Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Detected but not Quantified

Creation Date

2021-09-11 13:12:47 UTC

Update Date

2021-09-26 23:07:50 UTC

HMDB ID

HMDB0254068

Secondary Accession Numbers

None

Metabolite Identification

Common Name

Lewis y Tetrasaccharide

Description

Lewis y Tetrasaccharide, also known as le(y) antigen, belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group. Based on a literature review a small amount of articles have been published on Lewis y Tetrasaccharide. This compound has been identified in human blood as reported by (PMID: 31557052 ). Lewis y tetrasaccharide is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically Lewis y Tetrasaccharide is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv1652309112115132D          

 46 49  0  0  0  0            999 V2000
   -2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -7.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8592   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8592   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8592   -7.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -8.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -7.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -9.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -9.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013  -10.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -9.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -9.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302  -10.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013  -11.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724  -10.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -8.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -3.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  2  7  1  0  0  0  0
  6  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
  9 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 16 21  1  0  0  0  0
 20 22  1  0  0  0  0
 22 23  1  0  0  0  0
 19 24  1  0  0  0  0
 18 25  1  0  0  0  0
 17 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 27 32  1  0  0  0  0
 31 33  1  0  0  0  0
 30 34  1  0  0  0  0
 29 35  1  0  0  0  0
 28 36  1  0  0  0  0
 13 37  1  0  0  0  0
 37 38  1  0  0  0  0
 11 39  1  0  0  0  0
 10 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  2  0  0  0  0
 41 43  1  0  0  0  0
  5 44  1  0  0  0  0
  4 45  1  0  0  0  0
  3 46  1  0  0  0  0
M  END

HMDB0254068
     RDKit          3D
Lewis y Tetrasaccharide
 91 94  0  0  0  0  0  0  0  0999 V2000
   -6.2461   -3.3638    0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8298   -3.2445   -0.2062 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9961   -4.0448    0.2683 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3781   -2.2624   -1.1216 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0041   -2.1809   -1.4953 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7590   -2.2295   -2.9954 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9504   -2.6752   -3.5854 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4786   -0.9918   -3.5200 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2441   -0.4601   -3.1557 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1654   -0.8822   -4.0959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0229   -2.2541   -4.1530 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0065   -0.8658   -1.7129 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0243   -0.1723   -1.0710 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -0.9287   -0.7503 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2740   -1.1123    0.6184 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1549   -2.1134    0.8767 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6539   -1.9387    2.3083 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6288   -1.9953    3.2329 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3233   -2.2468   -0.0009 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -3.6248   -0.1710 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2624   -1.6518   -1.3541 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4924   -1.4125   -1.8994 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3901   -0.3857   -1.2674 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9808    0.3862   -0.2743 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3808    1.6321   -0.7053 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7320    1.8814   -0.5833 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9285    3.2310   -0.9218 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3649    3.5352   -1.2676 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4653    4.1570    0.2006 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7047    5.2165   -0.3146 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4888    3.3225    1.0370 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7878    4.0983    1.9462 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5444    2.6906    0.0052 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4566    2.1545    0.6468 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3609   -0.8582   -1.0550 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2834   -0.7463    0.3004 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9356    0.3885    0.7917 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0525   -0.0370    1.4440 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1373    0.0236    2.7828 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2832   -1.0033    3.4938 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9497    1.4225    3.3080 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1927    2.0925    3.3790 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1045    2.2040    2.3743 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4201    3.2506    2.9929 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1241    1.3158    1.5936 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2189    0.7074    2.4207 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8832   -2.5801   -0.2868 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3078   -3.1307    1.2987 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6312   -4.3816    0.0020 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0750   -1.5962   -1.5213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933   -2.9643   -1.0072 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9923   -3.0010   -3.2495 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6854   -3.0329   -4.4829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3367    0.6480   -3.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5327   -0.5919   -5.1273 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7633   -0.3348   -3.9565 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8131   -2.4041   -4.7571 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6331   -1.9353   -1.7948 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8831   -1.9810   -1.1273 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5709   -3.0811    0.9048 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2317   -1.0111    2.4402 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3628   -2.7722    2.5750 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7967   -1.3766    3.9857 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2516   -1.8393    0.4994 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3363   -4.1496    0.6112 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6623   -2.3400   -2.0199 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1743   -1.6911   -1.2085 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3293    0.1189   -2.2319 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1200    1.7016   -1.7858 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2652    3.4307   -1.7848 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3602    4.2252   -2.1348 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9797    2.6380   -1.3924 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8096    4.1171   -0.4150 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2945    4.5003    0.8211 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0651    5.5329    0.3775 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0363    2.4737    1.5109 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0231    3.8495    2.8932 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1733    3.4668   -0.7115 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7074    1.6825    1.4974 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9308   -0.0020   -1.5280 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3469    0.9829   -0.1051 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2214   -0.2248    3.0371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9875   -1.7432    3.9806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6802   -0.5585    4.3108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6858   -1.5456    2.7503 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4549    1.4353    4.3053 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4241    2.4935    2.5042 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7562    2.6669    1.5960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7247    3.6151    2.3906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5601    2.0732    0.9715 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3290    0.5886    2.0234 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 12 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 41 43  1  0
 43 44  1  0
 43 45  1  0
 45 46  1  0
 35  5  1  0
 45 37  1  0
 23 14  1  0
 33 25  1  0
  1 47  1  0
  1 48  1  0
  1 49  1  0
  4 50  1  0
  5 51  1  0
  6 52  1  0
  7 53  1  0
  9 54  1  0
 10 55  1  0
 10 56  1  0
 11 57  1  0
 12 58  1  0
 14 59  1  0
 16 60  1  0
 17 61  1  0
 17 62  1  0
 18 63  1  0
 19 64  1  0
 20 65  1  0
 21 66  1  0
 22 67  1  0
 23 68  1  0
 25 69  1  0
 27 70  1  0
 28 71  1  0
 28 72  1  0
 28 73  1  0
 29 74  1  0
 30 75  1  0
 31 76  1  0
 32 77  1  0
 33 78  1  0
 34 79  1  0
 35 80  1  0
 37 81  1  0
 39 82  1  0
 40 83  1  0
 40 84  1  0
 40 85  1  0
 41 86  1  0
 42 87  1  0
 43 88  1  0
 44 89  1  0
 45 90  1  0
 46 91  1  0
M  END

  Mrv1652309112115132D          

 46 49  0  0  0  0            999 V2000
   -2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -7.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8592   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8592   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8592   -7.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -8.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -7.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -9.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -9.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013  -10.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -9.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7158   -9.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302  -10.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013  -11.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724  -10.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -8.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4302   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0013   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -3.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  2  7  1  0  0  0  0
  6  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
  9 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 16 21  1  0  0  0  0
 20 22  1  0  0  0  0
 22 23  1  0  0  0  0
 19 24  1  0  0  0  0
 18 25  1  0  0  0  0
 17 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 27 32  1  0  0  0  0
 31 33  1  0  0  0  0
 30 34  1  0  0  0  0
 29 35  1  0  0  0  0
 28 36  1  0  0  0  0
 13 37  1  0  0  0  0
 37 38  1  0  0  0  0
 11 39  1  0  0  0  0
 10 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  2  0  0  0  0
 41 43  1  0  0  0  0
  5 44  1  0  0  0  0
  4 45  1  0  0  0  0
  3 46  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0254068

