Showing metabocard for Vinleucinol (HMDB0259818)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-11 22:44:57 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-26 23:17:37 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0259818 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Vinleucinol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | N-(1-ethoxy-3-methyl-1-oxopentan-2-yl)-12-ethyl-4-[17-ethyl-17-hydroxy-13-(methoxycarbonyl)-1,11-diazatetracyclo[13.3.1.0⁴,¹².0⁵,¹⁰]nonadeca-4(12),5,7,9-tetraen-13-yl]-10,11-dihydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.0¹,⁹.0²,⁷.0¹⁶,¹⁹]nonadeca-2,4,6,13-tetraene-10-carboximidic acid belongs to the class of organic compounds known as vinca alkaloids. These are alkaloids with a dimeric chemical structure composed of an indole nucleus (catharanthine), and a dihydroindole nucleus (vindoline), joined together. Based on a literature review very few articles have been published on N-(1-ethoxy-3-methyl-1-oxopentan-2-yl)-12-ethyl-4-[17-ethyl-17-hydroxy-13-(methoxycarbonyl)-1,11-diazatetracyclo[13.3.1.0⁴,¹².0⁵,¹⁰]nonadeca-4(12),5,7,9-tetraen-13-yl]-10,11-dihydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.0¹,⁹.0²,⁷.0¹⁶,¹⁹]nonadeca-2,4,6,13-tetraene-10-carboximidic acid. This compound has been identified in human blood as reported by (PMID: 31557052 ). Vinleucinol is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically Vinleucinol is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0259818 (Vinleucinol)Mrv1652309122100452D 65 73 0 0 0 0 999 V2000 0.1786 -0.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0035 -0.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4042 0.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9800 1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2291 0.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6298 1.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4547 1.4616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2057 2.1557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6064 2.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1822 3.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6533 0.0193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2525 -0.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4276 -0.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6767 -1.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3173 -1.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1874 -2.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7059 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2558 -4.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2869 -3.8535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4169 -3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7763 -2.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9062 -1.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2656 -1.1844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0057 -2.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8758 -3.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5164 -4.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1357 -1.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3651 -2.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9221 -3.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1347 -3.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9314 -4.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5154 -3.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3027 -2.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5060 -2.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1323 -1.8011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5076 -1.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3120 -3.7624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8960 -3.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1441 -4.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2847 -4.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5618 -5.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6982 -5.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3410 -6.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8583 -6.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7308 -6.9069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7191 -6.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5428 -7.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3768 -7.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8567 -6.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7651 -5.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5166 -5.1596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.0726 -5.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8976 -5.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3147 -6.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9069 -7.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0819 -7.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6647 -6.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6627 -6.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7302 -7.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5758 -5.9874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8502 -4.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6604 -4.6567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8338 -3.6764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5399 -3.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2999 -0.8688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 5 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 16 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 14 22 1 0 0 0 0 22 23 1 0 0 0 0 21 24 1 0 0 0 0 24 25 2 0 0 0 0 25 26 1 0 0 0 0 19 26 1 0 0 0 0 21 27 1 0 0 0 0 27 28 1 0 0 0 0 16 29 1 0 0 0 0 29 30 2 0 0 0 0 30 31 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 33 34 2 0 0 0 0 29 34 1 0 0 0 0 34 35 1 0 0 0 0 15 35 1 0 0 0 0 35 36 1 0 0 0 0 32 37 1 0 0 0 0 37 38 1 0 0 0 0 31 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 41 46 1 0 0 0 0 45 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 2 0 0 0 0 39 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 2 0 0 0 0 53 54 1 0 0 0 0 54 55 2 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 49 57 1 0 0 0 0 52 57 1 0 0 0 0 43 58 1 0 0 0 0 58 59 1 0 0 0 0 43 60 1 0 0 0 0 39 61 1 0 0 0 0 61 62 2 0 0 0 0 61 63 1 0 0 0 0 63 64 1 0 0 0 0 