Showing metabocard for 6a, 3'-p-Dihydroxypaclitaxel (HMDB0060795)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2013-07-04 19:00:02 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-14 15:46:11 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0060795 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 6a, 3'-p-Dihydroxypaclitaxel | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 6a, 3'-p-Dihydroxypaclitaxel is a metabolite of paclitaxel. Paclitaxel is a mitotic inhibitor used in cancer chemotherapy. It was discovered in a U.S. National Cancer Institute program at the Research Triangle Institute in 1967 when Monroe E. Wall and Mansukh C. Wani isolated it from the bark of the Pacific yew tree, Taxus brevifolia and named it taxol. When it was developed commercially by Bristol-Myers Squibb (BMS) the generic name was changed to paclitaxel and the BMS compound is sold under the trademark Taxol. (Wikipedia) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)Mrv0541 07041311592D 64 70 0 0 0 0 999 V2000 2.3240 1.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5088 0.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2975 0.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9049 0.3174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0897 -0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4728 -0.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5791 -0.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3271 0.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1142 -1.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9262 -1.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6462 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6817 -2.1282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4856 -1.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4412 -2.3782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7055 -2.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0143 -2.3012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6611 -3.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3523 -4.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3078 -4.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5722 -5.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8810 -4.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9254 -3.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3539 -1.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7825 -2.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8012 -2.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6260 -2.9055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6073 -2.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0035 -1.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8283 -1.3384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5749 -0.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9711 0.0715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7501 -0.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8170 0.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0381 -0.5376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1363 0.2815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9907 -2.3310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7953 -3.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3917 -3.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0034 -3.3641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6583 -0.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8283 0.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2104 0.5856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6993 -1.2840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9873 -2.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4617 -2.6930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8008 -2.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3263 -1.5583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0887 -2.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9023 -3.1046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1902 -3.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6647 -4.5136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0037 -4.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2917 -4.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1052 -4.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6308 -4.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3428 -3.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5293 -3.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5632 -3.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7497 -3.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2241 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5121 -4.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0135 -5.5111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3256 -5.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8511 -4.