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(CO)OC(O)C(NC(C)=O)C2OC2OC(C)C(O)C(O)C2O)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C26H45NO19/c1-6-12(31)15(34)18(37)24(40-6)45-21-11(27-8(3)30)23(39)42-10(5-29)20(21)44-26-22(17(36)14(33)9(4-28)43-26)46-25-19(38)16(35)13(32)7(2)41-25/h6-7,9-26,28-29,31-39H,4-5H2,1-3H3,(H,27,30)

> <INCHI_KEY>
SRHNADOZAAWYLV-UHFFFAOYSA-N

> <FORMULA>
C26H45NO19

> <MOLECULAR_WEIGHT>
675.634

> <EXACT_MASS>
675.258578233

> <JCHEM_ACCEPTOR_COUNT>
19

> <JCHEM_ATOM_COUNT>
91

> <JCHEM_AVERAGE_POLARIZABILITY>
63.846310680322475

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
12

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
N-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-3-yl)acetamide

> <ALOGPS_LOGP>
-2.02

> <JCHEM_LOGP>
-6.439261415333332

> <ALOGPS_LOGS>
-0.79

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
11.988041173834912

> <JCHEM_PKA_STRONGEST_ACIDIC>
11.405823335655247

> <JCHEM_PKA_STRONGEST_BASIC>
-3.648674410293115

> <JCHEM_POLAR_SURFACE_AREA>
316.24

> <JCHEM_REFRACTIVITY>
141.1772

> <JCHEM_ROTATABLE_BOND_COUNT>
9

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.11e+02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
N-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-3-yl)acetamide

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0254068
     RDKit          3D
Lewis y Tetrasaccharide
 91 94  0  0  0  0  0  0  0  0999 V2000
   -6.2461   -3.3638    0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8298   -3.2445   -0.2062 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9961   -4.0448    0.2683 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3781   -2.2624   -1.1216 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0041   -2.1809   -1.4953 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7590   -2.2295   -2.9954 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9504   -2.6752   -3.5854 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4786   -0.9918   -3.5200 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2441   -0.4601   -3.1557 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1654   -0.8822   -4.0959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0229   -2.2541   -4.1530 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0065   -0.8658   -1.7129 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0243   -0.1723   -1.0710 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -0.9287   -0.7503 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2740   -1.1123    0.6184 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1549   -2.1134    0.8767 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6539   -1.9387    2.3083 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6288   -1.9953    3.2329 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3233   -2.2468   -0.0009 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -3.6248   -0.1710 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2624   -1.6518   -1.3541 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4924   -1.4125   -1.8994 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3901   -0.3857   -1.2674 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9808    0.3862   -0.2743 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3808    1.6321   -0.7053 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7320    1.8814   -0.5833 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9285    3.2310   -0.9218 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3649    3.5352   -1.2676 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4653    4.1570    0.2006 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7047    5.2165   -0.3146 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4888    3.3225    1.0370 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7878    4.0983    1.9462 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5444    2.6906    0.0052 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4566    2.1545    0.6468 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3609   -0.8582   -1.0550 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2834   -0.7463    0.3004 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9356    0.3885    0.7917 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0525   -0.0370    1.4440 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1373    0.0236    2.7828 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2832   -1.0033    3.4938 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9497    1.4225    3.3080 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1927    2.0925    3.3790 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1045    2.2040    2.3743 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4201    3.2506    2.9929 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1241    1.3158    1.5936 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2189    0.7074    2.4207 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8832   -2.5801   -0.2868 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3078   -3.1307    1.2987 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6312   -4.3816    0.0020 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0750   -1.5962   -1.5213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933   -2.9643   -1.0072 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9923   -3.0010   -3.2495 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6854   -3.0329   -4.4829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3367    0.6480   -3.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5327   -0.5919   -5.1273 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7633   -0.3348   -3.9565 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8131   -2.4041   -4.7571 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6331   -1.9353   -1.7948 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8831   -1.9810   -1.1273 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5709   -3.0811    0.9048 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2317   -1.0111    2.4402 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3628   -2.7722    2.5750 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7967   -1.3766    3.9857 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2516   -1.8393    0.4994 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3363   -4.1496    0.6112 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6623   -2.3400   -2.0199 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1743   -1.6911   -1.2085 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3293    0.1189   -2.2319 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1200    1.7016   -1.7858 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2652    3.4307   -1.7848 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3602    4.2252   -2.1348 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9797    2.6380   -1.3924 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8096    4.1171   -0.4150 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2945    4.5003    0.8211 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0651    5.5329    0.3775 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0363    2.4737    1.5109 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0231    3.8495    2.8932 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1733    3.4668   -0.7115 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7074    1.6825    1.4974 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9308   -0.0020   -1.5280 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3469    0.9829   -0.1051 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2214   -0.2248    3.0371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9875   -1.7432    3.9806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6802   -0.5585    4.3108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6858   -1.5456    2.7503 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4549    1.4353    4.3053 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4241    2.4935    2.5042 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7562    2.6669    1.5960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7247    3.6151    2.3906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5601    2.0732    0.9715 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3290    0.5886    2.0234 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 12 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 41 43  1  0
 43 44  1  0
 43 45  1  0
 45 46  1  0
 35  5  1  0
 45 37  1  0
 23 14  1  0
 33 25  1  0
  1 47  1  0
  1 48  1  0
  1 49  1  0
  4 50  1  0
  5 51  1  0
  6 52  1  0
  7 53  1  0
  9 54  1  0
 10 55  1  0
 10 56  1  0
 11 57  1  0
 12 58  1  0
 14 59  1  0
 16 60  1  0
 17 61  1  0
 17 62  1  0
 18 63  1  0
 19 64  1  0
 20 65  1  0
 21 66  1  0
 22 67  1  0
 23 68  1  0
 25 69  1  0
 27 70  1  0
 28 71  1  0
 28 72  1  0
 28 73  1  0
 29 74  1  0
 30 75  1  0
 31 76  1  0
 32 77  1  0
 33 78  1  0
 34 79  1  0
 35 80  1  0
 37 81  1  0
 39 82  1  0
 40 83  1  0
 40 84  1  0
 40 85  1  0
 41 86  1  0
 42 87  1  0
 43 88  1  0
 44 89  1  0
 45 90  1  0
 46 91  1  0
M  END

