0.012 5.154 -3.859 1.00 0.00 H HETATM 136 H73 UNL 1 -1.119 6.224 -3.034 1.00 0.00 H HETATM 137 H74 UNL 1 -1.509 3.992 -2.438 1.00 0.00 H HETATM 138 H75 UNL 1 0.046 3.767 -1.607 1.00 0.00 H HETATM 139 H76 UNL 1 -2.150 5.851 -1.001 1.00 0.00 H HETATM 140 H77 UNL 1 -0.565 5.822 -0.167 1.00 0.00 H HETATM 141 H78 UNL 1 -2.533 3.543 -0.149 1.00 0.00 H HETATM 142 H79 UNL 1 -0.944 3.660 0.779 1.00 0.00 H HETATM 143 H80 UNL 1 -3.415 5.475 0.991 1.00 0.00 H HETATM 144 H81 UNL 1 -1.830 5.736 1.884 1.00 0.00 H HETATM 145 H82 UNL 1 -2.120 3.592 3.096 1.00 0.00 H HETATM 146 H83 UNL 1 -3.603 4.614 3.270 1.00 0.00 H HETATM 147 H84 UNL 1 -4.791 3.387 1.545 1.00 0.00 H HETATM 148 H85 UNL 1 -3.347 2.328 1.249 1.00 0.00 H HETATM 149 H86 UNL 1 -3.506 1.863 3.767 1.00 0.00 H HETATM 150 H87 UNL 1 -5.038 2.717 3.758 1.00 0.00 H HETATM 151 H88 UNL 1 -4.622 0.540 1.634 1.00 0.00 H HETATM 152 H89 UNL 1 -6.055 1.435 2.087 1.00 0.00 H HETATM 153 H90 UNL 1 -6.564 0.377 3.985 1.00 0.00 H HETATM 154 H91 UNL 1 -6.226 -0.841 2.753 1.00 0.00 H HETATM 155 H92 UNL 1 -4.507 -0.356 5.260 1.00 0.00 H HETATM 156 H93 UNL 1 -5.651 -1.628 4.879 1.00 0.00 H HETATM 157 H94 UNL 1 -3.382 -2.347 4.749 1.00 0.00 H HETATM 158 H95 UNL 1 -4.125 -2.606 3.179 1.00 0.00 H HETATM 159 H96 UNL 1 -1.884 -1.918 2.969 1.00 0.00 H HETATM 160 H97 UNL 1 -2.765 -0.526 2.352 1.00 0.00 H HETATM 161 H98 UNL 1 -2.637 0.166 4.996 1.00 0.00 H HETATM 162 H99 UNL 1 -1.392 -1.063 4.976 1.00 0.00 H HETATM 163 HA0 UNL 1 -0.134 -0.134 3.221 1.00 0.00 H HETATM 164 HA1 UNL 1 -1.338 1.067 2.820 1.00 0.00 H HETATM 165 HA2 UNL 1 -0.925 2.372 4.829 1.00 0.00 H HETATM 166 HA3 UNL 1 0.363 2.284 3.668 1.00 0.00 H HETATM 167 HA4 UNL 1 1.783 0.954 5.331 1.00 0.00 H HETATM 168 HA5 UNL 1 1.126 2.453 5.915 1.00 0.00 H HETATM 169 HA6 UNL 1 -0.114 -0.237 6.669 1.00 0.00 H HETATM 170 HA7 UNL 1 -0.670 1.358 7.235 1.00 0.00 H HETATM 171 HA8 UNL 1 2.030 0.054 7.741 1.00 0.00 H HETATM 172 HA9 UNL 1 0.642 0.317 8.819 1.00 0.00 H HETATM 173 HB0 UNL 1 0.864 2.622 8.822 1.00 0.00 H HETATM 174 HB1 UNL 1 2.204 2.657 7.561 1.00 0.00 H HETATM 175 HB2 UNL 1 2.166 1.324 10.315 1.00 0.00 H HETATM 176 HB3 UNL 1 3.009 2.843 9.967 1.00 0.00 H HETATM 177 HB4 UNL 1 4.515 1.692 8.430 1.00 0.00 H HETATM 178 HB5 UNL 1 3.739 0.080 8.754 1.00 0.00 H HETATM 179 HB6 UNL 1 5.222 1.956 10.700 1.00 0.00 H HETATM 180 HB7 UNL 1 5.741 0.353 10.128 1.00 0.00 H HETATM 181 HB8 UNL 1 3.319 0.890 11.905 1.00 0.00 H HETATM 182 HB9 UNL 1 4.905 0.180 12.378 1.00 0.00 H HETATM 183 HC0 UNL 1 4.089 -1.870 11.924 1.00 0.00 H HETATM 184 HC1 UNL 1 2.601 -1.152 11.234 1.00 0.00 H HETATM 185 HC2 UNL 1 4.019 -1.325 10.172 1.00 0.00 H CONECT 1 2 64 65 66 CONECT 2 3 67 68 CONECT 3 4 69 70 CONECT 4 5 71 72 CONECT 5 6 73 74 CONECT 6 7 75 76 CONECT 7 8 77 78 CONECT 8 9 79 80 CONECT 9 10 81 82 CONECT 10 11 83 84 CONECT 11 12 85 86 CONECT 12 13 87 88 CONECT 13 14 89 90 CONECT 14 15 91 92 CONECT 15 16 93 94 CONECT 16 17 95 96 CONECT 17 18 97 