| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2009-07-25 00:04:23 UTC |
|---|
| Update Date | 2022-03-07 02:51:27 UTC |
|---|
| HMDB ID | HMDB0012634 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 20-COOH-leukotriene E4 |
|---|
| Description | 20-COOH-leukotriene E4 is a metabolite through lipid oxidation of Leukotriene E4 (LTE4).Leukotriene E4 (LTE4) is a cysteinyl leukotriene. Cysteinyl leukotrienes (CysLTs) are a family of potent inflammatory mediators that appear to contribute to the pathophysiologic features of allergic rhinitis. Nasal blockage induced by CysLTs is mainly due to dilatation of nasal blood vessels, which can be induced by the nitric oxide produced through CysLT1 receptor activation. LTE4, activate contractile and inflammatory processes via specific interaction with putative seven transmembrane-spanning receptors that couple to G proteins and subsequent intracellular signaling pathways. LTE4 is metabolized from leukotriene C4 in a reaction catalyzed by gamma-glutamyl transpeptidase and a particulate dipeptidase from kidney. (PMID: 12607939 , 12432945 , 6311078 ). Leukotrienes are eicosanoids. The eicosanoids consist of the prostaglandins (PGs), thromboxanes (TXs), leukotrienes (LTs), and lipoxins (LXs). The PGs and TXs are collectively identified as prostanoids. Prostaglandins were originally shown to be synthesized in the prostate gland, thromboxanes from platelets (thrombocytes), and leukotrienes from leukocytes, hence the derivation of their names. All mammalian cells except erythrocytes synthesize eicosanoids. These molecules are extremely potent, able to cause profound physiological effects at very dilute concentrations. All eicosanoids function locally at the site of synthesis, through receptor-mediated G-protein linked signalling pathways. |
|---|
| Structure | N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O InChI=1S/C23H35NO7S/c24-18(23(30)31)17-32-20(19(25)13-12-16-22(28)29)14-10-8-6-4-2-1-3-5-7-9-11-15-21(26)27/h2-6,8,10,14,18-20,25H,1,7,9,11-13,15-17,24H2,(H,26,27)(H,28,29)(H,30,31)/b4-2-,5-3-,8-6+,14-10+/t18-,19+,20-/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 20-COOH-LTE4 | HMDB | | 6-(S-Cysteinyl)-(5S)-hydroxy-(7E,9E,11Z,14Z)-eicosatetraenedioate | HMDB | | 6-(S-Cysteinyl)-(5S)-hydroxy-(7E,9E,11Z,14Z)-eicosatetraenedioic acid | HMDB |
|
|---|
| Chemical Formula | C23H35NO7S |
|---|
| Average Molecular Weight | 469.592 |
|---|
| Monoisotopic Molecular Weight | 469.213423169 |
|---|
| IUPAC Name | (6Z,9Z,11E,13E,15R,16S)-15-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid |
|---|
| Traditional Name | (6Z,9Z,11E,13E,15R,16S)-15-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | N[C@H](CS[C@H](\C=C\C=C\C=C/C\C=C/CCCCC(O)=O)[C@@H](O)CCCC(O)=O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C23H35NO7S/c24-18(23(30)31)17-32-20(19(25)13-12-16-22(28)29)14-10-8-6-4-2-1-3-5-7-9-11-15-21(26)27/h2-6,8,10,14,18-20,25H,1,7,9,11-13,15-17,24H2,(H,26,27)(H,28,29)(H,30,31)/b4-2-,5-3-,8-6+,14-10+/t18-,19+,20-/m1/s1 |
|---|
| InChI Key | HVLRBLGTGJGVCX-RHSCJZQUSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as cysteine and derivatives. Cysteine and derivatives are compounds containing cysteine or a derivative thereof resulting from reaction of cysteine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Cysteine and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Cysteine or derivatives
- S-alkyl-l-cysteine
- Alpha-amino acid
- D-alpha-amino acid
- Tricarboxylic acid or derivatives
- Hydroxy fatty acid
- Thia fatty acid
- Fatty acyl
- Secondary alcohol
- Amino acid
- Carboxylic acid
- Dialkylthioether
- Sulfenyl compound
- Thioether
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Primary amine
- Organosulfur compound
- Organooxygen compound
- Organonitrogen compound
- Primary aliphatic amine
- Organopnictogen compound
- Organic oxygen compound
- Carbonyl group
- Amine
- Organic nitrogen compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.3 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 15.818 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.83 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 143.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2520.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 213.1 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 148.1 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 187.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 208.7 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 566.5 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 437.0 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 509.5 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1294.2 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 540.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1364.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 421.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 373.0 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 390.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 182.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 8.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 20-COOH-leukotriene E4,1TMS,isomer #1 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O | 4133.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TMS,isomer #2 | C[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O | 4158.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TMS,isomer #3 | C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O | 4131.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O | 4070.1 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TMS,isomer #5 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O | 4213.7 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O | 4048.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #10 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C | 4150.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #11 | C[Si](C)(C)N([C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O)[Si](C)(C)C | 4334.7 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #2 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C | 4121.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C | 4092.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #4 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O | 4190.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O | 4121.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #6 | C[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C | 4077.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #7 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O | 4215.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #8 | C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C | 4049.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TMS,isomer #9 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O | 4191.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C | 4048.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #10 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4147.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #11 | C[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 4329.7 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #12 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4101.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #13 | C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 4287.6 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #14 | C[Si](C)(C)OC(=O)[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 4275.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C | 4020.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #3 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C | 4099.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #4 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4093.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #5 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O | 4189.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #6 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O | 4141.7 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #7 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O | 4286.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #8 | C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C | 4046.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TMS,isomer #9 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O | 4189.6 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3997.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #10 | C[Si](C)(C)OC(=O)[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 4255.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #11 | C[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 4201.1 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #2 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4083.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #3 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4031.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O | 4199.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #5 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O | 4124.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #6 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C | 4262.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #7 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C | 4202.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #8 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4085.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,4TMS,isomer #9 | C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 4264.6 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #1 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4005.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #1 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3672.2 | Standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #1 | C[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4381.1 | Standard polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #2 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C | 4163.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #2 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C | 3769.0 | Standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #2 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C | 4519.5 | Standard polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #3 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C | 4107.6 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #3 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C | 3807.2 | Standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #3 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C | 4575.8 | Standard polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #4 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4164.1 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #4 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3786.3 | Standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #4 | C[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4534.7 | Standard polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 4165.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 3771.0 | Standard non polar | 33892256 | | 20-COOH-leukotriene E4,5TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 4512.6 | Standard polar | 33892256 | | 20-COOH-leukotriene E4,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O | 4395.6 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O | 4410.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O | 4392.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O | 4333.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O | 4434.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O | 4566.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 4614.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)N([C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 4769.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4644.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4612.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O | 4651.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O | 4645.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4598.8 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O | 4673.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 4566.9 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 4651.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4831.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4858.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)O[C@@H](CCCC(=O)O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4996.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4810.1 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4963.4 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4946.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4786.2 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 4808.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@@H](N)C(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4860.3 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)O | 4884.6 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 4837.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)CCCC(=O)O | 4967.5 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)SC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 4830.0 | Semi standard non polar | 33892256 | | 20-COOH-leukotriene E4,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N[C@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(=O)O | 4884.1 | Semi standard non polar | 33892256 |
|
|---|