HEADER    PROTEIN                                 11-SEP-21   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   11-SEP-21         0                                  
HETATM    1  C   UNK     0      -4.001  -5.390   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -4.001  -6.930   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -2.667  -7.700   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -2.667  -9.240   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -4.001 -10.010   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -5.335  -9.240   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0      -5.335  -7.700   0.000  0.00  0.00           O+0
HETATM    8  O   UNK     0      -6.668 -10.010   0.000  0.00  0.00           O+0
HETATM    9  C   UNK     0      -8.002  -9.240   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -8.002  -7.700   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -9.336  -6.930   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0     -10.669  -7.700   0.000  0.00  0.00           O+0
HETATM   13  C   UNK     0     -10.669  -9.240   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -9.336 -10.010   0.000  0.00  0.00           C+0
HETATM   15  O   UNK     0      -9.336 -11.550   0.000  0.00  0.00           O+0
HETATM   16  C   UNK     0     -10.669 -12.320   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0     -10.669 -13.860   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0     -12.003 -14.630   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0     -13.337 -13.860   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0     -13.337 -12.320   0.000  0.00  0.00           C+0
HETATM   21  O   UNK     0     -12.003 -11.550   0.000  0.00  0.00           O+0
HETATM   22  C   UNK     0     -14.670 -11.550   0.000  0.00  0.00           C+0
HETATM   23  O   UNK     0     -14.670 -10.010   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0     -14.670 -14.630   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0     -12.003 -16.170   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0      -9.336 -14.630   0.000  0.00  0.00           O+0
HETATM   27  C   UNK     0      -9.336 -16.170   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      -8.002 -16.940   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      -8.002 -18.480   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      -9.336 -19.250   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0     -10.669 -18.480   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0     -10.669 -16.940   0.000  0.00  0.00           O+0
HETATM   33  C   UNK     0     -12.003 -19.250   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0      -9.336 -20.790   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      -6.668 -19.250   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      -6.668 -16.170   0.000  0.00  0.00           O+0
HETATM   37  C   UNK     0     -12.003 -10.010   0.000  0.00  0.00           C+0
HETATM   38  O   UNK     0     -13.337  -9.240   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      -9.336  -5.390   0.000  0.00  0.00           O+0
HETATM   40  N   UNK     0      -6.668  -6.930   0.000  0.00  0.00           N+0
HETATM   41  C   UNK     0      -6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   42  O   UNK     0      -5.335  -4.620   0.000  0.00  0.00           O+0
HETATM   43  C   UNK     0      -8.002  -4.620   0.000  0.00  0.00           C+0
HETATM   44  O   UNK     0      -4.001 -11.550   0.000  0.00  0.00           O+0
HETATM   45  O   UNK     0      -1.334 -10.010   0.000  0.00  0.00           O+0
HETATM   46  O   UNK     0      -1.334  -6.930   0.000  0.00  0.00           O+0
CONECT    1    2                                                            
CONECT    2    1    3    7                                                  
CONECT    3    2    4   46                                                  
CONECT    4    3    5   45                                                  
CONECT    5    4    6   44                                                  
CONECT    6    5    7    8                                                  
CONECT    7    6    2                                                       
CONECT    8    6    9                                                       
CONECT    9    8   10   14                                                  
CONECT   10    9   11   40                                                  
CONECT   11   10   12   39                                                  
CONECT   12   11   13                                                       
CONECT   13   12   14   37                                                  
CONECT   14   13    9   15                                                  
CONECT   15   14   16                                                       
CONECT   16   15   17   21                                                  
CONECT   17   16   18   26                                                  
CONECT   18   17   19   25                                                  
CONECT   19   18   20   24                                                  
CONECT   20   19   21   22                                                  
CONECT   21   20   16                                                       
CONECT   22   20   23                                                       
CONECT   23   22                                                            
CONECT   24   19                                                            
CONECT   25   18                                                            
CONECT   26   17   27                                                       
CONECT   27   26   28   32                                                  
CONECT   28   27   29   36                                                  
CONECT   29   28   30   35                                                  
CONECT   30   29   31   34                                                  
CONECT   31   30   32   33                                                  
CONECT   32   31   27                                                       
CONECT   33   31                                                            
CONECT   34   30                                                            
CONECT   35   29                                                            
CONECT   36   28                                                            
CONECT   37   13   38                                                       
CONECT   38   37                                                            
CONECT   39   11                                                            
CONECT   40   10   41                                                       
CONECT   41   40   42   43                                                  
CONECT   42   41                                                            
CONECT   43   41                                                            
CONECT   44    5                                                            
CONECT   45    4                                                            
CONECT   46    3                                                            
MASTER        0    0    0    0    0    0    0    0   46    0   98    0
END