14 65 1 0 0 0 0 M END 3D MOL for HMDB0259818 (Vinleucinol)HMDB0259818 RDKit 3D Vinleucinol 134142 0 0 0 0 0 0 0 0999 V2000 9.7641 1.4948 0.1049 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8919 0.9571 -1.3073 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9496 -0.0456 -1.4871 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5737 0.0669 -1.3958 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1228 1.1929 -1.1219 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7762 -1.1645 -1.6336 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3953 -0.9236 -1.4410 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7391 -0.1969 -0.4210 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4679 0.3134 0.4678 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2558 -0.0035 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7604 -0.8609 -1.3625 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7783 1.3423 -0.7048 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7063 1.2373 -1.6216 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4070 2.2941 0.3673 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5649 3.2623 0.5645 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3390 4.2891 1.6197 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2757 3.1559 -0.1131 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4178 3.5816 0.7849 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4715 3.2810 2.2413 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3273 2.2513 2.6094 N 0 0 0 0 0 0 0 0 0 0 0 0 0.9165 1.2673 3.5414 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6177 -0.0448 3.1269 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6932 0.1913 1.6101 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5146 -0.3042 0.9819 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7946 0.1553 0.7826 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7837 -0.5530 0.1603 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1470 -0.0650 -0.0925 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1758 -0.0643 -1.5925 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6083 0.9614 -2.1096 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7056 -0.9824 -2.4214 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7281 -0.9768 -3.8106 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0639 -1.1211 0.5228 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4513 -0.9728 0.0663 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2436 0.0730 0.8636 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0965 0.6392 -0.1142 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.7510 1.7358 -0.8631 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3023 1.9867 -1.2579 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4204 2.1228 -0.0977 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5204 1.2509 0.4551 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0938 1.8223 1.6015 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.6475 3.0186 1.8335 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4971 3.9395 2.8643 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2040 5.1129 2.8432 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0435 5.3374 1.7947 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2021 4.4248 0.7600 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4822 3.2278 0.7798 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9540 -0.3631 -0.6232 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6412 -1.7856 -0.4893 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6676 -2.4159 -1.7613 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7508 -2.5008 0.2850 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4713 -3.9731 0.4282 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3386 -2.1961 0.1375 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4138 -1.8222 -0.3024 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2957 -2.6424 -0.9583 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0012 -3.9167 -1.4464 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1418 -2.3200 -0.1335 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8085 -1.5636 0.5044 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1819 -1.8885 0.8018 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7770 -3.1983 0.9203 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8209 -0.5797 0.9588 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1203 1.5971 1.6192 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3701 -2.2870 -0.8947 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7810 -2.5423 -1.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5731 -3.5672 -0.9324 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3167 -4.6173 -0.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8469 2.0966 0.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6479 0.5837 0.7553 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6669 2.0420 0.4236 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8462 1.7651 -2.0601 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9015 0.4657 -1.3456 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9322 -1.3065 -2.7738 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6960 -1.3328 -2.1511 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9683 -1.7916 -1.1938 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5998 1.8084 -1.3327 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0089 1.2171 -2.5568 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6403 3.8248 -0.4118 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5291 2.8017 0.7274 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2563 3.8783 2.6430 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5693 5.0485 1.3671 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2972 4.8935 1.6546 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1802 3.4112 -1.1684 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3999 4.2042 0.4394 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6959 4.2216 2.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5806 3.0206 2.5598 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3064 1.5314 4.5421 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1699 1.1161 3.6392 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6265 -0.0959 3.5152 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9458 -0.8805 3.3530 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9909 1.1708 1.