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 17 18 2 0 0 0 0 18 19 1 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 17 22 1 0 0 0 0 13 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 24 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 28 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 23 32 1 0 0 0 0 32 33 1 0 0 0 0 32 34 1 0 0 0 0 5 34 1 0 0 0 0 34 35 2 0 0 0 0 24 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 39 2 0 0 0 0 11 40 1 0 0 0 0 6 40 1 0 0 0 0 40 41 1 0 0 0 0 40 42 1 0 0 0 0 9 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 44 46 1 0 0 0 0 46 47 1 0 0 0 0 46 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 2 0 0 0 0 50 52 1 0 0 0 0 52 53 2 0 0 0 0 53 54 1 0 0 0 0 54 55 2 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 52 57 1 0 0 0 0 48 58 1 0 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 60 61 2 0 0 0 0 61 62 1 0 0 0 0 61 63 1 0 0 0 0 63 64 2 0 0 0 0 58 64 1 0 0 0 0 M END 3D MOL for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)HMDB0060795 RDKit 3D 6a, 3'-p-Dihydroxypaclitaxel 111117 0 0 0 0 0 0 0 0999 V2000 -2.9811 -6.7876 -1.4304 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3052 -5.5520 -1.9076 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5791 -5.5921 -2.9261 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5077 -4.3737 -1.1914 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8638 -3.1562 -1.6363 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9248 -2.1700 -1.9398 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1365 -2.1693 -3.1566 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7969 -1.2069 -1.2795 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1784 -1.9238 -1.2754 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0128 0.0117 -2.1326 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7895 0.3255 -2.7251 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6349 1.1659 -1.4530 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8006 2.2978 -1.6790 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0473 1.0300 -0.0564 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3658 1.8403 0.8860 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3506 0.8093 1.8272 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5947 -0.1491 0.7418 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5821 -1.0994 1.0423 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7442 -1.0226 1.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5975 -2.2483 1.8653 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0895 0.0657 2.1377 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4197 -0.8895 0.1529 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0597 -0.4196 0.3995 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8587 0.8932 0.8161 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2010 1.8860 0.1805 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6809 1.6571 -0.9326 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0851 3.2086 0.7560 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6421 3.5656 1.9602 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5422 4.8191 2.5219 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8502 5.8025 1.8645 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2754 5.4786 0.6464 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3783 4.2228 0.0912 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1745 -1.2481 1.3009 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4885 -1.0824 2.6213 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2784 -0.8269 1.1073 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9791 -1.4661 -0.0368 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6802 -0.5420 -0.8353 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9777 -0.6054 -1.2547 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6398 -1.6162 -0.9127 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5866 0.5016 -2.1002 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7529 1.5981 -1.8984 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9518 0.7288 -1.6128 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 0.9180 -0.1558 N 0 0 0 0 0 0 0 0 0 0 0 0 5.7773 0.1508 0.6814 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5277 -0.7043 0.0884 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8834 0.2275 2.1165 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9657 -0.3339 2.7604 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0748 -0.2686 4.1060 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1317 0.3502 4.9150 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0487 0.9077 4.2323 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9206 0.8523 2.8721 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6317 1.9000 -2.2307 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3471 3.1663 -1.7095 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9879 4.2250 -2.3072 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8677 4.1084 -3.3586 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4836 5.2358 -3.9164 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1133 2.8281 -3.8357 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4848 1.7464 -3.2562 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0550 -2.2088 -0.9951 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3833 -2.3192 -2.4288 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0411 -2.7377 -0.4986 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1571 -2.7174 0.9891 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0491 -3.2090 1.4876 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1069 -3.5061 1.5362 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3283 -7.6647 -1.7238 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9442 -6.8921 -1.9780 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0982 -6.8253 -0.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3012 -3.4611 -2.5372 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2798 -2.4250 -2.2880 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2243 -2.7296 -0.5532 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9399 -1.1503 -1.2458 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6255 -0.3597 -3.