COMPND    HMDB0254068
HETATM    1  C1  UNL     1      -6.246  -3.364   0.213  1.00  0.00           C  
HETATM    2  C2  UNL     1      -4.830  -3.244  -0.206  1.00  0.00           C  
HETATM    3  O1  UNL     1      -3.996  -4.045   0.268  1.00  0.00           O  
HETATM    4  N1  UNL     1      -4.378  -2.262  -1.122  1.00  0.00           N  
HETATM    5  C3  UNL     1      -3.004  -2.181  -1.495  1.00  0.00           C  
HETATM    6  C4  UNL     1      -2.759  -2.230  -2.995  1.00  0.00           C  
HETATM    7  O2  UNL     1      -3.950  -2.675  -3.585  1.00  0.00           O  
HETATM    8  O3  UNL     1      -2.479  -0.992  -3.520  1.00  0.00           O  
HETATM    9  C5  UNL     1      -1.244  -0.460  -3.156  1.00  0.00           C  
HETATM   10  C6  UNL     1      -0.165  -0.882  -4.096  1.00  0.00           C  
HETATM   11  O4  UNL     1       0.023  -2.254  -4.153  1.00  0.00           O  
HETATM   12  C7  UNL     1      -1.007  -0.866  -1.713  1.00  0.00           C  
HETATM   13  O5  UNL     1      -0.024  -0.172  -1.071  1.00  0.00           O  
HETATM   14  C8  UNL     1       1.072  -0.929  -0.750  1.00  0.00           C  
HETATM   15  O6  UNL     1       1.274  -1.112   0.618  1.00  0.00           O  
HETATM   16  C9  UNL     1       2.155  -2.113   0.877  1.00  0.00           C  
HETATM   17  C10 UNL     1       2.654  -1.939   2.308  1.00  0.00           C  
HETATM   18  O7  UNL     1       1.629  -1.995   3.233  1.00  0.00           O  
HETATM   19  C11 UNL     1       3.323  -2.247  -0.001  1.00  0.00           C  
HETATM   20  O8  UNL     1       3.599  -3.625  -0.171  1.00  0.00           O  
HETATM   21  C12 UNL     1       3.262  -1.652  -1.354  1.00  0.00           C  
HETATM   22  O9  UNL     1       4.492  -1.413  -1.899  1.00  0.00           O  
HETATM   23  C13 UNL     1       2.390  -0.386  -1.267  1.00  0.00           C  
HETATM   24  O10 UNL     1       2.981   0.386  -0.274  1.00  0.00           O  
HETATM   25  C14 UNL     1       3.381   1.632  -0.705  1.00  0.00           C  
HETATM   26  O11 UNL     1       4.732   1.881  -0.583  1.00  0.00           O  
HETATM   27  C15 UNL     1       4.928   3.231  -0.922  1.00  0.00           C  
HETATM   28  C16 UNL     1       6.365   3.535  -1.268  1.00  0.00           C  
HETATM   29  C17 UNL     1       4.465   4.157   0.201  1.00  0.00           C  
HETATM   30  O12 UNL     1       3.705   5.216  -0.315  1.00  0.00           O  
HETATM   31  C18 UNL     1       3.489   3.322   1.037  1.00  0.00           C  
HETATM   32  O13 UNL     1       2.788   4.098   1.946  1.00  0.00           O  
HETATM   33  C19 UNL     1       2.544   2.691   0.005  1.00  0.00           C  
HETATM   34  O14 UNL     1       1.457   2.155   0.647  1.00  0.00           O  
HETATM   35  C20 UNL     1      -2.361  -0.858  -1.055  1.00  0.00           C  
HETATM   36  O15 UNL     1      -2.283  -0.746   0.300  1.00  0.00           O  
HETATM   37  C21 UNL     1      -2.936   0.388   0.792  1.00  0.00           C  
HETATM   38  O16 UNL     1      -4.053  -0.037   1.444  1.00  0.00           O  
HETATM   39  C22 UNL     1      -4.137   0.024   2.783  1.00  0.00           C  
HETATM   40  C23 UNL     1      -3.283  -1.003   3.494  1.00  0.00           C  
HETATM   41  C24 UNL     1      -3.950   1.423   3.308  1.00  0.00           C  
HETATM   42  O17 UNL     1      -5.193   2.093   3.379  1.00  0.00           O  
HETATM   43  C25 UNL     1      -3.104   2.204   2.374  1.00  0.00           C  
HETATM   44  O18 UNL     1      -2.420   3.251   2.993  1.00  0.00           O  
HETATM   45  C26 UNL     1      -2.124   1.316   1.594  1.00  0.00           C  
HETATM   46  O19 UNL     1      -1.219   0.707   2.421  1.00  0.00           O  
HETATM   47  H1  UNL     1      -6.883  -2.580  -0.287  1.00  0.00           H  
HETATM   48  H2  UNL     1      -6.308  -3.131   1.299  1.00  0.00           H  
HETATM   49  H3  UNL     1      -6.631  -4.382   0.002  1.00  0.00           H  
HETATM   50  H4  UNL     1      -5.075  -1.596  -1.521  1.00  0.00           H  
HETATM   51  H5  UNL     1      -2.393  -2.964  -1.007  1.00  0.00           H  
HETATM   52  H6  UNL     1      -1.992  -3.001  -3.250  1.00  0.00           H  
HETATM   53  H7  UNL     1      -3.685  -3.033  -4.483  1.00  0.00           H  
HETATM   54  H8  UNL     1      -1.337   0.648  -3.216  1.00  0.00           H  
HETATM   55  H9  UNL     1      -0.533  -0.592  -5.127  1.00  0.00           H  
HETATM   56  H10 UNL     1       0.763  -0.335  -3.956  1.00  0.00           H  
HETATM   57  H11 UNL     1       0.813  -2.404  -4.757  1.00  0.00           H  
HETATM   58  H12 UNL     1      -0.633  -1.935  -1.795  1.00  0.00           H  
HETATM   59  H13 UNL     1       0.883  -1.981  -1.127  1.00  0.00           H  
HETATM   60  H14 UNL     1       1.571  -3.081   0.905  1.00  0.00           H  
HETATM   61  H15 UNL     1       3.232  -1.011   2.440  1.00  0.00           H  
HETATM   62  H16 UNL     1       3.363  -2.772   2.575  1.00  0.00           H  
HETATM   63  H17 UNL     1       1.797  -1.377   3.986  1.00  0.00           H  
HETATM   64  H18 UNL     1       4.252  -1.839   0.499  1.00  0.00           H  
HETATM   65  H19 UNL     1       3.336  -4.150   0.611  1.00  0.00           H  
HETATM   66  H20 UNL     1       2.662  -2.340  -2.020  1.00  0.00           H  
HETATM   67  H21 UNL     1       5.174  -1.691  -1.209  1.00  0.00           H  
HETATM   68  H22 UNL     1       2.329   0.119  -2.232  1.00  0.00           H  
HETATM   69  H23 UNL     1       3.120   1.702  -1.786  1.00  0.00           H  
HETATM   70  H24 UNL     1       4.265   3.431  -1.785  1.00  0.00           H  
HETATM   71  H25 UNL     1       6.360   4.225  -2.135  1.00  0.00           H  
HETATM   72  H26 UNL     1       6.980   2.638  -1.392  1.00  0.00           H  
HETATM   73  H27 UNL     1       6.810   4.117  -0.415  1.00  0.00           H  
HETATM   74  H28 UNL     1       5.294   4.500   0.821  1.00  0.00           H  
HETATM   75  H29 UNL     1       3.065   5.533   0.378  1.00  0.00           H  
HETATM   76  H30 UNL     1       4.036   2.474   1.511  1.00  0.00           H  
HETATM   77  H31 UNL     1       3.023   3.850   2.893  1.00  0.00           H  
HETATM   78  H32 UNL     1       2.173   3.467  -0.712  1.00  0.00           H  
HETATM   79  H33 UNL     1       1.707   1.682   1.497  1.00  0.00           H  
HETATM   80  H34 UNL     1      -2.931  -0.002  -1.528  1.00  0.00           H  
HETATM   81  H35 UNL     1      -3.347   0.983  -0.105  1.00  0.00           H  
HETATM   82  H36 UNL     1      -5.221  -0.225   3.037  1.00  0.00           H  
HETATM   83  H37 UNL     1      -3.988  -1.743   3.981  1.00  0.00           H  
HETATM   84  H38 UNL     1      -2.680  -0.558   4.311  1.00  0.00           H  
HETATM   85  H39 UNL     1      -2.686  -1.546   2.750  1.00  0.00           H  
HETATM   86  H40 UNL     1      -3.455   1.435   4.305  1.00  0.00           H  
HETATM   87  H41 UNL     1      -5.424   2.493   2.504  1.00  0.00           H  
HETATM   88  H42 UNL     1      -3.756   2.667   1.596  1.00  0.00           H  
HETATM   89  H43 UNL     1      -1.725   3.615   2.391  1.00  0.00           H  
HETATM   90  H44 UNL     1      -1.560   2.073   0.971  1.00  0.00           H  
HETATM   91  H45 UNL     1      -0.329   0.589   2.023  1.00  0.00           H  
CONECT    1    2   47   48   49
CONECT    2    3    3    4
CONECT    4    5   50
CONECT    5    6   35   51
CONECT    6    7    8   52
CONECT    7   53
CONECT    8    9
CONECT    9   10   12   54
CONECT   10   11   55   56
CONECT   11   57
CONECT   12   13   35   58
CONECT   13   14
CONECT   14   15   23   59
CONECT   15   16
CONECT   16   17   19   60
CONECT   17   18   61   62
CONECT   18   63
CONECT   19   20   21   64
CONECT   20   65
CONECT   21   22   23   66
CONECT   22   67
CONECT   23   24   68
CONECT   24   25
CONECT   25   26   33   69
CONECT   26   27
CONECT   27   28   29   70
CONECT   28   71   72   73
CONECT   29   30   31   74
CONECT   30   75
CONECT   31   32   33   76
CONECT   32   77
CONECT   33   34   78
CONECT   34   79
CONECT   35   36   80
CONECT   36   37
CONECT   37   38   45   81
CONECT   38   39
CONECT   39   40   41   82
CONECT   40   83   84   85
CONECT   41   42   43   86
CONECT   42   87
CONECT   43   44   45   88
CONECT   44   89
CONECT   45   46   90
CONECT   46   91
END