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7013 -1.4550 -4.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6708 0.0656 -4.1614 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9427 -1.6217 -4.2484 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0709 -0.8059 1.6333 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6364 -2.0816 0.5020 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4407 -0.7433 -1.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9428 -0.4372 1.6034 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6506 0.7047 1.4950 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3048 1.7336 -1.8362 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0987 2.6575 -0.3527 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3748 3.0142 -1.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9989 1.3876 -2.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4351 1.3967 2.3449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8235 3.7098 3.6658 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0687 5.8094 3.6557 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6132 6.2575 1.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8721 4.6552 -0.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9718 -0.1672 -0.1662 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1457 -0.1177 -1.7118 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1242 -1.9225 -2.4047 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7376 -2.3104 -0.1354 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7281 -2.0807 1.3299 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4078 -4.4051 -0.5971 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3365 -4.4094 0.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5769 -4.1621 1.0430 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8319 -3.0049 -0.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5281 -2.4865 1.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9112 -4.3340 -1.9427 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1990 -3.8427 -2.2060 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7292 -4.6484 -0.6659 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1121 -3.3243 -0.5084 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1810 -3.7534 1.7033 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7096 -3.8212 0.0190 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8000 -3.0808 1.3256 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6327 -0.6948 1.6939 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1578 1.5452 2.1445 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4760 -2.0558 0.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5615 -2.1142 -0.7027 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9609 -2.1234 -2.3842 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9556 -3.6483 -1.5124 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4801 -3.9657 -1.9558 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6110 -3.3722 -0.4276 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9003 -5.2852 -0.7877 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9232 -4.1937 0.6760 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5545 -5.2862 0.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 14 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 1 0 27 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 2 0 35 47 1 0 47 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 48 52 1 0 26 53 2 0 53 54 1 0 54 55 1 0 53 56 1 0 56 57 2 0 57 58 1 0 58 59 1 0 58 60 1 0 23 61 1 0 6 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 60 10 1 0 61 14 1 0 61 20 1 0 60 23 1 0 57 24 1 0 39 27 1 0 46 41 1 0 52 33 1 0 46 38 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 0 2 70 1 0 6 71 1 0 7 72 1 0 11 73 1 0 12 74 1 0 13 75 1 0 15 76 1 0 15 77 1 0 16 78 1 0 16 79 1 0 16 80 1 0 17 81 1 0 18 82 1 0 19 83 1 0 19 84 1 0 21 85 1 0 21 86 1 0 22 87 1 0 22 88 1 0 25 89 1 0 31 90 1 0 31 91 1 0 31 92 1 0 32 93 1 0 32 94 1 0 33 95 1 0 34 96 1 0 34 97 1 0 36 98 1 0 36 99 1 0 37100 1 0 37101 1 0 40102 1 0 42103 1 0 43104 1 0 44105 1 0 45106 1 0 47107 1 0 47108 1 0 49109 1 0 50110 1 0 50111 1 0 51112 1 0 51113 1 0 51114 1 0 52115 1 0 52116 1 0 55117 1 0 55118 1 0 55119 1 0 56120 1 0 59121 1 0 59122 1 0 59123 1 0 60124 1 0 61125 1 0 62126 1 0 63127 1 0 63128 1 0 63129 1 0 64130 1 0 64131 1 0 65132 1 0 65133 1 0 65134 1 0 M END 3D SDF for HMDB0259818 (Vinleucinol)Mrv1652309122100452D 65 73 0 0 0 0 999 V2000 0.1786 -0.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0035 -0.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4042 0.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9800 1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2291 0.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6298 1.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4547 1.4616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2057 2.1557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6064 2.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1822 3.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6533 0.0193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2525 -0.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4276 -0.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6767 -1.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3173 -1.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1874 -2.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7059 -3.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2558 -4.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2869 -3.8535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4169 -3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7763 -2.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9062 -1.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2656 -1.1844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0057 -2.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8758 -3.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5164 -4.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1357 -1.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3651 -2.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9221 -3.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1347 -3.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9314 -4.