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8586 0.5518 -3.6661 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5297 1.4540 -2.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9218 2.8859 -0.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1384 1.2945 0.0808 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1493 1.0326 2.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4375 0.7490 2.4480 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6595 -2.4985 2.9448 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1221 -3.0938 1.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6163 -2.0867 1.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4533 -1.9345 0.6060 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5410 -0.4585 -0.6154 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1942 2.8176 2.5054 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0153 5.0381 3.4918 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7656 6.7884 2.2947 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2628 6.2863 0.1639 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0795 4.0025 -0.8556 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6927 -1.2562 3.2139 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8703 -1.1446 2.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4324 0.2506 1.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7592 -2.2255 0.2761 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5160 0.1151 -3.1417 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8799 1.4186 -2.3572 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6369 -0.1350 -1.7960 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3023 1.6227 0.2614 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7505 -0.8380 2.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9296 -0.7113 4.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2440 0.3888 5.9880 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2825 1.4016 4.8278 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0370 1.3142 2.3740 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6466 3.2865 -0.8677 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7884 5.2281 -1.9222 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3572 5.5212 -3.5266 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8081 2.7737 -4.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7392 0.7624 -3.6978 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3512 -1.8288 -3.1038 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6851 -3.3409 -2.7543 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3261 -1.7155 -2.6268 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1199 -3.0101 2.4543 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9389 -3.5710 2.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 2 0 17 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 23 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 46 47 2 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 42 52 1 0 52 53 2 0 53 54 1 0 54 55 2 0 55 56 1 0 55 57 1 0 57 58 2 0 36 59 1 0 59 60 1 0 59 61 2 0 61 62 1 0 62 63 1 0 62 64 1 0 61 5 1 0 22 8 1 0 32 27 1 0 62 33 1 0 17 14 1 0 51 46 1 0 58 52 1 0 1 65 1 0 1 66 1 0 1 67 1 0 5 68 1 0 9 69 1 0 9 70 1 0 9 71 1 0 10 72 1 0 11 73 1 0 12 74 1 0 13 75 1 0 14 76 1 0 16 77 1 0 16 78 1 0 20 79 1 0 20 80 1 0 20 81 1 0 22 82 1 0 23 83 1 0 28 84 1 0 29 85 1 0 30 86 1 0 31 87 1 0 32 88 1 0 34 89 1 0 35 90 1 0 35 91 1 0 36 92 1 0 40 93 1 0 41 94 1 0 42 95 1 0 43 96 1 0 47 97 1 0 48 98 1 0 49 99 1 0 50100 1 0 51101 1 0 53102 1 0 54103 1 0 56104 1 0 57105 1 0 58106 1 0 60107 1 0 60108 1 0 60109 1 0 63110 1 0 64111 1 0 M END 3D SDF for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)Mrv0541 07041311592D 64 70 0 0 0 0 999 V2000 2.3240 1.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5088 0.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2975 0.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9049 0.3174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0897 -0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4728 -0.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5791 -0.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3271 0.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1142 -1.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9262 -1.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6462 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6817 -2.1282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4856 -1.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4412 -2.3782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7055 -2.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0143 -2.3012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6611 -3.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3523 -4.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3078 -4.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5722 -5.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8810 -4.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9254 -3.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3539 -1.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7825 -2.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8012 -2.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6260 -2.9055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6073 -2.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0035 -1.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8283 -1.3384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5749 -0.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9711 0.0715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7501 -0.