HMDB0254068
     RDKit          3D
Lewis y Tetrasaccharide
 91 94  0  0  0  0  0  0  0  0999 V2000
   -6.2461   -3.3638    0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8298   -3.2445   -0.2062 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9961   -4.0448    0.2683 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3781   -2.2624   -1.1216 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0041   -2.1809   -1.4953 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7590   -2.2295   -2.9954 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9504   -2.6752   -3.5854 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4786   -0.9918   -3.5200 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2441   -0.4601   -3.1557 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1654   -0.8822   -4.0959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0229   -2.2541   -4.1530 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0065   -0.8658   -1.7129 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0243   -0.1723   -1.0710 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -0.9287   -0.7503 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2740   -1.1123    0.6184 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1549   -2.1134    0.8767 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6539   -1.9387    2.3083 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6288   -1.9953    3.2329 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3233   -2.2468   -0.0009 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -3.6248   -0.1710 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2624   -1.6518   -1.3541 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4924   -1.4125   -1.8994 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3901   -0.3857   -1.2674 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9808    0.3862   -0.2743 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3808    1.6321   -0.7053 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7320    1.8814   -0.5833 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9285    3.2310   -0.9218 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3649    3.5352   -1.2676 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4653    4.1570    0.2006 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7047    5.2165   -0.3146 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4888    3.3225    1.0370 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7878    4.0983    1.9462 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5444    2.6906    0.0052 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4566    2.1545    0.6468 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3609   -0.8582   -1.0550 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2834   -0.7463    0.3004 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9356    0.3885    0.7917 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0525   -0.0370    1.4440 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1373    0.0236    2.7828 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2832   -1.0033    3.4938 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9497    1.4225    3.3080 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1927    2.0925    3.3790 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1045    2.2040    2.3743 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4201    3.2506    2.9929 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1241    1.3158    1.5936 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2189    0.7074    2.4207 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8832   -2.5801   -0.2868 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3078   -3.1307    1.2987 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6312   -4.3816    0.0020 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0750   -1.5962   -1.5213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933   -2.9643   -1.0072 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9923   -3.0010   -3.2495 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6854   -3.0329   -4.4829 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3367    0.6480   -3.2163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5327   -0.5919   -5.1273 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7633   -0.3348   -3.9565 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8131   -2.4041   -4.7571 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6331   -1.9353   -1.7948 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8831   -1.9810   -1.1273 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5709   -3.0811    0.9048 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2317   -1.0111    2.4402 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3628   -2.7722    2.5750 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7967   -1.3766    3.9857 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2516   -1.8393    0.4994 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3363   -4.1496    0.6112 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6623   -2.3400   -2.0199 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1743   -1.6911   -1.2085 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3293    0.1189   -2.2319 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1200    1.7016   -1.7858 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2652    3.4307   -1.7848 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3602    4.2252   -2.1348 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9797    2.6380   -1.3924 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8096    4.1171   -0.4150 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2945    4.5003    0.8211 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0651    5.5329    0.3775 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0363    2.4737    1.5109 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0231    3.8495    2.8932 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1733    3.4668   -0.7115 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7074    1.6825    1.4974 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9308   -0.0020   -1.5280 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3469    0.9829   -0.1051 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2214   -0.2248    3.0371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9875   -1.7432    3.9806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6802   -0.5585    4.3108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6858   -1.5456    2.7503 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4549    1.4353    4.3053 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4241    2.4935    2.5042 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7562    2.6669    1.5960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7247    3.6151    2.3906 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5601    2.0732    0.9715 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3290    0.5886    2.0234 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 12 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 41 43  1  0
 43 44  1  0
 43 45  1  0
 45 46  1  0
 35  5  1  0
 45 37  1  0
 23 14  1  0
 33 25  1  0
  1 47  1  0
  1 48  1  0
  1 49  1  0
  4 50  1  0
  5 51  1  0
  6 52  1  0
  7 53  1  0
  9 54  1  0
 10 55  1  0
 10 56  1  0
 11 57  1  0
 12 58  1  0
 14 59  1  0
 16 60  1  0
 17 61  1  0
 17 62  1  0
 18 63  1  0
 19 64  1  0
 20 65  1  0
 21 66  1  0
 22 67  1  0
 23 68  1  0
 25 69  1  0
 27 70  1  0
 28 71  1  0
 28 72  1  0
 28 73  1  0
 29 74  1  0
 30 75  1  0
 31 76  1  0
 32 77  1  0
 33 78  1  0
 34 79  1  0
 35 80  1  0
 37 81  1  0
 39 82  1  0
 40 83  1  0
 40 84  1  0
 40 85  1  0
 41 86  1  0
 42 87  1  0
 43 88  1  0
 44 89  1  0
 45 90  1  0
 46 91  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
alpha-L-Fucp-1-2-beta-D-galp-1-4(alpha-L-fucp-1-3)-beta-D-glcpnac	HMDB
Fuc-1-2-gal-1-4-(fuc-1-3)glcnac	HMDB
Le(y) antigen	HMDB
Lewis y antigen	HMDB
N-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-3-yl)ethanimidate	HMDB

Chemical Formula

C₂₆H₄₅NO₁₉

Average Molecular Weight

675.634

Monoisotopic Molecular Weight

675.258578233

IUPAC Name

N-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-3-yl)acetamide

Traditional Name

N-(5-{[4,5-dihydroxy-6-(hydroxymethyl)-3-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy}-2-hydroxy-6-(hydroxymethyl)-4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-3-yl)acetamide

CAS Registry Number

Not Available

SMILES

CC1OC(OC2C(O)C(O)C(CO)OC2OC2C(CO)OC(O)C(NC(C)=O)C2OC2OC(C)C(O)C(O)C2O)C(O)C(O)C1O

InChI Identifier

InChI=1S/C26H45NO19/c1-6-12(31)15(34)18(37)24(40-6)45-21-11(27-8(3)30)23(39)42-10(5-29)20(21)44-26-22(17(36)14(33)9(4-28)43-26)46-25-19(38)16(35)13(32)7(2)41-25/h6-7,9-26,28-29,31-39H,4-5H2,1-3H3,(H,27,30)

InChI Key

SRHNADOZAAWYLV-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group.

Kingdom

Organic compounds

Super Class

Organic oxygen compounds

Class

Organooxygen compounds

Sub Class

Carbohydrates and carbohydrate conjugates

Direct Parent

Acylaminosugars

Alternative Parents

Substituents

Oligosaccharide
Acylaminosugar
N-acyl-alpha-hexosamine
Glycosyl compound
O-glycosyl compound
Oxane
Acetamide
Carboxamide group
Hemiacetal
Secondary carboxylic acid amide
Secondary alcohol
Acetal
Carboxylic acid derivative
Oxacycle
Organoheterocyclic compound
Polyol
Hydrocarbon derivative
Organic oxide
Organic nitrogen compound
Organopnictogen compound
Alcohol
Primary alcohol
Organonitrogen compound
Carbonyl group
Aliphatic heteromonocyclic compound

Molecular Framework

Aliphatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Non-excretory biofluid

Biofluid or Excreta

Blood (PMID: 31557052)

Source

Exogenous

Exogenous (PMID: 31557052)

Process

Not Available

Role

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
logP	-2	ALOGPS
logP	-6.4	ChemAxon
logS	-0.79	ALOGPS
pKa (Strongest Acidic)	11.41	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	19	ChemAxon
Hydrogen Donor Count	12	ChemAxon
Polar Surface Area	316.24 Å²	ChemAxon
Rotatable Bond Count	9	ChemAxon
Refractivity	141.18 m³·mol⁻¹	ChemAxon
Polarizability	63.85 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	237.582	30932474
DeepCCS	[M-H]-	235.186	30932474
DeepCCS	[M-2H]-	268.388	30932474
DeepCCS	[M+Na]+	243.494	30932474
AllCCS	[M+H]+	242.3	32859911
AllCCS	[M+H-H2O]+	241.8	32859911
AllCCS	[M+NH4]+	242.7	32859911
AllCCS	[M+Na]+	242.8	32859911
AllCCS	[M-H]-	244.6	32859911
AllCCS	[M+Na-2H]-	246.7	32859911
AllCCS	[M+HCOO]-	249.1	32859911