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5154 -3.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3027 -2.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5060 -2.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1323 -1.8011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5076 -1.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3120 -3.7624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8960 -3.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1441 -4.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2847 -4.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5618 -5.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6982 -5.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3410 -6.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8583 -6.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7308 -6.9069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7191 -6.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5428 -7.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3768 -7.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8567 -6.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7651 -5.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5166 -5.1596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.0726 -5.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8976 -5.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3147 -6.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9069 -7.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0819 -7.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6647 -6.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6627 -6.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7302 -7.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5758 -5.9874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8502 -4.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6604 -4.6567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8338 -3.6764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5399 -3.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2999 -0.8688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 5 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 16 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 14 22 1 0 0 0 0 22 23 1 0 0 0 0 21 24 1 0 0 0 0 24 25 2 0 0 0 0 25 26 1 0 0 0 0 19 26 1 0 0 0 0 21 27 1 0 0 0 0 27 28 1 0 0 0 0 16 29 1 0 0 0 0 29 30 2 0 0 0 0 30 31 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 33 34 2 0 0 0 0 29 34 1 0 0 0 0 34 35 1 0 0 0 0 15 35 1 0 0 0 0 35 36 1 0 0 0 0 32 37 1 0 0 0 0 37 38 1 0 0 0 0 31 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 41 46 1 0 0 0 0 45 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 2 0 0 0 0 39 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 2 0 0 0 0 53 54 1 0 0 0 0 54 55 2 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 49 57 1 0 0 0 0 52 57 1 0 0 0 0 43 58 1 0 0 0 0 58 59 1 0 0 0 0 43 60 1 0 0 0 0 39 61 1 0 0 0 0 61 62 2 0 0 0 0 61 63 1 0 0 0 0 63 64 1 0 0 0 0 14 65 1 0 0 0 0 M END > <DATABASE_ID> HMDB0259818 > <DATABASE_NAME> hmdb > <SMILES> CCOC(=O)C(NC(=O)C1(O)C2N(C)C3=CC(OC)=C(C=C3C22CCN3CC=CC(CC)(C23)C1O)C1(CC2CN(CC(O)(CC)C2)CCC2=C1NC1=CC=CC=C21)C(=O)OC)C(C)CC > <INCHI_IDENTIFIER> InChI=1S/C51H69N5O9/c1-9-30(5)39(41(57)65-12-4)53-45(59)51(62)43-49(20-23-56-21-15-19-48(11-3,42(49)56)44(51)58)34-24-35(38(63-7)25-37(34)54(43)6)50(46(60)64-8)27-31-26-47(61,10-2)29-55(28-31)22-18-33-32-16-13-14-17-36(32)52-40(33)50/h13-17,19,24-25,30-31,39,42-44,52,58,61-62H,9-12,18,20-23,26-29H2,1-8H3,(H,53,59) > <INCHI_KEY> QSTPFUDHVVIGCL-UHFFFAOYSA-N > <FORMULA> C51H69N5O9 > <MOLECULAR_WEIGHT> 896.139 > <EXACT_MASS> 895.509528822 > <JCHEM_ACCEPTOR_COUNT> 10 > <JCHEM_ATOM_COUNT> 134 > <JCHEM_AVERAGE_POLARIZABILITY> 99.03463888969046 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 5 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> methyl 13-{10-[(1-ethoxy-3-methyl-1-oxopentan-2-yl)carbamoyl]-12-ethyl-10,11-dihydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.0^{1,9}.0^{2,7}.0^{16,19}]nonadeca-2,4,6,13-tetraen-4-yl}-17-ethyl-17-hydroxy-1,11-diazatetracyclo[13.3.1.0^{4,12}.0^{5,10}]nonadeca-4(12),5,7,9-tetraene-13-carboxylate > <ALOGPS_LOGP> 4.39 > <JCHEM_LOGP> 4.894372721333334 > <ALOGPS_LOGS> -4.65 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 9 > <JCHEM_PHYSIOLOGICAL_CHARGE> 2 > <JCHEM_PKA> 12.32174274679226 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.227984528209259 > <JCHEM_PKA_STRONGEST_BASIC> 8.676118759302359 > <JCHEM_POLAR_SURFACE_AREA> 177.12999999999997 > <JCHEM_REFRACTIVITY> 248.91169999999994 > <JCHEM_ROTATABLE_BOND_COUNT> 13 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 2.02e-02 g/l > <JCHEM_TRADITIONAL_IUPAC> methyl 13-{10-[(1-ethoxy-3-methyl-1-oxopentan-2-yl)carbamoyl]-12-ethyl-10,11-dihydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.0^{1,9}.0^{2,7}.0^{16,19}]nonadeca-2,4,6,13-tetraen-4-yl}-17-ethyl-17-hydroxy-1,11-diazatetracyclo[13.3.1.0^{4,12}.0^{5,10}]nonadeca-4(12),5,7,9-tetraene-13-carboxylate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0259818 (Vinleucinol)HMDB0259818 RDKit 3D Vinleucinol 134142 0 0 0 0 0 0 0 0999 V2000 9.7641 1.4948 0.1049 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8919 0.9571 -1.3073 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9496 -0.0456 -1.4871 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5737 0.0669 -1.3958 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1228 1.1929 -1.1219 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7762 -1.1645 -1.6336 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3953 -0.9236 -1.4410 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7391 -0.1969 -0.4210 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4679 0.3134 0.4678 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2558 -0.0035 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7604 -0.8609 -1.3625 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7783 1.3423 -0.7048 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7063 1.2373 -1.6216 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4070 2.2941 0.3673 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5649 3.2623 0.5645 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3390 4.2891 1.6197 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2757 3.1559 -0.1131 