98 CONECT 18 19 99 100 CONECT 19 20 101 102 CONECT 20 21 103 104 CONECT 21 22 105 106 CONECT 22 23 107 108 CONECT 23 24 109 110 CONECT 24 25 111 112 CONECT 25 26 113 114 CONECT 26 27 115 116 CONECT 27 28 117 118 CONECT 28 29 119 120 CONECT 29 30 121 122 CONECT 30 31 123 124 CONECT 31 32 125 126 CONECT 32 33 127 128 CONECT 33 34 129 130 CONECT 34 35 CONECT 35 36 36 37 CONECT 37 38 131 132 CONECT 38 39 133 134 CONECT 39 40 135 136 CONECT 40 41 137 138 CONECT 41 42 139 140 CONECT 42 43 141 142 CONECT 43 44 143 144 CONECT 44 45 145 146 CONECT 45 46 147 148 CONECT 46 47 149 150 CONECT 47 48 151 152 CONECT 48 49 153 154 CONECT 49 50 155 156 CONECT 50 51 157 158 CONECT 51 52 159 160 CONECT 52 53 161 162 CONECT 53 54 163 164 CONECT 54 55 165 166 CONECT 55 56 167 168 CONECT 56 57 169 170 CONECT 57 58 171 172 CONECT 58 59 173 174 CONECT 59 60 175 176 CONECT 60 61 177 178 CONECT 61 62 179 180 CONECT 62 63 181 182 CONECT 63 183 184 185 END SMILES for HMDB0041479 (Tritriacontyl octacosanoate)CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCC INCHI for HMDB0041479 (Tritriacontyl octacosanoate)InChI=1S/C61H122O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-30-31-32-33-34-36-38-40-42-44-46-48-50-52-54-56-58-60-63-61(62)59-57-55-53-51-49-47-45-43-41-39-37-35-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-60H2,1-2H3 3D Structure for HMDB0041479 (Tritriacontyl octacosanoate) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C61H122O2 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 887.6202 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 886.944483148 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | tritriacontyl octacosanoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | tritriacontyl octacosanoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 105419-00-9 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C61H122O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-30-31-32-33-34-36-38-40-42-44-46-48-50-52-54-56-58-60-63-61(62)59-57-55-53-51-49-47-45-43-41-39-37-35-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-60H2,1-2H3 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | INEGPTBZICBFNP-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as wax monoesters. These are waxes bearing an ester group at exactly one position. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Fatty Acyls | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Fatty acid esters | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Wax monoesters | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic acyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesUnderivatized
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB021442 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | C00057751 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 30777575 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 129685374 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|