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8170 0.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0381 -0.5376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1363 0.2815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9907 -2.3310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7953 -3.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3917 -3.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0034 -3.3641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6583 -0.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8283 0.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2104 0.5856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6993 -1.2840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9873 -2.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4617 -2.6930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8008 -2.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3263 -1.5583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0887 -2.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9023 -3.1046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1902 -3.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6647 -4.5136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0037 -4.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2917 -4.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1052 -4.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6308 -4.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3428 -3.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5293 -3.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5632 -3.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7497 -3.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2241 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5121 -4.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0135 -5.5111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3256 -5.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8511 -4.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 17 18 2 0 0 0 0 18 19 1 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 17 22 1 0 0 0 0 13 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 24 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 28 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 23 32 1 0 0 0 0 32 33 1 0 0 0 0 32 34 1 0 0 0 0 5 34 1 0 0 0 0 34 35 2 0 0 0 0 24 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 39 2 0 0 0 0 11 40 1 0 0 0 0 6 40 1 0 0 0 0 40 41 1 0 0 0 0 40 42 1 0 0 0 0 9 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 44 46 1 0 0 0 0 46 47 1 0 0 0 0 46 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 2 0 0 0 0 50 52 1 0 0 0 0 52 53 2 0 0 0 0 53 54 1 0 0 0 0 54 55 2 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 52 57 1 0 0 0 0 48 58 1 0 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 60 61 2 0 0 0 0 61 62 1 0 0 0 0 61 63 1 0 0 0 0 63 64 2 0 0 0 0 58 64 1 0 0 0 0 M END > <DATABASE_ID> HMDB0060795 > <DATABASE_NAME> hmdb > <SMILES> CC(=O)OC1C2=C(C)C(CC(O)(C(OC(=O)C3=CC=CC=C3)C3C4(COC4C(O)C(O)C3(C)C1=O)OC(C)=O)C2(O)O)OC(=O)C(O)C(NC(=O)C1=CC=CC=C1)C1=CC=C(O)C=C1 > <INCHI_IDENTIFIER> InChI=1S/C45H47NO18/c1-21-28(62-41(56)31(50)30(24-15-17-27(49)18-16-24)46-39(54)25-11-7-5-8-12-25)19-44(57)38(63-40(55)26-13-9-6-10-14-26)34-42(4,36(53)33(61-22(2)47)29(21)45(44,58)59)35(52)32(51)37-43(34,20-60-37)64-23(3)48/h5-18,28,30-35,37-38,49-52,57-59H,19-20H2,1-4H3,(H,46,54) > <INCHI_KEY> VCMRTKHRFJRAJE-UHFFFAOYSA-N > <FORMULA> C45H47NO18 > <MOLECULAR_WEIGHT> 889.8506 > <EXACT_MASS> 889.279313705 > <JCHEM_ACCEPTOR_COUNT> 14 > <JCHEM_AVERAGE_POLARIZABILITY> 86.0535897818142 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 8 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 4,12-bis(acetyloxy)-1,8,9,17,17-pentahydroxy-15-{[2-hydroxy-3-(4-hydroxyphenyl)-3-(phenylformamido)propanoyl]oxy}-10,14-dimethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹⁰.0⁴,⁷]heptadec-13-en-2-yl benzoate > <ALOGPS_LOGP> 1.56 > <JCHEM_LOGP> 0.6933261523333325 > <ALOGPS_LOGS> -3.88 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 7 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 9.452032312149214 > <JCHEM_PKA_STRONGEST_ACIDIC> 5.28485203619421 > <JCHEM_PKA_STRONGEST_BASIC> -3.6317325854019424 > <JCHEM_POLAR_SURFACE_AREA> 302.21 > <JCHEM_REFRACTIVITY> 215.1776 > <JCHEM_ROTATABLE_BOND_COUNT> 14 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.18e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 4,12-bis(acetyloxy)-1,8,9,17,17-pentahydroxy-15-{[2-hydroxy-3-(4-hydroxyphenyl)-3-(phenylformamido)propanoyl]oxy}-10,14-dimethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹⁰.0⁴,⁷]heptadec-13-en-2-yl benzoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)HMDB0060795 RDKit 3D 6a, 3'-p-Dihydroxypaclitaxel 111117 0 0 0 0 0 0 0 0999 V2000 -2.9811 -6.7876 -1.4304 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3052 -5.5520 -1.9076 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5791 -5.5921 -2.9261 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5077 -4.3737 -1.1914 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8638 -3.1562 -1.6363 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9248 -2.1700 -1.9398 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1365 -2.1693 -3.1566 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7969 -1.2069 -1.2795 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1784 -1.9238 -1.2754 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0128 0.0117 -2.1326 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7895 0.3255 -2.7251 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6349 1.1659 -1.4530 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8006 2.2978 -1.6790 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0473 1.0300 -0.0564 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3658 1.8403 0.8860 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3506 0.8093 1.8272 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5947 -0.1491 0.7418 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5821 -1.0994 1.0423 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7442 -1.0226 1.