Predicted Kovats Retention Indices

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Lewis y Tetrasaccharide,1TMS,isomer #1	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5290.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #1	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4582.2	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #1	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9621.0	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5262.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4607.0	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	9646.0	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #11	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5295.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #11	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4592.1	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #11	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9748.9	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #12	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5222.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #12	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4681.4	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #12	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	9753.4	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #2	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5282.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #2	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4589.1	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #2	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9649.4	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5276.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4645.7	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9818.9	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #4	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5282.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #4	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4652.2	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #4	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9824.8	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5313.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4594.4	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9574.2	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5294.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4592.7	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	9748.9	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5262.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4607.8	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	9646.0	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5282.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4607.1	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	9706.4	Standard polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5291.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4605.3	Standard non polar	33892256
Lewis y Tetrasaccharide,1TMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	9708.0	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #1	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5232.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #1	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4611.5	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #1	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8612.2	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5218.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4619.3	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8735.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #11	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5175.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #11	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4671.9	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #11	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8774.6	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #12	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5234.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #12	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4620.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #12	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8640.1	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #13	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5224.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #13	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4661.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #13	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8864.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #14	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5223.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #14	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4664.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #14	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8847.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #15	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5239.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #15	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4616.9	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #15	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8776.0	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #16	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5191.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #16	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4629.9	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #16	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8715.2	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #17	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5221.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #17	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4626.3	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #17	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8764.1	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #18	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5239.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #18	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4617.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #18	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8776.0	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #19	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5191.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #19	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4630.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #19	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8715.2	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #2	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5224.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #2	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4652.5	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #2	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8836.5	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #20	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5219.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #20	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4627.4	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #20	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8763.1	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #21	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5181.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #21	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4681.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #21	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8799.2	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #22	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5227.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #22	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4659.3	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #22	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8774.7	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #23	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5219.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #23	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4710.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #23	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9000.0	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #24	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5234.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #24	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4654.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #24	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8914.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #25	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5185.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #25	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4665.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #25	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8851.6	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #26	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5215.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #26	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4665.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #26	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8900.7	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #27	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5233.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #27	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4654.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #27	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8914.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #28	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5186.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #28	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4665.9	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #28	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8851.6	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #29	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5213.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #29	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4666.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #29	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8899.7	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5215.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4643.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8804.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #30	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5163.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #30	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4723.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #30	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8939.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #31	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5227.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #31	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4658.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #31	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8762.5	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #32	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5241.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #32	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4660.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #32	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8921.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #33	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5194.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #33	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4671.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #33	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8859.2	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #34	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5222.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #34	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4669.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #34	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8907.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #35	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5241.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #35	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4659.9	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #35	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8921.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #36	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5194.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #36	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4672.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #36	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8859.1	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #37	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5220.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #37	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4672.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #37	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8906.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #38	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5163.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #38	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4719.4	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #38	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8925.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #39	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5238.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #39	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4617.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #39	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8691.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #4	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5245.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #4	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4604.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #4	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8653.0	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #40	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5191.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #40	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4630.6	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #40	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8633.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #41	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5212.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #41	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4628.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #41	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8682.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #42	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5237.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #42	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4616.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #42	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8691.7	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #43	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5191.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #43	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4630.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #43	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8633.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #44	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5208.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #44	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4629.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #44	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8681.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #45	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5189.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #45	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4675.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #45	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8759.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #46	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5250.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #46	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4614.6	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #46	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8834.7	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #47	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5208.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #47	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4627.4	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #47	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8770.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #48	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5234.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #48	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4624.0	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #48	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8820.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #49	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5226.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #49	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4620.9	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #49	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	8706.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #5	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5236.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #5	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4607.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #5	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8747.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #50	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5221.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #50	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4635.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #50	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8786.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #51	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5184.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #51	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4677.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #51	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8858.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #52	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5208.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #52	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4627.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #52	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8770.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #53	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5173.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #53	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4638.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #53	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8709.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #54	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5196.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #54	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4636.5	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #54	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8758.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #55	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5218.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #55	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4632.4	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #55	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	8714.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #56	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5154.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #56	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4691.5	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #56	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8791.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #57	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5231.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #57	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4625.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #57	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8819.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #58	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5193.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #58	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4638.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #58	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8757.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #59	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5224.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #59	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4634.4	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #59	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8806.8	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5191.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4621.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8687.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #60	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5168.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #60	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4690.2	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #60	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8841.6	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #61	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5224.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #61	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4634.5	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #61	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8787.4	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #62	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5220.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #62	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4631.1	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #62	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8715.2	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #63	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5172.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #63	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4687.6	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #63	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8843.5	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #64	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5228.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #64	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4621.5	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #64	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8706.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #65	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5154.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #65	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4691.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #65	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8791.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #66	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5184.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #66	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4677.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #66	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8858.9	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5218.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4620.8	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8733.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5236.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4607.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8747.3	Standard polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5190.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4620.7	Standard non polar	33892256
Lewis y Tetrasaccharide,2TMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8687.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #1	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5109.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #1	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4669.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #1	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8013.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #10	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5143.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #10	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4682.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #10	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8012.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #100	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5139.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #100	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4703.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #100	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8101.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #101	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5091.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #101	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4708.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #101	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8144.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #102	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5145.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #102	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4670.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #102	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8064.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #103	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5092.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #103	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4679.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #103	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8030.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #104	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5108.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #104	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4675.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #104	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8070.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #105	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5145.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #105	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4668.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #105	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8064.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #106	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5091.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #106	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4679.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #106	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8030.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #107	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5108.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #107	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4678.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #107	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8070.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #108	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5130.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #108	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4724.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #108	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8146.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #109	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5142.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #109	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4702.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #109	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8260.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #11	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5096.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #11	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4695.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #11	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8186.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #110	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5084.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #110	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4713.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #110	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8221.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #111	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5117.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #111	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4708.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #111	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8262.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #112	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5142.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #112	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4700.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #112	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8260.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #113	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5082.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #113	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4712.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #113	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8221.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #114	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5117.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #114	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4710.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #114	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8261.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #115	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5112.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #115	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4765.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #115	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8285.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #116	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5132.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #116	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4669.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #116	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8085.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #117	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5132.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #117	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4683.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #117	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8150.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #118	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5187.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #118	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4661.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #118	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8172.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #119	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5134.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #119	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4671.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #119	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8133.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #12	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5141.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #12	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4657.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #12	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8063.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #120	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5163.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #120	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4669.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #120	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8174.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #121	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5145.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #121	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4723.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #121	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8215.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #122	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5136.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #122	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4673.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #122	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8106.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #123	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5134.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #123	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4670.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #123	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8133.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #124	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5079.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #124	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4679.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #124	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8096.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #125	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5115.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #125	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4679.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #125	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8136.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #126	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5103.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #126	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4733.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #126	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8173.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #127	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5163.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #127	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4666.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #127	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8175.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #128	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5113.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #128	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4676.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #128	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8137.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #129	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5144.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #129	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4673.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #129	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8177.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #13	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5154.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #13	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4662.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #13	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8123.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #130	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5124.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #130	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4730.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #130	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8216.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #131	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5132.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #131	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4668.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #131	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	8085.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #132	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5132.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #132	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4685.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #132	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8149.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #133	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5145.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #133	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4722.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #133	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8215.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #134	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5139.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #134	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4675.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #134	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	8106.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #135	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5103.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #135	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4732.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #135	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8173.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #136	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5125.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #136	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4734.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #136	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8215.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #137	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5130.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #137	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4670.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #137	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8061.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #138	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5074.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #138	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4681.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #138	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8028.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #139	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5090.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #139	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4675.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #139	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8067.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #14	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5097.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #14	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4672.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #14	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8087.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #140	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5130.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #140	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4669.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #140	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8061.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #141	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5073.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #141	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4681.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #141	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8028.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #142	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5091.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #142	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4677.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #142	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8067.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #143	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5107.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #143	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4716.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #143	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8115.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #144	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5135.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #144	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4672.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #144	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8095.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #145	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5135.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #145	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4687.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #145	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8160.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #146	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5189.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #146	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4664.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #146	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8182.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #147	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5133.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #147	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4675.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #147	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8143.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #148	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5165.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #148	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4672.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #148	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8184.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #149	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5146.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #149	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4720.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #149	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8205.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #15	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5129.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #15	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4670.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #15	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8125.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #150	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5138.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #150	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4676.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #150	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8116.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #151	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5133.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #151	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4674.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #151	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8143.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #152	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5077.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #152	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4684.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #152	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8106.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #153	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5112.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #153	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4682.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #153	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8146.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #154	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5105.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #154	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4731.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #154	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8163.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #155	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5164.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #155	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4669.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #155	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8185.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #156	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5111.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #156	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4680.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #156	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8146.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #157	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5143.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #157	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4676.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #157	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8186.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #158	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5122.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #158	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4726.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #158	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8206.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #159	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5134.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #159	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4671.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #159	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	8095.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #16	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5154.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #16	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4661.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #16	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8123.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #160	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5136.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #160	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4688.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #160	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8159.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #161	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5146.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #161	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4719.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #161	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8205.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #162	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5141.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #162	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4677.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #162	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	8115.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #163	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5105.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #163	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4730.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #163	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8163.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #164	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5124.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #164	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4730.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #164	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8205.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #165	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5134.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #165	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4645.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #165	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	7905.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #166	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5133.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #166	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4658.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #166	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7967.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #167	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5180.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #167	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4635.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #167	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7984.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #168	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5129.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #168	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4646.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #168	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7949.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #169	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5148.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #169	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4642.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #169	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	7989.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #17	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5097.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #17	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4673.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #17	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8087.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #170	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5153.