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4178 3.5816 0.7849 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4715 3.2810 2.2413 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3273 2.2513 2.6094 N 0 0 0 0 0 0 0 0 0 0 0 0 0.9165 1.2673 3.5414 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6177 -0.0448 3.1269 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6932 0.1913 1.6101 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5146 -0.3042 0.9819 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7946 0.1553 0.7826 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7837 -0.5530 0.1603 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1470 -0.0650 -0.0925 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1758 -0.0643 -1.5925 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6083 0.9614 -2.1096 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7056 -0.9824 -2.4214 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7281 -0.9768 -3.8106 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0639 -1.1211 0.5228 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4513 -0.9728 0.0663 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2436 0.0730 0.8636 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0965 0.6392 -0.1142 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.7510 1.7358 -0.8631 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3023 1.9867 -1.2579 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4204 2.1228 -0.0977 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5204 1.2509 0.4551 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0938 1.8223 1.6015 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.6475 3.0186 1.8335 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4971 3.9395 2.8643 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2040 5.1129 2.8432 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0435 5.3374 1.7947 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2021 4.4248 0.7600 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4822 3.2278 0.7798 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9540 -0.3631 -0.6232 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6412 -1.7856 -0.4893 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6676 -2.4159 -1.7613 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7508 -2.5008 0.2850 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4713 -3.9731 0.4282 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3386 -2.1961 0.1375 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4138 -1.8222 -0.3024 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2957 -2.6424 -0.9583 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0012 -3.9167 -1.4464 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1418 -2.3200 -0.1335 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8085 -1.5636 0.5044 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1819 -1.8885 0.8018 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7770 -3.1983 0.9203 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8209 -0.5797 0.9588 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1203 1.5971 1.6192 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3701 -2.2870 -0.8947 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7810 -2.5423 -1.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5731 -3.5672 -0.9324 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3167 -4.6173 -0.1276 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8469 2.0966 0.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6479 0.5837 0.7553 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6669 2.0420 0.4236 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8462 1.7651 -2.0601 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9015 0.4657 -1.3456 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9322 -1.3065 -2.7738 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6960 -1.3328 -2.1511 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9683 -1.7916 -1.1938 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5998 1.8084 -1.3327 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0089 1.2171 -2.5568 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6403 3.8248 -0.4118 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5291 2.8017 0.7274 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2563 3.8783 2.6430 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5693 5.0485 1.3671 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2972 4.8935 1.6546 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1802 3.4112 -1.1684 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3999 4.2042 0.4394 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6959 4.2216 2.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5806 3.0206 2.5598 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3064 1.5314 4.5421 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1699 1.1161 3.6392 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6265 -0.0959 3.5152 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9458 -0.8805 3.3530 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9909 1.1708 1.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7013 -1.4550 -4.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6708 0.0656 -4.1614 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9427 -1.6217 -4.2484 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0709 -0.8059 1.6333 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6364 -2.0816 0.5020 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4407 -0.7433 -1.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9428 -0.4372 1.6034 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6506 0.7047 1.4950 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3048 1.7336 -1.8362 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0987 2.6575 -0.3527 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3748 3.0142 -1.7490 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9989 1.3876 -2.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4351 1.3967 2.3449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8235 3.7098 3.6658 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0687 5.8094 3.6557 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6132 6.2575 1.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8721 4.6552 -0.