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5975 -2.2483 1.8653 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0895 0.0657 2.1377 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4197 -0.8895 0.1529 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0597 -0.4196 0.3995 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8587 0.8932 0.8161 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2010 1.8860 0.1805 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6809 1.6571 -0.9326 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0851 3.2086 0.7560 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6421 3.5656 1.9602 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5422 4.8191 2.5219 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8502 5.8025 1.8645 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2754 5.4786 0.6464 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3783 4.2228 0.0912 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1745 -1.2481 1.3009 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4885 -1.0824 2.6213 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2784 -0.8269 1.1073 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9791 -1.4661 -0.0368 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6802 -0.5420 -0.8353 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9777 -0.6054 -1.2547 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6398 -1.6162 -0.9127 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5866 0.5016 -2.1002 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7529 1.5981 -1.8984 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9518 0.7288 -1.6128 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9375 0.9180 -0.1558 N 0 0 0 0 0 0 0 0 0 0 0 0 5.7773 0.1508 0.6814 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5277 -0.7043 0.0884 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8834 0.2275 2.1165 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9657 -0.3339 2.7604 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0748 -0.2686 4.1060 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1317 0.3502 4.9150 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0487 0.9077 4.2323 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9206 0.8523 2.8721 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6317 1.9000 -2.2307 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3471 3.1663 -1.7095 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9879 4.2250 -2.3072 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8677 4.1084 -3.3586 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4836 5.2358 -3.9164 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1133 2.8281 -3.8357 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4848 1.7464 -3.2562 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0550 -2.2088 -0.9951 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3833 -2.3192 -2.4288 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0411 -2.7377 -0.4986 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1571 -2.7174 0.9891 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0491 -3.2090 1.4876 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1069 -3.5061 1.5362 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3283 -7.6647 -1.7238 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9442 -6.8921 -1.9780 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0982 -6.8253 -0.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3012 -3.4611 -2.5372 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2798 -2.4250 -2.2880 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2243 -2.7296 -0.5532 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9399 -1.1503 -1.2458 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6255 -0.3597 -3.0143 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8586 0.5518 -3.6661 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5297 1.4540 -2.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9218 2.8859 -0.8723 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1384 1.2945 0.0808 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1493 1.0326 2.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4375 0.7490 2.4480 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6595 -2.4985 2.9448 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1221 -3.0938 1.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6163 -2.0867 1.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4533 -1.9345 0.6060 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5410 -0.4585 -0.6154 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1942 2.8176 2.5054 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0153 5.0381 3.4918 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7656 6.7884 2.2947 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2628 6.2863 0.1639 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0795 4.0025 -0.8556 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6927 -1.2562 3.2139 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8703 -1.1446 2.