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #170	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4685.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #170	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8062.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #171	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5137.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #171	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4647.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #171	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7928.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #172	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5129.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #172	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4644.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #172	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7949.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #173	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5073.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #173	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4654.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #173	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7915.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #174	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5092.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #174	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4652.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #174	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	7955.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #175	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5112.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #175	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4694.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #175	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8024.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #176	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5148.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #176	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4639.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #176	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7989.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #177	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5090.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #177	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4650.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #177	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7955.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #178	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5119.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #178	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4647.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #178	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	7994.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #179	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5126.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #179	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4692.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #179	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8066.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #18	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5132.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #18	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4669.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #18	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8127.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #180	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5134.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #180	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4644.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #180	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	7905.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #181	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5134.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #181	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4660.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #181	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	7966.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #182	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5154.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #182	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4684.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #182	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8062.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #183	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5139.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #183	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4649.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #183	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	7927.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #184	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5112.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #184	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4694.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #184	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8024.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #185	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5127.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #185	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4695.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #185	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8065.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #186	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5174.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #186	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4636.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #186	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8006.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #187	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5176.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #187	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4651.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #187	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8072.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #188	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5173.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #188	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4637.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #188	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	8006.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #189	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5177.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #189	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4654.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #189	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8072.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #19	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5121.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #19	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4717.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #19	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8149.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #190	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5173.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #190	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4685.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #190	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8136.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #191	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5181.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #191	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4639.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #191	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8027.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #192	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5124.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #192	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4646.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #192	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	7971.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #193	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5128.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #193	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4663.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #193	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8035.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #194	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5136.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #194	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4693.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #194	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8093.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #195	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5153.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #195	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4641.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #195	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	8011.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #196	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5156.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #196	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4657.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #196	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8075.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #197	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5152.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #197	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4692.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #197	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8137.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #198	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5166.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #198	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4652.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #198	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	7951.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #199	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5132.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #199	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4697.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #199	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8052.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #2	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5117.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #2	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4667.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #2	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	7999.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #20	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5125.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #20	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4668.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #20	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8016.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #200	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5140.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #200	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4713.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #200	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8111.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #201	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5124.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #201	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4647.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #201	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7971.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #202	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5127.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #202	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4662.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #202	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8035.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #203	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5183.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #203	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4641.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #203	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	8027.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #204	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5136.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #204	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4693.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #204	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8093.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #205	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5131.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #205	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4650.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #205	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7992.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #206	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5133.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #206	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4651.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #206	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	7992.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #207	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5096.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #207	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4701.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #207	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8052.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #208	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5165.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #208	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4644.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #208	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	8032.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #209	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5114.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #209	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4702.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #209	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8095.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #21	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5142.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #21	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4658.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #21	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8096.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #210	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	5132.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #210	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4707.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #210	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	8069.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #211	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5156.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #211	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4644.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #211	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8010.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #212	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5158.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #212	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4658.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #212	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8075.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #213	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5153.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #213	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4697.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #213	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8136.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #214	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5163.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #214	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4645.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #214	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8032.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #215	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5115.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #215	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4706.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #215	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8094.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #216	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5135.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #216	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4703.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #216	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8137.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #217	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5164.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #217	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4650.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #217	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7952.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #218	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5139.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #218	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4711.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #218	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8112.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #219	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5131.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #219	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4704.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #219	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8070.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #22	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5090.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #22	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4667.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #22	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8061.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #220	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5132.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #220	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4698.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #220	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8052.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #23	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5117.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #23	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4665.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #23	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8099.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #24	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5142.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #24	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4656.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #24	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8096.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #25	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5090.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #25	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4668.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #25	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8061.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #26	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5121.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #26	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4664.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #26	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8101.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #27	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5115.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #27	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4720.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #27	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8143.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #28	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5195.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #28	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4622.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #28	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	7972.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #29	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5142.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #29	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4632.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #29	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	7940.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #3	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5164.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #3	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4631.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #3	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	7879.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #30	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5170.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #30	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4628.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #30	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7977.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #31	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5194.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #31	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4621.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #31	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7973.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #32	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5142.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #32	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4634.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #32	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7940.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #33	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5172.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #33	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4628.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #33	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	7979.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #34	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5150.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #34	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4685.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #34	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8023.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #35	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5147.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #35	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4632.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #35	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	7952.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #36	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5150.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #36	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4652.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #36	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8013.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #37	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5194.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #37	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4626.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #37	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8035.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #38	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5144.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #38	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4636.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #38	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7998.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #39	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5181.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #39	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4635.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #39	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8038.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #4	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5164.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #4	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4634.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #4	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	7931.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #40	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5153.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #40	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4682.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #40	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8078.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #41	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5156.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #41	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4640.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #41	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7972.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #42	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5144.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #42	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4634.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #42	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7998.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #43	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5090.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #43	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4643.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #43	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7964.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #44	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5128.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #44	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4643.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #44	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8003.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #45	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5111.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #45	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4691.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #45	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8038.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #46	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5178.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #46	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4634.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #46	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8036.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #47	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5126.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #47	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4644.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #47	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8001.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #48	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5163.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #48	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4640.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #48	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8040.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #49	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5133.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #49	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4694.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #49	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8078.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5110.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4643.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	7900.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #50	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5146.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #50	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4633.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #50	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	7952.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #51	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5151.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #51	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4652.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #51	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8015.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #52	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5153.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #52	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4682.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #52	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8078.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #53	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5158.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #53	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4639.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #53	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	7974.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #54	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5111.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #54	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4691.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #54	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8038.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #55	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	5134.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #55	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4694.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #55	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	8079.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #56	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5125.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #56	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4676.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #56	CC(=O)NC1C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8036.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #57	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5129.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #57	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4685.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #57	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8031.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #58	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5175.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #58	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4641.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #58	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	7956.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #59	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5121.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #59	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4650.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #59	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	7923.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #6	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5135.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #6	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4642.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #6	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7936.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #60	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5142.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #60	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4645.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #60	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7963.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #61	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5176.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #61	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4640.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #61	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7956.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #62	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5121.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #62	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4651.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #62	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7923.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #63	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5142.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #63	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4647.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #63	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	7962.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #64	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5149.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #64	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4692.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #64	CC(=O)N(C1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8033.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #65	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5108.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #65	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4717.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #65	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8220.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #66	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5168.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #66	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4670.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #66	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8149.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #67	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5110.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #67	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4679.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #67	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8112.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #68	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5142.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #68	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4674.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #68	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8152.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #69	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5168.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #69	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4668.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #69	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8149.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #7	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5164.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #7	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4632.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #7	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	7931.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #70	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5110.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #70	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4680.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #70	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8112.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #71	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5143.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #71	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4676.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #71	CC(=O)NC1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8152.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #72	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5131.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #72	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4726.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #72	CC(=O)N(C1C(O)OC(CO[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8171.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #73	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5155.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #73	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4677.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #73	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	8132.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #74	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5103.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #74	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4686.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #74	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	8095.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #75	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5130.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #75	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4680.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #75	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8135.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #76	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5155.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #76	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4675.2	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #76	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8132.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #77	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5102.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #77	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4687.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #77	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8095.7	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #78	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5131.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #78	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4682.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #78	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8135.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #79	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5130.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #79	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4740.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #79	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8173.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #8	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5110.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #8	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4643.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #8	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7900.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #80	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5156.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #80	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4643.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #80	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	7977.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #81	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5159.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #81	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4656.0	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #81	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	8041.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #82	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5201.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #82	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4634.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #82	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8062.3	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #83	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5152.0	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #83	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4645.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #83	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8025.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #84	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5183.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #84	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4642.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #84	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8065.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #85	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5159.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #85	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4694.1	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #85	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O[Si](C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8100.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #86	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5161.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #86	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4644.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #86	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O	7999.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #87	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5151.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #87	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4642.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #87	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8025.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #88	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5103.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #88	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4652.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #88	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	7989.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #89	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5135.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #89	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4650.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #89	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8028.4	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #9	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5135.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #9	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4641.8	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #9	CC(=O)NC1C(O[Si](C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	7938.9	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #90	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5118.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #90	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4703.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #90	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8060.2	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #91	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	5181.4	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #91	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	4637.3	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #91	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	8065.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #92	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	5133.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #92	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	4648.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #92	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	8029.1	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #93	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	5162.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #93	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	4643.5	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #93	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	8068.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #94	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	5137.7	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #94	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	4699.4	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #94	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C	8103.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #95	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5155.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #95	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4643.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #95	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	7977.5	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #96	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5160.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #96	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4658.6	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #96	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	8040.8	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #97	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	5159.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #97	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4692.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #97	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	8101.0	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #98	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5163.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #98	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4646.7	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #98	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	7998.6	Standard polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #99	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	5118.6	Semi standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #99	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4702.9	Standard non polar	33892256
Lewis y Tetrasaccharide,3TMS,isomer #99	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	8060.3	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #1	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5478.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #1	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4805.6	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #1	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9215.7	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	5453.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	4828.8	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #10	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1OC1OC(C)C(O)C(O)C1O	9233.7	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #11	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5486.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #11	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4817.1	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #11	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9313.5	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #12	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	5437.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #12	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4875.5	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #12	CC(=O)N(C1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	9288.3	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #2	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5476.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #2	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4814.9	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #2	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9242.0	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5456.3	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4896.1	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #3	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9400.8	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #4	CC(=O)NC1C(O)OC(CO[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5458.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #4	CC(=O)NC1C(O)OC(CO[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4904.3	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #4	CC(=O)NC1C(O)OC(CO[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9409.6	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C(C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	5489.2	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C(C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	4824.7	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #5	CC(=O)NC1C(O[Si](C)(C)C(C)(C)C)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O	9166.7	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5486.8	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4817.2	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #6	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	9313.5	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5453.1	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4829.5	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #7	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	9233.7	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5459.9	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4831.5	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #8	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)C1OC1OC(C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	9285.8	Standard polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1OC1OC(C)C(O)C(O)C1O	5466.5	Semi standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1OC1OC(C)C(O)C(O)C1O	4830.0	Standard non polar	33892256
Lewis y Tetrasaccharide,1TBDMS,isomer #9	CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1OC1OC(C)C(O)C(O)C1O	9286.8	Standard polar	33892256