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9718 -0.1672 -0.1662 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1457 -0.1177 -1.7118 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1242 -1.9225 -2.4047 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7376 -2.3104 -0.1354 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7281 -2.0807 1.3299 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4078 -4.4051 -0.5971 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3365 -4.4094 0.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5769 -4.1621 1.0430 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8319 -3.0049 -0.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5281 -2.4865 1.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9112 -4.3340 -1.9427 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1990 -3.8427 -2.2060 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7292 -4.6484 -0.6659 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1121 -3.3243 -0.5084 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1810 -3.7534 1.7033 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7096 -3.8212 0.0190 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8000 -3.0808 1.3256 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6327 -0.6948 1.6939 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1578 1.5452 2.1445 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4760 -2.0558 0.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5615 -2.1142 -0.7027 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9609 -2.1234 -2.3842 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9556 -3.6483 -1.5124 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4801 -3.9657 -1.9558 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6110 -3.3722 -0.4276 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9003 -5.2852 -0.7877 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9232 -4.1937 0.6760 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5545 -5.2862 0.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 14 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 1 0 27 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 2 0 35 47 1 0 47 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 48 52 1 0 26 53 2 0 53 54 1 0 54 55 1 0 53 56 1 0 56 57 2 0 57 58 1 0 58 59 1 0 58 60 1 0 23 61 1 0 6 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 60 10 1 0 61 14 1 0 61 20 1 0 60 23 1 0 57 24 1 0 39 27 1 0 46 41 1 0 52 33 1 0 46 38 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 0 2 70 1 0 6 71 1 0 7 72 1 0 11 73 1 0 12 74 1 0 13 75 1 0 15 76 1 0 15 77 1 0 16 78 1 0 16 79 1 0 16 80 1 0 17 81 1 0 18 82 1 0 19 83 1 0 19 84 1 0 21 85 1 0 21 86 1 0 22 87 1 0 22 88 1 0 25 89 1 0 31 90 1 0 31 91 1 0 31 92 1 0 32 93 1 0 32 94 1 0 33 95 1 0 34 96 1 0 34 97 1 0 36 98 1 0 36 99 1 0 37100 1 0 37101 1 0 40102 1 0 42103 1 0 43104 1 0 44105 1 0 45106 1 0 47107 1 0 47108 1 0 49109 1 0 50110 1 0 50111 1 0 51112 1 0 51113 1 0 51114 1 0 52115 1 0 52116 1 0 55117 1 0 55118 1 0 55119 1 0 56120 1 0 59121 1 0 59122 1 0 59123 1 0 60124 1 0 61125 1 0 62126 1 0 63127 1 0 63128 1 0 63129 1 0 64130 1 0 64131 1 0 65132 1 0 65133 1 0 65134 1 0 M END PDB for HMDB0259818 (Vinleucinol)HEADER PROTEIN 12-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 12-SEP-21 0 HETATM 1 C UNK 0 0.333 -0.040 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 1.873 -0.014 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 2.621 1.332 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 1.829 2.653 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 4.161 1.357 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 4.909 2.703 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 6.449 2.728 0.000 0.00 0.00 O+0 HETATM 8 O UNK 0 4.117 4.024 0.000 0.00 0.00 O+0 HETATM 9 C UNK 0 4.865 5.370 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 4.074 6.691 0.000 0.00 0.00 C+0 HETATM 11 N UNK 0 4.953 0.036 0.000 0.00 0.00 N+0 HETATM 12 C UNK 0 4.205 -1.310 0.000 0.00 0.00 C+0 HETATM 13 O UNK 0 2.665 -1.335 0.000 0.00 0.00 O+0 HETATM 14 C UNK 0 4.996 -2.631 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 6.192 -3.601 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 5.950 -5.122 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 6.918 -6.320 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 6.078 -7.611 0.000 0.00 0.00 C+0 HETATM 19 N UNK 0 4.269 -7.193 0.000 0.00 0.00 N+0 HETATM 20 C UNK 0 4.511 -5.672 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 3.316 -4.702 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 3.558 -3.181 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 2.362 -2.211 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 1.877 -5.252 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 1.635 -6.773 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 2.831 -7.744 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 2.120 -3.732 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 0.682 -4.282 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 7.321 -5.823 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 7.718 -7.311 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 9.205 -7.711 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 10.295 -6.623 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 9.898 -5.135 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 8.411 -4.735 0.000 0.00 0.00 C+0 HETATM 35 N UNK 0 7.714 -3.362 0.000 0.00 0.00 N+0 HETATM 36 C UNK 0 8.414 -1.991 0.000 0.00 0.00 C+0 HETATM 37 O UNK 0 11.782 -7.023 0.000 0.00 0.00 O+0 HETATM 38 C UNK 0 12.873 -5.935 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 9.602 -9.199 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 7.998 -9.163 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 6.649 -10.067 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 5.037 -10.323 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 4.370 -11.752 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 5.336 -12.999 0.000 0.00 0.00 C+0 HETATM 45 N UNK 0 6.964 -12.893 0.000 0.00 0.00 N+0 HETATM 46 C UNK 0 6.942 -11.465 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 8.480 -13.477 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 10.037 -13.088 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 10.932 -11.797 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 10.762 -10.267 0.000 0.00 0.00 