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4324 0.2506 1.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7592 -2.2255 0.2761 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5160 0.1151 -3.1417 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8799 1.4186 -2.3572 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6369 -0.1350 -1.7960 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3023 1.6227 0.2614 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7505 -0.8380 2.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9296 -0.7113 4.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2440 0.3888 5.9880 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2825 1.4016 4.8278 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0370 1.3142 2.3740 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6466 3.2865 -0.8677 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7884 5.2281 -1.9222 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3572 5.5212 -3.5266 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8081 2.7737 -4.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7392 0.7624 -3.6978 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3512 -1.8288 -3.1038 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6851 -3.3409 -2.7543 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3261 -1.7155 -2.6268 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1199 -3.0101 2.4543 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9389 -3.5710 2.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 2 0 17 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 23 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 46 47 2 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 42 52 1 0 52 53 2 0 53 54 1 0 54 55 2 0 55 56 1 0 55 57 1 0 57 58 2 0 36 59 1 0 59 60 1 0 59 61 2 0 61 62 1 0 62 63 1 0 62 64 1 0 61 5 1 0 22 8 1 0 32 27 1 0 62 33 1 0 17 14 1 0 51 46 1 0 58 52 1 0 1 65 1 0 1 66 1 0 1 67 1 0 5 68 1 0 9 69 1 0 9 70 1 0 9 71 1 0 10 72 1 0 11 73 1 0 12 74 1 0 13 75 1 0 14 76 1 0 16 77 1 0 16 78 1 0 20 79 1 0 20 80 1 0 20 81 1 0 22 82 1 0 23 83 1 0 28 84 1 0 29 85 1 0 30 86 1 0 31 87 1 0 32 88 1 0 34 89 1 0 35 90 1 0 35 91 1 0 36 92 1 0 40 93 1 0 41 94 1 0 42 95 1 0 43 96 1 0 47 97 1 0 48 98 1 0 49 99 1 0 50100 1 0 51101 1 0 53102 1 0 54103 1 0 56104 1 0 57105 1 0 58106 1 0 60107 1 0 60108 1 0 60109 1 0 63110 1 0 64111 1 0 M END PDB for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)HEADER PROTEIN 04-JUL-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 04-JUL-13 0 HETATM 1 C UNK 0 4.338 3.143 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 4.683 1.642 0.000 0.00 0.00 C+0 HETATM 3 O UNK 0 6.155 1.190 0.000 0.00 0.00 O+0 HETATM 4 O UNK 0 3.556 0.592 0.000 0.00 0.00 O+0 HETATM 5 C UNK 0 3.901 -0.908 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 2.749 -1.546 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 1.081 -1.188 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 0.611 0.279 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 0.213 -2.141 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 1.729 -2.965 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 3.073 -2.434 0.000 0.00 0.00 C+0 HETATM 12 O UNK 0 3.139 -3.973 0.000 0.00 0.00 O+0 HETATM 13 C UNK 0 4.640 -2.902 0.000 0.00 0.00 C+0 HETATM 14 O UNK 0 4.557 -4.439 0.000 0.00 0.00 O+0 HETATM 15 C UNK 0 3.184 -5.136 0.000 0.00 0.00 C+0 HETATM 16 O UNK 0 1.893 -4.296 0.000 0.00 0.00 O+0 HETATM 17 C UNK 0 3.101 -6.674 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 4.391 -7.515 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 4.308 -9.053 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 2.935 -9.750 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 1.645 -8.909 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 1.727 -7.371 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 6.261 -2.603 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 7.061 -3.919 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 7.096 -5.459 0.000 0.00 0.00 C+0 HETATM 26 O UNK 0 8.635 -5.424 0.000 0.00 0.00 O+0 HETATM 27 C UNK 0 8.600 -3.884 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 9.340 -2.533 0.000 0.00 0.00 C+0 HETATM 29 O UNK 0 10.879 -2.498 0.000 0.00 0.00 O+0 HETATM 30 C UNK 0 8.540 -1.217 0.000 0.00 0.00 C+0 HETATM 31 O UNK 0 9.279 0.133 0.000 0.00 0.00 O+0 HETATM 32 C UNK 0 7.000 -1.252 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 7.125 0.283 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 5.671 -1.004 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 5.854 0.525 0.000 0.00 0.00 O+0 HETATM 36 O UNK 0 5.583 -4.351 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 5.218 -5.847 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 6.331 -6.911 0.000 0.00 0.00 C+0 HETATM 39 O UNK 0 3.740 -6.280 0.000 0.00 0.00 O+0 HETATM 40 C UNK 0 3.095 -0.200 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 3.413 1.307 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 2.259 1.093 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 -1.305 -2.397 0.000 0.00 0.00 O+0 HETATM 44 C UNK 0 -1.843 -3.840 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 -0.862 -5.027 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -3.361 -4.096 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 -4.342 -2.909 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 -3.899 -5.539 0.000 0.00 0.00 C+0 HETATM 49 N UNK 0 -5.418 -5.795 0.000 0.00 0.00 N+0 HETATM 50 C UNK 0 -5.955 -7.238 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 -4.974 -8.425 0.000 0.00 0.00 O+0 HETATM 52 C UNK 0 -7.474 -7.494 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 -8.011 -8.938 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 -9.530 -9.194 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -10.511 -8.007 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 -9.973 -6.563 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 -8.455 -6.307 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -2.918 -6.726 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -1.399 -6.470 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -0.418 -7.657 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -0.956 -9.100 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 0.025 -10.287 0.000 0.00 0.00 O+0 HETATM 63 C UNK 0 -2.474 -9.356 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 -3.455 -8.169 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 CONECT 5 4 6 34 CONECT 6 5 7 40 CONECT 7 6 8 9 CONECT 8 7 CONECT 9 7 10 43 CONECT 10 9 11 CONECT 11 10 12 13 40 CONECT 12 11 CONECT 13 11 14 23 CONECT 14 13 15 CONECT 15 14 16 17 CONECT 16 15 CONECT 17 15 18 22 CONECT 18 17 19 CONECT 19 18 20 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 21 17 CONECT 23 13 24 32 CONECT 24 23 25 27 36 CONECT 25 24 26 CONECT 26 25 27 CONECT 27 26 24 28 CONECT 28 27 29 30 CONECT 29 28 CONECT 30 28 31 32 CONECT 31 30 CONECT 32 30 23 33 34 CONECT 33 32 CONECT 34 32 5 35 CONECT 35 34 CONECT 36 24 37 CONECT 37 36 38 39 CONECT 38 37 CONECT 39 37 CONECT 40 11 6 41 42 CONECT 41 40 CONECT 42 40 CONECT 43 9 44 CONECT 44 43 45 46 CONECT 45 44 CONECT 46 44 47 48 CONECT 47 46 CONECT 48 46 49 58 CONECT 49 48 50 CONECT 50 49 51 52 CONECT 51 50 CONECT 52 50 53 57 CONECT 53 52 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 52 CONECT 58 48 59 64 CONECT 59 58 60 CONECT 60 59 61 CONECT 61 60 62 63 CONECT 62 61 CONECT 63 61 64 CONECT 64 63 58 MASTER 0 0 0 0 0 0 0 0 64 0 140 0 END 3D PDB for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)COMPND HMDB0060795 HETATM 1 C1 UNL 1 -2.981 -6.788 -1.430 1.00 0.00 C HETATM 2 C2 UNL 1 -2.305 -5.552 -1.908 1.00 0.00 C HETATM 3 O1 UNL 1 -1.579 -5.592 -2.926 1.00 0.00 O HETATM 4 O2 UNL 1 -2.508 -4.374 -1.191 1.00 0.00 O HETATM 5 C3 UNL 1 -1.864 -3.156 -1.636 1.00 0.00 C HETATM 6 C4 UNL 1 -2.925 -2.170 -1.940 1.00 0.00 C HETATM 7 O3 UNL 1 -3.136 -2.169 -3.157 1.00 0.00 O HETATM 8 C5 UNL 1 -3.797 -1.207 -1.279 1.00 0.00 C HETATM 9 C6 UNL 1 -5.178 -1.924 -1.275 1.00 0.00 C HETATM 10 C7 UNL 1 -4.013 0.012 -2.133 1.00 0.00 C HETATM 11 O4 UNL 1 -2.790 0.326 -2.725 1.00 0.00 O HETATM 12 C8 UNL 1 -4.635 1.166 -1.453 1.00 0.00 C HETATM 13 O5 UNL 1 -3.801 2.298 -1.679 1.00 0.00 O HETATM 14 C9 UNL 1 -5.047 1.030 -0.056 1.00 0.00 C HETATM 15 O6 UNL 1 -4.366 1.840 0.886 1.00 0.00 O HETATM 16 C10 UNL 1 -4.351 0.809 1.827 1.00 0.00 C HETATM 17 C11 UNL 1 -4.595 -0.149 0.742 1.00 0.00 C HETATM 18 O7 UNL 1 -5.582 -1.099 1.042 1.00 0.00 O HETATM 19 C12 UNL 1 -6.744 -1.023 1.692 1.00 0.00 C HETATM 20 C13 UNL 1 -7.598 -2.248 1.865 1.00 0.00 C HETATM 21 O8 UNL 1 -7.089 0.066 2.138 1.00 0.00 O HETATM 22 C14 UNL 1 -3.420 -0.890 0.153 1.00 0.00 C HETATM 23 C15 UNL 1 -2.060 -0.420 0.400 1.00 0.00 C HETATM 24 O9 UNL 1 -1.859 0.893 0.816 1.00 0.00 O HETATM 25 C16 UNL 1 -1.201 1.886 0.180 1.00 0.00 C HETATM 26 O10 UNL 1 -0.681 1.657 -0.933 1.00 0.00 O HETATM 27 C17 UNL 1 -1.085 3.209 0.756 1.00 0.00 C HETATM 28 C18 UNL 1 -1.642 3.566 1.960 1.00 0.00 C HETATM 29 C19 UNL 1 -1.542 4.819 2.522 1.00 0.00 C HETATM 30 C20 UNL 1 -0.850 5.803 1.864 1.00 0.00 C HETATM 31 C21 UNL 1 -0.275 5.479 0.646 1.00 0.00 C HETATM 32 C22 UNL 1 -0.378 4.223 0.091 1.00 0.00 C HETATM 33 C23 UNL 1 -1.174 -1.248 1.301 1.00 0.00 C HETATM 34 O11 UNL 1 -1.488 -1.082 2.621 1.00 0.00 O HETATM 35 C24 UNL 1 0.278 -0.827 1.107 1.00 0.00 C HETATM 36 C25 UNL 1 0.979 -1.466 -0.037 1.00 0.00 C HETATM 37 O12 UNL 1 1.680 -0.542 -0.835 1.00 0.00 O HETATM 38 C26 UNL 1 2.978 -0.605 -1.255 1.00 0.00 C HETATM 39 O13 UNL 1 3.640 -1.616 -0.913 1.00 0.00 O HETATM 40 C27 UNL 1 3.587 0.502 -2.100 1.00 0.00 C HETATM 41 O14 UNL 1 2.753 1.598 -1.898 1.00 0.00 O HETATM 42 C28 UNL 1 4.952 0.729 -1.613 1.00 0.00 C HETATM 43 N1 UNL 1 4.938 0.918 -0.156 1.00 0.00 N HETATM 44 C29 UNL 1 5.777 0.151 0.681 1.00 0.00 C HETATM 45 O15 UNL 1 6.528 -0.704 0.088 1.00 0.00 O HETATM 46 C30 UNL 1 5.883 0.227 2.116 1.00 0.00 C HETATM 47 C31 UNL 1 6.966 -0.334 2.760 1.00 0.00 C HETATM 48 C32 UNL 1 7.075 -0.269 4.106 1.00 0.00 C HETATM 49 C33 UNL 1 6.132 0.350 4.915 1.00 0.00 C HETATM 50 C34 UNL 1 5.049 0.908 4.232 1.00 0.00 C HETATM 51 C35 UNL 1 4.921 0.852 2.872 1.00 0.00 C HETATM 52 C36 UNL 1 5.632 1.900 -2.231 1.00 0.00 C HETATM 53 C37 UNL 1 5.347 3.166 -1.710 1.00 0.00 C HETATM 54 C38 UNL 1 5.988 4.225 -2.307 1.00 0.00 C HETATM 55 C39 UNL 1 6.868 4.108 -3.359 1.00 0.00 C HETATM 56 O16 UNL 1 7.484 5.236 -3.916 1.00 0.00 O HETATM 57 C40 UNL 1 7.113 2.828 -3.836 1.00 0.00 C HETATM 58 C41 UNL 1 6.485 1.746 -3.256 1.00 0.00 C HETATM 59 C42 UNL 1 0.055 -2.209 -0.995 1.00 0.00 C HETATM 60 C43 UNL 1 0.383 -2.319 -2.429 1.00 0.00 C HETATM 61 C44 UNL 1 -1.041 -2.738 -0.499 1.00 0.00 C HETATM 62 C45 UNL 1 -1.157 -2.717 0.989 1.00 0.00 C HETATM 63 O17 UNL 1 0.049 -3.209 1.488 1.00 0.00 O HETATM 64 O18 UNL 1 -2.107 -3.506 1.536 1.00 0.00 O HETATM 65 H1 UNL 1 -2.328 -7.665 -1.724 1.00 0.00 H HETATM 66 H2 UNL 1 -3.944 -6.892 -1.978 1.00 0.00 H HETATM 67 H3 UNL 1 -3.098 -6.825 -0.343 1.00 0.00 H HETATM 68 H4 UNL 1 -1.301 -3.461 -2.537 1.00 0.00 H HETATM 69 H5 UNL 1 -5.280 -2.425 -2.288 1.00 0.00 H HETATM 70 H6 UNL 1 -5.224 -2.730 -0.553 1.00 0.00 H HETATM 71 