Spectra

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lewis y Tetrasaccharide 10V, Positive-QTOF	splash10-056r-0000039000-987aeb0b11a33016890a	2021-10-12	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lewis y Tetrasaccharide 20V, Positive-QTOF	splash10-001i-0906085000-c36cb79c313a08611a07	2021-10-12	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lewis y Tetrasaccharide 40V, Positive-QTOF	splash10-0079-9300021000-46cc949afdea48983fc5	2021-10-12	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lewis y Tetrasaccharide 10V, Negative-QTOF	splash10-00di-0000029000-b33930c466edf5511b7c	2021-10-12	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lewis y Tetrasaccharide 20V, Negative-QTOF	splash10-0aba-6603079000-b6f4997cc36be7e7e7eb	2021-10-12	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lewis y Tetrasaccharide 40V, Negative-QTOF	splash10-0gb9-2093000000-ae095c67c55cca21a375	2021-10-12	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-10-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Blood

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Biospecimen	Status	Value	Age	Sex	Condition	Reference	Details
Blood	Detected but not Quantified	Not Quantified	Not Specified	Not Specified	Normal	31557052	details

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

3324022

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

4110340

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Barupal DK, Fiehn O: Generating the Blood Exposome Database Using a Comprehensive Text Mining and Database Fusion Approach. Environ Health Perspect. 2019 Sep;127(9):97008. doi: 10.1289/EHP4713. Epub 2019 Sep 26. [PubMed:31557052 ]

Showing metabocard for Lewis y Tetrasaccharide (HMDB0254068)

MOL for HMDB0254068 (Lewis y Tetrasaccharide)

3D MOL for HMDB0254068 (Lewis y Tetrasaccharide)

3D SDF for HMDB0254068 (Lewis y Tetrasaccharide)

3D-SDF for HMDB0254068 (Lewis y Tetrasaccharide)

PDB for HMDB0254068 (Lewis y Tetrasaccharide)

3D PDB for HMDB0254068 (Lewis y Tetrasaccharide)

SMILES for HMDB0254068 (Lewis y Tetrasaccharide)

INCHI for HMDB0254068 (Lewis y Tetrasaccharide)

Structure for HMDB0254068 (Lewis y Tetrasaccharide)

3D Structure for HMDB0254068 (Lewis y Tetrasaccharide)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Derivatized

MS/MS Spectra

NMR Spectra