C+0 HETATM 51 N UNK 0 12.164 -9.631 0.000 0.00 0.00 N+0 HETATM 52 C UNK 0 13.202 -10.769 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 14.742 -10.759 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 15.521 -12.088 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 14.759 -13.426 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 13.220 -13.436 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 12.441 -12.108 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 3.104 -12.629 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 3.230 -14.164 0.000 0.00 0.00 C+0 HETATM 60 O UNK 0 2.942 -11.176 0.000 0.00 0.00 O+0 HETATM 61 C UNK 0 10.920 -8.402 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 12.433 -8.692 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 10.890 -6.863 0.000 0.00 0.00 O+0 HETATM 64 C UNK 0 12.208 -6.066 0.000 0.00 0.00 C+0 HETATM 65 O UNK 0 6.160 -1.622 0.000 0.00 0.00 O+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 5 CONECT 4 3 CONECT 5 3 6 11 CONECT 6 5 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 10 CONECT 10 9 CONECT 11 5 12 CONECT 12 11 13 14 CONECT 13 12 CONECT 14 12 15 22 65 CONECT 15 14 16 35 CONECT 16 15 17 20 29 CONECT 17 16 18 CONECT 18 17 19 CONECT 19 18 20 26 CONECT 20 19 16 21 CONECT 21 20 22 24 27 CONECT 22 21 14 23 CONECT 23 22 CONECT 24 21 25 CONECT 25 24 26 CONECT 26 25 19 CONECT 27 21 28 CONECT 28 27 CONECT 29 16 30 34 CONECT 30 29 31 CONECT 31 30 32 39 CONECT 32 31 33 37 CONECT 33 32 34 CONECT 34 33 29 35 CONECT 35 34 15 36 CONECT 36 35 CONECT 37 32 38 CONECT 38 37 CONECT 39 31 40 50 61 CONECT 40 39 41 CONECT 41 40 42 46 CONECT 42 41 43 CONECT 43 42 44 58 60 CONECT 44 43 45 CONECT 45 44 46 47 CONECT 46 45 41 CONECT 47 45 48 CONECT 48 47 49 CONECT 49 48 50 57 CONECT 50 49 39 51 CONECT 51 50 52 CONECT 52 51 53 57 CONECT 53 52 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 49 52 CONECT 58 43 59 CONECT 59 58 CONECT 60 43 CONECT 61 39 62 63 CONECT 62 61 CONECT 63 61 64 CONECT 64 63 CONECT 65 14 MASTER 0 0 0 0 0 0 0 0 65 0 146 0 END 3D PDB for HMDB0259818 (Vinleucinol)COMPND HMDB0259818 HETATM 1 C1 UNL 1 9.764 1.495 0.105 1.00 0.00 C HETATM 2 C2 UNL 1 9.892 0.957 -1.307 1.00 0.00 C HETATM 3 O1 UNL 1 8.950 -0.046 -1.487 1.00 0.00 O HETATM 4 C3 UNL 1 7.574 0.067 -1.396 1.00 0.00 C HETATM 5 O2 UNL 1 7.123 1.193 -1.122 1.00 0.00 O HETATM 6 C4 UNL 1 6.776 -1.164 -1.634 1.00 0.00 C HETATM 7 N1 UNL 1 5.395 -0.924 -1.441 1.00 0.00 N HETATM 8 C5 UNL 1 4.739 -0.197 -0.421 1.00 0.00 C HETATM 9 O3 UNL 1 5.468 0.313 0.468 1.00 0.00 O HETATM 10 C6 UNL 1 3.256 -0.003 -0.341 1.00 0.00 C HETATM 11 O4 UNL 1 2.760 -0.861 -1.362 1.00 0.00 O HETATM 12 C7 UNL 1 2.778 1.342 -0.705 1.00 0.00 C HETATM 13 O5 UNL 1 1.706 1.237 -1.622 1.00 0.00 O HETATM 14 C8 UNL 1 2.407 2.294 0.367 1.00 0.00 C HETATM 15 C9 UNL 1 3.565 3.262 0.565 1.00 0.00 C HETATM 16 C10 UNL 1 3.339 4.289 1.620 1.00 0.00 C HETATM 17 C11 UNL 1 1.276 3.156 -0.113 1.00 0.00 C HETATM 18 C12 UNL 1 0.418 3.582 0.785 1.00 0.00 C HETATM 19 C13 UNL 1 0.471 3.281 2.241 1.00 0.00 C HETATM 20 N2 UNL 1 1.327 2.251 2.609 1.00 0.00 N HETATM 21 C14 UNL 1 0.917 1.267 3.541 1.00 0.00 C HETATM 22 C15 UNL 1 1.618 -0.045 3.127 1.00 0.00 C HETATM 23 C16 UNL 1 1.693 0.191 1.610 1.00 0.00 C HETATM 24 C17 UNL 1 0.515 -0.304 0.982 1.00 0.00 C HETATM 25 C18 UNL 1 -0.795 0.155 0.783 1.00 0.00 C HETATM 26 C19 UNL 1 -1.784 -0.553 0.160 1.00 0.00 C HETATM 27 C20 UNL 1 -3.147 -0.065 -0.092 1.00 0.00 C HETATM 28 C21 UNL 1 -3.176 -0.064 -1.592 1.00 0.00 C HETATM 29 O6 UNL 1 -2.608 0.961 -2.110 1.00 0.00 O HETATM 30 O7 UNL 1 -3.706 -0.982 -2.421 1.00 0.00 O HETATM 31 C22 UNL 1 -3.728 -0.977 -3.811 1.00 0.00 C HETATM 32 C23 UNL 1 -4.064 -1.121 0.523 1.00 0.00 C HETATM 33 C24 UNL 1 -5.451 -0.973 0.066 1.00 0.00 C HETATM 34 C25 UNL 1 -6.244 0.073 0.864 1.00 0.00 C HETATM 35 N3 UNL 1 -7.096 0.639 -0.114 1.00 0.00 N HETATM 36 C26 UNL 1 -6.751 1.736 -0.863 1.00 0.00 C HETATM 37 C27 UNL 1 -5.302 1.987 -1.258 1.00 0.00 C HETATM 38 C28 UNL 1 -4.420 2.123 -0.098 1.00 0.00 C HETATM 39 C29 UNL 1 -3.520 1.251 0.455 1.00 0.00 C HETATM 40 N4 UNL 1 -3.094 1.822 1.602 1.00 0.00 N HETATM 41 C30 UNL 1 -3.647 3.019 1.833 1.00 0.00 C HETATM 42 C31 UNL 1 -3.497 3.939 2.864 1.00 0.00 C HETATM 43 C32 UNL 1 -4.204 5.113 2.843 1.00 0.00 C HETATM 44 C33 UNL 1 -5.044 5.337 1.795 1.00 0.00 C HETATM 45 C34 UNL 1 -5.202 4.425 0.760 1.00 0.00 C HETATM 46 C35 UNL 1 -4.482 3.228 0.780 1.00 0.00 C HETATM 47 C36 UNL 1 -7.954 -0.363 -0.623 1.00 0.00 C HETATM 48 C37 UNL 1 -7.641 -1.786 -0.489 1.00 0.00 C HETATM 49 O8 UNL 1 -7.668 -2.416 -1.761 1.00 0.00 O HETATM 50 C38 UNL 1 -8.751 -2.501 0.285 1.00 0.00 C HETATM 51 C39 UNL 1 -8.471 -3.973 0.428 1.00 0.00 C HETATM 52 C40 UNL 1 -6.339 -2.196 0.138 1.00 0.00 C HETATM 53 C41 UNL 1 -1.414 -1.822 -0.302 1.00 0.00 C HETATM 54 O9 UNL 1 -2.296 -2.642 -0.958 1.00 0.00 O HETATM 55 C42 UNL 1 -2.001 -3.917 -1.446 1.00 0.00 C HETATM 56 C43 UNL 1 -0.142 -2.320 -0.133 1.00 0.00 C HETATM 57 C44 UNL 1 0.808 -1.564 0.504 1.00 0.00 C HETATM 58 N5 UNL 1 2.182 -1.888 0.802 1.00 0.00 N HETATM 59 C45 UNL 1 2.777 -3.198 0.920 1.00 0.00 C HETATM 60 C46 UNL 1 2.821 -0.580 0.959 1.00 0.00 C HETATM 61 C47 UNL 1 2.120 1.597 1.619 1.00 0.00 C HETATM 62 C48 UNL 1 7.370 -2.287 -0.895 1.00 0.00 C HETATM 63 C49 UNL 1 8.781 -2.542 -1.369 1.00 0.00 C HETATM 64 C50 UNL 1 6.573 -3.567 -0.932 1.00 0.00 C HETATM 65 C51 UNL 1 7.317 -4.617 -0.128 1.00 0.00 C HETATM 66 H1 UNL 1 8.847 2.097 0.150 1.00 0.00 H HETATM 67 H2 UNL 1 9.648 0.584 0.755 1.00 0.00 H HETATM 68 H3 UNL 1 10.667 2.042 0.424 1.00 0.00 H HETATM 69 H4 UNL 1 9.846 1.765 -2.060 1.00 0.00 H HETATM 70 H5 UNL 1 10.902 0.466 -1.346 1.00 0.00 H HETATM 71 H6 UNL 1 6.932 -1.306 -2.774 1.00 0.00 H HETATM 72 H7 UNL 1 4.696 -1.333 -2.151 1.00 0.00 H HETATM 73 H8 UNL 1 2.968 -1.792 -1.194 1.00 0.00 H HETATM 74 H9 UNL 1 3.600 1.808 -1.333 1.00 0.00 H HETATM 75 H10 UNL 1 2.009 1.217 -2.557 1.00 0.00 H HETATM 76 H11 UNL 1 3.640 3.825 -0.412 1.00 0.00 H HETATM 77 H12 UNL 1 4.529 2.802 0.727 1.00 0.00 H HETATM 78 H13 UNL 1 3.256 3.878 2.643 1.00 0.00 H HETATM 79 H14 UNL 1 2.569 5.049 1.367 1.00 0.00 H HETATM 80 H15 UNL 1 4.297 4.893 1.655 1.00 0.00 H HETATM 81 H16 UNL 1 1.180 3.411 -1.168 1.00 0.00 H HETATM 82 H17 UNL 1 -0.400 4.204 0.439 1.00 0.00 H HETATM 83 H18 UNL 1 0.696 4.222 2.774 1.00 0.00 H HETATM 84 H19 UNL 1 -0.581 3.021 2.560 1.00 0.00 H HETATM 85 H20 UNL 1 1.306 1.531 4.542 1.00 0.00 H HETATM 86 H21 UNL 1 -0.170 1.116 3.639 1.00 0.00 H HETATM 87 H22 UNL 1 2.626 -0.096 3.515 1.00 0.00 H HETATM 88 H23 UNL 1 0.946 -0.881 3.353 1.00 0.00 H HETATM 89 H24 UNL 1 -0.991 1.171 1.090 1.00 0.00 H HETATM 90 H25 UNL 1 -4.701 -1.455 -4.126 1.00 0.00 H HETATM 91 H26 UNL 1 -3.671 0.066 -4.161 1.00 0.00 H HETATM 92 H27 UNL 1 -2.943 -1.622 -4.248 1.00 0.00 H HETATM 93 H28 UNL 1 -4.071 -0.806 1.633 1.00 0.00 H HETATM 94 H29 UNL 1 -3.636 -2.082 0.502 1.00 0.00 H HETATM 95 H30 UNL 1 -5.441 -0.743 -1.014 1.00 0.00 H HETATM 96 H31 UNL 1 -6.943 -0.437 1.603 1.00 0.00 H HETATM 97 H32 UNL 1 -5.651 0.705 1.495 1.00 0.00 H HETATM 98 H33 UNL 1 -7.305 1.734 -1.836 1.00 0.00 H HETATM 99 H34 UNL 1 -7.099 2.658 -0.353 1.00 0.00 H HETATM 100 H35 UNL 1 -5.375 3.014 -1.749 1.00 0.00 H HETATM 101 H36 UNL 1 -4.999 1.388 -2.102 1.00 0.00 H HETATM 102 H37 UNL 1 -2.435 1.397 2.345 1.00 0.00 H HETATM 103 H38 UNL 1 -2.823 3.710 3.666 1.00 0.00 H HETATM 104 H39 UNL 1 -4.069 5.809 3.656 1.00 0.00 H HETATM 105 H40 UNL 1 -5.613 6.257 1.758 1.00 0.00 H HETATM 106 H41 UNL 1 -5.872 4.655 -0.043 1.00 0.00 H HETATM 107 H42 UNL 1 -8.972 -0.167 -0.166 1.00 0.00 H HETATM 108 H43 UNL 1 -8.146 -0.118 -1.712 1.00 0.00 H HETATM 109 H44 UNL 1 -7.124 -1.923 -2.405 1.00 0.00 H HETATM 110 H45 UNL 1 -9.738 -2.310 -0.135 1.00 0.00 H HETATM 111 H46 UNL 1 -8.728 -2.081 1.330 1.00 0.00 H HETATM 112 H47 UNL 1 -8.408 -4.405 -0.597 1.00 0.00 H HETATM 113 H48 UNL 1 -9.336 -4.409 0.977 1.00 0.00 H HETATM 114 H49 UNL 1 -7.577 -4.162 1.043 1.00 0.00 H HETATM 115 H50 UNL 1 -5.832 -3.005 -0.396 1.00 0.00 H HETATM 116 H51 UNL 1 -6.528 -2.487 1.198 1.00 0.00 H HETATM 117 H52 UNL 1 -2.911 -4.334 -1.943 1.00 0.00 H HETATM 118 H53 UNL 1 -1.199 -3.843 -2.206 1.00 0.00 H HETATM 119 H54 UNL 1 -1.729 -4.648 -0.666 1.00 0.00 H HETATM 120 H55 UNL 1 0.112 -3.324 -0.508 1.00 0.00 H HETATM 121 H56 UNL 1 2.181 -3.753 1.703 1.00 0.00 H HETATM 122 H57 UNL 1 2.710 -3.821 0.019 1.00 0.00 H HETATM 123 H58 UNL 1 3.800 -3.081 1.326 1.00 0.00 H HETATM 124 H59 UNL 1 3.633 -0.695 1.694 1.00 0.00 H HETATM 125 H60 UNL 1 3.158 1.545 2.145 1.00 0.00 H HETATM 126 H61 UNL 1 7.476 -2.056 0.210 1.00 0.00 H HETATM 127 H62 UNL 1 9.561 -2.114 -0.703 1.00 0.00 H HETATM 128 H63 UNL 1 8.961 -2.123 -2.384 1.00 0.00 H HETATM 129 H64 UNL 1 8.956 -3.648 -1.512 1.00 0.00 H HETATM 130 H65 UNL 1 6.480 -3.966 -1.956 1.00 0.00 H HETATM 131 H66 UNL 1 5.611 -3.372 -0.428 1.00 0.00 H HETATM 132 H67 UNL 1 7.900 -5.285 -0.788 1.00 0.00 H HETATM 133 H68 UNL 1 7.923 -4.194 0.676 1.00 0.00 H HETATM 134 H69 UNL 1 6.555 -5.286 0.372 1.00 0.00 H CONECT 1 2 66 67 68 CONECT 2 3 69 70 CONECT 3 4 CONECT 4 5 5 6 CONECT 6 7 62 71 CONECT 7 8 72 CONECT 8 9 9 10 CONECT 10 11 12 60 CONECT 11 73 CONECT 12 13 14 74 CONECT 13 75 CONECT 14 15 17 61 CONECT 15 16 76 77 CONECT 16 78 79 80 CONECT 17 18 18 81 CONECT 18 19 82 CONECT 19 20 83 84 CONECT 20 21 61 CONECT 21 22 85 86 CONECT 22 23 87 88 CONECT 23 24 60 61 CONECT 24 25 25 57 CONECT 25 26 89 CONECT 26 27 53 53 CONECT 27 28 32 39 CONECT 28 29 29 30 CONECT 30 31 CONECT 31 90 91 92 CONECT 32 33 93 94 CONECT 33 34 52 95 CONECT 34 35 96 97 CONECT 35 36 47 CONECT 36 37 98 99 CONECT 37 38 100 101 CONECT 38 39 39 46 CONECT 39 40 CONECT 40 41 102 CONECT 41 42 42 46 CONECT 42 43 103 CONECT 43 44 44 104 CONECT 44 45 105 CONECT 45 46 46 106 CONECT 47 48 107 108 CONECT 48 49 50 52 CONECT 49 109 CONECT 50 51 110 111 CONECT 51 112 113 114 CONECT 52 115 116 CONECT 53 54 56 CONECT 54 55 CONECT 55 117 118 119 CONECT 56 57 57 120 CONECT 57 58 CONECT 58 59 60 CONECT 59 121 122 123 CONECT 60 124 CONECT 61 125 CONECT 62 63 64 126 CONECT 63 127 128 129 CONECT 64 65 130 131 CONECT 65 132 133 134 END SMILES for HMDB0259818 (Vinleucinol)CCOC(=O)C(NC(=O)C1(O)C2N(C)C3=CC(OC)=C(C=C3C22CCN3CC=CC(CC)(C23)C1O)C1(CC2CN(CC(O)(CC)C2)CCC2=C1NC1=CC=CC=C21)C(=O)OC)C(C)CC INCHI for HMDB0259818 (Vinleucinol)InChI=1S/C51H69N5O9/c1-9-30(5)39(41(57)65-12-4)53-45(59)51(62)43-49(20-23-56-21-15-19-48(11-3,42(49)56)44(51)58)34-24-35(38(63-7)25-37(34)54(43)6)50(46(60)64-8)27-31-26-47(61,10-2)29-55(28-31)22-18-33-32-16-13-14-17-36(32)52-40(33)50/h13-17,19,24-25,30-31,39,42-44,52,58,61-62H,9-12,18,20-23,26-29H2,1-8H3,(H,53,59) 3D Structure for HMDB0259818 (Vinleucinol) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C51H69N5O9 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 896.139 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 895.509528822 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | methyl 13-{10-[(1-ethoxy-3-methyl-1-oxopentan-2-yl)carbamoyl]-12-ethyl-10,11-dihydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.0^{1,9}.0^{2,7}.0^{16,19}]nonadeca-2,4,6,13-tetraen-4-yl}-17-ethyl-17-hydroxy-1,11-diazatetracyclo[13.3.1.0^{4,12}.0^{5,10}]nonadeca-4(12),5,7,9-tetraene-13-carboxylate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | methyl 13-{10-[(1-ethoxy-3-methyl-1-oxopentan-2-yl)carbamoyl]-12-ethyl-10,11-dihydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.0^{1,9}.0^{2,7}.0^{16,19}]nonadeca-2,4,6,13-tetraen-4-yl}-17-ethyl-17-hydroxy-1,11-diazatetracyclo[13.3.1.0^{4,12}.0^{5,10}]nonadeca-4(12),5,7,9-tetraene-13-carboxylate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCOC(=O)C(NC(=O)C1(O)C2N(C)C3=CC(OC)=C(C=C3C22CCN3CC=CC(CC)(C23)C1O)C1(CC2CN(CC(O)(CC)C2)CCC2=C1NC1=CC=CC=C21)C(=O)OC)C(C)CC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C51H69N5O9/c1-9-30(5)39(41(57)65-12-4)53-45(59)51(62)43-49(20-23-56-21-15-19-48(11-3,42(49)56)44(51)58)34-24-35(38(63-7)25-37(34)54(43)6)50(46(60)64-8)27-31-26-47(61,10-2)29-55(28-31)22-18-33-32-16-13-14-17-36(32)52-40(33)50/h13-17,19,24-25,30-31,39,42-44,52,58,61-62H,9-12,18,20-23,26-29H2,1-8H3,(H,53,59) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | QSTPFUDHVVIGCL-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as vinca alkaloids. These are alkaloids with a dimeric chemical structure composed of an indole nucleus (catharanthine), and a dihydroindole nucleus (vindoline), joined together. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Alkaloids and derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Vinca alkaloids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Vinca alkaloids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesUnderivatized
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 384815 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 435129 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|