H7 UNL 1 -5.940 -1.150 -1.246 1.00 0.00 H HETATM 72 H8 UNL 1 -4.625 -0.360 -3.014 1.00 0.00 H HETATM 73 H9 UNL 1 -2.859 0.552 -3.666 1.00 0.00 H HETATM 74 H10 UNL 1 -5.530 1.454 -2.102 1.00 0.00 H HETATM 75 H11 UNL 1 -3.922 2.886 -0.872 1.00 0.00 H HETATM 76 H12 UNL 1 -6.138 1.295 0.081 1.00 0.00 H HETATM 77 H13 UNL 1 -5.149 1.033 2.565 1.00 0.00 H HETATM 78 H14 UNL 1 -3.438 0.749 2.448 1.00 0.00 H HETATM 79 H15 UNL 1 -7.659 -2.499 2.945 1.00 0.00 H HETATM 80 H16 UNL 1 -7.122 -3.094 1.321 1.00 0.00 H HETATM 81 H17 UNL 1 -8.616 -2.087 1.419 1.00 0.00 H HETATM 82 H18 UNL 1 -3.453 -1.934 0.606 1.00 0.00 H HETATM 83 H19 UNL 1 -1.541 -0.458 -0.615 1.00 0.00 H HETATM 84 H20 UNL 1 -2.194 2.818 2.505 1.00 0.00 H HETATM 85 H21 UNL 1 -2.015 5.038 3.492 1.00 0.00 H HETATM 86 H22 UNL 1 -0.766 6.788 2.295 1.00 0.00 H HETATM 87 H23 UNL 1 0.263 6.286 0.164 1.00 0.00 H HETATM 88 H24 UNL 1 0.079 4.003 -0.856 1.00 0.00 H HETATM 89 H25 UNL 1 -0.693 -1.256 3.214 1.00 0.00 H HETATM 90 H26 UNL 1 0.870 -1.145 2.034 1.00 0.00 H HETATM 91 H27 UNL 1 0.432 0.251 1.070 1.00 0.00 H HETATM 92 H28 UNL 1 1.759 -2.226 0.276 1.00 0.00 H HETATM 93 H29 UNL 1 3.516 0.115 -3.142 1.00 0.00 H HETATM 94 H30 UNL 1 1.880 1.419 -2.357 1.00 0.00 H HETATM 95 H31 UNL 1 5.637 -0.135 -1.796 1.00 0.00 H HETATM 96 H32 UNL 1 4.302 1.623 0.261 1.00 0.00 H HETATM 97 H33 UNL 1 7.751 -0.838 2.200 1.00 0.00 H HETATM 98 H34 UNL 1 7.930 -0.711 4.642 1.00 0.00 H HETATM 99 H35 UNL 1 6.244 0.389 5.988 1.00 0.00 H HETATM 100 H36 UNL 1 4.283 1.402 4.828 1.00 0.00 H HETATM 101 H37 UNL 1 4.037 1.314 2.374 1.00 0.00 H HETATM 102 H38 UNL 1 4.647 3.287 -0.868 1.00 0.00 H HETATM 103 H39 UNL 1 5.788 5.228 -1.922 1.00 0.00 H HETATM 104 H40 UNL 1 8.357 5.521 -3.527 1.00 0.00 H HETATM 105 H41 UNL 1 7.808 2.774 -4.663 1.00 0.00 H HETATM 106 H42 UNL 1 6.739 0.762 -3.698 1.00 0.00 H HETATM 107 H43 UNL 1 -0.351 -1.829 -3.104 1.00 0.00 H HETATM 108 H44 UNL 1 0.685 -3.341 -2.754 1.00 0.00 H HETATM 109 H45 UNL 1 1.326 -1.716 -2.627 1.00 0.00 H HETATM 110 H46 UNL 1 0.120 -3.010 2.454 1.00 0.00 H HETATM 111 H47 UNL 1 -1.939 -3.571 2.512 1.00 0.00 H CONECT 1 2 65 66 67 CONECT 2 3 3 4 CONECT 4 5 CONECT 5 6 61 68 CONECT 6 7 7 8 CONECT 8 9 10 22 CONECT 9 69 70 71 CONECT 10 11 12 72 CONECT 11 73 CONECT 12 13 14 74 CONECT 13 75 CONECT 14 15 17 76 CONECT 15 16 CONECT 16 17 77 78 CONECT 17 18 22 CONECT 18 19 CONECT 19 20 21 21 CONECT 20 79 80 81 CONECT 22 23 82 CONECT 23 24 33 83 CONECT 24 25 CONECT 25 26 26 27 CONECT 27 28 28 32 CONECT 28 29 84 CONECT 29 30 30 85 CONECT 30 31 86 CONECT 31 32 32 87 CONECT 32 88 CONECT 33 34 35 62 CONECT 34 89 CONECT 35 36 90 91 CONECT 36 37 59 92 CONECT 37 38 CONECT 38 39 39 40 CONECT 40 41 42 93 CONECT 41 94 CONECT 42 43 52 95 CONECT 43 44 96 CONECT 44 45 45 46 CONECT 46 47 47 51 CONECT 47 48 97 CONECT 48 49 49 98 CONECT 49 50 99 CONECT 50 51 51 100 CONECT 51 101 CONECT 52 53 53 58 CONECT 53 54 102 CONECT 54 55 55 103 CONECT 55 56 57 CONECT 56 104 CONECT 57 58 58 105 CONECT 58 106 CONECT 59 60 61 61 CONECT 60 107 108 109 CONECT 61 62 CONECT 62 63 64 CONECT 63 110 CONECT 64 111 END SMILES for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)CC(=O)OC1C2=C(C)C(CC(O)(C(OC(=O)C3=CC=CC=C3)C3C4(COC4C(O)C(O)C3(C)C1=O)OC(C)=O)C2(O)O)OC(=O)C(O)C(NC(=O)C1=CC=CC=C1)C1=CC=C(O)C=C1 INCHI for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel)InChI=1S/C45H47NO18/c1-21-28(62-41(56)31(50)30(24-15-17-27(49)18-16-24)46-39(54)25-11-7-5-8-12-25)19-44(57)38(63-40(55)26-13-9-6-10-14-26)34-42(4,36(53)33(61-22(2)47)29(21)45(44,58)59)35(52)32(51)37-43(34,20-60-37)64-23(3)48/h5-18,28,30-35,37-38,49-52,57-59H,19-20H2,1-4H3,(H,46,54) 3D Structure for HMDB0060795 (6a, 3'-p-Dihydroxypaclitaxel) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C45H47NO18 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 889.8506 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 889.279313705 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 4,12-bis(acetyloxy)-1,8,9,17,17-pentahydroxy-15-{[2-hydroxy-3-(4-hydroxyphenyl)-3-(phenylformamido)propanoyl]oxy}-10,14-dimethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹⁰.0⁴,⁷]heptadec-13-en-2-yl benzoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 4,12-bis(acetyloxy)-1,8,9,17,17-pentahydroxy-15-{[2-hydroxy-3-(4-hydroxyphenyl)-3-(phenylformamido)propanoyl]oxy}-10,14-dimethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹⁰.0⁴,⁷]heptadec-13-en-2-yl benzoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(=O)OC1C2=C(C)C(CC(O)(C(OC(=O)C3=CC=CC=C3)C3C4(COC4C(O)C(O)C3(C)C1=O)OC(C)=O)C2(O)O)OC(=O)C(O)C(NC(=O)C1=CC=CC=C1)C1=CC=C(O)C=C1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C45H47NO18/c1-21-28(62-41(56)31(50)30(24-15-17-27(49)18-16-24)46-39(54)25-11-7-5-8-12-25)19-44(57)38(63-40(55)26-13-9-6-10-14-26)34-42(4,36(53)33(61-22(2)47)29(21)45(44,58)59)35(52)32(51)37-43(34,20-60-37)64-23(3)48/h5-18,28,30-35,37-38,49-52,57-59H,19-20H2,1-4H3,(H,46,54) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | VCMRTKHRFJRAJE-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as n-benzylbenzamides. N-benzylbenzamides are compounds containing a benzamide moiety that is N-linked to a benzyl group. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Benzenoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Benzene and substituted derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Benzoic acids and derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | N-benzylbenzamides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesUnderivatized
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131769953 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |